Mercurial > hg > graal-jvmci-8
comparison src/cpu/x86/vm/x86_32.ad @ 0:a61af66fc99e jdk7-b24
Initial load
author | duke |
---|---|
date | Sat, 01 Dec 2007 00:00:00 +0000 |
parents | |
children | 3d62cb85208d |
comparison
equal
deleted
inserted
replaced
-1:000000000000 | 0:a61af66fc99e |
---|---|
1 // | |
2 // Copyright 1997-2007 Sun Microsystems, Inc. All Rights Reserved. | |
3 // DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. | |
4 // | |
5 // This code is free software; you can redistribute it and/or modify it | |
6 // under the terms of the GNU General Public License version 2 only, as | |
7 // published by the Free Software Foundation. | |
8 // | |
9 // This code is distributed in the hope that it will be useful, but WITHOUT | |
10 // ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
11 // FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
12 // version 2 for more details (a copy is included in the LICENSE file that | |
13 // accompanied this code). | |
14 // | |
15 // You should have received a copy of the GNU General Public License version | |
16 // 2 along with this work; if not, write to the Free Software Foundation, | |
17 // Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. | |
18 // | |
19 // Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara, | |
20 // CA 95054 USA or visit www.sun.com if you need additional information or | |
21 // have any questions. | |
22 // | |
23 // | |
24 | |
25 // X86 Architecture Description File | |
26 | |
27 //----------REGISTER DEFINITION BLOCK------------------------------------------ | |
28 // This information is used by the matcher and the register allocator to | |
29 // describe individual registers and classes of registers within the target | |
30 // archtecture. | |
31 | |
32 register %{ | |
33 //----------Architecture Description Register Definitions---------------------- | |
34 // General Registers | |
35 // "reg_def" name ( register save type, C convention save type, | |
36 // ideal register type, encoding ); | |
37 // Register Save Types: | |
38 // | |
39 // NS = No-Save: The register allocator assumes that these registers | |
40 // can be used without saving upon entry to the method, & | |
41 // that they do not need to be saved at call sites. | |
42 // | |
43 // SOC = Save-On-Call: The register allocator assumes that these registers | |
44 // can be used without saving upon entry to the method, | |
45 // but that they must be saved at call sites. | |
46 // | |
47 // SOE = Save-On-Entry: The register allocator assumes that these registers | |
48 // must be saved before using them upon entry to the | |
49 // method, but they do not need to be saved at call | |
50 // sites. | |
51 // | |
52 // AS = Always-Save: The register allocator assumes that these registers | |
53 // must be saved before using them upon entry to the | |
54 // method, & that they must be saved at call sites. | |
55 // | |
56 // Ideal Register Type is used to determine how to save & restore a | |
57 // register. Op_RegI will get spilled with LoadI/StoreI, Op_RegP will get | |
58 // spilled with LoadP/StoreP. If the register supports both, use Op_RegI. | |
59 // | |
60 // The encoding number is the actual bit-pattern placed into the opcodes. | |
61 | |
62 // General Registers | |
63 // Previously set EBX, ESI, and EDI as save-on-entry for java code | |
64 // Turn off SOE in java-code due to frequent use of uncommon-traps. | |
65 // Now that allocator is better, turn on ESI and EDI as SOE registers. | |
66 | |
67 reg_def EBX(SOC, SOE, Op_RegI, 3, rbx->as_VMReg()); | |
68 reg_def ECX(SOC, SOC, Op_RegI, 1, rcx->as_VMReg()); | |
69 reg_def ESI(SOC, SOE, Op_RegI, 6, rsi->as_VMReg()); | |
70 reg_def EDI(SOC, SOE, Op_RegI, 7, rdi->as_VMReg()); | |
71 // now that adapter frames are gone EBP is always saved and restored by the prolog/epilog code | |
72 reg_def EBP(NS, SOE, Op_RegI, 5, rbp->as_VMReg()); | |
73 reg_def EDX(SOC, SOC, Op_RegI, 2, rdx->as_VMReg()); | |
74 reg_def EAX(SOC, SOC, Op_RegI, 0, rax->as_VMReg()); | |
75 reg_def ESP( NS, NS, Op_RegI, 4, rsp->as_VMReg()); | |
76 | |
77 // Special Registers | |
78 reg_def EFLAGS(SOC, SOC, 0, 8, VMRegImpl::Bad()); | |
79 | |
80 // Float registers. We treat TOS/FPR0 special. It is invisible to the | |
81 // allocator, and only shows up in the encodings. | |
82 reg_def FPR0L( SOC, SOC, Op_RegF, 0, VMRegImpl::Bad()); | |
83 reg_def FPR0H( SOC, SOC, Op_RegF, 0, VMRegImpl::Bad()); | |
84 // Ok so here's the trick FPR1 is really st(0) except in the midst | |
85 // of emission of assembly for a machnode. During the emission the fpu stack | |
86 // is pushed making FPR1 == st(1) temporarily. However at any safepoint | |
87 // the stack will not have this element so FPR1 == st(0) from the | |
88 // oopMap viewpoint. This same weirdness with numbering causes | |
89 // instruction encoding to have to play games with the register | |
90 // encode to correct for this 0/1 issue. See MachSpillCopyNode::implementation | |
91 // where it does flt->flt moves to see an example | |
92 // | |
93 reg_def FPR1L( SOC, SOC, Op_RegF, 1, as_FloatRegister(0)->as_VMReg()); | |
94 reg_def FPR1H( SOC, SOC, Op_RegF, 1, as_FloatRegister(0)->as_VMReg()->next()); | |
95 reg_def FPR2L( SOC, SOC, Op_RegF, 2, as_FloatRegister(1)->as_VMReg()); | |
96 reg_def FPR2H( SOC, SOC, Op_RegF, 2, as_FloatRegister(1)->as_VMReg()->next()); | |
97 reg_def FPR3L( SOC, SOC, Op_RegF, 3, as_FloatRegister(2)->as_VMReg()); | |
98 reg_def FPR3H( SOC, SOC, Op_RegF, 3, as_FloatRegister(2)->as_VMReg()->next()); | |
99 reg_def FPR4L( SOC, SOC, Op_RegF, 4, as_FloatRegister(3)->as_VMReg()); | |
100 reg_def FPR4H( SOC, SOC, Op_RegF, 4, as_FloatRegister(3)->as_VMReg()->next()); | |
101 reg_def FPR5L( SOC, SOC, Op_RegF, 5, as_FloatRegister(4)->as_VMReg()); | |
102 reg_def FPR5H( SOC, SOC, Op_RegF, 5, as_FloatRegister(4)->as_VMReg()->next()); | |
103 reg_def FPR6L( SOC, SOC, Op_RegF, 6, as_FloatRegister(5)->as_VMReg()); | |
104 reg_def FPR6H( SOC, SOC, Op_RegF, 6, as_FloatRegister(5)->as_VMReg()->next()); | |
105 reg_def FPR7L( SOC, SOC, Op_RegF, 7, as_FloatRegister(6)->as_VMReg()); | |
106 reg_def FPR7H( SOC, SOC, Op_RegF, 7, as_FloatRegister(6)->as_VMReg()->next()); | |
107 | |
108 // XMM registers. 128-bit registers or 4 words each, labeled a-d. | |
109 // Word a in each register holds a Float, words ab hold a Double. | |
110 // We currently do not use the SIMD capabilities, so registers cd | |
111 // are unused at the moment. | |
112 reg_def XMM0a( SOC, SOC, Op_RegF, 0, xmm0->as_VMReg()); | |
113 reg_def XMM0b( SOC, SOC, Op_RegF, 0, xmm0->as_VMReg()->next()); | |
114 reg_def XMM1a( SOC, SOC, Op_RegF, 1, xmm1->as_VMReg()); | |
115 reg_def XMM1b( SOC, SOC, Op_RegF, 1, xmm1->as_VMReg()->next()); | |
116 reg_def XMM2a( SOC, SOC, Op_RegF, 2, xmm2->as_VMReg()); | |
117 reg_def XMM2b( SOC, SOC, Op_RegF, 2, xmm2->as_VMReg()->next()); | |
118 reg_def XMM3a( SOC, SOC, Op_RegF, 3, xmm3->as_VMReg()); | |
119 reg_def XMM3b( SOC, SOC, Op_RegF, 3, xmm3->as_VMReg()->next()); | |
120 reg_def XMM4a( SOC, SOC, Op_RegF, 4, xmm4->as_VMReg()); | |
121 reg_def XMM4b( SOC, SOC, Op_RegF, 4, xmm4->as_VMReg()->next()); | |
122 reg_def XMM5a( SOC, SOC, Op_RegF, 5, xmm5->as_VMReg()); | |
123 reg_def XMM5b( SOC, SOC, Op_RegF, 5, xmm5->as_VMReg()->next()); | |
124 reg_def XMM6a( SOC, SOC, Op_RegF, 6, xmm6->as_VMReg()); | |
125 reg_def XMM6b( SOC, SOC, Op_RegF, 6, xmm6->as_VMReg()->next()); | |
126 reg_def XMM7a( SOC, SOC, Op_RegF, 7, xmm7->as_VMReg()); | |
127 reg_def XMM7b( SOC, SOC, Op_RegF, 7, xmm7->as_VMReg()->next()); | |
128 | |
129 // Specify priority of register selection within phases of register | |
130 // allocation. Highest priority is first. A useful heuristic is to | |
131 // give registers a low priority when they are required by machine | |
132 // instructions, like EAX and EDX. Registers which are used as | |
133 // pairs must fall on an even boundry (witness the FPR#L's in this list). | |
134 // For the Intel integer registers, the equivalent Long pairs are | |
135 // EDX:EAX, EBX:ECX, and EDI:EBP. | |
136 alloc_class chunk0( ECX, EBX, EBP, EDI, EAX, EDX, ESI, ESP, | |
137 FPR0L, FPR0H, FPR1L, FPR1H, FPR2L, FPR2H, | |
138 FPR3L, FPR3H, FPR4L, FPR4H, FPR5L, FPR5H, | |
139 FPR6L, FPR6H, FPR7L, FPR7H ); | |
140 | |
141 alloc_class chunk1( XMM0a, XMM0b, | |
142 XMM1a, XMM1b, | |
143 XMM2a, XMM2b, | |
144 XMM3a, XMM3b, | |
145 XMM4a, XMM4b, | |
146 XMM5a, XMM5b, | |
147 XMM6a, XMM6b, | |
148 XMM7a, XMM7b, EFLAGS); | |
149 | |
150 | |
151 //----------Architecture Description Register Classes-------------------------- | |
152 // Several register classes are automatically defined based upon information in | |
153 // this architecture description. | |
154 // 1) reg_class inline_cache_reg ( /* as def'd in frame section */ ) | |
155 // 2) reg_class compiler_method_oop_reg ( /* as def'd in frame section */ ) | |
156 // 2) reg_class interpreter_method_oop_reg ( /* as def'd in frame section */ ) | |
157 // 3) reg_class stack_slots( /* one chunk of stack-based "registers" */ ) | |
158 // | |
159 // Class for all registers | |
160 reg_class any_reg(EAX, EDX, EBP, EDI, ESI, ECX, EBX, ESP); | |
161 // Class for general registers | |
162 reg_class e_reg(EAX, EDX, EBP, EDI, ESI, ECX, EBX); | |
163 // Class for general registers which may be used for implicit null checks on win95 | |
164 // Also safe for use by tailjump. We don't want to allocate in rbp, | |
165 reg_class e_reg_no_rbp(EAX, EDX, EDI, ESI, ECX, EBX); | |
166 // Class of "X" registers | |
167 reg_class x_reg(EBX, ECX, EDX, EAX); | |
168 // Class of registers that can appear in an address with no offset. | |
169 // EBP and ESP require an extra instruction byte for zero offset. | |
170 // Used in fast-unlock | |
171 reg_class p_reg(EDX, EDI, ESI, EBX); | |
172 // Class for general registers not including ECX | |
173 reg_class ncx_reg(EAX, EDX, EBP, EDI, ESI, EBX); | |
174 // Class for general registers not including EAX | |
175 reg_class nax_reg(EDX, EDI, ESI, ECX, EBX); | |
176 // Class for general registers not including EAX or EBX. | |
177 reg_class nabx_reg(EDX, EDI, ESI, ECX, EBP); | |
178 // Class of EAX (for multiply and divide operations) | |
179 reg_class eax_reg(EAX); | |
180 // Class of EBX (for atomic add) | |
181 reg_class ebx_reg(EBX); | |
182 // Class of ECX (for shift and JCXZ operations and cmpLTMask) | |
183 reg_class ecx_reg(ECX); | |
184 // Class of EDX (for multiply and divide operations) | |
185 reg_class edx_reg(EDX); | |
186 // Class of EDI (for synchronization) | |
187 reg_class edi_reg(EDI); | |
188 // Class of ESI (for synchronization) | |
189 reg_class esi_reg(ESI); | |
190 // Singleton class for interpreter's stack pointer | |
191 reg_class ebp_reg(EBP); | |
192 // Singleton class for stack pointer | |
193 reg_class sp_reg(ESP); | |
194 // Singleton class for instruction pointer | |
195 // reg_class ip_reg(EIP); | |
196 // Singleton class for condition codes | |
197 reg_class int_flags(EFLAGS); | |
198 // Class of integer register pairs | |
199 reg_class long_reg( EAX,EDX, ECX,EBX, EBP,EDI ); | |
200 // Class of integer register pairs that aligns with calling convention | |
201 reg_class eadx_reg( EAX,EDX ); | |
202 reg_class ebcx_reg( ECX,EBX ); | |
203 // Not AX or DX, used in divides | |
204 reg_class nadx_reg( EBX,ECX,ESI,EDI,EBP ); | |
205 | |
206 // Floating point registers. Notice FPR0 is not a choice. | |
207 // FPR0 is not ever allocated; we use clever encodings to fake | |
208 // a 2-address instructions out of Intels FP stack. | |
209 reg_class flt_reg( FPR1L,FPR2L,FPR3L,FPR4L,FPR5L,FPR6L,FPR7L ); | |
210 | |
211 // make a register class for SSE registers | |
212 reg_class xmm_reg(XMM0a, XMM1a, XMM2a, XMM3a, XMM4a, XMM5a, XMM6a, XMM7a); | |
213 | |
214 // make a double register class for SSE2 registers | |
215 reg_class xdb_reg(XMM0a,XMM0b, XMM1a,XMM1b, XMM2a,XMM2b, XMM3a,XMM3b, | |
216 XMM4a,XMM4b, XMM5a,XMM5b, XMM6a,XMM6b, XMM7a,XMM7b ); | |
217 | |
218 reg_class dbl_reg( FPR1L,FPR1H, FPR2L,FPR2H, FPR3L,FPR3H, | |
219 FPR4L,FPR4H, FPR5L,FPR5H, FPR6L,FPR6H, | |
220 FPR7L,FPR7H ); | |
221 | |
222 reg_class flt_reg0( FPR1L ); | |
223 reg_class dbl_reg0( FPR1L,FPR1H ); | |
224 reg_class dbl_reg1( FPR2L,FPR2H ); | |
225 reg_class dbl_notreg0( FPR2L,FPR2H, FPR3L,FPR3H, FPR4L,FPR4H, | |
226 FPR5L,FPR5H, FPR6L,FPR6H, FPR7L,FPR7H ); | |
227 | |
228 // XMM6 and XMM7 could be used as temporary registers for long, float and | |
229 // double values for SSE2. | |
230 reg_class xdb_reg6( XMM6a,XMM6b ); | |
231 reg_class xdb_reg7( XMM7a,XMM7b ); | |
232 %} | |
233 | |
234 | |
235 //----------SOURCE BLOCK------------------------------------------------------- | |
236 // This is a block of C++ code which provides values, functions, and | |
237 // definitions necessary in the rest of the architecture description | |
238 source %{ | |
239 #define RELOC_IMM32 Assembler::imm32_operand | |
240 #define RELOC_DISP32 Assembler::disp32_operand | |
241 | |
242 #define __ _masm. | |
243 | |
244 // How to find the high register of a Long pair, given the low register | |
245 #define HIGH_FROM_LOW(x) ((x)+2) | |
246 | |
247 // These masks are used to provide 128-bit aligned bitmasks to the XMM | |
248 // instructions, to allow sign-masking or sign-bit flipping. They allow | |
249 // fast versions of NegF/NegD and AbsF/AbsD. | |
250 | |
251 // Note: 'double' and 'long long' have 32-bits alignment on x86. | |
252 static jlong* double_quadword(jlong *adr, jlong lo, jlong hi) { | |
253 // Use the expression (adr)&(~0xF) to provide 128-bits aligned address | |
254 // of 128-bits operands for SSE instructions. | |
255 jlong *operand = (jlong*)(((uintptr_t)adr)&((uintptr_t)(~0xF))); | |
256 // Store the value to a 128-bits operand. | |
257 operand[0] = lo; | |
258 operand[1] = hi; | |
259 return operand; | |
260 } | |
261 | |
262 // Buffer for 128-bits masks used by SSE instructions. | |
263 static jlong fp_signmask_pool[(4+1)*2]; // 4*128bits(data) + 128bits(alignment) | |
264 | |
265 // Static initialization during VM startup. | |
266 static jlong *float_signmask_pool = double_quadword(&fp_signmask_pool[1*2], CONST64(0x7FFFFFFF7FFFFFFF), CONST64(0x7FFFFFFF7FFFFFFF)); | |
267 static jlong *double_signmask_pool = double_quadword(&fp_signmask_pool[2*2], CONST64(0x7FFFFFFFFFFFFFFF), CONST64(0x7FFFFFFFFFFFFFFF)); | |
268 static jlong *float_signflip_pool = double_quadword(&fp_signmask_pool[3*2], CONST64(0x8000000080000000), CONST64(0x8000000080000000)); | |
269 static jlong *double_signflip_pool = double_quadword(&fp_signmask_pool[4*2], CONST64(0x8000000000000000), CONST64(0x8000000000000000)); | |
270 | |
271 // !!!!! Special hack to get all type of calls to specify the byte offset | |
272 // from the start of the call to the point where the return address | |
273 // will point. | |
274 int MachCallStaticJavaNode::ret_addr_offset() { | |
275 return 5 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); // 5 bytes from start of call to where return address points | |
276 } | |
277 | |
278 int MachCallDynamicJavaNode::ret_addr_offset() { | |
279 return 10 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); // 10 bytes from start of call to where return address points | |
280 } | |
281 | |
282 static int sizeof_FFree_Float_Stack_All = -1; | |
283 | |
284 int MachCallRuntimeNode::ret_addr_offset() { | |
285 assert(sizeof_FFree_Float_Stack_All != -1, "must have been emitted already"); | |
286 return sizeof_FFree_Float_Stack_All + 5 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); | |
287 } | |
288 | |
289 // Indicate if the safepoint node needs the polling page as an input. | |
290 // Since x86 does have absolute addressing, it doesn't. | |
291 bool SafePointNode::needs_polling_address_input() { | |
292 return false; | |
293 } | |
294 | |
295 // | |
296 // Compute padding required for nodes which need alignment | |
297 // | |
298 | |
299 // The address of the call instruction needs to be 4-byte aligned to | |
300 // ensure that it does not span a cache line so that it can be patched. | |
301 int CallStaticJavaDirectNode::compute_padding(int current_offset) const { | |
302 if (Compile::current()->in_24_bit_fp_mode()) | |
303 current_offset += 6; // skip fldcw in pre_call_FPU, if any | |
304 current_offset += 1; // skip call opcode byte | |
305 return round_to(current_offset, alignment_required()) - current_offset; | |
306 } | |
307 | |
308 // The address of the call instruction needs to be 4-byte aligned to | |
309 // ensure that it does not span a cache line so that it can be patched. | |
310 int CallDynamicJavaDirectNode::compute_padding(int current_offset) const { | |
311 if (Compile::current()->in_24_bit_fp_mode()) | |
312 current_offset += 6; // skip fldcw in pre_call_FPU, if any | |
313 current_offset += 5; // skip MOV instruction | |
314 current_offset += 1; // skip call opcode byte | |
315 return round_to(current_offset, alignment_required()) - current_offset; | |
316 } | |
317 | |
318 #ifndef PRODUCT | |
319 void MachBreakpointNode::format( PhaseRegAlloc *, outputStream* st ) const { | |
320 st->print("INT3"); | |
321 } | |
322 #endif | |
323 | |
324 // EMIT_RM() | |
325 void emit_rm(CodeBuffer &cbuf, int f1, int f2, int f3) { | |
326 unsigned char c = (unsigned char)((f1 << 6) | (f2 << 3) | f3); | |
327 *(cbuf.code_end()) = c; | |
328 cbuf.set_code_end(cbuf.code_end() + 1); | |
329 } | |
330 | |
331 // EMIT_CC() | |
332 void emit_cc(CodeBuffer &cbuf, int f1, int f2) { | |
333 unsigned char c = (unsigned char)( f1 | f2 ); | |
334 *(cbuf.code_end()) = c; | |
335 cbuf.set_code_end(cbuf.code_end() + 1); | |
336 } | |
337 | |
338 // EMIT_OPCODE() | |
339 void emit_opcode(CodeBuffer &cbuf, int code) { | |
340 *(cbuf.code_end()) = (unsigned char)code; | |
341 cbuf.set_code_end(cbuf.code_end() + 1); | |
342 } | |
343 | |
344 // EMIT_OPCODE() w/ relocation information | |
345 void emit_opcode(CodeBuffer &cbuf, int code, relocInfo::relocType reloc, int offset = 0) { | |
346 cbuf.relocate(cbuf.inst_mark() + offset, reloc); | |
347 emit_opcode(cbuf, code); | |
348 } | |
349 | |
350 // EMIT_D8() | |
351 void emit_d8(CodeBuffer &cbuf, int d8) { | |
352 *(cbuf.code_end()) = (unsigned char)d8; | |
353 cbuf.set_code_end(cbuf.code_end() + 1); | |
354 } | |
355 | |
356 // EMIT_D16() | |
357 void emit_d16(CodeBuffer &cbuf, int d16) { | |
358 *((short *)(cbuf.code_end())) = d16; | |
359 cbuf.set_code_end(cbuf.code_end() + 2); | |
360 } | |
361 | |
362 // EMIT_D32() | |
363 void emit_d32(CodeBuffer &cbuf, int d32) { | |
364 *((int *)(cbuf.code_end())) = d32; | |
365 cbuf.set_code_end(cbuf.code_end() + 4); | |
366 } | |
367 | |
368 // emit 32 bit value and construct relocation entry from relocInfo::relocType | |
369 void emit_d32_reloc(CodeBuffer &cbuf, int d32, relocInfo::relocType reloc, | |
370 int format) { | |
371 cbuf.relocate(cbuf.inst_mark(), reloc, format); | |
372 | |
373 *((int *)(cbuf.code_end())) = d32; | |
374 cbuf.set_code_end(cbuf.code_end() + 4); | |
375 } | |
376 | |
377 // emit 32 bit value and construct relocation entry from RelocationHolder | |
378 void emit_d32_reloc(CodeBuffer &cbuf, int d32, RelocationHolder const& rspec, | |
379 int format) { | |
380 #ifdef ASSERT | |
381 if (rspec.reloc()->type() == relocInfo::oop_type && d32 != 0 && d32 != (int)Universe::non_oop_word()) { | |
382 assert(oop(d32)->is_oop() && oop(d32)->is_perm(), "cannot embed non-perm oops in code"); | |
383 } | |
384 #endif | |
385 cbuf.relocate(cbuf.inst_mark(), rspec, format); | |
386 | |
387 *((int *)(cbuf.code_end())) = d32; | |
388 cbuf.set_code_end(cbuf.code_end() + 4); | |
389 } | |
390 | |
391 // Access stack slot for load or store | |
392 void store_to_stackslot(CodeBuffer &cbuf, int opcode, int rm_field, int disp) { | |
393 emit_opcode( cbuf, opcode ); // (e.g., FILD [ESP+src]) | |
394 if( -128 <= disp && disp <= 127 ) { | |
395 emit_rm( cbuf, 0x01, rm_field, ESP_enc ); // R/M byte | |
396 emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte | |
397 emit_d8 (cbuf, disp); // Displacement // R/M byte | |
398 } else { | |
399 emit_rm( cbuf, 0x02, rm_field, ESP_enc ); // R/M byte | |
400 emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte | |
401 emit_d32(cbuf, disp); // Displacement // R/M byte | |
402 } | |
403 } | |
404 | |
405 // eRegI ereg, memory mem) %{ // emit_reg_mem | |
406 void encode_RegMem( CodeBuffer &cbuf, int reg_encoding, int base, int index, int scale, int displace, bool displace_is_oop ) { | |
407 // There is no index & no scale, use form without SIB byte | |
408 if ((index == 0x4) && | |
409 (scale == 0) && (base != ESP_enc)) { | |
410 // If no displacement, mode is 0x0; unless base is [EBP] | |
411 if ( (displace == 0) && (base != EBP_enc) ) { | |
412 emit_rm(cbuf, 0x0, reg_encoding, base); | |
413 } | |
414 else { // If 8-bit displacement, mode 0x1 | |
415 if ((displace >= -128) && (displace <= 127) | |
416 && !(displace_is_oop) ) { | |
417 emit_rm(cbuf, 0x1, reg_encoding, base); | |
418 emit_d8(cbuf, displace); | |
419 } | |
420 else { // If 32-bit displacement | |
421 if (base == -1) { // Special flag for absolute address | |
422 emit_rm(cbuf, 0x0, reg_encoding, 0x5); | |
423 // (manual lies; no SIB needed here) | |
424 if ( displace_is_oop ) { | |
425 emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); | |
426 } else { | |
427 emit_d32 (cbuf, displace); | |
428 } | |
429 } | |
430 else { // Normal base + offset | |
431 emit_rm(cbuf, 0x2, reg_encoding, base); | |
432 if ( displace_is_oop ) { | |
433 emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); | |
434 } else { | |
435 emit_d32 (cbuf, displace); | |
436 } | |
437 } | |
438 } | |
439 } | |
440 } | |
441 else { // Else, encode with the SIB byte | |
442 // If no displacement, mode is 0x0; unless base is [EBP] | |
443 if (displace == 0 && (base != EBP_enc)) { // If no displacement | |
444 emit_rm(cbuf, 0x0, reg_encoding, 0x4); | |
445 emit_rm(cbuf, scale, index, base); | |
446 } | |
447 else { // If 8-bit displacement, mode 0x1 | |
448 if ((displace >= -128) && (displace <= 127) | |
449 && !(displace_is_oop) ) { | |
450 emit_rm(cbuf, 0x1, reg_encoding, 0x4); | |
451 emit_rm(cbuf, scale, index, base); | |
452 emit_d8(cbuf, displace); | |
453 } | |
454 else { // If 32-bit displacement | |
455 if (base == 0x04 ) { | |
456 emit_rm(cbuf, 0x2, reg_encoding, 0x4); | |
457 emit_rm(cbuf, scale, index, 0x04); | |
458 } else { | |
459 emit_rm(cbuf, 0x2, reg_encoding, 0x4); | |
460 emit_rm(cbuf, scale, index, base); | |
461 } | |
462 if ( displace_is_oop ) { | |
463 emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); | |
464 } else { | |
465 emit_d32 (cbuf, displace); | |
466 } | |
467 } | |
468 } | |
469 } | |
470 } | |
471 | |
472 | |
473 void encode_Copy( CodeBuffer &cbuf, int dst_encoding, int src_encoding ) { | |
474 if( dst_encoding == src_encoding ) { | |
475 // reg-reg copy, use an empty encoding | |
476 } else { | |
477 emit_opcode( cbuf, 0x8B ); | |
478 emit_rm(cbuf, 0x3, dst_encoding, src_encoding ); | |
479 } | |
480 } | |
481 | |
482 void encode_CopyXD( CodeBuffer &cbuf, int dst_encoding, int src_encoding ) { | |
483 if( dst_encoding == src_encoding ) { | |
484 // reg-reg copy, use an empty encoding | |
485 } else { | |
486 MacroAssembler _masm(&cbuf); | |
487 | |
488 __ movdqa(as_XMMRegister(dst_encoding), as_XMMRegister(src_encoding)); | |
489 } | |
490 } | |
491 | |
492 | |
493 //============================================================================= | |
494 #ifndef PRODUCT | |
495 void MachPrologNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
496 Compile* C = ra_->C; | |
497 if( C->in_24_bit_fp_mode() ) { | |
498 tty->print("FLDCW 24 bit fpu control word"); | |
499 tty->print_cr(""); tty->print("\t"); | |
500 } | |
501 | |
502 int framesize = C->frame_slots() << LogBytesPerInt; | |
503 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
504 // Remove two words for return addr and rbp, | |
505 framesize -= 2*wordSize; | |
506 | |
507 // Calls to C2R adapters often do not accept exceptional returns. | |
508 // We require that their callers must bang for them. But be careful, because | |
509 // some VM calls (such as call site linkage) can use several kilobytes of | |
510 // stack. But the stack safety zone should account for that. | |
511 // See bugs 4446381, 4468289, 4497237. | |
512 if (C->need_stack_bang(framesize)) { | |
513 tty->print_cr("# stack bang"); tty->print("\t"); | |
514 } | |
515 tty->print_cr("PUSHL EBP"); tty->print("\t"); | |
516 | |
517 if( VerifyStackAtCalls ) { // Majik cookie to verify stack depth | |
518 tty->print("PUSH 0xBADB100D\t# Majik cookie for stack depth check"); | |
519 tty->print_cr(""); tty->print("\t"); | |
520 framesize -= wordSize; | |
521 } | |
522 | |
523 if ((C->in_24_bit_fp_mode() || VerifyStackAtCalls ) && framesize < 128 ) { | |
524 if (framesize) { | |
525 tty->print("SUB ESP,%d\t# Create frame",framesize); | |
526 } | |
527 } else { | |
528 tty->print("SUB ESP,%d\t# Create frame",framesize); | |
529 } | |
530 } | |
531 #endif | |
532 | |
533 | |
534 void MachPrologNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
535 Compile* C = ra_->C; | |
536 | |
537 if (UseSSE >= 2 && VerifyFPU) { | |
538 MacroAssembler masm(&cbuf); | |
539 masm.verify_FPU(0, "FPU stack must be clean on entry"); | |
540 } | |
541 | |
542 // WARNING: Initial instruction MUST be 5 bytes or longer so that | |
543 // NativeJump::patch_verified_entry will be able to patch out the entry | |
544 // code safely. The fldcw is ok at 6 bytes, the push to verify stack | |
545 // depth is ok at 5 bytes, the frame allocation can be either 3 or | |
546 // 6 bytes. So if we don't do the fldcw or the push then we must | |
547 // use the 6 byte frame allocation even if we have no frame. :-( | |
548 // If method sets FPU control word do it now | |
549 if( C->in_24_bit_fp_mode() ) { | |
550 MacroAssembler masm(&cbuf); | |
551 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_24())); | |
552 } | |
553 | |
554 int framesize = C->frame_slots() << LogBytesPerInt; | |
555 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
556 // Remove two words for return addr and rbp, | |
557 framesize -= 2*wordSize; | |
558 | |
559 // Calls to C2R adapters often do not accept exceptional returns. | |
560 // We require that their callers must bang for them. But be careful, because | |
561 // some VM calls (such as call site linkage) can use several kilobytes of | |
562 // stack. But the stack safety zone should account for that. | |
563 // See bugs 4446381, 4468289, 4497237. | |
564 if (C->need_stack_bang(framesize)) { | |
565 MacroAssembler masm(&cbuf); | |
566 masm.generate_stack_overflow_check(framesize); | |
567 } | |
568 | |
569 // We always push rbp, so that on return to interpreter rbp, will be | |
570 // restored correctly and we can correct the stack. | |
571 emit_opcode(cbuf, 0x50 | EBP_enc); | |
572 | |
573 if( VerifyStackAtCalls ) { // Majik cookie to verify stack depth | |
574 emit_opcode(cbuf, 0x68); // push 0xbadb100d | |
575 emit_d32(cbuf, 0xbadb100d); | |
576 framesize -= wordSize; | |
577 } | |
578 | |
579 if ((C->in_24_bit_fp_mode() || VerifyStackAtCalls ) && framesize < 128 ) { | |
580 if (framesize) { | |
581 emit_opcode(cbuf, 0x83); // sub SP,#framesize | |
582 emit_rm(cbuf, 0x3, 0x05, ESP_enc); | |
583 emit_d8(cbuf, framesize); | |
584 } | |
585 } else { | |
586 emit_opcode(cbuf, 0x81); // sub SP,#framesize | |
587 emit_rm(cbuf, 0x3, 0x05, ESP_enc); | |
588 emit_d32(cbuf, framesize); | |
589 } | |
590 C->set_frame_complete(cbuf.code_end() - cbuf.code_begin()); | |
591 | |
592 #ifdef ASSERT | |
593 if (VerifyStackAtCalls) { | |
594 Label L; | |
595 MacroAssembler masm(&cbuf); | |
596 masm.pushl(rax); | |
597 masm.movl(rax, rsp); | |
598 masm.andl(rax, StackAlignmentInBytes-1); | |
599 masm.cmpl(rax, StackAlignmentInBytes-wordSize); | |
600 masm.popl(rax); | |
601 masm.jcc(Assembler::equal, L); | |
602 masm.stop("Stack is not properly aligned!"); | |
603 masm.bind(L); | |
604 } | |
605 #endif | |
606 | |
607 } | |
608 | |
609 uint MachPrologNode::size(PhaseRegAlloc *ra_) const { | |
610 return MachNode::size(ra_); // too many variables; just compute it the hard way | |
611 } | |
612 | |
613 int MachPrologNode::reloc() const { | |
614 return 0; // a large enough number | |
615 } | |
616 | |
617 //============================================================================= | |
618 #ifndef PRODUCT | |
619 void MachEpilogNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
620 Compile *C = ra_->C; | |
621 int framesize = C->frame_slots() << LogBytesPerInt; | |
622 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
623 // Remove two words for return addr and rbp, | |
624 framesize -= 2*wordSize; | |
625 | |
626 if( C->in_24_bit_fp_mode() ) { | |
627 st->print("FLDCW standard control word"); | |
628 st->cr(); st->print("\t"); | |
629 } | |
630 if( framesize ) { | |
631 st->print("ADD ESP,%d\t# Destroy frame",framesize); | |
632 st->cr(); st->print("\t"); | |
633 } | |
634 st->print_cr("POPL EBP"); st->print("\t"); | |
635 if( do_polling() && C->is_method_compilation() ) { | |
636 st->print("TEST PollPage,EAX\t! Poll Safepoint"); | |
637 st->cr(); st->print("\t"); | |
638 } | |
639 } | |
640 #endif | |
641 | |
642 void MachEpilogNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
643 Compile *C = ra_->C; | |
644 | |
645 // If method set FPU control word, restore to standard control word | |
646 if( C->in_24_bit_fp_mode() ) { | |
647 MacroAssembler masm(&cbuf); | |
648 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_std())); | |
649 } | |
650 | |
651 int framesize = C->frame_slots() << LogBytesPerInt; | |
652 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
653 // Remove two words for return addr and rbp, | |
654 framesize -= 2*wordSize; | |
655 | |
656 // Note that VerifyStackAtCalls' Majik cookie does not change the frame size popped here | |
657 | |
658 if( framesize >= 128 ) { | |
659 emit_opcode(cbuf, 0x81); // add SP, #framesize | |
660 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
661 emit_d32(cbuf, framesize); | |
662 } | |
663 else if( framesize ) { | |
664 emit_opcode(cbuf, 0x83); // add SP, #framesize | |
665 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
666 emit_d8(cbuf, framesize); | |
667 } | |
668 | |
669 emit_opcode(cbuf, 0x58 | EBP_enc); | |
670 | |
671 if( do_polling() && C->is_method_compilation() ) { | |
672 cbuf.relocate(cbuf.code_end(), relocInfo::poll_return_type, 0); | |
673 emit_opcode(cbuf,0x85); | |
674 emit_rm(cbuf, 0x0, EAX_enc, 0x5); // EAX | |
675 emit_d32(cbuf, (intptr_t)os::get_polling_page()); | |
676 } | |
677 } | |
678 | |
679 uint MachEpilogNode::size(PhaseRegAlloc *ra_) const { | |
680 Compile *C = ra_->C; | |
681 // If method set FPU control word, restore to standard control word | |
682 int size = C->in_24_bit_fp_mode() ? 6 : 0; | |
683 if( do_polling() && C->is_method_compilation() ) size += 6; | |
684 | |
685 int framesize = C->frame_slots() << LogBytesPerInt; | |
686 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
687 // Remove two words for return addr and rbp, | |
688 framesize -= 2*wordSize; | |
689 | |
690 size++; // popl rbp, | |
691 | |
692 if( framesize >= 128 ) { | |
693 size += 6; | |
694 } else { | |
695 size += framesize ? 3 : 0; | |
696 } | |
697 return size; | |
698 } | |
699 | |
700 int MachEpilogNode::reloc() const { | |
701 return 0; // a large enough number | |
702 } | |
703 | |
704 const Pipeline * MachEpilogNode::pipeline() const { | |
705 return MachNode::pipeline_class(); | |
706 } | |
707 | |
708 int MachEpilogNode::safepoint_offset() const { return 0; } | |
709 | |
710 //============================================================================= | |
711 | |
712 enum RC { rc_bad, rc_int, rc_float, rc_xmm, rc_stack }; | |
713 static enum RC rc_class( OptoReg::Name reg ) { | |
714 | |
715 if( !OptoReg::is_valid(reg) ) return rc_bad; | |
716 if (OptoReg::is_stack(reg)) return rc_stack; | |
717 | |
718 VMReg r = OptoReg::as_VMReg(reg); | |
719 if (r->is_Register()) return rc_int; | |
720 if (r->is_FloatRegister()) { | |
721 assert(UseSSE < 2, "shouldn't be used in SSE2+ mode"); | |
722 return rc_float; | |
723 } | |
724 assert(r->is_XMMRegister(), "must be"); | |
725 return rc_xmm; | |
726 } | |
727 | |
728 static int impl_helper( CodeBuffer *cbuf, bool do_size, bool is_load, int offset, int reg, int opcode, const char *op_str, int size ) { | |
729 if( cbuf ) { | |
730 emit_opcode (*cbuf, opcode ); | |
731 encode_RegMem(*cbuf, Matcher::_regEncode[reg], ESP_enc, 0x4, 0, offset, false); | |
732 #ifndef PRODUCT | |
733 } else if( !do_size ) { | |
734 if( size != 0 ) tty->print("\n\t"); | |
735 if( opcode == 0x8B || opcode == 0x89 ) { // MOV | |
736 if( is_load ) tty->print("%s %s,[ESP + #%d]",op_str,Matcher::regName[reg],offset); | |
737 else tty->print("%s [ESP + #%d],%s",op_str,offset,Matcher::regName[reg]); | |
738 } else { // FLD, FST, PUSH, POP | |
739 tty->print("%s [ESP + #%d]",op_str,offset); | |
740 } | |
741 #endif | |
742 } | |
743 int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); | |
744 return size+3+offset_size; | |
745 } | |
746 | |
747 // Helper for XMM registers. Extra opcode bits, limited syntax. | |
748 static int impl_x_helper( CodeBuffer *cbuf, bool do_size, bool is_load, | |
749 int offset, int reg_lo, int reg_hi, int size ) { | |
750 if( cbuf ) { | |
751 if( reg_lo+1 == reg_hi ) { // double move? | |
752 if( is_load && !UseXmmLoadAndClearUpper ) | |
753 emit_opcode(*cbuf, 0x66 ); // use 'movlpd' for load | |
754 else | |
755 emit_opcode(*cbuf, 0xF2 ); // use 'movsd' otherwise | |
756 } else { | |
757 emit_opcode(*cbuf, 0xF3 ); | |
758 } | |
759 emit_opcode(*cbuf, 0x0F ); | |
760 if( reg_lo+1 == reg_hi && is_load && !UseXmmLoadAndClearUpper ) | |
761 emit_opcode(*cbuf, 0x12 ); // use 'movlpd' for load | |
762 else | |
763 emit_opcode(*cbuf, is_load ? 0x10 : 0x11 ); | |
764 encode_RegMem(*cbuf, Matcher::_regEncode[reg_lo], ESP_enc, 0x4, 0, offset, false); | |
765 #ifndef PRODUCT | |
766 } else if( !do_size ) { | |
767 if( size != 0 ) tty->print("\n\t"); | |
768 if( reg_lo+1 == reg_hi ) { // double move? | |
769 if( is_load ) tty->print("%s %s,[ESP + #%d]", | |
770 UseXmmLoadAndClearUpper ? "MOVSD " : "MOVLPD", | |
771 Matcher::regName[reg_lo], offset); | |
772 else tty->print("MOVSD [ESP + #%d],%s", | |
773 offset, Matcher::regName[reg_lo]); | |
774 } else { | |
775 if( is_load ) tty->print("MOVSS %s,[ESP + #%d]", | |
776 Matcher::regName[reg_lo], offset); | |
777 else tty->print("MOVSS [ESP + #%d],%s", | |
778 offset, Matcher::regName[reg_lo]); | |
779 } | |
780 #endif | |
781 } | |
782 int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); | |
783 return size+5+offset_size; | |
784 } | |
785 | |
786 | |
787 static int impl_movx_helper( CodeBuffer *cbuf, bool do_size, int src_lo, int dst_lo, | |
788 int src_hi, int dst_hi, int size ) { | |
789 if( UseXmmRegToRegMoveAll ) {//Use movaps,movapd to move between xmm registers | |
790 if( cbuf ) { | |
791 if( (src_lo+1 == src_hi && dst_lo+1 == dst_hi) ) { | |
792 emit_opcode(*cbuf, 0x66 ); | |
793 } | |
794 emit_opcode(*cbuf, 0x0F ); | |
795 emit_opcode(*cbuf, 0x28 ); | |
796 emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst_lo], Matcher::_regEncode[src_lo] ); | |
797 #ifndef PRODUCT | |
798 } else if( !do_size ) { | |
799 if( size != 0 ) tty->print("\n\t"); | |
800 if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double move? | |
801 tty->print("MOVAPD %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
802 } else { | |
803 tty->print("MOVAPS %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
804 } | |
805 #endif | |
806 } | |
807 return size + ((src_lo+1 == src_hi && dst_lo+1 == dst_hi) ? 4 : 3); | |
808 } else { | |
809 if( cbuf ) { | |
810 emit_opcode(*cbuf, (src_lo+1 == src_hi && dst_lo+1 == dst_hi) ? 0xF2 : 0xF3 ); | |
811 emit_opcode(*cbuf, 0x0F ); | |
812 emit_opcode(*cbuf, 0x10 ); | |
813 emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst_lo], Matcher::_regEncode[src_lo] ); | |
814 #ifndef PRODUCT | |
815 } else if( !do_size ) { | |
816 if( size != 0 ) tty->print("\n\t"); | |
817 if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double move? | |
818 tty->print("MOVSD %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
819 } else { | |
820 tty->print("MOVSS %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
821 } | |
822 #endif | |
823 } | |
824 return size+4; | |
825 } | |
826 } | |
827 | |
828 static int impl_mov_helper( CodeBuffer *cbuf, bool do_size, int src, int dst, int size ) { | |
829 if( cbuf ) { | |
830 emit_opcode(*cbuf, 0x8B ); | |
831 emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst], Matcher::_regEncode[src] ); | |
832 #ifndef PRODUCT | |
833 } else if( !do_size ) { | |
834 if( size != 0 ) tty->print("\n\t"); | |
