diff src/share/vm/c1/c1_GraphBuilder.cpp @ 0:a61af66fc99e jdk7-b24

Initial load
author duke
date Sat, 01 Dec 2007 00:00:00 +0000
parents
children 3a86a8dcf27c
line wrap: on
line diff
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/share/vm/c1/c1_GraphBuilder.cpp	Sat Dec 01 00:00:00 2007 +0000
@@ -0,0 +1,3835 @@
+/*
+ * Copyright 1999-2007 Sun Microsystems, Inc.  All Rights Reserved.
+ * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER.
+ *
+ * This code is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License version 2 only, as
+ * published by the Free Software Foundation.
+ *
+ * This code is distributed in the hope that it will be useful, but WITHOUT
+ * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+ * FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+ * version 2 for more details (a copy is included in the LICENSE file that
+ * accompanied this code).
+ *
+ * You should have received a copy of the GNU General Public License version
+ * 2 along with this work; if not, write to the Free Software Foundation,
+ * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA.
+ *
+ * Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara,
+ * CA 95054 USA or visit www.sun.com if you need additional information or
+ * have any questions.
+ *
+ */
+
+#include "incls/_precompiled.incl"
+#include "incls/_c1_GraphBuilder.cpp.incl"
+
+class BlockListBuilder VALUE_OBJ_CLASS_SPEC {
+ private:
+  Compilation* _compilation;
+  IRScope*     _scope;
+
+  BlockList    _blocks;                // internal list of all blocks
+  BlockList*   _bci2block;             // mapping from bci to blocks for GraphBuilder
+
+  // fields used by mark_loops
+  BitMap       _active;                // for iteration of control flow graph
+  BitMap       _visited;               // for iteration of control flow graph
+  intArray     _loop_map;              // caches the information if a block is contained in a loop
+  int          _next_loop_index;       // next free loop number
+  int          _next_block_number;     // for reverse postorder numbering of blocks
+
+  // accessors
+  Compilation*  compilation() const              { return _compilation; }
+  IRScope*      scope() const                    { return _scope; }
+  ciMethod*     method() const                   { return scope()->method(); }
+  XHandlers*    xhandlers() const                { return scope()->xhandlers(); }
+
+  // unified bailout support
+  void          bailout(const char* msg) const   { compilation()->bailout(msg); }
+  bool          bailed_out() const               { return compilation()->bailed_out(); }
+
+  // helper functions
+  BlockBegin* make_block_at(int bci, BlockBegin* predecessor);
+  void handle_exceptions(BlockBegin* current, int cur_bci);
+  void handle_jsr(BlockBegin* current, int sr_bci, int next_bci);
+  void store_one(BlockBegin* current, int local);
+  void store_two(BlockBegin* current, int local);
+  void set_entries(int osr_bci);
+  void set_leaders();
+
+  void make_loop_header(BlockBegin* block);
+  void mark_loops();
+  int  mark_loops(BlockBegin* b, bool in_subroutine);
+
+  // debugging
+#ifndef PRODUCT
+  void print();
+#endif
+
+ public:
+  // creation
+  BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci);
+
+  // accessors for GraphBuilder
+  BlockList*    bci2block() const                { return _bci2block; }
+};
+
+
+// Implementation of BlockListBuilder
+
+BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci)
+ : _compilation(compilation)
+ , _scope(scope)
+ , _blocks(16)
+ , _bci2block(new BlockList(scope->method()->code_size(), NULL))
+ , _next_block_number(0)
+ , _active()         // size not known yet
+ , _visited()        // size not known yet
+ , _next_loop_index(0)
+ , _loop_map() // size not known yet
+{
+  set_entries(osr_bci);
+  set_leaders();
+  CHECK_BAILOUT();
+
+  mark_loops();
+  NOT_PRODUCT(if (PrintInitialBlockList) print());
+
+#ifndef PRODUCT
+  if (PrintCFGToFile) {
+    stringStream title;
+    title.print("BlockListBuilder ");
+    scope->method()->print_name(&title);
+    CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false);
+  }
+#endif
+}
+
+
+void BlockListBuilder::set_entries(int osr_bci) {
+  // generate start blocks
+  BlockBegin* std_entry = make_block_at(0, NULL);
+  if (scope()->caller() == NULL) {
+    std_entry->set(BlockBegin::std_entry_flag);
+  }
+  if (osr_bci != -1) {
+    BlockBegin* osr_entry = make_block_at(osr_bci, NULL);
+    osr_entry->set(BlockBegin::osr_entry_flag);
+  }
+
+  // generate exception entry blocks
+  XHandlers* list = xhandlers();
+  const int n = list->length();
+  for (int i = 0; i < n; i++) {
+    XHandler* h = list->handler_at(i);
+    BlockBegin* entry = make_block_at(h->handler_bci(), NULL);
+    entry->set(BlockBegin::exception_entry_flag);
+    h->set_entry_block(entry);
+  }
+}
+
+
+BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) {
+  assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer");
+
+  BlockBegin* block = _bci2block->at(cur_bci);
+  if (block == NULL) {
+    block = new BlockBegin(cur_bci);
+    block->init_stores_to_locals(method()->max_locals());
+    _bci2block->at_put(cur_bci, block);
+    _blocks.append(block);
+
+    assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist");
+  }
+
+  if (predecessor != NULL) {
+    if (block->is_set(BlockBegin::exception_entry_flag)) {
+      BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block);
+    }
+
+    predecessor->add_successor(block);
+    block->increment_total_preds();
+  }
+
+  return block;
+}
+
+
+inline void BlockListBuilder::store_one(BlockBegin* current, int local) {
+  current->stores_to_locals().set_bit(local);
+}
+inline void BlockListBuilder::store_two(BlockBegin* current, int local) {
+  store_one(current, local);
+  store_one(current, local + 1);
+}
+
+
+void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) {
+  // Draws edges from a block to its exception handlers
+  XHandlers* list = xhandlers();
+  const int n = list->length();
+
+  for (int i = 0; i < n; i++) {
+    XHandler* h = list->handler_at(i);
+
+    if (h->covers(cur_bci)) {
+      BlockBegin* entry = h->entry_block();
+      assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set");
+      assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set");
+
+      // add each exception handler only once
+      if (!current->is_successor(entry)) {
+        current->add_successor(entry);
+        entry->increment_total_preds();
+      }
+
+      // stop when reaching catchall
+      if (h->catch_type() == 0) break;
+    }
+  }
+}
+
+void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) {
+  // start a new block after jsr-bytecode and link this block into cfg
+  make_block_at(next_bci, current);
+
+  // start a new block at the subroutine entry at mark it with special flag
+  BlockBegin* sr_block = make_block_at(sr_bci, current);
+  if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) {
+    sr_block->set(BlockBegin::subroutine_entry_flag);
+  }
+}
+
+
+void BlockListBuilder::set_leaders() {
+  bool has_xhandlers = xhandlers()->has_handlers();
+  BlockBegin* current = NULL;
+
+  // The information which bci starts a new block simplifies the analysis
+  // Without it, backward branches could jump to a bci where no block was created
+  // during bytecode iteration. This would require the creation of a new block at the
+  // branch target and a modification of the successor lists.
+  BitMap bci_block_start = method()->bci_block_start();
+
+  ciBytecodeStream s(method());
+  while (s.next() != ciBytecodeStream::EOBC()) {
+    int cur_bci = s.cur_bci();
+
+    if (bci_block_start.at(cur_bci)) {
+      current = make_block_at(cur_bci, current);
+    }
+    assert(current != NULL, "must have current block");
+
+    if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) {
+      handle_exceptions(current, cur_bci);
+    }
+
+    switch (s.cur_bc()) {
+      // track stores to local variables for selective creation of phi functions
+      case Bytecodes::_iinc:     store_one(current, s.get_index()); break;
+      case Bytecodes::_istore:   store_one(current, s.get_index()); break;
+      case Bytecodes::_lstore:   store_two(current, s.get_index()); break;
+      case Bytecodes::_fstore:   store_one(current, s.get_index()); break;
+      case Bytecodes::_dstore:   store_two(current, s.get_index()); break;
+      case Bytecodes::_astore:   store_one(current, s.get_index()); break;
+      case Bytecodes::_istore_0: store_one(current, 0); break;
+      case Bytecodes::_istore_1: store_one(current, 1); break;
+      case Bytecodes::_istore_2: store_one(current, 2); break;
+      case Bytecodes::_istore_3: store_one(current, 3); break;
+      case Bytecodes::_lstore_0: store_two(current, 0); break;
+      case Bytecodes::_lstore_1: store_two(current, 1); break;
+      case Bytecodes::_lstore_2: store_two(current, 2); break;
+      case Bytecodes::_lstore_3: store_two(current, 3); break;
+      case Bytecodes::_fstore_0: store_one(current, 0); break;
+      case Bytecodes::_fstore_1: store_one(current, 1); break;
+      case Bytecodes::_fstore_2: store_one(current, 2); break;
+      case Bytecodes::_fstore_3: store_one(current, 3); break;
+      case Bytecodes::_dstore_0: store_two(current, 0); break;
+      case Bytecodes::_dstore_1: store_two(current, 1); break;
+      case Bytecodes::_dstore_2: store_two(current, 2); break;
+      case Bytecodes::_dstore_3: store_two(current, 3); break;
+      case Bytecodes::_astore_0: store_one(current, 0); break;
+      case Bytecodes::_astore_1: store_one(current, 1); break;
+      case Bytecodes::_astore_2: store_one(current, 2); break;
+      case Bytecodes::_astore_3: store_one(current, 3); break;
+
+      // track bytecodes that affect the control flow
+      case Bytecodes::_athrow:  // fall through
+      case Bytecodes::_ret:     // fall through
+      case Bytecodes::_ireturn: // fall through
+      case Bytecodes::_lreturn: // fall through
+      case Bytecodes::_freturn: // fall through
+      case Bytecodes::_dreturn: // fall through
+      case Bytecodes::_areturn: // fall through
+      case Bytecodes::_return:
+        current = NULL;
+        break;
+
+      case Bytecodes::_ifeq:      // fall through
+      case Bytecodes::_ifne:      // fall through
+      case Bytecodes::_iflt:      // fall through
+      case Bytecodes::_ifge:      // fall through
+      case Bytecodes::_ifgt:      // fall through
+      case Bytecodes::_ifle:      // fall through
+      case Bytecodes::_if_icmpeq: // fall through
+      case Bytecodes::_if_icmpne: // fall through
+      case Bytecodes::_if_icmplt: // fall through
+      case Bytecodes::_if_icmpge: // fall through
+      case Bytecodes::_if_icmpgt: // fall through
+      case Bytecodes::_if_icmple: // fall through
+      case Bytecodes::_if_acmpeq: // fall through
+      case Bytecodes::_if_acmpne: // fall through
+      case Bytecodes::_ifnull:    // fall through
+      case Bytecodes::_ifnonnull:
+        make_block_at(s.next_bci(), current);
+        make_block_at(s.get_dest(), current);
+        current = NULL;
+        break;
+
+      case Bytecodes::_goto:
+        make_block_at(s.get_dest(), current);
+        current = NULL;
+        break;
+
+      case Bytecodes::_goto_w:
+        make_block_at(s.get_far_dest(), current);
+        current = NULL;
+        break;
+
+      case Bytecodes::_jsr:
+        handle_jsr(current, s.get_dest(), s.next_bci());
+        current = NULL;
+        break;
+
+      case Bytecodes::_jsr_w:
+        handle_jsr(current, s.get_far_dest(), s.next_bci());
+        current = NULL;
+        break;
+
+      case Bytecodes::_tableswitch: {
+        // set block for each case
+        Bytecode_tableswitch *switch_ = Bytecode_tableswitch_at(s.cur_bcp());
+        int l = switch_->length();
+        for (int i = 0; i < l; i++) {
+          make_block_at(cur_bci + switch_->dest_offset_at(i), current);
+        }
+        make_block_at(cur_bci + switch_->default_offset(), current);
+        current = NULL;
+        break;
+      }
+
+      case Bytecodes::_lookupswitch: {
+        // set block for each case
+        Bytecode_lookupswitch *switch_ = Bytecode_lookupswitch_at(s.cur_bcp());
+        int l = switch_->number_of_pairs();
+        for (int i = 0; i < l; i++) {
+          make_block_at(cur_bci + switch_->pair_at(i)->offset(), current);
+        }
+        make_block_at(cur_bci + switch_->default_offset(), current);
+        current = NULL;
+        break;
+      }
+    }
+  }
+}
+
+
+void BlockListBuilder::mark_loops() {
+  ResourceMark rm;
+
+  _active = BitMap(BlockBegin::number_of_blocks());         _active.clear();
+  _visited = BitMap(BlockBegin::number_of_blocks());        _visited.clear();
+  _loop_map = intArray(BlockBegin::number_of_blocks(), 0);
+  _next_loop_index = 0;
+  _next_block_number = _blocks.length();
+
+  // recursively iterate the control flow graph
+  mark_loops(_bci2block->at(0), false);
+  assert(_next_block_number >= 0, "invalid block numbers");
+}
+
+void BlockListBuilder::make_loop_header(BlockBegin* block) {
+  if (block->is_set(BlockBegin::exception_entry_flag)) {
+    // exception edges may look like loops but don't mark them as such
+    // since it screws up block ordering.
+    return;
+  }
+  if (!block->is_set(BlockBegin::parser_loop_header_flag)) {
+    block->set(BlockBegin::parser_loop_header_flag);
+
+    assert(_loop_map.at(block->block_id()) == 0, "must not be set yet");
+    assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer");
+    _loop_map.at_put(block->block_id(), 1 << _next_loop_index);
+    if (_next_loop_index < 31) _next_loop_index++;
+  } else {
+    // block already marked as loop header
+    assert(is_power_of_2(_loop_map.at(block->block_id())), "exactly one bit must be set");
+  }
+}
+
+int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) {
+  int block_id = block->block_id();
+
+  if (_visited.at(block_id)) {
+    if (_active.at(block_id)) {
+      // reached block via backward branch
+      make_loop_header(block);
+    }
+    // return cached loop information for this block
+    return _loop_map.at(block_id);
+  }
+
+  if (block->is_set(BlockBegin::subroutine_entry_flag)) {
+    in_subroutine = true;
+  }
+
+  // set active and visited bits before successors are processed
+  _visited.set_bit(block_id);
+  _active.set_bit(block_id);
+
+  intptr_t loop_state = 0;
+  for (int i = block->number_of_sux() - 1; i >= 0; i--) {
+    // recursively process all successors
+    loop_state |= mark_loops(block->sux_at(i), in_subroutine);
+  }
+
+  // clear active-bit after all successors are processed
+  _active.clear_bit(block_id);
+
+  // reverse-post-order numbering of all blocks
+  block->set_depth_first_number(_next_block_number);
+  _next_block_number--;
+
+  if (loop_state != 0 || in_subroutine ) {
+    // block is contained at least in one loop, so phi functions are necessary
+    // phi functions are also necessary for all locals stored in a subroutine
+    scope()->requires_phi_function().set_union(block->stores_to_locals());
+  }
+
+  if (block->is_set(BlockBegin::parser_loop_header_flag)) {
+    int header_loop_state = _loop_map.at(block_id);
+    assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set");
+
+    // If the highest bit is set (i.e. when integer value is negative), the method
+    // has 32 or more loops. This bit is never cleared because it is used for multiple loops
+    if (header_loop_state >= 0) {
+      clear_bits(loop_state, header_loop_state);
+    }
+  }
+
+  // cache and return loop information for this block
+  _loop_map.at_put(block_id, loop_state);
+  return loop_state;
+}
+
+
+#ifndef PRODUCT
+
+int compare_depth_first(BlockBegin** a, BlockBegin** b) {
+  return (*a)->depth_first_number() - (*b)->depth_first_number();
+}
+
+void BlockListBuilder::print() {
+  tty->print("----- initial block list of BlockListBuilder for method ");
+  method()->print_short_name();
+  tty->cr();
+
+  // better readability if blocks are sorted in processing order
+  _blocks.sort(compare_depth_first);
+
+  for (int i = 0; i < _blocks.length(); i++) {
+    BlockBegin* cur = _blocks.at(i);
+    tty->print("%4d: B%-4d bci: %-4d  preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds());
+
+    tty->print(cur->is_set(BlockBegin::std_entry_flag)               ? " std" : "    ");
+    tty->print(cur->is_set(BlockBegin::osr_entry_flag)               ? " osr" : "    ");
+    tty->print(cur->is_set(BlockBegin::exception_entry_flag)         ? " ex" : "   ");
+    tty->print(cur->is_set(BlockBegin::subroutine_entry_flag)        ? " sr" : "   ");
+    tty->print(cur->is_set(BlockBegin::parser_loop_header_flag)      ? " lh" : "   ");
+
+    if (cur->number_of_sux() > 0) {
+      tty->print("    sux: ");
+      for (int j = 0; j < cur->number_of_sux(); j++) {
+        BlockBegin* sux = cur->sux_at(j);
+        tty->print("B%d ", sux->block_id());
+      }
+    }
+    tty->cr();
+  }
+}
+
+#endif
+
+
+// A simple growable array of Values indexed by ciFields
+class FieldBuffer: public CompilationResourceObj {
+ private:
+  GrowableArray<Value> _values;
+
+ public:
+  FieldBuffer() {}
+
+  void kill() {
+    _values.trunc_to(0);
+  }
+
+  Value at(ciField* field) {
+    assert(field->holder()->is_loaded(), "must be a loaded field");
+    int offset = field->offset();
+    if (offset < _values.length()) {
+      return _values.at(offset);
+    } else {
+      return NULL;
+    }
+  }
+
+  void at_put(ciField* field, Value value) {
+    assert(field->holder()->is_loaded(), "must be a loaded field");
+    int offset = field->offset();
+    _values.at_put_grow(offset, value, NULL);
+  }
+
+};
+
+
+// MemoryBuffer is fairly simple model of the current state of memory.
+// It partitions memory into several pieces.  The first piece is
+// generic memory where little is known about the owner of the memory.
