0
|
1 /*
|
|
2 * Copyright 1999-2007 Sun Microsystems, Inc. All Rights Reserved.
|
|
3 * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER.
|
|
4 *
|
|
5 * This code is free software; you can redistribute it and/or modify it
|
|
6 * under the terms of the GNU General Public License version 2 only, as
|
|
7 * published by the Free Software Foundation.
|
|
8 *
|
|
9 * This code is distributed in the hope that it will be useful, but WITHOUT
|
|
10 * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
|
|
11 * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
|
|
12 * version 2 for more details (a copy is included in the LICENSE file that
|
|
13 * accompanied this code).
|
|
14 *
|
|
15 * You should have received a copy of the GNU General Public License version
|
|
16 * 2 along with this work; if not, write to the Free Software Foundation,
|
|
17 * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA.
|
|
18 *
|
|
19 * Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara,
|
|
20 * CA 95054 USA or visit www.sun.com if you need additional information or
|
|
21 * have any questions.
|
|
22 *
|
|
23 */
|
|
24
|
|
25 #include "incls/_precompiled.incl"
|
|
26 #include "incls/_c1_GraphBuilder.cpp.incl"
|
|
27
|
|
28 class BlockListBuilder VALUE_OBJ_CLASS_SPEC {
|
|
29 private:
|
|
30 Compilation* _compilation;
|
|
31 IRScope* _scope;
|
|
32
|
|
33 BlockList _blocks; // internal list of all blocks
|
|
34 BlockList* _bci2block; // mapping from bci to blocks for GraphBuilder
|
|
35
|
|
36 // fields used by mark_loops
|
|
37 BitMap _active; // for iteration of control flow graph
|
|
38 BitMap _visited; // for iteration of control flow graph
|
|
39 intArray _loop_map; // caches the information if a block is contained in a loop
|
|
40 int _next_loop_index; // next free loop number
|
|
41 int _next_block_number; // for reverse postorder numbering of blocks
|
|
42
|
|
43 // accessors
|
|
44 Compilation* compilation() const { return _compilation; }
|
|
45 IRScope* scope() const { return _scope; }
|
|
46 ciMethod* method() const { return scope()->method(); }
|
|
47 XHandlers* xhandlers() const { return scope()->xhandlers(); }
|
|
48
|
|
49 // unified bailout support
|
|
50 void bailout(const char* msg) const { compilation()->bailout(msg); }
|
|
51 bool bailed_out() const { return compilation()->bailed_out(); }
|
|
52
|
|
53 // helper functions
|
|
54 BlockBegin* make_block_at(int bci, BlockBegin* predecessor);
|
|
55 void handle_exceptions(BlockBegin* current, int cur_bci);
|
|
56 void handle_jsr(BlockBegin* current, int sr_bci, int next_bci);
|
|
57 void store_one(BlockBegin* current, int local);
|
|
58 void store_two(BlockBegin* current, int local);
|
|
59 void set_entries(int osr_bci);
|
|
60 void set_leaders();
|
|
61
|
|
62 void make_loop_header(BlockBegin* block);
|
|
63 void mark_loops();
|
|
64 int mark_loops(BlockBegin* b, bool in_subroutine);
|
|
65
|
|
66 // debugging
|
|
67 #ifndef PRODUCT
|
|
68 void print();
|
|
69 #endif
|
|
70
|
|
71 public:
|
|
72 // creation
|
|
73 BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci);
|
|
74
|
|
75 // accessors for GraphBuilder
|
|
76 BlockList* bci2block() const { return _bci2block; }
|
|
77 };
|
|
78
|
|
79
|
|
80 // Implementation of BlockListBuilder
|
|
81
|
|
82 BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci)
|
|
83 : _compilation(compilation)
|
|
84 , _scope(scope)
|
|
85 , _blocks(16)
|
|
86 , _bci2block(new BlockList(scope->method()->code_size(), NULL))
|
|
87 , _next_block_number(0)
|
|
88 , _active() // size not known yet
|
|
89 , _visited() // size not known yet
|
|
90 , _next_loop_index(0)
|
|
91 , _loop_map() // size not known yet
|
|
92 {
|
|
93 set_entries(osr_bci);
|
|
94 set_leaders();
|
|
95 CHECK_BAILOUT();
|
|
96
|
|
97 mark_loops();
|
|
98 NOT_PRODUCT(if (PrintInitialBlockList) print());
|
|
99
|
|
100 #ifndef PRODUCT
|
|
101 if (PrintCFGToFile) {
|
|
102 stringStream title;
|
|
103 title.print("BlockListBuilder ");
|
|
104 scope->method()->print_name(&title);
|
|
105 CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false);
|
|
106 }
|
|
107 #endif
|
|
108 }
|
|
109
|
|
110
|
|
111 void BlockListBuilder::set_entries(int osr_bci) {
|
|
112 // generate start blocks
|
|
113 BlockBegin* std_entry = make_block_at(0, NULL);
|
|
114 if (scope()->caller() == NULL) {
|
|
115 std_entry->set(BlockBegin::std_entry_flag);
|
|
116 }
|
|
117 if (osr_bci != -1) {
|
|
118 BlockBegin* osr_entry = make_block_at(osr_bci, NULL);
|
|
119 osr_entry->set(BlockBegin::osr_entry_flag);
|
|
120 }
|
|
121
|
|
122 // generate exception entry blocks
|
|
123 XHandlers* list = xhandlers();
|
|
124 const int n = list->length();
|
|
125 for (int i = 0; i < n; i++) {
|
|
126 XHandler* h = list->handler_at(i);
|
|
127 BlockBegin* entry = make_block_at(h->handler_bci(), NULL);
|
|
128 entry->set(BlockBegin::exception_entry_flag);
|
|
129 h->set_entry_block(entry);
|
|
130 }
|
|
131 }
|
|
132
|
|
133
|
|
134 BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) {
|
|
135 assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer");
|
|
136
|
|
137 BlockBegin* block = _bci2block->at(cur_bci);
|
|
138 if (block == NULL) {
|
|
139 block = new BlockBegin(cur_bci);
|
|
140 block->init_stores_to_locals(method()->max_locals());
|
|
141 _bci2block->at_put(cur_bci, block);
|
|
142 _blocks.append(block);
|
|
143
|
|
144 assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist");
|
|
145 }
|
|
146
|
|
147 if (predecessor != NULL) {
|
|
148 if (block->is_set(BlockBegin::exception_entry_flag)) {
|
|
149 BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block);
|
|
150 }
|
|
151
|
|
152 predecessor->add_successor(block);
|
|
153 block->increment_total_preds();
|
|
154 }
|
|
155
|
|
156 return block;
|
|
157 }
|
|
158
|
|
159
|
|
160 inline void BlockListBuilder::store_one(BlockBegin* current, int local) {
|
|
161 current->stores_to_locals().set_bit(local);
|
|
162 }
|
|
163 inline void BlockListBuilder::store_two(BlockBegin* current, int local) {
|
|
164 store_one(current, local);
|
|
165 store_one(current, local + 1);
|
|
166 }
|
|
167
|
|
168
|
|
169 void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) {
|
|
170 // Draws edges from a block to its exception handlers
|
|
171 XHandlers* list = xhandlers();
|
|
172 const int n = list->length();
|
|
173
|
|
174 for (int i = 0; i < n; i++) {
|
|
175 XHandler* h = list->handler_at(i);
|
|
176
|
|
177 if (h->covers(cur_bci)) {
|
|
178 BlockBegin* entry = h->entry_block();
|
|
179 assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set");
|
|
180 assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set");
|
|
181
|
|
182 // add each exception handler only once
|
|
183 if (!current->is_successor(entry)) {
|
|
184 current->add_successor(entry);
|
|
185 entry->increment_total_preds();
|
|
186 }
|
|
187
|
|
188 // stop when reaching catchall
|
|
189 if (h->catch_type() == 0) break;
|
|
190 }
|
|
191 }
|
|
192 }
|
|
193
|
|
194 void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) {
|
|
195 // start a new block after jsr-bytecode and link this block into cfg
|
|
196 make_block_at(next_bci, current);
|
|
197
|
|
198 // start a new block at the subroutine entry at mark it with special flag
|
|
199 BlockBegin* sr_block = make_block_at(sr_bci, current);
|
|
200 if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) {
|
|
201 sr_block->set(BlockBegin::subroutine_entry_flag);
|
|
202 }
|
|
203 }
|
|
204
|
|
205
|
|
206 void BlockListBuilder::set_leaders() {
|
|
207 bool has_xhandlers = xhandlers()->has_handlers();
|
|
208 BlockBegin* current = NULL;
|
|
209
|
|
210 // The information which bci starts a new block simplifies the analysis
|
|
211 // Without it, backward branches could jump to a bci where no block was created
|
|
212 // during bytecode iteration. This would require the creation of a new block at the
|
|
213 // branch target and a modification of the successor lists.
|
|
214 BitMap bci_block_start = method()->bci_block_start();
|
|
215
|
|
216 ciBytecodeStream s(method());
|
|
217 while (s.next() != ciBytecodeStream::EOBC()) {
|
|
218 int cur_bci = s.cur_bci();
|
|
219
|
|
220 if (bci_block_start.at(cur_bci)) {
|
|
221 current = make_block_at(cur_bci, current);
|
|
222 }
|
|
223 assert(current != NULL, "must have current block");
|
|
224
|
|
225 if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) {
|
|
226 handle_exceptions(current, cur_bci);
|
|
227 }
|
|
228
|
|
229 switch (s.cur_bc()) {
|
|
230 // track stores to local variables for selective creation of phi functions
|
|
231 case Bytecodes::_iinc: store_one(current, s.get_index()); break;
|
|
232 case Bytecodes::_istore: store_one(current, s.get_index()); break;
|
|
233 case Bytecodes::_lstore: store_two(current, s.get_index()); break;
|
|
234 case Bytecodes::_fstore: store_one(current, s.get_index()); break;
|
|
235 case Bytecodes::_dstore: store_two(current, s.get_index()); break;
|
|
236 case Bytecodes::_astore: store_one(current, s.get_index()); break;
|
|
237 case Bytecodes::_istore_0: store_one(current, 0); break;
|
|
238 case Bytecodes::_istore_1: store_one(current, 1); break;
|
|
239 case Bytecodes::_istore_2: store_one(current, 2); break;
|
|
240 case Bytecodes::_istore_3: store_one(current, 3); break;
|
|
241 case Bytecodes::_lstore_0: store_two(current, 0); break;
|
|
242 case Bytecodes::_lstore_1: store_two(current, 1); break;
|
|
243 case Bytecodes::_lstore_2: store_two(current, 2); break;
|
|
244 case Bytecodes::_lstore_3: store_two(current, 3); break;
|
|
245 case Bytecodes::_fstore_0: store_one(current, 0); break;
|
|
246 case Bytecodes::_fstore_1: store_one(current, 1); break;
|
|
247 case Bytecodes::_fstore_2: store_one(current, 2); break;
|
|
248 case Bytecodes::_fstore_3: store_one(current, 3); break;
|
|
249 case Bytecodes::_dstore_0: store_two(current, 0); break;
|
|
250 case Bytecodes::_dstore_1: store_two(current, 1); break;
|
|
251 case Bytecodes::_dstore_2: store_two(current, 2); break;
|
|
252 case Bytecodes::_dstore_3: store_two(current, 3); break;
|
|
253 case Bytecodes::_astore_0: store_one(current, 0); break;
|
|
254 case Bytecodes::_astore_1: store_one(current, 1); break;
|
|
255 case Bytecodes::_astore_2: store_one(current, 2); break;
|
|
256 case Bytecodes::_astore_3: store_one(current, 3); break;
|
|
257
|
|
258 // track bytecodes that affect the control flow
|
|
259 case Bytecodes::_athrow: // fall through
|
|
260 case Bytecodes::_ret: // fall through
|
|
261 case Bytecodes::_ireturn: // fall through
|
|
262 case Bytecodes::_lreturn: // fall through
|
|
263 case Bytecodes::_freturn: // fall through
|
|
264 case Bytecodes::_dreturn: // fall through
|
|
265 case Bytecodes::_areturn: // fall through
|
|
266 case Bytecodes::_return:
|
|
267 current = NULL;
|
|
268 break;
|
|
269
|
|
270 case Bytecodes::_ifeq: // fall through
|
|
271 case Bytecodes::_ifne: // fall through
|
|
272 case Bytecodes::_iflt: // fall through
|
|
273 case Bytecodes::_ifge: // fall through
|
|
274 case Bytecodes::_ifgt: // fall through
|
|
275 case Bytecodes::_ifle: // fall through
|
|
276 case Bytecodes::_if_icmpeq: // fall through
|
|
277 case Bytecodes::_if_icmpne: // fall through
|
|
278 case Bytecodes::_if_icmplt: // fall through
|
|
279 case Bytecodes::_if_icmpge: // fall through
|
|
280 case Bytecodes::_if_icmpgt: // fall through
|
|
281 case Bytecodes::_if_icmple: // fall through
|
|
282 case Bytecodes::_if_acmpeq: // fall through
|
|
283 case Bytecodes::_if_acmpne: // fall through
|
|
284 case Bytecodes::_ifnull: // fall through
|
|
285 case Bytecodes::_ifnonnull:
|
|
286 make_block_at(s.next_bci(), current);
|
|
287 make_block_at(s.get_dest(), current);
|
|
288 current = NULL;
|
|
289 break;
|
|
290
|
|
291 case Bytecodes::_goto:
|
|
292 make_block_at(s.get_dest(), current);
|
|
293 current = NULL;
|
|
294 break;
|
|
295
|
|
296 case Bytecodes::_goto_w:
|
|
297 make_block_at(s.get_far_dest(), current);
|
|
298 current = NULL;
|
|
299 break;
|
|
300
|
|
301 case Bytecodes::_jsr:
|
|
302 handle_jsr(current, s.get_dest(), s.next_bci());
|
|
303 current = NULL;
|
|
304 break;
|
|
305
|
|
306 case Bytecodes::_jsr_w:
|
|
307 handle_jsr(current, s.get_far_dest(), s.next_bci());
|
|
308 current = NULL;
|
|
309 break;
|
|
310
|
|
311 case Bytecodes::_tableswitch: {
|
|
312 // set block for each case
|
|
313 Bytecode_tableswitch *switch_ = Bytecode_tableswitch_at(s.cur_bcp());
|
|
314 int l = switch_->length();
|
|
315 for (int i = 0; i < l; i++) {
|
|
316 make_block_at(cur_bci + switch_->dest_offset_at(i), current);
|
|
317 }
|
|
318 make_block_at(cur_bci + switch_->default_offset(), current);
|
|
319 current = NULL;
|
|
320 break;
|
|
321 }
|
|
322
|
|
323 case Bytecodes::_lookupswitch: {
|
|
324 // set block for each case
|
|
325 Bytecode_lookupswitch *switch_ = Bytecode_lookupswitch_at(s.cur_bcp());
|
|
326 int l = switch_->number_of_pairs();
|
|
327 for (int i = 0; i < l; i++) {
|
|
328 make_block_at(cur_bci + switch_->pair_at(i)->offset(), current);
|
|
329 }
|
|
330 make_block_at(cur_bci + switch_->default_offset(), current);
|
|
331 current = NULL;
|
|
332 break;
|
|
333 }
|
|
334 }
|
|
335 }
|
|
336 }
|
|
337
|
|
338
|
|
339 void BlockListBuilder::mark_loops() {
|
|
340 ResourceMark rm;
|
|
341
|
|
342 _active = BitMap(BlockBegin::number_of_blocks()); _active.clear();
|
|
343 _visited = BitMap(BlockBegin::number_of_blocks()); _visited.clear();
|
|
344 _loop_map = intArray(BlockBegin::number_of_blocks(), 0);
|
|
345 _next_loop_index = 0;
|
|
346 _next_block_number = _blocks.length();
|
|
347
|
|
348 // recursively iterate the control flow graph
|
|
349 mark_loops(_bci2block->at(0), false);
|
|
350 assert(_next_block_number >= 0, "invalid block numbers");
|
|
351 }
|
|
352
|
|
353 void BlockListBuilder::make_loop_header(BlockBegin* block) {
|
|
354 if (block->is_set(BlockBegin::exception_entry_flag)) {
|
|
355 // exception edges may look like loops but don't mark them as such
|
|
356 // since it screws up block ordering.
|
|
357 return;
|
|
358 }
|
|
359 if (!block->is_set(BlockBegin::parser_loop_header_flag)) {
|
|
360 block->set(BlockBegin::parser_loop_header_flag);
|
|
361
|
|
362 assert(_loop_map.at(block->block_id()) == 0, "must not be set yet");
|
|
363 assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer");
|
|
364 _loop_map.at_put(block->block_id(), 1 << _next_loop_index);
|
|
365 if (_next_loop_index < 31) _next_loop_index++;
|
|
366 } else {
|
|
367 // block already marked as loop header
|
|
368 assert(is_power_of_2(_loop_map.at(block->block_id())), "exactly one bit must be set");
|
|
369 }
|
|
370 }
|
|
371
|
|
372 int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) {
|
|
373 int block_id = block->block_id();
|
|
374
|
|
375 if (_visited.at(block_id)) {
|
|
376 if (_active.at(block_id)) {
|
|
377 // reached block via backward branch
|
|
378 make_loop_header(block);
|
|
379 }
|
|
380 // return cached loop information for this block
|
|
381 return _loop_map.at(block_id);
|
|
382 }
|
|
383
|
|
384 if (block->is_set(BlockBegin::subroutine_entry_flag)) {
|
|
385 in_subroutine = true;
|
|
386 }
|
|
387
|
|
388 // set active and visited bits before successors are processed
|
|
389 _visited.set_bit(block_id);
|
|
390 _active.set_bit(block_id);
|
|
391
|
|
392 intptr_t loop_state = 0;
|
|
393 for (int i = block->number_of_sux() - 1; i >= 0; i--) {
|
|
394 // recursively process all successors
|
|
395 loop_state |= mark_loops(block->sux_at(i), in_subroutine);
|
|
396 }
|
|
397
|
|
398 // clear active-bit after all successors are processed
|
|
399 _active.clear_bit(block_id);
|
|
400
|
|
401 // reverse-post-order numbering of all blocks
|
|
402 block->set_depth_first_number(_next_block_number);
|
|
403 _next_block_number--;
|
|
404
|
|
405 if (loop_state != 0 || in_subroutine ) {
|
|
406 // block is contained at least in one loop, so phi functions are necessary
|
|
407 // phi functions are also necessary for all locals stored in a subroutine
|
|
408 scope()->requires_phi_function().set_union(block->stores_to_locals());
|
|
409 }
|
|
410
|
|
411 if (block->is_set(BlockBegin::parser_loop_header_flag)) {
|
|
412 int header_loop_state = _loop_map.at(block_id);
|
|
413 assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set");
|
|
414
|
|
415 // If the highest bit is set (i.e. when integer value is negative), the method
|
|
416 // has 32 or more loops. This bit is never cleared because it is used for multiple loops
|
|
417 if (header_loop_state >= 0) {
|
|
418 clear_bits(loop_state, header_loop_state);
|
|
419 }
|
|
420 }
|
|
421
|
|
422 // cache and return loop information for this block
|
|
423 _loop_map.at_put(block_id, loop_state);
|
|
424 return loop_state;
|
|
425 }
|
|
426
|
|
427
|
|
428 #ifndef PRODUCT
|
|
429
|
|
430 int compare_depth_first(BlockBegin** a, BlockBegin** b) {
|
|
431 return (*a)->depth_first_number() - (*b)->depth_first_number();
|
|
432 }
|
|
433
|
|
434 void BlockListBuilder::print() {
|
|
435 tty->print("----- initial block list of BlockListBuilder for method ");
|
|
436 method()->print_short_name();
|
|
437 tty->cr();
|
|
438
|
|
439 // better readability if blocks are sorted in processing order
|
|
440 _blocks.sort(compare_depth_first);
|
|
441
|
|
442 for (int i = 0; i < _blocks.length(); i++) {
|
|
443 BlockBegin* cur = _blocks.at(i);
|
|
444 tty->print("%4d: B%-4d bci: %-4d preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds());
|
|
445
|
|
446 tty->print(cur->is_set(BlockBegin::std_entry_flag) ? " std" : " ");
|
|
447 tty->print(cur->is_set(BlockBegin::osr_entry_flag) ? " osr" : " ");
|
|
448 tty->print(cur->is_set(BlockBegin::exception_entry_flag) ? " ex" : " ");
|
|
449 tty->print(cur->is_set(BlockBegin::subroutine_entry_flag) ? " sr" : " ");
|
|
450 tty->print(cur->is_set(BlockBegin::parser_loop_header_flag) ? " lh" : " ");
|
|
451
|
|
452 if (cur->number_of_sux() > 0) {
|
|
453 tty->print(" sux: ");
|
|
454 for (int j = 0; j < cur->number_of_sux(); j++) {
|
|
455 BlockBegin* sux = cur->sux_at(j);
|
|
456 tty->print("B%d ", sux->block_id());
|
|
457 }
|
|
458 }
|
|
459 tty->cr();
|
|
460 }
|
|
461 }
|
|
462
|
|
463 #endif
|
|
464
|
|
465
|
|
466 // A simple growable array of Values indexed by ciFields
|
|
467 class FieldBuffer: public CompilationResourceObj {
|
|
468 private:
|
|
469 GrowableArray<Value> _values;
|
|
470
|
|
471 public:
|
|
472 FieldBuffer() {}
|
|
473
|
|
474 void kill() {
|
|
475 _values.trunc_to(0);
|
|
476 }
|
|
477
|
|
478 Value at(ciField* field) {
|
|
479 assert(field->holder()->is_loaded(), "must be a loaded field");
|
|
480 int offset = field->offset();
|
|
481 if (offset < _values.length()) {
|
|
482 return _values.at(offset);
|
|
483 } else {
|
|
484 return NULL;
|
|
485 }
|
|
486 }
|
|
487
|
|
488 void at_put(ciField* field, Value value) {
|
|
489 assert(field->holder()->is_loaded(), "must be a loaded field");
|
|
490 int offset = field->offset();
|
|
491 _values.at_put_grow(offset, value, NULL);
|
|
492 }
|
|
493
|
|
494 };
|
|
495
|
|
496
|
|
497 // MemoryBuffer is fairly simple model of the current state of memory.
|
|
498 // It partitions memory into several pieces. The first piece is
|
|
499 // generic memory where little is known about the owner of the memory.
|
|
500 // This is conceptually represented by the tuple <O, F, V> which says
|
|
501 // that the field F of object O has value V. This is flattened so
|
|
502 // that F is represented by the offset of the field and the parallel
|
|
503 // arrays _objects and _values are used for O and V. Loads of O.F can
|
|
504 // simply use V. Newly allocated objects are kept in a separate list
|
|
505 // along with a parallel array for each object which represents the
|
|
506 // current value of its fields. Stores of the default value to fields
|
|
507 // which have never been stored to before are eliminated since they
|
|
508 // are redundant. Once newly allocated objects are stored into
|
|
509 // another object or they are passed out of the current compile they
|
|
510 // are treated like generic memory.