835 tty->print("MOV %s,%s",Matcher::regName[dst],Matcher::regName[src]); | |
836 #endif | |
837 } | |
838 return size+2; | |
839 } | |
840 | |
841 static int impl_fp_store_helper( CodeBuffer *cbuf, bool do_size, int src_lo, int src_hi, int dst_lo, int dst_hi, int offset, int size ) { | |
842 if( src_lo != FPR1L_num ) { // Move value to top of FP stack, if not already there | |
843 if( cbuf ) { | |
844 emit_opcode( *cbuf, 0xD9 ); // FLD (i.e., push it) | |
845 emit_d8( *cbuf, 0xC0-1+Matcher::_regEncode[src_lo] ); | |
846 #ifndef PRODUCT | |
847 } else if( !do_size ) { | |
848 if( size != 0 ) tty->print("\n\t"); | |
849 tty->print("FLD %s",Matcher::regName[src_lo]); | |
850 #endif | |
851 } | |
852 size += 2; | |
853 } | |
854 | |
855 int st_op = (src_lo != FPR1L_num) ? EBX_num /*store & pop*/ : EDX_num /*store no pop*/; | |
856 const char *op_str; | |
857 int op; | |
858 if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double store? | |
859 op_str = (src_lo != FPR1L_num) ? "FSTP_D" : "FST_D "; | |
860 op = 0xDD; | |
861 } else { // 32-bit store | |
862 op_str = (src_lo != FPR1L_num) ? "FSTP_S" : "FST_S "; | |
863 op = 0xD9; | |
864 assert( !OptoReg::is_valid(src_hi) && !OptoReg::is_valid(dst_hi), "no non-adjacent float-stores" ); | |
865 } | |
866 | |
867 return impl_helper(cbuf,do_size,false,offset,st_op,op,op_str,size); | |
868 } | |
869 | |
870 uint MachSpillCopyNode::implementation( CodeBuffer *cbuf, PhaseRegAlloc *ra_, bool do_size, outputStream* st ) const { | |
871 // Get registers to move | |
872 OptoReg::Name src_second = ra_->get_reg_second(in(1)); | |
873 OptoReg::Name src_first = ra_->get_reg_first(in(1)); | |
874 OptoReg::Name dst_second = ra_->get_reg_second(this ); | |
875 OptoReg::Name dst_first = ra_->get_reg_first(this ); | |
876 | |
877 enum RC src_second_rc = rc_class(src_second); | |
878 enum RC src_first_rc = rc_class(src_first); | |
879 enum RC dst_second_rc = rc_class(dst_second); | |
880 enum RC dst_first_rc = rc_class(dst_first); | |
881 | |
882 assert( OptoReg::is_valid(src_first) && OptoReg::is_valid(dst_first), "must move at least 1 register" ); | |
883 | |
884 // Generate spill code! | |
885 int size = 0; | |
886 | |
887 if( src_first == dst_first && src_second == dst_second ) | |
888 return size; // Self copy, no move | |
889 | |
890 // -------------------------------------- | |
891 // Check for mem-mem move. push/pop to move. | |
892 if( src_first_rc == rc_stack && dst_first_rc == rc_stack ) { | |
893 if( src_second == dst_first ) { // overlapping stack copy ranges | |
894 assert( src_second_rc == rc_stack && dst_second_rc == rc_stack, "we only expect a stk-stk copy here" ); | |
895 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),ESI_num,0xFF,"PUSH ",size); | |
896 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),EAX_num,0x8F,"POP ",size); | |
897 src_second_rc = dst_second_rc = rc_bad; // flag as already moved the second bits | |
898 } | |
899 // move low bits | |
900 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),ESI_num,0xFF,"PUSH ",size); | |
901 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),EAX_num,0x8F,"POP ",size); | |
902 if( src_second_rc == rc_stack && dst_second_rc == rc_stack ) { // mov second bits | |
903 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),ESI_num,0xFF,"PUSH ",size); | |
904 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),EAX_num,0x8F,"POP ",size); | |
905 } | |
906 return size; | |
907 } | |
908 | |
909 // -------------------------------------- | |
910 // Check for integer reg-reg copy | |
911 if( src_first_rc == rc_int && dst_first_rc == rc_int ) | |
912 size = impl_mov_helper(cbuf,do_size,src_first,dst_first,size); | |
913 | |
914 // Check for integer store | |
915 if( src_first_rc == rc_int && dst_first_rc == rc_stack ) | |
916 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),src_first,0x89,"MOV ",size); | |
917 | |
918 // Check for integer load | |
919 if( dst_first_rc == rc_int && src_first_rc == rc_stack ) | |
920 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),dst_first,0x8B,"MOV ",size); | |
921 | |
922 // -------------------------------------- | |
923 // Check for float reg-reg copy | |
924 if( src_first_rc == rc_float && dst_first_rc == rc_float ) { | |
925 assert( (src_second_rc == rc_bad && dst_second_rc == rc_bad) || | |
926 (src_first+1 == src_second && dst_first+1 == dst_second), "no non-adjacent float-moves" ); | |
927 if( cbuf ) { | |
928 | |
929 // Note the mucking with the register encode to compensate for the 0/1 | |
930 // indexing issue mentioned in a comment in the reg_def sections | |
931 // for FPR registers many lines above here. | |
932 | |
933 if( src_first != FPR1L_num ) { | |
934 emit_opcode (*cbuf, 0xD9 ); // FLD ST(i) | |
935 emit_d8 (*cbuf, 0xC0+Matcher::_regEncode[src_first]-1 ); | |
936 emit_opcode (*cbuf, 0xDD ); // FSTP ST(i) | |
937 emit_d8 (*cbuf, 0xD8+Matcher::_regEncode[dst_first] ); | |
938 } else { | |
939 emit_opcode (*cbuf, 0xDD ); // FST ST(i) | |
940 emit_d8 (*cbuf, 0xD0+Matcher::_regEncode[dst_first]-1 ); | |
941 } | |
942 #ifndef PRODUCT | |
943 } else if( !do_size ) { | |
944 if( size != 0 ) st->print("\n\t"); | |
945 if( src_first != FPR1L_num ) st->print("FLD %s\n\tFSTP %s",Matcher::regName[src_first],Matcher::regName[dst_first]); | |
946 else st->print( "FST %s", Matcher::regName[dst_first]); | |
947 #endif | |
948 } | |
949 return size + ((src_first != FPR1L_num) ? 2+2 : 2); | |
950 } | |
951 | |
952 // Check for float store | |
953 if( src_first_rc == rc_float && dst_first_rc == rc_stack ) { | |
954 return impl_fp_store_helper(cbuf,do_size,src_first,src_second,dst_first,dst_second,ra_->reg2offset(dst_first),size); | |
955 } | |
956 | |
957 // Check for float load | |
958 if( dst_first_rc == rc_float && src_first_rc == rc_stack ) { | |
959 int offset = ra_->reg2offset(src_first); | |
960 const char *op_str; | |
961 int op; | |
962 if( src_first+1 == src_second && dst_first+1 == dst_second ) { // double load? | |
963 op_str = "FLD_D"; | |
964 op = 0xDD; | |
965 } else { // 32-bit load | |
966 op_str = "FLD_S"; | |
967 op = 0xD9; | |
968 assert( src_second_rc == rc_bad && dst_second_rc == rc_bad, "no non-adjacent float-loads" ); | |
969 } | |
970 if( cbuf ) { | |
971 emit_opcode (*cbuf, op ); | |
972 encode_RegMem(*cbuf, 0x0, ESP_enc, 0x4, 0, offset, false); | |
973 emit_opcode (*cbuf, 0xDD ); // FSTP ST(i) | |
974 emit_d8 (*cbuf, 0xD8+Matcher::_regEncode[dst_first] ); | |
975 #ifndef PRODUCT | |
976 } else if( !do_size ) { | |
977 if( size != 0 ) st->print("\n\t"); | |
978 st->print("%s ST,[ESP + #%d]\n\tFSTP %s",op_str, offset,Matcher::regName[dst_first]); | |
979 #endif | |
980 } | |
981 int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); | |
982 return size + 3+offset_size+2; | |
983 } | |
984 | |
985 // Check for xmm reg-reg copy | |
986 if( src_first_rc == rc_xmm && dst_first_rc == rc_xmm ) { | |
987 assert( (src_second_rc == rc_bad && dst_second_rc == rc_bad) || | |
988 (src_first+1 == src_second && dst_first+1 == dst_second), | |
989 "no non-adjacent float-moves" ); | |
990 return impl_movx_helper(cbuf,do_size,src_first,dst_first,src_second, dst_second, size); | |
991 } | |
992 | |
993 // Check for xmm store | |
994 if( src_first_rc == rc_xmm && dst_first_rc == rc_stack ) { | |
995 return impl_x_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),src_first, src_second, size); | |
996 } | |
997 | |
998 // Check for float xmm load | |
999 if( dst_first_rc == rc_xmm && src_first_rc == rc_stack ) { | |
1000 return impl_x_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),dst_first, dst_second, size); | |
1001 } | |
1002 | |
1003 // Copy from float reg to xmm reg | |
1004 if( dst_first_rc == rc_xmm && src_first_rc == rc_float ) { | |
1005 // copy to the top of stack from floating point reg | |
1006 // and use LEA to preserve flags | |
1007 if( cbuf ) { | |
1008 emit_opcode(*cbuf,0x8D); // LEA ESP,[ESP-8] | |
1009 emit_rm(*cbuf, 0x1, ESP_enc, 0x04); | |
1010 emit_rm(*cbuf, 0x0, 0x04, ESP_enc); | |
1011 emit_d8(*cbuf,0xF8); | |
1012 #ifndef PRODUCT | |
1013 } else if( !do_size ) { | |
1014 if( size != 0 ) st->print("\n\t"); | |
1015 st->print("LEA ESP,[ESP-8]"); | |
1016 #endif | |
1017 } | |
1018 size += 4; | |
1019 | |
1020 size = impl_fp_store_helper(cbuf,do_size,src_first,src_second,dst_first,dst_second,0,size); | |
1021 | |
1022 // Copy from the temp memory to the xmm reg. | |
1023 size = impl_x_helper(cbuf,do_size,true ,0,dst_first, dst_second, size); | |
1024 | |
1025 if( cbuf ) { | |
1026 emit_opcode(*cbuf,0x8D); // LEA ESP,[ESP+8] | |
1027 emit_rm(*cbuf, 0x1, ESP_enc, 0x04); | |
1028 emit_rm(*cbuf, 0x0, 0x04, ESP_enc); | |
1029 emit_d8(*cbuf,0x08); | |
1030 #ifndef PRODUCT | |
1031 } else if( !do_size ) { | |
1032 if( size != 0 ) st->print("\n\t"); | |
1033 st->print("LEA ESP,[ESP+8]"); | |
1034 #endif | |
1035 } | |
1036 size += 4; | |
1037 return size; | |
1038 } | |
1039 | |
1040 assert( size > 0, "missed a case" ); | |
1041 | |
1042 // -------------------------------------------------------------------- | |
1043 // Check for second bits still needing moving. | |
1044 if( src_second == dst_second ) | |
1045 return size; // Self copy; no move | |
1046 assert( src_second_rc != rc_bad && dst_second_rc != rc_bad, "src_second & dst_second cannot be Bad" ); | |
1047 | |
1048 // Check for second word int-int move | |
1049 if( src_second_rc == rc_int && dst_second_rc == rc_int ) | |
1050 return impl_mov_helper(cbuf,do_size,src_second,dst_second,size); | |
1051 | |
1052 // Check for second word integer store | |
1053 if( src_second_rc == rc_int && dst_second_rc == rc_stack ) | |
1054 return impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),src_second,0x89,"MOV ",size); | |
1055 | |
1056 // Check for second word integer load | |
1057 if( dst_second_rc == rc_int && src_second_rc == rc_stack ) | |
1058 return impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),dst_second,0x8B,"MOV ",size); | |
1059 | |
1060 | |
1061 Unimplemented(); | |
1062 } | |
1063 | |
1064 #ifndef PRODUCT | |
1065 void MachSpillCopyNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
1066 implementation( NULL, ra_, false, st ); | |
1067 } | |
1068 #endif | |
1069 | |
1070 void MachSpillCopyNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
1071 implementation( &cbuf, ra_, false, NULL ); | |
1072 } | |
1073 | |
1074 uint MachSpillCopyNode::size(PhaseRegAlloc *ra_) const { | |
1075 return implementation( NULL, ra_, true, NULL ); | |
1076 } | |
1077 | |
1078 //============================================================================= | |
1079 #ifndef PRODUCT | |
1080 void MachNopNode::format( PhaseRegAlloc *, outputStream* st ) const { | |
1081 st->print("NOP \t# %d bytes pad for loops and calls", _count); | |
1082 } | |
1083 #endif | |
1084 | |
1085 void MachNopNode::emit(CodeBuffer &cbuf, PhaseRegAlloc * ) const { | |
1086 MacroAssembler _masm(&cbuf); | |
1087 __ nop(_count); | |
1088 } | |
1089 | |
1090 uint MachNopNode::size(PhaseRegAlloc *) const { | |
1091 return _count; | |
1092 } | |
1093 | |
1094 | |
1095 //============================================================================= | |
1096 #ifndef PRODUCT | |
1097 void BoxLockNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
1098 int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); | |
1099 int reg = ra_->get_reg_first(this); | |
1100 st->print("LEA %s,[ESP + #%d]",Matcher::regName[reg],offset); | |
1101 } | |
1102 #endif | |
1103 | |
1104 void BoxLockNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
1105 int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); | |
1106 int reg = ra_->get_encode(this); | |
1107 if( offset >= 128 ) { | |
1108 emit_opcode(cbuf, 0x8D); // LEA reg,[SP+offset] | |
1109 emit_rm(cbuf, 0x2, reg, 0x04); | |
1110 emit_rm(cbuf, 0x0, 0x04, ESP_enc); | |
1111 emit_d32(cbuf, offset); | |
1112 } | |
1113 else { | |
1114 emit_opcode(cbuf, 0x8D); // LEA reg,[SP+offset] | |
1115 emit_rm(cbuf, 0x1, reg, 0x04); | |
1116 emit_rm(cbuf, 0x0, 0x04, ESP_enc); | |
1117 emit_d8(cbuf, offset); | |
1118 } | |
1119 } | |
1120 | |
1121 uint BoxLockNode::size(PhaseRegAlloc *ra_) const { | |
1122 int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); | |
1123 if( offset >= 128 ) { | |
1124 return 7; | |
1125 } | |
1126 else { | |
1127 return 4; | |
1128 } | |
1129 } | |
1130 | |
1131 //============================================================================= | |
1132 | |
1133 // emit call stub, compiled java to interpreter | |
1134 void emit_java_to_interp(CodeBuffer &cbuf ) { | |
1135 // Stub is fixed up when the corresponding call is converted from calling | |
1136 // compiled code to calling interpreted code. | |
1137 // mov rbx,0 | |
1138 // jmp -1 | |
1139 | |
1140 address mark = cbuf.inst_mark(); // get mark within main instrs section | |
1141 | |
1142 // Note that the code buffer's inst_mark is always relative to insts. | |
1143 // That's why we must use the macroassembler to generate a stub. | |
1144 MacroAssembler _masm(&cbuf); | |
1145 | |
1146 address base = | |
1147 __ start_a_stub(Compile::MAX_stubs_size); | |
1148 if (base == NULL) return; // CodeBuffer::expand failed | |
1149 // static stub relocation stores the instruction address of the call | |
1150 __ relocate(static_stub_Relocation::spec(mark), RELOC_IMM32); | |
1151 // static stub relocation also tags the methodOop in the code-stream. | |
1152 __ movoop(rbx, (jobject)NULL); // method is zapped till fixup time | |
1153 __ jump(RuntimeAddress((address)-1)); | |
1154 | |
1155 __ end_a_stub(); | |
1156 // Update current stubs pointer and restore code_end. | |
1157 } | |
1158 // size of call stub, compiled java to interpretor | |
1159 uint size_java_to_interp() { | |
1160 return 10; // movl; jmp | |
1161 } | |
1162 // relocation entries for call stub, compiled java to interpretor | |
1163 uint reloc_java_to_interp() { | |
1164 return 4; // 3 in emit_java_to_interp + 1 in Java_Static_Call | |
1165 } | |
1166 | |
1167 //============================================================================= | |
1168 #ifndef PRODUCT | |
1169 void MachUEPNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
1170 st->print_cr( "CMP EAX,[ECX+4]\t# Inline cache check"); | |
1171 st->print_cr("\tJNE SharedRuntime::handle_ic_miss_stub"); | |
1172 st->print_cr("\tNOP"); | |
1173 st->print_cr("\tNOP"); | |
1174 if( !OptoBreakpoint ) | |
1175 st->print_cr("\tNOP"); | |
1176 } | |
1177 #endif | |
1178 | |
1179 void MachUEPNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
1180 MacroAssembler masm(&cbuf); | |
1181 #ifdef ASSERT | |
1182 uint code_size = cbuf.code_size(); | |
1183 #endif | |
1184 masm.cmpl(rax, Address(rcx, oopDesc::klass_offset_in_bytes())); | |
1185 masm.jump_cc(Assembler::notEqual, | |
1186 RuntimeAddress(SharedRuntime::get_ic_miss_stub())); | |
1187 /* WARNING these NOPs are critical so that verified entry point is properly | |
1188 aligned for patching by NativeJump::patch_verified_entry() */ | |
1189 int nops_cnt = 2; | |
1190 if( !OptoBreakpoint ) // Leave space for int3 | |
1191 nops_cnt += 1; | |
1192 masm.nop(nops_cnt); | |
1193 | |
1194 assert(cbuf.code_size() - code_size == size(ra_), "checking code size of inline cache node"); | |
1195 } | |
1196 | |
1197 uint MachUEPNode::size(PhaseRegAlloc *ra_) const { | |
1198 return OptoBreakpoint ? 11 : 12; | |
1199 } | |
1200 | |
1201 | |
1202 //============================================================================= | |
1203 uint size_exception_handler() { | |
1204 // NativeCall instruction size is the same as NativeJump. | |
1205 // exception handler starts out as jump and can be patched to | |
1206 // a call be deoptimization. (4932387) | |
1207 // Note that this value is also credited (in output.cpp) to | |
1208 // the size of the code section. | |
1209 return NativeJump::instruction_size; | |
1210 } | |
1211 | |
1212 // Emit exception handler code. Stuff framesize into a register | |
1213 // and call a VM stub routine. | |
1214 int emit_exception_handler(CodeBuffer& cbuf) { | |
1215 | |
1216 // Note that the code buffer's inst_mark is always relative to insts. | |
1217 // That's why we must use the macroassembler to generate a handler. | |
1218 MacroAssembler _masm(&cbuf); | |
1219 address base = | |
1220 __ start_a_stub(size_exception_handler()); | |
1221 if (base == NULL) return 0; // CodeBuffer::expand failed | |
1222 int offset = __ offset(); | |
1223 __ jump(RuntimeAddress(OptoRuntime::exception_blob()->instructions_begin())); | |
1224 assert(__ offset() - offset <= (int) size_exception_handler(), "overflow"); | |
1225 __ end_a_stub(); | |
1226 return offset; | |
1227 } | |
1228 | |
1229 uint size_deopt_handler() { | |
1230 // NativeCall instruction size is the same as NativeJump. | |
1231 // exception handler starts out as jump and can be patched to | |
1232 // a call be deoptimization. (4932387) | |
1233 // Note that this value is also credited (in output.cpp) to | |
1234 // the size of the code section. | |
1235 return 5 + NativeJump::instruction_size; // pushl(); jmp; | |
1236 } | |
1237 | |
1238 // Emit deopt handler code. | |
1239 int emit_deopt_handler(CodeBuffer& cbuf) { | |
1240 | |
1241 // Note that the code buffer's inst_mark is always relative to insts. | |
1242 // That's why we must use the macroassembler to generate a handler. | |
1243 MacroAssembler _masm(&cbuf); | |
1244 address base = | |
1245 __ start_a_stub(size_exception_handler()); | |
1246 if (base == NULL) return 0; // CodeBuffer::expand failed | |
1247 int offset = __ offset(); | |
1248 InternalAddress here(__ pc()); | |
1249 __ pushptr(here.addr()); | |
1250 | |
1251 __ jump(RuntimeAddress(SharedRuntime::deopt_blob()->unpack())); | |
1252 assert(__ offset() - offset <= (int) size_deopt_handler(), "overflow"); | |
1253 __ end_a_stub(); | |
1254 return offset; | |
1255 } | |
1256 | |
1257 | |
1258 static void emit_double_constant(CodeBuffer& cbuf, double x) { | |
1259 int mark = cbuf.insts()->mark_off(); | |
1260 MacroAssembler _masm(&cbuf); | |
1261 address double_address = __ double_constant(x); | |
1262 cbuf.insts()->set_mark_off(mark); // preserve mark across masm shift | |
1263 emit_d32_reloc(cbuf, | |
1264 (int)double_address, | |
1265 internal_word_Relocation::spec(double_address), | |
1266 RELOC_DISP32); | |
1267 } | |
1268 | |
1269 static void emit_float_constant(CodeBuffer& cbuf, float x) { | |
1270 int mark = cbuf.insts()->mark_off(); | |
1271 MacroAssembler _masm(&cbuf); | |
1272 address float_address = __ float_constant(x); | |
1273 cbuf.insts()->set_mark_off(mark); // preserve mark across masm shift | |
1274 emit_d32_reloc(cbuf, | |
1275 (int)float_address, | |
1276 internal_word_Relocation::spec(float_address), | |
1277 RELOC_DISP32); | |
1278 } | |
1279 | |
1280 | |
1281 int Matcher::regnum_to_fpu_offset(int regnum) { | |
1282 return regnum - 32; // The FP registers are in the second chunk | |
1283 } | |
1284 | |
1285 bool is_positive_zero_float(jfloat f) { | |
1286 return jint_cast(f) == jint_cast(0.0F); | |
1287 } | |
1288 | |
1289 bool is_positive_one_float(jfloat f) { | |
1290 return jint_cast(f) == jint_cast(1.0F); | |
1291 } | |
1292 | |
1293 bool is_positive_zero_double(jdouble d) { | |
1294 return jlong_cast(d) == jlong_cast(0.0); | |
1295 } | |
1296 | |
1297 bool is_positive_one_double(jdouble d) { | |
1298 return jlong_cast(d) == jlong_cast(1.0); | |
1299 } | |
1300 | |
1301 // This is UltraSparc specific, true just means we have fast l2f conversion | |
1302 const bool Matcher::convL2FSupported(void) { | |
1303 return true; | |
1304 } | |
1305 | |
1306 // Vector width in bytes | |
1307 const uint Matcher::vector_width_in_bytes(void) { | |
1308 return UseSSE >= 2 ? 8 : 0; | |
1309 } | |
1310 | |
1311 // Vector ideal reg | |
1312 const uint Matcher::vector_ideal_reg(void) { | |
1313 return Op_RegD; | |
1314 } | |
1315 | |
1316 // Is this branch offset short enough that a short branch can be used? | |
1317 // | |
1318 // NOTE: If the platform does not provide any short branch variants, then | |
1319 // this method should return false for offset 0. | |
1320 bool Matcher::is_short_branch_offset(int offset) { | |
1321 return (-128 <= offset && offset <= 127); | |
1322 } | |
1323 | |
1324 const bool Matcher::isSimpleConstant64(jlong value) { | |
1325 // Will one (StoreL ConL) be cheaper than two (StoreI ConI)?. | |
1326 return false; | |
1327 } | |
1328 | |
1329 // The ecx parameter to rep stos for the ClearArray node is in dwords. | |
1330 const bool Matcher::init_array_count_is_in_bytes = false; | |
1331 | |
1332 // Threshold size for cleararray. | |
1333 const int Matcher::init_array_short_size = 8 * BytesPerLong; | |
1334 | |
1335 // Should the Matcher clone shifts on addressing modes, expecting them to | |
1336 // be subsumed into complex addressing expressions or compute them into | |
1337 // registers? True for Intel but false for most RISCs | |
1338 const bool Matcher::clone_shift_expressions = true; | |
1339 | |
1340 // Is it better to copy float constants, or load them directly from memory? | |
1341 // Intel can load a float constant from a direct address, requiring no | |
1342 // extra registers. Most RISCs will have to materialize an address into a | |
1343 // register first, so they would do better to copy the constant from stack. | |
1344 const bool Matcher::rematerialize_float_constants = true; | |
1345 | |
1346 // If CPU can load and store mis-aligned doubles directly then no fixup is | |
1347 // needed. Else we split the double into 2 integer pieces and move it | |
1348 // piece-by-piece. Only happens when passing doubles into C code as the | |
1349 // Java calling convention forces doubles to be aligned. | |
1350 const bool Matcher::misaligned_doubles_ok = true; | |
1351 | |
1352 | |
1353 void Matcher::pd_implicit_null_fixup(MachNode *node, uint idx) { | |
1354 // Get the memory operand from the node | |
1355 uint numopnds = node->num_opnds(); // Virtual call for number of operands | |
1356 uint skipped = node->oper_input_base(); // Sum of leaves skipped so far | |
1357 assert( idx >= skipped, "idx too low in pd_implicit_null_fixup" ); | |
1358 uint opcnt = 1; // First operand | |
1359 uint num_edges = node->_opnds[1]->num_edges(); // leaves for first operand | |
1360 while( idx >= skipped+num_edges ) { | |
1361 skipped += num_edges; | |
1362 opcnt++; // Bump operand count | |
1363 assert( opcnt < numopnds, "Accessing non-existent operand" ); | |
1364 num_edges = node->_opnds[opcnt]->num_edges(); // leaves for next operand | |
1365 } | |
1366 | |
1367 MachOper *memory = node->_opnds[opcnt]; | |
1368 MachOper *new_memory = NULL; | |
1369 switch (memory->opcode()) { | |
1370 case DIRECT: | |
1371 case INDOFFSET32X: | |
1372 // No transformation necessary. | |
1373 return; | |
1374 case INDIRECT: | |
1375 new_memory = new (C) indirect_win95_safeOper( ); | |
1376 break; | |
1377 case INDOFFSET8: | |
1378 new_memory = new (C) indOffset8_win95_safeOper(memory->disp(NULL, NULL, 0)); | |
1379 break; | |
1380 case INDOFFSET32: | |
1381 new_memory = new (C) indOffset32_win95_safeOper(memory->disp(NULL, NULL, 0)); | |
1382 break; | |
1383 case INDINDEXOFFSET: | |
1384 new_memory = new (C) indIndexOffset_win95_safeOper(memory->disp(NULL, NULL, 0)); | |
1385 break; | |
1386 case INDINDEXSCALE: | |
1387 new_memory = new (C) indIndexScale_win95_safeOper(memory->scale()); | |
1388 break; | |
1389 case INDINDEXSCALEOFFSET: | |
1390 new_memory = new (C) indIndexScaleOffset_win95_safeOper(memory->scale(), memory->disp(NULL, NULL, 0)); | |
1391 break; | |
1392 case LOAD_LONG_INDIRECT: | |
1393 case LOAD_LONG_INDOFFSET32: | |
1394 // Does not use EBP as address register, use { EDX, EBX, EDI, ESI} | |
1395 return; | |
1396 default: | |
1397 assert(false, "unexpected memory operand in pd_implicit_null_fixup()"); | |
1398 return; | |
1399 } | |
1400 node->_opnds[opcnt] = new_memory; | |
1401 } | |
1402 | |
1403 // Advertise here if the CPU requires explicit rounding operations | |
1404 // to implement the UseStrictFP mode. | |
1405 const bool Matcher::strict_fp_requires_explicit_rounding = true; | |
1406 | |
1407 // Do floats take an entire double register or just half? | |
1408 const bool Matcher::float_in_double = true; | |
1409 // Do ints take an entire long register or just half? | |
1410 const bool Matcher::int_in_long = false; | |
1411 | |
1412 // Return whether or not this register is ever used as an argument. This | |
1413 // function is used on startup to build the trampoline stubs in generateOptoStub. | |
1414 // Registers not mentioned will be killed by the VM call in the trampoline, and | |
1415 // arguments in those registers not be available to the callee. | |
1416 bool Matcher::can_be_java_arg( int reg ) { | |
1417 if( reg == ECX_num || reg == EDX_num ) return true; | |
1418 if( (reg == XMM0a_num || reg == XMM1a_num) && UseSSE>=1 ) return true; | |
1419 if( (reg == XMM0b_num || reg == XMM1b_num) && UseSSE>=2 ) return true; | |
1420 return false; | |
1421 } | |
1422 | |
1423 bool Matcher::is_spillable_arg( int reg ) { | |
1424 return can_be_java_arg(reg); | |
1425 } | |
1426 | |
1427 // Register for DIVI projection of divmodI | |
1428 RegMask Matcher::divI_proj_mask() { | |
1429 return EAX_REG_mask; | |
1430 } | |
1431 | |
1432 // Register for MODI projection of divmodI | |
1433 RegMask Matcher::modI_proj_mask() { | |
1434 return EDX_REG_mask; | |
1435 } | |
1436 | |
1437 // Register for DIVL projection of divmodL | |
1438 RegMask Matcher::divL_proj_mask() { | |
1439 ShouldNotReachHere(); | |
1440 return RegMask(); | |
1441 } | |
1442 | |
1443 // Register for MODL projection of divmodL | |
1444 RegMask Matcher::modL_proj_mask() { | |
1445 ShouldNotReachHere(); | |
1446 return RegMask(); | |
1447 } | |
1448 | |
1449 %} | |
1450 | |
1451 //----------ENCODING BLOCK----------------------------------------------------- | |
1452 // This block specifies the encoding classes used by the compiler to output | |
1453 // byte streams. Encoding classes generate functions which are called by | |
1454 // Machine Instruction Nodes in order to generate the bit encoding of the | |
1455 // instruction. Operands specify their base encoding interface with the | |
1456 // interface keyword. There are currently supported four interfaces, | |
1457 // REG_INTER, CONST_INTER, MEMORY_INTER, & COND_INTER. REG_INTER causes an | |
1458 // operand to generate a function which returns its register number when | |
1459 // queried. CONST_INTER causes an operand to generate a function which | |
1460 // returns the value of the constant when queried. MEMORY_INTER causes an | |
1461 // operand to generate four functions which return the Base Register, the | |
1462 // Index Register, the Scale Value, and the Offset Value of the operand when | |
1463 // queried. COND_INTER causes an operand to generate six functions which | |
1464 // return the encoding code (ie - encoding bits for the instruction) | |
1465 // associated with each basic boolean condition for a conditional instruction. | |
1466 // Instructions specify two basic values for encoding. They use the | |
1467 // ins_encode keyword to specify their encoding class (which must be one of | |
1468 // the class names specified in the encoding block), and they use the | |
1469 // opcode keyword to specify, in order, their primary, secondary, and | |
1470 // tertiary opcode. Only the opcode sections which a particular instruction | |
1471 // needs for encoding need to be specified. | |
1472 encode %{ | |
1473 // Build emit functions for each basic byte or larger field in the intel | |
1474 // encoding scheme (opcode, rm, sib, immediate), and call them from C++ | |
1475 // code in the enc_class source block. Emit functions will live in the | |
1476 // main source block for now. In future, we can generalize this by | |
1477 // adding a syntax that specifies the sizes of fields in an order, | |
1478 // so that the adlc can build the emit functions automagically | |
1479 enc_class OpcP %{ // Emit opcode | |
1480 emit_opcode(cbuf,$primary); | |
1481 %} | |
1482 | |
1483 enc_class OpcS %{ // Emit opcode | |
1484 emit_opcode(cbuf,$secondary); | |
1485 %} | |
1486 | |
1487 enc_class Opcode(immI d8 ) %{ // Emit opcode | |
1488 emit_opcode(cbuf,$d8$$constant); | |
1489 %} | |
1490 | |
1491 enc_class SizePrefix %{ | |
1492 emit_opcode(cbuf,0x66); | |
1493 %} | |
1494 | |
1495 enc_class RegReg (eRegI dst, eRegI src) %{ // RegReg(Many) | |
1496 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
1497 %} | |
1498 | |
1499 enc_class OpcRegReg (immI opcode, eRegI dst, eRegI src) %{ // OpcRegReg(Many) | |
1500 emit_opcode(cbuf,$opcode$$constant); | |
1501 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
1502 %} | |
1503 | |
1504 enc_class mov_r32_imm0( eRegI dst ) %{ | |
1505 emit_opcode( cbuf, 0xB8 + $dst$$reg ); // 0xB8+ rd -- MOV r32 ,imm32 | |
1506 emit_d32 ( cbuf, 0x0 ); // imm32==0x0 | |
1507 %} | |
1508 | |
1509 enc_class cdq_enc %{ | |
1510 // Full implementation of Java idiv and irem; checks for | |
1511 // special case as described in JVM spec., p.243 & p.271. | |
1512 // | |
1513 // normal case special case | |
1514 // | |
1515 // input : rax,: dividend min_int | |
1516 // reg: divisor -1 | |
1517 // | |
1518 // output: rax,: quotient (= rax, idiv reg) min_int | |
1519 // rdx: remainder (= rax, irem reg) 0 | |
1520 // | |
1521 // Code sequnce: | |
1522 // | |
1523 // 81 F8 00 00 00 80 cmp rax,80000000h | |
1524 // 0F 85 0B 00 00 00 jne normal_case | |
1525 // 33 D2 xor rdx,edx | |
1526 // 83 F9 FF cmp rcx,0FFh | |
1527 // 0F 84 03 00 00 00 je done | |
1528 // normal_case: | |
1529 // 99 cdq | |
1530 // F7 F9 idiv rax,ecx | |
1531 // done: | |
1532 // | |
1533 emit_opcode(cbuf,0x81); emit_d8(cbuf,0xF8); | |
1534 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); | |
1535 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x80); // cmp rax,80000000h | |
1536 emit_opcode(cbuf,0x0F); emit_d8(cbuf,0x85); | |
1537 emit_opcode(cbuf,0x0B); emit_d8(cbuf,0x00); | |
1538 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); // jne normal_case | |
1539 emit_opcode(cbuf,0x33); emit_d8(cbuf,0xD2); // xor rdx,edx | |
1540 emit_opcode(cbuf,0x83); emit_d8(cbuf,0xF9); emit_d8(cbuf,0xFF); // cmp rcx,0FFh | |
1541 emit_opcode(cbuf,0x0F); emit_d8(cbuf,0x84); | |
1542 emit_opcode(cbuf,0x03); emit_d8(cbuf,0x00); | |
1543 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); // je done | |
1544 // normal_case: | |
1545 emit_opcode(cbuf,0x99); // cdq | |
1546 // idiv (note: must be emitted by the user of this rule) | |
1547 // normal: | |
1548 %} | |
1549 | |
1550 // Dense encoding for older common ops | |
1551 enc_class Opc_plus(immI opcode, eRegI reg) %{ | |
1552 emit_opcode(cbuf, $opcode$$constant + $reg$$reg); | |
1553 %} | |
1554 | |
1555 | |
1556 // Opcde enc_class for 8/32 bit immediate instructions with sign-extension | |
1557 enc_class OpcSE (immI imm) %{ // Emit primary opcode and set sign-extend bit | |
1558 // Check for 8-bit immediate, and set sign extend bit in opcode | |
1559 if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { | |
1560 emit_opcode(cbuf, $primary | 0x02); | |
1561 } | |
1562 else { // If 32-bit immediate | |
1563 emit_opcode(cbuf, $primary); | |
1564 } | |
1565 %} | |
1566 | |
1567 enc_class OpcSErm (eRegI dst, immI imm) %{ // OpcSEr/m | |
1568 // Emit primary opcode and set sign-extend bit | |
1569 // Check for 8-bit immediate, and set sign extend bit in opcode | |
1570 if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { | |
1571 emit_opcode(cbuf, $primary | 0x02); } | |
1572 else { // If 32-bit immediate | |
1573 emit_opcode(cbuf, $primary); | |
1574 } | |
1575 // Emit r/m byte with secondary opcode, after primary opcode. | |
1576 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
1577 %} | |
1578 | |
1579 enc_class Con8or32 (immI imm) %{ // Con8or32(storeImmI), 8 or 32 bits | |
1580 // Check for 8-bit immediate, and set sign extend bit in opcode | |
1581 if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { | |
1582 $$$emit8$imm$$constant; | |
1583 } | |
1584 else { // If 32-bit immediate | |
1585 // Output immediate | |
1586 $$$emit32$imm$$constant; | |
1587 } | |
1588 %} | |
1589 | |
1590 enc_class Long_OpcSErm_Lo(eRegL dst, immL imm) %{ | |
1591 // Emit primary opcode and set sign-extend bit | |
1592 // Check for 8-bit immediate, and set sign extend bit in opcode | |
1593 int con = (int)$imm$$constant; // Throw away top bits | |
1594 emit_opcode(cbuf, ((con >= -128) && (con <= 127)) ? ($primary | 0x02) : $primary); | |
1595 // Emit r/m byte with secondary opcode, after primary opcode. | |
1596 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
1597 if ((con >= -128) && (con <= 127)) emit_d8 (cbuf,con); | |
1598 else emit_d32(cbuf,con); | |
1599 %} | |
1600 | |
1601 enc_class Long_OpcSErm_Hi(eRegL dst, immL imm) %{ | |
1602 // Emit primary opcode and set sign-extend bit | |
1603 // Check for 8-bit immediate, and set sign extend bit in opcode | |
1604 int con = (int)($imm$$constant >> 32); // Throw away bottom bits | |
1605 emit_opcode(cbuf, ((con >= -128) && (con <= 127)) ? ($primary | 0x02) : $primary); | |
1606 // Emit r/m byte with tertiary opcode, after primary opcode. | |
1607 emit_rm(cbuf, 0x3, $tertiary, HIGH_FROM_LOW($dst$$reg)); | |
1608 if ((con >= -128) && (con <= 127)) emit_d8 (cbuf,con); | |
1609 else emit_d32(cbuf,con); | |
1610 %} | |
1611 | |
1612 enc_class Lbl (label labl) %{ // JMP, CALL | |
1613 Label *l = $labl$$label; | |
1614 emit_d32(cbuf, l ? (l->loc_pos() - (cbuf.code_size()+4)) : 0); | |
1615 %} | |
1616 | |
1617 enc_class LblShort (label labl) %{ // JMP, CALL | |
1618 Label *l = $labl$$label; | |
1619 int disp = l ? (l->loc_pos() - (cbuf.code_size()+1)) : 0; | |
1620 assert(-128 <= disp && disp <= 127, "Displacement too large for short jmp"); | |
1621 emit_d8(cbuf, disp); | |
1622 %} | |
1623 | |
1624 enc_class OpcSReg (eRegI dst) %{ // BSWAP | |
1625 emit_cc(cbuf, $secondary, $dst$$reg ); | |
1626 %} | |
1627 | |
1628 enc_class bswap_long_bytes(eRegL dst) %{ // BSWAP | |
1629 int destlo = $dst$$reg; | |
1630 int desthi = HIGH_FROM_LOW(destlo); | |
1631 // bswap lo | |
1632 emit_opcode(cbuf, 0x0F); | |
1633 emit_cc(cbuf, 0xC8, destlo); | |
1634 // bswap hi | |
1635 emit_opcode(cbuf, 0x0F); | |
1636 emit_cc(cbuf, 0xC8, desthi); | |
1637 // xchg lo and hi | |
1638 emit_opcode(cbuf, 0x87); | |
1639 emit_rm(cbuf, 0x3, destlo, desthi); | |
1640 %} | |
1641 | |
1642 enc_class RegOpc (eRegI div) %{ // IDIV, IMOD, JMP indirect, ... | |
1643 emit_rm(cbuf, 0x3, $secondary, $div$$reg ); | |
1644 %} | |
1645 | |
1646 enc_class Jcc (cmpOp cop, label labl) %{ // JCC | |
1647 Label *l = $labl$$label; | |
1648 $$$emit8$primary; | |
1649 emit_cc(cbuf, $secondary, $cop$$cmpcode); | |
1650 emit_d32(cbuf, l ? (l->loc_pos() - (cbuf.code_size()+4)) : 0); | |
1651 %} | |
1652 | |
1653 enc_class JccShort (cmpOp cop, label labl) %{ // JCC | |
1654 Label *l = $labl$$label; | |
1655 emit_cc(cbuf, $primary, $cop$$cmpcode); | |
1656 int disp = l ? (l->loc_pos() - (cbuf.code_size()+1)) : 0; | |
1657 assert(-128 <= disp && disp <= 127, "Displacement too large for short jmp"); | |
1658 emit_d8(cbuf, disp); | |
1659 %} | |
1660 | |
1661 enc_class enc_cmov(cmpOp cop ) %{ // CMOV | |
1662 $$$emit8$primary; | |
1663 emit_cc(cbuf, $secondary, $cop$$cmpcode); | |
1664 %} | |
1665 | |
1666 enc_class enc_cmov_d(cmpOp cop, regD src ) %{ // CMOV | |
1667 int op = 0xDA00 + $cop$$cmpcode + ($src$$reg-1); | |
1668 emit_d8(cbuf, op >> 8 ); | |
1669 emit_d8(cbuf, op & 255); | |
1670 %} | |
1671 | |
1672 // emulate a CMOV with a conditional branch around a MOV | |
1673 enc_class enc_cmov_branch( cmpOp cop, immI brOffs ) %{ // CMOV | |
1674 // Invert sense of branch from sense of CMOV | |
1675 emit_cc( cbuf, 0x70, ($cop$$cmpcode^1) ); | |
1676 emit_d8( cbuf, $brOffs$$constant ); | |
1677 %} | |
1678 | |
1679 enc_class enc_PartialSubtypeCheck( ) %{ | |
1680 Register Redi = as_Register(EDI_enc); // result register | |
1681 Register Reax = as_Register(EAX_enc); // super class | |
1682 Register Recx = as_Register(ECX_enc); // killed | |
1683 Register Resi = as_Register(ESI_enc); // sub class | |
1684 Label hit, miss; | |
1685 | |
1686 MacroAssembler _masm(&cbuf); | |
1687 // Compare super with sub directly, since super is not in its own SSA. | |
1688 // The compiler used to emit this test, but we fold it in here, | |
1689 // to allow platform-specific tweaking on sparc. | |
1690 __ cmpl(Reax, Resi); | |
1691 __ jcc(Assembler::equal, hit); | |
1692 #ifndef PRODUCT | |
1693 __ increment(ExternalAddress((address)&SharedRuntime::_partial_subtype_ctr)); | |
1694 #endif //PRODUCT | |
1695 __ movl(Redi,Address(Resi,sizeof(oopDesc) + Klass::secondary_supers_offset_in_bytes())); | |