+// This is conceptually represented by the tuple <O, F, V> which says
+// that the field F of object O has value V.  This is flattened so
+// that F is represented by the offset of the field and the parallel
+// arrays _objects and _values are used for O and V.  Loads of O.F can
+// simply use V.  Newly allocated objects are kept in a separate list
+// along with a parallel array for each object which represents the
+// current value of its fields.  Stores of the default value to fields
+// which have never been stored to before are eliminated since they
+// are redundant.  Once newly allocated objects are stored into
+// another object or they are passed out of the current compile they
+// are treated like generic memory.
+
+class MemoryBuffer: public CompilationResourceObj {
+ private:
+  FieldBuffer                 _values;
+  GrowableArray<Value>        _objects;
+  GrowableArray<Value>        _newobjects;
+  GrowableArray<FieldBuffer*> _fields;
+
+ public:
+  MemoryBuffer() {}
+
+  StoreField* store(StoreField* st) {
+    if (!EliminateFieldAccess) {
+      return st;
+    }
+
+    Value object = st->obj();
+    Value value = st->value();
+    ciField* field = st->field();
+    if (field->holder()->is_loaded()) {
+      int offset = field->offset();
+      int index = _newobjects.find(object);
+      if (index != -1) {
+        // newly allocated object with no other stores performed on this field
+        FieldBuffer* buf = _fields.at(index);
+        if (buf->at(field) == NULL && is_default_value(value)) {
+#ifndef PRODUCT
+          if (PrintIRDuringConstruction && Verbose) {
+            tty->print_cr("Eliminated store for object %d:", index);
+            st->print_line();
+          }
+#endif
+          return NULL;
+        } else {
+          buf->at_put(field, value);
+        }
+      } else {
+        _objects.at_put_grow(offset, object, NULL);
+        _values.at_put(field, value);
+      }
+
+      store_value(value);
+    } else {
+      // if we held onto field names we could alias based on names but
+      // we don't know what's being stored to so kill it all.
+      kill();
+    }
+    return st;
+  }
+
+
+  // return true if this value correspond to the default value of a field.
+  bool is_default_value(Value value) {
+    Constant* con = value->as_Constant();
+    if (con) {
+      switch (con->type()->tag()) {
+        case intTag:    return con->type()->as_IntConstant()->value() == 0;
+        case longTag:   return con->type()->as_LongConstant()->value() == 0;
+        case floatTag:  return jint_cast(con->type()->as_FloatConstant()->value()) == 0;
+        case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0);
+        case objectTag: return con->type() == objectNull;
+        default:  ShouldNotReachHere();
+      }
+    }
+    return false;
+  }
+
+
+  // return either the actual value of a load or the load itself
+  Value load(LoadField* load) {
+    if (!EliminateFieldAccess) {
+      return load;
+    }
+
+    if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) {
+      // can't skip load since value might get rounded as a side effect
+      return load;
+    }
+
+    ciField* field = load->field();
+    Value object   = load->obj();
+    if (field->holder()->is_loaded() && !field->is_volatile()) {
+      int offset = field->offset();
+      Value result = NULL;
+      int index = _newobjects.find(object);
+      if (index != -1) {
+        result = _fields.at(index)->at(field);
+      } else if (_objects.at_grow(offset, NULL) == object) {
+        result = _values.at(field);
+      }
+      if (result != NULL) {
+#ifndef PRODUCT
+        if (PrintIRDuringConstruction && Verbose) {
+          tty->print_cr("Eliminated load: ");
+          load->print_line();
+        }
+#endif
+        assert(result->type()->tag() == load->type()->tag(), "wrong types");
+        return result;
+      }
+    }
+    return load;
+  }
+
+  // Record this newly allocated object
+  void new_instance(NewInstance* object) {
+    int index = _newobjects.length();
+    _newobjects.append(object);
+    if (_fields.at_grow(index, NULL) == NULL) {
+      _fields.at_put(index, new FieldBuffer());
+    } else {
+      _fields.at(index)->kill();
+    }
+  }
+
+  void store_value(Value value) {
+    int index = _newobjects.find(value);
+    if (index != -1) {
+      // stored a newly allocated object into another object.
+      // Assume we've lost track of it as separate slice of memory.
+      // We could do better by keeping track of whether individual
+      // fields could alias each other.
+      _newobjects.remove_at(index);
+      // pull out the field info and store it at the end up the list
+      // of field info list to be reused later.
+      _fields.append(_fields.at(index));
+      _fields.remove_at(index);
+    }
+  }
+
+  void kill() {
+    _newobjects.trunc_to(0);
+    _objects.trunc_to(0);
+    _values.kill();
+  }
+};
+
+
+// Implementation of GraphBuilder's ScopeData
+
+GraphBuilder::ScopeData::ScopeData(ScopeData* parent)
+  : _parent(parent)
+  , _bci2block(NULL)
+  , _scope(NULL)
+  , _has_handler(false)
+  , _stream(NULL)
+  , _work_list(NULL)
+  , _parsing_jsr(false)
+  , _jsr_xhandlers(NULL)
+  , _caller_stack_size(-1)
+  , _continuation(NULL)
+  , _continuation_state(NULL)
+  , _num_returns(0)
+  , _cleanup_block(NULL)
+  , _cleanup_return_prev(NULL)
+  , _cleanup_state(NULL)
+{
+  if (parent != NULL) {
+    _max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f);
+  } else {
+    _max_inline_size = MaxInlineSize;
+  }
+  if (_max_inline_size < MaxTrivialSize) {
+    _max_inline_size = MaxTrivialSize;
+  }
+}
+
+
+void GraphBuilder::kill_field(ciField* field) {
+  if (UseLocalValueNumbering) {
+    vmap()->kill_field(field);
+  }
+}
+
+
+void GraphBuilder::kill_array(Value value) {
+  if (UseLocalValueNumbering) {
+    vmap()->kill_array(value->type());
+  }
+  _memory->store_value(value);
+}
+
+
+void GraphBuilder::kill_all() {
+  if (UseLocalValueNumbering) {
+    vmap()->kill_all();
+  }
+  _memory->kill();
+}
+
+
+BlockBegin* GraphBuilder::ScopeData::block_at(int bci) {
+  if (parsing_jsr()) {
+    // It is necessary to clone all blocks associated with a
+    // subroutine, including those for exception handlers in the scope
+    // of the method containing the jsr (because those exception
+    // handlers may contain ret instructions in some cases).
+    BlockBegin* block = bci2block()->at(bci);
+    if (block != NULL && block == parent()->bci2block()->at(bci)) {
+      BlockBegin* new_block = new BlockBegin(block->bci());
+#ifndef PRODUCT
+      if (PrintInitialBlockList) {
+        tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr",
+                      block->block_id(), block->bci(), new_block->block_id());
+      }
+#endif
+      // copy data from cloned blocked
+      new_block->set_depth_first_number(block->depth_first_number());
+      if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag);
+      // Preserve certain flags for assertion checking
+      if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag);
+      if (block->is_set(BlockBegin::exception_entry_flag))  new_block->set(BlockBegin::exception_entry_flag);
+
+      // copy was_visited_flag to allow early detection of bailouts
+      // if a block that is used in a jsr has already been visited before,
+      // it is shared between the normal control flow and a subroutine
+      // BlockBegin::try_merge returns false when the flag is set, this leads
+      // to a compilation bailout
+      if (block->is_set(BlockBegin::was_visited_flag))  new_block->set(BlockBegin::was_visited_flag);
+
+      bci2block()->at_put(bci, new_block);
+      block = new_block;
+    }
+    return block;
+  } else {
+    return bci2block()->at(bci);
+  }
+}
+
+
+XHandlers* GraphBuilder::ScopeData::xhandlers() const {
+  if (_jsr_xhandlers == NULL) {
+    assert(!parsing_jsr(), "");
+    return scope()->xhandlers();
+  }
+  assert(parsing_jsr(), "");
+  return _jsr_xhandlers;
+}
+
+
+void GraphBuilder::ScopeData::set_scope(IRScope* scope) {
+  _scope = scope;
+  bool parent_has_handler = false;
+  if (parent() != NULL) {
+    parent_has_handler = parent()->has_handler();
+  }
+  _has_handler = parent_has_handler || scope->xhandlers()->has_handlers();
+}
+
+
+void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block,
+                                                      Instruction* return_prev,
+                                                      ValueStack* return_state) {
+  _cleanup_block       = block;
+  _cleanup_return_prev = return_prev;
+  _cleanup_state       = return_state;
+}
+
+
+void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) {
+  if (_work_list == NULL) {
+    _work_list = new BlockList();
+  }
+
+  if (!block->is_set(BlockBegin::is_on_work_list_flag)) {
+    // Do not start parsing the continuation block while in a
+    // sub-scope
+    if (parsing_jsr()) {
+      if (block == jsr_continuation()) {
+        return;
+      }
+    } else {
+      if (block == continuation()) {
+        return;
+      }
+    }
+    block->set(BlockBegin::is_on_work_list_flag);
+    _work_list->push(block);
+
+    sort_top_into_worklist(_work_list, block);
+  }
+}
+
+
+void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) {
+  assert(worklist->top() == top, "");
+  // sort block descending into work list
+  const int dfn = top->depth_first_number();
+  assert(dfn != -1, "unknown depth first number");
+  int i = worklist->length()-2;
+  while (i >= 0) {
+    BlockBegin* b = worklist->at(i);
+    if (b->depth_first_number() < dfn) {
+      worklist->at_put(i+1, b);
+    } else {
+      break;
+    }
+    i --;
+  }
+  if (i >= -1) worklist->at_put(i + 1, top);
+}
+
+int GraphBuilder::ScopeData::caller_stack_size() const {
+  ValueStack* state = scope()->caller_state();
+  if (state == NULL) {
+    return 0;
+  }
+  return state->stack_size();
+}
+
+
+BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() {
+  if (is_work_list_empty()) {
+    return NULL;
+  }
+  return _work_list->pop();
+}
+
+
+bool GraphBuilder::ScopeData::is_work_list_empty() const {
+  return (_work_list == NULL || _work_list->length() == 0);
+}
+
+
+void GraphBuilder::ScopeData::setup_jsr_xhandlers() {
+  assert(parsing_jsr(), "");
+  // clone all the exception handlers from the scope
+  XHandlers* handlers = new XHandlers(scope()->xhandlers());
+  const int n = handlers->length();
+  for (int i = 0; i < n; i++) {
+    // The XHandlers need to be adjusted to dispatch to the cloned
+    // handler block instead of the default one but the synthetic
+    // unlocker needs to be handled specially.  The synthetic unlocker
+    // should be left alone since there can be only one and all code
+    // should dispatch to the same one.
+    XHandler* h = handlers->handler_at(i);
+    if (h->handler_bci() != SynchronizationEntryBCI) {
+      h->set_entry_block(block_at(h->handler_bci()));
+    } else {
+      assert(h->entry_block()->is_set(BlockBegin::default_exception_handler_flag),
+             "should be the synthetic unlock block");
+    }
+  }
+  _jsr_xhandlers = handlers;
+}
+
+
+int GraphBuilder::ScopeData::num_returns() {
+  if (parsing_jsr()) {
+    return parent()->num_returns();
+  }
+  return _num_returns;
+}
+
+
+void GraphBuilder::ScopeData::incr_num_returns() {
+  if (parsing_jsr()) {
+    parent()->incr_num_returns();
+  } else {
+    ++_num_returns;
+  }
+}
+
+
+// Implementation of GraphBuilder
+
+#define INLINE_BAILOUT(msg)        { inline_bailout(msg); return false; }
+
+
+void GraphBuilder::load_constant() {
+  ciConstant con = stream()->get_constant();
+  if (con.basic_type() == T_ILLEGAL) {
+    BAILOUT("could not resolve a constant");
+  } else {
+    ValueType* t = illegalType;
+    ValueStack* patch_state = NULL;
+    switch (con.basic_type()) {
+      case T_BOOLEAN: t = new IntConstant     (con.as_boolean()); break;
+      case T_BYTE   : t = new IntConstant     (con.as_byte   ()); break;
+      case T_CHAR   : t = new IntConstant     (con.as_char   ()); break;
+      case T_SHORT  : t = new IntConstant     (con.as_short  ()); break;
+      case T_INT    : t = new IntConstant     (con.as_int    ()); break;
+      case T_LONG   : t = new LongConstant    (con.as_long   ()); break;
+      case T_FLOAT  : t = new FloatConstant   (con.as_float  ()); break;
+      case T_DOUBLE : t = new DoubleConstant  (con.as_double ()); break;
+      case T_ARRAY  : t = new ArrayConstant   (con.as_object ()->as_array   ()); break;
+      case T_OBJECT :
+       {
+        ciObject* obj = con.as_object();
+        if (obj->is_klass()) {
+          ciKlass* klass = obj->as_klass();
+          if (!klass->is_loaded() || PatchALot) {
+            patch_state = state()->copy();
+            t = new ObjectConstant(obj);
+          } else {
+            t = new InstanceConstant(klass->java_mirror());
+          }
+        } else {
+          t = new InstanceConstant(obj->as_instance());
+        }
+        break;
+       }
+      default       : ShouldNotReachHere();
+    }
+    Value x;
+    if (patch_state != NULL) {
+      x = new Constant(t, patch_state);
+    } else {
+      x = new Constant(t);
+    }
+    push(t, append(x));
+  }
+}
+
+
+void GraphBuilder::load_local(ValueType* type, int index) {
+  Value x = state()->load_local(index);
+  push(type, x);
+}
+
+
+void GraphBuilder::store_local(ValueType* type, int index) {
+  Value x = pop(type);
+  store_local(state(), x, type, index);
+}
+
+
+void GraphBuilder::store_local(ValueStack* state, Value x, ValueType* type, int index) {
+  if (parsing_jsr()) {
+    // We need to do additional tracking of the location of the return
+    // address for jsrs since we don't handle arbitrary jsr/ret
+    // constructs. Here we are figuring out in which circumstances we
+    // need to bail out.
+    if (x->type()->is_address()) {
+      scope_data()->set_jsr_return_address_local(index);
+
+      // Also check parent jsrs (if any) at this time to see whether
+      // they are using this local. We don't handle skipping over a
+      // ret.
+      for (ScopeData* cur_scope_data = scope_data()->parent();
+           cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope();
+           cur_scope_data = cur_scope_data->parent()) {
+        if (cur_scope_data->jsr_return_address_local() == index) {
+          BAILOUT("subroutine overwrites return address from previous subroutine");
+        }
+      }
+    } else if (index == scope_data()->jsr_return_address_local()) {
+      scope_data()->set_jsr_return_address_local(-1);
+    }
+  }
+
+  state->store_local(index, round_fp(x));
+}
+
+
+void GraphBuilder::load_indexed(BasicType type) {
+  Value index = ipop();
+  Value array = apop();
+  Value length = NULL;
+  if (CSEArrayLength ||
+      (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) ||
+      (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) {
+    length = append(new ArrayLength(array, lock_stack()));
+  }
+  push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, lock_stack())));
+}
+
+
+void GraphBuilder::store_indexed(BasicType type) {
+  Value value = pop(as_ValueType(type));
+  Value index = ipop();
+  Value array = apop();
+  Value length = NULL;
+  if (CSEArrayLength ||
+      (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) ||
+      (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) {
+    length = append(new ArrayLength(array, lock_stack()));
+  }
+  StoreIndexed* result = new StoreIndexed(array, index, length, type, value, lock_stack());
+  kill_array(value); // invalidate all CSEs that are memory accesses of the same type
+  append(result);
+}
+
+
+void GraphBuilder::stack_op(Bytecodes::Code code) {
+  switch (code) {
+    case Bytecodes::_pop:
+      { state()->raw_pop();
+      }
+      break;
+    case Bytecodes::_pop2:
+      { state()->raw_pop();
+        state()->raw_pop();
+      }
+      break;
+    case Bytecodes::_dup:
+      { Value w = state()->raw_pop();
+        state()->raw_push(w);
+        state()->raw_push(w);
+      }
+      break;
+    case Bytecodes::_dup_x1:
+      { Value w1 = state()->raw_pop();
+        Value w2 = state()->raw_pop();
+        state()->raw_push(w1);
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+      }
+      break;
+    case Bytecodes::_dup_x2:
+      { Value w1 = state()->raw_pop();
+        Value w2 = state()->raw_pop();
+        Value w3 = state()->raw_pop();
+        state()->raw_push(w1);
+        state()->raw_push(w3);
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+      }
+      break;
+    case Bytecodes::_dup2:
+      { Value w1 = state()->raw_pop();
+        Value w2 = state()->raw_pop();
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+      }
+      break;
+    case Bytecodes::_dup2_x1:
+      { Value w1 = state()->raw_pop();
+        Value w2 = state()->raw_pop();
+        Value w3 = state()->raw_pop();
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+        state()->raw_push(w3);
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+      }
+      break;
+    case Bytecodes::_dup2_x2:
+      { Value w1 = state()->raw_pop();
+        Value w2 = state()->raw_pop();
+        Value w3 = state()->raw_pop();
+        Value w4 = state()->raw_pop();
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+        state()->raw_push(w4);
+        state()->raw_push(w3);
+        state()->raw_push(w2);
+        state()->raw_push(w1);
+      }
+      break;
+    case Bytecodes::_swap:
+      { Value w1 = state()->raw_pop();
+        Value w2 = state()->raw_pop();
+        state()->raw_push(w1);
+        state()->raw_push(w2);
+      }
+      break;
+    default:
+      ShouldNotReachHere();
+      break;
+  }
+}
+
+
+void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* stack) {
+  Value y = pop(type);
+  Value x = pop(type);
+  // NOTE: strictfp can be queried from current method since we don't
+  // inline methods with differing strictfp bits
+  Value res = new ArithmeticOp(code, x, y, method()->is_strict(), stack);
+  // Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level
+  res = append(res);
+  if (method()->is_strict()) {
+    res = round_fp(res);
+  }
+  push(type, res);
+}
+
+
+void GraphBuilder::negate_op(ValueType* type) {
+  push(type, append(new NegateOp(pop(type))));
+}
+
+
+void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) {
+  Value s = ipop();
+  Value x = pop(type);
+  // try to simplify
+  // Note: This code should go into the canonicalizer as soon as it can
+  //       can handle canonicalized forms that contain more than one node.