|
|
511
|
|
512 class MemoryBuffer: public CompilationResourceObj {
|
|
513 private:
|
|
514 FieldBuffer _values;
|
|
515 GrowableArray<Value> _objects;
|
|
516 GrowableArray<Value> _newobjects;
|
|
517 GrowableArray<FieldBuffer*> _fields;
|
|
518
|
|
519 public:
|
|
520 MemoryBuffer() {}
|
|
521
|
|
522 StoreField* store(StoreField* st) {
|
|
523 if (!EliminateFieldAccess) {
|
|
524 return st;
|
|
525 }
|
|
526
|
|
527 Value object = st->obj();
|
|
528 Value value = st->value();
|
|
529 ciField* field = st->field();
|
|
530 if (field->holder()->is_loaded()) {
|
|
531 int offset = field->offset();
|
|
532 int index = _newobjects.find(object);
|
|
533 if (index != -1) {
|
|
534 // newly allocated object with no other stores performed on this field
|
|
535 FieldBuffer* buf = _fields.at(index);
|
|
536 if (buf->at(field) == NULL && is_default_value(value)) {
|
|
537 #ifndef PRODUCT
|
|
538 if (PrintIRDuringConstruction && Verbose) {
|
|
539 tty->print_cr("Eliminated store for object %d:", index);
|
|
540 st->print_line();
|
|
541 }
|
|
542 #endif
|
|
543 return NULL;
|
|
544 } else {
|
|
545 buf->at_put(field, value);
|
|
546 }
|
|
547 } else {
|
|
548 _objects.at_put_grow(offset, object, NULL);
|
|
549 _values.at_put(field, value);
|
|
550 }
|
|
551
|
|
552 store_value(value);
|
|
553 } else {
|
|
554 // if we held onto field names we could alias based on names but
|
|
555 // we don't know what's being stored to so kill it all.
|
|
556 kill();
|
|
557 }
|
|
558 return st;
|
|
559 }
|
|
560
|
|
561
|
|
562 // return true if this value correspond to the default value of a field.
|
|
563 bool is_default_value(Value value) {
|
|
564 Constant* con = value->as_Constant();
|
|
565 if (con) {
|
|
566 switch (con->type()->tag()) {
|
|
567 case intTag: return con->type()->as_IntConstant()->value() == 0;
|
|
568 case longTag: return con->type()->as_LongConstant()->value() == 0;
|
|
569 case floatTag: return jint_cast(con->type()->as_FloatConstant()->value()) == 0;
|
|
570 case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0);
|
|
571 case objectTag: return con->type() == objectNull;
|
|
572 default: ShouldNotReachHere();
|
|
573 }
|
|
574 }
|
|
575 return false;
|
|
576 }
|
|
577
|
|
578
|
|
579 // return either the actual value of a load or the load itself
|
|
580 Value load(LoadField* load) {
|
|
581 if (!EliminateFieldAccess) {
|
|
582 return load;
|
|
583 }
|
|
584
|
|
585 if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) {
|
|
586 // can't skip load since value might get rounded as a side effect
|
|
587 return load;
|
|
588 }
|
|
589
|
|
590 ciField* field = load->field();
|
|
591 Value object = load->obj();
|
|
592 if (field->holder()->is_loaded() && !field->is_volatile()) {
|
|
593 int offset = field->offset();
|
|
594 Value result = NULL;
|
|
595 int index = _newobjects.find(object);
|
|
596 if (index != -1) {
|
|
597 result = _fields.at(index)->at(field);
|
|
598 } else if (_objects.at_grow(offset, NULL) == object) {
|
|
599 result = _values.at(field);
|
|
600 }
|
|
601 if (result != NULL) {
|
|
602 #ifndef PRODUCT
|
|
603 if (PrintIRDuringConstruction && Verbose) {
|
|
604 tty->print_cr("Eliminated load: ");
|
|
605 load->print_line();
|
|
606 }
|
|
607 #endif
|
|
608 assert(result->type()->tag() == load->type()->tag(), "wrong types");
|
|
609 return result;
|
|
610 }
|
|
611 }
|
|
612 return load;
|
|
613 }
|
|
614
|
|
615 // Record this newly allocated object
|
|
616 void new_instance(NewInstance* object) {
|
|
617 int index = _newobjects.length();
|
|
618 _newobjects.append(object);
|
|
619 if (_fields.at_grow(index, NULL) == NULL) {
|
|
620 _fields.at_put(index, new FieldBuffer());
|
|
621 } else {
|
|
622 _fields.at(index)->kill();
|
|
623 }
|
|
624 }
|
|
625
|
|
626 void store_value(Value value) {
|
|
627 int index = _newobjects.find(value);
|
|
628 if (index != -1) {
|
|
629 // stored a newly allocated object into another object.
|
|
630 // Assume we've lost track of it as separate slice of memory.
|
|
631 // We could do better by keeping track of whether individual
|
|
632 // fields could alias each other.
|
|
633 _newobjects.remove_at(index);
|
|
634 // pull out the field info and store it at the end up the list
|
|
635 // of field info list to be reused later.
|
|
636 _fields.append(_fields.at(index));
|
|
637 _fields.remove_at(index);
|
|
638 }
|
|
639 }
|
|
640
|
|
641 void kill() {
|
|
642 _newobjects.trunc_to(0);
|
|
643 _objects.trunc_to(0);
|
|
644 _values.kill();
|
|
645 }
|
|
646 };
|
|
647
|
|
648
|
|
649 // Implementation of GraphBuilder's ScopeData
|
|
650
|
|
651 GraphBuilder::ScopeData::ScopeData(ScopeData* parent)
|
|
652 : _parent(parent)
|
|
653 , _bci2block(NULL)
|
|
654 , _scope(NULL)
|
|
655 , _has_handler(false)
|
|
656 , _stream(NULL)
|
|
657 , _work_list(NULL)
|
|
658 , _parsing_jsr(false)
|
|
659 , _jsr_xhandlers(NULL)
|
|
660 , _caller_stack_size(-1)
|
|
661 , _continuation(NULL)
|
|
662 , _continuation_state(NULL)
|
|
663 , _num_returns(0)
|
|
664 , _cleanup_block(NULL)
|
|
665 , _cleanup_return_prev(NULL)
|
|
666 , _cleanup_state(NULL)
|
|
667 {
|
|
668 if (parent != NULL) {
|
|
669 _max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f);
|
|
670 } else {
|
|
671 _max_inline_size = MaxInlineSize;
|
|
672 }
|
|
673 if (_max_inline_size < MaxTrivialSize) {
|
|
674 _max_inline_size = MaxTrivialSize;
|
|
675 }
|
|
676 }
|
|
677
|
|
678
|
|
679 void GraphBuilder::kill_field(ciField* field) {
|
|
680 if (UseLocalValueNumbering) {
|
|
681 vmap()->kill_field(field);
|
|
682 }
|
|
683 }
|
|
684
|
|
685
|
|
686 void GraphBuilder::kill_array(Value value) {
|
|
687 if (UseLocalValueNumbering) {
|
|
688 vmap()->kill_array(value->type());
|
|
689 }
|
|
690 _memory->store_value(value);
|
|
691 }
|
|
692
|
|
693
|
|
694 void GraphBuilder::kill_all() {
|
|
695 if (UseLocalValueNumbering) {
|
|
696 vmap()->kill_all();
|
|
697 }
|
|
698 _memory->kill();
|
|
699 }
|
|
700
|
|
701
|
|
702 BlockBegin* GraphBuilder::ScopeData::block_at(int bci) {
|
|
703 if (parsing_jsr()) {
|
|
704 // It is necessary to clone all blocks associated with a
|
|
705 // subroutine, including those for exception handlers in the scope
|
|
706 // of the method containing the jsr (because those exception
|
|
707 // handlers may contain ret instructions in some cases).
|
|
708 BlockBegin* block = bci2block()->at(bci);
|
|
709 if (block != NULL && block == parent()->bci2block()->at(bci)) {
|
|
710 BlockBegin* new_block = new BlockBegin(block->bci());
|
|
711 #ifndef PRODUCT
|
|
712 if (PrintInitialBlockList) {
|
|
713 tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr",
|
|
714 block->block_id(), block->bci(), new_block->block_id());
|
|
715 }
|
|
716 #endif
|
|
717 // copy data from cloned blocked
|
|
718 new_block->set_depth_first_number(block->depth_first_number());
|
|
719 if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag);
|
|
720 // Preserve certain flags for assertion checking
|
|
721 if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag);
|
|
722 if (block->is_set(BlockBegin::exception_entry_flag)) new_block->set(BlockBegin::exception_entry_flag);
|
|
723
|
|
724 // copy was_visited_flag to allow early detection of bailouts
|
|
725 // if a block that is used in a jsr has already been visited before,
|
|
726 // it is shared between the normal control flow and a subroutine
|
|
727 // BlockBegin::try_merge returns false when the flag is set, this leads
|
|
728 // to a compilation bailout
|
|
729 if (block->is_set(BlockBegin::was_visited_flag)) new_block->set(BlockBegin::was_visited_flag);
|
|
730
|
|
731 bci2block()->at_put(bci, new_block);
|
|
732 block = new_block;
|
|
733 }
|
|
734 return block;
|
|
735 } else {
|
|
736 return bci2block()->at(bci);
|
|
737 }
|
|
738 }
|
|
739
|
|
740
|
|
741 XHandlers* GraphBuilder::ScopeData::xhandlers() const {
|
|
742 if (_jsr_xhandlers == NULL) {
|
|
743 assert(!parsing_jsr(), "");
|
|
744 return scope()->xhandlers();
|
|
745 }
|
|
746 assert(parsing_jsr(), "");
|
|
747 return _jsr_xhandlers;
|
|
748 }
|
|
749
|
|
750
|
|
751 void GraphBuilder::ScopeData::set_scope(IRScope* scope) {
|
|
752 _scope = scope;
|
|
753 bool parent_has_handler = false;
|
|
754 if (parent() != NULL) {
|
|
755 parent_has_handler = parent()->has_handler();
|
|
756 }
|
|
757 _has_handler = parent_has_handler || scope->xhandlers()->has_handlers();
|
|
758 }
|
|
759
|
|
760
|
|
761 void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block,
|
|
762 Instruction* return_prev,
|
|
763 ValueStack* return_state) {
|
|
764 _cleanup_block = block;
|
|
765 _cleanup_return_prev = return_prev;
|
|
766 _cleanup_state = return_state;
|
|
767 }
|
|
768
|
|
769
|
|
770 void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) {
|
|
771 if (_work_list == NULL) {
|
|
772 _work_list = new BlockList();
|
|
773 }
|
|
774
|
|
775 if (!block->is_set(BlockBegin::is_on_work_list_flag)) {
|
|
776 // Do not start parsing the continuation block while in a
|
|
777 // sub-scope
|
|
778 if (parsing_jsr()) {
|
|
779 if (block == jsr_continuation()) {
|
|
780 return;
|
|
781 }
|
|
782 } else {
|
|
783 if (block == continuation()) {
|
|
784 return;
|
|
785 }
|
|
786 }
|
|
787 block->set(BlockBegin::is_on_work_list_flag);
|
|
788 _work_list->push(block);
|
|
789
|
|
790 sort_top_into_worklist(_work_list, block);
|
|
791 }
|
|
792 }
|
|
793
|
|
794
|
|
795 void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) {
|
|
796 assert(worklist->top() == top, "");
|
|
797 // sort block descending into work list
|
|
798 const int dfn = top->depth_first_number();
|
|
799 assert(dfn != -1, "unknown depth first number");
|
|
800 int i = worklist->length()-2;
|
|
801 while (i >= 0) {
|
|
802 BlockBegin* b = worklist->at(i);
|
|
803 if (b->depth_first_number() < dfn) {
|
|
804 worklist->at_put(i+1, b);
|
|
805 } else {
|
|
806 break;
|
|
807 }
|
|
808 i --;
|
|
809 }
|
|
810 if (i >= -1) worklist->at_put(i + 1, top);
|
|
811 }
|
|
812
|
|
813 int GraphBuilder::ScopeData::caller_stack_size() const {
|
|
814 ValueStack* state = scope()->caller_state();
|
|
815 if (state == NULL) {
|
|
816 return 0;
|
|
817 }
|
|
818 return state->stack_size();
|
|
819 }
|
|
820
|
|
821
|
|
822 BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() {
|
|
823 if (is_work_list_empty()) {
|
|
824 return NULL;
|
|
825 }
|
|
826 return _work_list->pop();
|
|
827 }
|
|
828
|
|
829
|
|
830 bool GraphBuilder::ScopeData::is_work_list_empty() const {
|
|
831 return (_work_list == NULL || _work_list->length() == 0);
|
|
832 }
|
|
833
|
|
834
|
|
835 void GraphBuilder::ScopeData::setup_jsr_xhandlers() {
|
|
836 assert(parsing_jsr(), "");
|
|
837 // clone all the exception handlers from the scope
|
|
838 XHandlers* handlers = new XHandlers(scope()->xhandlers());
|
|
839 const int n = handlers->length();
|
|
840 for (int i = 0; i < n; i++) {
|
|
841 // The XHandlers need to be adjusted to dispatch to the cloned
|
|
842 // handler block instead of the default one but the synthetic
|
|
843 // unlocker needs to be handled specially. The synthetic unlocker
|
|
844 // should be left alone since there can be only one and all code
|
|
845 // should dispatch to the same one.
|
|
846 XHandler* h = handlers->handler_at(i);
|
|
847 if (h->handler_bci() != SynchronizationEntryBCI) {
|
|
848 h->set_entry_block(block_at(h->handler_bci()));
|
|
849 } else {
|
|
850 assert(h->entry_block()->is_set(BlockBegin::default_exception_handler_flag),
|
|
851 "should be the synthetic unlock block");
|
|
852 }
|
|
853 }
|
|
854 _jsr_xhandlers = handlers;
|
|
855 }
|
|
856
|
|
857
|
|
858 int GraphBuilder::ScopeData::num_returns() {
|
|
859 if (parsing_jsr()) {
|
|
860 return parent()->num_returns();
|
|
861 }
|
|
862 return _num_returns;
|
|
863 }
|
|
864
|
|
865
|
|
866 void GraphBuilder::ScopeData::incr_num_returns() {
|
|
867 if (parsing_jsr()) {
|
|
868 parent()->incr_num_returns();
|
|
869 } else {
|
|
870 ++_num_returns;
|
|
871 }
|
|
872 }
|
|
873
|
|
874
|
|
875 // Implementation of GraphBuilder
|
|
876
|
|
877 #define INLINE_BAILOUT(msg) { inline_bailout(msg); return false; }
|
|
878
|
|
879
|
|
880 void GraphBuilder::load_constant() {
|
|
881 ciConstant con = stream()->get_constant();
|
|
882 if (con.basic_type() == T_ILLEGAL) {
|
|
883 BAILOUT("could not resolve a constant");
|
|
884 } else {
|
|
885 ValueType* t = illegalType;
|
|
886 ValueStack* patch_state = NULL;
|
|
887 switch (con.basic_type()) {
|
|
888 case T_BOOLEAN: t = new IntConstant (con.as_boolean()); break;
|
|
889 case T_BYTE : t = new IntConstant (con.as_byte ()); break;
|
|
890 case T_CHAR : t = new IntConstant (con.as_char ()); break;
|
|
891 case T_SHORT : t = new IntConstant (con.as_short ()); break;
|
|
892 case T_INT : t = new IntConstant (con.as_int ()); break;
|
|
893 case T_LONG : t = new LongConstant (con.as_long ()); break;
|
|
894 case T_FLOAT : t = new FloatConstant (con.as_float ()); break;
|
|
895 case T_DOUBLE : t = new DoubleConstant (con.as_double ()); break;
|
|
896 case T_ARRAY : t = new ArrayConstant (con.as_object ()->as_array ()); break;
|
|
897 case T_OBJECT :
|
|
898 {
|
|
899 ciObject* obj = con.as_object();
|
|
900 if (obj->is_klass()) {
|
|
901 ciKlass* klass = obj->as_klass();
|
|
902 if (!klass->is_loaded() || PatchALot) {
|
|
903 patch_state = state()->copy();
|
|
904 t = new ObjectConstant(obj);
|
|
905 } else {
|
|
906 t = new InstanceConstant(klass->java_mirror());
|
|
907 }
|
|
908 } else {
|
|
909 t = new InstanceConstant(obj->as_instance());
|
|
910 }
|
|
911 break;
|
|
912 }
|
|
913 default : ShouldNotReachHere();
|
|
914 }
|
|
915 Value x;
|
|
916 if (patch_state != NULL) {
|
|
917 x = new Constant(t, patch_state);
|
|
918 } else {
|
|
919 x = new Constant(t);
|
|
920 }
|
|
921 push(t, append(x));
|
|
922 }
|
|
923 }
|
|
924
|
|
925
|
|
926 void GraphBuilder::load_local(ValueType* type, int index) {
|
|
927 Value x = state()->load_local(index);
|
|
928 push(type, x);
|
|
929 }
|
|
930
|
|
931
|
|
932 void GraphBuilder::store_local(ValueType* type, int index) {
|
|
933 Value x = pop(type);
|
|
934 store_local(state(), x, type, index);
|
|
935 }
|
|
936
|
|
937
|
|
938 void GraphBuilder::store_local(ValueStack* state, Value x, ValueType* type, int index) {
|
|
939 if (parsing_jsr()) {
|
|
940 // We need to do additional tracking of the location of the return
|
|
941 // address for jsrs since we don't handle arbitrary jsr/ret
|
|
942 // constructs. Here we are figuring out in which circumstances we
|
|
943 // need to bail out.
|
|
944 if (x->type()->is_address()) {
|
|
945 scope_data()->set_jsr_return_address_local(index);
|
|
946
|
|
947 // Also check parent jsrs (if any) at this time to see whether
|
|
948 // they are using this local. We don't handle skipping over a
|
|
949 // ret.
|
|
950 for (ScopeData* cur_scope_data = scope_data()->parent();
|
|
951 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope();
|
|
952 cur_scope_data = cur_scope_data->parent()) {
|
|
953 if (cur_scope_data->jsr_return_address_local() == index) {
|
|
954 BAILOUT("subroutine overwrites return address from previous subroutine");
|
|
955 }
|
|
956 }
|
|
957 } else if (index == scope_data()->jsr_return_address_local()) {
|
|
958 scope_data()->set_jsr_return_address_local(-1);
|
|
959 }
|
|
960 }
|
|
961
|
|
962 state->store_local(index, round_fp(x));
|
|
963 }
|
|
964
|
|
965
|
|
966 void GraphBuilder::load_indexed(BasicType type) {
|
|
967 Value index = ipop();
|
|
968 Value array = apop();
|
|
969 Value length = NULL;
|
|
970 if (CSEArrayLength ||
|
|
971 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) ||
|
|
972 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) {
|
|
973 length = append(new ArrayLength(array, lock_stack()));
|
|
974 }
|
|
975 push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, lock_stack())));
|
|
976 }
|
|
977
|
|
978
|
|
979 void GraphBuilder::store_indexed(BasicType type) {
|
|
980 Value value = pop(as_ValueType(type));
|
|
981 Value index = ipop();
|
|
982 Value array = apop();
|
|
983 Value length = NULL;
|
|
984 if (CSEArrayLength ||
|
|
985 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) ||
|
|
986 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) {
|
|
987 length = append(new ArrayLength(array, lock_stack()));
|
|
988 }
|
|
989 StoreIndexed* result = new StoreIndexed(array, index, length, type, value, lock_stack());
|
|
990 kill_array(value); // invalidate all CSEs that are memory accesses of the same type
|
|
991 append(result);
|
|
992 }
|
|
993
|
|
994
|
|
995 void GraphBuilder::stack_op(Bytecodes::Code code) {
|
|
996 switch (code) {
|
|
997 case Bytecodes::_pop:
|
|
998 { state()->raw_pop();
|
|
999 }
|
|
1000 break;
|
|
1001 case Bytecodes::_pop2:
|
|
1002 { state()->raw_pop();
|
|
1003 state()->raw_pop();
|
|
1004 }
|
|
1005 break;
|
|
1006 case Bytecodes::_dup:
|
|
1007 { Value w = state()->raw_pop();
|
|
1008 state()->raw_push(w);
|
|
1009 state()->raw_push(w);
|
|
1010 }
|
|
1011 break;
|
|
1012 case Bytecodes::_dup_x1:
|
|
1013 { Value w1 = state()->raw_pop();
|
|
1014 Value w2 = state()->raw_pop();
|
|
1015 state()->raw_push(w1);
|
|
1016 state()->raw_push(w2);
|
|
1017 state()->raw_push(w1);
|
|
1018 }
|
|
1019 break;
|
|
1020 case Bytecodes::_dup_x2:
|
|
1021 { Value w1 = state()->raw_pop();
|
|
1022 Value w2 = state()->raw_pop();
|
|
1023 Value w3 = state()->raw_pop();
|
|
1024 state()->raw_push(w1);
|
|
1025 state()->raw_push(w3);
|
|
1026 state()->raw_push(w2);
|
|
1027 state()->raw_push(w1);
|
|
1028 }
|
|
1029 break;
|
|
1030 case Bytecodes::_dup2:
|
|
1031 { Value w1 = state()->raw_pop();
|
|
1032 Value w2 = state()->raw_pop();
|
|
1033 state()->raw_push(w2);
|
|
1034 state()->raw_push(w1);
|
|
1035 state()->raw_push(w2);
|
|
1036 state()->raw_push(w1);
|
|
1037 }
|
|
1038 break;
|
|
1039 case Bytecodes::_dup2_x1:
|
|
1040 { Value w1 = state()->raw_pop();
|
|
1041 Value w2 = state()->raw_pop();
|
|
1042 Value w3 = state()->raw_pop();
|
|
1043 state()->raw_push(w2);
|
|
1044 state()->raw_push(w1);
|
|
1045 state()->raw_push(w3);
|
|
1046 state()->raw_push(w2);
|
|
1047 state()->raw_push(w1);
|
|
1048 }
|
|
1049 break;
|
|
1050 case Bytecodes::_dup2_x2:
|
|
1051 { Value w1 = state()->raw_pop();
|
|
1052 Value w2 = state()->raw_pop();
|
|
1053 Value w3 = state()->raw_pop();
|
|
1054 Value w4 = state()->raw_pop();
|
|
1055 state()->raw_push(w2);
|
|
1056 state()->raw_push(w1);
|
|
1057 state()->raw_push(w4);
|
|
1058 state()->raw_push(w3);
|
|
1059 state()->raw_push(w2);
|
|
1060 state()->raw_push(w1);
|
|
1061 }
|
|
1062 break;
|
|
1063 case Bytecodes::_swap:
|
|
1064 { Value w1 = state()->raw_pop();
|
|
1065 Value w2 = state()->raw_pop();
|
|
1066 state()->raw_push(w1);
|
|
1067 state()->raw_push(w2);
|
|
1068 }
|
|
1069 break;
|
|
1070 default:
|
|
1071 ShouldNotReachHere();
|
|
1072 break;
|
|
1073 }
|
|
1074 }
|
|
1075
|
|
1076
|
|
1077 void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* stack) {
|
|
1078 Value y = pop(type);
|
|
1079 Value x = pop(type);
|
|
1080 // NOTE: strictfp can be queried from current method since we don't
|
|
1081 // inline methods with differing strictfp bits
|
|
1082 Value res = new ArithmeticOp(code, x, y, method()->is_strict(), stack);
|
|
1083 // Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level
|
|
1084 res = append(res);
|
|
1085 if (method()->is_strict()) {
|
|
1086 res = round_fp(res);
|
|
1087 }
|
|
1088 push(type, res);
|
|
1089 }
|
|
1090
|
|
1091
|
|
1092 void GraphBuilder::negate_op(ValueType* type) {
|
|
1093 push(type, append(new NegateOp(pop(type))));
|
|
1094 }
|
|
1095
|
|
1096
|
|
1097 void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) {
|
|
1098 Value s = ipop();
|
|
1099 Value x = pop(type);
|
|
1100 // try to simplify
|
|
1101 // Note: This code should go into the canonicalizer as soon as it can
|
|
1102 // can handle canonicalized forms that contain more than one node.