1696 __ movl(Recx,Address(Redi,arrayOopDesc::length_offset_in_bytes())); | |
1697 __ addl(Redi,arrayOopDesc::base_offset_in_bytes(T_OBJECT)); | |
1698 __ repne_scan(); | |
1699 __ jcc(Assembler::notEqual, miss); | |
1700 __ movl(Address(Resi,sizeof(oopDesc) + Klass::secondary_super_cache_offset_in_bytes()),Reax); | |
1701 __ bind(hit); | |
1702 if( $primary ) | |
1703 __ xorl(Redi,Redi); | |
1704 __ bind(miss); | |
1705 %} | |
1706 | |
1707 enc_class FFree_Float_Stack_All %{ // Free_Float_Stack_All | |
1708 MacroAssembler masm(&cbuf); | |
1709 int start = masm.offset(); | |
1710 if (UseSSE >= 2) { | |
1711 if (VerifyFPU) { | |
1712 masm.verify_FPU(0, "must be empty in SSE2+ mode"); | |
1713 } | |
1714 } else { | |
1715 // External c_calling_convention expects the FPU stack to be 'clean'. | |
1716 // Compiled code leaves it dirty. Do cleanup now. | |
1717 masm.empty_FPU_stack(); | |
1718 } | |
1719 if (sizeof_FFree_Float_Stack_All == -1) { | |
1720 sizeof_FFree_Float_Stack_All = masm.offset() - start; | |
1721 } else { | |
1722 assert(masm.offset() - start == sizeof_FFree_Float_Stack_All, "wrong size"); | |
1723 } | |
1724 %} | |
1725 | |
1726 enc_class Verify_FPU_For_Leaf %{ | |
1727 if( VerifyFPU ) { | |
1728 MacroAssembler masm(&cbuf); | |
1729 masm.verify_FPU( -3, "Returning from Runtime Leaf call"); | |
1730 } | |
1731 %} | |
1732 | |
1733 enc_class Java_To_Runtime (method meth) %{ // CALL Java_To_Runtime, Java_To_Runtime_Leaf | |
1734 // This is the instruction starting address for relocation info. | |
1735 cbuf.set_inst_mark(); | |
1736 $$$emit8$primary; | |
1737 // CALL directly to the runtime | |
1738 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
1739 runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
1740 | |
1741 if (UseSSE >= 2) { | |
1742 MacroAssembler _masm(&cbuf); | |
1743 BasicType rt = tf()->return_type(); | |
1744 | |
1745 if ((rt == T_FLOAT || rt == T_DOUBLE) && !return_value_is_used()) { | |
1746 // A C runtime call where the return value is unused. In SSE2+ | |
1747 // mode the result needs to be removed from the FPU stack. It's | |
1748 // likely that this function call could be removed by the | |
1749 // optimizer if the C function is a pure function. | |
1750 __ ffree(0); | |
1751 } else if (rt == T_FLOAT) { | |
1752 __ leal(rsp, Address(rsp, -4)); | |
1753 __ fstp_s(Address(rsp, 0)); | |
1754 __ movflt(xmm0, Address(rsp, 0)); | |
1755 __ leal(rsp, Address(rsp, 4)); | |
1756 } else if (rt == T_DOUBLE) { | |
1757 __ leal(rsp, Address(rsp, -8)); | |
1758 __ fstp_d(Address(rsp, 0)); | |
1759 __ movdbl(xmm0, Address(rsp, 0)); | |
1760 __ leal(rsp, Address(rsp, 8)); | |
1761 } | |
1762 } | |
1763 %} | |
1764 | |
1765 | |
1766 enc_class pre_call_FPU %{ | |
1767 // If method sets FPU control word restore it here | |
1768 if( Compile::current()->in_24_bit_fp_mode() ) { | |
1769 MacroAssembler masm(&cbuf); | |
1770 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_std())); | |
1771 } | |
1772 %} | |
1773 | |
1774 enc_class post_call_FPU %{ | |
1775 // If method sets FPU control word do it here also | |
1776 if( Compile::current()->in_24_bit_fp_mode() ) { | |
1777 MacroAssembler masm(&cbuf); | |
1778 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_24())); | |
1779 } | |
1780 %} | |
1781 | |
1782 enc_class Java_Static_Call (method meth) %{ // JAVA STATIC CALL | |
1783 // CALL to fixup routine. Fixup routine uses ScopeDesc info to determine | |
1784 // who we intended to call. | |
1785 cbuf.set_inst_mark(); | |
1786 $$$emit8$primary; | |
1787 if ( !_method ) { | |
1788 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
1789 runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
1790 } else if(_optimized_virtual) { | |
1791 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
1792 opt_virtual_call_Relocation::spec(), RELOC_IMM32 ); | |
1793 } else { | |
1794 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
1795 static_call_Relocation::spec(), RELOC_IMM32 ); | |
1796 } | |
1797 if( _method ) { // Emit stub for static call | |
1798 emit_java_to_interp(cbuf); | |
1799 } | |
1800 %} | |
1801 | |
1802 enc_class Java_Dynamic_Call (method meth) %{ // JAVA DYNAMIC CALL | |
1803 // !!!!! | |
1804 // Generate "Mov EAX,0x00", placeholder instruction to load oop-info | |
1805 // emit_call_dynamic_prologue( cbuf ); | |
1806 cbuf.set_inst_mark(); | |
1807 emit_opcode(cbuf, 0xB8 + EAX_enc); // mov EAX,-1 | |
1808 emit_d32_reloc(cbuf, (int)Universe::non_oop_word(), oop_Relocation::spec_for_immediate(), RELOC_IMM32); | |
1809 address virtual_call_oop_addr = cbuf.inst_mark(); | |
1810 // CALL to fixup routine. Fixup routine uses ScopeDesc info to determine | |
1811 // who we intended to call. | |
1812 cbuf.set_inst_mark(); | |
1813 $$$emit8$primary; | |
1814 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
1815 virtual_call_Relocation::spec(virtual_call_oop_addr), RELOC_IMM32 ); | |
1816 %} | |
1817 | |
1818 enc_class Java_Compiled_Call (method meth) %{ // JAVA COMPILED CALL | |
1819 int disp = in_bytes(methodOopDesc::from_compiled_offset()); | |
1820 assert( -128 <= disp && disp <= 127, "compiled_code_offset isn't small"); | |
1821 | |
1822 // CALL *[EAX+in_bytes(methodOopDesc::from_compiled_code_entry_point_offset())] | |
1823 cbuf.set_inst_mark(); | |
1824 $$$emit8$primary; | |
1825 emit_rm(cbuf, 0x01, $secondary, EAX_enc ); // R/M byte | |
1826 emit_d8(cbuf, disp); // Displacement | |
1827 | |
1828 %} | |
1829 | |
1830 enc_class Xor_Reg (eRegI dst) %{ | |
1831 emit_opcode(cbuf, 0x33); | |
1832 emit_rm(cbuf, 0x3, $dst$$reg, $dst$$reg); | |
1833 %} | |
1834 | |
1835 // Following encoding is no longer used, but may be restored if calling | |
1836 // convention changes significantly. | |
1837 // Became: Xor_Reg(EBP), Java_To_Runtime( labl ) | |
1838 // | |
1839 // enc_class Java_Interpreter_Call (label labl) %{ // JAVA INTERPRETER CALL | |
1840 // // int ic_reg = Matcher::inline_cache_reg(); | |
1841 // // int ic_encode = Matcher::_regEncode[ic_reg]; | |
1842 // // int imo_reg = Matcher::interpreter_method_oop_reg(); | |
1843 // // int imo_encode = Matcher::_regEncode[imo_reg]; | |
1844 // | |
1845 // // // Interpreter expects method_oop in EBX, currently a callee-saved register, | |
1846 // // // so we load it immediately before the call | |
1847 // // emit_opcode(cbuf, 0x8B); // MOV imo_reg,ic_reg # method_oop | |
1848 // // emit_rm(cbuf, 0x03, imo_encode, ic_encode ); // R/M byte | |
1849 // | |
1850 // // xor rbp,ebp | |
1851 // emit_opcode(cbuf, 0x33); | |
1852 // emit_rm(cbuf, 0x3, EBP_enc, EBP_enc); | |
1853 // | |
1854 // // CALL to interpreter. | |
1855 // cbuf.set_inst_mark(); | |
1856 // $$$emit8$primary; | |
1857 // emit_d32_reloc(cbuf, ($labl$$label - (int)(cbuf.code_end()) - 4), | |
1858 // runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
1859 // %} | |
1860 | |
1861 enc_class RegOpcImm (eRegI dst, immI8 shift) %{ // SHL, SAR, SHR | |
1862 $$$emit8$primary; | |
1863 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
1864 $$$emit8$shift$$constant; | |
1865 %} | |
1866 | |
1867 enc_class LdImmI (eRegI dst, immI src) %{ // Load Immediate | |
1868 // Load immediate does not have a zero or sign extended version | |
1869 // for 8-bit immediates | |
1870 emit_opcode(cbuf, 0xB8 + $dst$$reg); | |
1871 $$$emit32$src$$constant; | |
1872 %} | |
1873 | |
1874 enc_class LdImmP (eRegI dst, immI src) %{ // Load Immediate | |
1875 // Load immediate does not have a zero or sign extended version | |
1876 // for 8-bit immediates | |
1877 emit_opcode(cbuf, $primary + $dst$$reg); | |
1878 $$$emit32$src$$constant; | |
1879 %} | |
1880 | |
1881 enc_class LdImmL_Lo( eRegL dst, immL src) %{ // Load Immediate | |
1882 // Load immediate does not have a zero or sign extended version | |
1883 // for 8-bit immediates | |
1884 int dst_enc = $dst$$reg; | |
1885 int src_con = $src$$constant & 0x0FFFFFFFFL; | |
1886 if (src_con == 0) { | |
1887 // xor dst, dst | |
1888 emit_opcode(cbuf, 0x33); | |
1889 emit_rm(cbuf, 0x3, dst_enc, dst_enc); | |
1890 } else { | |
1891 emit_opcode(cbuf, $primary + dst_enc); | |
1892 emit_d32(cbuf, src_con); | |
1893 } | |
1894 %} | |
1895 | |
1896 enc_class LdImmL_Hi( eRegL dst, immL src) %{ // Load Immediate | |
1897 // Load immediate does not have a zero or sign extended version | |
1898 // for 8-bit immediates | |
1899 int dst_enc = $dst$$reg + 2; | |
1900 int src_con = ((julong)($src$$constant)) >> 32; | |
1901 if (src_con == 0) { | |
1902 // xor dst, dst | |
1903 emit_opcode(cbuf, 0x33); | |
1904 emit_rm(cbuf, 0x3, dst_enc, dst_enc); | |
1905 } else { | |
1906 emit_opcode(cbuf, $primary + dst_enc); | |
1907 emit_d32(cbuf, src_con); | |
1908 } | |
1909 %} | |
1910 | |
1911 | |
1912 enc_class LdImmD (immD src) %{ // Load Immediate | |
1913 if( is_positive_zero_double($src$$constant)) { | |
1914 // FLDZ | |
1915 emit_opcode(cbuf,0xD9); | |
1916 emit_opcode(cbuf,0xEE); | |
1917 } else if( is_positive_one_double($src$$constant)) { | |
1918 // FLD1 | |
1919 emit_opcode(cbuf,0xD9); | |
1920 emit_opcode(cbuf,0xE8); | |
1921 } else { | |
1922 emit_opcode(cbuf,0xDD); | |
1923 emit_rm(cbuf, 0x0, 0x0, 0x5); | |
1924 emit_double_constant(cbuf, $src$$constant); | |
1925 } | |
1926 %} | |
1927 | |
1928 | |
1929 enc_class LdImmF (immF src) %{ // Load Immediate | |
1930 if( is_positive_zero_float($src$$constant)) { | |
1931 emit_opcode(cbuf,0xD9); | |
1932 emit_opcode(cbuf,0xEE); | |
1933 } else if( is_positive_one_float($src$$constant)) { | |
1934 emit_opcode(cbuf,0xD9); | |
1935 emit_opcode(cbuf,0xE8); | |
1936 } else { | |
1937 $$$emit8$primary; | |
1938 // Load immediate does not have a zero or sign extended version | |
1939 // for 8-bit immediates | |
1940 // First load to TOS, then move to dst | |
1941 emit_rm(cbuf, 0x0, 0x0, 0x5); | |
1942 emit_float_constant(cbuf, $src$$constant); | |
1943 } | |
1944 %} | |
1945 | |
1946 enc_class LdImmX (regX dst, immXF con) %{ // Load Immediate | |
1947 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
1948 emit_float_constant(cbuf, $con$$constant); | |
1949 %} | |
1950 | |
1951 enc_class LdImmXD (regXD dst, immXD con) %{ // Load Immediate | |
1952 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
1953 emit_double_constant(cbuf, $con$$constant); | |
1954 %} | |
1955 | |
1956 enc_class load_conXD (regXD dst, immXD con) %{ // Load double constant | |
1957 // UseXmmLoadAndClearUpper ? movsd(dst, con) : movlpd(dst, con) | |
1958 emit_opcode(cbuf, UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
1959 emit_opcode(cbuf, 0x0F); | |
1960 emit_opcode(cbuf, UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
1961 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
1962 emit_double_constant(cbuf, $con$$constant); | |
1963 %} | |
1964 | |
1965 enc_class Opc_MemImm_F(immF src) %{ | |
1966 cbuf.set_inst_mark(); | |
1967 $$$emit8$primary; | |
1968 emit_rm(cbuf, 0x0, $secondary, 0x5); | |
1969 emit_float_constant(cbuf, $src$$constant); | |
1970 %} | |
1971 | |
1972 | |
1973 enc_class MovI2X_reg(regX dst, eRegI src) %{ | |
1974 emit_opcode(cbuf, 0x66 ); // MOVD dst,src | |
1975 emit_opcode(cbuf, 0x0F ); | |
1976 emit_opcode(cbuf, 0x6E ); | |
1977 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
1978 %} | |
1979 | |
1980 enc_class MovX2I_reg(eRegI dst, regX src) %{ | |
1981 emit_opcode(cbuf, 0x66 ); // MOVD dst,src | |
1982 emit_opcode(cbuf, 0x0F ); | |
1983 emit_opcode(cbuf, 0x7E ); | |
1984 emit_rm(cbuf, 0x3, $src$$reg, $dst$$reg); | |
1985 %} | |
1986 | |
1987 enc_class MovL2XD_reg(regXD dst, eRegL src, regXD tmp) %{ | |
1988 { // MOVD $dst,$src.lo | |
1989 emit_opcode(cbuf,0x66); | |
1990 emit_opcode(cbuf,0x0F); | |
1991 emit_opcode(cbuf,0x6E); | |
1992 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
1993 } | |
1994 { // MOVD $tmp,$src.hi | |
1995 emit_opcode(cbuf,0x66); | |
1996 emit_opcode(cbuf,0x0F); | |
1997 emit_opcode(cbuf,0x6E); | |
1998 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg)); | |
1999 } | |
2000 { // PUNPCKLDQ $dst,$tmp | |
2001 emit_opcode(cbuf,0x66); | |
2002 emit_opcode(cbuf,0x0F); | |
2003 emit_opcode(cbuf,0x62); | |
2004 emit_rm(cbuf, 0x3, $dst$$reg, $tmp$$reg); | |
2005 } | |
2006 %} | |
2007 | |
2008 enc_class MovXD2L_reg(eRegL dst, regXD src, regXD tmp) %{ | |
2009 { // MOVD $dst.lo,$src | |
2010 emit_opcode(cbuf,0x66); | |
2011 emit_opcode(cbuf,0x0F); | |
2012 emit_opcode(cbuf,0x7E); | |
2013 emit_rm(cbuf, 0x3, $src$$reg, $dst$$reg); | |
2014 } | |
2015 { // PSHUFLW $tmp,$src,0x4E (01001110b) | |
2016 emit_opcode(cbuf,0xF2); | |
2017 emit_opcode(cbuf,0x0F); | |
2018 emit_opcode(cbuf,0x70); | |
2019 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); | |
2020 emit_d8(cbuf, 0x4E); | |
2021 } | |
2022 { // MOVD $dst.hi,$tmp | |
2023 emit_opcode(cbuf,0x66); | |
2024 emit_opcode(cbuf,0x0F); | |
2025 emit_opcode(cbuf,0x7E); | |
2026 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg)); | |
2027 } | |
2028 %} | |
2029 | |
2030 | |
2031 // Encode a reg-reg copy. If it is useless, then empty encoding. | |
2032 enc_class enc_Copy( eRegI dst, eRegI src ) %{ | |
2033 encode_Copy( cbuf, $dst$$reg, $src$$reg ); | |
2034 %} | |
2035 | |
2036 enc_class enc_CopyL_Lo( eRegI dst, eRegL src ) %{ | |
2037 encode_Copy( cbuf, $dst$$reg, $src$$reg ); | |
2038 %} | |
2039 | |
2040 // Encode xmm reg-reg copy. If it is useless, then empty encoding. | |
2041 enc_class enc_CopyXD( RegXD dst, RegXD src ) %{ | |
2042 encode_CopyXD( cbuf, $dst$$reg, $src$$reg ); | |
2043 %} | |
2044 | |
2045 enc_class RegReg (eRegI dst, eRegI src) %{ // RegReg(Many) | |
2046 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
2047 %} | |
2048 | |
2049 enc_class RegReg_Lo(eRegL dst, eRegL src) %{ // RegReg(Many) | |
2050 $$$emit8$primary; | |
2051 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
2052 %} | |
2053 | |
2054 enc_class RegReg_Hi(eRegL dst, eRegL src) %{ // RegReg(Many) | |
2055 $$$emit8$secondary; | |
2056 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg)); | |
2057 %} | |
2058 | |
2059 enc_class RegReg_Lo2(eRegL dst, eRegL src) %{ // RegReg(Many) | |
2060 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
2061 %} | |
2062 | |
2063 enc_class RegReg_Hi2(eRegL dst, eRegL src) %{ // RegReg(Many) | |
2064 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg)); | |
2065 %} | |
2066 | |
2067 enc_class RegReg_HiLo( eRegL src, eRegI dst ) %{ | |
2068 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($src$$reg)); | |
2069 %} | |
2070 | |
2071 enc_class Con32 (immI src) %{ // Con32(storeImmI) | |
2072 // Output immediate | |
2073 $$$emit32$src$$constant; | |
2074 %} | |
2075 | |
2076 enc_class Con32F_as_bits(immF src) %{ // storeF_imm | |
2077 // Output Float immediate bits | |
2078 jfloat jf = $src$$constant; | |
2079 int jf_as_bits = jint_cast( jf ); | |
2080 emit_d32(cbuf, jf_as_bits); | |
2081 %} | |
2082 | |
2083 enc_class Con32XF_as_bits(immXF src) %{ // storeX_imm | |
2084 // Output Float immediate bits | |
2085 jfloat jf = $src$$constant; | |
2086 int jf_as_bits = jint_cast( jf ); | |
2087 emit_d32(cbuf, jf_as_bits); | |
2088 %} | |
2089 | |
2090 enc_class Con16 (immI src) %{ // Con16(storeImmI) | |
2091 // Output immediate | |
2092 $$$emit16$src$$constant; | |
2093 %} | |
2094 | |
2095 enc_class Con_d32(immI src) %{ | |
2096 emit_d32(cbuf,$src$$constant); | |
2097 %} | |
2098 | |
2099 enc_class conmemref (eRegP t1) %{ // Con32(storeImmI) | |
2100 // Output immediate memory reference | |
2101 emit_rm(cbuf, 0x00, $t1$$reg, 0x05 ); | |
2102 emit_d32(cbuf, 0x00); | |
2103 %} | |
2104 | |
2105 enc_class lock_prefix( ) %{ | |
2106 if( os::is_MP() ) | |
2107 emit_opcode(cbuf,0xF0); // [Lock] | |
2108 %} | |
2109 | |
2110 // Cmp-xchg long value. | |
2111 // Note: we need to swap rbx, and rcx before and after the | |
2112 // cmpxchg8 instruction because the instruction uses | |
2113 // rcx as the high order word of the new value to store but | |
2114 // our register encoding uses rbx,. | |
2115 enc_class enc_cmpxchg8(eSIRegP mem_ptr) %{ | |
2116 | |
2117 // XCHG rbx,ecx | |
2118 emit_opcode(cbuf,0x87); | |
2119 emit_opcode(cbuf,0xD9); | |
2120 // [Lock] | |
2121 if( os::is_MP() ) | |
2122 emit_opcode(cbuf,0xF0); | |
2123 // CMPXCHG8 [Eptr] | |
2124 emit_opcode(cbuf,0x0F); | |
2125 emit_opcode(cbuf,0xC7); | |
2126 emit_rm( cbuf, 0x0, 1, $mem_ptr$$reg ); | |
2127 // XCHG rbx,ecx | |
2128 emit_opcode(cbuf,0x87); | |
2129 emit_opcode(cbuf,0xD9); | |
2130 %} | |
2131 | |
2132 enc_class enc_cmpxchg(eSIRegP mem_ptr) %{ | |
2133 // [Lock] | |
2134 if( os::is_MP() ) | |
2135 emit_opcode(cbuf,0xF0); | |
2136 | |
2137 // CMPXCHG [Eptr] | |
2138 emit_opcode(cbuf,0x0F); | |
2139 emit_opcode(cbuf,0xB1); | |
2140 emit_rm( cbuf, 0x0, 1, $mem_ptr$$reg ); | |
2141 %} | |
2142 | |
2143 enc_class enc_flags_ne_to_boolean( iRegI res ) %{ | |
2144 int res_encoding = $res$$reg; | |
2145 | |
2146 // MOV res,0 | |
2147 emit_opcode( cbuf, 0xB8 + res_encoding); | |
2148 emit_d32( cbuf, 0 ); | |
2149 // JNE,s fail | |
2150 emit_opcode(cbuf,0x75); | |
2151 emit_d8(cbuf, 5 ); | |
2152 // MOV res,1 | |
2153 emit_opcode( cbuf, 0xB8 + res_encoding); | |
2154 emit_d32( cbuf, 1 ); | |
2155 // fail: | |
2156 %} | |
2157 | |
2158 enc_class set_instruction_start( ) %{ | |
2159 cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand | |
2160 %} | |
2161 | |
2162 enc_class RegMem (eRegI ereg, memory mem) %{ // emit_reg_mem | |
2163 int reg_encoding = $ereg$$reg; | |
2164 int base = $mem$$base; | |
2165 int index = $mem$$index; | |
2166 int scale = $mem$$scale; | |
2167 int displace = $mem$$disp; | |
2168 bool disp_is_oop = $mem->disp_is_oop(); | |
2169 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
2170 %} | |
2171 | |
2172 enc_class RegMem_Hi(eRegL ereg, memory mem) %{ // emit_reg_mem | |
2173 int reg_encoding = HIGH_FROM_LOW($ereg$$reg); // Hi register of pair, computed from lo | |
2174 int base = $mem$$base; | |
2175 int index = $mem$$index; | |
2176 int scale = $mem$$scale; | |
2177 int displace = $mem$$disp + 4; // Offset is 4 further in memory | |
2178 assert( !$mem->disp_is_oop(), "Cannot add 4 to oop" ); | |
2179 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, false/*disp_is_oop*/); | |
2180 %} | |
2181 | |
2182 enc_class move_long_small_shift( eRegL dst, immI_1_31 cnt ) %{ | |
2183 int r1, r2; | |
2184 if( $tertiary == 0xA4 ) { r1 = $dst$$reg; r2 = HIGH_FROM_LOW($dst$$reg); } | |
2185 else { r2 = $dst$$reg; r1 = HIGH_FROM_LOW($dst$$reg); } | |
2186 emit_opcode(cbuf,0x0F); | |
2187 emit_opcode(cbuf,$tertiary); | |
2188 emit_rm(cbuf, 0x3, r1, r2); | |
2189 emit_d8(cbuf,$cnt$$constant); | |
2190 emit_d8(cbuf,$primary); | |
2191 emit_rm(cbuf, 0x3, $secondary, r1); | |
2192 emit_d8(cbuf,$cnt$$constant); | |
2193 %} | |
2194 | |
2195 enc_class move_long_big_shift_sign( eRegL dst, immI_32_63 cnt ) %{ | |
2196 emit_opcode( cbuf, 0x8B ); // Move | |
2197 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg)); | |
2198 emit_d8(cbuf,$primary); | |
2199 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
2200 emit_d8(cbuf,$cnt$$constant-32); | |
2201 emit_d8(cbuf,$primary); | |
2202 emit_rm(cbuf, 0x3, $secondary, HIGH_FROM_LOW($dst$$reg)); | |
2203 emit_d8(cbuf,31); | |
2204 %} | |
2205 | |
2206 enc_class move_long_big_shift_clr( eRegL dst, immI_32_63 cnt ) %{ | |
2207 int r1, r2; | |
2208 if( $secondary == 0x5 ) { r1 = $dst$$reg; r2 = HIGH_FROM_LOW($dst$$reg); } | |
2209 else { r2 = $dst$$reg; r1 = HIGH_FROM_LOW($dst$$reg); } | |
2210 | |
2211 emit_opcode( cbuf, 0x8B ); // Move r1,r2 | |
2212 emit_rm(cbuf, 0x3, r1, r2); | |
2213 if( $cnt$$constant > 32 ) { // Shift, if not by zero | |
2214 emit_opcode(cbuf,$primary); | |
2215 emit_rm(cbuf, 0x3, $secondary, r1); | |
2216 emit_d8(cbuf,$cnt$$constant-32); | |
2217 } | |
2218 emit_opcode(cbuf,0x33); // XOR r2,r2 | |
2219 emit_rm(cbuf, 0x3, r2, r2); | |
2220 %} | |
2221 | |
2222 // Clone of RegMem but accepts an extra parameter to access each | |
2223 // half of a double in memory; it never needs relocation info. | |
2224 enc_class Mov_MemD_half_to_Reg (immI opcode, memory mem, immI disp_for_half, eRegI rm_reg) %{ | |
2225 emit_opcode(cbuf,$opcode$$constant); | |
2226 int reg_encoding = $rm_reg$$reg; | |
2227 int base = $mem$$base; | |
2228 int index = $mem$$index; | |
2229 int scale = $mem$$scale; | |
2230 int displace = $mem$$disp + $disp_for_half$$constant; | |
2231 bool disp_is_oop = false; | |
2232 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
2233 %} | |
2234 | |
2235 // !!!!! Special Custom Code used by MemMove, and stack access instructions !!!!! | |
2236 // | |
2237 // Clone of RegMem except the RM-byte's reg/opcode field is an ADLC-time constant | |
2238 // and it never needs relocation information. | |
2239 // Frequently used to move data between FPU's Stack Top and memory. | |
2240 enc_class RMopc_Mem_no_oop (immI rm_opcode, memory mem) %{ | |
2241 int rm_byte_opcode = $rm_opcode$$constant; | |
2242 int base = $mem$$base; | |
2243 int index = $mem$$index; | |
2244 int scale = $mem$$scale; | |
2245 int displace = $mem$$disp; | |
2246 assert( !$mem->disp_is_oop(), "No oops here because no relo info allowed" ); | |
2247 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, false); | |
2248 %} | |
2249 | |
2250 enc_class RMopc_Mem (immI rm_opcode, memory mem) %{ | |
2251 int rm_byte_opcode = $rm_opcode$$constant; | |
2252 int base = $mem$$base; | |
2253 int index = $mem$$index; | |
2254 int scale = $mem$$scale; | |
2255 int displace = $mem$$disp; | |
2256 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
2257 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); | |
2258 %} | |
2259 | |
2260 enc_class RegLea (eRegI dst, eRegI src0, immI src1 ) %{ // emit_reg_lea | |
2261 int reg_encoding = $dst$$reg; | |
2262 int base = $src0$$reg; // 0xFFFFFFFF indicates no base | |
2263 int index = 0x04; // 0x04 indicates no index | |
2264 int scale = 0x00; // 0x00 indicates no scale | |
2265 int displace = $src1$$constant; // 0x00 indicates no displacement | |
2266 bool disp_is_oop = false; | |
2267 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
2268 %} | |
2269 | |
2270 enc_class min_enc (eRegI dst, eRegI src) %{ // MIN | |
2271 // Compare dst,src | |
2272 emit_opcode(cbuf,0x3B); | |
2273 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
2274 // jmp dst < src around move | |
2275 emit_opcode(cbuf,0x7C); | |
2276 emit_d8(cbuf,2); | |
2277 // move dst,src | |
2278 emit_opcode(cbuf,0x8B); | |
2279 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
2280 %} | |
2281 | |
2282 enc_class max_enc (eRegI dst, eRegI src) %{ // MAX | |
2283 // Compare dst,src | |
2284 emit_opcode(cbuf,0x3B); | |
2285 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
2286 // jmp dst > src around move | |
2287 emit_opcode(cbuf,0x7F); | |
2288 emit_d8(cbuf,2); | |
2289 // move dst,src | |
2290 emit_opcode(cbuf,0x8B); | |
2291 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
2292 %} | |
2293 | |
2294 enc_class enc_FP_store(memory mem, regD src) %{ | |
2295 // If src is FPR1, we can just FST to store it. | |
2296 // Else we need to FLD it to FPR1, then FSTP to store/pop it. | |
2297 int reg_encoding = 0x2; // Just store | |
2298 int base = $mem$$base; | |
2299 int index = $mem$$index; | |
2300 int scale = $mem$$scale; | |
2301 int displace = $mem$$disp; | |
2302 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
2303 if( $src$$reg != FPR1L_enc ) { | |
2304 reg_encoding = 0x3; // Store & pop | |
2305 emit_opcode( cbuf, 0xD9 ); // FLD (i.e., push it) | |
2306 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
2307 } | |
2308 cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand | |
2309 emit_opcode(cbuf,$primary); | |
2310 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
2311 %} | |
2312 | |
2313 enc_class neg_reg(eRegI dst) %{ | |
2314 // NEG $dst | |
2315 emit_opcode(cbuf,0xF7); | |
2316 emit_rm(cbuf, 0x3, 0x03, $dst$$reg ); | |
2317 %} | |
2318 | |
2319 enc_class setLT_reg(eCXRegI dst) %{ | |
2320 // SETLT $dst | |
2321 emit_opcode(cbuf,0x0F); | |
2322 emit_opcode(cbuf,0x9C); | |
2323 emit_rm( cbuf, 0x3, 0x4, $dst$$reg ); | |
2324 %} | |
2325 | |
2326 enc_class enc_cmpLTP(ncxRegI p, ncxRegI q, ncxRegI y, eCXRegI tmp) %{ // cadd_cmpLT | |
2327 int tmpReg = $tmp$$reg; | |
2328 | |
2329 // SUB $p,$q | |
2330 emit_opcode(cbuf,0x2B); | |
2331 emit_rm(cbuf, 0x3, $p$$reg, $q$$reg); | |
2332 // SBB $tmp,$tmp | |
2333 emit_opcode(cbuf,0x1B); | |
2334 emit_rm(cbuf, 0x3, tmpReg, tmpReg); | |
2335 // AND $tmp,$y | |
2336 emit_opcode(cbuf,0x23); | |
2337 emit_rm(cbuf, 0x3, tmpReg, $y$$reg); | |
2338 // ADD $p,$tmp | |
2339 emit_opcode(cbuf,0x03); | |
2340 emit_rm(cbuf, 0x3, $p$$reg, tmpReg); | |
2341 %} | |
2342 | |
2343 enc_class enc_cmpLTP_mem(eRegI p, eRegI q, memory mem, eCXRegI tmp) %{ // cadd_cmpLT | |
2344 int tmpReg = $tmp$$reg; | |
2345 | |
2346 // SUB $p,$q | |
2347 emit_opcode(cbuf,0x2B); | |
2348 emit_rm(cbuf, 0x3, $p$$reg, $q$$reg); | |
2349 // SBB $tmp,$tmp | |
2350 emit_opcode(cbuf,0x1B); | |
2351 emit_rm(cbuf, 0x3, tmpReg, tmpReg); | |
2352 // AND $tmp,$y | |
2353 cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand | |
2354 emit_opcode(cbuf,0x23); | |
2355 int reg_encoding = tmpReg; | |
2356 int base = $mem$$base; | |
2357 int index = $mem$$index; | |
2358 int scale = $mem$$scale; | |
2359 int displace = $mem$$disp; | |
2360 bool disp_is_oop = $mem->disp_is_oop(); | |
2361 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
2362 // ADD $p,$tmp | |
2363 emit_opcode(cbuf,0x03); | |
2364 emit_rm(cbuf, 0x3, $p$$reg, tmpReg); | |
2365 %} | |
2366 | |
2367 enc_class shift_left_long( eRegL dst, eCXRegI shift ) %{ | |
2368 // TEST shift,32 | |
2369 emit_opcode(cbuf,0xF7); | |
2370 emit_rm(cbuf, 0x3, 0, ECX_enc); | |
2371 emit_d32(cbuf,0x20); | |
2372 // JEQ,s small | |
2373 emit_opcode(cbuf, 0x74); | |
2374 emit_d8(cbuf, 0x04); | |
2375 // MOV $dst.hi,$dst.lo | |
2376 emit_opcode( cbuf, 0x8B ); | |
2377 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg ); | |
2378 // CLR $dst.lo | |
2379 emit_opcode(cbuf, 0x33); | |
2380 emit_rm(cbuf, 0x3, $dst$$reg, $dst$$reg); | |
2381 // small: | |
2382 // SHLD $dst.hi,$dst.lo,$shift | |
2383 emit_opcode(cbuf,0x0F); | |
2384 emit_opcode(cbuf,0xA5); | |
2385 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg)); | |
2386 // SHL $dst.lo,$shift" | |
2387 emit_opcode(cbuf,0xD3); | |
2388 emit_rm(cbuf, 0x3, 0x4, $dst$$reg ); | |
2389 %} | |
2390 | |
2391 enc_class shift_right_long( eRegL dst, eCXRegI shift ) %{ | |
2392 // TEST shift,32 | |
2393 emit_opcode(cbuf,0xF7); | |
2394 emit_rm(cbuf, 0x3, 0, ECX_enc); | |
2395 emit_d32(cbuf,0x20); | |
2396 // JEQ,s small | |
2397 emit_opcode(cbuf, 0x74); | |
2398 emit_d8(cbuf, 0x04); | |
2399 // MOV $dst.lo,$dst.hi | |
2400 emit_opcode( cbuf, 0x8B ); | |
2401 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
2402 // CLR $dst.hi | |
2403 emit_opcode(cbuf, 0x33); | |
2404 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($dst$$reg)); | |
2405 // small: | |
2406 // SHRD $dst.lo,$dst.hi,$shift | |
2407 emit_opcode(cbuf,0x0F); | |
2408 emit_opcode(cbuf,0xAD); | |
2409 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg); | |
2410 // SHR $dst.hi,$shift" | |
2411 emit_opcode(cbuf,0xD3); | |
2412 emit_rm(cbuf, 0x3, 0x5, HIGH_FROM_LOW($dst$$reg) ); | |
2413 %} | |
2414 | |
2415 enc_class shift_right_arith_long( eRegL dst, eCXRegI shift ) %{ | |
2416 // TEST shift,32 | |
2417 emit_opcode(cbuf,0xF7); | |
2418 emit_rm(cbuf, 0x3, 0, ECX_enc); | |
2419 emit_d32(cbuf,0x20); | |
2420 // JEQ,s small | |
2421 emit_opcode(cbuf, 0x74); | |
2422 emit_d8(cbuf, 0x05); | |
2423 // MOV $dst.lo,$dst.hi | |
2424 emit_opcode( cbuf, 0x8B ); | |
2425 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
2426 // SAR $dst.hi,31 | |
2427 emit_opcode(cbuf, 0xC1); | |
2428 emit_rm(cbuf, 0x3, 7, HIGH_FROM_LOW($dst$$reg) ); | |
2429 emit_d8(cbuf, 0x1F ); | |
2430 // small: | |
2431 // SHRD $dst.lo,$dst.hi,$shift | |
2432 emit_opcode(cbuf,0x0F); | |
2433 emit_opcode(cbuf,0xAD); | |
2434 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg); | |
2435 // SAR $dst.hi,$shift" | |
2436 emit_opcode(cbuf,0xD3); | |
2437 emit_rm(cbuf, 0x3, 0x7, HIGH_FROM_LOW($dst$$reg) ); | |
2438 %} | |
2439 | |
2440 | |
2441 // ----------------- Encodings for floating point unit ----------------- | |
2442 // May leave result in FPU-TOS or FPU reg depending on opcodes | |
2443 enc_class OpcReg_F (regF src) %{ // FMUL, FDIV | |
2444 $$$emit8$primary; | |
2445 emit_rm(cbuf, 0x3, $secondary, $src$$reg ); | |
2446 %} | |
2447 | |
2448 // Pop argument in FPR0 with FSTP ST(0) | |
2449 enc_class PopFPU() %{ | |
2450 emit_opcode( cbuf, 0xDD ); | |
2451 emit_d8( cbuf, 0xD8 ); | |
2452 %} | |
2453 | |
2454 // !!!!! equivalent to Pop_Reg_F | |
2455 enc_class Pop_Reg_D( regD dst ) %{ | |
2456 emit_opcode( cbuf, 0xDD ); // FSTP ST(i) | |
2457 emit_d8( cbuf, 0xD8+$dst$$reg ); | |
2458 %} | |
2459 | |
2460 enc_class Push_Reg_D( regD dst ) %{ | |
2461 emit_opcode( cbuf, 0xD9 ); | |
2462 emit_d8( cbuf, 0xC0-1+$dst$$reg ); // FLD ST(i-1) | |
2463 %} | |
2464 | |
2465 enc_class strictfp_bias1( regD dst ) %{ | |
2466 emit_opcode( cbuf, 0xDB ); // FLD m80real | |
2467 emit_opcode( cbuf, 0x2D ); | |
2468 emit_d32( cbuf, (int)StubRoutines::addr_fpu_subnormal_bias1() ); | |
2469 emit_opcode( cbuf, 0xDE ); // FMULP ST(dst), ST0 | |
2470 emit_opcode( cbuf, 0xC8+$dst$$reg ); | |
2471 %} | |
2472 | |
2473 enc_class strictfp_bias2( regD dst ) %{ | |
2474 emit_opcode( cbuf, 0xDB ); // FLD m80real | |
2475 emit_opcode( cbuf, 0x2D ); | |
2476 emit_d32( cbuf, (int)StubRoutines::addr_fpu_subnormal_bias2() ); | |
2477 emit_opcode( cbuf, 0xDE ); // FMULP ST(dst), ST0 | |
2478 emit_opcode( cbuf, 0xC8+$dst$$reg ); | |
2479 %} | |
2480 | |
2481 // Special case for moving an integer register to a stack slot. | |
2482 enc_class OpcPRegSS( stackSlotI dst, eRegI src ) %{ // RegSS | |
2483 store_to_stackslot( cbuf, $primary, $src$$reg, $dst$$disp ); | |
2484 %} | |
2485 | |
2486 // Special case for moving a register to a stack slot. | |
2487 enc_class RegSS( stackSlotI dst, eRegI src ) %{ // RegSS | |
2488 // Opcode already emitted | |
2489 emit_rm( cbuf, 0x02, $src$$reg, ESP_enc ); // R/M byte | |
2490 emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte | |
2491 emit_d32(cbuf, $dst$$disp); // Displacement | |
2492 %} | |
2493 | |
2494 // Push the integer in stackSlot 'src' onto FP-stack | |
2495 enc_class Push_Mem_I( memory src ) %{ // FILD [ESP+src] | |
2496 store_to_stackslot( cbuf, $primary, $secondary, $src$$disp ); | |
2497 %} | |
2498 | |
2499 // Push the float in stackSlot 'src' onto FP-stack | |
2500 enc_class Push_Mem_F( memory src ) %{ // FLD_S [ESP+src] | |
2501 store_to_stackslot( cbuf, 0xD9, 0x00, $src$$disp ); | |
2502 %} | |
2503 | |
2504 // Push the double in stackSlot 'src' onto FP-stack | |
2505 enc_class Push_Mem_D( memory src ) %{ // FLD_D [ESP+src] | |
2506 store_to_stackslot( cbuf, 0xDD, 0x00, $src$$disp ); | |
2507 %} | |
2508 | |
2509 // Push FPU's TOS float to a stack-slot, and pop FPU-stack | |
2510 enc_class Pop_Mem_F( stackSlotF dst ) %{ // FSTP_S [ESP+dst] | |
2511 store_to_stackslot( cbuf, 0xD9, 0x03, $dst$$disp ); | |
2512 %} | |
2513 | |
2514 // Same as Pop_Mem_F except for opcode | |
2515 // Push FPU's TOS double to a stack-slot, and pop FPU-stack | |
2516 enc_class Pop_Mem_D( stackSlotD dst ) %{ // FSTP_D [ESP+dst] | |
2517 store_to_stackslot( cbuf, 0xDD, 0x03, $dst$$disp ); | |
2518 %} | |
2519 | |
2520 enc_class Pop_Reg_F( regF dst ) %{ | |
2521 emit_opcode( cbuf, 0xDD ); // FSTP ST(i) | |
2522 emit_d8( cbuf, 0xD8+$dst$$reg ); | |
2523 %} | |
2524 | |
2525 enc_class Push_Reg_F( regF dst ) %{ | |
2526 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
2527 emit_d8( cbuf, 0xC0-1+$dst$$reg ); | |
2528 %} | |
2529 | |
2530 // Push FPU's float to a stack-slot, and pop FPU-stack | |
2531 enc_class Pop_Mem_Reg_F( stackSlotF dst, regF src ) %{ | |
2532 int pop = 0x02; | |
2533 if ($src$$reg != FPR1L_enc) { | |
2534 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
2535 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
2536 pop = 0x03; | |
2537 } | |
2538 store_to_stackslot( cbuf, 0xD9, pop, $dst$$disp ); // FST<P>_S [ESP+dst] | |
2539 %} | |
2540 | |
2541 // Push FPU's double to a stack-slot, and pop FPU-stack | |
2542 enc_class Pop_Mem_Reg_D( stackSlotD dst, regD src ) %{ | |
2543 int pop = 0x02; | |
2544 if ($src$$reg != FPR1L_enc) { | |
2545 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
2546 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
2547 pop = 0x03; | |
2548 } | |
2549 store_to_stackslot( cbuf, 0xDD, pop, $dst$$disp ); // FST<P>_D [ESP+dst] | |
2550 %} | |
2551 | |
2552 // Push FPU's double to a FPU-stack-slot, and pop FPU-stack | |
2553 enc_class Pop_Reg_Reg_D( regD dst, regF src ) %{ | |
2554 int pop = 0xD0 - 1; // -1 since we skip FLD | |
2555 if ($src$$reg != FPR1L_enc) { | |
2556 emit_opcode( cbuf, 0xD9 ); // FLD ST(src-1) | |
2557 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
2558 pop = 0xD8; | |
2559 } | |
2560 emit_opcode( cbuf, 0xDD ); | |
2561 emit_d8( cbuf, pop+$dst$$reg ); // FST<P> ST(i) | |
2562 %} | |
2563 | |
2564 | |
2565 enc_class Mul_Add_F( regF dst, regF src, regF src1, regF src2 ) %{ | |
2566 MacroAssembler masm(&cbuf); | |
2567 masm.fld_s( $src1$$reg-1); // nothing at TOS, load TOS from src1.reg | |
2568 masm.fmul( $src2$$reg+0); // value at TOS | |
2569 masm.fadd( $src$$reg+0); // value at TOS | |
2570 masm.fstp_d( $dst$$reg+0); // value at TOS, popped off after store | |
2571 %} | |
2572 | |
2573 | |
2574 enc_class Push_Reg_Mod_D( regD dst, regD src) %{ | |
2575 // load dst in FPR0 | |
2576 emit_opcode( cbuf, 0xD9 ); | |
2577 emit_d8( cbuf, 0xC0-1+$dst$$reg ); | |
2578 if ($src$$reg != FPR1L_enc) { | |
2579 // fincstp | |
2580 emit_opcode (cbuf, 0xD9); | |
2581 emit_opcode (cbuf, 0xF7); | |
2582 // swap src with FPR1: | |
2583 // FXCH FPR1 with src | |
2584 emit_opcode(cbuf, 0xD9); | |
2585 emit_d8(cbuf, 0xC8-1+$src$$reg ); | |
2586 // fdecstp | |
2587 emit_opcode (cbuf, 0xD9); | |
2588 emit_opcode (cbuf, 0xF6); | |
2589 } | |
2590 %} | |
2591 | |
2592 enc_class Push_ModD_encoding( regXD src0, regXD src1) %{ | |
2593 // Allocate a word | |
2594 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
2595 emit_opcode(cbuf,0xEC); | |
2596 emit_d8(cbuf,0x08); | |
2597 | |
2598 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src1 | |
2599 emit_opcode (cbuf, 0x0F ); | |
2600 emit_opcode (cbuf, 0x11 ); | |
2601 encode_RegMem(cbuf, $src1$$reg, ESP_enc, 0x4, 0, 0, false); | |
2602 | |
2603 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
2604 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
2605 | |
2606 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src0 | |
2607 emit_opcode (cbuf, 0x0F ); | |
2608 emit_opcode (cbuf, 0x11 ); | |
2609 encode_RegMem(cbuf, $src0$$reg, ESP_enc, 0x4, 0, 0, false); | |
2610 | |
2611 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
2612 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
2613 | |
2614 %} | |
2615 | |
2616 enc_class Push_ModX_encoding( regX src0, regX src1) %{ | |
2617 // Allocate a word | |
2618 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
2619 emit_opcode(cbuf,0xEC); | |
2620 emit_d8(cbuf,0x04); | |
2621 | |
2622 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src1 | |
2623 emit_opcode (cbuf, 0x0F ); | |
2624 emit_opcode (cbuf, 0x11 ); | |
2625 encode_RegMem(cbuf, $src1$$reg, ESP_enc, 0x4, 0, 0, false); | |
2626 | |
2627 emit_opcode(cbuf,0xD9 ); // FLD [ESP] | |
2628 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
2629 | |
2630 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src0 | |
2631 emit_opcode (cbuf, 0x0F ); | |
2632 emit_opcode (cbuf, 0x11 ); | |
2633 encode_RegMem(cbuf, $src0$$reg, ESP_enc, 0x4, 0, 0, false); | |
2634 | |
2635 emit_opcode(cbuf,0xD9 ); // FLD [ESP] | |
2636 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
2637 | |
2638 %} | |
2639 | |
2640 enc_class Push_ResultXD(regXD dst) %{ | |
2641 store_to_stackslot( cbuf, 0xDD, 0x03, 0 ); //FSTP [ESP] | |
2642 | |
2643 // UseXmmLoadAndClearUpper ? movsd dst,[esp] : movlpd dst,[esp] | |
2644 emit_opcode (cbuf, UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
2645 emit_opcode (cbuf, 0x0F ); | |
2646 emit_opcode (cbuf, UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
2647 encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); | |
2648 | |
2649 emit_opcode(cbuf,0x83); // ADD ESP,8 | |
2650 emit_opcode(cbuf,0xC4); | |
2651 emit_d8(cbuf,0x08); | |
2652 %} | |
2653 | |
2654 enc_class Push_ResultX(regX dst, immI d8) %{ | |
2655 store_to_stackslot( cbuf, 0xD9, 0x03, 0 ); //FSTP_S [ESP] | |
2656 | |
2657 emit_opcode (cbuf, 0xF3 ); // MOVSS dst(xmm), [ESP] | |
2658 emit_opcode (cbuf, 0x0F ); | |
2659 emit_opcode (cbuf, 0x10 ); | |
2660 encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); | |
2661 | |
2662 emit_opcode(cbuf,0x83); // ADD ESP,d8 (4 or 8) | |