+  if (CanonicalizeNodes && code == Bytecodes::_iushr) {
+    // pattern: x >>> s
+    IntConstant* s1 = s->type()->as_IntConstant();
+    if (s1 != NULL) {
+      // pattern: x >>> s1, with s1 constant
+      ShiftOp* l = x->as_ShiftOp();
+      if (l != NULL && l->op() == Bytecodes::_ishl) {
+        // pattern: (a << b) >>> s1
+        IntConstant* s0 = l->y()->type()->as_IntConstant();
+        if (s0 != NULL) {
+          // pattern: (a << s0) >>> s1
+          const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts
+          const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts
+          if (s0c == s1c) {
+            if (s0c == 0) {
+              // pattern: (a << 0) >>> 0 => simplify to: a
+              ipush(l->x());
+            } else {
+              // pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant
+              assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases");
+              const int m = (1 << (BitsPerInt - s0c)) - 1;
+              Value s = append(new Constant(new IntConstant(m)));
+              ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s)));
+            }
+            return;
+          }
+        }
+      }
+    }
+  }
+  // could not simplify
+  push(type, append(new ShiftOp(code, x, s)));
+}
+
+
+void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) {
+  Value y = pop(type);
+  Value x = pop(type);
+  push(type, append(new LogicOp(code, x, y)));
+}
+
+
+void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) {
+  ValueStack* state_before = state()->copy();
+  Value y = pop(type);
+  Value x = pop(type);
+  ipush(append(new CompareOp(code, x, y, state_before)));
+}
+
+
+void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) {
+  push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to))));
+}
+
+
+void GraphBuilder::increment() {
+  int index = stream()->get_index();
+  int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]);
+  load_local(intType, index);
+  ipush(append(new Constant(new IntConstant(delta))));
+  arithmetic_op(intType, Bytecodes::_iadd);
+  store_local(intType, index);
+}
+
+
+void GraphBuilder::_goto(int from_bci, int to_bci) {
+  profile_bci(from_bci);
+  append(new Goto(block_at(to_bci), to_bci <= from_bci));
+}
+
+
+void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) {
+  BlockBegin* tsux = block_at(stream()->get_dest());
+  BlockBegin* fsux = block_at(stream()->next_bci());
+  bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci();
+  If* if_node = append(new If(x, cond, false, y, tsux, fsux, is_bb ? state_before : NULL, is_bb))->as_If();
+  if (profile_branches() && (if_node != NULL)) {
+    if_node->set_profiled_method(method());
+    if_node->set_profiled_bci(bci());
+    if_node->set_should_profile(true);
+  }
+}
+
+
+void GraphBuilder::if_zero(ValueType* type, If::Condition cond) {
+  Value y = append(new Constant(intZero));
+  ValueStack* state_before = state()->copy();
+  Value x = ipop();
+  if_node(x, cond, y, state_before);
+}
+
+
+void GraphBuilder::if_null(ValueType* type, If::Condition cond) {
+  Value y = append(new Constant(objectNull));
+  ValueStack* state_before = state()->copy();
+  Value x = apop();
+  if_node(x, cond, y, state_before);
+}
+
+
+void GraphBuilder::if_same(ValueType* type, If::Condition cond) {
+  ValueStack* state_before = state()->copy();
+  Value y = pop(type);
+  Value x = pop(type);
+  if_node(x, cond, y, state_before);
+}
+
+
+void GraphBuilder::jsr(int dest) {
+  // We only handle well-formed jsrs (those which are "block-structured").
+  // If the bytecodes are strange (jumping out of a jsr block) then we
+  // might end up trying to re-parse a block containing a jsr which
+  // has already been activated. Watch for this case and bail out.
+  for (ScopeData* cur_scope_data = scope_data();
+       cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope();
+       cur_scope_data = cur_scope_data->parent()) {
+    if (cur_scope_data->jsr_entry_bci() == dest) {
+      BAILOUT("too-complicated jsr/ret structure");
+    }
+  }
+
+  push(addressType, append(new Constant(new AddressConstant(next_bci()))));
+  if (!try_inline_jsr(dest)) {
+    return; // bailed out while parsing and inlining subroutine
+  }
+}
+
+
+void GraphBuilder::ret(int local_index) {
+  if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine");
+
+  if (local_index != scope_data()->jsr_return_address_local()) {
+    BAILOUT("can not handle complicated jsr/ret constructs");
+  }
+
+  // Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation
+  append(new Goto(scope_data()->jsr_continuation(), false));
+}
+
+
+void GraphBuilder::table_switch() {
+  Bytecode_tableswitch* switch_ = Bytecode_tableswitch_at(method()->code() + bci());
+  const int l = switch_->length();
+  if (CanonicalizeNodes && l == 1) {
+    // total of 2 successors => use If instead of switch
+    // Note: This code should go into the canonicalizer as soon as it can
+    //       can handle canonicalized forms that contain more than one node.
+    Value key = append(new Constant(new IntConstant(switch_->low_key())));
+    BlockBegin* tsux = block_at(bci() + switch_->dest_offset_at(0));
+    BlockBegin* fsux = block_at(bci() + switch_->default_offset());
+    bool is_bb = tsux->bci() < bci() || fsux->bci() < bci();
+    ValueStack* state_before = is_bb ? state() : NULL;
+    append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb));
+  } else {
+    // collect successors
+    BlockList* sux = new BlockList(l + 1, NULL);
+    int i;
+    bool has_bb = false;
+    for (i = 0; i < l; i++) {
+      sux->at_put(i, block_at(bci() + switch_->dest_offset_at(i)));
+      if (switch_->dest_offset_at(i) < 0) has_bb = true;
+    }
+    // add default successor
+    sux->at_put(i, block_at(bci() + switch_->default_offset()));
+    ValueStack* state_before = has_bb ? state() : NULL;
+    append(new TableSwitch(ipop(), sux, switch_->low_key(), state_before, has_bb));
+  }
+}
+
+
+void GraphBuilder::lookup_switch() {
+  Bytecode_lookupswitch* switch_ = Bytecode_lookupswitch_at(method()->code() + bci());
+  const int l = switch_->number_of_pairs();
+  if (CanonicalizeNodes && l == 1) {
+    // total of 2 successors => use If instead of switch
+    // Note: This code should go into the canonicalizer as soon as it can
+    //       can handle canonicalized forms that contain more than one node.
+    // simplify to If
+    LookupswitchPair* pair = switch_->pair_at(0);
+    Value key = append(new Constant(new IntConstant(pair->match())));
+    BlockBegin* tsux = block_at(bci() + pair->offset());
+    BlockBegin* fsux = block_at(bci() + switch_->default_offset());
+    bool is_bb = tsux->bci() < bci() || fsux->bci() < bci();
+    ValueStack* state_before = is_bb ? state() : NULL;
+    append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb));
+  } else {
+    // collect successors & keys
+    BlockList* sux = new BlockList(l + 1, NULL);
+    intArray* keys = new intArray(l, 0);
+    int i;
+    bool has_bb = false;
+    for (i = 0; i < l; i++) {
+      LookupswitchPair* pair = switch_->pair_at(i);
+      if (pair->offset() < 0) has_bb = true;
+      sux->at_put(i, block_at(bci() + pair->offset()));
+      keys->at_put(i, pair->match());
+    }
+    // add default successor
+    sux->at_put(i, block_at(bci() + switch_->default_offset()));
+    ValueStack* state_before = has_bb ? state() : NULL;
+    append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb));
+  }
+}
+
+void GraphBuilder::call_register_finalizer() {
+  // If the receiver requires finalization then emit code to perform
+  // the registration on return.
+
+  // Gather some type information about the receiver
+  Value receiver = state()->load_local(0);
+  assert(receiver != NULL, "must have a receiver");
+  ciType* declared_type = receiver->declared_type();
+  ciType* exact_type = receiver->exact_type();
+  if (exact_type == NULL &&
+      receiver->as_Local() &&
+      receiver->as_Local()->java_index() == 0) {
+    ciInstanceKlass* ik = compilation()->method()->holder();
+    if (ik->is_final()) {
+      exact_type = ik;
+    } else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) {
+      // test class is leaf class
+      compilation()->dependency_recorder()->assert_leaf_type(ik);
+      exact_type = ik;
+    } else {
+      declared_type = ik;
+    }
+  }
+
+  // see if we know statically that registration isn't required
+  bool needs_check = true;
+  if (exact_type != NULL) {
+    needs_check = exact_type->as_instance_klass()->has_finalizer();
+  } else if (declared_type != NULL) {
+    ciInstanceKlass* ik = declared_type->as_instance_klass();
+    if (!Dependencies::has_finalizable_subclass(ik)) {
+      compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik);
+      needs_check = false;
+    }
+  }
+
+  if (needs_check) {
+    // Perform the registration of finalizable objects.
+    load_local(objectType, 0);
+    append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init,
+                               state()->pop_arguments(1),
+                               true, lock_stack(), true));
+  }
+}
+
+
+void GraphBuilder::method_return(Value x) {
+  if (RegisterFinalizersAtInit &&
+      method()->intrinsic_id() == vmIntrinsics::_Object_init) {
+    call_register_finalizer();
+  }
+
+  // Check to see whether we are inlining. If so, Return
+  // instructions become Gotos to the continuation point.
+  if (continuation() != NULL) {
+    assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet");
+
+    // If the inlined method is synchronized, the monitor must be
+    // released before we jump to the continuation block.
+    if (method()->is_synchronized()) {
+      int i = state()->caller_state()->locks_size();
+      assert(state()->locks_size() == i + 1, "receiver must be locked here");
+      monitorexit(state()->lock_at(i), SynchronizationEntryBCI);
+    }
+
+    state()->truncate_stack(caller_stack_size());
+    if (x != NULL) {
+      state()->push(x->type(), x);
+    }
+    Goto* goto_callee = new Goto(continuation(), false);
+
+    // See whether this is the first return; if so, store off some
+    // of the state for later examination
+    if (num_returns() == 0) {
+      set_inline_cleanup_info(_block, _last, state());
+    }
+
+    // State at end of inlined method is the state of the caller
+    // without the method parameters on stack, including the
+    // return value, if any, of the inlined method on operand stack.
+    set_state(scope_data()->continuation_state()->copy());
+    if (x) {
+      state()->push(x->type(), x);
+    }
+
+    // The current bci() is in the wrong scope, so use the bci() of
+    // the continuation point.
+    append_with_bci(goto_callee, scope_data()->continuation()->bci());
+    incr_num_returns();
+
+    return;
+  }
+
+  state()->truncate_stack(0);
+  if (method()->is_synchronized()) {
+    // perform the unlocking before exiting the method
+    Value receiver;
+    if (!method()->is_static()) {
+      receiver = _initial_state->local_at(0);
+    } else {
+      receiver = append(new Constant(new ClassConstant(method()->holder())));
+    }
+    append_split(new MonitorExit(receiver, state()->unlock()));
+  }
+
+  append(new Return(x));
+}
+
+
+void GraphBuilder::access_field(Bytecodes::Code code) {
+  bool will_link;
+  ciField* field = stream()->get_field(will_link);
+  ciInstanceKlass* holder = field->holder();
+  BasicType field_type = field->type()->basic_type();
+  ValueType* type = as_ValueType(field_type);
+  // call will_link again to determine if the field is valid.
+  const bool is_loaded = holder->is_loaded() &&
+                         field->will_link(method()->holder(), code);
+  const bool is_initialized = is_loaded && holder->is_initialized();
+
+  ValueStack* state_copy = NULL;
+  if (!is_initialized || PatchALot) {
+    // save state before instruction for debug info when
+    // deoptimization happens during patching
+    state_copy = state()->copy();
+  }
+
+  Value obj = NULL;
+  if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) {
+    // commoning of class constants should only occur if the class is
+    // fully initialized and resolved in this constant pool.  The will_link test
+    // above essentially checks if this class is resolved in this constant pool
+    // so, the is_initialized flag should be suffiect.
+    if (state_copy != NULL) {
+      // build a patching constant
+      obj = new Constant(new ClassConstant(holder), state_copy);
+    } else {
+      obj = new Constant(new ClassConstant(holder));
+    }
+  }
+
+
+  const int offset = is_loaded ? field->offset() : -1;
+  switch (code) {
+    case Bytecodes::_getstatic: {
+      // check for compile-time constants, i.e., initialized static final fields
+      Instruction* constant = NULL;
+      if (field->is_constant() && !PatchALot) {
+        ciConstant field_val = field->constant_value();
+        BasicType field_type = field_val.basic_type();
+        switch (field_type) {
+        case T_ARRAY:
+        case T_OBJECT:
+          if (field_val.as_object()->has_encoding()) {
+            constant =  new Constant(as_ValueType(field_val));
+          }
+          break;
+
+        default:
+          constant = new Constant(as_ValueType(field_val));
+        }
+      }
+      if (constant != NULL) {
+        push(type, append(constant));
+        state_copy = NULL; // Not a potential deoptimization point (see set_state_before logic below)
+      } else {
+        push(type, append(new LoadField(append(obj), offset, field, true,
+                                        lock_stack(), state_copy, is_loaded, is_initialized)));
+      }
+      break;
+    }
+    case Bytecodes::_putstatic:
+      { Value val = pop(type);
+        append(new StoreField(append(obj), offset, field, val, true, lock_stack(), state_copy, is_loaded, is_initialized));
+        if (UseLocalValueNumbering) {
+          vmap()->kill_field(field);   // invalidate all CSEs that are memory accesses
+        }
+      }
+      break;
+    case Bytecodes::_getfield :
+      {
+        LoadField* load = new LoadField(apop(), offset, field, false, lock_stack(), state_copy, is_loaded, true);
+        Value replacement = is_loaded ? _memory->load(load) : load;
+        if (replacement != load) {
+          assert(replacement->bci() != -99 || replacement->as_Phi() || replacement->as_Local(),
+                 "should already by linked");
+          push(type, replacement);
+        } else {
+          push(type, append(load));
+        }
+        break;
+      }
+
+    case Bytecodes::_putfield :
+      { Value val = pop(type);
+        StoreField* store = new StoreField(apop(), offset, field, val, false, lock_stack(), state_copy, is_loaded, true);
+        if (is_loaded) store = _memory->store(store);
+        if (store != NULL) {
+          append(store);
+          kill_field(field);   // invalidate all CSEs that are accesses of this field
+        }
+      }
+      break;
+    default                   :
+      ShouldNotReachHere();
+      break;
+  }
+}
+
+
+Dependencies* GraphBuilder::dependency_recorder() const {
+  assert(DeoptC1, "need debug information");
+  compilation()->set_needs_debug_information(true);
+  return compilation()->dependency_recorder();
+}
+
+
+void GraphBuilder::invoke(Bytecodes::Code code) {
+  bool will_link;
+  ciMethod* target = stream()->get_method(will_link);
+  // we have to make sure the argument size (incl. the receiver)
+  // is correct for compilation (the call would fail later during
+  // linkage anyway) - was bug (gri 7/28/99)
+  if (target->is_loaded() && target->is_static() != (code == Bytecodes::_invokestatic)) BAILOUT("will cause link error");
+  ciInstanceKlass* klass = target->holder();
+
+  // check if CHA possible: if so, change the code to invoke_special
+  ciInstanceKlass* calling_klass = method()->holder();
+  ciKlass* holder = stream()->get_declared_method_holder();
+  ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder);
+  ciInstanceKlass* actual_recv = callee_holder;
+
+  // some methods are obviously bindable without any type checks so
+  // convert them directly to an invokespecial.
+  if (target->is_loaded() && !target->is_abstract() &&
+      target->can_be_statically_bound() && code == Bytecodes::_invokevirtual) {
+    code = Bytecodes::_invokespecial;
+  }
+
+  // NEEDS_CLEANUP
+  // I've added the target-is_loaded() test below but I don't really understand
+  // how klass->is_loaded() can be true and yet target->is_loaded() is false.
+  // this happened while running the JCK invokevirtual tests under doit.  TKR
+  ciMethod* cha_monomorphic_target = NULL;
+  ciMethod* exact_target = NULL;
+  if (UseCHA && DeoptC1 && klass->is_loaded() && target->is_loaded()) {
+    Value receiver = NULL;
+    ciInstanceKlass* receiver_klass = NULL;
+    bool type_is_exact = false;
+    // try to find a precise receiver type
+    if (will_link && !target->is_static()) {
+      int index = state()->stack_size() - (target->arg_size_no_receiver() + 1);
+      receiver = state()->stack_at(index);
+      ciType* type = receiver->exact_type();
+      if (type != NULL && type->is_loaded() &&
+          type->is_instance_klass() && !type->as_instance_klass()->is_interface()) {
+        receiver_klass = (ciInstanceKlass*) type;
+        type_is_exact = true;
+      }
+      if (type == NULL) {
+        type = receiver->declared_type();
+        if (type != NULL && type->is_loaded() &&
+            type->is_instance_klass() && !type->as_instance_klass()->is_interface()) {
+          receiver_klass = (ciInstanceKlass*) type;
+          if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) {
+            // Insert a dependency on this type since
+            // find_monomorphic_target may assume it's already done.
+            dependency_recorder()->assert_leaf_type(receiver_klass);
+            type_is_exact = true;
+          }
+        }
+      }
+    }
+    if (receiver_klass != NULL && type_is_exact &&
+        receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) {
+      // If we have the exact receiver type we can bind directly to
+      // the method to call.
+      exact_target = target->resolve_invoke(calling_klass, receiver_klass);
+      if (exact_target != NULL) {
+        target = exact_target;
+        code = Bytecodes::_invokespecial;
+      }
+    }
+    if (receiver_klass != NULL &&
+        receiver_klass->is_subtype_of(actual_recv) &&
+        actual_recv->is_initialized()) {
+      actual_recv = receiver_klass;
+    }
+
+    if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) ||
+        (code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) {
+      // Use CHA on the receiver to select a more precise method.