|
|
1103 if (CanonicalizeNodes && code == Bytecodes::_iushr) {
|
|
1104 // pattern: x >>> s
|
|
1105 IntConstant* s1 = s->type()->as_IntConstant();
|
|
1106 if (s1 != NULL) {
|
|
1107 // pattern: x >>> s1, with s1 constant
|
|
1108 ShiftOp* l = x->as_ShiftOp();
|
|
1109 if (l != NULL && l->op() == Bytecodes::_ishl) {
|
|
1110 // pattern: (a << b) >>> s1
|
|
1111 IntConstant* s0 = l->y()->type()->as_IntConstant();
|
|
1112 if (s0 != NULL) {
|
|
1113 // pattern: (a << s0) >>> s1
|
|
1114 const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts
|
|
1115 const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts
|
|
1116 if (s0c == s1c) {
|
|
1117 if (s0c == 0) {
|
|
1118 // pattern: (a << 0) >>> 0 => simplify to: a
|
|
1119 ipush(l->x());
|
|
1120 } else {
|
|
1121 // pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant
|
|
1122 assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases");
|
|
1123 const int m = (1 << (BitsPerInt - s0c)) - 1;
|
|
1124 Value s = append(new Constant(new IntConstant(m)));
|
|
1125 ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s)));
|
|
1126 }
|
|
1127 return;
|
|
1128 }
|
|
1129 }
|
|
1130 }
|
|
1131 }
|
|
1132 }
|
|
1133 // could not simplify
|
|
1134 push(type, append(new ShiftOp(code, x, s)));
|
|
1135 }
|
|
1136
|
|
1137
|
|
1138 void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) {
|
|
1139 Value y = pop(type);
|
|
1140 Value x = pop(type);
|
|
1141 push(type, append(new LogicOp(code, x, y)));
|
|
1142 }
|
|
1143
|
|
1144
|
|
1145 void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) {
|
|
1146 ValueStack* state_before = state()->copy();
|
|
1147 Value y = pop(type);
|
|
1148 Value x = pop(type);
|
|
1149 ipush(append(new CompareOp(code, x, y, state_before)));
|
|
1150 }
|
|
1151
|
|
1152
|
|
1153 void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) {
|
|
1154 push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to))));
|
|
1155 }
|
|
1156
|
|
1157
|
|
1158 void GraphBuilder::increment() {
|
|
1159 int index = stream()->get_index();
|
|
1160 int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]);
|
|
1161 load_local(intType, index);
|
|
1162 ipush(append(new Constant(new IntConstant(delta))));
|
|
1163 arithmetic_op(intType, Bytecodes::_iadd);
|
|
1164 store_local(intType, index);
|
|
1165 }
|
|
1166
|
|
1167
|
|
1168 void GraphBuilder::_goto(int from_bci, int to_bci) {
|
|
1169 profile_bci(from_bci);
|
|
1170 append(new Goto(block_at(to_bci), to_bci <= from_bci));
|
|
1171 }
|
|
1172
|
|
1173
|
|
1174 void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) {
|
|
1175 BlockBegin* tsux = block_at(stream()->get_dest());
|
|
1176 BlockBegin* fsux = block_at(stream()->next_bci());
|
|
1177 bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci();
|
|
1178 If* if_node = append(new If(x, cond, false, y, tsux, fsux, is_bb ? state_before : NULL, is_bb))->as_If();
|
|
1179 if (profile_branches() && (if_node != NULL)) {
|
|
1180 if_node->set_profiled_method(method());
|
|
1181 if_node->set_profiled_bci(bci());
|
|
1182 if_node->set_should_profile(true);
|
|
1183 }
|
|
1184 }
|
|
1185
|
|
1186
|
|
1187 void GraphBuilder::if_zero(ValueType* type, If::Condition cond) {
|
|
1188 Value y = append(new Constant(intZero));
|
|
1189 ValueStack* state_before = state()->copy();
|
|
1190 Value x = ipop();
|
|
1191 if_node(x, cond, y, state_before);
|
|
1192 }
|
|
1193
|
|
1194
|
|
1195 void GraphBuilder::if_null(ValueType* type, If::Condition cond) {
|
|
1196 Value y = append(new Constant(objectNull));
|
|
1197 ValueStack* state_before = state()->copy();
|
|
1198 Value x = apop();
|
|
1199 if_node(x, cond, y, state_before);
|
|
1200 }
|
|
1201
|
|
1202
|
|
1203 void GraphBuilder::if_same(ValueType* type, If::Condition cond) {
|
|
1204 ValueStack* state_before = state()->copy();
|
|
1205 Value y = pop(type);
|
|
1206 Value x = pop(type);
|
|
1207 if_node(x, cond, y, state_before);
|
|
1208 }
|
|
1209
|
|
1210
|
|
1211 void GraphBuilder::jsr(int dest) {
|
|
1212 // We only handle well-formed jsrs (those which are "block-structured").
|
|
1213 // If the bytecodes are strange (jumping out of a jsr block) then we
|
|
1214 // might end up trying to re-parse a block containing a jsr which
|
|
1215 // has already been activated. Watch for this case and bail out.
|
|
1216 for (ScopeData* cur_scope_data = scope_data();
|
|
1217 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope();
|
|
1218 cur_scope_data = cur_scope_data->parent()) {
|
|
1219 if (cur_scope_data->jsr_entry_bci() == dest) {
|
|
1220 BAILOUT("too-complicated jsr/ret structure");
|
|
1221 }
|
|
1222 }
|
|
1223
|
|
1224 push(addressType, append(new Constant(new AddressConstant(next_bci()))));
|
|
1225 if (!try_inline_jsr(dest)) {
|
|
1226 return; // bailed out while parsing and inlining subroutine
|
|
1227 }
|
|
1228 }
|
|
1229
|
|
1230
|
|
1231 void GraphBuilder::ret(int local_index) {
|
|
1232 if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine");
|
|
1233
|
|
1234 if (local_index != scope_data()->jsr_return_address_local()) {
|
|
1235 BAILOUT("can not handle complicated jsr/ret constructs");
|
|
1236 }
|
|
1237
|
|
1238 // Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation
|
|
1239 append(new Goto(scope_data()->jsr_continuation(), false));
|
|
1240 }
|
|
1241
|
|
1242
|
|
1243 void GraphBuilder::table_switch() {
|
|
1244 Bytecode_tableswitch* switch_ = Bytecode_tableswitch_at(method()->code() + bci());
|
|
1245 const int l = switch_->length();
|
|
1246 if (CanonicalizeNodes && l == 1) {
|
|
1247 // total of 2 successors => use If instead of switch
|
|
1248 // Note: This code should go into the canonicalizer as soon as it can
|
|
1249 // can handle canonicalized forms that contain more than one node.
|
|
1250 Value key = append(new Constant(new IntConstant(switch_->low_key())));
|
|
1251 BlockBegin* tsux = block_at(bci() + switch_->dest_offset_at(0));
|
|
1252 BlockBegin* fsux = block_at(bci() + switch_->default_offset());
|
|
1253 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci();
|
|
1254 ValueStack* state_before = is_bb ? state() : NULL;
|
|
1255 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb));
|
|
1256 } else {
|
|
1257 // collect successors
|
|
1258 BlockList* sux = new BlockList(l + 1, NULL);
|
|
1259 int i;
|
|
1260 bool has_bb = false;
|
|
1261 for (i = 0; i < l; i++) {
|
|
1262 sux->at_put(i, block_at(bci() + switch_->dest_offset_at(i)));
|
|
1263 if (switch_->dest_offset_at(i) < 0) has_bb = true;
|
|
1264 }
|
|
1265 // add default successor
|
|
1266 sux->at_put(i, block_at(bci() + switch_->default_offset()));
|
|
1267 ValueStack* state_before = has_bb ? state() : NULL;
|
|
1268 append(new TableSwitch(ipop(), sux, switch_->low_key(), state_before, has_bb));
|
|
1269 }
|
|
1270 }
|
|
1271
|
|
1272
|
|
1273 void GraphBuilder::lookup_switch() {
|
|
1274 Bytecode_lookupswitch* switch_ = Bytecode_lookupswitch_at(method()->code() + bci());
|
|
1275 const int l = switch_->number_of_pairs();
|
|
1276 if (CanonicalizeNodes && l == 1) {
|
|
1277 // total of 2 successors => use If instead of switch
|
|
1278 // Note: This code should go into the canonicalizer as soon as it can
|
|
1279 // can handle canonicalized forms that contain more than one node.
|
|
1280 // simplify to If
|
|
1281 LookupswitchPair* pair = switch_->pair_at(0);
|
|
1282 Value key = append(new Constant(new IntConstant(pair->match())));
|
|
1283 BlockBegin* tsux = block_at(bci() + pair->offset());
|
|
1284 BlockBegin* fsux = block_at(bci() + switch_->default_offset());
|
|
1285 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci();
|
|
1286 ValueStack* state_before = is_bb ? state() : NULL;
|
|
1287 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb));
|
|
1288 } else {
|
|
1289 // collect successors & keys
|
|
1290 BlockList* sux = new BlockList(l + 1, NULL);
|
|
1291 intArray* keys = new intArray(l, 0);
|
|
1292 int i;
|
|
1293 bool has_bb = false;
|
|
1294 for (i = 0; i < l; i++) {
|
|
1295 LookupswitchPair* pair = switch_->pair_at(i);
|
|
1296 if (pair->offset() < 0) has_bb = true;
|
|
1297 sux->at_put(i, block_at(bci() + pair->offset()));
|
|
1298 keys->at_put(i, pair->match());
|
|
1299 }
|
|
1300 // add default successor
|
|
1301 sux->at_put(i, block_at(bci() + switch_->default_offset()));
|
|
1302 ValueStack* state_before = has_bb ? state() : NULL;
|
|
1303 append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb));
|
|
1304 }
|
|
1305 }
|
|
1306
|
|
1307 void GraphBuilder::call_register_finalizer() {
|
|
1308 // If the receiver requires finalization then emit code to perform
|
|
1309 // the registration on return.
|
|
1310
|
|
1311 // Gather some type information about the receiver
|
|
1312 Value receiver = state()->load_local(0);
|
|
1313 assert(receiver != NULL, "must have a receiver");
|
|
1314 ciType* declared_type = receiver->declared_type();
|
|
1315 ciType* exact_type = receiver->exact_type();
|
|
1316 if (exact_type == NULL &&
|
|
1317 receiver->as_Local() &&
|
|
1318 receiver->as_Local()->java_index() == 0) {
|
|
1319 ciInstanceKlass* ik = compilation()->method()->holder();
|
|
1320 if (ik->is_final()) {
|
|
1321 exact_type = ik;
|
|
1322 } else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) {
|
|
1323 // test class is leaf class
|
|
1324 compilation()->dependency_recorder()->assert_leaf_type(ik);
|
|
1325 exact_type = ik;
|
|
1326 } else {
|
|
1327 declared_type = ik;
|
|
1328 }
|
|
1329 }
|
|
1330
|
|
1331 // see if we know statically that registration isn't required
|
|
1332 bool needs_check = true;
|
|
1333 if (exact_type != NULL) {
|
|
1334 needs_check = exact_type->as_instance_klass()->has_finalizer();
|
|
1335 } else if (declared_type != NULL) {
|
|
1336 ciInstanceKlass* ik = declared_type->as_instance_klass();
|
|
1337 if (!Dependencies::has_finalizable_subclass(ik)) {
|
|
1338 compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik);
|
|
1339 needs_check = false;
|
|
1340 }
|
|
1341 }
|
|
1342
|
|
1343 if (needs_check) {
|
|
1344 // Perform the registration of finalizable objects.
|
|
1345 load_local(objectType, 0);
|
|
1346 append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init,
|
|
1347 state()->pop_arguments(1),
|
|
1348 true, lock_stack(), true));
|
|
1349 }
|
|
1350 }
|
|
1351
|
|
1352
|
|
1353 void GraphBuilder::method_return(Value x) {
|
|
1354 if (RegisterFinalizersAtInit &&
|
|
1355 method()->intrinsic_id() == vmIntrinsics::_Object_init) {
|
|
1356 call_register_finalizer();
|
|
1357 }
|
|
1358
|
|
1359 // Check to see whether we are inlining. If so, Return
|
|
1360 // instructions become Gotos to the continuation point.
|
|
1361 if (continuation() != NULL) {
|
|
1362 assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet");
|
|
1363
|
|
1364 // If the inlined method is synchronized, the monitor must be
|
|
1365 // released before we jump to the continuation block.
|
|
1366 if (method()->is_synchronized()) {
|
|
1367 int i = state()->caller_state()->locks_size();
|
|
1368 assert(state()->locks_size() == i + 1, "receiver must be locked here");
|
|
1369 monitorexit(state()->lock_at(i), SynchronizationEntryBCI);
|
|
1370 }
|
|
1371
|
|
1372 state()->truncate_stack(caller_stack_size());
|
|
1373 if (x != NULL) {
|
|
1374 state()->push(x->type(), x);
|
|
1375 }
|
|
1376 Goto* goto_callee = new Goto(continuation(), false);
|
|
1377
|
|
1378 // See whether this is the first return; if so, store off some
|
|
1379 // of the state for later examination
|
|
1380 if (num_returns() == 0) {
|
|
1381 set_inline_cleanup_info(_block, _last, state());
|
|
1382 }
|
|
1383
|
|
1384 // State at end of inlined method is the state of the caller
|
|
1385 // without the method parameters on stack, including the
|
|
1386 // return value, if any, of the inlined method on operand stack.
|
|
1387 set_state(scope_data()->continuation_state()->copy());
|
|
1388 if (x) {
|
|
1389 state()->push(x->type(), x);
|
|
1390 }
|
|
1391
|
|
1392 // The current bci() is in the wrong scope, so use the bci() of
|
|
1393 // the continuation point.
|
|
1394 append_with_bci(goto_callee, scope_data()->continuation()->bci());
|
|
1395 incr_num_returns();
|
|
1396
|
|
1397 return;
|
|
1398 }
|
|
1399
|
|
1400 state()->truncate_stack(0);
|
|
1401 if (method()->is_synchronized()) {
|
|
1402 // perform the unlocking before exiting the method
|
|
1403 Value receiver;
|
|
1404 if (!method()->is_static()) {
|
|
1405 receiver = _initial_state->local_at(0);
|
|
1406 } else {
|
|
1407 receiver = append(new Constant(new ClassConstant(method()->holder())));
|
|
1408 }
|
|
1409 append_split(new MonitorExit(receiver, state()->unlock()));
|
|
1410 }
|
|
1411
|
|
1412 append(new Return(x));
|
|
1413 }
|
|
1414
|
|
1415
|
|
1416 void GraphBuilder::access_field(Bytecodes::Code code) {
|
|
1417 bool will_link;
|
|
1418 ciField* field = stream()->get_field(will_link);
|
|
1419 ciInstanceKlass* holder = field->holder();
|
|
1420 BasicType field_type = field->type()->basic_type();
|
|
1421 ValueType* type = as_ValueType(field_type);
|
|
1422 // call will_link again to determine if the field is valid.
|
|
1423 const bool is_loaded = holder->is_loaded() &&
|
|
1424 field->will_link(method()->holder(), code);
|
|
1425 const bool is_initialized = is_loaded && holder->is_initialized();
|
|
1426
|
|
1427 ValueStack* state_copy = NULL;
|
|
1428 if (!is_initialized || PatchALot) {
|
|
1429 // save state before instruction for debug info when
|
|
1430 // deoptimization happens during patching
|
|
1431 state_copy = state()->copy();
|
|
1432 }
|
|
1433
|
|
1434 Value obj = NULL;
|
|
1435 if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) {
|
|
1436 // commoning of class constants should only occur if the class is
|
|
1437 // fully initialized and resolved in this constant pool. The will_link test
|
|
1438 // above essentially checks if this class is resolved in this constant pool
|
|
1439 // so, the is_initialized flag should be suffiect.
|
|
1440 if (state_copy != NULL) {
|
|
1441 // build a patching constant
|
|
1442 obj = new Constant(new ClassConstant(holder), state_copy);
|
|
1443 } else {
|
|
1444 obj = new Constant(new ClassConstant(holder));
|
|
1445 }
|
|
1446 }
|
|
1447
|
|
1448
|
|
1449 const int offset = is_loaded ? field->offset() : -1;
|
|
1450 switch (code) {
|
|
1451 case Bytecodes::_getstatic: {
|
|
1452 // check for compile-time constants, i.e., initialized static final fields
|
|
1453 Instruction* constant = NULL;
|
|
1454 if (field->is_constant() && !PatchALot) {
|
|
1455 ciConstant field_val = field->constant_value();
|
|
1456 BasicType field_type = field_val.basic_type();
|
|
1457 switch (field_type) {
|
|
1458 case T_ARRAY:
|
|
1459 case T_OBJECT:
|
|
1460 if (field_val.as_object()->has_encoding()) {
|
|
1461 constant = new Constant(as_ValueType(field_val));
|
|
1462 }
|
|
1463 break;
|
|
1464
|
|
1465 default:
|
|
1466 constant = new Constant(as_ValueType(field_val));
|
|
1467 }
|
|
1468 }
|
|
1469 if (constant != NULL) {
|
|
1470 push(type, append(constant));
|
|
1471 state_copy = NULL; // Not a potential deoptimization point (see set_state_before logic below)
|
|
1472 } else {
|
|
1473 push(type, append(new LoadField(append(obj), offset, field, true,
|
|
1474 lock_stack(), state_copy, is_loaded, is_initialized)));
|
|
1475 }
|
|
1476 break;
|
|
1477 }
|
|
1478 case Bytecodes::_putstatic:
|
|
1479 { Value val = pop(type);
|
|
1480 append(new StoreField(append(obj), offset, field, val, true, lock_stack(), state_copy, is_loaded, is_initialized));
|
|
1481 if (UseLocalValueNumbering) {
|
|
1482 vmap()->kill_field(field); // invalidate all CSEs that are memory accesses
|
|
1483 }
|
|
1484 }
|
|
1485 break;
|
|
1486 case Bytecodes::_getfield :
|
|
1487 {
|
|
1488 LoadField* load = new LoadField(apop(), offset, field, false, lock_stack(), state_copy, is_loaded, true);
|
|
1489 Value replacement = is_loaded ? _memory->load(load) : load;
|
|
1490 if (replacement != load) {
|
|
1491 assert(replacement->bci() != -99 || replacement->as_Phi() || replacement->as_Local(),
|
|
1492 "should already by linked");
|
|
1493 push(type, replacement);
|
|
1494 } else {
|
|
1495 push(type, append(load));
|
|
1496 }
|
|
1497 break;
|
|
1498 }
|
|
1499
|
|
1500 case Bytecodes::_putfield :
|
|
1501 { Value val = pop(type);
|
|
1502 StoreField* store = new StoreField(apop(), offset, field, val, false, lock_stack(), state_copy, is_loaded, true);
|
|
1503 if (is_loaded) store = _memory->store(store);
|
|
1504 if (store != NULL) {
|
|
1505 append(store);
|
|
1506 kill_field(field); // invalidate all CSEs that are accesses of this field
|
|
1507 }
|
|
1508 }
|
|
1509 break;
|
|
1510 default :
|
|
1511 ShouldNotReachHere();
|
|
1512 break;
|
|
1513 }
|
|
1514 }
|
|
1515
|
|
1516
|
|
1517 Dependencies* GraphBuilder::dependency_recorder() const {
|
|
1518 assert(DeoptC1, "need debug information");
|
|
1519 compilation()->set_needs_debug_information(true);
|
|
1520 return compilation()->dependency_recorder();
|
|
1521 }
|
|
1522
|
|
1523
|
|
1524 void GraphBuilder::invoke(Bytecodes::Code code) {
|
|
1525 bool will_link;
|
|
1526 ciMethod* target = stream()->get_method(will_link);
|
|
1527 // we have to make sure the argument size (incl. the receiver)
|
|
1528 // is correct for compilation (the call would fail later during
|
|
1529 // linkage anyway) - was bug (gri 7/28/99)
|
|
1530 if (target->is_loaded() && target->is_static() != (code == Bytecodes::_invokestatic)) BAILOUT("will cause link error");
|
|
1531 ciInstanceKlass* klass = target->holder();
|
|
1532
|
|
1533 // check if CHA possible: if so, change the code to invoke_special
|
|
1534 ciInstanceKlass* calling_klass = method()->holder();
|
|
1535 ciKlass* holder = stream()->get_declared_method_holder();
|
|
1536 ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder);
|
|
1537 ciInstanceKlass* actual_recv = callee_holder;
|
|
1538
|
|
1539 // some methods are obviously bindable without any type checks so
|
|
1540 // convert them directly to an invokespecial.
|
|
1541 if (target->is_loaded() && !target->is_abstract() &&
|
|
1542 target->can_be_statically_bound() && code == Bytecodes::_invokevirtual) {
|
|
1543 code = Bytecodes::_invokespecial;
|
|
1544 }
|
|
1545
|
|
1546 // NEEDS_CLEANUP
|
|
1547 // I've added the target-is_loaded() test below but I don't really understand
|
|
1548 // how klass->is_loaded() can be true and yet target->is_loaded() is false.
|
|
1549 // this happened while running the JCK invokevirtual tests under doit. TKR
|
|
1550 ciMethod* cha_monomorphic_target = NULL;
|
|
1551 ciMethod* exact_target = NULL;
|
|
1552 if (UseCHA && DeoptC1 && klass->is_loaded() && target->is_loaded()) {
|
|
1553 Value receiver = NULL;
|
|
1554 ciInstanceKlass* receiver_klass = NULL;
|
|
1555 bool type_is_exact = false;
|
|
1556 // try to find a precise receiver type
|
|
1557 if (will_link && !target->is_static()) {
|
|
1558 int index = state()->stack_size() - (target->arg_size_no_receiver() + 1);
|
|
1559 receiver = state()->stack_at(index);
|
|
1560 ciType* type = receiver->exact_type();
|
|
1561 if (type != NULL && type->is_loaded() &&
|
|
1562 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) {
|
|
1563 receiver_klass = (ciInstanceKlass*) type;
|
|
1564 type_is_exact = true;
|
|
1565 }
|
|
1566 if (type == NULL) {
|
|
1567 type = receiver->declared_type();
|
|
1568 if (type != NULL && type->is_loaded() &&
|
|
1569 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) {
|
|
1570 receiver_klass = (ciInstanceKlass*) type;
|
|
1571 if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) {
|
|
1572 // Insert a dependency on this type since
|
|
1573 // find_monomorphic_target may assume it's already done.
|
|
1574 dependency_recorder()->assert_leaf_type(receiver_klass);
|
|
1575 type_is_exact = true;
|
|
1576 }
|
|
1577 }
|
|
1578 }
|
|
1579 }
|
|
1580 if (receiver_klass != NULL && type_is_exact &&
|
|
1581 receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) {
|
|
1582 // If we have the exact receiver type we can bind directly to
|
|
1583 // the method to call.