2663 emit_opcode(cbuf,0xC4); | |
2664 emit_d8(cbuf,$d8$$constant); | |
2665 %} | |
2666 | |
2667 enc_class Push_SrcXD(regXD src) %{ | |
2668 // Allocate a word | |
2669 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
2670 emit_opcode(cbuf,0xEC); | |
2671 emit_d8(cbuf,0x08); | |
2672 | |
2673 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src | |
2674 emit_opcode (cbuf, 0x0F ); | |
2675 emit_opcode (cbuf, 0x11 ); | |
2676 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
2677 | |
2678 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
2679 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
2680 %} | |
2681 | |
2682 enc_class push_stack_temp_qword() %{ | |
2683 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
2684 emit_opcode(cbuf,0xEC); | |
2685 emit_d8 (cbuf,0x08); | |
2686 %} | |
2687 | |
2688 enc_class pop_stack_temp_qword() %{ | |
2689 emit_opcode(cbuf,0x83); // ADD ESP,8 | |
2690 emit_opcode(cbuf,0xC4); | |
2691 emit_d8 (cbuf,0x08); | |
2692 %} | |
2693 | |
2694 enc_class push_xmm_to_fpr1( regXD xmm_src ) %{ | |
2695 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], xmm_src | |
2696 emit_opcode (cbuf, 0x0F ); | |
2697 emit_opcode (cbuf, 0x11 ); | |
2698 encode_RegMem(cbuf, $xmm_src$$reg, ESP_enc, 0x4, 0, 0, false); | |
2699 | |
2700 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
2701 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
2702 %} | |
2703 | |
2704 // Compute X^Y using Intel's fast hardware instructions, if possible. | |
2705 // Otherwise return a NaN. | |
2706 enc_class pow_exp_core_encoding %{ | |
2707 // FPR1 holds Y*ln2(X). Compute FPR1 = 2^(Y*ln2(X)) | |
2708 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xC0); // fdup = fld st(0) Q Q | |
2709 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xFC); // frndint int(Q) Q | |
2710 emit_opcode(cbuf,0xDC); emit_opcode(cbuf,0xE9); // fsub st(1) -= st(0); int(Q) frac(Q) | |
2711 emit_opcode(cbuf,0xDB); // FISTP [ESP] frac(Q) | |
2712 emit_opcode(cbuf,0x1C); | |
2713 emit_d8(cbuf,0x24); | |
2714 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xF0); // f2xm1 2^frac(Q)-1 | |
2715 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xE8); // fld1 1 2^frac(Q)-1 | |
2716 emit_opcode(cbuf,0xDE); emit_opcode(cbuf,0xC1); // faddp 2^frac(Q) | |
2717 emit_opcode(cbuf,0x8B); // mov rax,[esp+0]=int(Q) | |
2718 encode_RegMem(cbuf, EAX_enc, ESP_enc, 0x4, 0, 0, false); | |
2719 emit_opcode(cbuf,0xC7); // mov rcx,0xFFFFF800 - overflow mask | |
2720 emit_rm(cbuf, 0x3, 0x0, ECX_enc); | |
2721 emit_d32(cbuf,0xFFFFF800); | |
2722 emit_opcode(cbuf,0x81); // add rax,1023 - the double exponent bias | |
2723 emit_rm(cbuf, 0x3, 0x0, EAX_enc); | |
2724 emit_d32(cbuf,1023); | |
2725 emit_opcode(cbuf,0x8B); // mov rbx,eax | |
2726 emit_rm(cbuf, 0x3, EBX_enc, EAX_enc); | |
2727 emit_opcode(cbuf,0xC1); // shl rax,20 - Slide to exponent position | |
2728 emit_rm(cbuf,0x3,0x4,EAX_enc); | |
2729 emit_d8(cbuf,20); | |
2730 emit_opcode(cbuf,0x85); // test rbx,ecx - check for overflow | |
2731 emit_rm(cbuf, 0x3, EBX_enc, ECX_enc); | |
2732 emit_opcode(cbuf,0x0F); emit_opcode(cbuf,0x45); // CMOVne rax,ecx - overflow; stuff NAN into EAX | |
2733 emit_rm(cbuf, 0x3, EAX_enc, ECX_enc); | |
2734 emit_opcode(cbuf,0x89); // mov [esp+4],eax - Store as part of double word | |
2735 encode_RegMem(cbuf, EAX_enc, ESP_enc, 0x4, 0, 4, false); | |
2736 emit_opcode(cbuf,0xC7); // mov [esp+0],0 - [ESP] = (double)(1<<int(Q)) = 2^int(Q) | |
2737 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
2738 emit_d32(cbuf,0); | |
2739 emit_opcode(cbuf,0xDC); // fmul dword st(0),[esp+0]; FPR1 = 2^int(Q)*2^frac(Q) = 2^Q | |
2740 encode_RegMem(cbuf, 0x1, ESP_enc, 0x4, 0, 0, false); | |
2741 %} | |
2742 | |
2743 // enc_class Pop_Reg_Mod_D( regD dst, regD src) | |
2744 // was replaced by Push_Result_Mod_D followed by Pop_Reg_X() or Pop_Mem_X() | |
2745 | |
2746 enc_class Push_Result_Mod_D( regD src) %{ | |
2747 if ($src$$reg != FPR1L_enc) { | |
2748 // fincstp | |
2749 emit_opcode (cbuf, 0xD9); | |
2750 emit_opcode (cbuf, 0xF7); | |
2751 // FXCH FPR1 with src | |
2752 emit_opcode(cbuf, 0xD9); | |
2753 emit_d8(cbuf, 0xC8-1+$src$$reg ); | |
2754 // fdecstp | |
2755 emit_opcode (cbuf, 0xD9); | |
2756 emit_opcode (cbuf, 0xF6); | |
2757 } | |
2758 // // following asm replaced with Pop_Reg_F or Pop_Mem_F | |
2759 // // FSTP FPR$dst$$reg | |
2760 // emit_opcode( cbuf, 0xDD ); | |
2761 // emit_d8( cbuf, 0xD8+$dst$$reg ); | |
2762 %} | |
2763 | |
2764 enc_class fnstsw_sahf_skip_parity() %{ | |
2765 // fnstsw ax | |
2766 emit_opcode( cbuf, 0xDF ); | |
2767 emit_opcode( cbuf, 0xE0 ); | |
2768 // sahf | |
2769 emit_opcode( cbuf, 0x9E ); | |
2770 // jnp ::skip | |
2771 emit_opcode( cbuf, 0x7B ); | |
2772 emit_opcode( cbuf, 0x05 ); | |
2773 %} | |
2774 | |
2775 enc_class emitModD() %{ | |
2776 // fprem must be iterative | |
2777 // :: loop | |
2778 // fprem | |
2779 emit_opcode( cbuf, 0xD9 ); | |
2780 emit_opcode( cbuf, 0xF8 ); | |
2781 // wait | |
2782 emit_opcode( cbuf, 0x9b ); | |
2783 // fnstsw ax | |
2784 emit_opcode( cbuf, 0xDF ); | |
2785 emit_opcode( cbuf, 0xE0 ); | |
2786 // sahf | |
2787 emit_opcode( cbuf, 0x9E ); | |
2788 // jp ::loop | |
2789 emit_opcode( cbuf, 0x0F ); | |
2790 emit_opcode( cbuf, 0x8A ); | |
2791 emit_opcode( cbuf, 0xF4 ); | |
2792 emit_opcode( cbuf, 0xFF ); | |
2793 emit_opcode( cbuf, 0xFF ); | |
2794 emit_opcode( cbuf, 0xFF ); | |
2795 %} | |
2796 | |
2797 enc_class fpu_flags() %{ | |
2798 // fnstsw_ax | |
2799 emit_opcode( cbuf, 0xDF); | |
2800 emit_opcode( cbuf, 0xE0); | |
2801 // test ax,0x0400 | |
2802 emit_opcode( cbuf, 0x66 ); // operand-size prefix for 16-bit immediate | |
2803 emit_opcode( cbuf, 0xA9 ); | |
2804 emit_d16 ( cbuf, 0x0400 ); | |
2805 // // // This sequence works, but stalls for 12-16 cycles on PPro | |
2806 // // test rax,0x0400 | |
2807 // emit_opcode( cbuf, 0xA9 ); | |
2808 // emit_d32 ( cbuf, 0x00000400 ); | |
2809 // | |
2810 // jz exit (no unordered comparison) | |
2811 emit_opcode( cbuf, 0x74 ); | |
2812 emit_d8 ( cbuf, 0x02 ); | |
2813 // mov ah,1 - treat as LT case (set carry flag) | |
2814 emit_opcode( cbuf, 0xB4 ); | |
2815 emit_d8 ( cbuf, 0x01 ); | |
2816 // sahf | |
2817 emit_opcode( cbuf, 0x9E); | |
2818 %} | |
2819 | |
2820 enc_class cmpF_P6_fixup() %{ | |
2821 // Fixup the integer flags in case comparison involved a NaN | |
2822 // | |
2823 // JNP exit (no unordered comparison, P-flag is set by NaN) | |
2824 emit_opcode( cbuf, 0x7B ); | |
2825 emit_d8 ( cbuf, 0x03 ); | |
2826 // MOV AH,1 - treat as LT case (set carry flag) | |
2827 emit_opcode( cbuf, 0xB4 ); | |
2828 emit_d8 ( cbuf, 0x01 ); | |
2829 // SAHF | |
2830 emit_opcode( cbuf, 0x9E); | |
2831 // NOP // target for branch to avoid branch to branch | |
2832 emit_opcode( cbuf, 0x90); | |
2833 %} | |
2834 | |
2835 // fnstsw_ax(); | |
2836 // sahf(); | |
2837 // movl(dst, nan_result); | |
2838 // jcc(Assembler::parity, exit); | |
2839 // movl(dst, less_result); | |
2840 // jcc(Assembler::below, exit); | |
2841 // movl(dst, equal_result); | |
2842 // jcc(Assembler::equal, exit); | |
2843 // movl(dst, greater_result); | |
2844 | |
2845 // less_result = 1; | |
2846 // greater_result = -1; | |
2847 // equal_result = 0; | |
2848 // nan_result = -1; | |
2849 | |
2850 enc_class CmpF_Result(eRegI dst) %{ | |
2851 // fnstsw_ax(); | |
2852 emit_opcode( cbuf, 0xDF); | |
2853 emit_opcode( cbuf, 0xE0); | |
2854 // sahf | |
2855 emit_opcode( cbuf, 0x9E); | |
2856 // movl(dst, nan_result); | |
2857 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
2858 emit_d32( cbuf, -1 ); | |
2859 // jcc(Assembler::parity, exit); | |
2860 emit_opcode( cbuf, 0x7A ); | |
2861 emit_d8 ( cbuf, 0x13 ); | |
2862 // movl(dst, less_result); | |
2863 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
2864 emit_d32( cbuf, -1 ); | |
2865 // jcc(Assembler::below, exit); | |
2866 emit_opcode( cbuf, 0x72 ); | |
2867 emit_d8 ( cbuf, 0x0C ); | |
2868 // movl(dst, equal_result); | |
2869 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
2870 emit_d32( cbuf, 0 ); | |
2871 // jcc(Assembler::equal, exit); | |
2872 emit_opcode( cbuf, 0x74 ); | |
2873 emit_d8 ( cbuf, 0x05 ); | |
2874 // movl(dst, greater_result); | |
2875 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
2876 emit_d32( cbuf, 1 ); | |
2877 %} | |
2878 | |
2879 | |
2880 // XMM version of CmpF_Result. Because the XMM compare | |
2881 // instructions set the EFLAGS directly. It becomes simpler than | |
2882 // the float version above. | |
2883 enc_class CmpX_Result(eRegI dst) %{ | |
2884 MacroAssembler _masm(&cbuf); | |
2885 Label nan, inc, done; | |
2886 | |
2887 __ jccb(Assembler::parity, nan); | |
2888 __ jccb(Assembler::equal, done); | |
2889 __ jccb(Assembler::above, inc); | |
2890 __ bind(nan); | |
2891 __ decrement(as_Register($dst$$reg)); | |
2892 __ jmpb(done); | |
2893 __ bind(inc); | |
2894 __ increment(as_Register($dst$$reg)); | |
2895 __ bind(done); | |
2896 %} | |
2897 | |
2898 // Compare the longs and set flags | |
2899 // BROKEN! Do Not use as-is | |
2900 enc_class cmpl_test( eRegL src1, eRegL src2 ) %{ | |
2901 // CMP $src1.hi,$src2.hi | |
2902 emit_opcode( cbuf, 0x3B ); | |
2903 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($src1$$reg), HIGH_FROM_LOW($src2$$reg) ); | |
2904 // JNE,s done | |
2905 emit_opcode(cbuf,0x75); | |
2906 emit_d8(cbuf, 2 ); | |
2907 // CMP $src1.lo,$src2.lo | |
2908 emit_opcode( cbuf, 0x3B ); | |
2909 emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); | |
2910 // done: | |
2911 %} | |
2912 | |
2913 enc_class convert_int_long( regL dst, eRegI src ) %{ | |
2914 // mov $dst.lo,$src | |
2915 int dst_encoding = $dst$$reg; | |
2916 int src_encoding = $src$$reg; | |
2917 encode_Copy( cbuf, dst_encoding , src_encoding ); | |
2918 // mov $dst.hi,$src | |
2919 encode_Copy( cbuf, HIGH_FROM_LOW(dst_encoding), src_encoding ); | |
2920 // sar $dst.hi,31 | |
2921 emit_opcode( cbuf, 0xC1 ); | |
2922 emit_rm(cbuf, 0x3, 7, HIGH_FROM_LOW(dst_encoding) ); | |
2923 emit_d8(cbuf, 0x1F ); | |
2924 %} | |
2925 | |
2926 enc_class convert_long_double( eRegL src ) %{ | |
2927 // push $src.hi | |
2928 emit_opcode(cbuf, 0x50+HIGH_FROM_LOW($src$$reg)); | |
2929 // push $src.lo | |
2930 emit_opcode(cbuf, 0x50+$src$$reg ); | |
2931 // fild 64-bits at [SP] | |
2932 emit_opcode(cbuf,0xdf); | |
2933 emit_d8(cbuf, 0x6C); | |
2934 emit_d8(cbuf, 0x24); | |
2935 emit_d8(cbuf, 0x00); | |
2936 // pop stack | |
2937 emit_opcode(cbuf, 0x83); // add SP, #8 | |
2938 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
2939 emit_d8(cbuf, 0x8); | |
2940 %} | |
2941 | |
2942 enc_class multiply_con_and_shift_high( eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32_63 cnt, eFlagsReg cr ) %{ | |
2943 // IMUL EDX:EAX,$src1 | |
2944 emit_opcode( cbuf, 0xF7 ); | |
2945 emit_rm( cbuf, 0x3, 0x5, $src1$$reg ); | |
2946 // SAR EDX,$cnt-32 | |
2947 int shift_count = ((int)$cnt$$constant) - 32; | |
2948 if (shift_count > 0) { | |
2949 emit_opcode(cbuf, 0xC1); | |
2950 emit_rm(cbuf, 0x3, 7, $dst$$reg ); | |
2951 emit_d8(cbuf, shift_count); | |
2952 } | |
2953 %} | |
2954 | |
2955 // this version doesn't have add sp, 8 | |
2956 enc_class convert_long_double2( eRegL src ) %{ | |
2957 // push $src.hi | |
2958 emit_opcode(cbuf, 0x50+HIGH_FROM_LOW($src$$reg)); | |
2959 // push $src.lo | |
2960 emit_opcode(cbuf, 0x50+$src$$reg ); | |
2961 // fild 64-bits at [SP] | |
2962 emit_opcode(cbuf,0xdf); | |
2963 emit_d8(cbuf, 0x6C); | |
2964 emit_d8(cbuf, 0x24); | |
2965 emit_d8(cbuf, 0x00); | |
2966 %} | |
2967 | |
2968 enc_class long_int_multiply( eADXRegL dst, nadxRegI src) %{ | |
2969 // Basic idea: long = (long)int * (long)int | |
2970 // IMUL EDX:EAX, src | |
2971 emit_opcode( cbuf, 0xF7 ); | |
2972 emit_rm( cbuf, 0x3, 0x5, $src$$reg); | |
2973 %} | |
2974 | |
2975 enc_class long_uint_multiply( eADXRegL dst, nadxRegI src) %{ | |
2976 // Basic Idea: long = (int & 0xffffffffL) * (int & 0xffffffffL) | |
2977 // MUL EDX:EAX, src | |
2978 emit_opcode( cbuf, 0xF7 ); | |
2979 emit_rm( cbuf, 0x3, 0x4, $src$$reg); | |
2980 %} | |
2981 | |
2982 enc_class long_multiply( eADXRegL dst, eRegL src, eRegI tmp ) %{ | |
2983 // Basic idea: lo(result) = lo(x_lo * y_lo) | |
2984 // hi(result) = hi(x_lo * y_lo) + lo(x_hi * y_lo) + lo(x_lo * y_hi) | |
2985 // MOV $tmp,$src.lo | |
2986 encode_Copy( cbuf, $tmp$$reg, $src$$reg ); | |
2987 // IMUL $tmp,EDX | |
2988 emit_opcode( cbuf, 0x0F ); | |
2989 emit_opcode( cbuf, 0xAF ); | |
2990 emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
2991 // MOV EDX,$src.hi | |
2992 encode_Copy( cbuf, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg) ); | |
2993 // IMUL EDX,EAX | |
2994 emit_opcode( cbuf, 0x0F ); | |
2995 emit_opcode( cbuf, 0xAF ); | |
2996 emit_rm( cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg ); | |
2997 // ADD $tmp,EDX | |
2998 emit_opcode( cbuf, 0x03 ); | |
2999 emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
3000 // MUL EDX:EAX,$src.lo | |
3001 emit_opcode( cbuf, 0xF7 ); | |
3002 emit_rm( cbuf, 0x3, 0x4, $src$$reg ); | |
3003 // ADD EDX,ESI | |
3004 emit_opcode( cbuf, 0x03 ); | |
3005 emit_rm( cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $tmp$$reg ); | |
3006 %} | |
3007 | |
3008 enc_class long_multiply_con( eADXRegL dst, immL_127 src, eRegI tmp ) %{ | |
3009 // Basic idea: lo(result) = lo(src * y_lo) | |
3010 // hi(result) = hi(src * y_lo) + lo(src * y_hi) | |
3011 // IMUL $tmp,EDX,$src | |
3012 emit_opcode( cbuf, 0x6B ); | |
3013 emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
3014 emit_d8( cbuf, (int)$src$$constant ); | |
3015 // MOV EDX,$src | |
3016 emit_opcode(cbuf, 0xB8 + EDX_enc); | |
3017 emit_d32( cbuf, (int)$src$$constant ); | |
3018 // MUL EDX:EAX,EDX | |
3019 emit_opcode( cbuf, 0xF7 ); | |
3020 emit_rm( cbuf, 0x3, 0x4, EDX_enc ); | |
3021 // ADD EDX,ESI | |
3022 emit_opcode( cbuf, 0x03 ); | |
3023 emit_rm( cbuf, 0x3, EDX_enc, $tmp$$reg ); | |
3024 %} | |
3025 | |
3026 enc_class long_div( eRegL src1, eRegL src2 ) %{ | |
3027 // PUSH src1.hi | |
3028 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src1$$reg) ); | |
3029 // PUSH src1.lo | |
3030 emit_opcode(cbuf, 0x50+$src1$$reg ); | |
3031 // PUSH src2.hi | |
3032 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src2$$reg) ); | |
3033 // PUSH src2.lo | |
3034 emit_opcode(cbuf, 0x50+$src2$$reg ); | |
3035 // CALL directly to the runtime | |
3036 cbuf.set_inst_mark(); | |
3037 emit_opcode(cbuf,0xE8); // Call into runtime | |
3038 emit_d32_reloc(cbuf, (CAST_FROM_FN_PTR(address, SharedRuntime::ldiv) - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
3039 // Restore stack | |
3040 emit_opcode(cbuf, 0x83); // add SP, #framesize | |
3041 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
3042 emit_d8(cbuf, 4*4); | |
3043 %} | |
3044 | |
3045 enc_class long_mod( eRegL src1, eRegL src2 ) %{ | |
3046 // PUSH src1.hi | |
3047 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src1$$reg) ); | |
3048 // PUSH src1.lo | |
3049 emit_opcode(cbuf, 0x50+$src1$$reg ); | |
3050 // PUSH src2.hi | |
3051 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src2$$reg) ); | |
3052 // PUSH src2.lo | |
3053 emit_opcode(cbuf, 0x50+$src2$$reg ); | |
3054 // CALL directly to the runtime | |
3055 cbuf.set_inst_mark(); | |
3056 emit_opcode(cbuf,0xE8); // Call into runtime | |
3057 emit_d32_reloc(cbuf, (CAST_FROM_FN_PTR(address, SharedRuntime::lrem ) - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
3058 // Restore stack | |
3059 emit_opcode(cbuf, 0x83); // add SP, #framesize | |
3060 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
3061 emit_d8(cbuf, 4*4); | |
3062 %} | |
3063 | |
3064 enc_class long_cmp_flags0( eRegL src, eRegI tmp ) %{ | |
3065 // MOV $tmp,$src.lo | |
3066 emit_opcode(cbuf, 0x8B); | |
3067 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); | |
3068 // OR $tmp,$src.hi | |
3069 emit_opcode(cbuf, 0x0B); | |
3070 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg)); | |
3071 %} | |
3072 | |
3073 enc_class long_cmp_flags1( eRegL src1, eRegL src2 ) %{ | |
3074 // CMP $src1.lo,$src2.lo | |
3075 emit_opcode( cbuf, 0x3B ); | |
3076 emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); | |
3077 // JNE,s skip | |
3078 emit_cc(cbuf, 0x70, 0x5); | |
3079 emit_d8(cbuf,2); | |
3080 // CMP $src1.hi,$src2.hi | |
3081 emit_opcode( cbuf, 0x3B ); | |
3082 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($src1$$reg), HIGH_FROM_LOW($src2$$reg) ); | |
3083 %} | |
3084 | |
3085 enc_class long_cmp_flags2( eRegL src1, eRegL src2, eRegI tmp ) %{ | |
3086 // CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits | |
3087 emit_opcode( cbuf, 0x3B ); | |
3088 emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); | |
3089 // MOV $tmp,$src1.hi | |
3090 emit_opcode( cbuf, 0x8B ); | |
3091 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src1$$reg) ); | |
3092 // SBB $tmp,$src2.hi\t! Compute flags for long compare | |
3093 emit_opcode( cbuf, 0x1B ); | |
3094 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src2$$reg) ); | |
3095 %} | |
3096 | |
3097 enc_class long_cmp_flags3( eRegL src, eRegI tmp ) %{ | |
3098 // XOR $tmp,$tmp | |
3099 emit_opcode(cbuf,0x33); // XOR | |
3100 emit_rm(cbuf,0x3, $tmp$$reg, $tmp$$reg); | |
3101 // CMP $tmp,$src.lo | |
3102 emit_opcode( cbuf, 0x3B ); | |
3103 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg ); | |
3104 // SBB $tmp,$src.hi | |
3105 emit_opcode( cbuf, 0x1B ); | |
3106 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg) ); | |
3107 %} | |
3108 | |
3109 // Sniff, sniff... smells like Gnu Superoptimizer | |
3110 enc_class neg_long( eRegL dst ) %{ | |
3111 emit_opcode(cbuf,0xF7); // NEG hi | |
3112 emit_rm (cbuf,0x3, 0x3, HIGH_FROM_LOW($dst$$reg)); | |
3113 emit_opcode(cbuf,0xF7); // NEG lo | |
3114 emit_rm (cbuf,0x3, 0x3, $dst$$reg ); | |
3115 emit_opcode(cbuf,0x83); // SBB hi,0 | |
3116 emit_rm (cbuf,0x3, 0x3, HIGH_FROM_LOW($dst$$reg)); | |
3117 emit_d8 (cbuf,0 ); | |
3118 %} | |
3119 | |
3120 enc_class movq_ld(regXD dst, memory mem) %{ | |
3121 MacroAssembler _masm(&cbuf); | |
3122 Address madr = Address::make_raw($mem$$base, $mem$$index, $mem$$scale, $mem$$disp); | |
3123 __ movq(as_XMMRegister($dst$$reg), madr); | |
3124 %} | |
3125 | |
3126 enc_class movq_st(memory mem, regXD src) %{ | |
3127 MacroAssembler _masm(&cbuf); | |
3128 Address madr = Address::make_raw($mem$$base, $mem$$index, $mem$$scale, $mem$$disp); | |
3129 __ movq(madr, as_XMMRegister($src$$reg)); | |
3130 %} | |
3131 | |
3132 enc_class pshufd_8x8(regX dst, regX src) %{ | |
3133 MacroAssembler _masm(&cbuf); | |
3134 | |
3135 encode_CopyXD(cbuf, $dst$$reg, $src$$reg); | |
3136 __ punpcklbw(as_XMMRegister($dst$$reg), as_XMMRegister($dst$$reg)); | |
3137 __ pshuflw(as_XMMRegister($dst$$reg), as_XMMRegister($dst$$reg), 0x00); | |
3138 %} | |
3139 | |
3140 enc_class pshufd_4x16(regX dst, regX src) %{ | |
3141 MacroAssembler _masm(&cbuf); | |
3142 | |
3143 __ pshuflw(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg), 0x00); | |
3144 %} | |
3145 | |
3146 enc_class pshufd(regXD dst, regXD src, int mode) %{ | |
3147 MacroAssembler _masm(&cbuf); | |
3148 | |
3149 __ pshufd(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg), $mode); | |
3150 %} | |
3151 | |
3152 enc_class pxor(regXD dst, regXD src) %{ | |
3153 MacroAssembler _masm(&cbuf); | |
3154 | |
3155 __ pxor(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg)); | |
3156 %} | |
3157 | |
3158 enc_class mov_i2x(regXD dst, eRegI src) %{ | |
3159 MacroAssembler _masm(&cbuf); | |
3160 | |
3161 __ movd(as_XMMRegister($dst$$reg), as_Register($src$$reg)); | |
3162 %} | |
3163 | |
3164 | |
3165 // Because the transitions from emitted code to the runtime | |
3166 // monitorenter/exit helper stubs are so slow it's critical that | |
3167 // we inline both the stack-locking fast-path and the inflated fast path. | |
3168 // | |
3169 // See also: cmpFastLock and cmpFastUnlock. | |
3170 // | |
3171 // What follows is a specialized inline transliteration of the code | |
3172 // in slow_enter() and slow_exit(). If we're concerned about I$ bloat | |
3173 // another option would be to emit TrySlowEnter and TrySlowExit methods | |
3174 // at startup-time. These methods would accept arguments as | |
3175 // (rax,=Obj, rbx=Self, rcx=box, rdx=Scratch) and return success-failure | |
3176 // indications in the icc.ZFlag. Fast_Lock and Fast_Unlock would simply | |
3177 // marshal the arguments and emit calls to TrySlowEnter and TrySlowExit. | |
3178 // In practice, however, the # of lock sites is bounded and is usually small. | |
3179 // Besides the call overhead, TrySlowEnter and TrySlowExit might suffer | |
3180 // if the processor uses simple bimodal branch predictors keyed by EIP | |
3181 // Since the helper routines would be called from multiple synchronization | |
3182 // sites. | |
3183 // | |
3184 // An even better approach would be write "MonitorEnter()" and "MonitorExit()" | |
3185 // in java - using j.u.c and unsafe - and just bind the lock and unlock sites | |
3186 // to those specialized methods. That'd give us a mostly platform-independent | |
3187 // implementation that the JITs could optimize and inline at their pleasure. | |
3188 // Done correctly, the only time we'd need to cross to native could would be | |
3189 // to park() or unpark() threads. We'd also need a few more unsafe operators | |
3190 // to (a) prevent compiler-JIT reordering of non-volatile accesses, and | |
3191 // (b) explicit barriers or fence operations. | |
3192 // | |
3193 // TODO: | |
3194 // | |
3195 // * Arrange for C2 to pass "Self" into Fast_Lock and Fast_Unlock in one of the registers (scr). | |
3196 // This avoids manifesting the Self pointer in the Fast_Lock and Fast_Unlock terminals. | |
3197 // Given TLAB allocation, Self is usually manifested in a register, so passing it into | |
3198 // the lock operators would typically be faster than reifying Self. | |
3199 // | |
3200 // * Ideally I'd define the primitives as: | |
3201 // fast_lock (nax Obj, nax box, EAX tmp, nax scr) where box, tmp and scr are KILLED. | |
3202 // fast_unlock (nax Obj, EAX box, nax tmp) where box and tmp are KILLED | |
3203 // Unfortunately ADLC bugs prevent us from expressing the ideal form. | |
3204 // Instead, we're stuck with a rather awkward and brittle register assignments below. | |
3205 // Furthermore the register assignments are overconstrained, possibly resulting in | |
3206 // sub-optimal code near the synchronization site. | |
3207 // | |
3208 // * Eliminate the sp-proximity tests and just use "== Self" tests instead. | |
3209 // Alternately, use a better sp-proximity test. | |
3210 // | |
3211 // * Currently ObjectMonitor._Owner can hold either an sp value or a (THREAD *) value. | |
3212 // Either one is sufficient to uniquely identify a thread. | |
3213 // TODO: eliminate use of sp in _owner and use get_thread(tr) instead. | |
3214 // | |
3215 // * Intrinsify notify() and notifyAll() for the common cases where the | |
3216 // object is locked by the calling thread but the waitlist is empty. | |
3217 // avoid the expensive JNI call to JVM_Notify() and JVM_NotifyAll(). | |
3218 // | |
3219 // * use jccb and jmpb instead of jcc and jmp to improve code density. | |
3220 // But beware of excessive branch density on AMD Opterons. | |
3221 // | |
3222 // * Both Fast_Lock and Fast_Unlock set the ICC.ZF to indicate success | |
3223 // or failure of the fast-path. If the fast-path fails then we pass | |
3224 // control to the slow-path, typically in C. In Fast_Lock and | |
3225 // Fast_Unlock we often branch to DONE_LABEL, just to find that C2 | |
3226 // will emit a conditional branch immediately after the node. | |
3227 // So we have branches to branches and lots of ICC.ZF games. | |
3228 // Instead, it might be better to have C2 pass a "FailureLabel" | |
3229 // into Fast_Lock and Fast_Unlock. In the case of success, control | |
3230 // will drop through the node. ICC.ZF is undefined at exit. | |
3231 // In the case of failure, the node will branch directly to the | |
3232 // FailureLabel | |
3233 | |
3234 | |
3235 // obj: object to lock | |
3236 // box: on-stack box address (displaced header location) - KILLED | |
3237 // rax,: tmp -- KILLED | |
3238 // scr: tmp -- KILLED | |
3239 enc_class Fast_Lock( eRegP obj, eRegP box, eAXRegI tmp, eRegP scr ) %{ | |
3240 | |
3241 Register objReg = as_Register($obj$$reg); | |
3242 Register boxReg = as_Register($box$$reg); | |
3243 Register tmpReg = as_Register($tmp$$reg); | |
3244 Register scrReg = as_Register($scr$$reg); | |
3245 | |
3246 // Ensure the register assignents are disjoint | |
3247 guarantee (objReg != boxReg, "") ; | |
3248 guarantee (objReg != tmpReg, "") ; | |
3249 guarantee (objReg != scrReg, "") ; | |
3250 guarantee (boxReg != tmpReg, "") ; | |
3251 guarantee (boxReg != scrReg, "") ; | |
3252 guarantee (tmpReg == as_Register(EAX_enc), "") ; | |
3253 | |
3254 MacroAssembler masm(&cbuf); | |
3255 | |
3256 if (_counters != NULL) { | |
3257 masm.atomic_incl(ExternalAddress((address) _counters->total_entry_count_addr())); | |
3258 } | |
3259 if (EmitSync & 1) { | |
3260 // set box->dhw = unused_mark (3) | |
3261 // Force all sync thru slow-path: slow_enter() and slow_exit() | |
3262 masm.movl (Address(boxReg, 0), intptr_t(markOopDesc::unused_mark())) ; | |
3263 masm.cmpl (rsp, 0) ; | |
3264 } else | |
3265 if (EmitSync & 2) { | |
3266 Label DONE_LABEL ; | |
3267 if (UseBiasedLocking) { | |
3268 // Note: tmpReg maps to the swap_reg argument and scrReg to the tmp_reg argument. | |
3269 masm.biased_locking_enter(boxReg, objReg, tmpReg, scrReg, false, DONE_LABEL, NULL, _counters); | |
3270 } | |
3271 | |
3272 masm.movl (tmpReg, Address(objReg, 0)) ; // fetch markword | |
3273 masm.orl (tmpReg, 0x1); | |
3274 masm.movl (Address(boxReg, 0), tmpReg); // Anticipate successful CAS | |
3275 if (os::is_MP()) { masm.lock(); } | |
3276 masm.cmpxchg(boxReg, Address(objReg, 0)); // Updates tmpReg | |
3277 masm.jcc(Assembler::equal, DONE_LABEL); | |
3278 // Recursive locking | |
3279 masm.subl(tmpReg, rsp); | |
3280 masm.andl(tmpReg, 0xFFFFF003 ); | |
3281 masm.movl(Address(boxReg, 0), tmpReg); | |
3282 masm.bind(DONE_LABEL) ; | |
3283 } else { | |
3284 // Possible cases that we'll encounter in fast_lock | |
3285 // ------------------------------------------------ | |
3286 // * Inflated | |
3287 // -- unlocked | |
3288 // -- Locked | |
3289 // = by self | |
3290 // = by other | |
3291 // * biased | |
3292 // -- by Self | |
3293 // -- by other | |
3294 // * neutral | |
3295 // * stack-locked | |
3296 // -- by self | |
3297 // = sp-proximity test hits | |
3298 // = sp-proximity test generates false-negative | |
3299 // -- by other | |
3300 // | |
3301 | |
3302 Label IsInflated, DONE_LABEL, PopDone ; | |
3303 | |
3304 // TODO: optimize away redundant LDs of obj->mark and improve the markword triage | |
3305 // order to reduce the number of conditional branches in the most common cases. | |
3306 // Beware -- there's a subtle invariant that fetch of the markword | |
3307 // at [FETCH], below, will never observe a biased encoding (*101b). | |
3308 // If this invariant is not held we risk exclusion (safety) failure. | |
3309 if (UseBiasedLocking) { | |
3310 masm.biased_locking_enter(boxReg, objReg, tmpReg, scrReg, false, DONE_LABEL, NULL, _counters); | |
3311 } | |
3312 | |
3313 masm.movl (tmpReg, Address(objReg, 0)) ; // [FETCH] | |
3314 masm.testl (tmpReg, 0x02) ; // Inflated v (Stack-locked or neutral) | |
3315 masm.jccb (Assembler::notZero, IsInflated) ; | |
3316 | |
3317 // Attempt stack-locking ... | |
3318 masm.orl (tmpReg, 0x1); | |
3319 masm.movl (Address(boxReg, 0), tmpReg); // Anticipate successful CAS | |
3320 if (os::is_MP()) { masm.lock(); } | |
3321 masm.cmpxchg(boxReg, Address(objReg, 0)); // Updates tmpReg | |
3322 if (_counters != NULL) { | |
3323 masm.cond_inc32(Assembler::equal, | |
3324 ExternalAddress((address)_counters->fast_path_entry_count_addr())); | |
3325 } | |
3326 masm.jccb (Assembler::equal, DONE_LABEL); | |
3327 | |
3328 // Recursive locking | |
3329 masm.subl(tmpReg, rsp); | |
3330 masm.andl(tmpReg, 0xFFFFF003 ); | |
3331 masm.movl(Address(boxReg, 0), tmpReg); | |
3332 if (_counters != NULL) { | |
3333 masm.cond_inc32(Assembler::equal, | |
3334 ExternalAddress((address)_counters->fast_path_entry_count_addr())); | |
3335 } | |
3336 masm.jmp (DONE_LABEL) ; | |
3337 | |
3338 masm.bind (IsInflated) ; | |
3339 | |
3340 // The object is inflated. | |
3341 // | |
3342 // TODO-FIXME: eliminate the ugly use of manifest constants: | |
3343 // Use markOopDesc::monitor_value instead of "2". | |
3344 // use markOop::unused_mark() instead of "3". | |
3345 // The tmpReg value is an objectMonitor reference ORed with | |
3346 // markOopDesc::monitor_value (2). We can either convert tmpReg to an | |
3347 // objectmonitor pointer by masking off the "2" bit or we can just | |
3348 // use tmpReg as an objectmonitor pointer but bias the objectmonitor | |
3349 // field offsets with "-2" to compensate for and annul the low-order tag bit. | |
3350 // | |
3351 // I use the latter as it avoids AGI stalls. | |
3352 // As such, we write "mov r, [tmpReg+OFFSETOF(Owner)-2]" | |
3353 // instead of "mov r, [tmpReg+OFFSETOF(Owner)]". | |
3354 // | |
3355 #define OFFSET_SKEWED(f) ((ObjectMonitor::f ## _offset_in_bytes())-2) | |
3356 | |
3357 // boxReg refers to the on-stack BasicLock in the current frame. | |
3358 // We'd like to write: | |
3359 // set box->_displaced_header = markOop::unused_mark(). Any non-0 value suffices. | |
3360 // This is convenient but results a ST-before-CAS penalty. The following CAS suffers | |
3361 // additional latency as we have another ST in the store buffer that must drain. | |
3362 | |
3363 if (EmitSync & 8192) { | |
3364 masm.movl (Address(boxReg, 0), 3) ; // results in ST-before-CAS penalty | |
3365 masm.get_thread (scrReg) ; | |
3366 masm.movl (boxReg, tmpReg); // consider: LEA box, [tmp-2] | |
3367 masm.movl (tmpReg, 0); // consider: xor vs mov | |
3368 if (os::is_MP()) { masm.lock(); } | |
3369 masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
3370 } else | |
3371 if ((EmitSync & 128) == 0) { // avoid ST-before-CAS | |
3372 masm.movl (scrReg, boxReg) ; | |
3373 masm.movl (boxReg, tmpReg); // consider: LEA box, [tmp-2] | |
3374 | |
3375 // Using a prefetchw helps avoid later RTS->RTO upgrades and cache probes | |
3376 if ((EmitSync & 2048) && VM_Version::supports_3dnow() && os::is_MP()) { | |
3377 // prefetchw [eax + Offset(_owner)-2] | |
3378 masm.emit_raw (0x0F) ; | |
3379 masm.emit_raw (0x0D) ; | |
3380 masm.emit_raw (0x48) ; | |
3381 masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; | |
3382 } | |
3383 | |
3384 if ((EmitSync & 64) == 0) { | |
3385 // Optimistic form: consider XORL tmpReg,tmpReg | |
3386 masm.movl (tmpReg, 0 ) ; | |
3387 } else { | |
3388 // Can suffer RTS->RTO upgrades on shared or cold $ lines | |
3389 // Test-And-CAS instead of CAS | |
3390 masm.movl (tmpReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; // rax, = m->_owner | |
3391 masm.testl (tmpReg, tmpReg) ; // Locked ? | |
3392 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
3393 } | |
3394 | |
3395 // Appears unlocked - try to swing _owner from null to non-null. | |
3396 // Ideally, I'd manifest "Self" with get_thread and then attempt | |
3397 // to CAS the register containing Self into m->Owner. | |
3398 // But we don't have enough registers, so instead we can either try to CAS | |
3399 // rsp or the address of the box (in scr) into &m->owner. If the CAS succeeds | |
3400 // we later store "Self" into m->Owner. Transiently storing a stack address | |
3401 // (rsp or the address of the box) into m->owner is harmless. | |
3402 // Invariant: tmpReg == 0. tmpReg is EAX which is the implicit cmpxchg comparand. | |
3403 if (os::is_MP()) { masm.lock(); } | |
3404 masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
3405 masm.movl (Address(scrReg, 0), 3) ; // box->_displaced_header = 3 | |
3406 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
3407 masm.get_thread (scrReg) ; // beware: clobbers ICCs | |
3408 masm.movl (Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2), scrReg) ; | |
3409 masm.xorl (boxReg, boxReg) ; // set icc.ZFlag = 1 to indicate success | |
3410 | |
3411 // If the CAS fails we can either retry or pass control to the slow-path. | |
3412 // We use the latter tactic. | |
3413 // Pass the CAS result in the icc.ZFlag into DONE_LABEL | |
3414 // If the CAS was successful ... | |
3415 // Self has acquired the lock | |
3416 // Invariant: m->_recursions should already be 0, so we don't need to explicitly set it. | |
3417 // Intentional fall-through into DONE_LABEL ... | |
3418 } else { | |
3419 masm.movl (Address(boxReg, 0), 3) ; // results in ST-before-CAS penalty | |
3420 masm.movl (boxReg, tmpReg) ; | |
3421 | |
3422 // Using a prefetchw helps avoid later RTS->RTO upgrades and cache probes | |
3423 if ((EmitSync & 2048) && VM_Version::supports_3dnow() && os::is_MP()) { | |
3424 // prefetchw [eax + Offset(_owner)-2] | |
3425 masm.emit_raw (0x0F) ; | |
3426 masm.emit_raw (0x0D) ; | |
3427 masm.emit_raw (0x48) ; | |
3428 masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; | |
3429 } | |
3430 | |
3431 if ((EmitSync & 64) == 0) { | |
3432 // Optimistic form | |
3433 masm.xorl (tmpReg, tmpReg) ; | |
3434 } else { | |
3435 // Can suffer RTS->RTO upgrades on shared or cold $ lines | |
3436 masm.movl (tmpReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; // rax, = m->_owner | |
3437 masm.testl (tmpReg, tmpReg) ; // Locked ? | |
3438 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
3439 } | |
3440 | |
3441 // Appears unlocked - try to swing _owner from null to non-null. | |
3442 // Use either "Self" (in scr) or rsp as thread identity in _owner. | |
3443 // Invariant: tmpReg == 0. tmpReg is EAX which is the implicit cmpxchg comparand. | |
3444 masm.get_thread (scrReg) ; | |
3445 if (os::is_MP()) { masm.lock(); } | |
3446 masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
3447 | |
3448 // If the CAS fails we can either retry or pass control to the slow-path. | |
3449 // We use the latter tactic. | |
3450 // Pass the CAS result in the icc.ZFlag into DONE_LABEL | |
3451 // If the CAS was successful ... | |
3452 // Self has acquired the lock | |
3453 // Invariant: m->_recursions should already be 0, so we don't need to explicitly set it. | |
3454 // Intentional fall-through into DONE_LABEL ... | |
3455 } | |
3456 | |
3457 // DONE_LABEL is a hot target - we'd really like to place it at the | |
3458 // start of cache line by padding with NOPs. | |
3459 // See the AMD and Intel software optimization manuals for the | |
3460 // most efficient "long" NOP encodings. | |
3461 // Unfortunately none of our alignment mechanisms suffice. | |
3462 masm.bind(DONE_LABEL); | |
3463 | |
3464 // Avoid branch-to-branch on AMD processors | |
3465 // This appears to be superstition. | |
3466 if (EmitSync & 32) masm.nop() ; | |
3467 | |
3468 | |
3469 // At DONE_LABEL the icc ZFlag is set as follows ... | |
3470 // Fast_Unlock uses the same protocol. | |
3471 // ZFlag == 1 -> Success | |
3472 // ZFlag == 0 -> Failure - force control through the slow-path | |
3473 } | |
3474 %} | |
3475 | |
3476 // obj: object to unlock | |
3477 // box: box address (displaced header location), killed. Must be EAX. | |
3478 // rbx,: killed tmp; cannot be obj nor box. | |
3479 // | |
3480 // Some commentary on balanced locking: | |
3481 // | |
3482 // Fast_Lock and Fast_Unlock are emitted only for provably balanced lock sites. | |
3483 // Methods that don't have provably balanced locking are forced to run in the | |
3484 // interpreter - such methods won't be compiled to use fast_lock and fast_unlock. | |
3485 // The interpreter provides two properties: | |
3486 // I1: At return-time the interpreter automatically and quietly unlocks any | |
3487 // objects acquired the current activation (frame). Recall that the | |
3488 // interpreter maintains an on-stack list of locks currently held by | |
3489 // a frame. | |
3490 // I2: If a method attempts to unlock an object that is not held by the | |
3491 // the frame the interpreter throws IMSX. | |
3492 // | |
3493 // Lets say A(), which has provably balanced locking, acquires O and then calls B(). | |
3494 // B() doesn't have provably balanced locking so it runs in the interpreter. | |
3495 // Control returns to A() and A() unlocks O. By I1 and I2, above, we know that O | |
3496 // is still locked by A(). | |
3497 // | |
3498 // The only other source of unbalanced locking would be JNI. The "Java Native Interface: | |
3499 // Programmer's Guide and Specification" claims that an object locked by jni_monitorenter | |
3500 // should not be unlocked by "normal" java-level locking and vice-versa. The specification | |
3501 // doesn't specify what will occur if a program engages in such mixed-mode locking, however. | |