+      cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv);
+    } else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) {
+      // if there is only one implementor of this interface then we
+      // may be able bind this invoke directly to the implementing
+      // klass but we need both a dependence on the single interface
+      // and on the method we bind to.  Additionally since all we know
+      // about the receiver type is the it's supposed to implement the
+      // interface we have to insert a check that it's the class we
+      // expect.  Interface types are not checked by the verifier so
+      // they are roughly equivalent to Object.
+      ciInstanceKlass* singleton = NULL;
+      if (target->holder()->nof_implementors() == 1) {
+        singleton = target->holder()->implementor(0);
+      }
+      if (singleton) {
+        cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton);
+        if (cha_monomorphic_target != NULL) {
+          // If CHA is able to bind this invoke then update the class
+          // to match that class, otherwise klass will refer to the
+          // interface.
+          klass = cha_monomorphic_target->holder();
+          actual_recv = target->holder();
+
+          // insert a check it's really the expected class.
+          CheckCast* c = new CheckCast(klass, receiver, NULL);
+          c->set_incompatible_class_change_check();
+          c->set_direct_compare(klass->is_final());
+          append_split(c);
+        }
+      }
+    }
+  }
+
+  if (cha_monomorphic_target != NULL) {
+    if (cha_monomorphic_target->is_abstract()) {
+      // Do not optimize for abstract methods
+      cha_monomorphic_target = NULL;
+    }
+  }
+
+  if (cha_monomorphic_target != NULL) {
+    if (!(target->is_final_method())) {
+      // If we inlined because CHA revealed only a single target method,
+      // then we are dependent on that target method not getting overridden
+      // by dynamic class loading.  Be sure to test the "static" receiver
+      // dest_method here, as opposed to the actual receiver, which may
+      // falsely lead us to believe that the receiver is final or private.
+      dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target);
+    }
+    code = Bytecodes::_invokespecial;
+  }
+  // check if we could do inlining
+  if (!PatchALot && Inline && klass->is_loaded() &&
+      (klass->is_initialized() || klass->is_interface() && target->holder()->is_initialized())
+      && target->will_link(klass, callee_holder, code)) {
+    // callee is known => check if we have static binding
+    assert(target->is_loaded(), "callee must be known");
+    if (code == Bytecodes::_invokestatic
+     || code == Bytecodes::_invokespecial
+     || code == Bytecodes::_invokevirtual && target->is_final_method()
+    ) {
+      // static binding => check if callee is ok
+      ciMethod* inline_target = (cha_monomorphic_target != NULL)
+                                  ? cha_monomorphic_target
+                                  : target;
+      bool res = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL));
+      CHECK_BAILOUT();
+
+#ifndef PRODUCT
+      // printing
+      if (PrintInlining && !res) {
+        // if it was successfully inlined, then it was already printed.
+        print_inline_result(inline_target, res);
+      }
+#endif
+      clear_inline_bailout();
+      if (res) {
+        // Register dependence if JVMTI has either breakpoint
+        // setting or hotswapping of methods capabilities since they may
+        // cause deoptimization.
+        if (JvmtiExport::can_hotswap_or_post_breakpoint()) {
+          dependency_recorder()->assert_evol_method(inline_target);
+        }
+        return;
+      }
+    }
+  }
+  // If we attempted an inline which did not succeed because of a
+  // bailout during construction of the callee graph, the entire
+  // compilation has to be aborted. This is fairly rare and currently
+  // seems to only occur for jasm-generated classes which contain
+  // jsr/ret pairs which are not associated with finally clauses and
+  // do not have exception handlers in the containing method, and are
+  // therefore not caught early enough to abort the inlining without
+  // corrupting the graph. (We currently bail out with a non-empty
+  // stack at a ret in these situations.)
+  CHECK_BAILOUT();
+
+  // inlining not successful => standard invoke
+  bool is_static = code == Bytecodes::_invokestatic;
+  ValueType* result_type = as_ValueType(target->return_type());
+  Values* args = state()->pop_arguments(target->arg_size_no_receiver());
+  Value recv = is_static ? NULL : apop();
+  bool is_loaded = target->is_loaded();
+  int vtable_index = methodOopDesc::invalid_vtable_index;
+
+#ifdef SPARC
+  // Currently only supported on Sparc.
+  // The UseInlineCaches only controls dispatch to invokevirtuals for
+  // loaded classes which we weren't able to statically bind.
+  if (!UseInlineCaches && is_loaded && code == Bytecodes::_invokevirtual
+      && !target->can_be_statically_bound()) {
+    // Find a vtable index if one is available
+    vtable_index = target->resolve_vtable_index(calling_klass, callee_holder);
+  }
+#endif
+
+  if (recv != NULL &&
+      (code == Bytecodes::_invokespecial ||
+       !is_loaded || target->is_final() ||
+       profile_calls())) {
+    // invokespecial always needs a NULL check.  invokevirtual where
+    // the target is final or where it's not known that whether the
+    // target is final requires a NULL check.  Otherwise normal
+    // invokevirtual will perform the null check during the lookup
+    // logic or the unverified entry point.  Profiling of calls
+    // requires that the null check is performed in all cases.
+    null_check(recv);
+  }
+
+  if (profile_calls()) {
+    assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set");
+    ciKlass* target_klass = NULL;
+    if (cha_monomorphic_target != NULL) {
+      target_klass = cha_monomorphic_target->holder();
+    } else if (exact_target != NULL) {
+      target_klass = exact_target->holder();
+    }
+    profile_call(recv, target_klass);
+  }
+
+  Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target);
+  // push result
+  append_split(result);
+
+  if (result_type != voidType) {
+    if (method()->is_strict()) {
+      push(result_type, round_fp(result));
+    } else {
+      push(result_type, result);
+    }
+  }
+}
+
+
+void GraphBuilder::new_instance(int klass_index) {
+  bool will_link;
+  ciKlass* klass = stream()->get_klass(will_link);
+  assert(klass->is_instance_klass(), "must be an instance klass");
+  NewInstance* new_instance = new NewInstance(klass->as_instance_klass());
+  _memory->new_instance(new_instance);
+  apush(append_split(new_instance));
+}
+
+
+void GraphBuilder::new_type_array() {
+  apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index())));
+}
+
+
+void GraphBuilder::new_object_array() {
+  bool will_link;
+  ciKlass* klass = stream()->get_klass(will_link);
+  ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
+  NewArray* n = new NewObjectArray(klass, ipop(), state_before);
+  apush(append_split(n));
+}
+
+
+bool GraphBuilder::direct_compare(ciKlass* k) {
+  if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) {
+    ciInstanceKlass* ik = k->as_instance_klass();
+    if (ik->is_final()) {
+      return true;
+    } else {
+      if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) {
+        // test class is leaf class
+        dependency_recorder()->assert_leaf_type(ik);
+        return true;
+      }
+    }
+  }
+  return false;
+}
+
+
+void GraphBuilder::check_cast(int klass_index) {
+  bool will_link;
+  ciKlass* klass = stream()->get_klass(will_link);
+  ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
+  CheckCast* c = new CheckCast(klass, apop(), state_before);
+  apush(append_split(c));
+  c->set_direct_compare(direct_compare(klass));
+  if (profile_checkcasts()) {
+    c->set_profiled_method(method());
+    c->set_profiled_bci(bci());
+    c->set_should_profile(true);
+  }
+}
+
+
+void GraphBuilder::instance_of(int klass_index) {
+  bool will_link;
+  ciKlass* klass = stream()->get_klass(will_link);
+  ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
+  InstanceOf* i = new InstanceOf(klass, apop(), state_before);
+  ipush(append_split(i));
+  i->set_direct_compare(direct_compare(klass));
+}
+
+
+void GraphBuilder::monitorenter(Value x, int bci) {
+  // save state before locking in case of deoptimization after a NullPointerException
+  ValueStack* lock_stack_before = lock_stack();
+  append_with_bci(new MonitorEnter(x, state()->lock(scope(), x), lock_stack_before), bci);
+  kill_all();
+}
+
+
+void GraphBuilder::monitorexit(Value x, int bci) {
+  // Note: the comment below is only relevant for the case where we do
+  // not deoptimize due to asynchronous exceptions (!(DeoptC1 &&
+  // DeoptOnAsyncException), which is not used anymore)
+
+  // Note: Potentially, the monitor state in an exception handler
+  //       can be wrong due to wrong 'initialization' of the handler
+  //       via a wrong asynchronous exception path. This can happen,
+  //       if the exception handler range for asynchronous exceptions
+  //       is too long (see also java bug 4327029, and comment in
+  //       GraphBuilder::handle_exception()). This may cause 'under-
+  //       flow' of the monitor stack => bailout instead.
+  if (state()->locks_size() < 1) BAILOUT("monitor stack underflow");
+  append_with_bci(new MonitorExit(x, state()->unlock()), bci);
+  kill_all();
+}
+
+
+void GraphBuilder::new_multi_array(int dimensions) {
+  bool will_link;
+  ciKlass* klass = stream()->get_klass(will_link);
+  ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
+
+  Values* dims = new Values(dimensions, NULL);
+  // fill in all dimensions
+  int i = dimensions;
+  while (i-- > 0) dims->at_put(i, ipop());
+  // create array
+  NewArray* n = new NewMultiArray(klass, dims, state_before);
+  apush(append_split(n));
+}
+
+
+void GraphBuilder::throw_op(int bci) {
+  // We require that the debug info for a Throw be the "state before"
+  // the Throw (i.e., exception oop is still on TOS)
+  ValueStack* state_before = state()->copy();
+  Throw* t = new Throw(apop(), state_before);
+  append_with_bci(t, bci);
+}
+
+
+Value GraphBuilder::round_fp(Value fp_value) {
+  // no rounding needed if SSE2 is used
+  if (RoundFPResults && UseSSE < 2) {
+    // Must currently insert rounding node for doubleword values that
+    // are results of expressions (i.e., not loads from memory or
+    // constants)
+    if (fp_value->type()->tag() == doubleTag &&
+        fp_value->as_Constant() == NULL &&
+        fp_value->as_Local() == NULL &&       // method parameters need no rounding
+        fp_value->as_RoundFP() == NULL) {
+      return append(new RoundFP(fp_value));
+    }
+  }
+  return fp_value;
+}
+
+
+Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) {
+  Canonicalizer canon(instr, bci);
+  Instruction* i1 = canon.canonical();
+  if (i1->bci() != -99) {
+    // Canonicalizer returned an instruction which was already
+    // appended so simply return it.
+    return i1;
+  } else if (UseLocalValueNumbering) {
+    // Lookup the instruction in the ValueMap and add it to the map if
+    // it's not found.
+    Instruction* i2 = vmap()->find_insert(i1);
+    if (i2 != i1) {
+      // found an entry in the value map, so just return it.
+      assert(i2->bci() != -1, "should already be linked");
+      return i2;
+    }
+  }
+
+  if (i1->as_Phi() == NULL && i1->as_Local() == NULL) {
+    // i1 was not eliminated => append it
+    assert(i1->next() == NULL, "shouldn't already be linked");
+    _last = _last->set_next(i1, canon.bci());
+    if (++_instruction_count >= InstructionCountCutoff
+        && !bailed_out()) {
+      // set the bailout state but complete normal processing.  We
+      // might do a little more work before noticing the bailout so we
+      // want processing to continue normally until it's noticed.
+      bailout("Method and/or inlining is too large");
+    }
+
+#ifndef PRODUCT
+    if (PrintIRDuringConstruction) {
+      InstructionPrinter ip;
+      ip.print_line(i1);
+      if (Verbose) {
+        state()->print();
+      }
+    }
+#endif
+    assert(_last == i1, "adjust code below");
+    StateSplit* s = i1->as_StateSplit();
+    if (s != NULL && i1->as_BlockEnd() == NULL) {
+      // Continue CSE across certain intrinsics
+      Intrinsic* intrinsic = s->as_Intrinsic();
+      if (UseLocalValueNumbering) {
+        if (intrinsic == NULL || !intrinsic->preserves_state()) {
+          vmap()->kill_all();      // for now, hopefully we need this only for calls eventually
+          }
+      }
+      if (EliminateFieldAccess) {
+        if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) {
+          _memory->kill();
+        }
+      }
+      s->set_state(state()->copy());
+    }
+    // set up exception handlers for this instruction if necessary
+    if (i1->can_trap()) {
+      assert(exception_state() != NULL || !has_handler(), "must have setup exception state");
+      i1->set_exception_handlers(handle_exception(bci));
+    }
+  }
+  return i1;
+}
+
+
+Instruction* GraphBuilder::append(Instruction* instr) {
+  assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used");
+  return append_with_bci(instr, bci());
+}
+
+
+Instruction* GraphBuilder::append_split(StateSplit* instr) {
+  return append_with_bci(instr, bci());
+}
+
+
+void GraphBuilder::null_check(Value value) {
+  if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) {
+    return;
+  } else {
+    Constant* con = value->as_Constant();
+    if (con) {
+      ObjectType* c = con->type()->as_ObjectType();
+      if (c && c->is_loaded()) {
+        ObjectConstant* oc = c->as_ObjectConstant();
+        if (!oc || !oc->value()->is_null_object()) {
+          return;
+        }
+      }
+    }
+  }
+  append(new NullCheck(value, lock_stack()));
+}
+
+
+
+XHandlers* GraphBuilder::handle_exception(int cur_bci) {
+  // fast path if it is guaranteed that no exception handlers are present
+  if (!has_handler()) {
+    // TODO: check if return NULL is possible (avoids empty lists)
+    return new XHandlers();
+  }
+
+  XHandlers*  exception_handlers = new XHandlers();
+  ScopeData*  cur_scope_data = scope_data();
+  ValueStack* s = exception_state();
+  int scope_count = 0;
+
+  assert(s != NULL, "exception state must be set");
+  do {
+    assert(cur_scope_data->scope() == s->scope(), "scopes do not match");
+    assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci");
+
+    // join with all potential exception handlers
+    XHandlers* list = cur_scope_data->xhandlers();
+    const int n = list->length();
+    for (int i = 0; i < n; i++) {
+      XHandler* h = list->handler_at(i);
+      if (h->covers(cur_bci)) {
+        // h is a potential exception handler => join it
+        compilation()->set_has_exception_handlers(true);
+
+        BlockBegin* entry = h->entry_block();
+        if (entry == block()) {
+          // It's acceptable for an exception handler to cover itself
+          // but we don't handle that in the parser currently.  It's
+          // very rare so we bailout instead of trying to handle it.
+          BAILOUT_("exception handler covers itself", exception_handlers);
+        }
+        assert(entry->bci() == h->handler_bci(), "must match");
+        assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond");
+
+        // previously this was a BAILOUT, but this is not necessary
+        // now because asynchronous exceptions are not handled this way.
+        assert(entry->state() == NULL || s->locks_size() == entry->state()->locks_size(), "locks do not match");
+
+        // xhandler start with an empty expression stack
+        s->truncate_stack(cur_scope_data->caller_stack_size());
+
+        // Note: Usually this join must work. However, very
+        // complicated jsr-ret structures where we don't ret from
+        // the subroutine can cause the objects on the monitor
+        // stacks to not match because blocks can be parsed twice.
+        // The only test case we've seen so far which exhibits this
+        // problem is caught by the infinite recursion test in
+        // GraphBuilder::jsr() if the join doesn't work.
+        if (!entry->try_merge(s)) {
+          BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers);
+        }
+
+        // add current state for correct handling of phi functions at begin of xhandler
+        int phi_operand = entry->add_exception_state(s);
+
+        // add entry to the list of xhandlers of this block
+        _block->add_exception_handler(entry);
+
+        // add back-edge from xhandler entry to this block
+        if (!entry->is_predecessor(_block)) {
+          entry->add_predecessor(_block);
+        }
+
+        // clone XHandler because phi_operand and scope_count can not be shared
+        XHandler* new_xhandler = new XHandler(h);
+        new_xhandler->set_phi_operand(phi_operand);
+        new_xhandler->set_scope_count(scope_count);
+        exception_handlers->append(new_xhandler);
+
+        // fill in exception handler subgraph lazily
+        assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet");
+        cur_scope_data->add_to_work_list(entry);
+
+        // stop when reaching catchall
+        if (h->catch_type() == 0) {
+          return exception_handlers;
+        }
+      }
+    }
+
+    // Set up iteration for next time.
+    // If parsing a jsr, do not grab exception handlers from the
+    // parent scopes for this method (already got them, and they
+    // needed to be cloned)
+    if (cur_scope_data->parsing_jsr()) {
+      IRScope* tmp_scope = cur_scope_data->scope();
+      while (cur_scope_data->parent() != NULL &&
+             cur_scope_data->parent()->scope() == tmp_scope) {
+        cur_scope_data = cur_scope_data->parent();
+      }
+    }
+    if (cur_scope_data != NULL) {
+      if (cur_scope_data->parent() != NULL) {
+        // must use pop_scope instead of caller_state to preserve all monitors
+        s = s->pop_scope();
+      }
+      cur_bci = cur_scope_data->scope()->caller_bci();
+      cur_scope_data = cur_scope_data->parent();
+      scope_count++;
+    }
+  } while (cur_scope_data != NULL);
+
+  return exception_handlers;
+}
+
+
+// Helper class for simplifying Phis.