|
|
1584 exact_target = target->resolve_invoke(calling_klass, receiver_klass);
|
|
1585 if (exact_target != NULL) {
|
|
1586 target = exact_target;
|
|
1587 code = Bytecodes::_invokespecial;
|
|
1588 }
|
|
1589 }
|
|
1590 if (receiver_klass != NULL &&
|
|
1591 receiver_klass->is_subtype_of(actual_recv) &&
|
|
1592 actual_recv->is_initialized()) {
|
|
1593 actual_recv = receiver_klass;
|
|
1594 }
|
|
1595
|
|
1596 if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) ||
|
|
1597 (code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) {
|
|
1598 // Use CHA on the receiver to select a more precise method.
|
|
1599 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv);
|
|
1600 } else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) {
|
|
1601 // if there is only one implementor of this interface then we
|
|
1602 // may be able bind this invoke directly to the implementing
|
|
1603 // klass but we need both a dependence on the single interface
|
|
1604 // and on the method we bind to. Additionally since all we know
|
|
1605 // about the receiver type is the it's supposed to implement the
|
|
1606 // interface we have to insert a check that it's the class we
|
|
1607 // expect. Interface types are not checked by the verifier so
|
|
1608 // they are roughly equivalent to Object.
|
|
1609 ciInstanceKlass* singleton = NULL;
|
|
1610 if (target->holder()->nof_implementors() == 1) {
|
|
1611 singleton = target->holder()->implementor(0);
|
|
1612 }
|
|
1613 if (singleton) {
|
|
1614 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton);
|
|
1615 if (cha_monomorphic_target != NULL) {
|
|
1616 // If CHA is able to bind this invoke then update the class
|
|
1617 // to match that class, otherwise klass will refer to the
|
|
1618 // interface.
|
|
1619 klass = cha_monomorphic_target->holder();
|
|
1620 actual_recv = target->holder();
|
|
1621
|
|
1622 // insert a check it's really the expected class.
|
|
1623 CheckCast* c = new CheckCast(klass, receiver, NULL);
|
|
1624 c->set_incompatible_class_change_check();
|
|
1625 c->set_direct_compare(klass->is_final());
|
|
1626 append_split(c);
|
|
1627 }
|
|
1628 }
|
|
1629 }
|
|
1630 }
|
|
1631
|
|
1632 if (cha_monomorphic_target != NULL) {
|
|
1633 if (cha_monomorphic_target->is_abstract()) {
|
|
1634 // Do not optimize for abstract methods
|
|
1635 cha_monomorphic_target = NULL;
|
|
1636 }
|
|
1637 }
|
|
1638
|
|
1639 if (cha_monomorphic_target != NULL) {
|
|
1640 if (!(target->is_final_method())) {
|
|
1641 // If we inlined because CHA revealed only a single target method,
|
|
1642 // then we are dependent on that target method not getting overridden
|
|
1643 // by dynamic class loading. Be sure to test the "static" receiver
|
|
1644 // dest_method here, as opposed to the actual receiver, which may
|
|
1645 // falsely lead us to believe that the receiver is final or private.
|
|
1646 dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target);
|
|
1647 }
|
|
1648 code = Bytecodes::_invokespecial;
|
|
1649 }
|
|
1650 // check if we could do inlining
|
|
1651 if (!PatchALot && Inline && klass->is_loaded() &&
|
|
1652 (klass->is_initialized() || klass->is_interface() && target->holder()->is_initialized())
|
|
1653 && target->will_link(klass, callee_holder, code)) {
|
|
1654 // callee is known => check if we have static binding
|
|
1655 assert(target->is_loaded(), "callee must be known");
|
|
1656 if (code == Bytecodes::_invokestatic
|
|
1657 || code == Bytecodes::_invokespecial
|
|
1658 || code == Bytecodes::_invokevirtual && target->is_final_method()
|
|
1659 ) {
|
|
1660 // static binding => check if callee is ok
|
|
1661 ciMethod* inline_target = (cha_monomorphic_target != NULL)
|
|
1662 ? cha_monomorphic_target
|
|
1663 : target;
|
|
1664 bool res = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL));
|
|
1665 CHECK_BAILOUT();
|
|
1666
|
|
1667 #ifndef PRODUCT
|
|
1668 // printing
|
|
1669 if (PrintInlining && !res) {
|
|
1670 // if it was successfully inlined, then it was already printed.
|
|
1671 print_inline_result(inline_target, res);
|
|
1672 }
|
|
1673 #endif
|
|
1674 clear_inline_bailout();
|
|
1675 if (res) {
|
|
1676 // Register dependence if JVMTI has either breakpoint
|
|
1677 // setting or hotswapping of methods capabilities since they may
|
|
1678 // cause deoptimization.
|
|
1679 if (JvmtiExport::can_hotswap_or_post_breakpoint()) {
|
|
1680 dependency_recorder()->assert_evol_method(inline_target);
|
|
1681 }
|
|
1682 return;
|
|
1683 }
|
|
1684 }
|
|
1685 }
|
|
1686 // If we attempted an inline which did not succeed because of a
|
|
1687 // bailout during construction of the callee graph, the entire
|
|
1688 // compilation has to be aborted. This is fairly rare and currently
|
|
1689 // seems to only occur for jasm-generated classes which contain
|
|
1690 // jsr/ret pairs which are not associated with finally clauses and
|
|
1691 // do not have exception handlers in the containing method, and are
|
|
1692 // therefore not caught early enough to abort the inlining without
|
|
1693 // corrupting the graph. (We currently bail out with a non-empty
|
|
1694 // stack at a ret in these situations.)
|
|
1695 CHECK_BAILOUT();
|
|
1696
|
|
1697 // inlining not successful => standard invoke
|
|
1698 bool is_static = code == Bytecodes::_invokestatic;
|
|
1699 ValueType* result_type = as_ValueType(target->return_type());
|
|
1700 Values* args = state()->pop_arguments(target->arg_size_no_receiver());
|
|
1701 Value recv = is_static ? NULL : apop();
|
|
1702 bool is_loaded = target->is_loaded();
|
|
1703 int vtable_index = methodOopDesc::invalid_vtable_index;
|
|
1704
|
|
1705 #ifdef SPARC
|
|
1706 // Currently only supported on Sparc.
|
|
1707 // The UseInlineCaches only controls dispatch to invokevirtuals for
|
|
1708 // loaded classes which we weren't able to statically bind.
|
|
1709 if (!UseInlineCaches && is_loaded && code == Bytecodes::_invokevirtual
|
|
1710 && !target->can_be_statically_bound()) {
|
|
1711 // Find a vtable index if one is available
|
|
1712 vtable_index = target->resolve_vtable_index(calling_klass, callee_holder);
|
|
1713 }
|
|
1714 #endif
|
|
1715
|
|
1716 if (recv != NULL &&
|
|
1717 (code == Bytecodes::_invokespecial ||
|
|
1718 !is_loaded || target->is_final() ||
|
|
1719 profile_calls())) {
|
|
1720 // invokespecial always needs a NULL check. invokevirtual where
|
|
1721 // the target is final or where it's not known that whether the
|
|
1722 // target is final requires a NULL check. Otherwise normal
|
|
1723 // invokevirtual will perform the null check during the lookup
|
|
1724 // logic or the unverified entry point. Profiling of calls
|
|
1725 // requires that the null check is performed in all cases.
|
|
1726 null_check(recv);
|
|
1727 }
|
|
1728
|
|
1729 if (profile_calls()) {
|
|
1730 assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set");
|
|
1731 ciKlass* target_klass = NULL;
|
|
1732 if (cha_monomorphic_target != NULL) {
|
|
1733 target_klass = cha_monomorphic_target->holder();
|
|
1734 } else if (exact_target != NULL) {
|
|
1735 target_klass = exact_target->holder();
|
|
1736 }
|
|
1737 profile_call(recv, target_klass);
|
|
1738 }
|
|
1739
|
|
1740 Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target);
|
|
1741 // push result
|
|
1742 append_split(result);
|
|
1743
|
|
1744 if (result_type != voidType) {
|
|
1745 if (method()->is_strict()) {
|
|
1746 push(result_type, round_fp(result));
|
|
1747 } else {
|
|
1748 push(result_type, result);
|
|
1749 }
|
|
1750 }
|
|
1751 }
|
|
1752
|
|
1753
|
|
1754 void GraphBuilder::new_instance(int klass_index) {
|
|
1755 bool will_link;
|
|
1756 ciKlass* klass = stream()->get_klass(will_link);
|
|
1757 assert(klass->is_instance_klass(), "must be an instance klass");
|
|
1758 NewInstance* new_instance = new NewInstance(klass->as_instance_klass());
|
|
1759 _memory->new_instance(new_instance);
|
|
1760 apush(append_split(new_instance));
|
|
1761 }
|
|
1762
|
|
1763
|
|
1764 void GraphBuilder::new_type_array() {
|
|
1765 apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index())));
|
|
1766 }
|
|
1767
|
|
1768
|
|
1769 void GraphBuilder::new_object_array() {
|
|
1770 bool will_link;
|
|
1771 ciKlass* klass = stream()->get_klass(will_link);
|
|
1772 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
1773 NewArray* n = new NewObjectArray(klass, ipop(), state_before);
|
|
1774 apush(append_split(n));
|
|
1775 }
|
|
1776
|
|
1777
|
|
1778 bool GraphBuilder::direct_compare(ciKlass* k) {
|
|
1779 if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) {
|
|
1780 ciInstanceKlass* ik = k->as_instance_klass();
|
|
1781 if (ik->is_final()) {
|
|
1782 return true;
|
|
1783 } else {
|
|
1784 if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) {
|
|
1785 // test class is leaf class
|
|
1786 dependency_recorder()->assert_leaf_type(ik);
|
|
1787 return true;
|
|
1788 }
|
|
1789 }
|
|
1790 }
|
|
1791 return false;
|
|
1792 }
|
|
1793
|
|
1794
|
|
1795 void GraphBuilder::check_cast(int klass_index) {
|
|
1796 bool will_link;
|
|
1797 ciKlass* klass = stream()->get_klass(will_link);
|
|
1798 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
1799 CheckCast* c = new CheckCast(klass, apop(), state_before);
|
|
1800 apush(append_split(c));
|
|
1801 c->set_direct_compare(direct_compare(klass));
|
|
1802 if (profile_checkcasts()) {
|
|
1803 c->set_profiled_method(method());
|
|
1804 c->set_profiled_bci(bci());
|
|
1805 c->set_should_profile(true);
|
|
1806 }
|
|
1807 }
|
|
1808
|
|
1809
|
|
1810 void GraphBuilder::instance_of(int klass_index) {
|
|
1811 bool will_link;
|
|
1812 ciKlass* klass = stream()->get_klass(will_link);
|
|
1813 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
1814 InstanceOf* i = new InstanceOf(klass, apop(), state_before);
|
|
1815 ipush(append_split(i));
|
|
1816 i->set_direct_compare(direct_compare(klass));
|
|
1817 }
|
|
1818
|
|
1819
|
|
1820 void GraphBuilder::monitorenter(Value x, int bci) {
|
|
1821 // save state before locking in case of deoptimization after a NullPointerException
|
|
1822 ValueStack* lock_stack_before = lock_stack();
|
|
1823 append_with_bci(new MonitorEnter(x, state()->lock(scope(), x), lock_stack_before), bci);
|
|
1824 kill_all();
|
|
1825 }
|
|
1826
|
|
1827
|
|
1828 void GraphBuilder::monitorexit(Value x, int bci) {
|
|
1829 // Note: the comment below is only relevant for the case where we do
|
|
1830 // not deoptimize due to asynchronous exceptions (!(DeoptC1 &&
|
|
1831 // DeoptOnAsyncException), which is not used anymore)
|
|
1832
|
|
1833 // Note: Potentially, the monitor state in an exception handler
|
|
1834 // can be wrong due to wrong 'initialization' of the handler
|
|
1835 // via a wrong asynchronous exception path. This can happen,
|
|
1836 // if the exception handler range for asynchronous exceptions
|
|
1837 // is too long (see also java bug 4327029, and comment in
|
|
1838 // GraphBuilder::handle_exception()). This may cause 'under-
|
|
1839 // flow' of the monitor stack => bailout instead.
|
|
1840 if (state()->locks_size() < 1) BAILOUT("monitor stack underflow");
|
|
1841 append_with_bci(new MonitorExit(x, state()->unlock()), bci);
|
|
1842 kill_all();
|
|
1843 }
|
|
1844
|
|
1845
|
|
1846 void GraphBuilder::new_multi_array(int dimensions) {
|
|
1847 bool will_link;
|
|
1848 ciKlass* klass = stream()->get_klass(will_link);
|
|
1849 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL;
|
|
1850
|
|
1851 Values* dims = new Values(dimensions, NULL);
|
|
1852 // fill in all dimensions
|
|
1853 int i = dimensions;
|
|
1854 while (i-- > 0) dims->at_put(i, ipop());
|
|
1855 // create array
|
|
1856 NewArray* n = new NewMultiArray(klass, dims, state_before);
|
|
1857 apush(append_split(n));
|
|
1858 }
|
|
1859
|
|
1860
|
|
1861 void GraphBuilder::throw_op(int bci) {
|
|
1862 // We require that the debug info for a Throw be the "state before"
|
|
1863 // the Throw (i.e., exception oop is still on TOS)
|
|
1864 ValueStack* state_before = state()->copy();
|
|
1865 Throw* t = new Throw(apop(), state_before);
|
|
1866 append_with_bci(t, bci);
|
|
1867 }
|
|
1868
|
|
1869
|
|
1870 Value GraphBuilder::round_fp(Value fp_value) {
|
|
1871 // no rounding needed if SSE2 is used
|
|
1872 if (RoundFPResults && UseSSE < 2) {
|
|
1873 // Must currently insert rounding node for doubleword values that
|
|
1874 // are results of expressions (i.e., not loads from memory or
|
|
1875 // constants)
|
|
1876 if (fp_value->type()->tag() == doubleTag &&
|
|
1877 fp_value->as_Constant() == NULL &&
|
|
1878 fp_value->as_Local() == NULL && // method parameters need no rounding
|
|
1879 fp_value->as_RoundFP() == NULL) {
|
|
1880 return append(new RoundFP(fp_value));
|
|
1881 }
|
|
1882 }
|
|
1883 return fp_value;
|
|
1884 }
|
|
1885
|
|
1886
|
|
1887 Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) {
|
|
1888 Canonicalizer canon(instr, bci);
|
|
1889 Instruction* i1 = canon.canonical();
|
|
1890 if (i1->bci() != -99) {
|
|
1891 // Canonicalizer returned an instruction which was already
|
|
1892 // appended so simply return it.
|
|
1893 return i1;
|
|
1894 } else if (UseLocalValueNumbering) {
|
|
1895 // Lookup the instruction in the ValueMap and add it to the map if
|
|
1896 // it's not found.
|
|
1897 Instruction* i2 = vmap()->find_insert(i1);
|
|
1898 if (i2 != i1) {
|
|
1899 // found an entry in the value map, so just return it.
|
|
1900 assert(i2->bci() != -1, "should already be linked");
|
|
1901 return i2;
|
|
1902 }
|
|
1903 }
|
|
1904
|
|
1905 if (i1->as_Phi() == NULL && i1->as_Local() == NULL) {
|
|
1906 // i1 was not eliminated => append it
|
|
1907 assert(i1->next() == NULL, "shouldn't already be linked");
|
|
1908 _last = _last->set_next(i1, canon.bci());
|
|
1909 if (++_instruction_count >= InstructionCountCutoff
|
|
1910 && !bailed_out()) {
|
|
1911 // set the bailout state but complete normal processing. We
|
|
1912 // might do a little more work before noticing the bailout so we
|
|
1913 // want processing to continue normally until it's noticed.
|
|
1914 bailout("Method and/or inlining is too large");
|
|
1915 }
|
|
1916
|
|
1917 #ifndef PRODUCT
|
|
1918 if (PrintIRDuringConstruction) {
|
|
1919 InstructionPrinter ip;
|
|
1920 ip.print_line(i1);
|
|
1921 if (Verbose) {
|
|
1922 state()->print();
|
|
1923 }
|
|
1924 }
|
|
1925 #endif
|
|
1926 assert(_last == i1, "adjust code below");
|
|
1927 StateSplit* s = i1->as_StateSplit();
|
|
1928 if (s != NULL && i1->as_BlockEnd() == NULL) {
|
|
1929 // Continue CSE across certain intrinsics
|
|
1930 Intrinsic* intrinsic = s->as_Intrinsic();
|
|
1931 if (UseLocalValueNumbering) {
|
|
1932 if (intrinsic == NULL || !intrinsic->preserves_state()) {
|
|
1933 vmap()->kill_all(); // for now, hopefully we need this only for calls eventually
|
|
1934 }
|
|
1935 }
|
|
1936 if (EliminateFieldAccess) {
|
|
1937 if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) {
|
|
1938 _memory->kill();
|
|
1939 }
|
|
1940 }
|
|
1941 s->set_state(state()->copy());
|
|
1942 }
|
|
1943 // set up exception handlers for this instruction if necessary
|
|
1944 if (i1->can_trap()) {
|
|
1945 assert(exception_state() != NULL || !has_handler(), "must have setup exception state");
|
|
1946 i1->set_exception_handlers(handle_exception(bci));
|
|
1947 }
|
|
1948 }
|
|
1949 return i1;
|
|
1950 }
|
|
1951
|
|
1952
|
|
1953 Instruction* GraphBuilder::append(Instruction* instr) {
|
|
1954 assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used");
|
|
1955 return append_with_bci(instr, bci());
|
|
1956 }
|
|
1957
|
|
1958
|
|
1959 Instruction* GraphBuilder::append_split(StateSplit* instr) {
|
|
1960 return append_with_bci(instr, bci());
|
|
1961 }
|
|
1962
|
|
1963
|
|
1964 void GraphBuilder::null_check(Value value) {
|
|
1965 if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) {
|
|
1966 return;
|
|
1967 } else {
|
|
1968 Constant* con = value->as_Constant();
|
|
1969 if (con) {
|
|
1970 ObjectType* c = con->type()->as_ObjectType();
|
|
1971 if (c && c->is_loaded()) {
|
|
1972 ObjectConstant* oc = c->as_ObjectConstant();
|
|
1973 if (!oc || !oc->value()->is_null_object()) {
|
|
1974 return;
|
|
1975 }
|
|
1976 }
|
|
1977 }
|
|
1978 }
|
|
1979 append(new NullCheck(value, lock_stack()));
|
|
1980 }
|
|
1981
|
|
1982
|
|
1983
|
|
1984 XHandlers* GraphBuilder::handle_exception(int cur_bci) {
|
|
1985 // fast path if it is guaranteed that no exception handlers are present
|
|
1986 if (!has_handler()) {
|
|
1987 // TODO: check if return NULL is possible (avoids empty lists)
|
|
1988 return new XHandlers();
|
|
1989 }
|
|
1990
|
|
1991 XHandlers* exception_handlers = new XHandlers();
|
|
1992 ScopeData* cur_scope_data = scope_data();
|
|
1993 ValueStack* s = exception_state();
|
|
1994 int scope_count = 0;
|
|
1995
|
|
1996 assert(s != NULL, "exception state must be set");
|
|
1997 do {
|
|
1998 assert(cur_scope_data->scope() == s->scope(), "scopes do not match");
|
|
1999 assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci");
|
|
2000
|
|
2001 // join with all potential exception handlers
|
|
2002 XHandlers* list = cur_scope_data->xhandlers();
|
|
2003 const int n = list->length();
|
|
2004 for (int i = 0; i < n; i++) {
|
|
2005 XHandler* h = list->handler_at(i);
|
|
2006 if (h->covers(cur_bci)) {
|
|
2007 // h is a potential exception handler => join it
|
|
2008 compilation()->set_has_exception_handlers(true);
|
|
2009
|
|
2010 BlockBegin* entry = h->entry_block();
|
|
2011 if (entry == block()) {
|
|
2012 // It's acceptable for an exception handler to cover itself
|
|
2013 // but we don't handle that in the parser currently. It's
|
|
2014 // very rare so we bailout instead of trying to handle it.
|
|
2015 BAILOUT_("exception handler covers itself", exception_handlers);
|
|
2016 }
|
|
2017 assert(entry->bci() == h->handler_bci(), "must match");
|
|
2018 assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond");
|
|
2019
|
|
2020 // previously this was a BAILOUT, but this is not necessary
|
|
2021 // now because asynchronous exceptions are not handled this way.
|
|
2022 assert(entry->state() == NULL || s->locks_size() == entry->state()->locks_size(), "locks do not match");
|
|
2023
|
|
2024 // xhandler start with an empty expression stack
|
|
2025 s->truncate_stack(cur_scope_data->caller_stack_size());
|
|
2026
|
|
2027 // Note: Usually this join must work. However, very
|
|
2028 // complicated jsr-ret structures where we don't ret from
|
|
2029 // the subroutine can cause the objects on the monitor
|
|
2030 // stacks to not match because blocks can be parsed twice.
|
|
2031 // The only test case we've seen so far which exhibits this
|
|
2032 // problem is caught by the infinite recursion test in
|
|
2033 // GraphBuilder::jsr() if the join doesn't work.
|
|
2034 if (!entry->try_merge(s)) {
|
|
2035 BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers);
|
|
2036 }
|
|
2037
|
|
2038 // add current state for correct handling of phi functions at begin of xhandler
|
|
2039 int phi_operand = entry->add_exception_state(s);
|
|
2040
|
|
2041 // add entry to the list of xhandlers of this block
|
|
2042 _block->add_exception_handler(entry);
|
|
2043
|
|
2044 // add back-edge from xhandler entry to this block
|
|
2045 if (!entry->is_predecessor(_block)) {
|
|
2046 entry->add_predecessor(_block);
|
|
2047 }
|
|
2048
|
|
2049 // clone XHandler because phi_operand and scope_count can not be shared
|
|
2050 XHandler* new_xhandler = new XHandler(h);
|
|
2051 new_xhandler->set_phi_operand(phi_operand);
|
|
2052 new_xhandler->set_scope_count(scope_count);
|
|
2053 exception_handlers->append(new_xhandler);
|
|
2054
|
|
2055 // fill in exception handler subgraph lazily
|
|
2056 assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet");
|
|
2057 cur_scope_data->add_to_work_list(entry);
|
|
2058
|
|
2059 // stop when reaching catchall
|
|
2060 if (h->catch_type() == 0) {
|
|
2061 return exception_handlers;
|
|
2062 }
|
|
2063 }
|
|
2064 }
|
|
2065
|
|
2066 // Set up iteration for next time.
|
|
2067 // If parsing a jsr, do not grab exception handlers from the
|
|
2068 // parent scopes for this method (already got them, and they
|
|
2069 // needed to be cloned)
|
|
2070 if (cur_scope_data->parsing_jsr()) {
|
|
2071 IRScope* tmp_scope = cur_scope_data->scope();
|
|
2072 while (cur_scope_data->parent() != NULL &&
|
|
2073 cur_scope_data->parent()->scope() == tmp_scope) {
|
|
2074 cur_scope_data = cur_scope_data->parent();
|
|
2075 }
|
|
2076 }
|
|
2077 if (cur_scope_data != NULL) {
|
|
2078 if (cur_scope_data->parent() != NULL) {
|
|
2079 // must use pop_scope instead of caller_state to preserve all monitors
|
|
2080 s = s->pop_scope();
|
|
2081 }
|
|
2082 cur_bci = cur_scope_data->scope()->caller_bci();
|
|
2083 cur_scope_data = cur_scope_data->parent();
|
|
2084 scope_count++;
|
|
2085 }
|
|
2086 } while (cur_scope_data != NULL);
|
|
2087
|
|
2088 return exception_handlers;
|
|
2089 }
|
|
2090
|
|
2091
|
|
2092 // Helper class for simplifying Phis.