3502 | |
3503 enc_class Fast_Unlock( nabxRegP obj, eAXRegP box, eRegP tmp) %{ | |
3504 | |
3505 Register objReg = as_Register($obj$$reg); | |
3506 Register boxReg = as_Register($box$$reg); | |
3507 Register tmpReg = as_Register($tmp$$reg); | |
3508 | |
3509 guarantee (objReg != boxReg, "") ; | |
3510 guarantee (objReg != tmpReg, "") ; | |
3511 guarantee (boxReg != tmpReg, "") ; | |
3512 guarantee (boxReg == as_Register(EAX_enc), "") ; | |
3513 MacroAssembler masm(&cbuf); | |
3514 | |
3515 if (EmitSync & 4) { | |
3516 // Disable - inhibit all inlining. Force control through the slow-path | |
3517 masm.cmpl (rsp, 0) ; | |
3518 } else | |
3519 if (EmitSync & 8) { | |
3520 Label DONE_LABEL ; | |
3521 if (UseBiasedLocking) { | |
3522 masm.biased_locking_exit(objReg, tmpReg, DONE_LABEL); | |
3523 } | |
3524 // classic stack-locking code ... | |
3525 masm.movl (tmpReg, Address(boxReg, 0)) ; | |
3526 masm.testl (tmpReg, tmpReg) ; | |
3527 masm.jcc (Assembler::zero, DONE_LABEL) ; | |
3528 if (os::is_MP()) { masm.lock(); } | |
3529 masm.cmpxchg(tmpReg, Address(objReg, 0)); // Uses EAX which is box | |
3530 masm.bind(DONE_LABEL); | |
3531 } else { | |
3532 Label DONE_LABEL, Stacked, CheckSucc, Inflated ; | |
3533 | |
3534 // Critically, the biased locking test must have precedence over | |
3535 // and appear before the (box->dhw == 0) recursive stack-lock test. | |
3536 if (UseBiasedLocking) { | |
3537 masm.biased_locking_exit(objReg, tmpReg, DONE_LABEL); | |
3538 } | |
3539 | |
3540 masm.cmpl (Address(boxReg, 0), 0) ; // Examine the displaced header | |
3541 masm.movl (tmpReg, Address(objReg, 0)) ; // Examine the object's markword | |
3542 masm.jccb (Assembler::zero, DONE_LABEL) ; // 0 indicates recursive stack-lock | |
3543 | |
3544 masm.testl (tmpReg, 0x02) ; // Inflated? | |
3545 masm.jccb (Assembler::zero, Stacked) ; | |
3546 | |
3547 masm.bind (Inflated) ; | |
3548 // It's inflated. | |
3549 // Despite our balanced locking property we still check that m->_owner == Self | |
3550 // as java routines or native JNI code called by this thread might | |
3551 // have released the lock. | |
3552 // Refer to the comments in synchronizer.cpp for how we might encode extra | |
3553 // state in _succ so we can avoid fetching EntryList|cxq. | |
3554 // | |
3555 // I'd like to add more cases in fast_lock() and fast_unlock() -- | |
3556 // such as recursive enter and exit -- but we have to be wary of | |
3557 // I$ bloat, T$ effects and BP$ effects. | |
3558 // | |
3559 // If there's no contention try a 1-0 exit. That is, exit without | |
3560 // a costly MEMBAR or CAS. See synchronizer.cpp for details on how | |
3561 // we detect and recover from the race that the 1-0 exit admits. | |
3562 // | |
3563 // Conceptually Fast_Unlock() must execute a STST|LDST "release" barrier | |
3564 // before it STs null into _owner, releasing the lock. Updates | |
3565 // to data protected by the critical section must be visible before | |
3566 // we drop the lock (and thus before any other thread could acquire | |
3567 // the lock and observe the fields protected by the lock). | |
3568 // IA32's memory-model is SPO, so STs are ordered with respect to | |
3569 // each other and there's no need for an explicit barrier (fence). | |
3570 // See also http://gee.cs.oswego.edu/dl/jmm/cookbook.html. | |
3571 | |
3572 masm.get_thread (boxReg) ; | |
3573 if ((EmitSync & 4096) && VM_Version::supports_3dnow() && os::is_MP()) { | |
3574 // prefetchw [ebx + Offset(_owner)-2] | |
3575 masm.emit_raw (0x0F) ; | |
3576 masm.emit_raw (0x0D) ; | |
3577 masm.emit_raw (0x4B) ; | |
3578 masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; | |
3579 } | |
3580 | |
3581 // Note that we could employ various encoding schemes to reduce | |
3582 // the number of loads below (currently 4) to just 2 or 3. | |
3583 // Refer to the comments in synchronizer.cpp. | |
3584 // In practice the chain of fetches doesn't seem to impact performance, however. | |
3585 if ((EmitSync & 65536) == 0 && (EmitSync & 256)) { | |
3586 // Attempt to reduce branch density - AMD's branch predictor. | |
3587 masm.xorl (boxReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
3588 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::recursions_offset_in_bytes()-2)) ; | |
3589 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::EntryList_offset_in_bytes()-2)) ; | |
3590 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::cxq_offset_in_bytes()-2)) ; | |
3591 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
3592 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; | |
3593 masm.jmpb (DONE_LABEL) ; | |
3594 } else { | |
3595 masm.xorl (boxReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
3596 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::recursions_offset_in_bytes()-2)) ; | |
3597 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
3598 masm.movl (boxReg, Address (tmpReg, ObjectMonitor::EntryList_offset_in_bytes()-2)) ; | |
3599 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::cxq_offset_in_bytes()-2)) ; | |
3600 masm.jccb (Assembler::notZero, CheckSucc) ; | |
3601 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; | |
3602 masm.jmpb (DONE_LABEL) ; | |
3603 } | |
3604 | |
3605 // The Following code fragment (EmitSync & 65536) improves the performance of | |
3606 // contended applications and contended synchronization microbenchmarks. | |
3607 // Unfortunately the emission of the code - even though not executed - causes regressions | |
3608 // in scimark and jetstream, evidently because of $ effects. Replacing the code | |
3609 // with an equal number of never-executed NOPs results in the same regression. | |
3610 // We leave it off by default. | |
3611 | |
3612 if ((EmitSync & 65536) != 0) { | |
3613 Label LSuccess, LGoSlowPath ; | |
3614 | |
3615 masm.bind (CheckSucc) ; | |
3616 | |
3617 // Optional pre-test ... it's safe to elide this | |
3618 if ((EmitSync & 16) == 0) { | |
3619 masm.cmpl (Address (tmpReg, ObjectMonitor::succ_offset_in_bytes()-2), 0) ; | |
3620 masm.jccb (Assembler::zero, LGoSlowPath) ; | |
3621 } | |
3622 | |
3623 // We have a classic Dekker-style idiom: | |
3624 // ST m->_owner = 0 ; MEMBAR; LD m->_succ | |
3625 // There are a number of ways to implement the barrier: | |
3626 // (1) lock:andl &m->_owner, 0 | |
3627 // is fast, but mask doesn't currently support the "ANDL M,IMM32" form. | |
3628 // LOCK: ANDL [ebx+Offset(_Owner)-2], 0 | |
3629 // Encodes as 81 31 OFF32 IMM32 or 83 63 OFF8 IMM8 | |
3630 // (2) If supported, an explicit MFENCE is appealing. | |
3631 // In older IA32 processors MFENCE is slower than lock:add or xchg | |
3632 // particularly if the write-buffer is full as might be the case if | |
3633 // if stores closely precede the fence or fence-equivalent instruction. | |
3634 // In more modern implementations MFENCE appears faster, however. | |
3635 // (3) In lieu of an explicit fence, use lock:addl to the top-of-stack | |
3636 // The $lines underlying the top-of-stack should be in M-state. | |
3637 // The locked add instruction is serializing, of course. | |
3638 // (4) Use xchg, which is serializing | |
3639 // mov boxReg, 0; xchgl boxReg, [tmpReg + Offset(_owner)-2] also works | |
3640 // (5) ST m->_owner = 0 and then execute lock:orl &m->_succ, 0. | |
3641 // The integer condition codes will tell us if succ was 0. | |
3642 // Since _succ and _owner should reside in the same $line and | |
3643 // we just stored into _owner, it's likely that the $line | |
3644 // remains in M-state for the lock:orl. | |
3645 // | |
3646 // We currently use (3), although it's likely that switching to (2) | |
3647 // is correct for the future. | |
3648 | |
3649 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; | |
3650 if (os::is_MP()) { | |
3651 if (VM_Version::supports_sse2() && 1 == FenceInstruction) { | |
3652 masm.emit_raw (0x0F) ; // MFENCE ... | |
3653 masm.emit_raw (0xAE) ; | |
3654 masm.emit_raw (0xF0) ; | |
3655 } else { | |
3656 masm.lock () ; masm.addl (Address(rsp, 0), 0) ; | |
3657 } | |
3658 } | |
3659 // Ratify _succ remains non-null | |
3660 masm.cmpl (Address (tmpReg, ObjectMonitor::succ_offset_in_bytes()-2), 0) ; | |
3661 masm.jccb (Assembler::notZero, LSuccess) ; | |
3662 | |
3663 masm.xorl (boxReg, boxReg) ; // box is really EAX | |
3664 if (os::is_MP()) { masm.lock(); } | |
3665 masm.cmpxchg(rsp, Address(tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)); | |
3666 masm.jccb (Assembler::notEqual, LSuccess) ; | |
3667 // Since we're low on registers we installed rsp as a placeholding in _owner. | |
3668 // Now install Self over rsp. This is safe as we're transitioning from | |
3669 // non-null to non=null | |
3670 masm.get_thread (boxReg) ; | |
3671 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), boxReg) ; | |
3672 // Intentional fall-through into LGoSlowPath ... | |
3673 | |
3674 masm.bind (LGoSlowPath) ; | |
3675 masm.orl (boxReg, 1) ; // set ICC.ZF=0 to indicate failure | |
3676 masm.jmpb (DONE_LABEL) ; | |
3677 | |
3678 masm.bind (LSuccess) ; | |
3679 masm.xorl (boxReg, boxReg) ; // set ICC.ZF=1 to indicate success | |
3680 masm.jmpb (DONE_LABEL) ; | |
3681 } | |
3682 | |
3683 masm.bind (Stacked) ; | |
3684 // It's not inflated and it's not recursively stack-locked and it's not biased. | |
3685 // It must be stack-locked. | |
3686 // Try to reset the header to displaced header. | |
3687 // The "box" value on the stack is stable, so we can reload | |
3688 // and be assured we observe the same value as above. | |
3689 masm.movl (tmpReg, Address(boxReg, 0)) ; | |
3690 if (os::is_MP()) { masm.lock(); } | |
3691 masm.cmpxchg(tmpReg, Address(objReg, 0)); // Uses EAX which is box | |
3692 // Intention fall-thru into DONE_LABEL | |
3693 | |
3694 | |
3695 // DONE_LABEL is a hot target - we'd really like to place it at the | |
3696 // start of cache line by padding with NOPs. | |
3697 // See the AMD and Intel software optimization manuals for the | |
3698 // most efficient "long" NOP encodings. | |
3699 // Unfortunately none of our alignment mechanisms suffice. | |
3700 if ((EmitSync & 65536) == 0) { | |
3701 masm.bind (CheckSucc) ; | |
3702 } | |
3703 masm.bind(DONE_LABEL); | |
3704 | |
3705 // Avoid branch to branch on AMD processors | |
3706 if (EmitSync & 32768) { masm.nop() ; } | |
3707 } | |
3708 %} | |
3709 | |
3710 enc_class enc_String_Compare() %{ | |
3711 Label ECX_GOOD_LABEL, LENGTH_DIFF_LABEL, | |
3712 POP_LABEL, DONE_LABEL, CONT_LABEL, | |
3713 WHILE_HEAD_LABEL; | |
3714 MacroAssembler masm(&cbuf); | |
3715 | |
3716 // Get the first character position in both strings | |
3717 // [8] char array, [12] offset, [16] count | |
3718 int value_offset = java_lang_String::value_offset_in_bytes(); | |
3719 int offset_offset = java_lang_String::offset_offset_in_bytes(); | |
3720 int count_offset = java_lang_String::count_offset_in_bytes(); | |
3721 int base_offset = arrayOopDesc::base_offset_in_bytes(T_CHAR); | |
3722 | |
3723 masm.movl(rax, Address(rsi, value_offset)); | |
3724 masm.movl(rcx, Address(rsi, offset_offset)); | |
3725 masm.leal(rax, Address(rax, rcx, Address::times_2, base_offset)); | |
3726 masm.movl(rbx, Address(rdi, value_offset)); | |
3727 masm.movl(rcx, Address(rdi, offset_offset)); | |
3728 masm.leal(rbx, Address(rbx, rcx, Address::times_2, base_offset)); | |
3729 | |
3730 // Compute the minimum of the string lengths(rsi) and the | |
3731 // difference of the string lengths (stack) | |
3732 | |
3733 | |
3734 if (VM_Version::supports_cmov()) { | |
3735 masm.movl(rdi, Address(rdi, count_offset)); | |
3736 masm.movl(rsi, Address(rsi, count_offset)); | |
3737 masm.movl(rcx, rdi); | |
3738 masm.subl(rdi, rsi); | |
3739 masm.pushl(rdi); | |
3740 masm.cmovl(Assembler::lessEqual, rsi, rcx); | |
3741 } else { | |
3742 masm.movl(rdi, Address(rdi, count_offset)); | |
3743 masm.movl(rcx, Address(rsi, count_offset)); | |
3744 masm.movl(rsi, rdi); | |
3745 masm.subl(rdi, rcx); | |
3746 masm.pushl(rdi); | |
3747 masm.jcc(Assembler::lessEqual, ECX_GOOD_LABEL); | |
3748 masm.movl(rsi, rcx); | |
3749 // rsi holds min, rcx is unused | |
3750 } | |
3751 | |
3752 // Is the minimum length zero? | |
3753 masm.bind(ECX_GOOD_LABEL); | |
3754 masm.testl(rsi, rsi); | |
3755 masm.jcc(Assembler::zero, LENGTH_DIFF_LABEL); | |
3756 | |
3757 // Load first characters | |
3758 masm.load_unsigned_word(rcx, Address(rbx, 0)); | |
3759 masm.load_unsigned_word(rdi, Address(rax, 0)); | |
3760 | |
3761 // Compare first characters | |
3762 masm.subl(rcx, rdi); | |
3763 masm.jcc(Assembler::notZero, POP_LABEL); | |
3764 masm.decrement(rsi); | |
3765 masm.jcc(Assembler::zero, LENGTH_DIFF_LABEL); | |
3766 | |
3767 { | |
3768 // Check after comparing first character to see if strings are equivalent | |
3769 Label LSkip2; | |
3770 // Check if the strings start at same location | |
3771 masm.cmpl(rbx,rax); | |
3772 masm.jcc(Assembler::notEqual, LSkip2); | |
3773 | |
3774 // Check if the length difference is zero (from stack) | |
3775 masm.cmpl(Address(rsp, 0), 0x0); | |
3776 masm.jcc(Assembler::equal, LENGTH_DIFF_LABEL); | |
3777 | |
3778 // Strings might not be equivalent | |
3779 masm.bind(LSkip2); | |
3780 } | |
3781 | |
3782 // Shift rax, and rbx, to the end of the arrays, negate min | |
3783 masm.leal(rax, Address(rax, rsi, Address::times_2, 2)); | |
3784 masm.leal(rbx, Address(rbx, rsi, Address::times_2, 2)); | |
3785 masm.negl(rsi); | |
3786 | |
3787 // Compare the rest of the characters | |
3788 masm.bind(WHILE_HEAD_LABEL); | |
3789 masm.load_unsigned_word(rcx, Address(rbx, rsi, Address::times_2, 0)); | |
3790 masm.load_unsigned_word(rdi, Address(rax, rsi, Address::times_2, 0)); | |
3791 masm.subl(rcx, rdi); | |
3792 masm.jcc(Assembler::notZero, POP_LABEL); | |
3793 masm.increment(rsi); | |
3794 masm.jcc(Assembler::notZero, WHILE_HEAD_LABEL); | |
3795 | |
3796 // Strings are equal up to min length. Return the length difference. | |
3797 masm.bind(LENGTH_DIFF_LABEL); | |
3798 masm.popl(rcx); | |
3799 masm.jmp(DONE_LABEL); | |
3800 | |
3801 // Discard the stored length difference | |
3802 masm.bind(POP_LABEL); | |
3803 masm.addl(rsp, 4); | |
3804 | |
3805 // That's it | |
3806 masm.bind(DONE_LABEL); | |
3807 %} | |
3808 | |
3809 enc_class enc_pop_rdx() %{ | |
3810 emit_opcode(cbuf,0x5A); | |
3811 %} | |
3812 | |
3813 enc_class enc_rethrow() %{ | |
3814 cbuf.set_inst_mark(); | |
3815 emit_opcode(cbuf, 0xE9); // jmp entry | |
3816 emit_d32_reloc(cbuf, (int)OptoRuntime::rethrow_stub() - ((int)cbuf.code_end())-4, | |
3817 runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
3818 %} | |
3819 | |
3820 | |
3821 // Convert a double to an int. Java semantics require we do complex | |
3822 // manglelations in the corner cases. So we set the rounding mode to | |
3823 // 'zero', store the darned double down as an int, and reset the | |
3824 // rounding mode to 'nearest'. The hardware throws an exception which | |
3825 // patches up the correct value directly to the stack. | |
3826 enc_class D2I_encoding( regD src ) %{ | |
3827 // Flip to round-to-zero mode. We attempted to allow invalid-op | |
3828 // exceptions here, so that a NAN or other corner-case value will | |
3829 // thrown an exception (but normal values get converted at full speed). | |
3830 // However, I2C adapters and other float-stack manglers leave pending | |
3831 // invalid-op exceptions hanging. We would have to clear them before | |
3832 // enabling them and that is more expensive than just testing for the | |
3833 // invalid value Intel stores down in the corner cases. | |
3834 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
3835 emit_opcode(cbuf,0x2D); | |
3836 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
3837 // Allocate a word | |
3838 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
3839 emit_opcode(cbuf,0xEC); | |
3840 emit_d8(cbuf,0x04); | |
3841 // Encoding assumes a double has been pushed into FPR0. | |
3842 // Store down the double as an int, popping the FPU stack | |
3843 emit_opcode(cbuf,0xDB); // FISTP [ESP] | |
3844 emit_opcode(cbuf,0x1C); | |
3845 emit_d8(cbuf,0x24); | |
3846 // Restore the rounding mode; mask the exception | |
3847 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
3848 emit_opcode(cbuf,0x2D); | |
3849 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
3850 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
3851 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
3852 | |
3853 // Load the converted int; adjust CPU stack | |
3854 emit_opcode(cbuf,0x58); // POP EAX | |
3855 emit_opcode(cbuf,0x3D); // CMP EAX,imm | |
3856 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
3857 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
3858 emit_d8 (cbuf,0x07); // Size of slow_call | |
3859 // Push src onto stack slow-path | |
3860 emit_opcode(cbuf,0xD9 ); // FLD ST(i) | |
3861 emit_d8 (cbuf,0xC0-1+$src$$reg ); | |
3862 // CALL directly to the runtime | |
3863 cbuf.set_inst_mark(); | |
3864 emit_opcode(cbuf,0xE8); // Call into runtime | |
3865 emit_d32_reloc(cbuf, (StubRoutines::d2i_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
3866 // Carry on here... | |
3867 %} | |
3868 | |
3869 enc_class D2L_encoding( regD src ) %{ | |
3870 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
3871 emit_opcode(cbuf,0x2D); | |
3872 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
3873 // Allocate a word | |
3874 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
3875 emit_opcode(cbuf,0xEC); | |
3876 emit_d8(cbuf,0x08); | |
3877 // Encoding assumes a double has been pushed into FPR0. | |
3878 // Store down the double as a long, popping the FPU stack | |
3879 emit_opcode(cbuf,0xDF); // FISTP [ESP] | |
3880 emit_opcode(cbuf,0x3C); | |
3881 emit_d8(cbuf,0x24); | |
3882 // Restore the rounding mode; mask the exception | |
3883 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
3884 emit_opcode(cbuf,0x2D); | |
3885 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
3886 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
3887 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
3888 | |
3889 // Load the converted int; adjust CPU stack | |
3890 emit_opcode(cbuf,0x58); // POP EAX | |
3891 emit_opcode(cbuf,0x5A); // POP EDX | |
3892 emit_opcode(cbuf,0x81); // CMP EDX,imm | |
3893 emit_d8 (cbuf,0xFA); // rdx | |
3894 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
3895 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
3896 emit_d8 (cbuf,0x07+4); // Size of slow_call | |
3897 emit_opcode(cbuf,0x85); // TEST EAX,EAX | |
3898 emit_opcode(cbuf,0xC0); // 2/rax,/rax, | |
3899 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
3900 emit_d8 (cbuf,0x07); // Size of slow_call | |
3901 // Push src onto stack slow-path | |
3902 emit_opcode(cbuf,0xD9 ); // FLD ST(i) | |
3903 emit_d8 (cbuf,0xC0-1+$src$$reg ); | |
3904 // CALL directly to the runtime | |
3905 cbuf.set_inst_mark(); | |
3906 emit_opcode(cbuf,0xE8); // Call into runtime | |
3907 emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
3908 // Carry on here... | |
3909 %} | |
3910 | |
3911 enc_class X2L_encoding( regX src ) %{ | |
3912 // Allocate a word | |
3913 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
3914 emit_opcode(cbuf,0xEC); | |
3915 emit_d8(cbuf,0x08); | |
3916 | |
3917 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src | |
3918 emit_opcode (cbuf, 0x0F ); | |
3919 emit_opcode (cbuf, 0x11 ); | |
3920 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
3921 | |
3922 emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] | |
3923 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
3924 | |
3925 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
3926 emit_opcode(cbuf,0x2D); | |
3927 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
3928 | |
3929 // Encoding assumes a double has been pushed into FPR0. | |
3930 // Store down the double as a long, popping the FPU stack | |
3931 emit_opcode(cbuf,0xDF); // FISTP [ESP] | |
3932 emit_opcode(cbuf,0x3C); | |
3933 emit_d8(cbuf,0x24); | |
3934 | |
3935 // Restore the rounding mode; mask the exception | |
3936 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
3937 emit_opcode(cbuf,0x2D); | |
3938 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
3939 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
3940 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
3941 | |
3942 // Load the converted int; adjust CPU stack | |
3943 emit_opcode(cbuf,0x58); // POP EAX | |
3944 | |
3945 emit_opcode(cbuf,0x5A); // POP EDX | |
3946 | |
3947 emit_opcode(cbuf,0x81); // CMP EDX,imm | |
3948 emit_d8 (cbuf,0xFA); // rdx | |
3949 emit_d32 (cbuf,0x80000000);// 0x80000000 | |
3950 | |
3951 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
3952 emit_d8 (cbuf,0x13+4); // Size of slow_call | |
3953 | |
3954 emit_opcode(cbuf,0x85); // TEST EAX,EAX | |
3955 emit_opcode(cbuf,0xC0); // 2/rax,/rax, | |
3956 | |
3957 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
3958 emit_d8 (cbuf,0x13); // Size of slow_call | |
3959 | |
3960 // Allocate a word | |
3961 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
3962 emit_opcode(cbuf,0xEC); | |
3963 emit_d8(cbuf,0x04); | |
3964 | |
3965 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src | |
3966 emit_opcode (cbuf, 0x0F ); | |
3967 emit_opcode (cbuf, 0x11 ); | |
3968 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
3969 | |
3970 emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] | |
3971 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
3972 | |
3973 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
3974 emit_opcode(cbuf,0xC4); | |
3975 emit_d8(cbuf,0x04); | |
3976 | |
3977 // CALL directly to the runtime | |
3978 cbuf.set_inst_mark(); | |
3979 emit_opcode(cbuf,0xE8); // Call into runtime | |
3980 emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
3981 // Carry on here... | |
3982 %} | |
3983 | |
3984 enc_class XD2L_encoding( regXD src ) %{ | |
3985 // Allocate a word | |
3986 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
3987 emit_opcode(cbuf,0xEC); | |
3988 emit_d8(cbuf,0x08); | |
3989 | |
3990 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src | |
3991 emit_opcode (cbuf, 0x0F ); | |
3992 emit_opcode (cbuf, 0x11 ); | |
3993 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
3994 | |
3995 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
3996 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
3997 | |
3998 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
3999 emit_opcode(cbuf,0x2D); | |
4000 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
4001 | |
4002 // Encoding assumes a double has been pushed into FPR0. | |
4003 // Store down the double as a long, popping the FPU stack | |
4004 emit_opcode(cbuf,0xDF); // FISTP [ESP] | |
4005 emit_opcode(cbuf,0x3C); | |
4006 emit_d8(cbuf,0x24); | |
4007 | |
4008 // Restore the rounding mode; mask the exception | |
4009 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
4010 emit_opcode(cbuf,0x2D); | |
4011 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
4012 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
4013 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
4014 | |
4015 // Load the converted int; adjust CPU stack | |
4016 emit_opcode(cbuf,0x58); // POP EAX | |
4017 | |
4018 emit_opcode(cbuf,0x5A); // POP EDX | |
4019 | |
4020 emit_opcode(cbuf,0x81); // CMP EDX,imm | |
4021 emit_d8 (cbuf,0xFA); // rdx | |
4022 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
4023 | |
4024 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
4025 emit_d8 (cbuf,0x13+4); // Size of slow_call | |
4026 | |
4027 emit_opcode(cbuf,0x85); // TEST EAX,EAX | |
4028 emit_opcode(cbuf,0xC0); // 2/rax,/rax, | |
4029 | |
4030 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
4031 emit_d8 (cbuf,0x13); // Size of slow_call | |
4032 | |
4033 // Push src onto stack slow-path | |
4034 // Allocate a word | |
4035 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
4036 emit_opcode(cbuf,0xEC); | |
4037 emit_d8(cbuf,0x08); | |
4038 | |
4039 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src | |
4040 emit_opcode (cbuf, 0x0F ); | |
4041 emit_opcode (cbuf, 0x11 ); | |
4042 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
4043 | |
4044 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
4045 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
4046 | |
4047 emit_opcode(cbuf,0x83); // ADD ESP,8 | |
4048 emit_opcode(cbuf,0xC4); | |
4049 emit_d8(cbuf,0x08); | |
4050 | |
4051 // CALL directly to the runtime | |
4052 cbuf.set_inst_mark(); | |
4053 emit_opcode(cbuf,0xE8); // Call into runtime | |
4054 emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
4055 // Carry on here... | |
4056 %} | |
4057 | |
4058 enc_class D2X_encoding( regX dst, regD src ) %{ | |
4059 // Allocate a word | |
4060 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
4061 emit_opcode(cbuf,0xEC); | |
4062 emit_d8(cbuf,0x04); | |
4063 int pop = 0x02; | |
4064 if ($src$$reg != FPR1L_enc) { | |
4065 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
4066 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
4067 pop = 0x03; | |
4068 } | |
4069 store_to_stackslot( cbuf, 0xD9, pop, 0 ); // FST<P>_S [ESP] | |
4070 | |
4071 emit_opcode (cbuf, 0xF3 ); // MOVSS dst(xmm), [ESP] | |
4072 emit_opcode (cbuf, 0x0F ); | |
4073 emit_opcode (cbuf, 0x10 ); | |
4074 encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); | |
4075 | |
4076 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
4077 emit_opcode(cbuf,0xC4); | |
4078 emit_d8(cbuf,0x04); | |
4079 // Carry on here... | |
4080 %} | |
4081 | |
4082 enc_class FX2I_encoding( regX src, eRegI dst ) %{ | |
4083 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
4084 | |
4085 // Compare the result to see if we need to go to the slow path | |
4086 emit_opcode(cbuf,0x81); // CMP dst,imm | |
4087 emit_rm (cbuf,0x3,0x7,$dst$$reg); | |
4088 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
4089 | |
4090 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
4091 emit_d8 (cbuf,0x13); // Size of slow_call | |
4092 // Store xmm to a temp memory | |
4093 // location and push it onto stack. | |
4094 | |
4095 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
4096 emit_opcode(cbuf,0xEC); | |
4097 emit_d8(cbuf, $primary ? 0x8 : 0x4); | |
4098 | |
4099 emit_opcode (cbuf, $primary ? 0xF2 : 0xF3 ); // MOVSS [ESP], xmm | |
4100 emit_opcode (cbuf, 0x0F ); | |
4101 emit_opcode (cbuf, 0x11 ); | |
4102 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
4103 | |
4104 emit_opcode(cbuf, $primary ? 0xDD : 0xD9 ); // FLD [ESP] | |
4105 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
4106 | |
4107 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
4108 emit_opcode(cbuf,0xC4); | |
4109 emit_d8(cbuf, $primary ? 0x8 : 0x4); | |
4110 | |
4111 // CALL directly to the runtime | |
4112 cbuf.set_inst_mark(); | |
4113 emit_opcode(cbuf,0xE8); // Call into runtime | |
4114 emit_d32_reloc(cbuf, (StubRoutines::d2i_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
4115 | |
4116 // Carry on here... | |
4117 %} | |
4118 | |
4119 enc_class X2D_encoding( regD dst, regX src ) %{ | |
4120 // Allocate a word | |
4121 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
4122 emit_opcode(cbuf,0xEC); | |
4123 emit_d8(cbuf,0x04); | |
4124 | |
4125 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], xmm | |
4126 emit_opcode (cbuf, 0x0F ); | |
4127 emit_opcode (cbuf, 0x11 ); | |
4128 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
4129 | |
4130 emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] | |
4131 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
4132 | |
4133 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
4134 emit_opcode(cbuf,0xC4); | |
4135 emit_d8(cbuf,0x04); | |
4136 | |
4137 // Carry on here... | |
4138 %} | |
4139 | |
4140 enc_class AbsXF_encoding(regX dst) %{ | |
4141 address signmask_address=(address)float_signmask_pool; | |
4142 // andpd:\tANDPS $dst,[signconst] | |
4143 emit_opcode(cbuf, 0x0F); | |
4144 emit_opcode(cbuf, 0x54); | |
4145 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
4146 emit_d32(cbuf, (int)signmask_address); | |
4147 %} | |
4148 | |
4149 enc_class AbsXD_encoding(regXD dst) %{ | |
4150 address signmask_address=(address)double_signmask_pool; | |
4151 // andpd:\tANDPD $dst,[signconst] | |
4152 emit_opcode(cbuf, 0x66); | |
4153 emit_opcode(cbuf, 0x0F); | |
4154 emit_opcode(cbuf, 0x54); | |
4155 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
4156 emit_d32(cbuf, (int)signmask_address); | |
4157 %} | |
4158 | |
4159 enc_class NegXF_encoding(regX dst) %{ | |
4160 address signmask_address=(address)float_signflip_pool; | |
4161 // andpd:\tXORPS $dst,[signconst] | |
4162 emit_opcode(cbuf, 0x0F); | |
4163 emit_opcode(cbuf, 0x57); | |
4164 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
4165 emit_d32(cbuf, (int)signmask_address); | |
4166 %} | |
4167 | |
4168 enc_class NegXD_encoding(regXD dst) %{ | |
4169 address signmask_address=(address)double_signflip_pool; | |
4170 // andpd:\tXORPD $dst,[signconst] | |
4171 emit_opcode(cbuf, 0x66); | |
4172 emit_opcode(cbuf, 0x0F); | |
4173 emit_opcode(cbuf, 0x57); | |
4174 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
4175 emit_d32(cbuf, (int)signmask_address); | |
4176 %} | |
4177 | |
4178 enc_class FMul_ST_reg( eRegF src1 ) %{ | |
4179 // Operand was loaded from memory into fp ST (stack top) | |
4180 // FMUL ST,$src /* D8 C8+i */ | |
4181 emit_opcode(cbuf, 0xD8); | |
4182 emit_opcode(cbuf, 0xC8 + $src1$$reg); | |
4183 %} | |
4184 | |
4185 enc_class FAdd_ST_reg( eRegF src2 ) %{ | |
4186 // FADDP ST,src2 /* D8 C0+i */ | |
4187 emit_opcode(cbuf, 0xD8); | |
4188 emit_opcode(cbuf, 0xC0 + $src2$$reg); | |
4189 //could use FADDP src2,fpST /* DE C0+i */ | |
4190 %} | |
4191 | |
4192 enc_class FAddP_reg_ST( eRegF src2 ) %{ | |
4193 // FADDP src2,ST /* DE C0+i */ | |
4194 emit_opcode(cbuf, 0xDE); | |
4195 emit_opcode(cbuf, 0xC0 + $src2$$reg); | |
4196 %} | |
4197 | |
4198 enc_class subF_divF_encode( eRegF src1, eRegF src2) %{ | |
4199 // Operand has been loaded into fp ST (stack top) | |
4200 // FSUB ST,$src1 | |
4201 emit_opcode(cbuf, 0xD8); | |
4202 emit_opcode(cbuf, 0xE0 + $src1$$reg); | |
4203 | |
4204 // FDIV | |
4205 emit_opcode(cbuf, 0xD8); | |
4206 emit_opcode(cbuf, 0xF0 + $src2$$reg); | |
4207 %} | |
4208 | |
4209 enc_class MulFAddF (eRegF src1, eRegF src2) %{ | |
4210 // Operand was loaded from memory into fp ST (stack top) | |
4211 // FADD ST,$src /* D8 C0+i */ | |
4212 emit_opcode(cbuf, 0xD8); | |
4213 emit_opcode(cbuf, 0xC0 + $src1$$reg); | |
4214 | |
4215 // FMUL ST,src2 /* D8 C*+i */ | |
4216 emit_opcode(cbuf, 0xD8); | |
4217 emit_opcode(cbuf, 0xC8 + $src2$$reg); | |
4218 %} | |
4219 | |
4220 | |
4221 enc_class MulFAddFreverse (eRegF src1, eRegF src2) %{ | |
4222 // Operand was loaded from memory into fp ST (stack top) | |
4223 // FADD ST,$src /* D8 C0+i */ | |
4224 emit_opcode(cbuf, 0xD8); | |
4225 emit_opcode(cbuf, 0xC0 + $src1$$reg); | |
4226 | |
4227 // FMULP src2,ST /* DE C8+i */ | |
4228 emit_opcode(cbuf, 0xDE); | |
4229 emit_opcode(cbuf, 0xC8 + $src2$$reg); | |
4230 %} | |
4231 | |
4232 enc_class enc_membar_acquire %{ | |
4233 // Doug Lea believes this is not needed with current Sparcs and TSO. | |
4234 // MacroAssembler masm(&cbuf); | |
4235 // masm.membar(); | |
4236 %} | |
4237 | |
4238 enc_class enc_membar_release %{ | |
4239 // Doug Lea believes this is not needed with current Sparcs and TSO. | |
4240 // MacroAssembler masm(&cbuf); | |
4241 // masm.membar(); | |
4242 %} | |
4243 | |
4244 enc_class enc_membar_volatile %{ | |
4245 MacroAssembler masm(&cbuf); | |
4246 masm.membar(); | |
4247 %} | |
4248 | |
4249 // Atomically load the volatile long | |
4250 enc_class enc_loadL_volatile( memory mem, stackSlotL dst ) %{ | |
4251 emit_opcode(cbuf,0xDF); | |
4252 int rm_byte_opcode = 0x05; | |
4253 int base = $mem$$base; | |
4254 int index = $mem$$index; | |
4255 int scale = $mem$$scale; | |
4256 int displace = $mem$$disp; | |
4257 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
4258 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); | |
4259 store_to_stackslot( cbuf, 0x0DF, 0x07, $dst$$disp ); | |
4260 %} | |
4261 | |
4262 enc_class enc_loadLX_volatile( memory mem, stackSlotL dst, regXD tmp ) %{ | |
4263 { // Atomic long load | |
4264 // UseXmmLoadAndClearUpper ? movsd $tmp,$mem : movlpd $tmp,$mem | |
4265 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
4266 emit_opcode(cbuf,0x0F); | |
4267 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
4268 int base = $mem$$base; | |
4269 int index = $mem$$index; | |
4270 int scale = $mem$$scale; | |
4271 int displace = $mem$$disp; | |
4272 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
4273 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
4274 } | |
4275 { // MOVSD $dst,$tmp ! atomic long store | |
4276 emit_opcode(cbuf,0xF2); | |
4277 emit_opcode(cbuf,0x0F); | |
4278 emit_opcode(cbuf,0x11); | |
4279 int base = $dst$$base; | |
4280 int index = $dst$$index; | |
4281 int scale = $dst$$scale; | |
4282 int displace = $dst$$disp; | |
4283 bool disp_is_oop = $dst->disp_is_oop(); // disp-as-oop when working with static globals | |
4284 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
4285 } | |
4286 %} | |
4287 | |
4288 enc_class enc_loadLX_reg_volatile( memory mem, eRegL dst, regXD tmp ) %{ | |
4289 { // Atomic long load | |
4290 // UseXmmLoadAndClearUpper ? movsd $tmp,$mem : movlpd $tmp,$mem | |
4291 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
4292 emit_opcode(cbuf,0x0F); | |
4293 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
4294 int base = $mem$$base; | |
4295 int index = $mem$$index; | |
4296 int scale = $mem$$scale; | |
4297 int displace = $mem$$disp; | |
4298 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
4299 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
4300 } | |
4301 { // MOVD $dst.lo,$tmp | |
4302 emit_opcode(cbuf,0x66); | |
4303 emit_opcode(cbuf,0x0F); | |
4304 emit_opcode(cbuf,0x7E); | |
4305 emit_rm(cbuf, 0x3, $tmp$$reg, $dst$$reg); | |
4306 } | |
4307 { // PSRLQ $tmp,32 | |
4308 emit_opcode(cbuf,0x66); | |
4309 emit_opcode(cbuf,0x0F); | |
4310 emit_opcode(cbuf,0x73); | |
4311 emit_rm(cbuf, 0x3, 0x02, $tmp$$reg); | |
4312 emit_d8(cbuf, 0x20); | |
4313 } | |
4314 { // MOVD $dst.hi,$tmp | |
4315 emit_opcode(cbuf,0x66); | |
4316 emit_opcode(cbuf,0x0F); | |
4317 emit_opcode(cbuf,0x7E); | |
4318 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg)); | |
4319 } | |
4320 %} | |
4321 | |
4322 // Volatile Store Long. Must be atomic, so move it into | |
4323 // the FP TOS and then do a 64-bit FIST. Has to probe the | |
4324 // target address before the store (for null-ptr checks) | |
4325 // so the memory operand is used twice in the encoding. | |
4326 enc_class enc_storeL_volatile( memory mem, stackSlotL src ) %{ | |
4327 store_to_stackslot( cbuf, 0x0DF, 0x05, $src$$disp ); | |
4328 cbuf.set_inst_mark(); // Mark start of FIST in case $mem has an oop | |
4329 emit_opcode(cbuf,0xDF); | |
4330 int rm_byte_opcode = 0x07; | |
4331 int base = $mem$$base; | |
4332 int index = $mem$$index; | |
4333 int scale = $mem$$scale; | |
4334 int displace = $mem$$disp; | |
4335 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
4336 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); | |
4337 %} | |
4338 | |
4339 enc_class enc_storeLX_volatile( memory mem, stackSlotL src, regXD tmp) %{ | |
4340 { // Atomic long load | |
4341 // UseXmmLoadAndClearUpper ? movsd $tmp,[$src] : movlpd $tmp,[$src] | |
4342 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
4343 emit_opcode(cbuf,0x0F); | |
4344 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
4345 int base = $src$$base; | |
4346 int index = $src$$index; | |
4347 int scale = $src$$scale; | |
4348 int displace = $src$$disp; | |
4349 bool disp_is_oop = $src->disp_is_oop(); // disp-as-oop when working with static globals | |
4350 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
4351 } | |
4352 cbuf.set_inst_mark(); // Mark start of MOVSD in case $mem has an oop | |
4353 { // MOVSD $mem,$tmp ! atomic long store | |
4354 emit_opcode(cbuf,0xF2); | |
4355 emit_opcode(cbuf,0x0F); | |
4356 emit_opcode(cbuf,0x11); | |
4357 int base = $mem$$base; | |
4358 int index = $mem$$index; | |
4359 int scale = $mem$$scale; | |
4360 int displace = $mem$$disp; | |
4361 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
4362 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
4363 } | |
4364 %} | |
4365 | |
4366 enc_class enc_storeLX_reg_volatile( memory mem, eRegL src, regXD tmp, regXD tmp2) %{ | |
4367 { // MOVD $tmp,$src.lo | |
4368 emit_opcode(cbuf,0x66); | |
4369 emit_opcode(cbuf,0x0F); | |
4370 emit_opcode(cbuf,0x6E); | |
4371 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); | |
4372 } | |
4373 { // MOVD $tmp2,$src.hi | |
4374 emit_opcode(cbuf,0x66); | |