+class PhiSimplifier : public BlockClosure {
+ private:
+  bool _has_substitutions;
+  Value simplify(Value v);
+
+ public:
+  PhiSimplifier(BlockBegin* start) : _has_substitutions(false) {
+    start->iterate_preorder(this);
+    if (_has_substitutions) {
+      SubstitutionResolver sr(start);
+    }
+  }
+  void block_do(BlockBegin* b);
+  bool has_substitutions() const { return _has_substitutions; }
+};
+
+
+Value PhiSimplifier::simplify(Value v) {
+  Phi* phi = v->as_Phi();
+
+  if (phi == NULL) {
+    // no phi function
+    return v;
+  } else if (v->has_subst()) {
+    // already substituted; subst can be phi itself -> simplify
+    return simplify(v->subst());
+  } else if (phi->is_set(Phi::cannot_simplify)) {
+    // already tried to simplify phi before
+    return phi;
+  } else if (phi->is_set(Phi::visited)) {
+    // break cycles in phi functions
+    return phi;
+  } else if (phi->type()->is_illegal()) {
+    // illegal phi functions are ignored anyway
+    return phi;
+
+  } else {
+    // mark phi function as processed to break cycles in phi functions
+    phi->set(Phi::visited);
+
+    // simplify x = [y, x] and x = [y, y] to y
+    Value subst = NULL;
+    int opd_count = phi->operand_count();
+    for (int i = 0; i < opd_count; i++) {
+      Value opd = phi->operand_at(i);
+      assert(opd != NULL, "Operand must exist!");
+
+      if (opd->type()->is_illegal()) {
+        // if one operand is illegal, the entire phi function is illegal
+        phi->make_illegal();
+        phi->clear(Phi::visited);
+        return phi;
+      }
+
+      Value new_opd = simplify(opd);
+      assert(new_opd != NULL, "Simplified operand must exist!");
+
+      if (new_opd != phi && new_opd != subst) {
+        if (subst == NULL) {
+          subst = new_opd;
+        } else {
+          // no simplification possible
+          phi->set(Phi::cannot_simplify);
+          phi->clear(Phi::visited);
+          return phi;
+        }
+      }
+    }
+
+    // sucessfully simplified phi function
+    assert(subst != NULL, "illegal phi function");
+    _has_substitutions = true;
+    phi->clear(Phi::visited);
+    phi->set_subst(subst);
+
+#ifndef PRODUCT
+    if (PrintPhiFunctions) {
+      tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id());
+    }
+#endif
+
+    return subst;
+  }
+}
+
+
+void PhiSimplifier::block_do(BlockBegin* b) {
+  for_each_phi_fun(b, phi,
+    simplify(phi);
+  );
+
+#ifdef ASSERT
+  for_each_phi_fun(b, phi,
+                   assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification");
+  );
+
+  ValueStack* state = b->state()->caller_state();
+  int index;
+  Value value;
+  for_each_state(state) {
+    for_each_local_value(state, index, value) {
+      Phi* phi = value->as_Phi();
+      assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state");
+    }
+  }
+#endif
+}
+
+// This method is called after all blocks are filled with HIR instructions
+// It eliminates all Phi functions of the form x = [y, y] and x = [y, x]
+void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) {
+  PhiSimplifier simplifier(start);
+}
+
+
+void GraphBuilder::connect_to_end(BlockBegin* beg) {
+  // setup iteration
+  kill_all();
+  _block = beg;
+  _state = beg->state()->copy();
+  _last  = beg;
+  iterate_bytecodes_for_block(beg->bci());
+}
+
+
+BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) {
+#ifndef PRODUCT
+  if (PrintIRDuringConstruction) {
+    tty->cr();
+    InstructionPrinter ip;
+    ip.print_instr(_block); tty->cr();
+    ip.print_stack(_block->state()); tty->cr();
+    ip.print_inline_level(_block);
+    ip.print_head();
+    tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size());
+  }
+#endif
+  _skip_block = false;
+  assert(state() != NULL, "ValueStack missing!");
+  ciBytecodeStream s(method());
+  s.reset_to_bci(bci);
+  int prev_bci = bci;
+  scope_data()->set_stream(&s);
+  // iterate
+  Bytecodes::Code code = Bytecodes::_illegal;
+  bool push_exception = false;
+
+  if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) {
+    // first thing in the exception entry block should be the exception object.
+    push_exception = true;
+  }
+
+  while (!bailed_out() && last()->as_BlockEnd() == NULL &&
+         (code = stream()->next()) != ciBytecodeStream::EOBC() &&
+         (block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) {
+
+    if (has_handler() && can_trap(method(), code)) {
+      // copy the state because it is modified before handle_exception is called
+      set_exception_state(state()->copy());
+    } else {
+      // handle_exception is not called for this bytecode
+      set_exception_state(NULL);
+    }
+
+    // Check for active jsr during OSR compilation
+    if (compilation()->is_osr_compile()
+        && scope()->is_top_scope()
+        && parsing_jsr()
+        && s.cur_bci() == compilation()->osr_bci()) {
+      bailout("OSR not supported while a jsr is active");
+    }
+
+    if (push_exception) {
+      apush(append(new ExceptionObject()));
+      push_exception = false;
+    }
+
+    // handle bytecode
+    switch (code) {
+      case Bytecodes::_nop            : /* nothing to do */ break;
+      case Bytecodes::_aconst_null    : apush(append(new Constant(objectNull            ))); break;
+      case Bytecodes::_iconst_m1      : ipush(append(new Constant(new IntConstant   (-1)))); break;
+      case Bytecodes::_iconst_0       : ipush(append(new Constant(intZero               ))); break;
+      case Bytecodes::_iconst_1       : ipush(append(new Constant(intOne                ))); break;
+      case Bytecodes::_iconst_2       : ipush(append(new Constant(new IntConstant   ( 2)))); break;
+      case Bytecodes::_iconst_3       : ipush(append(new Constant(new IntConstant   ( 3)))); break;
+      case Bytecodes::_iconst_4       : ipush(append(new Constant(new IntConstant   ( 4)))); break;
+      case Bytecodes::_iconst_5       : ipush(append(new Constant(new IntConstant   ( 5)))); break;
+      case Bytecodes::_lconst_0       : lpush(append(new Constant(new LongConstant  ( 0)))); break;
+      case Bytecodes::_lconst_1       : lpush(append(new Constant(new LongConstant  ( 1)))); break;
+      case Bytecodes::_fconst_0       : fpush(append(new Constant(new FloatConstant ( 0)))); break;
+      case Bytecodes::_fconst_1       : fpush(append(new Constant(new FloatConstant ( 1)))); break;
+      case Bytecodes::_fconst_2       : fpush(append(new Constant(new FloatConstant ( 2)))); break;
+      case Bytecodes::_dconst_0       : dpush(append(new Constant(new DoubleConstant( 0)))); break;
+      case Bytecodes::_dconst_1       : dpush(append(new Constant(new DoubleConstant( 1)))); break;
+      case Bytecodes::_bipush         : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break;
+      case Bytecodes::_sipush         : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break;
+      case Bytecodes::_ldc            : // fall through
+      case Bytecodes::_ldc_w          : // fall through
+      case Bytecodes::_ldc2_w         : load_constant(); break;
+      case Bytecodes::_iload          : load_local(intType     , s.get_index()); break;
+      case Bytecodes::_lload          : load_local(longType    , s.get_index()); break;
+      case Bytecodes::_fload          : load_local(floatType   , s.get_index()); break;
+      case Bytecodes::_dload          : load_local(doubleType  , s.get_index()); break;
+      case Bytecodes::_aload          : load_local(instanceType, s.get_index()); break;
+      case Bytecodes::_iload_0        : load_local(intType   , 0); break;
+      case Bytecodes::_iload_1        : load_local(intType   , 1); break;
+      case Bytecodes::_iload_2        : load_local(intType   , 2); break;
+      case Bytecodes::_iload_3        : load_local(intType   , 3); break;
+      case Bytecodes::_lload_0        : load_local(longType  , 0); break;
+      case Bytecodes::_lload_1        : load_local(longType  , 1); break;
+      case Bytecodes::_lload_2        : load_local(longType  , 2); break;
+      case Bytecodes::_lload_3        : load_local(longType  , 3); break;
+      case Bytecodes::_fload_0        : load_local(floatType , 0); break;
+      case Bytecodes::_fload_1        : load_local(floatType , 1); break;
+      case Bytecodes::_fload_2        : load_local(floatType , 2); break;
+      case Bytecodes::_fload_3        : load_local(floatType , 3); break;
+      case Bytecodes::_dload_0        : load_local(doubleType, 0); break;
+      case Bytecodes::_dload_1        : load_local(doubleType, 1); break;
+      case Bytecodes::_dload_2        : load_local(doubleType, 2); break;
+      case Bytecodes::_dload_3        : load_local(doubleType, 3); break;
+      case Bytecodes::_aload_0        : load_local(objectType, 0); break;
+      case Bytecodes::_aload_1        : load_local(objectType, 1); break;
+      case Bytecodes::_aload_2        : load_local(objectType, 2); break;
+      case Bytecodes::_aload_3        : load_local(objectType, 3); break;
+      case Bytecodes::_iaload         : load_indexed(T_INT   ); break;
+      case Bytecodes::_laload         : load_indexed(T_LONG  ); break;
+      case Bytecodes::_faload         : load_indexed(T_FLOAT ); break;
+      case Bytecodes::_daload         : load_indexed(T_DOUBLE); break;
+      case Bytecodes::_aaload         : load_indexed(T_OBJECT); break;
+      case Bytecodes::_baload         : load_indexed(T_BYTE  ); break;
+      case Bytecodes::_caload         : load_indexed(T_CHAR  ); break;
+      case Bytecodes::_saload         : load_indexed(T_SHORT ); break;
+      case Bytecodes::_istore         : store_local(intType   , s.get_index()); break;
+      case Bytecodes::_lstore         : store_local(longType  , s.get_index()); break;
+      case Bytecodes::_fstore         : store_local(floatType , s.get_index()); break;
+      case Bytecodes::_dstore         : store_local(doubleType, s.get_index()); break;
+      case Bytecodes::_astore         : store_local(objectType, s.get_index()); break;
+      case Bytecodes::_istore_0       : store_local(intType   , 0); break;
+      case Bytecodes::_istore_1       : store_local(intType   , 1); break;
+      case Bytecodes::_istore_2       : store_local(intType   , 2); break;
+      case Bytecodes::_istore_3       : store_local(intType   , 3); break;
+      case Bytecodes::_lstore_0       : store_local(longType  , 0); break;
+      case Bytecodes::_lstore_1       : store_local(longType  , 1); break;
+      case Bytecodes::_lstore_2       : store_local(longType  , 2); break;
+      case Bytecodes::_lstore_3       : store_local(longType  , 3); break;
+      case Bytecodes::_fstore_0       : store_local(floatType , 0); break;
+      case Bytecodes::_fstore_1       : store_local(floatType , 1); break;
+      case Bytecodes::_fstore_2       : store_local(floatType , 2); break;
+      case Bytecodes::_fstore_3       : store_local(floatType , 3); break;
+      case Bytecodes::_dstore_0       : store_local(doubleType, 0); break;
+      case Bytecodes::_dstore_1       : store_local(doubleType, 1); break;
+      case Bytecodes::_dstore_2       : store_local(doubleType, 2); break;
+      case Bytecodes::_dstore_3       : store_local(doubleType, 3); break;
+      case Bytecodes::_astore_0       : store_local(objectType, 0); break;
+      case Bytecodes::_astore_1       : store_local(objectType, 1); break;
+      case Bytecodes::_astore_2       : store_local(objectType, 2); break;
+      case Bytecodes::_astore_3       : store_local(objectType, 3); break;
+      case Bytecodes::_iastore        : store_indexed(T_INT   ); break;
+      case Bytecodes::_lastore        : store_indexed(T_LONG  ); break;
+      case Bytecodes::_fastore        : store_indexed(T_FLOAT ); break;
+      case Bytecodes::_dastore        : store_indexed(T_DOUBLE); break;
+      case Bytecodes::_aastore        : store_indexed(T_OBJECT); break;
+      case Bytecodes::_bastore        : store_indexed(T_BYTE  ); break;
+      case Bytecodes::_castore        : store_indexed(T_CHAR  ); break;
+      case Bytecodes::_sastore        : store_indexed(T_SHORT ); break;
+      case Bytecodes::_pop            : // fall through
+      case Bytecodes::_pop2           : // fall through
+      case Bytecodes::_dup            : // fall through
+      case Bytecodes::_dup_x1         : // fall through
+      case Bytecodes::_dup_x2         : // fall through
+      case Bytecodes::_dup2           : // fall through
+      case Bytecodes::_dup2_x1        : // fall through
+      case Bytecodes::_dup2_x2        : // fall through
+      case Bytecodes::_swap           : stack_op(code); break;
+      case Bytecodes::_iadd           : arithmetic_op(intType   , code); break;
+      case Bytecodes::_ladd           : arithmetic_op(longType  , code); break;
+      case Bytecodes::_fadd           : arithmetic_op(floatType , code); break;
+      case Bytecodes::_dadd           : arithmetic_op(doubleType, code); break;
+      case Bytecodes::_isub           : arithmetic_op(intType   , code); break;
+      case Bytecodes::_lsub           : arithmetic_op(longType  , code); break;
+      case Bytecodes::_fsub           : arithmetic_op(floatType , code); break;
+      case Bytecodes::_dsub           : arithmetic_op(doubleType, code); break;
+      case Bytecodes::_imul           : arithmetic_op(intType   , code); break;
+      case Bytecodes::_lmul           : arithmetic_op(longType  , code); break;
+      case Bytecodes::_fmul           : arithmetic_op(floatType , code); break;
+      case Bytecodes::_dmul           : arithmetic_op(doubleType, code); break;
+      case Bytecodes::_idiv           : arithmetic_op(intType   , code, lock_stack()); break;
+      case Bytecodes::_ldiv           : arithmetic_op(longType  , code, lock_stack()); break;
+      case Bytecodes::_fdiv           : arithmetic_op(floatType , code); break;
+      case Bytecodes::_ddiv           : arithmetic_op(doubleType, code); break;
+      case Bytecodes::_irem           : arithmetic_op(intType   , code, lock_stack()); break;
+      case Bytecodes::_lrem           : arithmetic_op(longType  , code, lock_stack()); break;
+      case Bytecodes::_frem           : arithmetic_op(floatType , code); break;
+      case Bytecodes::_drem           : arithmetic_op(doubleType, code); break;
+      case Bytecodes::_ineg           : negate_op(intType   ); break;
+      case Bytecodes::_lneg           : negate_op(longType  ); break;
+      case Bytecodes::_fneg           : negate_op(floatType ); break;
+      case Bytecodes::_dneg           : negate_op(doubleType); break;
+      case Bytecodes::_ishl           : shift_op(intType , code); break;
+      case Bytecodes::_lshl           : shift_op(longType, code); break;
+      case Bytecodes::_ishr           : shift_op(intType , code); break;
+      case Bytecodes::_lshr           : shift_op(longType, code); break;
+      case Bytecodes::_iushr          : shift_op(intType , code); break;
+      case Bytecodes::_lushr          : shift_op(longType, code); break;
+      case Bytecodes::_iand           : logic_op(intType , code); break;
+      case Bytecodes::_land           : logic_op(longType, code); break;
+      case Bytecodes::_ior            : logic_op(intType , code); break;
+      case Bytecodes::_lor            : logic_op(longType, code); break;
+      case Bytecodes::_ixor           : logic_op(intType , code); break;
+      case Bytecodes::_lxor           : logic_op(longType, code); break;
+      case Bytecodes::_iinc           : increment(); break;
+      case Bytecodes::_i2l            : convert(code, T_INT   , T_LONG  ); break;
+      case Bytecodes::_i2f            : convert(code, T_INT   , T_FLOAT ); break;
+      case Bytecodes::_i2d            : convert(code, T_INT   , T_DOUBLE); break;
+      case Bytecodes::_l2i            : convert(code, T_LONG  , T_INT   ); break;
+      case Bytecodes::_l2f            : convert(code, T_LONG  , T_FLOAT ); break;
+      case Bytecodes::_l2d            : convert(code, T_LONG  , T_DOUBLE); break;
+      case Bytecodes::_f2i            : convert(code, T_FLOAT , T_INT   ); break;
+      case Bytecodes::_f2l            : convert(code, T_FLOAT , T_LONG  ); break;
+      case Bytecodes::_f2d            : convert(code, T_FLOAT , T_DOUBLE); break;
+      case Bytecodes::_d2i            : convert(code, T_DOUBLE, T_INT   ); break;
+      case Bytecodes::_d2l            : convert(code, T_DOUBLE, T_LONG  ); break;
+      case Bytecodes::_d2f            : convert(code, T_DOUBLE, T_FLOAT ); break;
+      case Bytecodes::_i2b            : convert(code, T_INT   , T_BYTE  ); break;
+      case Bytecodes::_i2c            : convert(code, T_INT   , T_CHAR  ); break;
+      case Bytecodes::_i2s            : convert(code, T_INT   , T_SHORT ); break;
+      case Bytecodes::_lcmp           : compare_op(longType  , code); break;
+      case Bytecodes::_fcmpl          : compare_op(floatType , code); break;
+      case Bytecodes::_fcmpg          : compare_op(floatType , code); break;
+      case Bytecodes::_dcmpl          : compare_op(doubleType, code); break;
+      case Bytecodes::_dcmpg          : compare_op(doubleType, code); break;
+      case Bytecodes::_ifeq           : if_zero(intType   , If::eql); break;
+      case Bytecodes::_ifne           : if_zero(intType   , If::neq); break;
+      case Bytecodes::_iflt           : if_zero(intType   , If::lss); break;
+      case Bytecodes::_ifge           : if_zero(intType   , If::geq); break;
+      case Bytecodes::_ifgt           : if_zero(intType   , If::gtr); break;
+      case Bytecodes::_ifle           : if_zero(intType   , If::leq); break;
+      case Bytecodes::_if_icmpeq      : if_same(intType   , If::eql); break;
+      case Bytecodes::_if_icmpne      : if_same(intType   , If::neq); break;
+      case Bytecodes::_if_icmplt      : if_same(intType   , If::lss); break;
+      case Bytecodes::_if_icmpge      : if_same(intType   , If::geq); break;
+      case Bytecodes::_if_icmpgt      : if_same(intType   , If::gtr); break;
+      case Bytecodes::_if_icmple      : if_same(intType   , If::leq); break;
+      case Bytecodes::_if_acmpeq      : if_same(objectType, If::eql); break;
+      case Bytecodes::_if_acmpne      : if_same(objectType, If::neq); break;
+      case Bytecodes::_goto           : _goto(s.cur_bci(), s.get_dest()); break;
+      case Bytecodes::_jsr            : jsr(s.get_dest()); break;
+      case Bytecodes::_ret            : ret(s.get_index()); break;
+      case Bytecodes::_tableswitch    : table_switch(); break;
+      case Bytecodes::_lookupswitch   : lookup_switch(); break;
+      case Bytecodes::_ireturn        : method_return(ipop()); break;
+      case Bytecodes::_lreturn        : method_return(lpop()); break;
+      case Bytecodes::_freturn        : method_return(fpop()); break;
+      case Bytecodes::_dreturn        : method_return(dpop()); break;
+      case Bytecodes::_areturn        : method_return(apop()); break;
+      case Bytecodes::_return         : method_return(NULL  ); break;
+      case Bytecodes::_getstatic      : // fall through
+      case Bytecodes::_putstatic      : // fall through
+      case Bytecodes::_getfield       : // fall through
+      case Bytecodes::_putfield       : access_field(code); break;
+      case Bytecodes::_invokevirtual  : // fall through
+      case Bytecodes::_invokespecial  : // fall through
+      case Bytecodes::_invokestatic   : // fall through
+      case Bytecodes::_invokeinterface: invoke(code); break;
+      case Bytecodes::_xxxunusedxxx   : ShouldNotReachHere(); break;
+      case Bytecodes::_new            : new_instance(s.get_index_big()); break;
+      case Bytecodes::_newarray       : new_type_array(); break;
+      case Bytecodes::_anewarray      : new_object_array(); break;
+      case Bytecodes::_arraylength    : ipush(append(new ArrayLength(apop(), lock_stack()))); break;
+      case Bytecodes::_athrow         : throw_op(s.cur_bci()); break;
+      case Bytecodes::_checkcast      : check_cast(s.get_index_big()); break;
+      case Bytecodes::_instanceof     : instance_of(s.get_index_big()); break;
+      // Note: we do not have special handling for the monitorenter bytecode if DeoptC1 && DeoptOnAsyncException
+      case Bytecodes::_monitorenter   : monitorenter(apop(), s.cur_bci()); break;
+      case Bytecodes::_monitorexit    : monitorexit (apop(), s.cur_bci()); break;
+      case Bytecodes::_wide           : ShouldNotReachHere(); break;
+      case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break;
+      case Bytecodes::_ifnull         : if_null(objectType, If::eql); break;
+      case Bytecodes::_ifnonnull      : if_null(objectType, If::neq); break;
+      case Bytecodes::_goto_w         : _goto(s.cur_bci(), s.get_far_dest()); break;
+      case Bytecodes::_jsr_w          : jsr(s.get_far_dest()); break;
+      case Bytecodes::_breakpoint     : BAILOUT_("concurrent setting of breakpoint", NULL);
+      default                         : ShouldNotReachHere(); break;
+    }
+    // save current bci to setup Goto at the end
+    prev_bci = s.cur_bci();
+  }
+  CHECK_BAILOUT_(NULL);
+  // stop processing of this block (see try_inline_full)
+  if (_skip_block) {
+    _skip_block = false;
+    assert(_last && _last->as_BlockEnd(), "");
+    return _last->as_BlockEnd();
+  }
+  // if there are any, check if last instruction is a BlockEnd instruction
+  BlockEnd* end = last()->as_BlockEnd();
+  if (end == NULL) {
+    // all blocks must end with a BlockEnd instruction => add a Goto
+    end = new Goto(block_at(s.cur_bci()), false);
+    _last = _last->set_next(end, prev_bci);
+  }
+  assert(end == last()->as_BlockEnd(), "inconsistency");
+
+  // if the method terminates, we don't need the stack anymore
+  if (end->as_Return() != NULL) {
+    state()->clear_stack();
+  } else if (end->as_Throw() != NULL) {
+    // May have exception handler in caller scopes
+    state()->truncate_stack(scope()->lock_stack_size());
+  }
+
+  // connect to begin & set state
+  // NOTE that inlining may have changed the block we are parsing
+  block()->set_end(end);
+  end->set_state(state());
+  // propagate state
+  for (int i = end->number_of_sux() - 1; i >= 0; i--) {
+    BlockBegin* sux = end->sux_at(i);
+    assert(sux->is_predecessor(block()), "predecessor missing");
+    // be careful, bailout if bytecodes are strange
+    if (!sux->try_merge(state())) BAILOUT_("block join failed", NULL);
+    scope_data()->add_to_work_list(end->sux_at(i));
+  }
+
+  scope_data()->set_stream(NULL);
+
+  // done
+  return end;
+}
+
+
+void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) {
+  do {
+    if (start_in_current_block_for_inlining && !bailed_out()) {
+      iterate_bytecodes_for_block(0);
+      start_in_current_block_for_inlining = false;
+    } else {
+      BlockBegin* b;
+      while ((b = scope_data()->remove_from_work_list()) != NULL) {
+        if (!b->is_set(BlockBegin::was_visited_flag)) {
+          if (b->is_set(BlockBegin::osr_entry_flag)) {
+            // we're about to parse the osr entry block, so make sure
+            // we setup the OSR edge leading into this block so that
+            // Phis get setup correctly.