|
|
2093 class PhiSimplifier : public BlockClosure {
|
|
2094 private:
|
|
2095 bool _has_substitutions;
|
|
2096 Value simplify(Value v);
|
|
2097
|
|
2098 public:
|
|
2099 PhiSimplifier(BlockBegin* start) : _has_substitutions(false) {
|
|
2100 start->iterate_preorder(this);
|
|
2101 if (_has_substitutions) {
|
|
2102 SubstitutionResolver sr(start);
|
|
2103 }
|
|
2104 }
|
|
2105 void block_do(BlockBegin* b);
|
|
2106 bool has_substitutions() const { return _has_substitutions; }
|
|
2107 };
|
|
2108
|
|
2109
|
|
2110 Value PhiSimplifier::simplify(Value v) {
|
|
2111 Phi* phi = v->as_Phi();
|
|
2112
|
|
2113 if (phi == NULL) {
|
|
2114 // no phi function
|
|
2115 return v;
|
|
2116 } else if (v->has_subst()) {
|
|
2117 // already substituted; subst can be phi itself -> simplify
|
|
2118 return simplify(v->subst());
|
|
2119 } else if (phi->is_set(Phi::cannot_simplify)) {
|
|
2120 // already tried to simplify phi before
|
|
2121 return phi;
|
|
2122 } else if (phi->is_set(Phi::visited)) {
|
|
2123 // break cycles in phi functions
|
|
2124 return phi;
|
|
2125 } else if (phi->type()->is_illegal()) {
|
|
2126 // illegal phi functions are ignored anyway
|
|
2127 return phi;
|
|
2128
|
|
2129 } else {
|
|
2130 // mark phi function as processed to break cycles in phi functions
|
|
2131 phi->set(Phi::visited);
|
|
2132
|
|
2133 // simplify x = [y, x] and x = [y, y] to y
|
|
2134 Value subst = NULL;
|
|
2135 int opd_count = phi->operand_count();
|
|
2136 for (int i = 0; i < opd_count; i++) {
|
|
2137 Value opd = phi->operand_at(i);
|
|
2138 assert(opd != NULL, "Operand must exist!");
|
|
2139
|
|
2140 if (opd->type()->is_illegal()) {
|
|
2141 // if one operand is illegal, the entire phi function is illegal
|
|
2142 phi->make_illegal();
|
|
2143 phi->clear(Phi::visited);
|
|
2144 return phi;
|
|
2145 }
|
|
2146
|
|
2147 Value new_opd = simplify(opd);
|
|
2148 assert(new_opd != NULL, "Simplified operand must exist!");
|
|
2149
|
|
2150 if (new_opd != phi && new_opd != subst) {
|
|
2151 if (subst == NULL) {
|
|
2152 subst = new_opd;
|
|
2153 } else {
|
|
2154 // no simplification possible
|
|
2155 phi->set(Phi::cannot_simplify);
|
|
2156 phi->clear(Phi::visited);
|
|
2157 return phi;
|
|
2158 }
|
|
2159 }
|
|
2160 }
|
|
2161
|
|
2162 // sucessfully simplified phi function
|
|
2163 assert(subst != NULL, "illegal phi function");
|
|
2164 _has_substitutions = true;
|
|
2165 phi->clear(Phi::visited);
|
|
2166 phi->set_subst(subst);
|
|
2167
|
|
2168 #ifndef PRODUCT
|
|
2169 if (PrintPhiFunctions) {
|
|
2170 tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id());
|
|
2171 }
|
|
2172 #endif
|
|
2173
|
|
2174 return subst;
|
|
2175 }
|
|
2176 }
|
|
2177
|
|
2178
|
|
2179 void PhiSimplifier::block_do(BlockBegin* b) {
|
|
2180 for_each_phi_fun(b, phi,
|
|
2181 simplify(phi);
|
|
2182 );
|
|
2183
|
|
2184 #ifdef ASSERT
|
|
2185 for_each_phi_fun(b, phi,
|
|
2186 assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification");
|
|
2187 );
|
|
2188
|
|
2189 ValueStack* state = b->state()->caller_state();
|
|
2190 int index;
|
|
2191 Value value;
|
|
2192 for_each_state(state) {
|
|
2193 for_each_local_value(state, index, value) {
|
|
2194 Phi* phi = value->as_Phi();
|
|
2195 assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state");
|
|
2196 }
|
|
2197 }
|
|
2198 #endif
|
|
2199 }
|
|
2200
|
|
2201 // This method is called after all blocks are filled with HIR instructions
|
|
2202 // It eliminates all Phi functions of the form x = [y, y] and x = [y, x]
|
|
2203 void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) {
|
|
2204 PhiSimplifier simplifier(start);
|
|
2205 }
|
|
2206
|
|
2207
|
|
2208 void GraphBuilder::connect_to_end(BlockBegin* beg) {
|
|
2209 // setup iteration
|
|
2210 kill_all();
|
|
2211 _block = beg;
|
|
2212 _state = beg->state()->copy();
|
|
2213 _last = beg;
|
|
2214 iterate_bytecodes_for_block(beg->bci());
|
|
2215 }
|
|
2216
|
|
2217
|
|
2218 BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) {
|
|
2219 #ifndef PRODUCT
|
|
2220 if (PrintIRDuringConstruction) {
|
|
2221 tty->cr();
|
|
2222 InstructionPrinter ip;
|
|
2223 ip.print_instr(_block); tty->cr();
|
|
2224 ip.print_stack(_block->state()); tty->cr();
|
|
2225 ip.print_inline_level(_block);
|
|
2226 ip.print_head();
|
|
2227 tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size());
|
|
2228 }
|
|
2229 #endif
|
|
2230 _skip_block = false;
|
|
2231 assert(state() != NULL, "ValueStack missing!");
|
|
2232 ciBytecodeStream s(method());
|
|
2233 s.reset_to_bci(bci);
|
|
2234 int prev_bci = bci;
|
|
2235 scope_data()->set_stream(&s);
|
|
2236 // iterate
|
|
2237 Bytecodes::Code code = Bytecodes::_illegal;
|
|
2238 bool push_exception = false;
|
|
2239
|
|
2240 if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) {
|
|
2241 // first thing in the exception entry block should be the exception object.
|
|
2242 push_exception = true;
|
|
2243 }
|
|
2244
|
|
2245 while (!bailed_out() && last()->as_BlockEnd() == NULL &&
|
|
2246 (code = stream()->next()) != ciBytecodeStream::EOBC() &&
|
|
2247 (block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) {
|
|
2248
|
|
2249 if (has_handler() && can_trap(method(), code)) {
|
|
2250 // copy the state because it is modified before handle_exception is called
|
|
2251 set_exception_state(state()->copy());
|
|
2252 } else {
|
|
2253 // handle_exception is not called for this bytecode
|
|
2254 set_exception_state(NULL);
|
|
2255 }
|
|
2256
|
|
2257 // Check for active jsr during OSR compilation
|
|
2258 if (compilation()->is_osr_compile()
|
|
2259 && scope()->is_top_scope()
|
|
2260 && parsing_jsr()
|
|
2261 && s.cur_bci() == compilation()->osr_bci()) {
|
|
2262 bailout("OSR not supported while a jsr is active");
|
|
2263 }
|
|
2264
|
|
2265 if (push_exception) {
|
|
2266 apush(append(new ExceptionObject()));
|
|
2267 push_exception = false;
|
|
2268 }
|
|
2269
|
|
2270 // handle bytecode
|
|
2271 switch (code) {
|
|
2272 case Bytecodes::_nop : /* nothing to do */ break;
|
|
2273 case Bytecodes::_aconst_null : apush(append(new Constant(objectNull ))); break;
|
|
2274 case Bytecodes::_iconst_m1 : ipush(append(new Constant(new IntConstant (-1)))); break;
|
|
2275 case Bytecodes::_iconst_0 : ipush(append(new Constant(intZero ))); break;
|
|
2276 case Bytecodes::_iconst_1 : ipush(append(new Constant(intOne ))); break;
|
|
2277 case Bytecodes::_iconst_2 : ipush(append(new Constant(new IntConstant ( 2)))); break;
|
|
2278 case Bytecodes::_iconst_3 : ipush(append(new Constant(new IntConstant ( 3)))); break;
|
|
2279 case Bytecodes::_iconst_4 : ipush(append(new Constant(new IntConstant ( 4)))); break;
|
|
2280 case Bytecodes::_iconst_5 : ipush(append(new Constant(new IntConstant ( 5)))); break;
|
|
2281 case Bytecodes::_lconst_0 : lpush(append(new Constant(new LongConstant ( 0)))); break;
|
|
2282 case Bytecodes::_lconst_1 : lpush(append(new Constant(new LongConstant ( 1)))); break;
|
|
2283 case Bytecodes::_fconst_0 : fpush(append(new Constant(new FloatConstant ( 0)))); break;
|
|
2284 case Bytecodes::_fconst_1 : fpush(append(new Constant(new FloatConstant ( 1)))); break;
|
|
2285 case Bytecodes::_fconst_2 : fpush(append(new Constant(new FloatConstant ( 2)))); break;
|
|
2286 case Bytecodes::_dconst_0 : dpush(append(new Constant(new DoubleConstant( 0)))); break;
|
|
2287 case Bytecodes::_dconst_1 : dpush(append(new Constant(new DoubleConstant( 1)))); break;
|
|
2288 case Bytecodes::_bipush : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break;
|
|
2289 case Bytecodes::_sipush : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break;
|
|
2290 case Bytecodes::_ldc : // fall through
|
|
2291 case Bytecodes::_ldc_w : // fall through
|
|
2292 case Bytecodes::_ldc2_w : load_constant(); break;
|
|
2293 case Bytecodes::_iload : load_local(intType , s.get_index()); break;
|
|
2294 case Bytecodes::_lload : load_local(longType , s.get_index()); break;
|
|
2295 case Bytecodes::_fload : load_local(floatType , s.get_index()); break;
|
|
2296 case Bytecodes::_dload : load_local(doubleType , s.get_index()); break;
|
|
2297 case Bytecodes::_aload : load_local(instanceType, s.get_index()); break;
|
|
2298 case Bytecodes::_iload_0 : load_local(intType , 0); break;
|
|
2299 case Bytecodes::_iload_1 : load_local(intType , 1); break;
|
|
2300 case Bytecodes::_iload_2 : load_local(intType , 2); break;
|
|
2301 case Bytecodes::_iload_3 : load_local(intType , 3); break;
|
|
2302 case Bytecodes::_lload_0 : load_local(longType , 0); break;
|
|
2303 case Bytecodes::_lload_1 : load_local(longType , 1); break;
|
|
2304 case Bytecodes::_lload_2 : load_local(longType , 2); break;
|
|
2305 case Bytecodes::_lload_3 : load_local(longType , 3); break;
|
|
2306 case Bytecodes::_fload_0 : load_local(floatType , 0); break;
|
|
2307 case Bytecodes::_fload_1 : load_local(floatType , 1); break;
|
|
2308 case Bytecodes::_fload_2 : load_local(floatType , 2); break;
|
|
2309 case Bytecodes::_fload_3 : load_local(floatType , 3); break;
|
|
2310 case Bytecodes::_dload_0 : load_local(doubleType, 0); break;
|
|
2311 case Bytecodes::_dload_1 : load_local(doubleType, 1); break;
|
|
2312 case Bytecodes::_dload_2 : load_local(doubleType, 2); break;
|
|
2313 case Bytecodes::_dload_3 : load_local(doubleType, 3); break;
|
|
2314 case Bytecodes::_aload_0 : load_local(objectType, 0); break;
|
|
2315 case Bytecodes::_aload_1 : load_local(objectType, 1); break;
|
|
2316 case Bytecodes::_aload_2 : load_local(objectType, 2); break;
|
|
2317 case Bytecodes::_aload_3 : load_local(objectType, 3); break;
|
|
2318 case Bytecodes::_iaload : load_indexed(T_INT ); break;
|
|
2319 case Bytecodes::_laload : load_indexed(T_LONG ); break;
|
|
2320 case Bytecodes::_faload : load_indexed(T_FLOAT ); break;
|
|
2321 case Bytecodes::_daload : load_indexed(T_DOUBLE); break;
|
|
2322 case Bytecodes::_aaload : load_indexed(T_OBJECT); break;
|
|
2323 case Bytecodes::_baload : load_indexed(T_BYTE ); break;
|
|
2324 case Bytecodes::_caload : load_indexed(T_CHAR ); break;
|
|
2325 case Bytecodes::_saload : load_indexed(T_SHORT ); break;
|
|
2326 case Bytecodes::_istore : store_local(intType , s.get_index()); break;
|
|
2327 case Bytecodes::_lstore : store_local(longType , s.get_index()); break;
|
|
2328 case Bytecodes::_fstore : store_local(floatType , s.get_index()); break;
|
|
2329 case Bytecodes::_dstore : store_local(doubleType, s.get_index()); break;
|
|
2330 case Bytecodes::_astore : store_local(objectType, s.get_index()); break;
|
|
2331 case Bytecodes::_istore_0 : store_local(intType , 0); break;
|
|
2332 case Bytecodes::_istore_1 : store_local(intType , 1); break;
|
|
2333 case Bytecodes::_istore_2 : store_local(intType , 2); break;
|
|
2334 case Bytecodes::_istore_3 : store_local(intType , 3); break;
|
|
2335 case Bytecodes::_lstore_0 : store_local(longType , 0); break;
|
|
2336 case Bytecodes::_lstore_1 : store_local(longType , 1); break;
|
|
2337 case Bytecodes::_lstore_2 : store_local(longType , 2); break;
|
|
2338 case Bytecodes::_lstore_3 : store_local(longType , 3); break;
|
|
2339 case Bytecodes::_fstore_0 : store_local(floatType , 0); break;
|
|
2340 case Bytecodes::_fstore_1 : store_local(floatType , 1); break;
|
|
2341 case Bytecodes::_fstore_2 : store_local(floatType , 2); break;
|
|
2342 case Bytecodes::_fstore_3 : store_local(floatType , 3); break;
|
|
2343 case Bytecodes::_dstore_0 : store_local(doubleType, 0); break;
|
|
2344 case Bytecodes::_dstore_1 : store_local(doubleType, 1); break;
|
|
2345 case Bytecodes::_dstore_2 : store_local(doubleType, 2); break;
|
|
2346 case Bytecodes::_dstore_3 : store_local(doubleType, 3); break;
|
|
2347 case Bytecodes::_astore_0 : store_local(objectType, 0); break;
|
|
2348 case Bytecodes::_astore_1 : store_local(objectType, 1); break;
|
|
2349 case Bytecodes::_astore_2 : store_local(objectType, 2); break;
|
|
2350 case Bytecodes::_astore_3 : store_local(objectType, 3); break;
|
|
2351 case Bytecodes::_iastore : store_indexed(T_INT ); break;
|
|
2352 case Bytecodes::_lastore : store_indexed(T_LONG ); break;
|
|
2353 case Bytecodes::_fastore : store_indexed(T_FLOAT ); break;
|
|
2354 case Bytecodes::_dastore : store_indexed(T_DOUBLE); break;
|
|
2355 case Bytecodes::_aastore : store_indexed(T_OBJECT); break;
|
|
2356 case Bytecodes::_bastore : store_indexed(T_BYTE ); break;
|
|
2357 case Bytecodes::_castore : store_indexed(T_CHAR ); break;
|
|
2358 case Bytecodes::_sastore : store_indexed(T_SHORT ); break;
|
|
2359 case Bytecodes::_pop : // fall through
|
|
2360 case Bytecodes::_pop2 : // fall through
|
|
2361 case Bytecodes::_dup : // fall through
|
|
2362 case Bytecodes::_dup_x1 : // fall through
|
|
2363 case Bytecodes::_dup_x2 : // fall through
|
|
2364 case Bytecodes::_dup2 : // fall through
|
|
2365 case Bytecodes::_dup2_x1 : // fall through
|
|
2366 case Bytecodes::_dup2_x2 : // fall through
|
|
2367 case Bytecodes::_swap : stack_op(code); break;
|
|
2368 case Bytecodes::_iadd : arithmetic_op(intType , code); break;
|
|
2369 case Bytecodes::_ladd : arithmetic_op(longType , code); break;
|
|
2370 case Bytecodes::_fadd : arithmetic_op(floatType , code); break;
|
|
2371 case Bytecodes::_dadd : arithmetic_op(doubleType, code); break;
|
|
2372 case Bytecodes::_isub : arithmetic_op(intType , code); break;
|
|
2373 case Bytecodes::_lsub : arithmetic_op(longType , code); break;
|
|
2374 case Bytecodes::_fsub : arithmetic_op(floatType , code); break;
|
|
2375 case Bytecodes::_dsub : arithmetic_op(doubleType, code); break;
|
|
2376 case Bytecodes::_imul : arithmetic_op(intType , code); break;
|
|
2377 case Bytecodes::_lmul : arithmetic_op(longType , code); break;
|
|
2378 case Bytecodes::_fmul : arithmetic_op(floatType , code); break;
|
|
2379 case Bytecodes::_dmul : arithmetic_op(doubleType, code); break;
|
|
2380 case Bytecodes::_idiv : arithmetic_op(intType , code, lock_stack()); break;
|
|
2381 case Bytecodes::_ldiv : arithmetic_op(longType , code, lock_stack()); break;
|
|
2382 case Bytecodes::_fdiv : arithmetic_op(floatType , code); break;
|
|
2383 case Bytecodes::_ddiv : arithmetic_op(doubleType, code); break;
|
|
2384 case Bytecodes::_irem : arithmetic_op(intType , code, lock_stack()); break;
|
|
2385 case Bytecodes::_lrem : arithmetic_op(longType , code, lock_stack()); break;
|
|
2386 case Bytecodes::_frem : arithmetic_op(floatType , code); break;
|
|
2387 case Bytecodes::_drem : arithmetic_op(doubleType, code); break;
|
|
2388 case Bytecodes::_ineg : negate_op(intType ); break;
|
|
2389 case Bytecodes::_lneg : negate_op(longType ); break;
|
|
2390 case Bytecodes::_fneg : negate_op(floatType ); break;
|
|
2391 case Bytecodes::_dneg : negate_op(doubleType); break;
|
|
2392 case Bytecodes::_ishl : shift_op(intType , code); break;
|
|
2393 case Bytecodes::_lshl : shift_op(longType, code); break;
|
|
2394 case Bytecodes::_ishr : shift_op(intType , code); break;
|
|
2395 case Bytecodes::_lshr : shift_op(longType, code); break;
|
|
2396 case Bytecodes::_iushr : shift_op(intType , code); break;
|
|
2397 case Bytecodes::_lushr : shift_op(longType, code); break;
|
|
2398 case Bytecodes::_iand : logic_op(intType , code); break;
|
|
2399 case Bytecodes::_land : logic_op(longType, code); break;
|
|
2400 case Bytecodes::_ior : logic_op(intType , code); break;
|
|
2401 case Bytecodes::_lor : logic_op(longType, code); break;
|
|
2402 case Bytecodes::_ixor : logic_op(intType , code); break;
|
|
2403 case Bytecodes::_lxor : logic_op(longType, code); break;
|
|
2404 case Bytecodes::_iinc : increment(); break;
|
|
2405 case Bytecodes::_i2l : convert(code, T_INT , T_LONG ); break;
|
|
2406 case Bytecodes::_i2f : convert(code, T_INT , T_FLOAT ); break;
|
|
2407 case Bytecodes::_i2d : convert(code, T_INT , T_DOUBLE); break;
|
|
2408 case Bytecodes::_l2i : convert(code, T_LONG , T_INT ); break;
|
|
2409 case Bytecodes::_l2f : convert(code, T_LONG , T_FLOAT ); break;
|
|
2410 case Bytecodes::_l2d : convert(code, T_LONG , T_DOUBLE); break;
|
|
2411 case Bytecodes::_f2i : convert(code, T_FLOAT , T_INT ); break;
|
|
2412 case Bytecodes::_f2l : convert(code, T_FLOAT , T_LONG ); break;
|
|
2413 case Bytecodes::_f2d : convert(code, T_FLOAT , T_DOUBLE); break;
|
|
2414 case Bytecodes::_d2i : convert(code, T_DOUBLE, T_INT ); break;
|
|
2415 case Bytecodes::_d2l : convert(code, T_DOUBLE, T_LONG ); break;
|
|
2416 case Bytecodes::_d2f : convert(code, T_DOUBLE, T_FLOAT ); break;
|
|
2417 case Bytecodes::_i2b : convert(code, T_INT , T_BYTE ); break;
|
|
2418 case Bytecodes::_i2c : convert(code, T_INT , T_CHAR ); break;
|
|
2419 case Bytecodes::_i2s : convert(code, T_INT , T_SHORT ); break;
|
|
2420 case Bytecodes::_lcmp : compare_op(longType , code); break;
|
|
2421 case Bytecodes::_fcmpl : compare_op(floatType , code); break;
|
|
2422 case Bytecodes::_fcmpg : compare_op(floatType , code); break;
|
|
2423 case Bytecodes::_dcmpl : compare_op(doubleType, code); break;
|
|
2424 case Bytecodes::_dcmpg : compare_op(doubleType, code); break;
|
|
2425 case Bytecodes::_ifeq : if_zero(intType , If::eql); break;
|
|
2426 case Bytecodes::_ifne : if_zero(intType , If::neq); break;
|
|
2427 case Bytecodes::_iflt : if_zero(intType , If::lss); break;
|
|
2428 case Bytecodes::_ifge : if_zero(intType , If::geq); break;
|
|
2429 case Bytecodes::_ifgt : if_zero(intType , If::gtr); break;
|
|
2430 case Bytecodes::_ifle : if_zero(intType , If::leq); break;
|
|
2431 case Bytecodes::_if_icmpeq : if_same(intType , If::eql); break;
|
|
2432 case Bytecodes::_if_icmpne : if_same(intType , If::neq); break;
|
|
2433 case Bytecodes::_if_icmplt : if_same(intType , If::lss); break;
|
|
2434 case Bytecodes::_if_icmpge : if_same(intType , If::geq); break;
|
|
2435 case Bytecodes::_if_icmpgt : if_same(intType , If::gtr); break;
|
|
2436 case Bytecodes::_if_icmple : if_same(intType , If::leq); break;
|
|
2437 case Bytecodes::_if_acmpeq : if_same(objectType, If::eql); break;
|
|
2438 case Bytecodes::_if_acmpne : if_same(objectType, If::neq); break;
|
|
2439 case Bytecodes::_goto : _goto(s.cur_bci(), s.get_dest()); break;
|
|
2440 case Bytecodes::_jsr : jsr(s.get_dest()); break;
|
|
2441 case Bytecodes::_ret : ret(s.get_index()); break;
|
|
2442 case Bytecodes::_tableswitch : table_switch(); break;
|
|
2443 case Bytecodes::_lookupswitch : lookup_switch(); break;
|
|
2444 case Bytecodes::_ireturn : method_return(ipop()); break;
|
|
2445 case Bytecodes::_lreturn : method_return(lpop()); break;
|
|
2446 case Bytecodes::_freturn : method_return(fpop()); break;
|
|
2447 case Bytecodes::_dreturn : method_return(dpop()); break;
|
|
2448 case Bytecodes::_areturn : method_return(apop()); break;
|
|
2449 case Bytecodes::_return : method_return(NULL ); break;
|
|
2450 case Bytecodes::_getstatic : // fall through
|
|
2451 case Bytecodes::_putstatic : // fall through
|
|
2452 case Bytecodes::_getfield : // fall through
|
|
2453 case Bytecodes::_putfield : access_field(code); break;
|
|
2454 case Bytecodes::_invokevirtual : // fall through
|
|
2455 case Bytecodes::_invokespecial : // fall through
|
|
2456 case Bytecodes::_invokestatic : // fall through
|
|
2457 case Bytecodes::_invokeinterface: invoke(code); break;
|
|
2458 case Bytecodes::_xxxunusedxxx : ShouldNotReachHere(); break;
|
|
2459 case Bytecodes::_new : new_instance(s.get_index_big()); break;
|
|
2460 case Bytecodes::_newarray : new_type_array(); break;
|
|
2461 case Bytecodes::_anewarray : new_object_array(); break;
|
|
2462 case Bytecodes::_arraylength : ipush(append(new ArrayLength(apop(), lock_stack()))); break;
|
|
2463 case Bytecodes::_athrow : throw_op(s.cur_bci()); break;
|
|
2464 case Bytecodes::_checkcast : check_cast(s.get_index_big()); break;
|
|
2465 case Bytecodes::_instanceof : instance_of(s.get_index_big()); break;
|
|
2466 // Note: we do not have special handling for the monitorenter bytecode if DeoptC1 && DeoptOnAsyncException
|
|
2467 case Bytecodes::_monitorenter : monitorenter(apop(), s.cur_bci()); break;
|
|
2468 case Bytecodes::_monitorexit : monitorexit (apop(), s.cur_bci()); break;
|
|
2469 case Bytecodes::_wide : ShouldNotReachHere(); break;
|
|
2470 case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break;
|
|
2471 case Bytecodes::_ifnull : if_null(objectType, If::eql); break;
|
|
2472 case Bytecodes::_ifnonnull : if_null(objectType, If::neq); break;
|
|
2473 case Bytecodes::_goto_w : _goto(s.cur_bci(), s.get_far_dest()); break;
|
|
2474 case Bytecodes::_jsr_w : jsr(s.get_far_dest()); break;
|
|
2475 case Bytecodes::_breakpoint : BAILOUT_("concurrent setting of breakpoint", NULL);
|
|
2476 default : ShouldNotReachHere(); break;
|
|
2477 }
|
|
2478 // save current bci to setup Goto at the end
|
|
2479 prev_bci = s.cur_bci();
|
|
2480 }
|
|
2481 CHECK_BAILOUT_(NULL);
|
|
2482 // stop processing of this block (see try_inline_full)
|
|
2483 if (_skip_block) {
|
|
2484 _skip_block = false;
|
|
2485 assert(_last && _last->as_BlockEnd(), "");
|
|
2486 return _last->as_BlockEnd();
|
|
2487 }
|
|
2488 // if there are any, check if last instruction is a BlockEnd instruction
|
|
2489 BlockEnd* end = last()->as_BlockEnd();
|
|
2490 if (end == NULL) {
|
|
2491 // all blocks must end with a BlockEnd instruction => add a Goto
|
|
2492 end = new Goto(block_at(s.cur_bci()), false);
|
|
2493 _last = _last->set_next(end, prev_bci);
|
|
2494 }
|
|
2495 assert(end == last()->as_BlockEnd(), "inconsistency");
|
|
2496
|
|
2497 // if the method terminates, we don't need the stack anymore
|
|
2498 if (end->as_Return() != NULL) {
|
|
2499 state()->clear_stack();
|
|
2500 } else if (end->as_Throw() != NULL) {
|
|
2501 // May have exception handler in caller scopes
|
|
2502 state()->truncate_stack(scope()->lock_stack_size());
|
|
2503 }
|
|
2504
|
|
2505 // connect to begin & set state
|
|
2506 // NOTE that inlining may have changed the block we are parsing
|
|
2507 block()->set_end(end);
|
|
2508 end->set_state(state());
|
|
2509 // propagate state
|
|
2510 for (int i = end->number_of_sux() - 1; i >= 0; i--) {
|
|
2511 BlockBegin* sux = end->sux_at(i);
|
|
2512 assert(sux->is_predecessor(block()), "predecessor missing");
|
|
2513 // be careful, bailout if bytecodes are strange
|
|
2514 if (!sux->try_merge(state())) BAILOUT_("block join failed", NULL);
|
|
2515 scope_data()->add_to_work_list(end->sux_at(i));
|
|
2516 }
|
|
2517
|
|
2518 scope_data()->set_stream(NULL);
|
|
2519
|
|
2520 // done
|
|
2521 return end;
|
|
2522 }
|
|
2523
|
|
2524
|
|
2525 void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) {
|
|
2526 do {
|
|
2527 if (start_in_current_block_for_inlining && !bailed_out()) {
|
|
2528 iterate_bytecodes_for_block(0);
|
|
2529 start_in_current_block_for_inlining = false;
|
|
2530 } else {
|
|
2531 BlockBegin* b;
|
|
2532 while ((b = scope_data()->remove_from_work_list()) != NULL) {
|
|
2533 if (!b->is_set(BlockBegin::was_visited_flag)) {
|
|
2534 if (b->is_set(BlockBegin::osr_entry_flag)) {
|
|
2535 // we're about to parse the osr entry block, so make sure
|
|
2536 // we setup the OSR edge leading into this block so that
|
|
2537 // Phis get setup correctly.