4375 emit_opcode(cbuf,0x0F); | |
4376 emit_opcode(cbuf,0x6E); | |
4377 emit_rm(cbuf, 0x3, $tmp2$$reg, HIGH_FROM_LOW($src$$reg)); | |
4378 } | |
4379 { // PUNPCKLDQ $tmp,$tmp2 | |
4380 emit_opcode(cbuf,0x66); | |
4381 emit_opcode(cbuf,0x0F); | |
4382 emit_opcode(cbuf,0x62); | |
4383 emit_rm(cbuf, 0x3, $tmp$$reg, $tmp2$$reg); | |
4384 } | |
4385 cbuf.set_inst_mark(); // Mark start of MOVSD in case $mem has an oop | |
4386 { // MOVSD $mem,$tmp ! atomic long store | |
4387 emit_opcode(cbuf,0xF2); | |
4388 emit_opcode(cbuf,0x0F); | |
4389 emit_opcode(cbuf,0x11); | |
4390 int base = $mem$$base; | |
4391 int index = $mem$$index; | |
4392 int scale = $mem$$scale; | |
4393 int displace = $mem$$disp; | |
4394 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
4395 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
4396 } | |
4397 %} | |
4398 | |
4399 // Safepoint Poll. This polls the safepoint page, and causes an | |
4400 // exception if it is not readable. Unfortunately, it kills the condition code | |
4401 // in the process | |
4402 // We current use TESTL [spp],EDI | |
4403 // A better choice might be TESTB [spp + pagesize() - CacheLineSize()],0 | |
4404 | |
4405 enc_class Safepoint_Poll() %{ | |
4406 cbuf.relocate(cbuf.inst_mark(), relocInfo::poll_type, 0); | |
4407 emit_opcode(cbuf,0x85); | |
4408 emit_rm (cbuf, 0x0, 0x7, 0x5); | |
4409 emit_d32(cbuf, (intptr_t)os::get_polling_page()); | |
4410 %} | |
4411 %} | |
4412 | |
4413 | |
4414 //----------FRAME-------------------------------------------------------------- | |
4415 // Definition of frame structure and management information. | |
4416 // | |
4417 // S T A C K L A Y O U T Allocators stack-slot number | |
4418 // | (to get allocators register number | |
4419 // G Owned by | | v add OptoReg::stack0()) | |
4420 // r CALLER | | | |
4421 // o | +--------+ pad to even-align allocators stack-slot | |
4422 // w V | pad0 | numbers; owned by CALLER | |
4423 // t -----------+--------+----> Matcher::_in_arg_limit, unaligned | |
4424 // h ^ | in | 5 | |
4425 // | | args | 4 Holes in incoming args owned by SELF | |
4426 // | | | | 3 | |
4427 // | | +--------+ | |
4428 // V | | old out| Empty on Intel, window on Sparc | |
4429 // | old |preserve| Must be even aligned. | |
4430 // | SP-+--------+----> Matcher::_old_SP, even aligned | |
4431 // | | in | 3 area for Intel ret address | |
4432 // Owned by |preserve| Empty on Sparc. | |
4433 // SELF +--------+ | |
4434 // | | pad2 | 2 pad to align old SP | |
4435 // | +--------+ 1 | |
4436 // | | locks | 0 | |
4437 // | +--------+----> OptoReg::stack0(), even aligned | |
4438 // | | pad1 | 11 pad to align new SP | |
4439 // | +--------+ | |
4440 // | | | 10 | |
4441 // | | spills | 9 spills | |
4442 // V | | 8 (pad0 slot for callee) | |
4443 // -----------+--------+----> Matcher::_out_arg_limit, unaligned | |
4444 // ^ | out | 7 | |
4445 // | | args | 6 Holes in outgoing args owned by CALLEE | |
4446 // Owned by +--------+ | |
4447 // CALLEE | new out| 6 Empty on Intel, window on Sparc | |
4448 // | new |preserve| Must be even-aligned. | |
4449 // | SP-+--------+----> Matcher::_new_SP, even aligned | |
4450 // | | | | |
4451 // | |
4452 // Note 1: Only region 8-11 is determined by the allocator. Region 0-5 is | |
4453 // known from SELF's arguments and the Java calling convention. | |
4454 // Region 6-7 is determined per call site. | |
4455 // Note 2: If the calling convention leaves holes in the incoming argument | |
4456 // area, those holes are owned by SELF. Holes in the outgoing area | |
4457 // are owned by the CALLEE. Holes should not be nessecary in the | |
4458 // incoming area, as the Java calling convention is completely under | |
4459 // the control of the AD file. Doubles can be sorted and packed to | |
4460 // avoid holes. Holes in the outgoing arguments may be nessecary for | |
4461 // varargs C calling conventions. | |
4462 // Note 3: Region 0-3 is even aligned, with pad2 as needed. Region 3-5 is | |
4463 // even aligned with pad0 as needed. | |
4464 // Region 6 is even aligned. Region 6-7 is NOT even aligned; | |
4465 // region 6-11 is even aligned; it may be padded out more so that | |
4466 // the region from SP to FP meets the minimum stack alignment. | |
4467 | |
4468 frame %{ | |
4469 // What direction does stack grow in (assumed to be same for C & Java) | |
4470 stack_direction(TOWARDS_LOW); | |
4471 | |
4472 // These three registers define part of the calling convention | |
4473 // between compiled code and the interpreter. | |
4474 inline_cache_reg(EAX); // Inline Cache Register | |
4475 interpreter_method_oop_reg(EBX); // Method Oop Register when calling interpreter | |
4476 | |
4477 // Optional: name the operand used by cisc-spilling to access [stack_pointer + offset] | |
4478 cisc_spilling_operand_name(indOffset32); | |
4479 | |
4480 // Number of stack slots consumed by locking an object | |
4481 sync_stack_slots(1); | |
4482 | |
4483 // Compiled code's Frame Pointer | |
4484 frame_pointer(ESP); | |
4485 // Interpreter stores its frame pointer in a register which is | |
4486 // stored to the stack by I2CAdaptors. | |
4487 // I2CAdaptors convert from interpreted java to compiled java. | |
4488 interpreter_frame_pointer(EBP); | |
4489 | |
4490 // Stack alignment requirement | |
4491 // Alignment size in bytes (128-bit -> 16 bytes) | |
4492 stack_alignment(StackAlignmentInBytes); | |
4493 | |
4494 // Number of stack slots between incoming argument block and the start of | |
4495 // a new frame. The PROLOG must add this many slots to the stack. The | |
4496 // EPILOG must remove this many slots. Intel needs one slot for | |
4497 // return address and one for rbp, (must save rbp) | |
4498 in_preserve_stack_slots(2+VerifyStackAtCalls); | |
4499 | |
4500 // Number of outgoing stack slots killed above the out_preserve_stack_slots | |
4501 // for calls to C. Supports the var-args backing area for register parms. | |
4502 varargs_C_out_slots_killed(0); | |
4503 | |
4504 // The after-PROLOG location of the return address. Location of | |
4505 // return address specifies a type (REG or STACK) and a number | |
4506 // representing the register number (i.e. - use a register name) or | |
4507 // stack slot. | |
4508 // Ret Addr is on stack in slot 0 if no locks or verification or alignment. | |
4509 // Otherwise, it is above the locks and verification slot and alignment word | |
4510 return_addr(STACK - 1 + | |
4511 round_to(1+VerifyStackAtCalls+ | |
4512 Compile::current()->fixed_slots(), | |
4513 (StackAlignmentInBytes/wordSize))); | |
4514 | |
4515 // Body of function which returns an integer array locating | |
4516 // arguments either in registers or in stack slots. Passed an array | |
4517 // of ideal registers called "sig" and a "length" count. Stack-slot | |
4518 // offsets are based on outgoing arguments, i.e. a CALLER setting up | |
4519 // arguments for a CALLEE. Incoming stack arguments are | |
4520 // automatically biased by the preserve_stack_slots field above. | |
4521 calling_convention %{ | |
4522 // No difference between ingoing/outgoing just pass false | |
4523 SharedRuntime::java_calling_convention(sig_bt, regs, length, false); | |
4524 %} | |
4525 | |
4526 | |
4527 // Body of function which returns an integer array locating | |
4528 // arguments either in registers or in stack slots. Passed an array | |
4529 // of ideal registers called "sig" and a "length" count. Stack-slot | |
4530 // offsets are based on outgoing arguments, i.e. a CALLER setting up | |
4531 // arguments for a CALLEE. Incoming stack arguments are | |
4532 // automatically biased by the preserve_stack_slots field above. | |
4533 c_calling_convention %{ | |
4534 // This is obviously always outgoing | |
4535 (void) SharedRuntime::c_calling_convention(sig_bt, regs, length); | |
4536 %} | |
4537 | |
4538 // Location of C & interpreter return values | |
4539 c_return_value %{ | |
4540 assert( ideal_reg >= Op_RegI && ideal_reg <= Op_RegL, "only return normal values" ); | |
4541 static int lo[Op_RegL+1] = { 0, 0, EAX_num, EAX_num, FPR1L_num, FPR1L_num, EAX_num }; | |
4542 static int hi[Op_RegL+1] = { 0, 0, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, FPR1H_num, EDX_num }; | |
4543 | |
4544 // in SSE2+ mode we want to keep the FPU stack clean so pretend | |
4545 // that C functions return float and double results in XMM0. | |
4546 if( ideal_reg == Op_RegD && UseSSE>=2 ) | |
4547 return OptoRegPair(XMM0b_num,XMM0a_num); | |
4548 if( ideal_reg == Op_RegF && UseSSE>=2 ) | |
4549 return OptoRegPair(OptoReg::Bad,XMM0a_num); | |
4550 | |
4551 return OptoRegPair(hi[ideal_reg],lo[ideal_reg]); | |
4552 %} | |
4553 | |
4554 // Location of return values | |
4555 return_value %{ | |
4556 assert( ideal_reg >= Op_RegI && ideal_reg <= Op_RegL, "only return normal values" ); | |
4557 static int lo[Op_RegL+1] = { 0, 0, EAX_num, EAX_num, FPR1L_num, FPR1L_num, EAX_num }; | |
4558 static int hi[Op_RegL+1] = { 0, 0, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, FPR1H_num, EDX_num }; | |
4559 if( ideal_reg == Op_RegD && UseSSE>=2 ) | |
4560 return OptoRegPair(XMM0b_num,XMM0a_num); | |
4561 if( ideal_reg == Op_RegF && UseSSE>=1 ) | |
4562 return OptoRegPair(OptoReg::Bad,XMM0a_num); | |
4563 return OptoRegPair(hi[ideal_reg],lo[ideal_reg]); | |
4564 %} | |
4565 | |
4566 %} | |
4567 | |
4568 //----------ATTRIBUTES--------------------------------------------------------- | |
4569 //----------Operand Attributes------------------------------------------------- | |
4570 op_attrib op_cost(0); // Required cost attribute | |
4571 | |
4572 //----------Instruction Attributes--------------------------------------------- | |
4573 ins_attrib ins_cost(100); // Required cost attribute | |
4574 ins_attrib ins_size(8); // Required size attribute (in bits) | |
4575 ins_attrib ins_pc_relative(0); // Required PC Relative flag | |
4576 ins_attrib ins_short_branch(0); // Required flag: is this instruction a | |
4577 // non-matching short branch variant of some | |
4578 // long branch? | |
4579 ins_attrib ins_alignment(1); // Required alignment attribute (must be a power of 2) | |
4580 // specifies the alignment that some part of the instruction (not | |
4581 // necessarily the start) requires. If > 1, a compute_padding() | |
4582 // function must be provided for the instruction | |
4583 | |
4584 //----------OPERANDS----------------------------------------------------------- | |
4585 // Operand definitions must precede instruction definitions for correct parsing | |
4586 // in the ADLC because operands constitute user defined types which are used in | |
4587 // instruction definitions. | |
4588 | |
4589 //----------Simple Operands---------------------------------------------------- | |
4590 // Immediate Operands | |
4591 // Integer Immediate | |
4592 operand immI() %{ | |
4593 match(ConI); | |
4594 | |
4595 op_cost(10); | |
4596 format %{ %} | |
4597 interface(CONST_INTER); | |
4598 %} | |
4599 | |
4600 // Constant for test vs zero | |
4601 operand immI0() %{ | |
4602 predicate(n->get_int() == 0); | |
4603 match(ConI); | |
4604 | |
4605 op_cost(0); | |
4606 format %{ %} | |
4607 interface(CONST_INTER); | |
4608 %} | |
4609 | |
4610 // Constant for increment | |
4611 operand immI1() %{ | |
4612 predicate(n->get_int() == 1); | |
4613 match(ConI); | |
4614 | |
4615 op_cost(0); | |
4616 format %{ %} | |
4617 interface(CONST_INTER); | |
4618 %} | |
4619 | |
4620 // Constant for decrement | |
4621 operand immI_M1() %{ | |
4622 predicate(n->get_int() == -1); | |
4623 match(ConI); | |
4624 | |
4625 op_cost(0); | |
4626 format %{ %} | |
4627 interface(CONST_INTER); | |
4628 %} | |
4629 | |
4630 // Valid scale values for addressing modes | |
4631 operand immI2() %{ | |
4632 predicate(0 <= n->get_int() && (n->get_int() <= 3)); | |
4633 match(ConI); | |
4634 | |
4635 format %{ %} | |
4636 interface(CONST_INTER); | |
4637 %} | |
4638 | |
4639 operand immI8() %{ | |
4640 predicate((-128 <= n->get_int()) && (n->get_int() <= 127)); | |
4641 match(ConI); | |
4642 | |
4643 op_cost(5); | |
4644 format %{ %} | |
4645 interface(CONST_INTER); | |
4646 %} | |
4647 | |
4648 operand immI16() %{ | |
4649 predicate((-32768 <= n->get_int()) && (n->get_int() <= 32767)); | |
4650 match(ConI); | |
4651 | |
4652 op_cost(10); | |
4653 format %{ %} | |
4654 interface(CONST_INTER); | |
4655 %} | |
4656 | |
4657 // Constant for long shifts | |
4658 operand immI_32() %{ | |
4659 predicate( n->get_int() == 32 ); | |
4660 match(ConI); | |
4661 | |
4662 op_cost(0); | |
4663 format %{ %} | |
4664 interface(CONST_INTER); | |
4665 %} | |
4666 | |
4667 operand immI_1_31() %{ | |
4668 predicate( n->get_int() >= 1 && n->get_int() <= 31 ); | |
4669 match(ConI); | |
4670 | |
4671 op_cost(0); | |
4672 format %{ %} | |
4673 interface(CONST_INTER); | |
4674 %} | |
4675 | |
4676 operand immI_32_63() %{ | |
4677 predicate( n->get_int() >= 32 && n->get_int() <= 63 ); | |
4678 match(ConI); | |
4679 op_cost(0); | |
4680 | |
4681 format %{ %} | |
4682 interface(CONST_INTER); | |
4683 %} | |
4684 | |
4685 // Pointer Immediate | |
4686 operand immP() %{ | |
4687 match(ConP); | |
4688 | |
4689 op_cost(10); | |
4690 format %{ %} | |
4691 interface(CONST_INTER); | |
4692 %} | |
4693 | |
4694 // NULL Pointer Immediate | |
4695 operand immP0() %{ | |
4696 predicate( n->get_ptr() == 0 ); | |
4697 match(ConP); | |
4698 op_cost(0); | |
4699 | |
4700 format %{ %} | |
4701 interface(CONST_INTER); | |
4702 %} | |
4703 | |
4704 // Long Immediate | |
4705 operand immL() %{ | |
4706 match(ConL); | |
4707 | |
4708 op_cost(20); | |
4709 format %{ %} | |
4710 interface(CONST_INTER); | |
4711 %} | |
4712 | |
4713 // Long Immediate zero | |
4714 operand immL0() %{ | |
4715 predicate( n->get_long() == 0L ); | |
4716 match(ConL); | |
4717 op_cost(0); | |
4718 | |
4719 format %{ %} | |
4720 interface(CONST_INTER); | |
4721 %} | |
4722 | |
4723 // Long immediate from 0 to 127. | |
4724 // Used for a shorter form of long mul by 10. | |
4725 operand immL_127() %{ | |
4726 predicate((0 <= n->get_long()) && (n->get_long() <= 127)); | |
4727 match(ConL); | |
4728 op_cost(0); | |
4729 | |
4730 format %{ %} | |
4731 interface(CONST_INTER); | |
4732 %} | |
4733 | |
4734 // Long Immediate: low 32-bit mask | |
4735 operand immL_32bits() %{ | |
4736 predicate(n->get_long() == 0xFFFFFFFFL); | |
4737 match(ConL); | |
4738 op_cost(0); | |
4739 | |
4740 format %{ %} | |
4741 interface(CONST_INTER); | |
4742 %} | |
4743 | |
4744 // Long Immediate: low 32-bit mask | |
4745 operand immL32() %{ | |
4746 predicate(n->get_long() == (int)(n->get_long())); | |
4747 match(ConL); | |
4748 op_cost(20); | |
4749 | |
4750 format %{ %} | |
4751 interface(CONST_INTER); | |
4752 %} | |
4753 | |
4754 //Double Immediate zero | |
4755 operand immD0() %{ | |
4756 // Do additional (and counter-intuitive) test against NaN to work around VC++ | |
4757 // bug that generates code such that NaNs compare equal to 0.0 | |
4758 predicate( UseSSE<=1 && n->getd() == 0.0 && !g_isnan(n->getd()) ); | |
4759 match(ConD); | |
4760 | |
4761 op_cost(5); | |
4762 format %{ %} | |
4763 interface(CONST_INTER); | |
4764 %} | |
4765 | |
4766 // Double Immediate | |
4767 operand immD1() %{ | |
4768 predicate( UseSSE<=1 && n->getd() == 1.0 ); | |
4769 match(ConD); | |
4770 | |
4771 op_cost(5); | |
4772 format %{ %} | |
4773 interface(CONST_INTER); | |
4774 %} | |
4775 | |
4776 // Double Immediate | |
4777 operand immD() %{ | |
4778 predicate(UseSSE<=1); | |
4779 match(ConD); | |
4780 | |
4781 op_cost(5); | |
4782 format %{ %} | |
4783 interface(CONST_INTER); | |
4784 %} | |
4785 | |
4786 operand immXD() %{ | |
4787 predicate(UseSSE>=2); | |
4788 match(ConD); | |
4789 | |
4790 op_cost(5); | |
4791 format %{ %} | |
4792 interface(CONST_INTER); | |
4793 %} | |
4794 | |
4795 // Double Immediate zero | |
4796 operand immXD0() %{ | |
4797 // Do additional (and counter-intuitive) test against NaN to work around VC++ | |
4798 // bug that generates code such that NaNs compare equal to 0.0 AND do not | |
4799 // compare equal to -0.0. | |
4800 predicate( UseSSE>=2 && jlong_cast(n->getd()) == 0 ); | |
4801 match(ConD); | |
4802 | |
4803 format %{ %} | |
4804 interface(CONST_INTER); | |
4805 %} | |
4806 | |
4807 // Float Immediate zero | |
4808 operand immF0() %{ | |
4809 predicate( UseSSE == 0 && n->getf() == 0.0 ); | |
4810 match(ConF); | |
4811 | |
4812 op_cost(5); | |
4813 format %{ %} | |
4814 interface(CONST_INTER); | |
4815 %} | |
4816 | |
4817 // Float Immediate | |
4818 operand immF() %{ | |
4819 predicate( UseSSE == 0 ); | |
4820 match(ConF); | |
4821 | |
4822 op_cost(5); | |
4823 format %{ %} | |
4824 interface(CONST_INTER); | |
4825 %} | |
4826 | |
4827 // Float Immediate | |
4828 operand immXF() %{ | |
4829 predicate(UseSSE >= 1); | |
4830 match(ConF); | |
4831 | |
4832 op_cost(5); | |
4833 format %{ %} | |
4834 interface(CONST_INTER); | |
4835 %} | |
4836 | |
4837 // Float Immediate zero. Zero and not -0.0 | |
4838 operand immXF0() %{ | |
4839 predicate( UseSSE >= 1 && jint_cast(n->getf()) == 0 ); | |
4840 match(ConF); | |
4841 | |
4842 op_cost(5); | |
4843 format %{ %} | |
4844 interface(CONST_INTER); | |
4845 %} | |
4846 | |
4847 // Immediates for special shifts (sign extend) | |
4848 | |
4849 // Constants for increment | |
4850 operand immI_16() %{ | |
4851 predicate( n->get_int() == 16 ); | |
4852 match(ConI); | |
4853 | |
4854 format %{ %} | |
4855 interface(CONST_INTER); | |
4856 %} | |
4857 | |
4858 operand immI_24() %{ | |
4859 predicate( n->get_int() == 24 ); | |
4860 match(ConI); | |
4861 | |
4862 format %{ %} | |
4863 interface(CONST_INTER); | |
4864 %} | |
4865 | |
4866 // Constant for byte-wide masking | |
4867 operand immI_255() %{ | |
4868 predicate( n->get_int() == 255 ); | |
4869 match(ConI); | |
4870 | |
4871 format %{ %} | |
4872 interface(CONST_INTER); | |
4873 %} | |
4874 | |
4875 // Register Operands | |
4876 // Integer Register | |
4877 operand eRegI() %{ | |
4878 constraint(ALLOC_IN_RC(e_reg)); | |
4879 match(RegI); | |
4880 match(xRegI); | |
4881 match(eAXRegI); | |
4882 match(eBXRegI); | |
4883 match(eCXRegI); | |
4884 match(eDXRegI); | |
4885 match(eDIRegI); | |
4886 match(eSIRegI); | |
4887 | |
4888 format %{ %} | |
4889 interface(REG_INTER); | |
4890 %} | |
4891 | |
4892 // Subset of Integer Register | |
4893 operand xRegI(eRegI reg) %{ | |
4894 constraint(ALLOC_IN_RC(x_reg)); | |
4895 match(reg); | |
4896 match(eAXRegI); | |
4897 match(eBXRegI); | |
4898 match(eCXRegI); | |
4899 match(eDXRegI); | |
4900 | |
4901 format %{ %} | |
4902 interface(REG_INTER); | |
4903 %} | |
4904 | |
4905 // Special Registers | |
4906 operand eAXRegI(xRegI reg) %{ | |
4907 constraint(ALLOC_IN_RC(eax_reg)); | |
4908 match(reg); | |
4909 match(eRegI); | |
4910 | |
4911 format %{ "EAX" %} | |
4912 interface(REG_INTER); | |
4913 %} | |
4914 | |
4915 // Special Registers | |
4916 operand eBXRegI(xRegI reg) %{ | |
4917 constraint(ALLOC_IN_RC(ebx_reg)); | |
4918 match(reg); | |
4919 match(eRegI); | |
4920 | |
4921 format %{ "EBX" %} | |
4922 interface(REG_INTER); | |
4923 %} | |
4924 | |
4925 operand eCXRegI(xRegI reg) %{ | |
4926 constraint(ALLOC_IN_RC(ecx_reg)); | |
4927 match(reg); | |
4928 match(eRegI); | |
4929 | |
4930 format %{ "ECX" %} | |
4931 interface(REG_INTER); | |
4932 %} | |
4933 | |
4934 operand eDXRegI(xRegI reg) %{ | |
4935 constraint(ALLOC_IN_RC(edx_reg)); | |
4936 match(reg); | |
4937 match(eRegI); | |
4938 | |
4939 format %{ "EDX" %} | |
4940 interface(REG_INTER); | |
4941 %} | |
4942 | |
4943 operand eDIRegI(xRegI reg) %{ | |
4944 constraint(ALLOC_IN_RC(edi_reg)); | |
4945 match(reg); | |
4946 match(eRegI); | |
4947 | |
4948 format %{ "EDI" %} | |
4949 interface(REG_INTER); | |
4950 %} | |
4951 | |
4952 operand naxRegI() %{ | |
4953 constraint(ALLOC_IN_RC(nax_reg)); | |
4954 match(RegI); | |
4955 match(eCXRegI); | |
4956 match(eDXRegI); | |
4957 match(eSIRegI); | |
4958 match(eDIRegI); | |
4959 | |
4960 format %{ %} | |
4961 interface(REG_INTER); | |
4962 %} | |
4963 | |
4964 operand nadxRegI() %{ | |
4965 constraint(ALLOC_IN_RC(nadx_reg)); | |
4966 match(RegI); | |
4967 match(eBXRegI); | |
4968 match(eCXRegI); | |
4969 match(eSIRegI); | |
4970 match(eDIRegI); | |
4971 | |
4972 format %{ %} | |
4973 interface(REG_INTER); | |
4974 %} | |
4975 | |
4976 operand ncxRegI() %{ | |
4977 constraint(ALLOC_IN_RC(ncx_reg)); | |
4978 match(RegI); | |
4979 match(eAXRegI); | |
4980 match(eDXRegI); | |
4981 match(eSIRegI); | |
4982 match(eDIRegI); | |
4983 | |
4984 format %{ %} | |
4985 interface(REG_INTER); | |
4986 %} | |
4987 | |
4988 // // This operand was used by cmpFastUnlock, but conflicted with 'object' reg | |
4989 // // | |
4990 operand eSIRegI(xRegI reg) %{ | |
4991 constraint(ALLOC_IN_RC(esi_reg)); | |
4992 match(reg); | |
4993 match(eRegI); | |
4994 | |
4995 format %{ "ESI" %} | |
4996 interface(REG_INTER); | |
4997 %} | |
4998 | |
4999 // Pointer Register | |
5000 operand anyRegP() %{ | |
5001 constraint(ALLOC_IN_RC(any_reg)); | |
5002 match(RegP); | |
5003 match(eAXRegP); | |
5004 match(eBXRegP); | |
5005 match(eCXRegP); | |
5006 match(eDIRegP); | |
5007 match(eRegP); | |
5008 | |
5009 format %{ %} | |
5010 interface(REG_INTER); | |
5011 %} | |
5012 | |
5013 operand eRegP() %{ | |
5014 constraint(ALLOC_IN_RC(e_reg)); | |
5015 match(RegP); | |
5016 match(eAXRegP); | |
5017 match(eBXRegP); | |
5018 match(eCXRegP); | |
5019 match(eDIRegP); | |
5020 | |
5021 format %{ %} | |
5022 interface(REG_INTER); | |
5023 %} | |
5024 | |
5025 // On windows95, EBP is not safe to use for implicit null tests. | |
5026 operand eRegP_no_EBP() %{ | |
5027 constraint(ALLOC_IN_RC(e_reg_no_rbp)); | |
5028 match(RegP); | |
5029 match(eAXRegP); | |
5030 match(eBXRegP); | |
5031 match(eCXRegP); | |
5032 match(eDIRegP); | |
5033 | |
5034 op_cost(100); | |
5035 format %{ %} | |
5036 interface(REG_INTER); | |
5037 %} | |
5038 | |
5039 operand naxRegP() %{ | |
5040 constraint(ALLOC_IN_RC(nax_reg)); | |
5041 match(RegP); | |
5042 match(eBXRegP); | |
5043 match(eDXRegP); | |
5044 match(eCXRegP); | |
5045 match(eSIRegP); | |
5046 match(eDIRegP); | |
5047 | |
5048 format %{ %} | |
5049 interface(REG_INTER); | |
5050 %} | |
5051 | |
5052 operand nabxRegP() %{ | |
5053 constraint(ALLOC_IN_RC(nabx_reg)); | |
5054 match(RegP); | |
5055 match(eCXRegP); | |
5056 match(eDXRegP); | |
5057 match(eSIRegP); | |
5058 match(eDIRegP); | |
5059 | |
5060 format %{ %} | |
5061 interface(REG_INTER); | |
5062 %} | |
5063 | |
5064 operand pRegP() %{ | |
5065 constraint(ALLOC_IN_RC(p_reg)); | |
5066 match(RegP); | |
5067 match(eBXRegP); | |
5068 match(eDXRegP); | |
5069 match(eSIRegP); | |
5070 match(eDIRegP); | |
5071 | |
5072 format %{ %} | |
5073 interface(REG_INTER); | |
5074 %} | |
5075 | |
5076 // Special Registers | |
5077 // Return a pointer value | |
5078 operand eAXRegP(eRegP reg) %{ | |
5079 constraint(ALLOC_IN_RC(eax_reg)); | |
5080 match(reg); | |
5081 format %{ "EAX" %} | |
5082 interface(REG_INTER); | |
5083 %} | |
5084 | |
5085 // Used in AtomicAdd | |
5086 operand eBXRegP(eRegP reg) %{ | |
5087 constraint(ALLOC_IN_RC(ebx_reg)); | |
5088 match(reg); | |
5089 format %{ "EBX" %} | |
5090 interface(REG_INTER); | |
5091 %} | |
5092 | |
5093 // Tail-call (interprocedural jump) to interpreter | |
5094 operand eCXRegP(eRegP reg) %{ | |
5095 constraint(ALLOC_IN_RC(ecx_reg)); | |
5096 match(reg); | |
5097 format %{ "ECX" %} | |
5098 interface(REG_INTER); | |
5099 %} | |
5100 | |
5101 operand eSIRegP(eRegP reg) %{ | |
5102 constraint(ALLOC_IN_RC(esi_reg)); | |
5103 match(reg); | |
5104 format %{ "ESI" %} | |
5105 interface(REG_INTER); | |
5106 %} | |
5107 | |
5108 // Used in rep stosw | |
5109 operand eDIRegP(eRegP reg) %{ | |
5110 constraint(ALLOC_IN_RC(edi_reg)); | |
5111 match(reg); | |
5112 format %{ "EDI" %} | |
5113 interface(REG_INTER); | |
5114 %} | |
5115 | |
5116 operand eBPRegP() %{ | |
5117 constraint(ALLOC_IN_RC(ebp_reg)); | |
5118 match(RegP); | |
5119 format %{ "EBP" %} | |
5120 interface(REG_INTER); | |
5121 %} | |
5122 | |
5123 operand eRegL() %{ | |
5124 constraint(ALLOC_IN_RC(long_reg)); | |
5125 match(RegL); | |
5126 match(eADXRegL); | |
5127 | |
5128 format %{ %} | |
5129 interface(REG_INTER); | |
5130 %} | |
5131 | |
5132 operand eADXRegL( eRegL reg ) %{ | |
5133 constraint(ALLOC_IN_RC(eadx_reg)); | |
5134 match(reg); | |
5135 | |
5136 format %{ "EDX:EAX" %} | |
5137 interface(REG_INTER); | |
5138 %} | |
5139 | |
5140 operand eBCXRegL( eRegL reg ) %{ | |
5141 constraint(ALLOC_IN_RC(ebcx_reg)); | |
5142 match(reg); | |
5143 | |
5144 format %{ "EBX:ECX" %} | |
5145 interface(REG_INTER); | |
5146 %} | |
5147 | |
5148 // Special case for integer high multiply | |
5149 operand eADXRegL_low_only() %{ | |
5150 constraint(ALLOC_IN_RC(eadx_reg)); | |
5151 match(RegL); | |
5152 | |
5153 format %{ "EAX" %} | |
5154 interface(REG_INTER); | |
5155 %} | |
5156 | |
5157 // Flags register, used as output of compare instructions | |
5158 operand eFlagsReg() %{ | |
5159 constraint(ALLOC_IN_RC(int_flags)); | |
5160 match(RegFlags); | |
5161 | |
5162 format %{ "EFLAGS" %} | |
5163 interface(REG_INTER); | |
5164 %} | |
5165 | |
5166 // Flags register, used as output of FLOATING POINT compare instructions | |
5167 operand eFlagsRegU() %{ | |
5168 constraint(ALLOC_IN_RC(int_flags)); | |
5169 match(RegFlags); | |
5170 | |
5171 format %{ "EFLAGS_U" %} | |
5172 interface(REG_INTER); | |
5173 %} | |
5174 | |
5175 // Condition Code Register used by long compare | |
5176 operand flagsReg_long_LTGE() %{ | |
5177 constraint(ALLOC_IN_RC(int_flags)); | |
5178 match(RegFlags); | |
5179 format %{ "FLAGS_LTGE" %} | |
5180 interface(REG_INTER); | |
5181 %} | |
5182 operand flagsReg_long_EQNE() %{ | |
5183 constraint(ALLOC_IN_RC(int_flags)); | |
5184 match(RegFlags); | |
5185 format %{ "FLAGS_EQNE" %} | |
5186 interface(REG_INTER); | |
5187 %} | |
5188 operand flagsReg_long_LEGT() %{ | |
5189 constraint(ALLOC_IN_RC(int_flags)); | |
5190 match(RegFlags); | |
5191 format %{ "FLAGS_LEGT" %} | |
5192 interface(REG_INTER); | |
5193 %} | |
5194 | |
5195 // Float register operands | |
5196 operand regD() %{ | |
5197 predicate( UseSSE < 2 ); | |
5198 constraint(ALLOC_IN_RC(dbl_reg)); | |
5199 match(RegD); | |
5200 match(regDPR1); | |
5201 match(regDPR2); | |
5202 format %{ %} | |
5203 interface(REG_INTER); | |
5204 %} | |
5205 | |
5206 operand regDPR1(regD reg) %{ | |
5207 predicate( UseSSE < 2 ); | |
5208 constraint(ALLOC_IN_RC(dbl_reg0)); | |
5209 match(reg); | |
5210 format %{ "FPR1" %} | |
5211 interface(REG_INTER); | |
5212 %} | |
5213 | |
5214 operand regDPR2(regD reg) %{ | |
5215 predicate( UseSSE < 2 ); | |
5216 constraint(ALLOC_IN_RC(dbl_reg1)); | |
5217 match(reg); | |
5218 format %{ "FPR2" %} | |
5219 interface(REG_INTER); | |
5220 %} | |
5221 | |
5222 operand regnotDPR1(regD reg) %{ | |
5223 predicate( UseSSE < 2 ); | |
5224 constraint(ALLOC_IN_RC(dbl_notreg0)); | |
5225 match(reg); | |
5226 format %{ %} | |
5227 interface(REG_INTER); | |
5228 %} | |
5229 | |
5230 // XMM Double register operands | |
5231 operand regXD() %{ | |
5232 predicate( UseSSE>=2 ); | |
5233 constraint(ALLOC_IN_RC(xdb_reg)); | |
5234 match(RegD); | |
5235 match(regXD6); | |
5236 match(regXD7); | |
5237 format %{ %} | |
5238 interface(REG_INTER); | |
5239 %} | |
5240 | |
5241 // XMM6 double register operands | |
5242 operand regXD6(regXD reg) %{ | |
5243 predicate( UseSSE>=2 ); | |
5244 constraint(ALLOC_IN_RC(xdb_reg6)); | |
5245 match(reg); | |
5246 format %{ "XMM6" %} | |
5247 interface(REG_INTER); | |
5248 %} | |
5249 | |
5250 // XMM7 double register operands | |
5251 operand regXD7(regXD reg) %{ | |
5252 predicate( UseSSE>=2 ); | |
5253 constraint(ALLOC_IN_RC(xdb_reg7)); | |
5254 match(reg); | |
5255 format %{ "XMM7" %} | |
5256 interface(REG_INTER); | |
5257 %} | |
5258 | |
5259 // Float register operands | |
5260 operand regF() %{ | |
5261 predicate( UseSSE < 2 ); | |
5262 constraint(ALLOC_IN_RC(flt_reg)); | |
5263 match(RegF); | |
5264 match(regFPR1); | |
5265 format %{ %} | |
5266 interface(REG_INTER); | |
5267 %} | |
5268 | |
5269 // Float register operands | |
5270 operand regFPR1(regF reg) %{ | |
5271 predicate( UseSSE < 2 ); | |
5272 constraint(ALLOC_IN_RC(flt_reg0)); | |
5273 match(reg); | |
5274 format %{ "FPR1" %} | |
5275 interface(REG_INTER); | |
5276 %} | |
5277 | |
5278 // XMM register operands | |
5279 operand regX() %{ | |
5280 predicate( UseSSE>=1 ); | |
5281 constraint(ALLOC_IN_RC(xmm_reg)); | |
5282 match(RegF); | |
5283 format %{ %} | |
5284 interface(REG_INTER); | |
5285 %} | |
5286 | |
5287 | |
5288 //----------Memory Operands---------------------------------------------------- | |
5289 // Direct Memory Operand | |
5290 operand direct(immP addr) %{ | |
5291 match(addr); | |
5292 | |
5293 format %{ "[$addr]" %} | |
5294 interface(MEMORY_INTER) %{ | |
5295 base(0xFFFFFFFF); | |
5296 index(0x4); | |
5297 scale(0x0); | |
5298 disp($addr); | |
5299 %} | |
5300 %} | |
5301 | |
5302 // Indirect Memory Operand | |
5303 operand indirect(eRegP reg) %{ | |
5304 constraint(ALLOC_IN_RC(e_reg)); | |
5305 match(reg); | |
5306 | |
5307 format %{ "[$reg]" %} | |
5308 interface(MEMORY_INTER) %{ | |
5309 base($reg); | |
5310 index(0x4); | |
5311 scale(0x0); | |
5312 disp(0x0); | |
5313 %} | |
5314 %} | |
5315 | |
5316 // Indirect Memory Plus Short Offset Operand | |
5317 operand indOffset8(eRegP reg, immI8 off) %{ | |
5318 match(AddP reg off); | |
5319 | |
5320 format %{ "[$reg + $off]" %} | |
5321 interface(MEMORY_INTER) %{ | |
5322 base($reg); | |
5323 index(0x4); | |
5324 scale(0x0); | |
5325 disp($off); | |
5326 %} | |
5327 %} | |
5328 | |
5329 // Indirect Memory Plus Long Offset Operand | |
5330 operand indOffset32(eRegP reg, immI off) %{ | |
5331 match(AddP reg off); | |
5332 | |
5333 format %{ "[$reg + $off]" %} | |
5334 interface(MEMORY_INTER) %{ | |
5335 base($reg); | |
5336 index(0x4); | |
5337 scale(0x0); | |
5338 disp($off); | |
5339 %} | |
5340 %} | |
5341 | |
5342 // Indirect Memory Plus Long Offset Operand | |
5343 operand indOffset32X(eRegI reg, immP off) %{ | |
5344 match(AddP off reg); | |
5345 | |
5346 format %{ "[$reg + $off]" %} | |
5347 interface(MEMORY_INTER) %{ | |
5348 base($reg); | |
5349 index(0x4); | |
5350 scale(0x0); | |
5351 disp($off); | |
5352 %} | |
5353 %} | |
5354 | |
5355 // Indirect Memory Plus Index Register Plus Offset Operand | |
5356 operand indIndexOffset(eRegP reg, eRegI ireg, immI off) %{ | |
5357 match(AddP (AddP reg ireg) off); | |
5358 | |
5359 op_cost(10); | |
5360 format %{"[$reg + $off + $ireg]" %} | |
5361 interface(MEMORY_INTER) %{ | |
5362 base($reg); | |
5363 index($ireg); | |
5364 scale(0x0); | |
5365 disp($off); | |
5366 %} | |
5367 %} | |
5368 | |
5369 // Indirect Memory Plus Index Register Plus Offset Operand | |
5370 operand indIndex(eRegP reg, eRegI ireg) %{ | |
5371 match(AddP reg ireg); | |
5372 | |
5373 op_cost(10); | |
5374 format %{"[$reg + $ireg]" %} | |
5375 interface(MEMORY_INTER) %{ | |
5376 base($reg); | |
5377 index($ireg); | |
5378 scale(0x0); | |
5379 disp(0x0); | |
5380 %} | |
5381 %} | |
5382 | |
5383 // // ------------------------------------------------------------------------- | |
5384 // // 486 architecture doesn't support "scale * index + offset" with out a base | |
5385 // // ------------------------------------------------------------------------- | |
5386 // // Scaled Memory Operands | |
5387 // // Indirect Memory Times Scale Plus Offset Operand | |
5388 // operand indScaleOffset(immP off, eRegI ireg, immI2 scale) %{ | |
5389 // match(AddP off (LShiftI ireg scale)); | |
5390 // | |
5391 // op_cost(10); | |
5392 // format %{"[$off + $ireg << $scale]" %} | |
5393 // interface(MEMORY_INTER) %{ | |
5394 // base(0x4); | |
5395 // index($ireg); | |
5396 // scale($scale); | |
5397 // disp($off); | |
5398 // %} | |
5399 // %} | |
5400 | |
5401 // Indirect Memory Times Scale Plus Index Register | |
5402 operand indIndexScale(eRegP reg, eRegI ireg, immI2 scale) %{ | |
5403 match(AddP reg (LShiftI ireg scale)); | |
5404 | |
5405 op_cost(10); | |
5406 format %{"[$reg + $ireg << $scale]" %} | |
5407 interface(MEMORY_INTER) %{ | |
5408 base($reg); | |
5409 index($ireg); | |
5410 scale($scale); | |
5411 disp(0x0); | |
5412 %} | |
5413 %} | |
5414 | |
5415 // Indirect Memory Times Scale Plus Index Register Plus Offset Operand | |
5416 operand indIndexScaleOffset(eRegP reg, immI off, eRegI ireg, immI2 scale) %{ | |
5417 match(AddP (AddP reg (LShiftI ireg scale)) off); | |
5418 | |
5419 op_cost(10); | |
5420 format %{"[$reg + $off + $ireg << $scale]" %} | |
5421 interface(MEMORY_INTER) %{ | |
5422 base($reg); | |
5423 index($ireg); | |
5424 scale($scale); | |
5425 disp($off); | |
5426 %} | |
5427 %} | |
5428 | |
5429 //----------Load Long Memory Operands------------------------------------------ | |
5430 // The load-long idiom will use it's address expression again after loading | |
5431 // the first word of the long. If the load-long destination overlaps with | |
5432 // registers used in the addressing expression, the 2nd half will be loaded | |
5433 // from a clobbered address. Fix this by requiring that load-long use | |
5434 // address registers that do not overlap with the load-long target. | |
5435 | |
5436 // load-long support | |
5437 operand load_long_RegP() %{ | |
5438 constraint(ALLOC_IN_RC(esi_reg)); | |
5439 match(RegP); | |
5440 match(eSIRegP); | |
5441 op_cost(100); | |
5442 format %{ %} | |
5443 interface(REG_INTER); | |
5444 %} | |
5445 | |
5446 // Indirect Memory Operand Long | |
5447 operand load_long_indirect(load_long_RegP reg) %{ | |
5448 constraint(ALLOC_IN_RC(esi_reg)); | |
5449 match(reg); | |
5450 | |
5451 format %{ "[$reg]" %} | |
5452 interface(MEMORY_INTER) %{ | |
5453 base($reg); | |
5454 index(0x4); | |
5455 scale(0x0); | |
5456 disp(0x0); | |
5457 %} | |
5458 %} | |
5459 | |
5460 // Indirect Memory Plus Long Offset Operand | |
5461 operand load_long_indOffset32(load_long_RegP reg, immI off) %{ | |
5462 match(AddP reg off); | |
5463 | |
5464 format %{ "[$reg + $off]" %} | |
5465 interface(MEMORY_INTER) %{ | |
5466 base($reg); | |
5467 index(0x4); | |
5468 scale(0x0); | |
5469 disp($off); | |
5470 %} | |
5471 %} | |
5472 | |
5473 opclass load_long_memory(load_long_indirect, load_long_indOffset32); | |
5474 | |
5475 | |
5476 //----------Special Memory Operands-------------------------------------------- | |
5477 // Stack Slot Operand - This operand is used for loading and storing temporary | |
5478 // values on the stack where a match requires a value to | |
5479 // flow through memory. | |
5480 operand stackSlotP(sRegP reg) %{ | |
5481 constraint(ALLOC_IN_RC(stack_slots)); | |
5482 // No match rule because this operand is only generated in matching | |
5483 format %{ "[$reg]" %} | |
5484 interface(MEMORY_INTER) %{ | |
5485 base(0x4); // ESP | |
5486 index(0x4); // No Index | |
5487 scale(0x0); // No Scale | |
5488 disp($reg); // Stack Offset | |
5489 %} | |
5490 %} | |
5491 | |
5492 operand stackSlotI(sRegI reg) %{ | |
5493 constraint(ALLOC_IN_RC(stack_slots)); | |
5494 // No match rule because this operand is only generated in matching | |
5495 format %{ "[$reg]" %} | |
5496 interface(MEMORY_INTER) %{ | |
5497 base(0x4); // ESP | |
5498 index(0x4); // No Index | |
5499 scale(0x0); // No Scale | |
5500 disp($reg); // Stack Offset | |
5501 %} | |
5502 %} | |
5503 | |
5504 operand stackSlotF(sRegF reg) %{ | |
5505 constraint(ALLOC_IN_RC(stack_slots)); | |
5506 // No match rule because this operand is only generated in matching | |
5507 format %{ "[$reg]" %} | |
5508 interface(MEMORY_INTER) %{ | |
5509 base(0x4); // ESP | |
5510 index(0x4); // No Index | |
5511 scale(0x0); // No Scale | |
5512 disp($reg); // Stack Offset | |
5513 %} | |
5514 %} | |
5515 | |
5516 operand stackSlotD(sRegD reg) %{ | |
5517 constraint(ALLOC_IN_RC(stack_slots)); | |
5518 // No match rule because this operand is only generated in matching | |
5519 format %{ "[$reg]" %} | |
5520 interface(MEMORY_INTER) %{ | |
5521 base(0x4); // ESP | |
5522 index(0x4); // No Index | |
5523 scale(0x0); // No Scale | |
5524 disp($reg); // Stack Offset | |
5525 %} | |
5526 %} | |
5527 | |
5528 operand stackSlotL(sRegL reg) %{ | |
5529 constraint(ALLOC_IN_RC(stack_slots)); | |
5530 // No match rule because this operand is only generated in matching | |
5531 format %{ "[$reg]" %} | |
5532 interface(MEMORY_INTER) %{ | |
5533 base(0x4); // ESP | |
5534 index(0x4); // No Index | |
5535 scale(0x0); // No Scale | |
5536 disp($reg); // Stack Offset | |
5537 %} | |
5538 %} | |
5539 | |
5540 //----------Memory Operands - Win95 Implicit Null Variants---------------- | |
5541 // Indirect Memory Operand | |
5542 operand indirect_win95_safe(eRegP_no_EBP reg) | |
5543 %{ | |
5544 constraint(ALLOC_IN_RC(e_reg)); | |
5545 match(reg); | |
5546 | |
5547 op_cost(100); | |
5548 format %{ "[$reg]" %} | |
5549 interface(MEMORY_INTER) %{ | |