+            setup_osr_entry_block();
+            // this is no longer the osr entry block, so clear it.
+            b->clear(BlockBegin::osr_entry_flag);
+          }
+          b->set(BlockBegin::was_visited_flag);
+          connect_to_end(b);
+        }
+      }
+    }
+  } while (!bailed_out() && !scope_data()->is_work_list_empty());
+}
+
+
+bool GraphBuilder::_is_initialized = false;
+bool GraphBuilder::_can_trap      [Bytecodes::number_of_java_codes];
+bool GraphBuilder::_is_async[Bytecodes::number_of_java_codes];
+
+void GraphBuilder::initialize() {
+  // make sure initialization happens only once (need a
+  // lock here, if we allow the compiler to be re-entrant)
+  if (is_initialized()) return;
+  _is_initialized = true;
+
+  // the following bytecodes are assumed to potentially
+  // throw exceptions in compiled code - note that e.g.
+  // monitorexit & the return bytecodes do not throw
+  // exceptions since monitor pairing proved that they
+  // succeed (if monitor pairing succeeded)
+  Bytecodes::Code can_trap_list[] =
+    { Bytecodes::_ldc
+    , Bytecodes::_ldc_w
+    , Bytecodes::_ldc2_w
+    , Bytecodes::_iaload
+    , Bytecodes::_laload
+    , Bytecodes::_faload
+    , Bytecodes::_daload
+    , Bytecodes::_aaload
+    , Bytecodes::_baload
+    , Bytecodes::_caload
+    , Bytecodes::_saload
+    , Bytecodes::_iastore
+    , Bytecodes::_lastore
+    , Bytecodes::_fastore
+    , Bytecodes::_dastore
+    , Bytecodes::_aastore
+    , Bytecodes::_bastore
+    , Bytecodes::_castore
+    , Bytecodes::_sastore
+    , Bytecodes::_idiv
+    , Bytecodes::_ldiv
+    , Bytecodes::_irem
+    , Bytecodes::_lrem
+    , Bytecodes::_getstatic
+    , Bytecodes::_putstatic
+    , Bytecodes::_getfield
+    , Bytecodes::_putfield
+    , Bytecodes::_invokevirtual
+    , Bytecodes::_invokespecial
+    , Bytecodes::_invokestatic
+    , Bytecodes::_invokeinterface
+    , Bytecodes::_new
+    , Bytecodes::_newarray
+    , Bytecodes::_anewarray
+    , Bytecodes::_arraylength
+    , Bytecodes::_athrow
+    , Bytecodes::_checkcast
+    , Bytecodes::_instanceof
+    , Bytecodes::_monitorenter
+    , Bytecodes::_multianewarray
+    };
+
+  // the following bytecodes are assumed to potentially
+  // throw asynchronous exceptions in compiled code due
+  // to safepoints (note: these entries could be merged
+  // with the can_trap_list - however, we need to know
+  // which ones are asynchronous for now - see also the
+  // comment in GraphBuilder::handle_exception)
+  Bytecodes::Code is_async_list[] =
+    { Bytecodes::_ifeq
+    , Bytecodes::_ifne
+    , Bytecodes::_iflt
+    , Bytecodes::_ifge
+    , Bytecodes::_ifgt
+    , Bytecodes::_ifle
+    , Bytecodes::_if_icmpeq
+    , Bytecodes::_if_icmpne
+    , Bytecodes::_if_icmplt
+    , Bytecodes::_if_icmpge
+    , Bytecodes::_if_icmpgt
+    , Bytecodes::_if_icmple
+    , Bytecodes::_if_acmpeq
+    , Bytecodes::_if_acmpne
+    , Bytecodes::_goto
+    , Bytecodes::_jsr
+    , Bytecodes::_ret
+    , Bytecodes::_tableswitch
+    , Bytecodes::_lookupswitch
+    , Bytecodes::_ireturn
+    , Bytecodes::_lreturn
+    , Bytecodes::_freturn
+    , Bytecodes::_dreturn
+    , Bytecodes::_areturn
+    , Bytecodes::_return
+    , Bytecodes::_ifnull
+    , Bytecodes::_ifnonnull
+    , Bytecodes::_goto_w
+    , Bytecodes::_jsr_w
+    };
+
+  // inititialize trap tables
+  for (int i = 0; i < Bytecodes::number_of_java_codes; i++) {
+    _can_trap[i] = false;
+    _is_async[i] = false;
+  }
+  // set standard trap info
+  for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) {
+    _can_trap[can_trap_list[j]] = true;
+  }
+
+  // We now deoptimize if an asynchronous exception is thrown. This
+  // considerably cleans up corner case issues related to javac's
+  // incorrect exception handler ranges for async exceptions and
+  // allows us to precisely analyze the types of exceptions from
+  // certain bytecodes.
+  if (!(DeoptC1 && DeoptOnAsyncException)) {
+    // set asynchronous trap info
+    for (uint k = 0; k < ARRAY_SIZE(is_async_list); k++) {
+      assert(!_can_trap[is_async_list[k]], "can_trap_list and is_async_list should be disjoint");
+      _can_trap[is_async_list[k]] = true;
+      _is_async[is_async_list[k]] = true;
+    }
+  }
+}
+
+
+BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) {
+  assert(entry->is_set(f), "entry/flag mismatch");
+  // create header block
+  BlockBegin* h = new BlockBegin(entry->bci());
+  h->set_depth_first_number(0);
+
+  Value l = h;
+  if (profile_branches()) {
+    // Increment the invocation count on entry to the method.  We
+    // can't use profile_invocation here because append isn't setup to
+    // work properly at this point.  The instruction have to be
+    // appended to the instruction stream by hand.
+    Value m = new Constant(new ObjectConstant(compilation()->method()));
+    h->set_next(m, 0);
+    Value p = new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1);
+    m->set_next(p, 0);
+    l = p;
+  }
+
+  BlockEnd* g = new Goto(entry, false);
+  l->set_next(g, entry->bci());
+  h->set_end(g);
+  h->set(f);
+  // setup header block end state
+  ValueStack* s = state->copy(); // can use copy since stack is empty (=> no phis)
+  assert(s->stack_is_empty(), "must have empty stack at entry point");
+  g->set_state(s);
+  return h;
+}
+
+
+
+BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) {
+  BlockBegin* start = new BlockBegin(0);
+
+  // This code eliminates the empty start block at the beginning of
+  // each method.  Previously, each method started with the
+  // start-block created below, and this block was followed by the
+  // header block that was always empty.  This header block is only
+  // necesary if std_entry is also a backward branch target because
+  // then phi functions may be necessary in the header block.  It's
+  // also necessary when profiling so that there's a single block that
+  // can increment the interpreter_invocation_count.
+  BlockBegin* new_header_block;
+  if (std_entry->number_of_preds() == 0 && !profile_branches()) {
+    new_header_block = std_entry;
+  } else {
+    new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state);
+  }
+
+  // setup start block (root for the IR graph)
+  Base* base =
+    new Base(
+      new_header_block,
+      osr_entry
+    );
+  start->set_next(base, 0);
+  start->set_end(base);
+  // create & setup state for start block
+  start->set_state(state->copy());
+  base->set_state(state->copy());
+
+  if (base->std_entry()->state() == NULL) {
+    // setup states for header blocks
+    base->std_entry()->merge(state);
+  }
+
+  assert(base->std_entry()->state() != NULL, "");
+  return start;
+}
+
+
+void GraphBuilder::setup_osr_entry_block() {
+  assert(compilation()->is_osr_compile(), "only for osrs");
+
+  int osr_bci = compilation()->osr_bci();
+  ciBytecodeStream s(method());
+  s.reset_to_bci(osr_bci);
+  s.next();
+  scope_data()->set_stream(&s);
+
+  // create a new block to be the osr setup code
+  _osr_entry = new BlockBegin(osr_bci);
+  _osr_entry->set(BlockBegin::osr_entry_flag);
+  _osr_entry->set_depth_first_number(0);
+  BlockBegin* target = bci2block()->at(osr_bci);
+  assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there");
+  // the osr entry has no values for locals
+  ValueStack* state = target->state()->copy();
+  _osr_entry->set_state(state);
+
+  kill_all();
+  _block = _osr_entry;
+  _state = _osr_entry->state()->copy();
+  _last  = _osr_entry;
+  Value e = append(new OsrEntry());
+  e->set_needs_null_check(false);
+
+  // OSR buffer is
+  //
+  // locals[nlocals-1..0]
+  // monitors[number_of_locks-1..0]
+  //
+  // locals is a direct copy of the interpreter frame so in the osr buffer
+  // so first slot in the local array is the last local from the interpreter
+  // and last slot is local[0] (receiver) from the interpreter
+  //
+  // Similarly with locks. The first lock slot in the osr buffer is the nth lock
+  // from the interpreter frame, the nth lock slot in the osr buffer is 0th lock
+  // in the interpreter frame (the method lock if a sync method)
+
+  // Initialize monitors in the compiled activation.
+
+  int index;
+  Value local;
+
+  // find all the locals that the interpreter thinks contain live oops
+  const BitMap live_oops = method()->live_local_oops_at_bci(osr_bci);
+
+  // compute the offset into the locals so that we can treat the buffer
+  // as if the locals were still in the interpreter frame
+  int locals_offset = BytesPerWord * (method()->max_locals() - 1);
+  for_each_local_value(state, index, local) {
+    int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord;
+    Value get;
+    if (local->type()->is_object_kind() && !live_oops.at(index)) {
+      // The interpreter thinks this local is dead but the compiler
+      // doesn't so pretend that the interpreter passed in null.
+      get = append(new Constant(objectNull));
+    } else {
+      get = append(new UnsafeGetRaw(as_BasicType(local->type()), e,
+                                    append(new Constant(new IntConstant(offset))),
+                                    0,
+                                    true));
+    }
+    _state->store_local(index, get);
+  }
+
+  // the storage for the OSR buffer is freed manually in the LIRGenerator.
+
+  assert(state->caller_state() == NULL, "should be top scope");
+  state->clear_locals();
+  Goto* g = new Goto(target, false);
+  g->set_state(_state->copy());
+  append(g);
+  _osr_entry->set_end(g);
+  target->merge(_osr_entry->end()->state());
+
+  scope_data()->set_stream(NULL);
+}
+
+
+ValueStack* GraphBuilder::state_at_entry() {
+  ValueStack* state = new ValueStack(scope(), method()->max_locals(), method()->max_stack());
+
+  // Set up locals for receiver
+  int idx = 0;
+  if (!method()->is_static()) {
+    // we should always see the receiver
+    state->store_local(idx, new Local(objectType, idx));
+    idx = 1;
+  }
+
+  // Set up locals for incoming arguments
+  ciSignature* sig = method()->signature();
+  for (int i = 0; i < sig->count(); i++) {
+    ciType* type = sig->type_at(i);
+    BasicType basic_type = type->basic_type();
+    // don't allow T_ARRAY to propagate into locals types
+    if (basic_type == T_ARRAY) basic_type = T_OBJECT;
+    ValueType* vt = as_ValueType(basic_type);
+    state->store_local(idx, new Local(vt, idx));
+    idx += type->size();
+  }
+
+  // lock synchronized method
+  if (method()->is_synchronized()) {
+    state->lock(scope(), NULL);
+  }
+
+  return state;
+}
+
+
+GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope)
+  : _scope_data(NULL)
+  , _exception_state(NULL)
+  , _instruction_count(0)
+  , _osr_entry(NULL)
+  , _memory(new MemoryBuffer())
+  , _compilation(compilation)
+  , _inline_bailout_msg(NULL)
+{
+  int osr_bci = compilation->osr_bci();
+
+  // determine entry points and bci2block mapping
+  BlockListBuilder blm(compilation, scope, osr_bci);
+  CHECK_BAILOUT();
+
+  BlockList* bci2block = blm.bci2block();
+  BlockBegin* start_block = bci2block->at(0);
+
+  assert(is_initialized(), "GraphBuilder must have been initialized");
+  push_root_scope(scope, bci2block, start_block);
+
+  // setup state for std entry
+  _initial_state = state_at_entry();
+  start_block->merge(_initial_state);
+
+  BlockBegin* sync_handler = NULL;
+  if (method()->is_synchronized() || DTraceMethodProbes) {
+    // setup an exception handler to do the unlocking and/or notification
+    sync_handler = new BlockBegin(-1);
+    sync_handler->set(BlockBegin::exception_entry_flag);
+    sync_handler->set(BlockBegin::is_on_work_list_flag);
+    sync_handler->set(BlockBegin::default_exception_handler_flag);
+
+    ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0);
+    XHandler* h = new XHandler(desc);
+    h->set_entry_block(sync_handler);
+    scope_data()->xhandlers()->append(h);
+    scope_data()->set_has_handler();
+  }
+
+  // complete graph
+  _vmap        = new ValueMap();
+  scope->compute_lock_stack_size();
+  switch (scope->method()->intrinsic_id()) {
+  case vmIntrinsics::_dabs          : // fall through
+  case vmIntrinsics::_dsqrt         : // fall through
+  case vmIntrinsics::_dsin          : // fall through
+  case vmIntrinsics::_dcos          : // fall through
+  case vmIntrinsics::_dtan          : // fall through
+  case vmIntrinsics::_dlog          : // fall through
+  case vmIntrinsics::_dlog10        : // fall through
+    {
+      // Compiles where the root method is an intrinsic need a special
+      // compilation environment because the bytecodes for the method
+      // shouldn't be parsed during the compilation, only the special
+      // Intrinsic node should be emitted.  If this isn't done the the
+      // code for the inlined version will be different than the root
+      // compiled version which could lead to monotonicity problems on
+      // intel.