|
|
2538 setup_osr_entry_block();
|
|
2539 // this is no longer the osr entry block, so clear it.
|
|
2540 b->clear(BlockBegin::osr_entry_flag);
|
|
2541 }
|
|
2542 b->set(BlockBegin::was_visited_flag);
|
|
2543 connect_to_end(b);
|
|
2544 }
|
|
2545 }
|
|
2546 }
|
|
2547 } while (!bailed_out() && !scope_data()->is_work_list_empty());
|
|
2548 }
|
|
2549
|
|
2550
|
|
2551 bool GraphBuilder::_is_initialized = false;
|
|
2552 bool GraphBuilder::_can_trap [Bytecodes::number_of_java_codes];
|
|
2553 bool GraphBuilder::_is_async[Bytecodes::number_of_java_codes];
|
|
2554
|
|
2555 void GraphBuilder::initialize() {
|
|
2556 // make sure initialization happens only once (need a
|
|
2557 // lock here, if we allow the compiler to be re-entrant)
|
|
2558 if (is_initialized()) return;
|
|
2559 _is_initialized = true;
|
|
2560
|
|
2561 // the following bytecodes are assumed to potentially
|
|
2562 // throw exceptions in compiled code - note that e.g.
|
|
2563 // monitorexit & the return bytecodes do not throw
|
|
2564 // exceptions since monitor pairing proved that they
|
|
2565 // succeed (if monitor pairing succeeded)
|
|
2566 Bytecodes::Code can_trap_list[] =
|
|
2567 { Bytecodes::_ldc
|
|
2568 , Bytecodes::_ldc_w
|
|
2569 , Bytecodes::_ldc2_w
|
|
2570 , Bytecodes::_iaload
|
|
2571 , Bytecodes::_laload
|
|
2572 , Bytecodes::_faload
|
|
2573 , Bytecodes::_daload
|
|
2574 , Bytecodes::_aaload
|
|
2575 , Bytecodes::_baload
|
|
2576 , Bytecodes::_caload
|
|
2577 , Bytecodes::_saload
|
|
2578 , Bytecodes::_iastore
|
|
2579 , Bytecodes::_lastore
|
|
2580 , Bytecodes::_fastore
|
|
2581 , Bytecodes::_dastore
|
|
2582 , Bytecodes::_aastore
|
|
2583 , Bytecodes::_bastore
|
|
2584 , Bytecodes::_castore
|
|
2585 , Bytecodes::_sastore
|
|
2586 , Bytecodes::_idiv
|
|
2587 , Bytecodes::_ldiv
|
|
2588 , Bytecodes::_irem
|
|
2589 , Bytecodes::_lrem
|
|
2590 , Bytecodes::_getstatic
|
|
2591 , Bytecodes::_putstatic
|
|
2592 , Bytecodes::_getfield
|
|
2593 , Bytecodes::_putfield
|
|
2594 , Bytecodes::_invokevirtual
|
|
2595 , Bytecodes::_invokespecial
|
|
2596 , Bytecodes::_invokestatic
|
|
2597 , Bytecodes::_invokeinterface
|
|
2598 , Bytecodes::_new
|
|
2599 , Bytecodes::_newarray
|
|
2600 , Bytecodes::_anewarray
|
|
2601 , Bytecodes::_arraylength
|
|
2602 , Bytecodes::_athrow
|
|
2603 , Bytecodes::_checkcast
|
|
2604 , Bytecodes::_instanceof
|
|
2605 , Bytecodes::_monitorenter
|
|
2606 , Bytecodes::_multianewarray
|
|
2607 };
|
|
2608
|
|
2609 // the following bytecodes are assumed to potentially
|
|
2610 // throw asynchronous exceptions in compiled code due
|
|
2611 // to safepoints (note: these entries could be merged
|
|
2612 // with the can_trap_list - however, we need to know
|
|
2613 // which ones are asynchronous for now - see also the
|
|
2614 // comment in GraphBuilder::handle_exception)
|
|
2615 Bytecodes::Code is_async_list[] =
|
|
2616 { Bytecodes::_ifeq
|
|
2617 , Bytecodes::_ifne
|
|
2618 , Bytecodes::_iflt
|
|
2619 , Bytecodes::_ifge
|
|
2620 , Bytecodes::_ifgt
|
|
2621 , Bytecodes::_ifle
|
|
2622 , Bytecodes::_if_icmpeq
|
|
2623 , Bytecodes::_if_icmpne
|
|
2624 , Bytecodes::_if_icmplt
|
|
2625 , Bytecodes::_if_icmpge
|
|
2626 , Bytecodes::_if_icmpgt
|
|
2627 , Bytecodes::_if_icmple
|
|
2628 , Bytecodes::_if_acmpeq
|
|
2629 , Bytecodes::_if_acmpne
|
|
2630 , Bytecodes::_goto
|
|
2631 , Bytecodes::_jsr
|
|
2632 , Bytecodes::_ret
|
|
2633 , Bytecodes::_tableswitch
|
|
2634 , Bytecodes::_lookupswitch
|
|
2635 , Bytecodes::_ireturn
|
|
2636 , Bytecodes::_lreturn
|
|
2637 , Bytecodes::_freturn
|
|
2638 , Bytecodes::_dreturn
|
|
2639 , Bytecodes::_areturn
|
|
2640 , Bytecodes::_return
|
|
2641 , Bytecodes::_ifnull
|
|
2642 , Bytecodes::_ifnonnull
|
|
2643 , Bytecodes::_goto_w
|
|
2644 , Bytecodes::_jsr_w
|
|
2645 };
|
|
2646
|
|
2647 // inititialize trap tables
|
|
2648 for (int i = 0; i < Bytecodes::number_of_java_codes; i++) {
|
|
2649 _can_trap[i] = false;
|
|
2650 _is_async[i] = false;
|
|
2651 }
|
|
2652 // set standard trap info
|
|
2653 for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) {
|
|
2654 _can_trap[can_trap_list[j]] = true;
|
|
2655 }
|
|
2656
|
|
2657 // We now deoptimize if an asynchronous exception is thrown. This
|
|
2658 // considerably cleans up corner case issues related to javac's
|
|
2659 // incorrect exception handler ranges for async exceptions and
|
|
2660 // allows us to precisely analyze the types of exceptions from
|
|
2661 // certain bytecodes.
|
|
2662 if (!(DeoptC1 && DeoptOnAsyncException)) {
|
|
2663 // set asynchronous trap info
|
|
2664 for (uint k = 0; k < ARRAY_SIZE(is_async_list); k++) {
|
|
2665 assert(!_can_trap[is_async_list[k]], "can_trap_list and is_async_list should be disjoint");
|
|
2666 _can_trap[is_async_list[k]] = true;
|
|
2667 _is_async[is_async_list[k]] = true;
|
|
2668 }
|
|
2669 }
|
|
2670 }
|
|
2671
|
|
2672
|
|
2673 BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) {
|
|
2674 assert(entry->is_set(f), "entry/flag mismatch");
|
|
2675 // create header block
|
|
2676 BlockBegin* h = new BlockBegin(entry->bci());
|
|
2677 h->set_depth_first_number(0);
|
|
2678
|
|
2679 Value l = h;
|
|
2680 if (profile_branches()) {
|
|
2681 // Increment the invocation count on entry to the method. We
|
|
2682 // can't use profile_invocation here because append isn't setup to
|
|
2683 // work properly at this point. The instruction have to be
|
|
2684 // appended to the instruction stream by hand.
|
|
2685 Value m = new Constant(new ObjectConstant(compilation()->method()));
|
|
2686 h->set_next(m, 0);
|
|
2687 Value p = new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1);
|
|
2688 m->set_next(p, 0);
|
|
2689 l = p;
|
|
2690 }
|
|
2691
|
|
2692 BlockEnd* g = new Goto(entry, false);
|
|
2693 l->set_next(g, entry->bci());
|
|
2694 h->set_end(g);
|
|
2695 h->set(f);
|
|
2696 // setup header block end state
|
|
2697 ValueStack* s = state->copy(); // can use copy since stack is empty (=> no phis)
|
|
2698 assert(s->stack_is_empty(), "must have empty stack at entry point");
|
|
2699 g->set_state(s);
|
|
2700 return h;
|
|
2701 }
|
|
2702
|
|
2703
|
|
2704
|
|
2705 BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) {
|
|
2706 BlockBegin* start = new BlockBegin(0);
|
|
2707
|
|
2708 // This code eliminates the empty start block at the beginning of
|
|
2709 // each method. Previously, each method started with the
|
|
2710 // start-block created below, and this block was followed by the
|
|
2711 // header block that was always empty. This header block is only
|
|
2712 // necesary if std_entry is also a backward branch target because
|
|
2713 // then phi functions may be necessary in the header block. It's
|
|
2714 // also necessary when profiling so that there's a single block that
|
|
2715 // can increment the interpreter_invocation_count.
|
|
2716 BlockBegin* new_header_block;
|
|
2717 if (std_entry->number_of_preds() == 0 && !profile_branches()) {
|
|
2718 new_header_block = std_entry;
|
|
2719 } else {
|
|
2720 new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state);
|
|
2721 }
|
|
2722
|
|
2723 // setup start block (root for the IR graph)
|
|
2724 Base* base =
|
|
2725 new Base(
|
|
2726 new_header_block,
|
|
2727 osr_entry
|
|
2728 );
|
|
2729 start->set_next(base, 0);
|
|
2730 start->set_end(base);
|
|
2731 // create & setup state for start block
|
|
2732 start->set_state(state->copy());
|
|
2733 base->set_state(state->copy());
|
|
2734
|
|
2735 if (base->std_entry()->state() == NULL) {
|
|
2736 // setup states for header blocks
|
|
2737 base->std_entry()->merge(state);
|
|
2738 }
|
|
2739
|
|
2740 assert(base->std_entry()->state() != NULL, "");
|
|
2741 return start;
|
|
2742 }
|
|
2743
|
|
2744
|
|
2745 void GraphBuilder::setup_osr_entry_block() {
|
|
2746 assert(compilation()->is_osr_compile(), "only for osrs");
|
|
2747
|
|
2748 int osr_bci = compilation()->osr_bci();
|
|
2749 ciBytecodeStream s(method());
|
|
2750 s.reset_to_bci(osr_bci);
|
|
2751 s.next();
|
|
2752 scope_data()->set_stream(&s);
|
|
2753
|
|
2754 // create a new block to be the osr setup code
|
|
2755 _osr_entry = new BlockBegin(osr_bci);
|
|
2756 _osr_entry->set(BlockBegin::osr_entry_flag);
|
|
2757 _osr_entry->set_depth_first_number(0);
|
|
2758 BlockBegin* target = bci2block()->at(osr_bci);
|
|
2759 assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there");
|
|
2760 // the osr entry has no values for locals
|
|
2761 ValueStack* state = target->state()->copy();
|
|
2762 _osr_entry->set_state(state);
|
|
2763
|
|
2764 kill_all();
|
|
2765 _block = _osr_entry;
|
|
2766 _state = _osr_entry->state()->copy();
|
|
2767 _last = _osr_entry;
|
|
2768 Value e = append(new OsrEntry());
|
|
2769 e->set_needs_null_check(false);
|
|
2770
|
|
2771 // OSR buffer is
|
|
2772 //
|
|
2773 // locals[nlocals-1..0]
|
|
2774 // monitors[number_of_locks-1..0]
|
|
2775 //
|
|
2776 // locals is a direct copy of the interpreter frame so in the osr buffer
|
|
2777 // so first slot in the local array is the last local from the interpreter
|
|
2778 // and last slot is local[0] (receiver) from the interpreter
|
|
2779 //
|
|
2780 // Similarly with locks. The first lock slot in the osr buffer is the nth lock
|
|
2781 // from the interpreter frame, the nth lock slot in the osr buffer is 0th lock
|
|
2782 // in the interpreter frame (the method lock if a sync method)
|
|
2783
|
|
2784 // Initialize monitors in the compiled activation.
|
|
2785
|
|
2786 int index;
|
|
2787 Value local;
|
|
2788
|
|
2789 // find all the locals that the interpreter thinks contain live oops
|
|
2790 const BitMap live_oops = method()->live_local_oops_at_bci(osr_bci);
|
|
2791
|
|
2792 // compute the offset into the locals so that we can treat the buffer
|
|
2793 // as if the locals were still in the interpreter frame
|
|
2794 int locals_offset = BytesPerWord * (method()->max_locals() - 1);
|
|
2795 for_each_local_value(state, index, local) {
|
|
2796 int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord;
|
|
2797 Value get;
|
|
2798 if (local->type()->is_object_kind() && !live_oops.at(index)) {
|
|
2799 // The interpreter thinks this local is dead but the compiler
|
|
2800 // doesn't so pretend that the interpreter passed in null.
|
|
2801 get = append(new Constant(objectNull));
|
|
2802 } else {
|
|
2803 get = append(new UnsafeGetRaw(as_BasicType(local->type()), e,
|
|
2804 append(new Constant(new IntConstant(offset))),
|
|
2805 0,
|
|
2806 true));
|
|
2807 }
|
|
2808 _state->store_local(index, get);
|
|
2809 }
|
|
2810
|
|
2811 // the storage for the OSR buffer is freed manually in the LIRGenerator.
|
|
2812
|
|
2813 assert(state->caller_state() == NULL, "should be top scope");
|
|
2814 state->clear_locals();
|
|
2815 Goto* g = new Goto(target, false);
|
|
2816 g->set_state(_state->copy());
|
|
2817 append(g);
|
|
2818 _osr_entry->set_end(g);
|
|
2819 target->merge(_osr_entry->end()->state());
|
|
2820
|
|
2821 scope_data()->set_stream(NULL);
|
|
2822 }
|
|
2823
|
|
2824
|
|
2825 ValueStack* GraphBuilder::state_at_entry() {
|
|
2826 ValueStack* state = new ValueStack(scope(), method()->max_locals(), method()->max_stack());
|
|
2827
|
|
2828 // Set up locals for receiver
|
|
2829 int idx = 0;
|
|
2830 if (!method()->is_static()) {
|
|
2831 // we should always see the receiver
|
|
2832 state->store_local(idx, new Local(objectType, idx));
|
|
2833 idx = 1;
|
|
2834 }
|
|
2835
|
|
2836 // Set up locals for incoming arguments
|
|
2837 ciSignature* sig = method()->signature();
|
|
2838 for (int i = 0; i < sig->count(); i++) {
|
|
2839 ciType* type = sig->type_at(i);
|
|
2840 BasicType basic_type = type->basic_type();
|
|
2841 // don't allow T_ARRAY to propagate into locals types
|
|
2842 if (basic_type == T_ARRAY) basic_type = T_OBJECT;
|
|
2843 ValueType* vt = as_ValueType(basic_type);
|
|
2844 state->store_local(idx, new Local(vt, idx));
|
|
2845 idx += type->size();
|
|
2846 }
|
|
2847
|
|
2848 // lock synchronized method
|
|
2849 if (method()->is_synchronized()) {
|
|
2850 state->lock(scope(), NULL);
|
|
2851 }
|
|
2852
|
|
2853 return state;
|
|
2854 }
|
|
2855
|
|
2856
|
|
2857 GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope)
|
|
2858 : _scope_data(NULL)
|
|
2859 , _exception_state(NULL)
|
|
2860 , _instruction_count(0)
|
|
2861 , _osr_entry(NULL)
|
|
2862 , _memory(new MemoryBuffer())
|
|
2863 , _compilation(compilation)
|
|
2864 , _inline_bailout_msg(NULL)
|
|
2865 {
|
|
2866 int osr_bci = compilation->osr_bci();
|
|
2867
|
|
2868 // determine entry points and bci2block mapping
|
|
2869 BlockListBuilder blm(compilation, scope, osr_bci);
|
|
2870 CHECK_BAILOUT();
|
|
2871
|
|
2872 BlockList* bci2block = blm.bci2block();
|
|
2873 BlockBegin* start_block = bci2block->at(0);
|
|
2874
|
|
2875 assert(is_initialized(), "GraphBuilder must have been initialized");
|
|
2876 push_root_scope(scope, bci2block, start_block);
|
|
2877
|
|
2878 // setup state for std entry
|
|
2879 _initial_state = state_at_entry();
|
|
2880 start_block->merge(_initial_state);
|
|
2881
|
|
2882 BlockBegin* sync_handler = NULL;
|
|
2883 if (method()->is_synchronized() || DTraceMethodProbes) {
|
|
2884 // setup an exception handler to do the unlocking and/or notification
|
|
2885 sync_handler = new BlockBegin(-1);
|
|
2886 sync_handler->set(BlockBegin::exception_entry_flag);
|
|
2887 sync_handler->set(BlockBegin::is_on_work_list_flag);
|
|
2888 sync_handler->set(BlockBegin::default_exception_handler_flag);
|
|
2889
|
|
2890 ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0);
|
|
2891 XHandler* h = new XHandler(desc);
|
|
2892 h->set_entry_block(sync_handler);
|
|
2893 scope_data()->xhandlers()->append(h);
|
|
2894 scope_data()->set_has_handler();
|
|
2895 }
|
|
2896
|
|
2897 // complete graph
|
|
2898 _vmap = new ValueMap();
|
|
2899 scope->compute_lock_stack_size();
|
|
2900 switch (scope->method()->intrinsic_id()) {
|
|
2901 case vmIntrinsics::_dabs : // fall through
|
|
2902 case vmIntrinsics::_dsqrt : // fall through
|
|
2903 case vmIntrinsics::_dsin : // fall through
|
|
2904 case vmIntrinsics::_dcos : // fall through
|
|
2905 case vmIntrinsics::_dtan : // fall through
|
|
2906 case vmIntrinsics::_dlog : // fall through
|
|
2907 case vmIntrinsics::_dlog10 : // fall through
|
|
2908 {
|
|
2909 // Compiles where the root method is an intrinsic need a special
|
|
2910 // compilation environment because the bytecodes for the method
|
|
2911 // shouldn't be parsed during the compilation, only the special
|
|
2912 // Intrinsic node should be emitted. If this isn't done the the
|
|
2913 // code for the inlined version will be different than the root
|
|
2914 // compiled version which could lead to monotonicity problems on
|
|
2915 // intel.