5550 base($reg); | |
5551 index(0x4); | |
5552 scale(0x0); | |
5553 disp(0x0); | |
5554 %} | |
5555 %} | |
5556 | |
5557 // Indirect Memory Plus Short Offset Operand | |
5558 operand indOffset8_win95_safe(eRegP_no_EBP reg, immI8 off) | |
5559 %{ | |
5560 match(AddP reg off); | |
5561 | |
5562 op_cost(100); | |
5563 format %{ "[$reg + $off]" %} | |
5564 interface(MEMORY_INTER) %{ | |
5565 base($reg); | |
5566 index(0x4); | |
5567 scale(0x0); | |
5568 disp($off); | |
5569 %} | |
5570 %} | |
5571 | |
5572 // Indirect Memory Plus Long Offset Operand | |
5573 operand indOffset32_win95_safe(eRegP_no_EBP reg, immI off) | |
5574 %{ | |
5575 match(AddP reg off); | |
5576 | |
5577 op_cost(100); | |
5578 format %{ "[$reg + $off]" %} | |
5579 interface(MEMORY_INTER) %{ | |
5580 base($reg); | |
5581 index(0x4); | |
5582 scale(0x0); | |
5583 disp($off); | |
5584 %} | |
5585 %} | |
5586 | |
5587 // Indirect Memory Plus Index Register Plus Offset Operand | |
5588 operand indIndexOffset_win95_safe(eRegP_no_EBP reg, eRegI ireg, immI off) | |
5589 %{ | |
5590 match(AddP (AddP reg ireg) off); | |
5591 | |
5592 op_cost(100); | |
5593 format %{"[$reg + $off + $ireg]" %} | |
5594 interface(MEMORY_INTER) %{ | |
5595 base($reg); | |
5596 index($ireg); | |
5597 scale(0x0); | |
5598 disp($off); | |
5599 %} | |
5600 %} | |
5601 | |
5602 // Indirect Memory Times Scale Plus Index Register | |
5603 operand indIndexScale_win95_safe(eRegP_no_EBP reg, eRegI ireg, immI2 scale) | |
5604 %{ | |
5605 match(AddP reg (LShiftI ireg scale)); | |
5606 | |
5607 op_cost(100); | |
5608 format %{"[$reg + $ireg << $scale]" %} | |
5609 interface(MEMORY_INTER) %{ | |
5610 base($reg); | |
5611 index($ireg); | |
5612 scale($scale); | |
5613 disp(0x0); | |
5614 %} | |
5615 %} | |
5616 | |
5617 // Indirect Memory Times Scale Plus Index Register Plus Offset Operand | |
5618 operand indIndexScaleOffset_win95_safe(eRegP_no_EBP reg, immI off, eRegI ireg, immI2 scale) | |
5619 %{ | |
5620 match(AddP (AddP reg (LShiftI ireg scale)) off); | |
5621 | |
5622 op_cost(100); | |
5623 format %{"[$reg + $off + $ireg << $scale]" %} | |
5624 interface(MEMORY_INTER) %{ | |
5625 base($reg); | |
5626 index($ireg); | |
5627 scale($scale); | |
5628 disp($off); | |
5629 %} | |
5630 %} | |
5631 | |
5632 //----------Conditional Branch Operands---------------------------------------- | |
5633 // Comparison Op - This is the operation of the comparison, and is limited to | |
5634 // the following set of codes: | |
5635 // L (<), LE (<=), G (>), GE (>=), E (==), NE (!=) | |
5636 // | |
5637 // Other attributes of the comparison, such as unsignedness, are specified | |
5638 // by the comparison instruction that sets a condition code flags register. | |
5639 // That result is represented by a flags operand whose subtype is appropriate | |
5640 // to the unsignedness (etc.) of the comparison. | |
5641 // | |
5642 // Later, the instruction which matches both the Comparison Op (a Bool) and | |
5643 // the flags (produced by the Cmp) specifies the coding of the comparison op | |
5644 // by matching a specific subtype of Bool operand below, such as cmpOpU. | |
5645 | |
5646 // Comparision Code | |
5647 operand cmpOp() %{ | |
5648 match(Bool); | |
5649 | |
5650 format %{ "" %} | |
5651 interface(COND_INTER) %{ | |
5652 equal(0x4); | |
5653 not_equal(0x5); | |
5654 less(0xC); | |
5655 greater_equal(0xD); | |
5656 less_equal(0xE); | |
5657 greater(0xF); | |
5658 %} | |
5659 %} | |
5660 | |
5661 // Comparison Code, unsigned compare. Used by FP also, with | |
5662 // C2 (unordered) turned into GT or LT already. The other bits | |
5663 // C0 and C3 are turned into Carry & Zero flags. | |
5664 operand cmpOpU() %{ | |
5665 match(Bool); | |
5666 | |
5667 format %{ "" %} | |
5668 interface(COND_INTER) %{ | |
5669 equal(0x4); | |
5670 not_equal(0x5); | |
5671 less(0x2); | |
5672 greater_equal(0x3); | |
5673 less_equal(0x6); | |
5674 greater(0x7); | |
5675 %} | |
5676 %} | |
5677 | |
5678 // Comparison Code for FP conditional move | |
5679 operand cmpOp_fcmov() %{ | |
5680 match(Bool); | |
5681 | |
5682 format %{ "" %} | |
5683 interface(COND_INTER) %{ | |
5684 equal (0x0C8); | |
5685 not_equal (0x1C8); | |
5686 less (0x0C0); | |
5687 greater_equal(0x1C0); | |
5688 less_equal (0x0D0); | |
5689 greater (0x1D0); | |
5690 %} | |
5691 %} | |
5692 | |
5693 // Comparision Code used in long compares | |
5694 operand cmpOp_commute() %{ | |
5695 match(Bool); | |
5696 | |
5697 format %{ "" %} | |
5698 interface(COND_INTER) %{ | |
5699 equal(0x4); | |
5700 not_equal(0x5); | |
5701 less(0xF); | |
5702 greater_equal(0xE); | |
5703 less_equal(0xD); | |
5704 greater(0xC); | |
5705 %} | |
5706 %} | |
5707 | |
5708 //----------OPERAND CLASSES---------------------------------------------------- | |
5709 // Operand Classes are groups of operands that are used as to simplify | |
5710 // instruction definitions by not requiring the AD writer to specify seperate | |
5711 // instructions for every form of operand when the instruction accepts | |
5712 // multiple operand types with the same basic encoding and format. The classic | |
5713 // case of this is memory operands. | |
5714 | |
5715 opclass memory(direct, indirect, indOffset8, indOffset32, indOffset32X, indIndexOffset, | |
5716 indIndex, indIndexScale, indIndexScaleOffset); | |
5717 | |
5718 // Long memory operations are encoded in 2 instructions and a +4 offset. | |
5719 // This means some kind of offset is always required and you cannot use | |
5720 // an oop as the offset (done when working on static globals). | |
5721 opclass long_memory(direct, indirect, indOffset8, indOffset32, indIndexOffset, | |
5722 indIndex, indIndexScale, indIndexScaleOffset); | |
5723 | |
5724 | |
5725 //----------PIPELINE----------------------------------------------------------- | |
5726 // Rules which define the behavior of the target architectures pipeline. | |
5727 pipeline %{ | |
5728 | |
5729 //----------ATTRIBUTES--------------------------------------------------------- | |
5730 attributes %{ | |
5731 variable_size_instructions; // Fixed size instructions | |
5732 max_instructions_per_bundle = 3; // Up to 3 instructions per bundle | |
5733 instruction_unit_size = 1; // An instruction is 1 bytes long | |
5734 instruction_fetch_unit_size = 16; // The processor fetches one line | |
5735 instruction_fetch_units = 1; // of 16 bytes | |
5736 | |
5737 // List of nop instructions | |
5738 nops( MachNop ); | |
5739 %} | |
5740 | |
5741 //----------RESOURCES---------------------------------------------------------- | |
5742 // Resources are the functional units available to the machine | |
5743 | |
5744 // Generic P2/P3 pipeline | |
5745 // 3 decoders, only D0 handles big operands; a "bundle" is the limit of | |
5746 // 3 instructions decoded per cycle. | |
5747 // 2 load/store ops per cycle, 1 branch, 1 FPU, | |
5748 // 2 ALU op, only ALU0 handles mul/div instructions. | |
5749 resources( D0, D1, D2, DECODE = D0 | D1 | D2, | |
5750 MS0, MS1, MEM = MS0 | MS1, | |
5751 BR, FPU, | |
5752 ALU0, ALU1, ALU = ALU0 | ALU1 ); | |
5753 | |
5754 //----------PIPELINE DESCRIPTION----------------------------------------------- | |
5755 // Pipeline Description specifies the stages in the machine's pipeline | |
5756 | |
5757 // Generic P2/P3 pipeline | |
5758 pipe_desc(S0, S1, S2, S3, S4, S5); | |
5759 | |
5760 //----------PIPELINE CLASSES--------------------------------------------------- | |
5761 // Pipeline Classes describe the stages in which input and output are | |
5762 // referenced by the hardware pipeline. | |
5763 | |
5764 // Naming convention: ialu or fpu | |
5765 // Then: _reg | |
5766 // Then: _reg if there is a 2nd register | |
5767 // Then: _long if it's a pair of instructions implementing a long | |
5768 // Then: _fat if it requires the big decoder | |
5769 // Or: _mem if it requires the big decoder and a memory unit. | |
5770 | |
5771 // Integer ALU reg operation | |
5772 pipe_class ialu_reg(eRegI dst) %{ | |
5773 single_instruction; | |
5774 dst : S4(write); | |
5775 dst : S3(read); | |
5776 DECODE : S0; // any decoder | |
5777 ALU : S3; // any alu | |
5778 %} | |
5779 | |
5780 // Long ALU reg operation | |
5781 pipe_class ialu_reg_long(eRegL dst) %{ | |
5782 instruction_count(2); | |
5783 dst : S4(write); | |
5784 dst : S3(read); | |
5785 DECODE : S0(2); // any 2 decoders | |
5786 ALU : S3(2); // both alus | |
5787 %} | |
5788 | |
5789 // Integer ALU reg operation using big decoder | |
5790 pipe_class ialu_reg_fat(eRegI dst) %{ | |
5791 single_instruction; | |
5792 dst : S4(write); | |
5793 dst : S3(read); | |
5794 D0 : S0; // big decoder only | |
5795 ALU : S3; // any alu | |
5796 %} | |
5797 | |
5798 // Long ALU reg operation using big decoder | |
5799 pipe_class ialu_reg_long_fat(eRegL dst) %{ | |
5800 instruction_count(2); | |
5801 dst : S4(write); | |
5802 dst : S3(read); | |
5803 D0 : S0(2); // big decoder only; twice | |
5804 ALU : S3(2); // any 2 alus | |
5805 %} | |
5806 | |
5807 // Integer ALU reg-reg operation | |
5808 pipe_class ialu_reg_reg(eRegI dst, eRegI src) %{ | |
5809 single_instruction; | |
5810 dst : S4(write); | |
5811 src : S3(read); | |
5812 DECODE : S0; // any decoder | |
5813 ALU : S3; // any alu | |
5814 %} | |
5815 | |
5816 // Long ALU reg-reg operation | |
5817 pipe_class ialu_reg_reg_long(eRegL dst, eRegL src) %{ | |
5818 instruction_count(2); | |
5819 dst : S4(write); | |
5820 src : S3(read); | |
5821 DECODE : S0(2); // any 2 decoders | |
5822 ALU : S3(2); // both alus | |
5823 %} | |
5824 | |
5825 // Integer ALU reg-reg operation | |
5826 pipe_class ialu_reg_reg_fat(eRegI dst, memory src) %{ | |
5827 single_instruction; | |
5828 dst : S4(write); | |
5829 src : S3(read); | |
5830 D0 : S0; // big decoder only | |
5831 ALU : S3; // any alu | |
5832 %} | |
5833 | |
5834 // Long ALU reg-reg operation | |
5835 pipe_class ialu_reg_reg_long_fat(eRegL dst, eRegL src) %{ | |
5836 instruction_count(2); | |
5837 dst : S4(write); | |
5838 src : S3(read); | |
5839 D0 : S0(2); // big decoder only; twice | |
5840 ALU : S3(2); // both alus | |
5841 %} | |
5842 | |
5843 // Integer ALU reg-mem operation | |
5844 pipe_class ialu_reg_mem(eRegI dst, memory mem) %{ | |
5845 single_instruction; | |
5846 dst : S5(write); | |
5847 mem : S3(read); | |
5848 D0 : S0; // big decoder only | |
5849 ALU : S4; // any alu | |
5850 MEM : S3; // any mem | |
5851 %} | |
5852 | |
5853 // Long ALU reg-mem operation | |
5854 pipe_class ialu_reg_long_mem(eRegL dst, load_long_memory mem) %{ | |
5855 instruction_count(2); | |
5856 dst : S5(write); | |
5857 mem : S3(read); | |
5858 D0 : S0(2); // big decoder only; twice | |
5859 ALU : S4(2); // any 2 alus | |
5860 MEM : S3(2); // both mems | |
5861 %} | |
5862 | |
5863 // Integer mem operation (prefetch) | |
5864 pipe_class ialu_mem(memory mem) | |
5865 %{ | |
5866 single_instruction; | |
5867 mem : S3(read); | |
5868 D0 : S0; // big decoder only | |
5869 MEM : S3; // any mem | |
5870 %} | |
5871 | |
5872 // Integer Store to Memory | |
5873 pipe_class ialu_mem_reg(memory mem, eRegI src) %{ | |
5874 single_instruction; | |
5875 mem : S3(read); | |
5876 src : S5(read); | |
5877 D0 : S0; // big decoder only | |
5878 ALU : S4; // any alu | |
5879 MEM : S3; | |
5880 %} | |
5881 | |
5882 // Long Store to Memory | |
5883 pipe_class ialu_mem_long_reg(memory mem, eRegL src) %{ | |
5884 instruction_count(2); | |
5885 mem : S3(read); | |
5886 src : S5(read); | |
5887 D0 : S0(2); // big decoder only; twice | |
5888 ALU : S4(2); // any 2 alus | |
5889 MEM : S3(2); // Both mems | |
5890 %} | |
5891 | |
5892 // Integer Store to Memory | |
5893 pipe_class ialu_mem_imm(memory mem) %{ | |
5894 single_instruction; | |
5895 mem : S3(read); | |
5896 D0 : S0; // big decoder only | |
5897 ALU : S4; // any alu | |
5898 MEM : S3; | |
5899 %} | |
5900 | |
5901 // Integer ALU0 reg-reg operation | |
5902 pipe_class ialu_reg_reg_alu0(eRegI dst, eRegI src) %{ | |
5903 single_instruction; | |
5904 dst : S4(write); | |
5905 src : S3(read); | |
5906 D0 : S0; // Big decoder only | |
5907 ALU0 : S3; // only alu0 | |
5908 %} | |
5909 | |
5910 // Integer ALU0 reg-mem operation | |
5911 pipe_class ialu_reg_mem_alu0(eRegI dst, memory mem) %{ | |
5912 single_instruction; | |
5913 dst : S5(write); | |
5914 mem : S3(read); | |
5915 D0 : S0; // big decoder only | |
5916 ALU0 : S4; // ALU0 only | |
5917 MEM : S3; // any mem | |
5918 %} | |
5919 | |
5920 // Integer ALU reg-reg operation | |
5921 pipe_class ialu_cr_reg_reg(eFlagsReg cr, eRegI src1, eRegI src2) %{ | |
5922 single_instruction; | |
5923 cr : S4(write); | |
5924 src1 : S3(read); | |
5925 src2 : S3(read); | |
5926 DECODE : S0; // any decoder | |
5927 ALU : S3; // any alu | |
5928 %} | |
5929 | |
5930 // Integer ALU reg-imm operation | |
5931 pipe_class ialu_cr_reg_imm(eFlagsReg cr, eRegI src1) %{ | |
5932 single_instruction; | |
5933 cr : S4(write); | |
5934 src1 : S3(read); | |
5935 DECODE : S0; // any decoder | |
5936 ALU : S3; // any alu | |
5937 %} | |
5938 | |
5939 // Integer ALU reg-mem operation | |
5940 pipe_class ialu_cr_reg_mem(eFlagsReg cr, eRegI src1, memory src2) %{ | |
5941 single_instruction; | |
5942 cr : S4(write); | |
5943 src1 : S3(read); | |
5944 src2 : S3(read); | |
5945 D0 : S0; // big decoder only | |
5946 ALU : S4; // any alu | |
5947 MEM : S3; | |
5948 %} | |
5949 | |
5950 // Conditional move reg-reg | |
5951 pipe_class pipe_cmplt( eRegI p, eRegI q, eRegI y ) %{ | |
5952 instruction_count(4); | |
5953 y : S4(read); | |
5954 q : S3(read); | |
5955 p : S3(read); | |
5956 DECODE : S0(4); // any decoder | |
5957 %} | |
5958 | |
5959 // Conditional move reg-reg | |
5960 pipe_class pipe_cmov_reg( eRegI dst, eRegI src, eFlagsReg cr ) %{ | |
5961 single_instruction; | |
5962 dst : S4(write); | |
5963 src : S3(read); | |
5964 cr : S3(read); | |
5965 DECODE : S0; // any decoder | |
5966 %} | |
5967 | |
5968 // Conditional move reg-mem | |
5969 pipe_class pipe_cmov_mem( eFlagsReg cr, eRegI dst, memory src) %{ | |
5970 single_instruction; | |
5971 dst : S4(write); | |
5972 src : S3(read); | |
5973 cr : S3(read); | |
5974 DECODE : S0; // any decoder | |
5975 MEM : S3; | |
5976 %} | |
5977 | |
5978 // Conditional move reg-reg long | |
5979 pipe_class pipe_cmov_reg_long( eFlagsReg cr, eRegL dst, eRegL src) %{ | |
5980 single_instruction; | |
5981 dst : S4(write); | |
5982 src : S3(read); | |
5983 cr : S3(read); | |
5984 DECODE : S0(2); // any 2 decoders | |
5985 %} | |
5986 | |
5987 // Conditional move double reg-reg | |
5988 pipe_class pipe_cmovD_reg( eFlagsReg cr, regDPR1 dst, regD src) %{ | |
5989 single_instruction; | |
5990 dst : S4(write); | |
5991 src : S3(read); | |
5992 cr : S3(read); | |
5993 DECODE : S0; // any decoder | |
5994 %} | |
5995 | |
5996 // Float reg-reg operation | |
5997 pipe_class fpu_reg(regD dst) %{ | |
5998 instruction_count(2); | |
5999 dst : S3(read); | |
6000 DECODE : S0(2); // any 2 decoders | |
6001 FPU : S3; | |
6002 %} | |
6003 | |
6004 // Float reg-reg operation | |
6005 pipe_class fpu_reg_reg(regD dst, regD src) %{ | |
6006 instruction_count(2); | |
6007 dst : S4(write); | |
6008 src : S3(read); | |
6009 DECODE : S0(2); // any 2 decoders | |
6010 FPU : S3; | |
6011 %} | |
6012 | |
6013 // Float reg-reg operation | |
6014 pipe_class fpu_reg_reg_reg(regD dst, regD src1, regD src2) %{ | |
6015 instruction_count(3); | |
6016 dst : S4(write); | |
6017 src1 : S3(read); | |
6018 src2 : S3(read); | |
6019 DECODE : S0(3); // any 3 decoders | |
6020 FPU : S3(2); | |
6021 %} | |
6022 | |
6023 // Float reg-reg operation | |
6024 pipe_class fpu_reg_reg_reg_reg(regD dst, regD src1, regD src2, regD src3) %{ | |
6025 instruction_count(4); | |
6026 dst : S4(write); | |
6027 src1 : S3(read); | |
6028 src2 : S3(read); | |
6029 src3 : S3(read); | |
6030 DECODE : S0(4); // any 3 decoders | |
6031 FPU : S3(2); | |
6032 %} | |
6033 | |
6034 // Float reg-reg operation | |
6035 pipe_class fpu_reg_mem_reg_reg(regD dst, memory src1, regD src2, regD src3) %{ | |
6036 instruction_count(4); | |
6037 dst : S4(write); | |
6038 src1 : S3(read); | |
6039 src2 : S3(read); | |
6040 src3 : S3(read); | |
6041 DECODE : S1(3); // any 3 decoders | |
6042 D0 : S0; // Big decoder only | |
6043 FPU : S3(2); | |
6044 MEM : S3; | |
6045 %} | |
6046 | |
6047 // Float reg-mem operation | |
6048 pipe_class fpu_reg_mem(regD dst, memory mem) %{ | |
6049 instruction_count(2); | |
6050 dst : S5(write); | |
6051 mem : S3(read); | |
6052 D0 : S0; // big decoder only | |
6053 DECODE : S1; // any decoder for FPU POP | |
6054 FPU : S4; | |
6055 MEM : S3; // any mem | |
6056 %} | |
6057 | |
6058 // Float reg-mem operation | |
6059 pipe_class fpu_reg_reg_mem(regD dst, regD src1, memory mem) %{ | |
6060 instruction_count(3); | |
6061 dst : S5(write); | |
6062 src1 : S3(read); | |
6063 mem : S3(read); | |
6064 D0 : S0; // big decoder only | |
6065 DECODE : S1(2); // any decoder for FPU POP | |
6066 FPU : S4; | |
6067 MEM : S3; // any mem | |
6068 %} | |
6069 | |
6070 // Float mem-reg operation | |
6071 pipe_class fpu_mem_reg(memory mem, regD src) %{ | |
6072 instruction_count(2); | |
6073 src : S5(read); | |
6074 mem : S3(read); | |
6075 DECODE : S0; // any decoder for FPU PUSH | |
6076 D0 : S1; // big decoder only | |
6077 FPU : S4; | |
6078 MEM : S3; // any mem | |
6079 %} | |
6080 | |
6081 pipe_class fpu_mem_reg_reg(memory mem, regD src1, regD src2) %{ | |
6082 instruction_count(3); | |
6083 src1 : S3(read); | |
6084 src2 : S3(read); | |
6085 mem : S3(read); | |
6086 DECODE : S0(2); // any decoder for FPU PUSH | |
6087 D0 : S1; // big decoder only | |
6088 FPU : S4; | |
6089 MEM : S3; // any mem | |
6090 %} | |
6091 | |
6092 pipe_class fpu_mem_reg_mem(memory mem, regD src1, memory src2) %{ | |
6093 instruction_count(3); | |
6094 src1 : S3(read); | |
6095 src2 : S3(read); | |
6096 mem : S4(read); | |
6097 DECODE : S0; // any decoder for FPU PUSH | |
6098 D0 : S0(2); // big decoder only | |
6099 FPU : S4; | |
6100 MEM : S3(2); // any mem | |
6101 %} | |
6102 | |
6103 pipe_class fpu_mem_mem(memory dst, memory src1) %{ | |
6104 instruction_count(2); | |
6105 src1 : S3(read); | |
6106 dst : S4(read); | |
6107 D0 : S0(2); // big decoder only | |
6108 MEM : S3(2); // any mem | |
6109 %} | |
6110 | |
6111 pipe_class fpu_mem_mem_mem(memory dst, memory src1, memory src2) %{ | |
6112 instruction_count(3); | |
6113 src1 : S3(read); | |
6114 src2 : S3(read); | |
6115 dst : S4(read); | |
6116 D0 : S0(3); // big decoder only | |
6117 FPU : S4; | |
6118 MEM : S3(3); // any mem | |
6119 %} | |
6120 | |
6121 pipe_class fpu_mem_reg_con(memory mem, regD src1) %{ | |
6122 instruction_count(3); | |
6123 src1 : S4(read); | |
6124 mem : S4(read); | |
6125 DECODE : S0; // any decoder for FPU PUSH | |
6126 D0 : S0(2); // big decoder only | |
6127 FPU : S4; | |
6128 MEM : S3(2); // any mem | |
6129 %} | |
6130 | |
6131 // Float load constant | |
6132 pipe_class fpu_reg_con(regD dst) %{ | |
6133 instruction_count(2); | |
6134 dst : S5(write); | |
6135 D0 : S0; // big decoder only for the load | |
6136 DECODE : S1; // any decoder for FPU POP | |
6137 FPU : S4; | |
6138 MEM : S3; // any mem | |
6139 %} | |
6140 | |
6141 // Float load constant | |
6142 pipe_class fpu_reg_reg_con(regD dst, regD src) %{ | |
6143 instruction_count(3); | |
6144 dst : S5(write); | |
6145 src : S3(read); | |
6146 D0 : S0; // big decoder only for the load | |
6147 DECODE : S1(2); // any decoder for FPU POP | |
6148 FPU : S4; | |
6149 MEM : S3; // any mem | |
6150 %} | |
6151 | |
6152 // UnConditional branch | |
6153 pipe_class pipe_jmp( label labl ) %{ | |
6154 single_instruction; | |
6155 BR : S3; | |
6156 %} | |
6157 | |
6158 // Conditional branch | |
6159 pipe_class pipe_jcc( cmpOp cmp, eFlagsReg cr, label labl ) %{ | |
6160 single_instruction; | |
6161 cr : S1(read); | |
6162 BR : S3; | |
6163 %} | |
6164 | |
6165 // Allocation idiom | |
6166 pipe_class pipe_cmpxchg( eRegP dst, eRegP heap_ptr ) %{ | |
6167 instruction_count(1); force_serialization; | |
6168 fixed_latency(6); | |
6169 heap_ptr : S3(read); | |
6170 DECODE : S0(3); | |
6171 D0 : S2; | |
6172 MEM : S3; | |
6173 ALU : S3(2); | |
6174 dst : S5(write); | |
6175 BR : S5; | |
6176 %} | |
6177 | |
6178 // Generic big/slow expanded idiom | |
6179 pipe_class pipe_slow( ) %{ | |
6180 instruction_count(10); multiple_bundles; force_serialization; | |
6181 fixed_latency(100); | |
6182 D0 : S0(2); | |
6183 MEM : S3(2); | |
6184 %} | |
6185 | |
6186 // The real do-nothing guy | |
6187 pipe_class empty( ) %{ | |
6188 instruction_count(0); | |
6189 %} | |
6190 | |
6191 // Define the class for the Nop node | |
6192 define %{ | |
6193 MachNop = empty; | |
6194 %} | |
6195 | |
6196 %} | |
6197 | |
6198 //----------INSTRUCTIONS------------------------------------------------------- | |
6199 // | |
6200 // match -- States which machine-independent subtree may be replaced | |
6201 // by this instruction. | |
6202 // ins_cost -- The estimated cost of this instruction is used by instruction | |
6203 // selection to identify a minimum cost tree of machine | |
6204 // instructions that matches a tree of machine-independent | |
6205 // instructions. | |
6206 // format -- A string providing the disassembly for this instruction. | |
6207 // The value of an instruction's operand may be inserted | |
6208 // by referring to it with a '$' prefix. | |
6209 // opcode -- Three instruction opcodes may be provided. These are referred | |
6210 // to within an encode class as $primary, $secondary, and $tertiary | |
6211 // respectively. The primary opcode is commonly used to | |
6212 // indicate the type of machine instruction, while secondary | |
6213 // and tertiary are often used for prefix options or addressing | |
6214 // modes. | |
6215 // ins_encode -- A list of encode classes with parameters. The encode class | |
6216 // name must have been defined in an 'enc_class' specification | |
6217 // in the encode section of the architecture description. | |
6218 | |
6219 //----------BSWAP-Instruction-------------------------------------------------- | |
6220 instruct bytes_reverse_int(eRegI dst) %{ | |
6221 match(Set dst (ReverseBytesI dst)); | |
6222 | |
6223 format %{ "BSWAP $dst" %} | |
6224 opcode(0x0F, 0xC8); | |
6225 ins_encode( OpcP, OpcSReg(dst) ); | |
6226 ins_pipe( ialu_reg ); | |
6227 %} | |
6228 | |
6229 instruct bytes_reverse_long(eRegL dst) %{ | |
6230 match(Set dst (ReverseBytesL dst)); | |
6231 | |
6232 format %{ "BSWAP $dst.lo\n\t" | |
6233 "BSWAP $dst.hi\n\t" | |
6234 "XCHG $dst.lo $dst.hi" %} | |
6235 | |
6236 ins_cost(125); | |
6237 ins_encode( bswap_long_bytes(dst) ); | |
6238 ins_pipe( ialu_reg_reg); | |
6239 %} | |
6240 | |
6241 | |
6242 //----------Load/Store/Move Instructions--------------------------------------- | |
6243 //----------Load Instructions-------------------------------------------------- | |
6244 // Load Byte (8bit signed) | |
6245 instruct loadB(xRegI dst, memory mem) %{ | |
6246 match(Set dst (LoadB mem)); | |
6247 | |
6248 ins_cost(125); | |
6249 format %{ "MOVSX8 $dst,$mem" %} | |
6250 opcode(0xBE, 0x0F); | |
6251 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
6252 ins_pipe( ialu_reg_mem ); | |
6253 %} | |
6254 | |
6255 // Load Byte (8bit UNsigned) | |
6256 instruct loadUB(xRegI dst, memory mem, immI_255 bytemask) %{ | |
6257 match(Set dst (AndI (LoadB mem) bytemask)); | |
6258 | |
6259 ins_cost(125); | |
6260 format %{ "MOVZX8 $dst,$mem" %} | |
6261 opcode(0xB6, 0x0F); | |
6262 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
6263 ins_pipe( ialu_reg_mem ); | |
6264 %} | |
6265 | |
6266 // Load Char (16bit unsigned) | |
6267 instruct loadC(eRegI dst, memory mem) %{ | |
6268 match(Set dst (LoadC mem)); | |
6269 | |
6270 ins_cost(125); | |
6271 format %{ "MOVZX $dst,$mem" %} | |
6272 opcode(0xB7, 0x0F); | |
6273 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
6274 ins_pipe( ialu_reg_mem ); | |
6275 %} | |
6276 | |
6277 // Load Integer | |
6278 instruct loadI(eRegI dst, memory mem) %{ | |
6279 match(Set dst (LoadI mem)); | |
6280 | |
6281 ins_cost(125); | |
6282 format %{ "MOV $dst,$mem" %} | |
6283 opcode(0x8B); | |
6284 ins_encode( OpcP, RegMem(dst,mem)); | |
6285 ins_pipe( ialu_reg_mem ); | |
6286 %} | |
6287 | |
6288 // Load Long. Cannot clobber address while loading, so restrict address | |
6289 // register to ESI | |
6290 instruct loadL(eRegL dst, load_long_memory mem) %{ | |
6291 predicate(!((LoadLNode*)n)->require_atomic_access()); | |
6292 match(Set dst (LoadL mem)); | |
6293 | |
6294 ins_cost(250); | |
6295 format %{ "MOV $dst.lo,$mem\n\t" | |
6296 "MOV $dst.hi,$mem+4" %} | |
6297 opcode(0x8B, 0x8B); | |
6298 ins_encode( OpcP, RegMem(dst,mem), OpcS, RegMem_Hi(dst,mem)); | |
6299 ins_pipe( ialu_reg_long_mem ); | |
6300 %} | |
6301 | |
6302 // Volatile Load Long. Must be atomic, so do 64-bit FILD | |
6303 // then store it down to the stack and reload on the int | |
6304 // side. | |
6305 instruct loadL_volatile(stackSlotL dst, memory mem) %{ | |
6306 predicate(UseSSE<=1 && ((LoadLNode*)n)->require_atomic_access()); | |
6307 match(Set dst (LoadL mem)); | |
6308 | |
6309 ins_cost(200); | |
6310 format %{ "FILD $mem\t# Atomic volatile long load\n\t" | |
6311 "FISTp $dst" %} | |
6312 ins_encode(enc_loadL_volatile(mem,dst)); | |
6313 ins_pipe( fpu_reg_mem ); | |
6314 %} | |
6315 | |
6316 instruct loadLX_volatile(stackSlotL dst, memory mem, regXD tmp) %{ | |
6317 predicate(UseSSE>=2 && ((LoadLNode*)n)->require_atomic_access()); | |
6318 match(Set dst (LoadL mem)); | |
6319 effect(TEMP tmp); | |
6320 ins_cost(180); | |
6321 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
6322 "MOVSD $dst,$tmp" %} | |
6323 ins_encode(enc_loadLX_volatile(mem, dst, tmp)); | |
6324 ins_pipe( pipe_slow ); | |
6325 %} | |
6326 | |
6327 instruct loadLX_reg_volatile(eRegL dst, memory mem, regXD tmp) %{ | |
6328 predicate(UseSSE>=2 && ((LoadLNode*)n)->require_atomic_access()); | |
6329 match(Set dst (LoadL mem)); | |
6330 effect(TEMP tmp); | |
6331 ins_cost(160); | |
6332 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
6333 "MOVD $dst.lo,$tmp\n\t" | |
6334 "PSRLQ $tmp,32\n\t" | |
6335 "MOVD $dst.hi,$tmp" %} | |
6336 ins_encode(enc_loadLX_reg_volatile(mem, dst, tmp)); | |
6337 ins_pipe( pipe_slow ); | |
6338 %} | |
6339 | |
6340 // Load Range | |
6341 instruct loadRange(eRegI dst, memory mem) %{ | |
6342 match(Set dst (LoadRange mem)); | |
6343 | |
6344 ins_cost(125); | |
6345 format %{ "MOV $dst,$mem" %} | |
6346 opcode(0x8B); | |
6347 ins_encode( OpcP, RegMem(dst,mem)); | |
6348 ins_pipe( ialu_reg_mem ); | |
6349 %} | |
6350 | |
6351 | |
6352 // Load Pointer | |
6353 instruct loadP(eRegP dst, memory mem) %{ | |
6354 match(Set dst (LoadP mem)); | |
6355 | |
6356 ins_cost(125); | |
6357 format %{ "MOV $dst,$mem" %} | |
6358 opcode(0x8B); | |
6359 ins_encode( OpcP, RegMem(dst,mem)); | |
6360 ins_pipe( ialu_reg_mem ); | |
6361 %} | |
6362 | |
6363 // Load Klass Pointer | |
6364 instruct loadKlass(eRegP dst, memory mem) %{ | |
6365 match(Set dst (LoadKlass mem)); | |
6366 | |
6367 ins_cost(125); | |
6368 format %{ "MOV $dst,$mem" %} | |
6369 opcode(0x8B); | |
6370 ins_encode( OpcP, RegMem(dst,mem)); | |
6371 ins_pipe( ialu_reg_mem ); | |
6372 %} | |
6373 | |
6374 // Load Short (16bit signed) | |
6375 instruct loadS(eRegI dst, memory mem) %{ | |
6376 match(Set dst (LoadS mem)); | |
6377 | |
6378 ins_cost(125); | |
6379 format %{ "MOVSX $dst,$mem" %} | |
6380 opcode(0xBF, 0x0F); | |
6381 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
6382 ins_pipe( ialu_reg_mem ); | |
6383 %} | |
6384 | |
6385 // Load Double | |
6386 instruct loadD(regD dst, memory mem) %{ | |
6387 predicate(UseSSE<=1); | |
6388 match(Set dst (LoadD mem)); | |
6389 | |
6390 ins_cost(150); | |
6391 format %{ "FLD_D ST,$mem\n\t" | |
6392 "FSTP $dst" %} | |
6393 opcode(0xDD); /* DD /0 */ | |
6394 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
6395 Pop_Reg_D(dst) ); | |
6396 ins_pipe( fpu_reg_mem ); | |
6397 %} | |
6398 | |
6399 // Load Double to XMM | |
6400 instruct loadXD(regXD dst, memory mem) %{ | |
6401 predicate(UseSSE>=2 && UseXmmLoadAndClearUpper); | |
6402 match(Set dst (LoadD mem)); | |
6403 ins_cost(145); | |
6404 format %{ "MOVSD $dst,$mem" %} | |
6405 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x10), RegMem(dst,mem)); | |
6406 ins_pipe( pipe_slow ); | |
6407 %} | |
6408 | |
6409 instruct loadXD_partial(regXD dst, memory mem) %{ | |
6410 predicate(UseSSE>=2 && !UseXmmLoadAndClearUpper); | |
6411 match(Set dst (LoadD mem)); | |
6412 ins_cost(145); | |
6413 format %{ "MOVLPD $dst,$mem" %} | |
6414 ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x12), RegMem(dst,mem)); | |
6415 ins_pipe( pipe_slow ); | |
6416 %} | |
6417 | |
6418 // Load to XMM register (single-precision floating point) | |
6419 // MOVSS instruction | |
6420 instruct loadX(regX dst, memory mem) %{ | |
6421 predicate(UseSSE>=1); | |
6422 match(Set dst (LoadF mem)); | |
6423 ins_cost(145); | |
6424 format %{ "MOVSS $dst,$mem" %} | |
6425 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), RegMem(dst,mem)); | |
6426 ins_pipe( pipe_slow ); | |
6427 %} | |
6428 | |
6429 // Load Float | |
6430 instruct loadF(regF dst, memory mem) %{ | |
6431 predicate(UseSSE==0); | |
6432 match(Set dst (LoadF mem)); | |
6433 | |
6434 ins_cost(150); | |
6435 format %{ "FLD_S ST,$mem\n\t" | |
6436 "FSTP $dst" %} | |
6437 opcode(0xD9); /* D9 /0 */ | |
6438 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
6439 Pop_Reg_F(dst) ); | |
6440 ins_pipe( fpu_reg_mem ); | |
6441 %} | |
6442 | |
6443 // Load Aligned Packed Byte to XMM register | |
6444 instruct loadA8B(regXD dst, memory mem) %{ | |
6445 predicate(UseSSE>=1); | |
6446 match(Set dst (Load8B mem)); | |
6447 ins_cost(125); | |
6448 format %{ "MOVQ $dst,$mem\t! packed8B" %} | |
6449 ins_encode( movq_ld(dst, mem)); | |
6450 ins_pipe( pipe_slow ); | |
6451 %} | |
6452 | |
6453 // Load Aligned Packed Short to XMM register | |
6454 instruct loadA4S(regXD dst, memory mem) %{ | |
6455 predicate(UseSSE>=1); | |
6456 match(Set dst (Load4S mem)); | |
6457 ins_cost(125); | |
6458 format %{ "MOVQ $dst,$mem\t! packed4S" %} | |
6459 ins_encode( movq_ld(dst, mem)); | |
6460 ins_pipe( pipe_slow ); | |
6461 %} | |
6462 | |
6463 // Load Aligned Packed Char to XMM register | |
6464 instruct loadA4C(regXD dst, memory mem) %{ | |
6465 predicate(UseSSE>=1); | |
6466 match(Set dst (Load4C mem)); | |
6467 ins_cost(125); | |
6468 format %{ "MOVQ $dst,$mem\t! packed4C" %} | |
6469 ins_encode( movq_ld(dst, mem)); | |
6470 ins_pipe( pipe_slow ); | |
6471 %} | |
6472 | |
6473 // Load Aligned Packed Integer to XMM register | |
6474 instruct load2IU(regXD dst, memory mem) %{ | |
6475 predicate(UseSSE>=1); | |
6476 match(Set dst (Load2I mem)); | |
6477 ins_cost(125); | |
6478 format %{ "MOVQ $dst,$mem\t! packed2I" %} | |
6479 ins_encode( movq_ld(dst, mem)); | |
6480 ins_pipe( pipe_slow ); | |
6481 %} | |
6482 | |
6483 // Load Aligned Packed Single to XMM | |
6484 instruct loadA2F(regXD dst, memory mem) %{ | |
6485 predicate(UseSSE>=1); | |
6486 match(Set dst (Load2F mem)); | |
6487 ins_cost(145); | |
6488 format %{ "MOVQ $dst,$mem\t! packed2F" %} | |
6489 ins_encode( movq_ld(dst, mem)); | |
6490 ins_pipe( pipe_slow ); | |
6491 %} | |
6492 | |
6493 // Load Effective Address | |
6494 instruct leaP8(eRegP dst, indOffset8 mem) %{ | |
6495 match(Set dst mem); | |
6496 | |
6497 ins_cost(110); | |
6498 format %{ "LEA $dst,$mem" %} | |
6499 opcode(0x8D); | |
6500 ins_encode( OpcP, RegMem(dst,mem)); | |
6501 ins_pipe( ialu_reg_reg_fat ); | |
6502 %} | |
6503 | |
6504 instruct leaP32(eRegP dst, indOffset32 mem) %{ | |
6505 match(Set dst mem); | |
6506 | |
6507 ins_cost(110); | |
6508 format %{ "LEA $dst,$mem" %} | |
6509 opcode(0x8D); | |
6510 ins_encode( OpcP, RegMem(dst,mem)); | |
6511 ins_pipe( ialu_reg_reg_fat ); | |
6512 %} | |
6513 | |
6514 instruct leaPIdxOff(eRegP dst, indIndexOffset mem) %{ | |
6515 match(Set dst mem); | |
6516 | |
6517 ins_cost(110); | |
6518 format %{ "LEA $dst,$mem" %} | |
6519 opcode(0x8D); | |
6520 ins_encode( OpcP, RegMem(dst,mem)); | |
6521 ins_pipe( ialu_reg_reg_fat ); | |
6522 %} | |
6523 | |
6524 instruct leaPIdxScale(eRegP dst, indIndexScale mem) %{ | |
6525 match(Set dst mem); | |
6526 | |
6527 ins_cost(110); | |
6528 format %{ "LEA $dst,$mem" %} | |
6529 opcode(0x8D); | |
6530 ins_encode( OpcP, RegMem(dst,mem)); | |
6531 ins_pipe( ialu_reg_reg_fat ); | |
6532 %} | |
6533 | |
6534 instruct leaPIdxScaleOff(eRegP dst, indIndexScaleOffset mem) %{ | |
6535 match(Set dst mem); | |
6536 | |
6537 ins_cost(110); | |
6538 format %{ "LEA $dst,$mem" %} | |
6539 opcode(0x8D); | |
6540 ins_encode( OpcP, RegMem(dst,mem)); | |
6541 ins_pipe( ialu_reg_reg_fat ); | |
6542 %} | |
6543 | |
6544 // Load Constant | |
6545 instruct loadConI(eRegI dst, immI src) %{ | |
6546 match(Set dst src); | |
6547 | |
6548 format %{ "MOV $dst,$src" %} | |
6549 ins_encode( LdImmI(dst, src) ); | |
6550 ins_pipe( ialu_reg_fat ); | |
6551 %} | |
6552 | |
6553 // Load Constant zero | |
6554 instruct loadConI0(eRegI dst, immI0 src, eFlagsReg cr) %{ | |
6555 match(Set dst src); | |
6556 effect(KILL cr); | |
6557 | |
6558 ins_cost(50); | |
6559 format %{ "XOR $dst,$dst" %} | |
6560 opcode(0x33); /* + rd */ | |
6561 ins_encode( OpcP, RegReg( dst, dst ) ); | |
6562 ins_pipe( ialu_reg ); | |
6563 %} | |
6564 | |
6565 instruct loadConP(eRegP dst, immP src) %{ | |
6566 match(Set dst src); | |
6567 | |
6568 format %{ "MOV $dst,$src" %} | |
6569 opcode(0xB8); /* + rd */ | |
6570 ins_encode( LdImmP(dst, src) ); | |
6571 ins_pipe( ialu_reg_fat ); | |
6572 %} | |
6573 | |
6574 instruct loadConL(eRegL dst, immL src, eFlagsReg cr) %{ | |
6575 match(Set dst src); | |
6576 effect(KILL cr); | |
6577 ins_cost(200); | |
6578 format %{ "MOV $dst.lo,$src.lo\n\t" | |
6579 "MOV $dst.hi,$src.hi" %} | |
6580 opcode(0xB8); | |
6581 ins_encode( LdImmL_Lo(dst, src), LdImmL_Hi(dst, src) ); | |
6582 ins_pipe( ialu_reg_long_fat ); | |
6583 %} | |
6584 | |
6585 instruct loadConL0(eRegL dst, immL0 src, eFlagsReg cr) %{ | |
6586 match(Set dst src); | |
6587 effect(KILL cr); | |
6588 ins_cost(150); | |
6589 format %{ "XOR $dst.lo,$dst.lo\n\t" | |
6590 "XOR $dst.hi,$dst.hi" %} | |
6591 opcode(0x33,0x33); | |
6592 ins_encode( RegReg_Lo(dst,dst), RegReg_Hi(dst, dst) ); | |
6593 ins_pipe( ialu_reg_long ); | |
6594 %} | |
6595 | |
6596 // The instruction usage is guarded by predicate in operand immF(). | |
6597 instruct loadConF(regF dst, immF src) %{ | |
6598 match(Set dst src); | |
6599 ins_cost(125); | |
6600 | |
6601 format %{ "FLD_S ST,$src\n\t" | |
6602 "FSTP $dst" %} | |
6603 opcode(0xD9, 0x00); /* D9 /0 */ | |
6604 ins_encode(LdImmF(src), Pop_Reg_F(dst) ); | |
6605 ins_pipe( fpu_reg_con ); | |
6606 %} | |
6607 | |
6608 // The instruction usage is guarded by predicate in operand immXF(). | |
6609 instruct loadConX(regX dst, immXF con) %{ | |
6610 match(Set dst con); | |
6611 ins_cost(125); | |
6612 format %{ "MOVSS $dst,[$con]" %} | |
6613 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), LdImmX(dst, con)); | |
6614 ins_pipe( pipe_slow ); | |
6615 %} | |
6616 | |
6617 // The instruction usage is guarded by predicate in operand immXF0(). | |
6618 instruct loadConX0(regX dst, immXF0 src) %{ | |
6619 match(Set dst src); | |
6620 ins_cost(100); | |
6621 format %{ "XORPS $dst,$dst\t# float 0.0" %} | |
6622 ins_encode( Opcode(0x0F), Opcode(0x57), RegReg(dst,dst)); | |
6623 ins_pipe( pipe_slow ); | |
6624 %} | |
6625 | |
6626 // The instruction usage is guarded by predicate in operand immD(). | |
6627 instruct loadConD(regD dst, immD src) %{ | |
6628 match(Set dst src); | |
6629 ins_cost(125); | |
6630 | |
6631 format %{ "FLD_D ST,$src\n\t" | |
6632 "FSTP $dst" %} | |
6633 ins_encode(LdImmD(src), Pop_Reg_D(dst) ); | |
6634 ins_pipe( fpu_reg_con ); | |
6635 %} | |
6636 | |
6637 // The instruction usage is guarded by predicate in operand immXD(). | |
6638 instruct loadConXD(regXD dst, immXD con) %{ | |
6639 match(Set dst con); | |
6640 ins_cost(125); | |
6641 format %{ "MOVSD $dst,[$con]" %} | |
6642 ins_encode(load_conXD(dst, con)); | |
6643 ins_pipe( pipe_slow ); | |
6644 %} | |
6645 | |
6646 // The instruction usage is guarded by predicate in operand immXD0(). | |
6647 instruct loadConXD0(regXD dst, immXD0 src) %{ | |
6648 match(Set dst src); | |
6649 ins_cost(100); | |
6650 format %{ "XORPD $dst,$dst\t# double 0.0" %} | |
6651 ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x57), RegReg(dst,dst)); | |
6652 ins_pipe( pipe_slow ); | |
6653 %} | |
6654 | |
6655 // Load Stack Slot | |
6656 instruct loadSSI(eRegI dst, stackSlotI src) %{ | |
6657 match(Set dst src); | |
6658 ins_cost(125); | |
6659 | |
6660 format %{ "MOV $dst,$src" %} | |
6661 opcode(0x8B); | |
6662 ins_encode( OpcP, RegMem(dst,src)); | |
6663 ins_pipe( ialu_reg_mem ); | |
6664 %} | |
6665 | |
6666 instruct loadSSL(eRegL dst, stackSlotL src) %{ | |