+
+      // Set up a stream so that appending instructions works properly.
+      ciBytecodeStream s(scope->method());
+      s.reset_to_bci(0);
+      scope_data()->set_stream(&s);
+      s.next();
+
+      // setup the initial block state
+      _block = start_block;
+      _state = start_block->state()->copy();
+      _last  = start_block;
+      load_local(doubleType, 0);
+
+      // Emit the intrinsic node.
+      bool result = try_inline_intrinsics(scope->method());
+      if (!result) BAILOUT("failed to inline intrinsic");
+      method_return(dpop());
+
+      // connect the begin and end blocks and we're all done.
+      BlockEnd* end = last()->as_BlockEnd();
+      block()->set_end(end);
+      end->set_state(state());
+      break;
+    }
+  default:
+    scope_data()->add_to_work_list(start_block);
+    iterate_all_blocks();
+    break;
+  }
+  CHECK_BAILOUT();
+
+  if (sync_handler && sync_handler->state() != NULL) {
+    Value lock = NULL;
+    if (method()->is_synchronized()) {
+      lock = method()->is_static() ? new Constant(new InstanceConstant(method()->holder()->java_mirror())) :
+                                     _initial_state->local_at(0);
+
+      sync_handler->state()->unlock();
+      sync_handler->state()->lock(scope, lock);
+
+    }
+    fill_sync_handler(lock, sync_handler, true);
+  }
+
+  _start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state);
+
+  eliminate_redundant_phis(_start);
+
+  NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats());
+  // for osr compile, bailout if some requirements are not fulfilled
+  if (osr_bci != -1) {
+    BlockBegin* osr_block = blm.bci2block()->at(osr_bci);
+    assert(osr_block->is_set(BlockBegin::was_visited_flag),"osr entry must have been visited for osr compile");
+
+    // check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points
+    if (!osr_block->state()->stack_is_empty()) {
+      BAILOUT("stack not empty at OSR entry point");
+    }
+  }
+#ifndef PRODUCT
+  if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count);
+#endif
+}
+
+
+ValueStack* GraphBuilder::lock_stack() {
+  // return a new ValueStack representing just the current lock stack
+  // (for debug info at safepoints in exception throwing or handling)
+  ValueStack* new_stack = state()->copy_locks();
+  return new_stack;
+}
+
+
+int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const {
+  int recur_level = 0;
+  for (IRScope* s = scope(); s != NULL; s = s->caller()) {
+    if (s->method() == cur_callee) {
+      ++recur_level;
+    }
+  }
+  return recur_level;
+}
+
+
+bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known) {
+  // Clear out any existing inline bailout condition
+  clear_inline_bailout();
+
+  if (callee->should_exclude()) {
+    // callee is excluded
+    INLINE_BAILOUT("excluded by CompilerOracle")
+  } else if (!callee->can_be_compiled()) {
+    // callee is not compilable (prob. has breakpoints)
+    INLINE_BAILOUT("not compilable")
+  } else if (callee->intrinsic_id() != vmIntrinsics::_none && try_inline_intrinsics(callee)) {
+    // intrinsics can be native or not
+    return true;
+  } else if (callee->is_native()) {
+    // non-intrinsic natives cannot be inlined
+    INLINE_BAILOUT("non-intrinsic native")
+  } else if (callee->is_abstract()) {
+    INLINE_BAILOUT("abstract")
+  } else {
+    return try_inline_full(callee, holder_known);
+  }
+}
+
+
+bool GraphBuilder::try_inline_intrinsics(ciMethod* callee) {
+  if (!InlineNatives           ) INLINE_BAILOUT("intrinsic method inlining disabled");
+  if (callee->is_synchronized()) INLINE_BAILOUT("intrinsic method is synchronized");
+  // callee seems like a good candidate
+  // determine id
+  bool preserves_state = false;
+  bool cantrap = true;
+  vmIntrinsics::ID id = callee->intrinsic_id();
+  switch (id) {
+    case vmIntrinsics::_arraycopy     :
+      if (!InlineArrayCopy) return false;
+      break;
+
+    case vmIntrinsics::_currentTimeMillis:
+    case vmIntrinsics::_nanoTime:
+      preserves_state = true;
+      cantrap = false;
+      break;
+
+    case vmIntrinsics::_floatToRawIntBits   :
+    case vmIntrinsics::_intBitsToFloat      :
+    case vmIntrinsics::_doubleToRawLongBits :
+    case vmIntrinsics::_longBitsToDouble    :
+      if (!InlineMathNatives) return false;
+      preserves_state = true;
+      cantrap = false;
+      break;
+
+    case vmIntrinsics::_getClass      :
+      if (!InlineClassNatives) return false;
+      preserves_state = true;
+      break;
+
+    case vmIntrinsics::_currentThread :
+      if (!InlineThreadNatives) return false;
+      preserves_state = true;
+      cantrap = false;
+      break;
+
+    case vmIntrinsics::_dabs          : // fall through
+    case vmIntrinsics::_dsqrt         : // fall through
+    case vmIntrinsics::_dsin          : // fall through
+    case vmIntrinsics::_dcos          : // fall through
+    case vmIntrinsics::_dtan          : // fall through
+    case vmIntrinsics::_dlog          : // fall through
+    case vmIntrinsics::_dlog10        : // fall through
+      if (!InlineMathNatives) return false;
+      cantrap = false;
+      preserves_state = true;
+      break;
+
+    // sun/misc/AtomicLong.attemptUpdate
+    case vmIntrinsics::_attemptUpdate :
+      if (!VM_Version::supports_cx8()) return false;
+      if (!InlineAtomicLong) return false;
+      preserves_state = true;
+      break;
+
+    // Use special nodes for Unsafe instructions so we can more easily
+    // perform an address-mode optimization on the raw variants
+    case vmIntrinsics::_getObject : return append_unsafe_get_obj(callee, T_OBJECT,  false);
+    case vmIntrinsics::_getBoolean: return append_unsafe_get_obj(callee, T_BOOLEAN, false);
+    case vmIntrinsics::_getByte   : return append_unsafe_get_obj(callee, T_BYTE,    false);
+    case vmIntrinsics::_getShort  : return append_unsafe_get_obj(callee, T_SHORT,   false);
+    case vmIntrinsics::_getChar   : return append_unsafe_get_obj(callee, T_CHAR,    false);
+    case vmIntrinsics::_getInt    : return append_unsafe_get_obj(callee, T_INT,     false);
+    case vmIntrinsics::_getLong   : return append_unsafe_get_obj(callee, T_LONG,    false);
+    case vmIntrinsics::_getFloat  : return append_unsafe_get_obj(callee, T_FLOAT,   false);
+    case vmIntrinsics::_getDouble : return append_unsafe_get_obj(callee, T_DOUBLE,  false);
+
+    case vmIntrinsics::_putObject : return append_unsafe_put_obj(callee, T_OBJECT,  false);
+    case vmIntrinsics::_putBoolean: return append_unsafe_put_obj(callee, T_BOOLEAN, false);
+    case vmIntrinsics::_putByte   : return append_unsafe_put_obj(callee, T_BYTE,    false);
+    case vmIntrinsics::_putShort  : return append_unsafe_put_obj(callee, T_SHORT,   false);
+    case vmIntrinsics::_putChar   : return append_unsafe_put_obj(callee, T_CHAR,    false);
+    case vmIntrinsics::_putInt    : return append_unsafe_put_obj(callee, T_INT,     false);
+    case vmIntrinsics::_putLong   : return append_unsafe_put_obj(callee, T_LONG,    false);
+    case vmIntrinsics::_putFloat  : return append_unsafe_put_obj(callee, T_FLOAT,   false);
+    case vmIntrinsics::_putDouble : return append_unsafe_put_obj(callee, T_DOUBLE,  false);
+
+    case vmIntrinsics::_getObjectVolatile : return append_unsafe_get_obj(callee, T_OBJECT,  true);
+    case vmIntrinsics::_getBooleanVolatile: return append_unsafe_get_obj(callee, T_BOOLEAN, true);
+    case vmIntrinsics::_getByteVolatile   : return append_unsafe_get_obj(callee, T_BYTE,    true);
+    case vmIntrinsics::_getShortVolatile  : return append_unsafe_get_obj(callee, T_SHORT,   true);
+    case vmIntrinsics::_getCharVolatile   : return append_unsafe_get_obj(callee, T_CHAR,    true);
+    case vmIntrinsics::_getIntVolatile    : return append_unsafe_get_obj(callee, T_INT,     true);
+    case vmIntrinsics::_getLongVolatile   : return append_unsafe_get_obj(callee, T_LONG,    true);
+    case vmIntrinsics::_getFloatVolatile  : return append_unsafe_get_obj(callee, T_FLOAT,   true);
+    case vmIntrinsics::_getDoubleVolatile : return append_unsafe_get_obj(callee, T_DOUBLE,  true);
+
+    case vmIntrinsics::_putObjectVolatile : return append_unsafe_put_obj(callee, T_OBJECT,  true);
+    case vmIntrinsics::_putBooleanVolatile: return append_unsafe_put_obj(callee, T_BOOLEAN, true);
+    case vmIntrinsics::_putByteVolatile   : return append_unsafe_put_obj(callee, T_BYTE,    true);
+    case vmIntrinsics::_putShortVolatile  : return append_unsafe_put_obj(callee, T_SHORT,   true);
+    case vmIntrinsics::_putCharVolatile   : return append_unsafe_put_obj(callee, T_CHAR,    true);
+    case vmIntrinsics::_putIntVolatile    : return append_unsafe_put_obj(callee, T_INT,     true);
+    case vmIntrinsics::_putLongVolatile   : return append_unsafe_put_obj(callee, T_LONG,    true);
+    case vmIntrinsics::_putFloatVolatile  : return append_unsafe_put_obj(callee, T_FLOAT,   true);
+    case vmIntrinsics::_putDoubleVolatile : return append_unsafe_put_obj(callee, T_DOUBLE,  true);
+
+    case vmIntrinsics::_getByte_raw   : return append_unsafe_get_raw(callee, T_BYTE);
+    case vmIntrinsics::_getShort_raw  : return append_unsafe_get_raw(callee, T_SHORT);
+    case vmIntrinsics::_getChar_raw   : return append_unsafe_get_raw(callee, T_CHAR);
+    case vmIntrinsics::_getInt_raw    : return append_unsafe_get_raw(callee, T_INT);
+    case vmIntrinsics::_getLong_raw   : return append_unsafe_get_raw(callee, T_LONG);
+    case vmIntrinsics::_getFloat_raw  : return append_unsafe_get_raw(callee, T_FLOAT);
+    case vmIntrinsics::_getDouble_raw : return append_unsafe_get_raw(callee, T_DOUBLE);
+
+    case vmIntrinsics::_putByte_raw   : return append_unsafe_put_raw(callee, T_BYTE);
+    case vmIntrinsics::_putShort_raw  : return append_unsafe_put_raw(callee, T_SHORT);
+    case vmIntrinsics::_putChar_raw   : return append_unsafe_put_raw(callee, T_CHAR);
+    case vmIntrinsics::_putInt_raw    : return append_unsafe_put_raw(callee, T_INT);
+    case vmIntrinsics::_putLong_raw   : return append_unsafe_put_raw(callee, T_LONG);
+    case vmIntrinsics::_putFloat_raw  : return append_unsafe_put_raw(callee, T_FLOAT);
+    case vmIntrinsics::_putDouble_raw : return append_unsafe_put_raw(callee, T_DOUBLE);
+
+    case vmIntrinsics::_prefetchRead        : return append_unsafe_prefetch(callee, false, false);
+    case vmIntrinsics::_prefetchWrite       : return append_unsafe_prefetch(callee, false, true);
+    case vmIntrinsics::_prefetchReadStatic  : return append_unsafe_prefetch(callee, true,  false);
+    case vmIntrinsics::_prefetchWriteStatic : return append_unsafe_prefetch(callee, true,  true);
+
+    case vmIntrinsics::_checkIndex    :
+      if (!InlineNIOCheckIndex) return false;
+      preserves_state = true;
+      break;
+    case vmIntrinsics::_putOrderedObject : return append_unsafe_put_obj(callee, T_OBJECT,  true);
+    case vmIntrinsics::_putOrderedInt    : return append_unsafe_put_obj(callee, T_INT,     true);
+    case vmIntrinsics::_putOrderedLong   : return append_unsafe_put_obj(callee, T_LONG,    true);
+
+    case vmIntrinsics::_compareAndSwapLong:
+      if (!VM_Version::supports_cx8()) return false;
+      // fall through
+    case vmIntrinsics::_compareAndSwapInt:
+    case vmIntrinsics::_compareAndSwapObject:
+      append_unsafe_CAS(callee);
+      return true;
+
+    default                       : return false; // do not inline
+  }
+  // create intrinsic node
+  const bool has_receiver = !callee->is_static();
+  ValueType* result_type = as_ValueType(callee->return_type());
+
+  Values* args = state()->pop_arguments(callee->arg_size());
+  ValueStack* locks = lock_stack();
+  if (profile_calls()) {
+    // Don't profile in the special case where the root method
+    // is the intrinsic
+    if (callee != method()) {
+      Value recv = NULL;
+      if (has_receiver) {
+        recv = args->at(0);
+        null_check(recv);
+      }
+      profile_call(recv, NULL);
+    }
+  }
+
+  Intrinsic* result = new Intrinsic(result_type, id, args, has_receiver, lock_stack(),
+                                    preserves_state, cantrap);
+  // append instruction & push result
+  Value value = append_split(result);
+  if (result_type != voidType) push(result_type, value);
+
+#ifndef PRODUCT
+  // printing
+  if (PrintInlining) {
+    print_inline_result(callee, true);
+  }
+#endif
+
+  // done
+  return true;
+}
+
+
+bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) {
+  // Introduce a new callee continuation point - all Ret instructions
+  // will be replaced with Gotos to this point.
+  BlockBegin* cont = block_at(next_bci());
+  assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr");
+
+  // Note: can not assign state to continuation yet, as we have to
+  // pick up the state from the Ret instructions.
+
+  // Push callee scope
+  push_scope_for_jsr(cont, jsr_dest_bci);
+
+  // Temporarily set up bytecode stream so we can append instructions
+  // (only using the bci of this stream)
+  scope_data()->set_stream(scope_data()->parent()->stream());
+
+  BlockBegin* jsr_start_block = block_at(jsr_dest_bci);
+  assert(jsr_start_block != NULL, "jsr start block must exist");
+  assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet");
+  Goto* goto_sub = new Goto(jsr_start_block, false);
+  goto_sub->set_state(state());
+  // Must copy state to avoid wrong sharing when parsing bytecodes
+  assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block");
+  jsr_start_block->set_state(state()->copy());
+  append(goto_sub);
+  _block->set_end(goto_sub);
+  _last = _block = jsr_start_block;
+
+  // Clear out bytecode stream
+  scope_data()->set_stream(NULL);
+
+  scope_data()->add_to_work_list(jsr_start_block);
+
+  // Ready to resume parsing in subroutine
+  iterate_all_blocks();
+
+  // If we bailed out during parsing, return immediately (this is bad news)
+  CHECK_BAILOUT_(false);
+
+  // Detect whether the continuation can actually be reached. If not,
+  // it has not had state set by the join() operations in
+  // iterate_bytecodes_for_block()/ret() and we should not touch the
+  // iteration state. The calling activation of
+  // iterate_bytecodes_for_block will then complete normally.
+  if (cont->state() != NULL) {
+    if (!cont->is_set(BlockBegin::was_visited_flag)) {
+      // add continuation to work list instead of parsing it immediately
+      scope_data()->parent()->add_to_work_list(cont);
+    }
+  }
+
+  assert(jsr_continuation() == cont, "continuation must not have changed");
+  assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) ||
+         jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag),
+         "continuation can only be visited in case of backward branches");
+  assert(_last && _last->as_BlockEnd(), "block must have end");
+
+  // continuation is in work list, so end iteration of current block
+  _skip_block = true;
+  pop_scope_for_jsr();
+
+  return true;
+}
+
+
+// Inline the entry of a synchronized method as a monitor enter and
+// register the exception handler which releases the monitor if an
+// exception is thrown within the callee. Note that the monitor enter
+// cannot throw an exception itself, because the receiver is
+// guaranteed to be non-null by the explicit null check at the
+// beginning of inlining.
+void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) {
+  assert(lock != NULL && sync_handler != NULL, "lock or handler missing");
+
+  set_exception_state(state()->copy());
+  monitorenter(lock, SynchronizationEntryBCI);
+  assert(_last->as_MonitorEnter() != NULL, "monitor enter expected");
+  _last->set_needs_null_check(false);
+
+  sync_handler->set(BlockBegin::exception_entry_flag);
+  sync_handler->set(BlockBegin::is_on_work_list_flag);
+
+  ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0);
+  XHandler* h = new XHandler(desc);
+  h->set_entry_block(sync_handler);
+  scope_data()->xhandlers()->append(h);
+  scope_data()->set_has_handler();
+}
+
+
+// If an exception is thrown and not handled within an inlined
+// synchronized method, the monitor must be released before the
+// exception is rethrown in the outer scope. Generate the appropriate
+// instructions here.