|
|
2916
|
|
2917 // Set up a stream so that appending instructions works properly.
|
|
2918 ciBytecodeStream s(scope->method());
|
|
2919 s.reset_to_bci(0);
|
|
2920 scope_data()->set_stream(&s);
|
|
2921 s.next();
|
|
2922
|
|
2923 // setup the initial block state
|
|
2924 _block = start_block;
|
|
2925 _state = start_block->state()->copy();
|
|
2926 _last = start_block;
|
|
2927 load_local(doubleType, 0);
|
|
2928
|
|
2929 // Emit the intrinsic node.
|
|
2930 bool result = try_inline_intrinsics(scope->method());
|
|
2931 if (!result) BAILOUT("failed to inline intrinsic");
|
|
2932 method_return(dpop());
|
|
2933
|
|
2934 // connect the begin and end blocks and we're all done.
|
|
2935 BlockEnd* end = last()->as_BlockEnd();
|
|
2936 block()->set_end(end);
|
|
2937 end->set_state(state());
|
|
2938 break;
|
|
2939 }
|
|
2940 default:
|
|
2941 scope_data()->add_to_work_list(start_block);
|
|
2942 iterate_all_blocks();
|
|
2943 break;
|
|
2944 }
|
|
2945 CHECK_BAILOUT();
|
|
2946
|
|
2947 if (sync_handler && sync_handler->state() != NULL) {
|
|
2948 Value lock = NULL;
|
|
2949 if (method()->is_synchronized()) {
|
|
2950 lock = method()->is_static() ? new Constant(new InstanceConstant(method()->holder()->java_mirror())) :
|
|
2951 _initial_state->local_at(0);
|
|
2952
|
|
2953 sync_handler->state()->unlock();
|
|
2954 sync_handler->state()->lock(scope, lock);
|
|
2955
|
|
2956 }
|
|
2957 fill_sync_handler(lock, sync_handler, true);
|
|
2958 }
|
|
2959
|
|
2960 _start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state);
|
|
2961
|
|
2962 eliminate_redundant_phis(_start);
|
|
2963
|
|
2964 NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats());
|
|
2965 // for osr compile, bailout if some requirements are not fulfilled
|
|
2966 if (osr_bci != -1) {
|
|
2967 BlockBegin* osr_block = blm.bci2block()->at(osr_bci);
|
|
2968 assert(osr_block->is_set(BlockBegin::was_visited_flag),"osr entry must have been visited for osr compile");
|
|
2969
|
|
2970 // check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points
|
|
2971 if (!osr_block->state()->stack_is_empty()) {
|
|
2972 BAILOUT("stack not empty at OSR entry point");
|
|
2973 }
|
|
2974 }
|
|
2975 #ifndef PRODUCT
|
|
2976 if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count);
|
|
2977 #endif
|
|
2978 }
|
|
2979
|
|
2980
|
|
2981 ValueStack* GraphBuilder::lock_stack() {
|
|
2982 // return a new ValueStack representing just the current lock stack
|
|
2983 // (for debug info at safepoints in exception throwing or handling)
|
|
2984 ValueStack* new_stack = state()->copy_locks();
|
|
2985 return new_stack;
|
|
2986 }
|
|
2987
|
|
2988
|
|
2989 int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const {
|
|
2990 int recur_level = 0;
|
|
2991 for (IRScope* s = scope(); s != NULL; s = s->caller()) {
|
|
2992 if (s->method() == cur_callee) {
|
|
2993 ++recur_level;
|
|
2994 }
|
|
2995 }
|
|
2996 return recur_level;
|
|
2997 }
|
|
2998
|
|
2999
|
|
3000 bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known) {
|
|
3001 // Clear out any existing inline bailout condition
|
|
3002 clear_inline_bailout();
|
|
3003
|
|
3004 if (callee->should_exclude()) {
|
|
3005 // callee is excluded
|
|
3006 INLINE_BAILOUT("excluded by CompilerOracle")
|
|
3007 } else if (!callee->can_be_compiled()) {
|
|
3008 // callee is not compilable (prob. has breakpoints)
|
|
3009 INLINE_BAILOUT("not compilable")
|
|
3010 } else if (callee->intrinsic_id() != vmIntrinsics::_none && try_inline_intrinsics(callee)) {
|
|
3011 // intrinsics can be native or not
|
|
3012 return true;
|
|
3013 } else if (callee->is_native()) {
|
|
3014 // non-intrinsic natives cannot be inlined
|
|
3015 INLINE_BAILOUT("non-intrinsic native")
|
|
3016 } else if (callee->is_abstract()) {
|
|
3017 INLINE_BAILOUT("abstract")
|
|
3018 } else {
|
|
3019 return try_inline_full(callee, holder_known);
|
|
3020 }
|
|
3021 }
|
|
3022
|
|
3023
|
|
3024 bool GraphBuilder::try_inline_intrinsics(ciMethod* callee) {
|
|
3025 if (!InlineNatives ) INLINE_BAILOUT("intrinsic method inlining disabled");
|
|
3026 if (callee->is_synchronized()) INLINE_BAILOUT("intrinsic method is synchronized");
|
|
3027 // callee seems like a good candidate
|
|
3028 // determine id
|
|
3029 bool preserves_state = false;
|
|
3030 bool cantrap = true;
|
|
3031 vmIntrinsics::ID id = callee->intrinsic_id();
|
|
3032 switch (id) {
|
|
3033 case vmIntrinsics::_arraycopy :
|
|
3034 if (!InlineArrayCopy) return false;
|
|
3035 break;
|
|
3036
|
|
3037 case vmIntrinsics::_currentTimeMillis:
|
|
3038 case vmIntrinsics::_nanoTime:
|
|
3039 preserves_state = true;
|
|
3040 cantrap = false;
|
|
3041 break;
|
|
3042
|
|
3043 case vmIntrinsics::_floatToRawIntBits :
|
|
3044 case vmIntrinsics::_intBitsToFloat :
|
|
3045 case vmIntrinsics::_doubleToRawLongBits :
|
|
3046 case vmIntrinsics::_longBitsToDouble :
|
|
3047 if (!InlineMathNatives) return false;
|
|
3048 preserves_state = true;
|
|
3049 cantrap = false;
|
|
3050 break;
|
|
3051
|
|
3052 case vmIntrinsics::_getClass :
|
|
3053 if (!InlineClassNatives) return false;
|
|
3054 preserves_state = true;
|
|
3055 break;
|
|
3056
|
|
3057 case vmIntrinsics::_currentThread :
|
|
3058 if (!InlineThreadNatives) return false;
|
|
3059 preserves_state = true;
|
|
3060 cantrap = false;
|
|
3061 break;
|
|
3062
|
|
3063 case vmIntrinsics::_dabs : // fall through
|
|
3064 case vmIntrinsics::_dsqrt : // fall through
|
|
3065 case vmIntrinsics::_dsin : // fall through
|
|
3066 case vmIntrinsics::_dcos : // fall through
|
|
3067 case vmIntrinsics::_dtan : // fall through
|
|
3068 case vmIntrinsics::_dlog : // fall through
|
|
3069 case vmIntrinsics::_dlog10 : // fall through
|
|
3070 if (!InlineMathNatives) return false;
|
|
3071 cantrap = false;
|
|
3072 preserves_state = true;
|
|
3073 break;
|
|
3074
|
|
3075 // sun/misc/AtomicLong.attemptUpdate
|
|
3076 case vmIntrinsics::_attemptUpdate :
|
|
3077 if (!VM_Version::supports_cx8()) return false;
|
|
3078 if (!InlineAtomicLong) return false;
|
|
3079 preserves_state = true;
|
|
3080 break;
|
|
3081
|
|
3082 // Use special nodes for Unsafe instructions so we can more easily
|
|
3083 // perform an address-mode optimization on the raw variants
|
|
3084 case vmIntrinsics::_getObject : return append_unsafe_get_obj(callee, T_OBJECT, false);
|
|
3085 case vmIntrinsics::_getBoolean: return append_unsafe_get_obj(callee, T_BOOLEAN, false);
|
|
3086 case vmIntrinsics::_getByte : return append_unsafe_get_obj(callee, T_BYTE, false);
|
|
3087 case vmIntrinsics::_getShort : return append_unsafe_get_obj(callee, T_SHORT, false);
|
|
3088 case vmIntrinsics::_getChar : return append_unsafe_get_obj(callee, T_CHAR, false);
|
|
3089 case vmIntrinsics::_getInt : return append_unsafe_get_obj(callee, T_INT, false);
|
|
3090 case vmIntrinsics::_getLong : return append_unsafe_get_obj(callee, T_LONG, false);
|
|
3091 case vmIntrinsics::_getFloat : return append_unsafe_get_obj(callee, T_FLOAT, false);
|
|
3092 case vmIntrinsics::_getDouble : return append_unsafe_get_obj(callee, T_DOUBLE, false);
|
|
3093
|
|
3094 case vmIntrinsics::_putObject : return append_unsafe_put_obj(callee, T_OBJECT, false);
|
|
3095 case vmIntrinsics::_putBoolean: return append_unsafe_put_obj(callee, T_BOOLEAN, false);
|
|
3096 case vmIntrinsics::_putByte : return append_unsafe_put_obj(callee, T_BYTE, false);
|
|
3097 case vmIntrinsics::_putShort : return append_unsafe_put_obj(callee, T_SHORT, false);
|
|
3098 case vmIntrinsics::_putChar : return append_unsafe_put_obj(callee, T_CHAR, false);
|
|
3099 case vmIntrinsics::_putInt : return append_unsafe_put_obj(callee, T_INT, false);
|
|
3100 case vmIntrinsics::_putLong : return append_unsafe_put_obj(callee, T_LONG, false);
|
|
3101 case vmIntrinsics::_putFloat : return append_unsafe_put_obj(callee, T_FLOAT, false);
|
|
3102 case vmIntrinsics::_putDouble : return append_unsafe_put_obj(callee, T_DOUBLE, false);
|
|
3103
|
|
3104 case vmIntrinsics::_getObjectVolatile : return append_unsafe_get_obj(callee, T_OBJECT, true);
|
|
3105 case vmIntrinsics::_getBooleanVolatile: return append_unsafe_get_obj(callee, T_BOOLEAN, true);
|
|
3106 case vmIntrinsics::_getByteVolatile : return append_unsafe_get_obj(callee, T_BYTE, true);
|
|
3107 case vmIntrinsics::_getShortVolatile : return append_unsafe_get_obj(callee, T_SHORT, true);
|
|
3108 case vmIntrinsics::_getCharVolatile : return append_unsafe_get_obj(callee, T_CHAR, true);
|
|
3109 case vmIntrinsics::_getIntVolatile : return append_unsafe_get_obj(callee, T_INT, true);
|
|
3110 case vmIntrinsics::_getLongVolatile : return append_unsafe_get_obj(callee, T_LONG, true);
|
|
3111 case vmIntrinsics::_getFloatVolatile : return append_unsafe_get_obj(callee, T_FLOAT, true);
|
|
3112 case vmIntrinsics::_getDoubleVolatile : return append_unsafe_get_obj(callee, T_DOUBLE, true);
|
|
3113
|
|
3114 case vmIntrinsics::_putObjectVolatile : return append_unsafe_put_obj(callee, T_OBJECT, true);
|
|
3115 case vmIntrinsics::_putBooleanVolatile: return append_unsafe_put_obj(callee, T_BOOLEAN, true);
|
|
3116 case vmIntrinsics::_putByteVolatile : return append_unsafe_put_obj(callee, T_BYTE, true);
|
|
3117 case vmIntrinsics::_putShortVolatile : return append_unsafe_put_obj(callee, T_SHORT, true);
|
|
3118 case vmIntrinsics::_putCharVolatile : return append_unsafe_put_obj(callee, T_CHAR, true);
|
|
3119 case vmIntrinsics::_putIntVolatile : return append_unsafe_put_obj(callee, T_INT, true);
|
|
3120 case vmIntrinsics::_putLongVolatile : return append_unsafe_put_obj(callee, T_LONG, true);
|
|
3121 case vmIntrinsics::_putFloatVolatile : return append_unsafe_put_obj(callee, T_FLOAT, true);
|
|
3122 case vmIntrinsics::_putDoubleVolatile : return append_unsafe_put_obj(callee, T_DOUBLE, true);
|
|
3123
|
|
3124 case vmIntrinsics::_getByte_raw : return append_unsafe_get_raw(callee, T_BYTE);
|
|
3125 case vmIntrinsics::_getShort_raw : return append_unsafe_get_raw(callee, T_SHORT);
|
|
3126 case vmIntrinsics::_getChar_raw : return append_unsafe_get_raw(callee, T_CHAR);
|
|
3127 case vmIntrinsics::_getInt_raw : return append_unsafe_get_raw(callee, T_INT);
|
|
3128 case vmIntrinsics::_getLong_raw : return append_unsafe_get_raw(callee, T_LONG);
|
|
3129 case vmIntrinsics::_getFloat_raw : return append_unsafe_get_raw(callee, T_FLOAT);
|
|
3130 case vmIntrinsics::_getDouble_raw : return append_unsafe_get_raw(callee, T_DOUBLE);
|
|
3131
|
|
3132 case vmIntrinsics::_putByte_raw : return append_unsafe_put_raw(callee, T_BYTE);
|
|
3133 case vmIntrinsics::_putShort_raw : return append_unsafe_put_raw(callee, T_SHORT);
|
|
3134 case vmIntrinsics::_putChar_raw : return append_unsafe_put_raw(callee, T_CHAR);
|
|
3135 case vmIntrinsics::_putInt_raw : return append_unsafe_put_raw(callee, T_INT);
|
|
3136 case vmIntrinsics::_putLong_raw : return append_unsafe_put_raw(callee, T_LONG);
|
|
3137 case vmIntrinsics::_putFloat_raw : return append_unsafe_put_raw(callee, T_FLOAT);
|
|
3138 case vmIntrinsics::_putDouble_raw : return append_unsafe_put_raw(callee, T_DOUBLE);
|
|
3139
|
|
3140 case vmIntrinsics::_prefetchRead : return append_unsafe_prefetch(callee, false, false);
|
|
3141 case vmIntrinsics::_prefetchWrite : return append_unsafe_prefetch(callee, false, true);
|
|
3142 case vmIntrinsics::_prefetchReadStatic : return append_unsafe_prefetch(callee, true, false);
|
|
3143 case vmIntrinsics::_prefetchWriteStatic : return append_unsafe_prefetch(callee, true, true);
|
|
3144
|
|
3145 case vmIntrinsics::_checkIndex :
|
|
3146 if (!InlineNIOCheckIndex) return false;
|
|
3147 preserves_state = true;
|
|
3148 break;
|
|
3149 case vmIntrinsics::_putOrderedObject : return append_unsafe_put_obj(callee, T_OBJECT, true);
|
|
3150 case vmIntrinsics::_putOrderedInt : return append_unsafe_put_obj(callee, T_INT, true);
|
|
3151 case vmIntrinsics::_putOrderedLong : return append_unsafe_put_obj(callee, T_LONG, true);
|
|
3152
|
|
3153 case vmIntrinsics::_compareAndSwapLong:
|
|
3154 if (!VM_Version::supports_cx8()) return false;
|
|
3155 // fall through
|
|
3156 case vmIntrinsics::_compareAndSwapInt:
|
|
3157 case vmIntrinsics::_compareAndSwapObject:
|
|
3158 append_unsafe_CAS(callee);
|
|
3159 return true;
|
|
3160
|
|
3161 default : return false; // do not inline
|
|
3162 }
|
|
3163 // create intrinsic node
|
|
3164 const bool has_receiver = !callee->is_static();
|
|
3165 ValueType* result_type = as_ValueType(callee->return_type());
|
|
3166
|
|
3167 Values* args = state()->pop_arguments(callee->arg_size());
|
|
3168 ValueStack* locks = lock_stack();
|
|
3169 if (profile_calls()) {
|
|
3170 // Don't profile in the special case where the root method
|
|
3171 // is the intrinsic
|
|
3172 if (callee != method()) {
|
|
3173 Value recv = NULL;
|
|
3174 if (has_receiver) {
|
|
3175 recv = args->at(0);
|
|
3176 null_check(recv);
|
|
3177 }
|
|
3178 profile_call(recv, NULL);
|
|
3179 }
|
|
3180 }
|
|
3181
|
|
3182 Intrinsic* result = new Intrinsic(result_type, id, args, has_receiver, lock_stack(),
|
|
3183 preserves_state, cantrap);
|
|
3184 // append instruction & push result
|
|
3185 Value value = append_split(result);
|
|
3186 if (result_type != voidType) push(result_type, value);
|
|
3187
|
|
3188 #ifndef PRODUCT
|
|
3189 // printing
|
|
3190 if (PrintInlining) {
|
|
3191 print_inline_result(callee, true);
|
|
3192 }
|
|
3193 #endif
|
|
3194
|
|
3195 // done
|
|
3196 return true;
|
|
3197 }
|
|
3198
|
|
3199
|
|
3200 bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) {
|
|
3201 // Introduce a new callee continuation point - all Ret instructions
|
|
3202 // will be replaced with Gotos to this point.
|
|
3203 BlockBegin* cont = block_at(next_bci());
|
|
3204 assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr");
|
|
3205
|
|
3206 // Note: can not assign state to continuation yet, as we have to
|
|
3207 // pick up the state from the Ret instructions.
|
|
3208
|
|
3209 // Push callee scope
|
|
3210 push_scope_for_jsr(cont, jsr_dest_bci);
|
|
3211
|
|
3212 // Temporarily set up bytecode stream so we can append instructions
|
|
3213 // (only using the bci of this stream)
|
|
3214 scope_data()->set_stream(scope_data()->parent()->stream());
|
|
3215
|
|
3216 BlockBegin* jsr_start_block = block_at(jsr_dest_bci);
|
|
3217 assert(jsr_start_block != NULL, "jsr start block must exist");
|
|
3218 assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet");
|
|
3219 Goto* goto_sub = new Goto(jsr_start_block, false);
|
|
3220 goto_sub->set_state(state());
|
|
3221 // Must copy state to avoid wrong sharing when parsing bytecodes
|
|
3222 assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block");
|
|
3223 jsr_start_block->set_state(state()->copy());
|
|
3224 append(goto_sub);
|
|
3225 _block->set_end(goto_sub);
|
|
3226 _last = _block = jsr_start_block;
|
|
3227
|
|
3228 // Clear out bytecode stream
|
|
3229 scope_data()->set_stream(NULL);
|
|
3230
|
|
3231 scope_data()->add_to_work_list(jsr_start_block);
|
|
3232
|
|
3233 // Ready to resume parsing in subroutine
|
|
3234 iterate_all_blocks();
|
|
3235
|
|
3236 // If we bailed out during parsing, return immediately (this is bad news)
|
|
3237 CHECK_BAILOUT_(false);
|
|
3238
|
|
3239 // Detect whether the continuation can actually be reached. If not,
|
|
3240 // it has not had state set by the join() operations in
|
|
3241 // iterate_bytecodes_for_block()/ret() and we should not touch the
|
|
3242 // iteration state. The calling activation of
|
|
3243 // iterate_bytecodes_for_block will then complete normally.
|
|
3244 if (cont->state() != NULL) {
|
|
3245 if (!cont->is_set(BlockBegin::was_visited_flag)) {
|
|
3246 // add continuation to work list instead of parsing it immediately
|
|
3247 scope_data()->parent()->add_to_work_list(cont);
|
|
3248 }
|
|
3249 }
|
|
3250
|
|
3251 assert(jsr_continuation() == cont, "continuation must not have changed");
|
|
3252 assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) ||
|
|
3253 jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag),
|
|
3254 "continuation can only be visited in case of backward branches");
|
|
3255 assert(_last && _last->as_BlockEnd(), "block must have end");
|
|
3256
|
|
3257 // continuation is in work list, so end iteration of current block
|
|
3258 _skip_block = true;
|
|
3259 pop_scope_for_jsr();
|
|
3260
|
|
3261 return true;
|
|
3262 }
|
|
3263
|
|
3264
|
|
3265 // Inline the entry of a synchronized method as a monitor enter and
|
|
3266 // register the exception handler which releases the monitor if an
|
|
3267 // exception is thrown within the callee. Note that the monitor enter
|
|
3268 // cannot throw an exception itself, because the receiver is
|
|
3269 // guaranteed to be non-null by the explicit null check at the
|
|
3270 // beginning of inlining.
|
|
3271 void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) {
|
|
3272 assert(lock != NULL && sync_handler != NULL, "lock or handler missing");
|
|
3273
|
|
3274 set_exception_state(state()->copy());
|
|
3275 monitorenter(lock, SynchronizationEntryBCI);
|
|
3276 assert(_last->as_MonitorEnter() != NULL, "monitor enter expected");
|
|
3277 _last->set_needs_null_check(false);
|
|
3278
|
|
3279 sync_handler->set(BlockBegin::exception_entry_flag);
|
|
3280 sync_handler->set(BlockBegin::is_on_work_list_flag);
|
|
3281
|
|
3282 ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0);
|
|
3283 XHandler* h = new XHandler(desc);
|
|
3284 h->set_entry_block(sync_handler);
|
|
3285 scope_data()->xhandlers()->append(h);
|
|
3286 scope_data()->set_has_handler();
|
|
3287 }
|
|
3288
|
|
3289
|
|
3290 // If an exception is thrown and not handled within an inlined
|
|
3291 // synchronized method, the monitor must be released before the
|
|
3292 // exception is rethrown in the outer scope. Generate the appropriate
|
|
3293 // instructions here.
|
|
3294 void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) {
|
|
3295 BlockBegin* orig_block = _block;
|
|
3296 ValueStack* orig_state = _state;
|
|
3297 Instruction* orig_last = _last;
|
|
3298 _last = _block = sync_handler;
|
|
3299 _state = sync_handler->state()->copy();
|
|
3300
|
|
3301 assert(sync_handler != NULL, "handler missing");
|
|
3302 assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here");
|
|
3303
|
|
3304 assert(lock != NULL || default_handler, "lock or handler missing");
|
|
3305
|
|
3306 XHandler* h = scope_data()->xhandlers()->remove_last();
|
|
3307 assert(h->entry_block() == sync_handler, "corrupt list of handlers");
|
|
3308
|
|
3309 block()->set(BlockBegin::was_visited_flag);
|
|
3310 Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI);
|
|
3311 assert(exception->is_pinned(), "must be");
|
|
3312
|
|
3313 int bci = SynchronizationEntryBCI;
|
|
3314 if (lock) {
|
|
3315 assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing");
|
|
3316 if (lock->bci() == -99) {
|
|
3317 lock = append_with_bci(lock, -1);
|
|
3318 }
|
|
3319
|
|
3320 // exit the monitor in the context of the synchronized method
|
|
3321 monitorexit(lock, SynchronizationEntryBCI);
|
|
3322
|
|
3323 // exit the context of the synchronized method
|
|
3324 if (!default_handler) {
|
|
3325 pop_scope();
|
|
3326 _state = _state->copy();
|
|
3327 bci = _state->scope()->caller_bci();
|
|
3328 _state = _state->pop_scope()->copy();
|
|
3329 }
|
|
3330 }
|
|
3331
|
|
3332 // perform the throw as if at the the call site
|
|
3333 apush(exception);
|
|
3334
|
|
3335 set_exception_state(state()->copy());
|
|
3336 throw_op(bci);
|
|
3337
|
|
3338 BlockEnd* end = last()->as_BlockEnd();
|
|
3339 block()->set_end(end);
|
|
3340 end->set_state(state());
|
|
3341
|
|
3342 _block = orig_block;
|
|
3343 _state = orig_state;
|
|
3344 _last = orig_last;
|
|
3345 }
|
|
3346
|
|
3347
|
|
3348 bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known) {
|
|
3349 assert(!callee->is_native(), "callee must not be native");
|
|
3350
|
|
3351 // first perform tests of things it's not possible to inline
|
|
3352 if (callee->has_exception_handlers() &&
|
|
3353 !InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers");
|
|
3354 if (callee->is_synchronized() &&
|
|
3355 !InlineSynchronizedMethods ) INLINE_BAILOUT("callee is synchronized");
|
|
3356 if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet");
|
|
3357 if (!callee->has_balanced_monitors()) INLINE_BAILOUT("callee's monitors do not match");
|
|
3358
|
|
3359 // Proper inlining of methods with jsrs requires a little more work.