+void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) {
+  BlockBegin* orig_block = _block;
+  ValueStack* orig_state = _state;
+  Instruction* orig_last = _last;
+  _last = _block = sync_handler;
+  _state = sync_handler->state()->copy();
+
+  assert(sync_handler != NULL, "handler missing");
+  assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here");
+
+  assert(lock != NULL || default_handler, "lock or handler missing");
+
+  XHandler* h = scope_data()->xhandlers()->remove_last();
+  assert(h->entry_block() == sync_handler, "corrupt list of handlers");
+
+  block()->set(BlockBegin::was_visited_flag);
+  Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI);
+  assert(exception->is_pinned(), "must be");
+
+  int bci = SynchronizationEntryBCI;
+  if (lock) {
+    assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing");
+    if (lock->bci() == -99) {
+      lock = append_with_bci(lock, -1);
+    }
+
+    // exit the monitor in the context of the synchronized method
+    monitorexit(lock, SynchronizationEntryBCI);
+
+    // exit the context of the synchronized method
+    if (!default_handler) {
+      pop_scope();
+      _state = _state->copy();
+      bci = _state->scope()->caller_bci();
+      _state = _state->pop_scope()->copy();
+    }
+  }
+
+  // perform the throw as if at the the call site
+  apush(exception);
+
+  set_exception_state(state()->copy());
+  throw_op(bci);
+
+  BlockEnd* end = last()->as_BlockEnd();
+  block()->set_end(end);
+  end->set_state(state());
+
+  _block = orig_block;
+  _state = orig_state;
+  _last = orig_last;
+}
+
+
+bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known) {
+  assert(!callee->is_native(), "callee must not be native");
+
+  // first perform tests of things it's not possible to inline
+  if (callee->has_exception_handlers() &&
+      !InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers");
+  if (callee->is_synchronized() &&
+      !InlineSynchronizedMethods         ) INLINE_BAILOUT("callee is synchronized");
+  if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet");
+  if (!callee->has_balanced_monitors())    INLINE_BAILOUT("callee's monitors do not match");
+
+  // Proper inlining of methods with jsrs requires a little more work.
+  if (callee->has_jsrs()                 ) INLINE_BAILOUT("jsrs not handled properly by inliner yet");
+
+  // now perform tests that are based on flag settings
+  if (inline_level() > MaxInlineLevel                         ) INLINE_BAILOUT("too-deep inlining");
+  if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("too-deep recursive inlining");
+  if (callee->code_size() > max_inline_size()                 ) INLINE_BAILOUT("callee is too large");
+
+  // don't inline throwable methods unless the inlining tree is rooted in a throwable class
+  if (callee->name() == ciSymbol::object_initializer_name() &&
+      callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) {
+    // Throwable constructor call
+    IRScope* top = scope();
+    while (top->caller() != NULL) {
+      top = top->caller();
+    }
+    if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) {
+      INLINE_BAILOUT("don't inline Throwable constructors");
+    }
+  }
+
+  // When SSE2 is used on intel, then no special handling is needed
+  // for strictfp because the enum-constant is fixed at compile time,
+  // the check for UseSSE2 is needed here
+  if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) {
+    INLINE_BAILOUT("caller and callee have different strict fp requirements");
+  }
+
+  if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) {
+    INLINE_BAILOUT("total inlining greater than DesiredMethodLimit");
+  }
+
+#ifndef PRODUCT
+      // printing
+  if (PrintInlining) {
+    print_inline_result(callee, true);
+  }
+#endif
+
+  // NOTE: Bailouts from this point on, which occur at the
+  // GraphBuilder level, do not cause bailout just of the inlining but
+  // in fact of the entire compilation.
+
+  BlockBegin* orig_block = block();
+
+  const int args_base = state()->stack_size() - callee->arg_size();
+  assert(args_base >= 0, "stack underflow during inlining");
+
+  // Insert null check if necessary
+  Value recv = NULL;
+  if (code() != Bytecodes::_invokestatic) {
+    // note: null check must happen even if first instruction of callee does
+    //       an implicit null check since the callee is in a different scope
+    //       and we must make sure exception handling does the right thing
+    assert(!callee->is_static(), "callee must not be static");
+    assert(callee->arg_size() > 0, "must have at least a receiver");
+    recv = state()->stack_at(args_base);
+    null_check(recv);
+  }
+
+  if (profile_inlined_calls()) {
+    profile_call(recv, holder_known ? callee->holder() : NULL);
+  }
+
+  profile_invocation(callee);
+
+  // Introduce a new callee continuation point - if the callee has
+  // more than one return instruction or the return does not allow
+  // fall-through of control flow, all return instructions of the
+  // callee will need to be replaced by Goto's pointing to this
+  // continuation point.
+  BlockBegin* cont = block_at(next_bci());
+  bool continuation_existed = true;
+  if (cont == NULL) {
+    cont = new BlockBegin(next_bci());
+    // low number so that continuation gets parsed as early as possible
+    cont->set_depth_first_number(0);
+#ifndef PRODUCT
+    if (PrintInitialBlockList) {
+      tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d",
+                    cont->block_id(), cont->bci(), bci());
+    }
+#endif
+    continuation_existed = false;
+  }
+  // Record number of predecessors of continuation block before
+  // inlining, to detect if inlined method has edges to its
+  // continuation after inlining.
+  int continuation_preds = cont->number_of_preds();
+
+  // Push callee scope
+  push_scope(callee, cont);
+
+  // the BlockListBuilder for the callee could have bailed out
+  CHECK_BAILOUT_(false);
+
+  // Temporarily set up bytecode stream so we can append instructions
+  // (only using the bci of this stream)
+  scope_data()->set_stream(scope_data()->parent()->stream());
+
+  // Pass parameters into callee state: add assignments
+  // note: this will also ensure that all arguments are computed before being passed
+  ValueStack* callee_state = state();
+  ValueStack* caller_state = scope()->caller_state();
+  { int i = args_base;
+    while (i < caller_state->stack_size()) {
+      const int par_no = i - args_base;
+      Value  arg = caller_state->stack_at_inc(i);
+      // NOTE: take base() of arg->type() to avoid problems storing
+      // constants
+      store_local(callee_state, arg, arg->type()->base(), par_no);
+    }
+  }
+
+  // Remove args from stack.
+  // Note that we preserve locals state in case we can use it later
+  // (see use of pop_scope() below)
+  caller_state->truncate_stack(args_base);
+  callee_state->truncate_stack(args_base);
+
+  // Setup state that is used at returns form the inlined method.
+  // This is essentially the state of the continuation block,
+  // but without the return value on stack, if any, this will
+  // be pushed at the return instruction (see method_return).
+  scope_data()->set_continuation_state(caller_state->copy());
+
+  // Compute lock stack size for callee scope now that args have been passed
+  scope()->compute_lock_stack_size();
+
+  Value lock;
+  BlockBegin* sync_handler;
+
+  // Inline the locking of the receiver if the callee is synchronized
+  if (callee->is_synchronized()) {
+    lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror())))
+                               : state()->local_at(0);
+    sync_handler = new BlockBegin(-1);
+    inline_sync_entry(lock, sync_handler);
+
+    // recompute the lock stack size
+    scope()->compute_lock_stack_size();
+  }
+
+
+  BlockBegin* callee_start_block = block_at(0);
+  if (callee_start_block != NULL) {
+    assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header");
+    Goto* goto_callee = new Goto(callee_start_block, false);
+    goto_callee->set_state(state());
+    // The state for this goto is in the scope of the callee, so use
+    // the entry bci for the callee instead of the call site bci.
+    append_with_bci(goto_callee, 0);
+    _block->set_end(goto_callee);
+    callee_start_block->merge(callee_state);
+
+    _last = _block = callee_start_block;
+
+    scope_data()->add_to_work_list(callee_start_block);
+  }
+
+  // Clear out bytecode stream
+  scope_data()->set_stream(NULL);
+
+  // Ready to resume parsing in callee (either in the same block we
+  // were in before or in the callee's start block)
+  iterate_all_blocks(callee_start_block == NULL);
+
+  // If we bailed out during parsing, return immediately (this is bad news)
+  if (bailed_out()) return false;
+
+  // iterate_all_blocks theoretically traverses in random order; in
+  // practice, we have only traversed the continuation if we are
+  // inlining into a subroutine
+  assert(continuation_existed ||
+         !continuation()->is_set(BlockBegin::was_visited_flag),
+         "continuation should not have been parsed yet if we created it");
+
+  // If we bailed out during parsing, return immediately (this is bad news)
+  CHECK_BAILOUT_(false);
+
+  // At this point we are almost ready to return and resume parsing of
+  // the caller back in the GraphBuilder. The only thing we want to do
+  // first is an optimization: during parsing of the callee we
+  // generated at least one Goto to the continuation block. If we
+  // generated exactly one, and if the inlined method spanned exactly
+  // one block (and we didn't have to Goto its entry), then we snip
+  // off the Goto to the continuation, allowing control to fall
+  // through back into the caller block and effectively performing
+  // block merging. This allows load elimination and CSE to take place
+  // across multiple callee scopes if they are relatively simple, and
+  // is currently essential to making inlining profitable.
+  if (   num_returns() == 1
+      && block() == orig_block
+      && block() == inline_cleanup_block()) {
+    _last = inline_cleanup_return_prev();
+    _state = inline_cleanup_state()->pop_scope();
+  } else if (continuation_preds == cont->number_of_preds()) {
+    // Inlining caused that the instructions after the invoke in the
+    // caller are not reachable any more. So skip filling this block
+    // with instructions!
+    assert (cont == continuation(), "");
+    assert(_last && _last->as_BlockEnd(), "");
+    _skip_block = true;
+  } else {
+    // Resume parsing in continuation block unless it was already parsed.
+    // Note that if we don't change _last here, iteration in
+    // iterate_bytecodes_for_block will stop when we return.
+    if (!continuation()->is_set(BlockBegin::was_visited_flag)) {
+      // add continuation to work list instead of parsing it immediately
+      assert(_last && _last->as_BlockEnd(), "");
+      scope_data()->parent()->add_to_work_list(continuation());
+      _skip_block = true;
+    }
+  }
+
+  // Fill the exception handler for synchronized methods with instructions
+  if (callee->is_synchronized() && sync_handler->state() != NULL) {
+    fill_sync_handler(lock, sync_handler);
+  } else {
+    pop_scope();
+  }
+
+  compilation()->notice_inlined_method(callee);
+
+  return true;
+}
+
+
+void GraphBuilder::inline_bailout(const char* msg) {
+  assert(msg != NULL, "inline bailout msg must exist");
+  _inline_bailout_msg = msg;
+}
+
+
+void GraphBuilder::clear_inline_bailout() {
+  _inline_bailout_msg = NULL;
+}
+
+
+void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) {
+  ScopeData* data = new ScopeData(NULL);
+  data->set_scope(scope);
+  data->set_bci2block(bci2block);
+  _scope_data = data;
+  _block = start;
+}
+
+
+void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) {
+  IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false);
+  scope()->add_callee(callee_scope);
+
+  BlockListBuilder blb(compilation(), callee_scope, -1);
+  CHECK_BAILOUT();
+
+  if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) {
+    // this scope can be inlined directly into the caller so remove
+    // the block at bci 0.
+    blb.bci2block()->at_put(0, NULL);
+  }
+
+  callee_scope->set_caller_state(state());
+  set_state(state()->push_scope(callee_scope));
+
+  ScopeData* data = new ScopeData(scope_data());
+  data->set_scope(callee_scope);
+  data->set_bci2block(blb.bci2block());
+  data->set_continuation(continuation);
+  _scope_data = data;
+}
+
+
+void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) {
+  ScopeData* data = new ScopeData(scope_data());
+  data->set_parsing_jsr();
+  data->set_jsr_entry_bci(jsr_dest_bci);
+  data->set_jsr_return_address_local(-1);
+  // Must clone bci2block list as we will be mutating it in order to
+  // properly clone all blocks in jsr region as well as exception
+  // handlers containing rets
+  BlockList* new_bci2block = new BlockList(bci2block()->length());
+  new_bci2block->push_all(bci2block());
+  data->set_bci2block(new_bci2block);
+  data->set_scope(scope());
+  data->setup_jsr_xhandlers();
+  data->set_continuation(continuation());
+  if (continuation() != NULL) {
+    assert(continuation_state() != NULL, "");
+    data->set_continuation_state(continuation_state()->copy());
+  }
+  data->set_jsr_continuation(jsr_continuation);
+  _scope_data = data;
+}
+
+
+void GraphBuilder::pop_scope() {
+  int number_of_locks = scope()->number_of_locks();
+  _scope_data = scope_data()->parent();
+  // accumulate minimum number of monitor slots to be reserved
+  scope()->set_min_number_of_locks(number_of_locks);
+}
+
+
+void GraphBuilder::pop_scope_for_jsr() {
+  _scope_data = scope_data()->parent();
+}
+
+bool GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) {
+  if (InlineUnsafeOps) {
+    Values* args = state()->pop_arguments(callee->arg_size());
+    null_check(args->at(0));
+    Instruction* offset = args->at(2);
+#ifndef _LP64
+    offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
+#endif
+    Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile));
+    push(op->type(), op);
+    compilation()->set_has_unsafe_access(true);
+  }
+  return InlineUnsafeOps;
+}
+
+
+bool GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) {
+  if (InlineUnsafeOps) {
+    Values* args = state()->pop_arguments(callee->arg_size());
+    null_check(args->at(0));
+    Instruction* offset = args->at(2);
+#ifndef _LP64
+    offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
+#endif
+    Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, args->at(3), is_volatile));
+    compilation()->set_has_unsafe_access(true);
+    kill_all();
+  }
+  return InlineUnsafeOps;
+}
+
+
+bool GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) {
+  if (InlineUnsafeOps) {
+    Values* args = state()->pop_arguments(callee->arg_size());
+    null_check(args->at(0));
+    Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false));
+    push(op->type(), op);
+    compilation()->set_has_unsafe_access(true);
+  }
+  return InlineUnsafeOps;
+}
+
+
+bool GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) {
+  if (InlineUnsafeOps) {
+    Values* args = state()->pop_arguments(callee->arg_size());
+    null_check(args->at(0));
+    Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2)));
+    compilation()->set_has_unsafe_access(true);
+  }
+  return InlineUnsafeOps;
+}
+
+
+bool GraphBuilder::append_unsafe_prefetch(ciMethod* callee, bool is_static, bool is_store) {
+  if (InlineUnsafeOps) {
+    Values* args = state()->pop_arguments(callee->arg_size());
+    int obj_arg_index = 1; // Assume non-static case
+    if (is_static) {
+      obj_arg_index = 0;
+    } else {
+      null_check(args->at(0));
+    }
+    Instruction* offset = args->at(obj_arg_index + 1);
+#ifndef _LP64
+    offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
+#endif
+    Instruction* op = is_store ? append(new UnsafePrefetchWrite(args->at(obj_arg_index), offset))
+                               : append(new UnsafePrefetchRead (args->at(obj_arg_index), offset));
+    compilation()->set_has_unsafe_access(true);
+  }
+  return InlineUnsafeOps;
+}
+
+
+void GraphBuilder::append_unsafe_CAS(ciMethod* callee) {
+  ValueType* result_type = as_ValueType(callee->return_type());
+  assert(result_type->is_int(), "int result");
+  Values* args = state()->pop_arguments(callee->arg_size());
+
+  // Pop off some args to speically handle, then push back
+  Value newval = args->pop();
+  Value cmpval = args->pop();
+  Value offset = args->pop();
+  Value src = args->pop();
+  Value unsafe_obj = args->pop();
+
+  // Separately handle the unsafe arg. It is not needed for code
+  // generation, but must be null checked
+  null_check(unsafe_obj);
+
+#ifndef _LP64
+  offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
+#endif
+
+  args->push(src);
+  args->push(offset);
+  args->push(cmpval);
+  args->push(newval);
+
+  // An unsafe CAS can alias with other field accesses, but we don't
+  // know which ones so mark the state as no preserved.  This will
+  // cause CSE to invalidate memory across it.
+  bool preserves_state = false;
+  Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, lock_stack(), preserves_state);
+  append_split(result);
+  push(result_type, result);
+  compilation()->set_has_unsafe_access(true);
+}
+
+
+#ifndef PRODUCT
+void GraphBuilder::print_inline_result(ciMethod* callee, bool res) {
+  const char sync_char      = callee->is_synchronized()        ? 's' : ' ';
+  const char exception_char = callee->has_exception_handlers() ? '!' : ' ';
+  const char monitors_char  = callee->has_monitor_bytecodes()  ? 'm' : ' ';
+  tty->print("     %c%c%c ", sync_char, exception_char, monitors_char);
+  for (int i = 0; i < scope()->level(); i++) tty->print("  ");
+  if (res) {
+    tty->print("  ");
+  } else {
+    tty->print("- ");
+  }
+  tty->print("@ %d  ", bci());
+  callee->print_short_name();
+  tty->print(" (%d bytes)", callee->code_size());
+  if (_inline_bailout_msg) {
+    tty->print("  %s", _inline_bailout_msg);
+  }
+  tty->cr();
+
+  if (res && CIPrintMethodCodes) {
+    callee->print_codes();
+  }
+}
+
+
+void GraphBuilder::print_stats() {
+  vmap()->print();
+}
+#endif // PRODUCT
+
+
+void GraphBuilder::profile_call(Value recv, ciKlass* known_holder) {
+  append(new ProfileCall(method(), bci(), recv, known_holder));
+}
+
+
+void GraphBuilder::profile_invocation(ciMethod* callee) {
+  if (profile_calls()) {
+    // increment the interpreter_invocation_count for the inlinee
+    Value m = append(new Constant(new ObjectConstant(callee)));
+    append(new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1));
+  }
+}
+
+
+void GraphBuilder::profile_bci(int bci) {
+  if (profile_branches()) {
+    ciMethodData* md = method()->method_data();
+    if (md == NULL) {
+      BAILOUT("out of memory building methodDataOop");
+    }
+    ciProfileData* data = md->bci_to_data(bci);
+    assert(data != NULL && data->is_JumpData(), "need JumpData for goto");
+    Value mdo = append(new Constant(new ObjectConstant(md)));
+    append(new ProfileCounter(mdo, md->byte_offset_of_slot(data, JumpData::taken_offset()), 1));
+  }
+}