|
|
3360 if (callee->has_jsrs() ) INLINE_BAILOUT("jsrs not handled properly by inliner yet");
|
|
3361
|
|
3362 // now perform tests that are based on flag settings
|
|
3363 if (inline_level() > MaxInlineLevel ) INLINE_BAILOUT("too-deep inlining");
|
|
3364 if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("too-deep recursive inlining");
|
|
3365 if (callee->code_size() > max_inline_size() ) INLINE_BAILOUT("callee is too large");
|
|
3366
|
|
3367 // don't inline throwable methods unless the inlining tree is rooted in a throwable class
|
|
3368 if (callee->name() == ciSymbol::object_initializer_name() &&
|
|
3369 callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) {
|
|
3370 // Throwable constructor call
|
|
3371 IRScope* top = scope();
|
|
3372 while (top->caller() != NULL) {
|
|
3373 top = top->caller();
|
|
3374 }
|
|
3375 if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) {
|
|
3376 INLINE_BAILOUT("don't inline Throwable constructors");
|
|
3377 }
|
|
3378 }
|
|
3379
|
|
3380 // When SSE2 is used on intel, then no special handling is needed
|
|
3381 // for strictfp because the enum-constant is fixed at compile time,
|
|
3382 // the check for UseSSE2 is needed here
|
|
3383 if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) {
|
|
3384 INLINE_BAILOUT("caller and callee have different strict fp requirements");
|
|
3385 }
|
|
3386
|
|
3387 if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) {
|
|
3388 INLINE_BAILOUT("total inlining greater than DesiredMethodLimit");
|
|
3389 }
|
|
3390
|
|
3391 #ifndef PRODUCT
|
|
3392 // printing
|
|
3393 if (PrintInlining) {
|
|
3394 print_inline_result(callee, true);
|
|
3395 }
|
|
3396 #endif
|
|
3397
|
|
3398 // NOTE: Bailouts from this point on, which occur at the
|
|
3399 // GraphBuilder level, do not cause bailout just of the inlining but
|
|
3400 // in fact of the entire compilation.
|
|
3401
|
|
3402 BlockBegin* orig_block = block();
|
|
3403
|
|
3404 const int args_base = state()->stack_size() - callee->arg_size();
|
|
3405 assert(args_base >= 0, "stack underflow during inlining");
|
|
3406
|
|
3407 // Insert null check if necessary
|
|
3408 Value recv = NULL;
|
|
3409 if (code() != Bytecodes::_invokestatic) {
|
|
3410 // note: null check must happen even if first instruction of callee does
|
|
3411 // an implicit null check since the callee is in a different scope
|
|
3412 // and we must make sure exception handling does the right thing
|
|
3413 assert(!callee->is_static(), "callee must not be static");
|
|
3414 assert(callee->arg_size() > 0, "must have at least a receiver");
|
|
3415 recv = state()->stack_at(args_base);
|
|
3416 null_check(recv);
|
|
3417 }
|
|
3418
|
|
3419 if (profile_inlined_calls()) {
|
|
3420 profile_call(recv, holder_known ? callee->holder() : NULL);
|
|
3421 }
|
|
3422
|
|
3423 profile_invocation(callee);
|
|
3424
|
|
3425 // Introduce a new callee continuation point - if the callee has
|
|
3426 // more than one return instruction or the return does not allow
|
|
3427 // fall-through of control flow, all return instructions of the
|
|
3428 // callee will need to be replaced by Goto's pointing to this
|
|
3429 // continuation point.
|
|
3430 BlockBegin* cont = block_at(next_bci());
|
|
3431 bool continuation_existed = true;
|
|
3432 if (cont == NULL) {
|
|
3433 cont = new BlockBegin(next_bci());
|
|
3434 // low number so that continuation gets parsed as early as possible
|
|
3435 cont->set_depth_first_number(0);
|
|
3436 #ifndef PRODUCT
|
|
3437 if (PrintInitialBlockList) {
|
|
3438 tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d",
|
|
3439 cont->block_id(), cont->bci(), bci());
|
|
3440 }
|
|
3441 #endif
|
|
3442 continuation_existed = false;
|
|
3443 }
|
|
3444 // Record number of predecessors of continuation block before
|
|
3445 // inlining, to detect if inlined method has edges to its
|
|
3446 // continuation after inlining.
|
|
3447 int continuation_preds = cont->number_of_preds();
|
|
3448
|
|
3449 // Push callee scope
|
|
3450 push_scope(callee, cont);
|
|
3451
|
|
3452 // the BlockListBuilder for the callee could have bailed out
|
|
3453 CHECK_BAILOUT_(false);
|
|
3454
|
|
3455 // Temporarily set up bytecode stream so we can append instructions
|
|
3456 // (only using the bci of this stream)
|
|
3457 scope_data()->set_stream(scope_data()->parent()->stream());
|
|
3458
|
|
3459 // Pass parameters into callee state: add assignments
|
|
3460 // note: this will also ensure that all arguments are computed before being passed
|
|
3461 ValueStack* callee_state = state();
|
|
3462 ValueStack* caller_state = scope()->caller_state();
|
|
3463 { int i = args_base;
|
|
3464 while (i < caller_state->stack_size()) {
|
|
3465 const int par_no = i - args_base;
|
|
3466 Value arg = caller_state->stack_at_inc(i);
|
|
3467 // NOTE: take base() of arg->type() to avoid problems storing
|
|
3468 // constants
|
|
3469 store_local(callee_state, arg, arg->type()->base(), par_no);
|
|
3470 }
|
|
3471 }
|
|
3472
|
|
3473 // Remove args from stack.
|
|
3474 // Note that we preserve locals state in case we can use it later
|
|
3475 // (see use of pop_scope() below)
|
|
3476 caller_state->truncate_stack(args_base);
|
|
3477 callee_state->truncate_stack(args_base);
|
|
3478
|
|
3479 // Setup state that is used at returns form the inlined method.
|
|
3480 // This is essentially the state of the continuation block,
|
|
3481 // but without the return value on stack, if any, this will
|
|
3482 // be pushed at the return instruction (see method_return).
|
|
3483 scope_data()->set_continuation_state(caller_state->copy());
|
|
3484
|
|
3485 // Compute lock stack size for callee scope now that args have been passed
|
|
3486 scope()->compute_lock_stack_size();
|
|
3487
|
|
3488 Value lock;
|
|
3489 BlockBegin* sync_handler;
|
|
3490
|
|
3491 // Inline the locking of the receiver if the callee is synchronized
|
|
3492 if (callee->is_synchronized()) {
|
|
3493 lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror())))
|
|
3494 : state()->local_at(0);
|
|
3495 sync_handler = new BlockBegin(-1);
|
|
3496 inline_sync_entry(lock, sync_handler);
|
|
3497
|
|
3498 // recompute the lock stack size
|
|
3499 scope()->compute_lock_stack_size();
|
|
3500 }
|
|
3501
|
|
3502
|
|
3503 BlockBegin* callee_start_block = block_at(0);
|
|
3504 if (callee_start_block != NULL) {
|
|
3505 assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header");
|
|
3506 Goto* goto_callee = new Goto(callee_start_block, false);
|
|
3507 goto_callee->set_state(state());
|
|
3508 // The state for this goto is in the scope of the callee, so use
|
|
3509 // the entry bci for the callee instead of the call site bci.
|
|
3510 append_with_bci(goto_callee, 0);
|
|
3511 _block->set_end(goto_callee);
|
|
3512 callee_start_block->merge(callee_state);
|
|
3513
|
|
3514 _last = _block = callee_start_block;
|
|
3515
|
|
3516 scope_data()->add_to_work_list(callee_start_block);
|
|
3517 }
|
|
3518
|
|
3519 // Clear out bytecode stream
|
|
3520 scope_data()->set_stream(NULL);
|
|
3521
|
|
3522 // Ready to resume parsing in callee (either in the same block we
|
|
3523 // were in before or in the callee's start block)
|
|
3524 iterate_all_blocks(callee_start_block == NULL);
|
|
3525
|
|
3526 // If we bailed out during parsing, return immediately (this is bad news)
|
|
3527 if (bailed_out()) return false;
|
|
3528
|
|
3529 // iterate_all_blocks theoretically traverses in random order; in
|
|
3530 // practice, we have only traversed the continuation if we are
|
|
3531 // inlining into a subroutine
|
|
3532 assert(continuation_existed ||
|
|
3533 !continuation()->is_set(BlockBegin::was_visited_flag),
|
|
3534 "continuation should not have been parsed yet if we created it");
|
|
3535
|
|
3536 // If we bailed out during parsing, return immediately (this is bad news)
|
|
3537 CHECK_BAILOUT_(false);
|
|
3538
|
|
3539 // At this point we are almost ready to return and resume parsing of
|
|
3540 // the caller back in the GraphBuilder. The only thing we want to do
|
|
3541 // first is an optimization: during parsing of the callee we
|
|
3542 // generated at least one Goto to the continuation block. If we
|
|
3543 // generated exactly one, and if the inlined method spanned exactly
|
|
3544 // one block (and we didn't have to Goto its entry), then we snip
|
|
3545 // off the Goto to the continuation, allowing control to fall
|
|
3546 // through back into the caller block and effectively performing
|
|
3547 // block merging. This allows load elimination and CSE to take place
|
|
3548 // across multiple callee scopes if they are relatively simple, and
|
|
3549 // is currently essential to making inlining profitable.
|
|
3550 if ( num_returns() == 1
|
|
3551 && block() == orig_block
|
|
3552 && block() == inline_cleanup_block()) {
|
|
3553 _last = inline_cleanup_return_prev();
|
|
3554 _state = inline_cleanup_state()->pop_scope();
|
|
3555 } else if (continuation_preds == cont->number_of_preds()) {
|
|
3556 // Inlining caused that the instructions after the invoke in the
|
|
3557 // caller are not reachable any more. So skip filling this block
|
|
3558 // with instructions!
|
|
3559 assert (cont == continuation(), "");
|
|
3560 assert(_last && _last->as_BlockEnd(), "");
|
|
3561 _skip_block = true;
|
|
3562 } else {
|
|
3563 // Resume parsing in continuation block unless it was already parsed.
|
|
3564 // Note that if we don't change _last here, iteration in
|
|
3565 // iterate_bytecodes_for_block will stop when we return.
|
|
3566 if (!continuation()->is_set(BlockBegin::was_visited_flag)) {
|
|
3567 // add continuation to work list instead of parsing it immediately
|
|
3568 assert(_last && _last->as_BlockEnd(), "");
|
|
3569 scope_data()->parent()->add_to_work_list(continuation());
|
|
3570 _skip_block = true;
|
|
3571 }
|
|
3572 }
|
|
3573
|
|
3574 // Fill the exception handler for synchronized methods with instructions
|
|
3575 if (callee->is_synchronized() && sync_handler->state() != NULL) {
|
|
3576 fill_sync_handler(lock, sync_handler);
|
|
3577 } else {
|
|
3578 pop_scope();
|
|
3579 }
|
|
3580
|
|
3581 compilation()->notice_inlined_method(callee);
|
|
3582
|
|
3583 return true;
|
|
3584 }
|
|
3585
|
|
3586
|
|
3587 void GraphBuilder::inline_bailout(const char* msg) {
|
|
3588 assert(msg != NULL, "inline bailout msg must exist");
|
|
3589 _inline_bailout_msg = msg;
|
|
3590 }
|
|
3591
|
|
3592
|
|
3593 void GraphBuilder::clear_inline_bailout() {
|
|
3594 _inline_bailout_msg = NULL;
|
|
3595 }
|
|
3596
|
|
3597
|
|
3598 void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) {
|
|
3599 ScopeData* data = new ScopeData(NULL);
|
|
3600 data->set_scope(scope);
|
|
3601 data->set_bci2block(bci2block);
|
|
3602 _scope_data = data;
|
|
3603 _block = start;
|
|
3604 }
|
|
3605
|
|
3606
|
|
3607 void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) {
|
|
3608 IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false);
|
|
3609 scope()->add_callee(callee_scope);
|
|
3610
|
|
3611 BlockListBuilder blb(compilation(), callee_scope, -1);
|
|
3612 CHECK_BAILOUT();
|
|
3613
|
|
3614 if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) {
|
|
3615 // this scope can be inlined directly into the caller so remove
|
|
3616 // the block at bci 0.
|
|
3617 blb.bci2block()->at_put(0, NULL);
|
|
3618 }
|
|
3619
|
|
3620 callee_scope->set_caller_state(state());
|
|
3621 set_state(state()->push_scope(callee_scope));
|
|
3622
|
|
3623 ScopeData* data = new ScopeData(scope_data());
|
|
3624 data->set_scope(callee_scope);
|
|
3625 data->set_bci2block(blb.bci2block());
|
|
3626 data->set_continuation(continuation);
|
|
3627 _scope_data = data;
|
|
3628 }
|
|
3629
|
|
3630
|
|
3631 void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) {
|
|
3632 ScopeData* data = new ScopeData(scope_data());
|
|
3633 data->set_parsing_jsr();
|
|
3634 data->set_jsr_entry_bci(jsr_dest_bci);
|
|
3635 data->set_jsr_return_address_local(-1);
|
|
3636 // Must clone bci2block list as we will be mutating it in order to
|
|
3637 // properly clone all blocks in jsr region as well as exception
|
|
3638 // handlers containing rets
|
|
3639 BlockList* new_bci2block = new BlockList(bci2block()->length());
|
|
3640 new_bci2block->push_all(bci2block());
|
|
3641 data->set_bci2block(new_bci2block);
|
|
3642 data->set_scope(scope());
|
|
3643 data->setup_jsr_xhandlers();
|
|
3644 data->set_continuation(continuation());
|
|
3645 if (continuation() != NULL) {
|
|
3646 assert(continuation_state() != NULL, "");
|
|
3647 data->set_continuation_state(continuation_state()->copy());
|
|
3648 }
|
|
3649 data->set_jsr_continuation(jsr_continuation);
|
|
3650 _scope_data = data;
|
|
3651 }
|
|
3652
|
|
3653
|
|
3654 void GraphBuilder::pop_scope() {
|
|
3655 int number_of_locks = scope()->number_of_locks();
|
|
3656 _scope_data = scope_data()->parent();
|
|
3657 // accumulate minimum number of monitor slots to be reserved
|
|
3658 scope()->set_min_number_of_locks(number_of_locks);
|
|
3659 }
|
|
3660
|
|
3661
|
|
3662 void GraphBuilder::pop_scope_for_jsr() {
|
|
3663 _scope_data = scope_data()->parent();
|
|
3664 }
|
|
3665
|
|
3666 bool GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) {
|
|
3667 if (InlineUnsafeOps) {
|
|
3668 Values* args = state()->pop_arguments(callee->arg_size());
|
|
3669 null_check(args->at(0));
|
|
3670 Instruction* offset = args->at(2);
|
|
3671 #ifndef _LP64
|
|
3672 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
3673 #endif
|
|
3674 Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile));
|
|
3675 push(op->type(), op);
|
|
3676 compilation()->set_has_unsafe_access(true);
|
|
3677 }
|
|
3678 return InlineUnsafeOps;
|
|
3679 }
|
|
3680
|
|
3681
|
|
3682 bool GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) {
|
|
3683 if (InlineUnsafeOps) {
|
|
3684 Values* args = state()->pop_arguments(callee->arg_size());
|
|
3685 null_check(args->at(0));
|
|
3686 Instruction* offset = args->at(2);
|
|
3687 #ifndef _LP64
|
|
3688 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
3689 #endif
|
|
3690 Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, args->at(3), is_volatile));
|
|
3691 compilation()->set_has_unsafe_access(true);
|
|
3692 kill_all();
|
|
3693 }
|
|
3694 return InlineUnsafeOps;
|
|
3695 }
|
|
3696
|
|
3697
|
|
3698 bool GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) {
|
|
3699 if (InlineUnsafeOps) {
|
|
3700 Values* args = state()->pop_arguments(callee->arg_size());
|
|
3701 null_check(args->at(0));
|
|
3702 Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false));
|
|
3703 push(op->type(), op);
|
|
3704 compilation()->set_has_unsafe_access(true);
|
|
3705 }
|
|
3706 return InlineUnsafeOps;
|
|
3707 }
|
|
3708
|
|
3709
|
|
3710 bool GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) {
|
|
3711 if (InlineUnsafeOps) {
|
|
3712 Values* args = state()->pop_arguments(callee->arg_size());
|
|
3713 null_check(args->at(0));
|
|
3714 Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2)));
|
|
3715 compilation()->set_has_unsafe_access(true);
|
|
3716 }
|
|
3717 return InlineUnsafeOps;
|
|
3718 }
|
|
3719
|
|
3720
|
|
3721 bool GraphBuilder::append_unsafe_prefetch(ciMethod* callee, bool is_static, bool is_store) {
|
|
3722 if (InlineUnsafeOps) {
|
|
3723 Values* args = state()->pop_arguments(callee->arg_size());
|
|
3724 int obj_arg_index = 1; // Assume non-static case
|
|
3725 if (is_static) {
|
|
3726 obj_arg_index = 0;
|
|
3727 } else {
|
|
3728 null_check(args->at(0));
|
|
3729 }
|
|
3730 Instruction* offset = args->at(obj_arg_index + 1);
|
|
3731 #ifndef _LP64
|
|
3732 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
3733 #endif
|
|
3734 Instruction* op = is_store ? append(new UnsafePrefetchWrite(args->at(obj_arg_index), offset))
|
|
3735 : append(new UnsafePrefetchRead (args->at(obj_arg_index), offset));
|
|
3736 compilation()->set_has_unsafe_access(true);
|
|
3737 }
|
|
3738 return InlineUnsafeOps;
|
|
3739 }
|
|
3740
|
|
3741
|
|
3742 void GraphBuilder::append_unsafe_CAS(ciMethod* callee) {
|
|
3743 ValueType* result_type = as_ValueType(callee->return_type());
|
|
3744 assert(result_type->is_int(), "int result");
|
|
3745 Values* args = state()->pop_arguments(callee->arg_size());
|
|
3746
|
|
3747 // Pop off some args to speically handle, then push back
|
|
3748 Value newval = args->pop();
|
|
3749 Value cmpval = args->pop();
|
|
3750 Value offset = args->pop();
|
|
3751 Value src = args->pop();
|
|
3752 Value unsafe_obj = args->pop();
|
|
3753
|
|
3754 // Separately handle the unsafe arg. It is not needed for code
|
|
3755 // generation, but must be null checked
|
|
3756 null_check(unsafe_obj);
|
|
3757
|
|
3758 #ifndef _LP64
|
|
3759 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT)));
|
|
3760 #endif
|
|
3761
|
|
3762 args->push(src);
|
|
3763 args->push(offset);
|
|
3764 args->push(cmpval);
|
|
3765 args->push(newval);
|
|
3766
|
|
3767 // An unsafe CAS can alias with other field accesses, but we don't
|
|
3768 // know which ones so mark the state as no preserved. This will
|
|
3769 // cause CSE to invalidate memory across it.
|
|
3770 bool preserves_state = false;
|
|
3771 Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, lock_stack(), preserves_state);
|
|
3772 append_split(result);
|
|
3773 push(result_type, result);
|
|
3774 compilation()->set_has_unsafe_access(true);
|
|
3775 }
|
|
3776
|
|
3777
|
|
3778 #ifndef PRODUCT
|
|
3779 void GraphBuilder::print_inline_result(ciMethod* callee, bool res) {
|
|
3780 const char sync_char = callee->is_synchronized() ? 's' : ' ';
|
|
3781 const char exception_char = callee->has_exception_handlers() ? '!' : ' ';
|
|
3782 const char monitors_char = callee->has_monitor_bytecodes() ? 'm' : ' ';
|
|
3783 tty->print(" %c%c%c ", sync_char, exception_char, monitors_char);
|
|
3784 for (int i = 0; i < scope()->level(); i++) tty->print(" ");
|
|
3785 if (res) {
|
|
3786 tty->print(" ");
|
|
3787 } else {
|
|
3788 tty->print("- ");
|
|
3789 }
|
|
3790 tty->print("@ %d ", bci());
|
|
3791 callee->print_short_name();
|
|
3792 tty->print(" (%d bytes)", callee->code_size());
|
|
3793 if (_inline_bailout_msg) {
|
|
3794 tty->print(" %s", _inline_bailout_msg);
|
|
3795 }
|
|
3796 tty->cr();
|
|
3797
|
|
3798 if (res && CIPrintMethodCodes) {
|
|
3799 callee->print_codes();
|
|
3800 }
|
|
3801 }
|
|
3802
|
|
3803
|
|
3804 void GraphBuilder::print_stats() {
|
|
3805 vmap()->print();
|
|
3806 }
|
|
3807 #endif // PRODUCT
|
|
3808
|
|
3809
|
|
3810 void GraphBuilder::profile_call(Value recv, ciKlass* known_holder) {
|
|
3811 append(new ProfileCall(method(), bci(), recv, known_holder));
|
|
3812 }
|
|
3813
|
|
3814
|
|
3815 void GraphBuilder::profile_invocation(ciMethod* callee) {
|
|
3816 if (profile_calls()) {
|
|
3817 // increment the interpreter_invocation_count for the inlinee
|
|
3818 Value m = append(new Constant(new ObjectConstant(callee)));
|
|
3819 append(new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1));
|
|
3820 }
|
|
3821 }
|
|
3822
|
|
3823
|
|
3824 void GraphBuilder::profile_bci(int bci) {
|
|
3825 if (profile_branches()) {
|
|
3826 ciMethodData* md = method()->method_data();
|
|
3827 if (md == NULL) {
|
|
3828 BAILOUT("out of memory building methodDataOop");
|
|
3829 }
|
|
3830 ciProfileData* data = md->bci_to_data(bci);
|
|
3831 assert(data != NULL && data->is_JumpData(), "need JumpData for goto");
|
|
3832 Value mdo = append(new Constant(new ObjectConstant(md)));
|
|
3833 append(new ProfileCounter(mdo, md->byte_offset_of_slot(data, JumpData::taken_offset()), 1));
|
|
3834 }
|
|
3835 }
|