6667 match(Set dst src); | |
6668 | |
6669 ins_cost(200); | |
6670 format %{ "MOV $dst,$src.lo\n\t" | |
6671 "MOV $dst+4,$src.hi" %} | |
6672 opcode(0x8B, 0x8B); | |
6673 ins_encode( OpcP, RegMem( dst, src ), OpcS, RegMem_Hi( dst, src ) ); | |
6674 ins_pipe( ialu_mem_long_reg ); | |
6675 %} | |
6676 | |
6677 // Load Stack Slot | |
6678 instruct loadSSP(eRegP dst, stackSlotP src) %{ | |
6679 match(Set dst src); | |
6680 ins_cost(125); | |
6681 | |
6682 format %{ "MOV $dst,$src" %} | |
6683 opcode(0x8B); | |
6684 ins_encode( OpcP, RegMem(dst,src)); | |
6685 ins_pipe( ialu_reg_mem ); | |
6686 %} | |
6687 | |
6688 // Load Stack Slot | |
6689 instruct loadSSF(regF dst, stackSlotF src) %{ | |
6690 match(Set dst src); | |
6691 ins_cost(125); | |
6692 | |
6693 format %{ "FLD_S $src\n\t" | |
6694 "FSTP $dst" %} | |
6695 opcode(0xD9); /* D9 /0, FLD m32real */ | |
6696 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
6697 Pop_Reg_F(dst) ); | |
6698 ins_pipe( fpu_reg_mem ); | |
6699 %} | |
6700 | |
6701 // Load Stack Slot | |
6702 instruct loadSSD(regD dst, stackSlotD src) %{ | |
6703 match(Set dst src); | |
6704 ins_cost(125); | |
6705 | |
6706 format %{ "FLD_D $src\n\t" | |
6707 "FSTP $dst" %} | |
6708 opcode(0xDD); /* DD /0, FLD m64real */ | |
6709 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
6710 Pop_Reg_D(dst) ); | |
6711 ins_pipe( fpu_reg_mem ); | |
6712 %} | |
6713 | |
6714 // Prefetch instructions. | |
6715 // Must be safe to execute with invalid address (cannot fault). | |
6716 | |
6717 instruct prefetchr0( memory mem ) %{ | |
6718 predicate(UseSSE==0 && !VM_Version::supports_3dnow()); | |
6719 match(PrefetchRead mem); | |
6720 ins_cost(0); | |
6721 size(0); | |
6722 format %{ "PREFETCHR (non-SSE is empty encoding)" %} | |
6723 ins_encode(); | |
6724 ins_pipe(empty); | |
6725 %} | |
6726 | |
6727 instruct prefetchr( memory mem ) %{ | |
6728 predicate(UseSSE==0 && VM_Version::supports_3dnow() || ReadPrefetchInstr==3); | |
6729 match(PrefetchRead mem); | |
6730 ins_cost(100); | |
6731 | |
6732 format %{ "PREFETCHR $mem\t! Prefetch into level 1 cache for read" %} | |
6733 opcode(0x0F, 0x0d); /* Opcode 0F 0d /0 */ | |
6734 ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); | |
6735 ins_pipe(ialu_mem); | |
6736 %} | |
6737 | |
6738 instruct prefetchrNTA( memory mem ) %{ | |
6739 predicate(UseSSE>=1 && ReadPrefetchInstr==0); | |
6740 match(PrefetchRead mem); | |
6741 ins_cost(100); | |
6742 | |
6743 format %{ "PREFETCHNTA $mem\t! Prefetch into non-temporal cache for read" %} | |
6744 opcode(0x0F, 0x18); /* Opcode 0F 18 /0 */ | |
6745 ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); | |
6746 ins_pipe(ialu_mem); | |
6747 %} | |
6748 | |
6749 instruct prefetchrT0( memory mem ) %{ | |
6750 predicate(UseSSE>=1 && ReadPrefetchInstr==1); | |
6751 match(PrefetchRead mem); | |
6752 ins_cost(100); | |
6753 | |
6754 format %{ "PREFETCHT0 $mem\t! Prefetch into L1 and L2 caches for read" %} | |
6755 opcode(0x0F, 0x18); /* Opcode 0F 18 /1 */ | |
6756 ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); | |
6757 ins_pipe(ialu_mem); | |
6758 %} | |
6759 | |
6760 instruct prefetchrT2( memory mem ) %{ | |
6761 predicate(UseSSE>=1 && ReadPrefetchInstr==2); | |
6762 match(PrefetchRead mem); | |
6763 ins_cost(100); | |
6764 | |
6765 format %{ "PREFETCHT2 $mem\t! Prefetch into L2 cache for read" %} | |
6766 opcode(0x0F, 0x18); /* Opcode 0F 18 /3 */ | |
6767 ins_encode(OpcP, OpcS, RMopc_Mem(0x03,mem)); | |
6768 ins_pipe(ialu_mem); | |
6769 %} | |
6770 | |
6771 instruct prefetchw0( memory mem ) %{ | |
6772 predicate(UseSSE==0 && !VM_Version::supports_3dnow()); | |
6773 match(PrefetchWrite mem); | |
6774 ins_cost(0); | |
6775 size(0); | |
6776 format %{ "Prefetch (non-SSE is empty encoding)" %} | |
6777 ins_encode(); | |
6778 ins_pipe(empty); | |
6779 %} | |
6780 | |
6781 instruct prefetchw( memory mem ) %{ | |
6782 predicate(UseSSE==0 && VM_Version::supports_3dnow() || AllocatePrefetchInstr==3); | |
6783 match( PrefetchWrite mem ); | |
6784 ins_cost(100); | |
6785 | |
6786 format %{ "PREFETCHW $mem\t! Prefetch into L1 cache and mark modified" %} | |
6787 opcode(0x0F, 0x0D); /* Opcode 0F 0D /1 */ | |
6788 ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); | |
6789 ins_pipe(ialu_mem); | |
6790 %} | |
6791 | |
6792 instruct prefetchwNTA( memory mem ) %{ | |
6793 predicate(UseSSE>=1 && AllocatePrefetchInstr==0); | |
6794 match(PrefetchWrite mem); | |
6795 ins_cost(100); | |
6796 | |
6797 format %{ "PREFETCHNTA $mem\t! Prefetch into non-temporal cache for write" %} | |
6798 opcode(0x0F, 0x18); /* Opcode 0F 18 /0 */ | |
6799 ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); | |
6800 ins_pipe(ialu_mem); | |
6801 %} | |
6802 | |
6803 instruct prefetchwT0( memory mem ) %{ | |
6804 predicate(UseSSE>=1 && AllocatePrefetchInstr==1); | |
6805 match(PrefetchWrite mem); | |
6806 ins_cost(100); | |
6807 | |
6808 format %{ "PREFETCHT0 $mem\t! Prefetch into L1 and L2 caches for write" %} | |
6809 opcode(0x0F, 0x18); /* Opcode 0F 18 /1 */ | |
6810 ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); | |
6811 ins_pipe(ialu_mem); | |
6812 %} | |
6813 | |
6814 instruct prefetchwT2( memory mem ) %{ | |
6815 predicate(UseSSE>=1 && AllocatePrefetchInstr==2); | |
6816 match(PrefetchWrite mem); | |
6817 ins_cost(100); | |
6818 | |
6819 format %{ "PREFETCHT2 $mem\t! Prefetch into L2 cache for write" %} | |
6820 opcode(0x0F, 0x18); /* Opcode 0F 18 /3 */ | |
6821 ins_encode(OpcP, OpcS, RMopc_Mem(0x03,mem)); | |
6822 ins_pipe(ialu_mem); | |
6823 %} | |
6824 | |
6825 //----------Store Instructions------------------------------------------------- | |
6826 | |
6827 // Store Byte | |
6828 instruct storeB(memory mem, xRegI src) %{ | |
6829 match(Set mem (StoreB mem src)); | |
6830 | |
6831 ins_cost(125); | |
6832 format %{ "MOV8 $mem,$src" %} | |
6833 opcode(0x88); | |
6834 ins_encode( OpcP, RegMem( src, mem ) ); | |
6835 ins_pipe( ialu_mem_reg ); | |
6836 %} | |
6837 | |
6838 // Store Char/Short | |
6839 instruct storeC(memory mem, eRegI src) %{ | |
6840 match(Set mem (StoreC mem src)); | |
6841 | |
6842 ins_cost(125); | |
6843 format %{ "MOV16 $mem,$src" %} | |
6844 opcode(0x89, 0x66); | |
6845 ins_encode( OpcS, OpcP, RegMem( src, mem ) ); | |
6846 ins_pipe( ialu_mem_reg ); | |
6847 %} | |
6848 | |
6849 // Store Integer | |
6850 instruct storeI(memory mem, eRegI src) %{ | |
6851 match(Set mem (StoreI mem src)); | |
6852 | |
6853 ins_cost(125); | |
6854 format %{ "MOV $mem,$src" %} | |
6855 opcode(0x89); | |
6856 ins_encode( OpcP, RegMem( src, mem ) ); | |
6857 ins_pipe( ialu_mem_reg ); | |
6858 %} | |
6859 | |
6860 // Store Long | |
6861 instruct storeL(long_memory mem, eRegL src) %{ | |
6862 predicate(!((StoreLNode*)n)->require_atomic_access()); | |
6863 match(Set mem (StoreL mem src)); | |
6864 | |
6865 ins_cost(200); | |
6866 format %{ "MOV $mem,$src.lo\n\t" | |
6867 "MOV $mem+4,$src.hi" %} | |
6868 opcode(0x89, 0x89); | |
6869 ins_encode( OpcP, RegMem( src, mem ), OpcS, RegMem_Hi( src, mem ) ); | |
6870 ins_pipe( ialu_mem_long_reg ); | |
6871 %} | |
6872 | |
6873 // Volatile Store Long. Must be atomic, so move it into | |
6874 // the FP TOS and then do a 64-bit FIST. Has to probe the | |
6875 // target address before the store (for null-ptr checks) | |
6876 // so the memory operand is used twice in the encoding. | |
6877 instruct storeL_volatile(memory mem, stackSlotL src, eFlagsReg cr ) %{ | |
6878 predicate(UseSSE<=1 && ((StoreLNode*)n)->require_atomic_access()); | |
6879 match(Set mem (StoreL mem src)); | |
6880 effect( KILL cr ); | |
6881 ins_cost(400); | |
6882 format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" | |
6883 "FILD $src\n\t" | |
6884 "FISTp $mem\t # 64-bit atomic volatile long store" %} | |
6885 opcode(0x3B); | |
6886 ins_encode( OpcP, RegMem( EAX, mem ), enc_storeL_volatile(mem,src)); | |
6887 ins_pipe( fpu_reg_mem ); | |
6888 %} | |
6889 | |
6890 instruct storeLX_volatile(memory mem, stackSlotL src, regXD tmp, eFlagsReg cr) %{ | |
6891 predicate(UseSSE>=2 && ((StoreLNode*)n)->require_atomic_access()); | |
6892 match(Set mem (StoreL mem src)); | |
6893 effect( TEMP tmp, KILL cr ); | |
6894 ins_cost(380); | |
6895 format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" | |
6896 "MOVSD $tmp,$src\n\t" | |
6897 "MOVSD $mem,$tmp\t # 64-bit atomic volatile long store" %} | |
6898 opcode(0x3B); | |
6899 ins_encode( OpcP, RegMem( EAX, mem ), enc_storeLX_volatile(mem, src, tmp)); | |
6900 ins_pipe( pipe_slow ); | |
6901 %} | |
6902 | |
6903 instruct storeLX_reg_volatile(memory mem, eRegL src, regXD tmp2, regXD tmp, eFlagsReg cr) %{ | |
6904 predicate(UseSSE>=2 && ((StoreLNode*)n)->require_atomic_access()); | |
6905 match(Set mem (StoreL mem src)); | |
6906 effect( TEMP tmp2 , TEMP tmp, KILL cr ); | |
6907 ins_cost(360); | |
6908 format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" | |
6909 "MOVD $tmp,$src.lo\n\t" | |
6910 "MOVD $tmp2,$src.hi\n\t" | |
6911 "PUNPCKLDQ $tmp,$tmp2\n\t" | |
6912 "MOVSD $mem,$tmp\t # 64-bit atomic volatile long store" %} | |
6913 opcode(0x3B); | |
6914 ins_encode( OpcP, RegMem( EAX, mem ), enc_storeLX_reg_volatile(mem, src, tmp, tmp2)); | |
6915 ins_pipe( pipe_slow ); | |
6916 %} | |
6917 | |
6918 // Store Pointer; for storing unknown oops and raw pointers | |
6919 instruct storeP(memory mem, anyRegP src) %{ | |
6920 match(Set mem (StoreP mem src)); | |
6921 | |
6922 ins_cost(125); | |
6923 format %{ "MOV $mem,$src" %} | |
6924 opcode(0x89); | |
6925 ins_encode( OpcP, RegMem( src, mem ) ); | |
6926 ins_pipe( ialu_mem_reg ); | |
6927 %} | |
6928 | |
6929 // Store Integer Immediate | |
6930 instruct storeImmI(memory mem, immI src) %{ | |
6931 match(Set mem (StoreI mem src)); | |
6932 | |
6933 ins_cost(150); | |
6934 format %{ "MOV $mem,$src" %} | |
6935 opcode(0xC7); /* C7 /0 */ | |
6936 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32( src )); | |
6937 ins_pipe( ialu_mem_imm ); | |
6938 %} | |
6939 | |
6940 // Store Short/Char Immediate | |
6941 instruct storeImmI16(memory mem, immI16 src) %{ | |
6942 predicate(UseStoreImmI16); | |
6943 match(Set mem (StoreC mem src)); | |
6944 | |
6945 ins_cost(150); | |
6946 format %{ "MOV16 $mem,$src" %} | |
6947 opcode(0xC7); /* C7 /0 Same as 32 store immediate with prefix */ | |
6948 ins_encode( SizePrefix, OpcP, RMopc_Mem(0x00,mem), Con16( src )); | |
6949 ins_pipe( ialu_mem_imm ); | |
6950 %} | |
6951 | |
6952 // Store Pointer Immediate; null pointers or constant oops that do not | |
6953 // need card-mark barriers. | |
6954 instruct storeImmP(memory mem, immP src) %{ | |
6955 match(Set mem (StoreP mem src)); | |
6956 | |
6957 ins_cost(150); | |
6958 format %{ "MOV $mem,$src" %} | |
6959 opcode(0xC7); /* C7 /0 */ | |
6960 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32( src )); | |
6961 ins_pipe( ialu_mem_imm ); | |
6962 %} | |
6963 | |
6964 // Store Byte Immediate | |
6965 instruct storeImmB(memory mem, immI8 src) %{ | |
6966 match(Set mem (StoreB mem src)); | |
6967 | |
6968 ins_cost(150); | |
6969 format %{ "MOV8 $mem,$src" %} | |
6970 opcode(0xC6); /* C6 /0 */ | |
6971 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con8or32( src )); | |
6972 ins_pipe( ialu_mem_imm ); | |
6973 %} | |
6974 | |
6975 // Store Aligned Packed Byte XMM register to memory | |
6976 instruct storeA8B(memory mem, regXD src) %{ | |
6977 predicate(UseSSE>=1); | |
6978 match(Set mem (Store8B mem src)); | |
6979 ins_cost(145); | |
6980 format %{ "MOVQ $mem,$src\t! packed8B" %} | |
6981 ins_encode( movq_st(mem, src)); | |
6982 ins_pipe( pipe_slow ); | |
6983 %} | |
6984 | |
6985 // Store Aligned Packed Char/Short XMM register to memory | |
6986 instruct storeA4C(memory mem, regXD src) %{ | |
6987 predicate(UseSSE>=1); | |
6988 match(Set mem (Store4C mem src)); | |
6989 ins_cost(145); | |
6990 format %{ "MOVQ $mem,$src\t! packed4C" %} | |
6991 ins_encode( movq_st(mem, src)); | |
6992 ins_pipe( pipe_slow ); | |
6993 %} | |
6994 | |
6995 // Store Aligned Packed Integer XMM register to memory | |
6996 instruct storeA2I(memory mem, regXD src) %{ | |
6997 predicate(UseSSE>=1); | |
6998 match(Set mem (Store2I mem src)); | |
6999 ins_cost(145); | |
7000 format %{ "MOVQ $mem,$src\t! packed2I" %} | |
7001 ins_encode( movq_st(mem, src)); | |
7002 ins_pipe( pipe_slow ); | |
7003 %} | |
7004 | |
7005 // Store CMS card-mark Immediate | |
7006 instruct storeImmCM(memory mem, immI8 src) %{ | |
7007 match(Set mem (StoreCM mem src)); | |
7008 | |
7009 ins_cost(150); | |
7010 format %{ "MOV8 $mem,$src\t! CMS card-mark imm0" %} | |
7011 opcode(0xC6); /* C6 /0 */ | |
7012 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con8or32( src )); | |
7013 ins_pipe( ialu_mem_imm ); | |
7014 %} | |
7015 | |
7016 // Store Double | |
7017 instruct storeD( memory mem, regDPR1 src) %{ | |
7018 predicate(UseSSE<=1); | |
7019 match(Set mem (StoreD mem src)); | |
7020 | |
7021 ins_cost(100); | |
7022 format %{ "FST_D $mem,$src" %} | |
7023 opcode(0xDD); /* DD /2 */ | |
7024 ins_encode( enc_FP_store(mem,src) ); | |
7025 ins_pipe( fpu_mem_reg ); | |
7026 %} | |
7027 | |
7028 // Store double does rounding on x86 | |
7029 instruct storeD_rounded( memory mem, regDPR1 src) %{ | |
7030 predicate(UseSSE<=1); | |
7031 match(Set mem (StoreD mem (RoundDouble src))); | |
7032 | |
7033 ins_cost(100); | |
7034 format %{ "FST_D $mem,$src\t# round" %} | |
7035 opcode(0xDD); /* DD /2 */ | |
7036 ins_encode( enc_FP_store(mem,src) ); | |
7037 ins_pipe( fpu_mem_reg ); | |
7038 %} | |
7039 | |
7040 // Store XMM register to memory (double-precision floating points) | |
7041 // MOVSD instruction | |
7042 instruct storeXD(memory mem, regXD src) %{ | |
7043 predicate(UseSSE>=2); | |
7044 match(Set mem (StoreD mem src)); | |
7045 ins_cost(95); | |
7046 format %{ "MOVSD $mem,$src" %} | |
7047 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x11), RegMem(src, mem)); | |
7048 ins_pipe( pipe_slow ); | |
7049 %} | |
7050 | |
7051 // Store XMM register to memory (single-precision floating point) | |
7052 // MOVSS instruction | |
7053 instruct storeX(memory mem, regX src) %{ | |
7054 predicate(UseSSE>=1); | |
7055 match(Set mem (StoreF mem src)); | |
7056 ins_cost(95); | |
7057 format %{ "MOVSS $mem,$src" %} | |
7058 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x11), RegMem(src, mem)); | |
7059 ins_pipe( pipe_slow ); | |
7060 %} | |
7061 | |
7062 // Store Aligned Packed Single Float XMM register to memory | |
7063 instruct storeA2F(memory mem, regXD src) %{ | |
7064 predicate(UseSSE>=1); | |
7065 match(Set mem (Store2F mem src)); | |
7066 ins_cost(145); | |
7067 format %{ "MOVQ $mem,$src\t! packed2F" %} | |
7068 ins_encode( movq_st(mem, src)); | |
7069 ins_pipe( pipe_slow ); | |
7070 %} | |
7071 | |
7072 // Store Float | |
7073 instruct storeF( memory mem, regFPR1 src) %{ | |
7074 predicate(UseSSE==0); | |
7075 match(Set mem (StoreF mem src)); | |
7076 | |
7077 ins_cost(100); | |
7078 format %{ "FST_S $mem,$src" %} | |
7079 opcode(0xD9); /* D9 /2 */ | |
7080 ins_encode( enc_FP_store(mem,src) ); | |
7081 ins_pipe( fpu_mem_reg ); | |
7082 %} | |
7083 | |
7084 // Store Float does rounding on x86 | |
7085 instruct storeF_rounded( memory mem, regFPR1 src) %{ | |
7086 predicate(UseSSE==0); | |
7087 match(Set mem (StoreF mem (RoundFloat src))); | |
7088 | |
7089 ins_cost(100); | |
7090 format %{ "FST_S $mem,$src\t# round" %} | |
7091 opcode(0xD9); /* D9 /2 */ | |
7092 ins_encode( enc_FP_store(mem,src) ); | |
7093 ins_pipe( fpu_mem_reg ); | |
7094 %} | |
7095 | |
7096 // Store Float does rounding on x86 | |
7097 instruct storeF_Drounded( memory mem, regDPR1 src) %{ | |
7098 predicate(UseSSE<=1); | |
7099 match(Set mem (StoreF mem (ConvD2F src))); | |
7100 | |
7101 ins_cost(100); | |
7102 format %{ "FST_S $mem,$src\t# D-round" %} | |
7103 opcode(0xD9); /* D9 /2 */ | |
7104 ins_encode( enc_FP_store(mem,src) ); | |
7105 ins_pipe( fpu_mem_reg ); | |
7106 %} | |
7107 | |
7108 // Store immediate Float value (it is faster than store from FPU register) | |
7109 // The instruction usage is guarded by predicate in operand immF(). | |
7110 instruct storeF_imm( memory mem, immF src) %{ | |
7111 match(Set mem (StoreF mem src)); | |
7112 | |
7113 ins_cost(50); | |
7114 format %{ "MOV $mem,$src\t# store float" %} | |
7115 opcode(0xC7); /* C7 /0 */ | |
7116 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32F_as_bits( src )); | |
7117 ins_pipe( ialu_mem_imm ); | |
7118 %} | |
7119 | |
7120 // Store immediate Float value (it is faster than store from XMM register) | |
7121 // The instruction usage is guarded by predicate in operand immXF(). | |
7122 instruct storeX_imm( memory mem, immXF src) %{ | |
7123 match(Set mem (StoreF mem src)); | |
7124 | |
7125 ins_cost(50); | |
7126 format %{ "MOV $mem,$src\t# store float" %} | |
7127 opcode(0xC7); /* C7 /0 */ | |
7128 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32XF_as_bits( src )); | |
7129 ins_pipe( ialu_mem_imm ); | |
7130 %} | |
7131 | |
7132 // Store Integer to stack slot | |
7133 instruct storeSSI(stackSlotI dst, eRegI src) %{ | |
7134 match(Set dst src); | |
7135 | |
7136 ins_cost(100); | |
7137 format %{ "MOV $dst,$src" %} | |
7138 opcode(0x89); | |
7139 ins_encode( OpcPRegSS( dst, src ) ); | |
7140 ins_pipe( ialu_mem_reg ); | |
7141 %} | |
7142 | |
7143 // Store Integer to stack slot | |
7144 instruct storeSSP(stackSlotP dst, eRegP src) %{ | |
7145 match(Set dst src); | |
7146 | |
7147 ins_cost(100); | |
7148 format %{ "MOV $dst,$src" %} | |
7149 opcode(0x89); | |
7150 ins_encode( OpcPRegSS( dst, src ) ); | |
7151 ins_pipe( ialu_mem_reg ); | |
7152 %} | |
7153 | |
7154 // Store Long to stack slot | |
7155 instruct storeSSL(stackSlotL dst, eRegL src) %{ | |
7156 match(Set dst src); | |
7157 | |
7158 ins_cost(200); | |
7159 format %{ "MOV $dst,$src.lo\n\t" | |
7160 "MOV $dst+4,$src.hi" %} | |
7161 opcode(0x89, 0x89); | |
7162 ins_encode( OpcP, RegMem( src, dst ), OpcS, RegMem_Hi( src, dst ) ); | |
7163 ins_pipe( ialu_mem_long_reg ); | |
7164 %} | |
7165 | |
7166 //----------MemBar Instructions----------------------------------------------- | |
7167 // Memory barrier flavors | |
7168 | |
7169 instruct membar_acquire() %{ | |
7170 match(MemBarAcquire); | |
7171 ins_cost(400); | |
7172 | |
7173 size(0); | |
7174 format %{ "MEMBAR-acquire" %} | |
7175 ins_encode( enc_membar_acquire ); | |
7176 ins_pipe(pipe_slow); | |
7177 %} | |
7178 | |
7179 instruct membar_acquire_lock() %{ | |
7180 match(MemBarAcquire); | |
7181 predicate(Matcher::prior_fast_lock(n)); | |
7182 ins_cost(0); | |
7183 | |
7184 size(0); | |
7185 format %{ "MEMBAR-acquire (prior CMPXCHG in FastLock so empty encoding)" %} | |
7186 ins_encode( ); | |
7187 ins_pipe(empty); | |
7188 %} | |
7189 | |
7190 instruct membar_release() %{ | |
7191 match(MemBarRelease); | |
7192 ins_cost(400); | |
7193 | |
7194 size(0); | |
7195 format %{ "MEMBAR-release" %} | |
7196 ins_encode( enc_membar_release ); | |
7197 ins_pipe(pipe_slow); | |
7198 %} | |
7199 | |
7200 instruct membar_release_lock() %{ | |
7201 match(MemBarRelease); | |
7202 predicate(Matcher::post_fast_unlock(n)); | |
7203 ins_cost(0); | |
7204 | |
7205 size(0); | |
7206 format %{ "MEMBAR-release (a FastUnlock follows so empty encoding)" %} | |
7207 ins_encode( ); | |
7208 ins_pipe(empty); | |
7209 %} | |
7210 | |
7211 instruct membar_volatile() %{ | |
7212 match(MemBarVolatile); | |
7213 ins_cost(400); | |
7214 | |
7215 format %{ "MEMBAR-volatile" %} | |
7216 ins_encode( enc_membar_volatile ); | |
7217 ins_pipe(pipe_slow); | |
7218 %} | |
7219 | |
7220 instruct unnecessary_membar_volatile() %{ | |
7221 match(MemBarVolatile); | |
7222 predicate(Matcher::post_store_load_barrier(n)); | |
7223 ins_cost(0); | |
7224 | |
7225 size(0); | |
7226 format %{ "MEMBAR-volatile (unnecessary so empty encoding)" %} | |
7227 ins_encode( ); | |
7228 ins_pipe(empty); | |
7229 %} | |
7230 | |
7231 //----------Move Instructions-------------------------------------------------- | |
7232 instruct castX2P(eAXRegP dst, eAXRegI src) %{ | |
7233 match(Set dst (CastX2P src)); | |
7234 format %{ "# X2P $dst, $src" %} | |
7235 ins_encode( /*empty encoding*/ ); | |
7236 ins_cost(0); | |
7237 ins_pipe(empty); | |
7238 %} | |
7239 | |
7240 instruct castP2X(eRegI dst, eRegP src ) %{ | |
7241 match(Set dst (CastP2X src)); | |
7242 ins_cost(50); | |
7243 format %{ "MOV $dst, $src\t# CastP2X" %} | |
7244 ins_encode( enc_Copy( dst, src) ); | |
7245 ins_pipe( ialu_reg_reg ); | |
7246 %} | |
7247 | |
7248 //----------Conditional Move--------------------------------------------------- | |
7249 // Conditional move | |
7250 instruct cmovI_reg(eRegI dst, eRegI src, eFlagsReg cr, cmpOp cop ) %{ | |
7251 predicate(VM_Version::supports_cmov() ); | |
7252 match(Set dst (CMoveI (Binary cop cr) (Binary dst src))); | |
7253 ins_cost(200); | |
7254 format %{ "CMOV$cop $dst,$src" %} | |
7255 opcode(0x0F,0x40); | |
7256 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
7257 ins_pipe( pipe_cmov_reg ); | |
7258 %} | |
7259 | |
7260 instruct cmovI_regU( eRegI dst, eRegI src, eFlagsRegU cr, cmpOpU cop ) %{ | |
7261 predicate(VM_Version::supports_cmov() ); | |
7262 match(Set dst (CMoveI (Binary cop cr) (Binary dst src))); | |
7263 ins_cost(200); | |
7264 format %{ "CMOV$cop $dst,$src" %} | |
7265 opcode(0x0F,0x40); | |
7266 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
7267 ins_pipe( pipe_cmov_reg ); | |
7268 %} | |
7269 | |
7270 // Conditional move | |
7271 instruct cmovI_mem(cmpOp cop, eFlagsReg cr, eRegI dst, memory src) %{ | |
7272 predicate(VM_Version::supports_cmov() ); | |
7273 match(Set dst (CMoveI (Binary cop cr) (Binary dst (LoadI src)))); | |
7274 ins_cost(250); | |
7275 format %{ "CMOV$cop $dst,$src" %} | |
7276 opcode(0x0F,0x40); | |
7277 ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
7278 ins_pipe( pipe_cmov_mem ); | |
7279 %} | |
7280 | |
7281 // Conditional move | |
7282 instruct cmovI_memu(cmpOpU cop, eFlagsRegU cr, eRegI dst, memory src) %{ | |
7283 predicate(VM_Version::supports_cmov() ); | |
7284 match(Set dst (CMoveI (Binary cop cr) (Binary dst (LoadI src)))); | |
7285 ins_cost(250); | |
7286 format %{ "CMOV$cop $dst,$src" %} | |
7287 opcode(0x0F,0x40); | |
7288 ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
7289 ins_pipe( pipe_cmov_mem ); | |
7290 %} | |
7291 | |
7292 // Conditional move | |
7293 instruct cmovP_reg(eRegP dst, eRegP src, eFlagsReg cr, cmpOp cop ) %{ | |
7294 predicate(VM_Version::supports_cmov() ); | |
7295 match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); | |
7296 ins_cost(200); | |
7297 format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
7298 opcode(0x0F,0x40); | |
7299 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
7300 ins_pipe( pipe_cmov_reg ); | |
7301 %} | |
7302 | |
7303 // Conditional move (non-P6 version) | |
7304 // Note: a CMoveP is generated for stubs and native wrappers | |
7305 // regardless of whether we are on a P6, so we | |
7306 // emulate a cmov here | |
7307 instruct cmovP_reg_nonP6(eRegP dst, eRegP src, eFlagsReg cr, cmpOp cop ) %{ | |
7308 match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); | |
7309 ins_cost(300); | |
7310 format %{ "Jn$cop skip\n\t" | |
7311 "MOV $dst,$src\t# pointer\n" | |
7312 "skip:" %} | |
7313 opcode(0x8b); | |
7314 ins_encode( enc_cmov_branch(cop, 0x2), OpcP, RegReg(dst, src)); | |
7315 ins_pipe( pipe_cmov_reg ); | |
7316 %} | |
7317 | |
7318 // Conditional move | |
7319 instruct cmovP_regU(eRegP dst, eRegP src, eFlagsRegU cr, cmpOpU cop ) %{ | |
7320 predicate(VM_Version::supports_cmov() ); | |
7321 match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); | |
7322 ins_cost(200); | |
7323 format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
7324 opcode(0x0F,0x40); | |
7325 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
7326 ins_pipe( pipe_cmov_reg ); | |
7327 %} | |
7328 | |
7329 // DISABLED: Requires the ADLC to emit a bottom_type call that | |
7330 // correctly meets the two pointer arguments; one is an incoming | |
7331 // register but the other is a memory operand. ALSO appears to | |
7332 // be buggy with implicit null checks. | |
7333 // | |
7334 //// Conditional move | |
7335 //instruct cmovP_mem(cmpOp cop, eFlagsReg cr, eRegP dst, memory src) %{ | |
7336 // predicate(VM_Version::supports_cmov() ); | |
7337 // match(Set dst (CMoveP (Binary cop cr) (Binary dst (LoadP src)))); | |
7338 // ins_cost(250); | |
7339 // format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
7340 // opcode(0x0F,0x40); | |
7341 // ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
7342 // ins_pipe( pipe_cmov_mem ); | |
7343 //%} | |
7344 // | |
7345 //// Conditional move | |
7346 //instruct cmovP_memU(cmpOpU cop, eFlagsRegU cr, eRegP dst, memory src) %{ | |
7347 // predicate(VM_Version::supports_cmov() ); | |
7348 // match(Set dst (CMoveP (Binary cop cr) (Binary dst (LoadP src)))); | |
7349 // ins_cost(250); | |
7350 // format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
7351 // opcode(0x0F,0x40); | |
7352 // ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
7353 // ins_pipe( pipe_cmov_mem ); | |
7354 //%} | |
7355 | |
7356 // Conditional move | |
7357 instruct fcmovD_regU(cmpOp_fcmov cop, eFlagsRegU cr, regDPR1 dst, regD src) %{ | |
7358 predicate(UseSSE<=1); | |
7359 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
7360 ins_cost(200); | |
7361 format %{ "FCMOV$cop $dst,$src\t# double" %} | |
7362 opcode(0xDA); | |
7363 ins_encode( enc_cmov_d(cop,src) ); | |
7364 ins_pipe( pipe_cmovD_reg ); | |
7365 %} | |
7366 | |
7367 // Conditional move | |
7368 instruct fcmovF_regU(cmpOp_fcmov cop, eFlagsRegU cr, regFPR1 dst, regF src) %{ | |
7369 predicate(UseSSE==0); | |
7370 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
7371 ins_cost(200); | |
7372 format %{ "FCMOV$cop $dst,$src\t# float" %} | |
7373 opcode(0xDA); | |
7374 ins_encode( enc_cmov_d(cop,src) ); | |
7375 ins_pipe( pipe_cmovD_reg ); | |
7376 %} | |
7377 | |
7378 // Float CMOV on Intel doesn't handle *signed* compares, only unsigned. | |
7379 instruct fcmovD_regS(cmpOp cop, eFlagsReg cr, regD dst, regD src) %{ | |
7380 predicate(UseSSE<=1); | |
7381 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
7382 ins_cost(200); | |
7383 format %{ "Jn$cop skip\n\t" | |
7384 "MOV $dst,$src\t# double\n" | |
7385 "skip:" %} | |
7386 opcode (0xdd, 0x3); /* DD D8+i or DD /3 */ | |
7387 ins_encode( enc_cmov_branch( cop, 0x4 ), Push_Reg_D(src), OpcP, RegOpc(dst) ); | |
7388 ins_pipe( pipe_cmovD_reg ); | |
7389 %} | |
7390 | |
7391 // Float CMOV on Intel doesn't handle *signed* compares, only unsigned. | |
7392 instruct fcmovF_regS(cmpOp cop, eFlagsReg cr, regF dst, regF src) %{ | |
7393 predicate(UseSSE==0); | |
7394 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
7395 ins_cost(200); | |
7396 format %{ "Jn$cop skip\n\t" | |
7397 "MOV $dst,$src\t# float\n" | |
7398 "skip:" %} | |
7399 opcode (0xdd, 0x3); /* DD D8+i or DD /3 */ | |
7400 ins_encode( enc_cmov_branch( cop, 0x4 ), Push_Reg_F(src), OpcP, RegOpc(dst) ); | |
7401 ins_pipe( pipe_cmovD_reg ); | |
7402 %} | |
7403 | |
7404 // No CMOVE with SSE/SSE2 | |
7405 instruct fcmovX_regS(cmpOp cop, eFlagsReg cr, regX dst, regX src) %{ | |
7406 predicate (UseSSE>=1); | |
7407 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
7408 ins_cost(200); | |
7409 format %{ "Jn$cop skip\n\t" | |
7410 "MOVSS $dst,$src\t# float\n" | |
7411 "skip:" %} | |
7412 ins_encode %{ | |
7413 Label skip; | |
7414 // Invert sense of branch from sense of CMOV | |
7415 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
7416 __ movflt($dst$$XMMRegister, $src$$XMMRegister); | |
7417 __ bind(skip); | |
7418 %} | |
7419 ins_pipe( pipe_slow ); | |
7420 %} | |
7421 | |
7422 // No CMOVE with SSE/SSE2 | |
7423 instruct fcmovXD_regS(cmpOp cop, eFlagsReg cr, regXD dst, regXD src) %{ | |
7424 predicate (UseSSE>=2); | |
7425 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
7426 ins_cost(200); | |
7427 format %{ "Jn$cop skip\n\t" | |
7428 "MOVSD $dst,$src\t# float\n" | |
7429 "skip:" %} | |
7430 ins_encode %{ | |
7431 Label skip; | |
7432 // Invert sense of branch from sense of CMOV | |
7433 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
7434 __ movdbl($dst$$XMMRegister, $src$$XMMRegister); | |
7435 __ bind(skip); | |
7436 %} | |
7437 ins_pipe( pipe_slow ); | |
7438 %} | |
7439 | |
7440 // unsigned version | |
7441 instruct fcmovX_regU(cmpOpU cop, eFlagsRegU cr, regX dst, regX src) %{ | |
7442 predicate (UseSSE>=1); | |
7443 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
7444 ins_cost(200); | |
7445 format %{ "Jn$cop skip\n\t" | |
7446 "MOVSS $dst,$src\t# float\n" | |
7447 "skip:" %} | |
7448 ins_encode %{ | |
7449 Label skip; | |
7450 // Invert sense of branch from sense of CMOV | |
7451 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
7452 __ movflt($dst$$XMMRegister, $src$$XMMRegister); | |
7453 __ bind(skip); | |
7454 %} | |
7455 ins_pipe( pipe_slow ); | |
7456 %} | |
7457 | |
7458 // unsigned version | |
7459 instruct fcmovXD_regU(cmpOpU cop, eFlagsRegU cr, regXD dst, regXD src) %{ | |
7460 predicate (UseSSE>=2); | |
7461 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
7462 ins_cost(200); | |
7463 format %{ "Jn$cop skip\n\t" | |
7464 "MOVSD $dst,$src\t# float\n" | |
7465 "skip:" %} | |
7466 ins_encode %{ | |
7467 Label skip; | |
7468 // Invert sense of branch from sense of CMOV | |
7469 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
7470 __ movdbl($dst$$XMMRegister, $src$$XMMRegister); | |
7471 __ bind(skip); | |
7472 %} | |
7473 ins_pipe( pipe_slow ); | |
7474 %} | |
7475 | |
7476 instruct cmovL_reg(cmpOp cop, eFlagsReg cr, eRegL dst, eRegL src) %{ | |
7477 predicate(VM_Version::supports_cmov() ); | |
7478 match(Set dst (CMoveL (Binary cop cr) (Binary dst src))); | |
7479 ins_cost(200); | |
7480 format %{ "CMOV$cop $dst.lo,$src.lo\n\t" | |
7481 "CMOV$cop $dst.hi,$src.hi" %} | |
7482 opcode(0x0F,0x40); | |
7483 ins_encode( enc_cmov(cop), RegReg_Lo2( dst, src ), enc_cmov(cop), RegReg_Hi2( dst, src ) ); | |
7484 ins_pipe( pipe_cmov_reg_long ); | |
7485 %} | |
7486 | |
7487 instruct cmovL_regU(cmpOpU cop, eFlagsRegU cr, eRegL dst, eRegL src) %{ | |
7488 predicate(VM_Version::supports_cmov() ); | |
7489 match(Set dst (CMoveL (Binary cop cr) (Binary dst src))); | |
7490 ins_cost(200); | |
7491 format %{ "CMOV$cop $dst.lo,$src.lo\n\t" | |
7492 "CMOV$cop $dst.hi,$src.hi" %} | |
7493 opcode(0x0F,0x40); | |
7494 ins_encode( enc_cmov(cop), RegReg_Lo2( dst, src ), enc_cmov(cop), RegReg_Hi2( dst, src ) ); | |
7495 ins_pipe( pipe_cmov_reg_long ); | |
7496 %} | |
7497 | |
7498 //----------Arithmetic Instructions-------------------------------------------- | |
7499 //----------Addition Instructions---------------------------------------------- | |
7500 // Integer Addition Instructions | |
7501 instruct addI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
7502 match(Set dst (AddI dst src)); | |
7503 effect(KILL cr); | |
7504 | |
7505 size(2); | |
7506 format %{ "ADD $dst,$src" %} | |
7507 opcode(0x03); | |
7508 ins_encode( OpcP, RegReg( dst, src) ); | |
7509 ins_pipe( ialu_reg_reg ); | |
7510 %} | |
7511 | |
7512 instruct addI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
7513 match(Set dst (AddI dst src)); | |
7514 effect(KILL cr); | |
7515 | |
7516 format %{ "ADD $dst,$src" %} | |
7517 opcode(0x81, 0x00); /* /0 id */ | |
7518 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
7519 ins_pipe( ialu_reg ); | |
7520 %} | |
7521 | |
7522 instruct incI_eReg(eRegI dst, immI1 src, eFlagsReg cr) %{ | |
7523 predicate(UseIncDec); | |
7524 match(Set dst (AddI dst src)); | |
7525 effect(KILL cr); | |
7526 | |
7527 size(1); | |
7528 format %{ "INC $dst" %} | |
7529 opcode(0x40); /* */ | |
7530 ins_encode( Opc_plus( primary, dst ) ); | |
7531 ins_pipe( ialu_reg ); | |
7532 %} | |
7533 | |
7534 instruct leaI_eReg_immI(eRegI dst, eRegI src0, immI src1) %{ | |
7535 match(Set dst (AddI src0 src1)); | |
7536 ins_cost(110); | |
7537 | |
7538 format %{ "LEA $dst,[$src0 + $src1]" %} | |
7539 opcode(0x8D); /* 0x8D /r */ | |
7540 ins_encode( OpcP, RegLea( dst, src0, src1 ) ); | |
7541 ins_pipe( ialu_reg_reg ); | |
7542 %} | |
7543 | |
7544 instruct leaP_eReg_immI(eRegP dst, eRegP src0, immI src1) %{ | |
7545 match(Set dst (AddP src0 src1)); | |
7546 ins_cost(110); | |
7547 | |
7548 format %{ "LEA $dst,[$src0 + $src1]\t# ptr" %} | |
7549 opcode(0x8D); /* 0x8D /r */ | |
7550 ins_encode( OpcP, RegLea( dst, src0, src1 ) ); | |
7551 ins_pipe( ialu_reg_reg ); | |
7552 %} | |
7553 | |
7554 instruct decI_eReg(eRegI dst, immI_M1 src, eFlagsReg cr) %{ | |
7555 predicate(UseIncDec); | |
7556 match(Set dst (AddI dst src)); | |
7557 effect(KILL cr); | |
7558 | |
7559 size(1); | |
7560 format %{ "DEC $dst" %} | |
7561 opcode(0x48); /* */ | |
7562 ins_encode( Opc_plus( primary, dst ) ); | |
7563 ins_pipe( ialu_reg ); | |
7564 %} | |
7565 | |
7566 instruct addP_eReg(eRegP dst, eRegI src, eFlagsReg cr) %{ | |
7567 match(Set dst (AddP dst src)); | |
7568 effect(KILL cr); | |
7569 | |
7570 size(2); | |
7571 format %{ "ADD $dst,$src" %} | |
7572 opcode(0x03); | |
7573 ins_encode( OpcP, RegReg( dst, src) ); | |
7574 ins_pipe( ialu_reg_reg ); | |
7575 %} | |
7576 | |
7577 instruct addP_eReg_imm(eRegP dst, immI src, eFlagsReg cr) %{ | |
7578 match(Set dst (AddP dst src)); | |
7579 effect(KILL cr); | |
7580 | |
7581 format %{ "ADD $dst,$src" %} | |
7582 opcode(0x81,0x00); /* Opcode 81 /0 id */ | |
7583 // ins_encode( RegImm( dst, src) ); | |
7584 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
7585 ins_pipe( ialu_reg ); | |
7586 %} | |
7587 | |
7588 instruct addI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
7589 match(Set dst (AddI dst (LoadI src))); | |
7590 effect(KILL cr); | |
7591 | |
7592 ins_cost(125); | |
7593 format %{ "ADD $dst,$src" %} | |
7594 opcode(0x03); | |
7595 ins_encode( OpcP, RegMem( dst, src) ); | |
7596 ins_pipe( ialu_reg_mem ); | |
7597 %} | |
7598 | |
7599 instruct addI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
7600 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
7601 effect(KILL cr); | |
7602 | |
7603 ins_cost(150); | |
7604 format %{ "ADD $dst,$src" %} | |
7605 opcode(0x01); /* Opcode 01 /r */ | |
7606 ins_encode( OpcP, RegMem( src, dst ) ); | |
7607 ins_pipe( ialu_mem_reg ); | |
7608 %} | |
7609 | |
7610 // Add Memory with Immediate | |
7611 instruct addI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
7612 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
7613 effect(KILL cr); | |
7614 | |
7615 ins_cost(125); | |
7616 format %{ "ADD $dst,$src" %} | |
7617 opcode(0x81); /* Opcode 81 /0 id */ | |
7618 ins_encode( OpcSE( src ), RMopc_Mem(0x00,dst), Con8or32( src ) ); | |
7619 ins_pipe( ialu_mem_imm ); | |
7620 %} | |
7621 | |
7622 instruct incI_mem(memory dst, immI1 src, eFlagsReg cr) %{ | |
7623 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
7624 effect(KILL cr); | |
7625 | |
7626 ins_cost(125); | |
7627 format %{ "INC $dst" %} | |
7628 opcode(0xFF); /* Opcode FF /0 */ | |
7629 ins_encode( OpcP, RMopc_Mem(0x00,dst)); | |
7630 ins_pipe( ialu_mem_imm ); | |
7631 %} | |
7632 | |
7633 instruct decI_mem(memory dst, immI_M1 src, eFlagsReg cr) %{ | |
7634 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
7635 effect(KILL cr); | |
7636 | |
7637 ins_cost(125); | |
7638 format %{ "DEC $dst" %} | |
7639 opcode(0xFF); /* Opcode FF /1 */ | |
7640 ins_encode( OpcP, RMopc_Mem(0x01,dst)); | |
7641 ins_pipe( ialu_mem_imm ); | |
7642 %} | |
7643 | |
7644 | |
7645 instruct checkCastPP( eRegP dst ) %{ | |
7646 match(Set dst (CheckCastPP dst)); | |
7647 | |
7648 size(0); | |
7649 format %{ "#checkcastPP of $dst" %} | |
7650 ins_encode( /*empty encoding*/ ); | |
7651 ins_pipe( empty ); | |
7652 %} | |
7653 | |
7654 instruct castPP( eRegP dst ) %{ | |
7655 match(Set dst (CastPP dst)); | |
7656 format %{ "#castPP of $dst" %} | |
7657 ins_encode( /*empty encoding*/ ); | |
7658 ins_pipe( empty ); | |
7659 %} | |
7660 | |
7661 instruct castII( eRegI dst ) %{ | |
7662 match(Set dst (CastII dst)); | |
7663 format %{ "#castII of $dst" %} | |
7664 ins_encode( /*empty encoding*/ ); | |
7665 ins_cost(0); | |
7666 ins_pipe( empty ); | |
7667 %} | |
7668 | |
7669 | |
7670 // Load-locked - same as a regular pointer load when used with compare-swap | |
7671 instruct loadPLocked(eRegP dst, memory mem) %{ | |
7672 match(Set dst (LoadPLocked mem)); | |
7673 | |
7674 ins_cost(125); | |
7675 format %{ "MOV $dst,$mem\t# Load ptr. locked" %} | |
7676 opcode(0x8B); | |
7677 ins_encode( OpcP, RegMem(dst,mem)); | |
7678 ins_pipe( ialu_reg_mem ); | |
7679 %} | |
7680 | |
7681 // LoadLong-locked - same as a volatile long load when used with compare-swap | |
7682 instruct loadLLocked(stackSlotL dst, load_long_memory mem) %{ | |
7683 predicate(UseSSE<=1); | |
7684 match(Set dst (LoadLLocked mem)); | |
7685 | |
7686 ins_cost(200); | |
7687 format %{ "FILD $mem\t# Atomic volatile long load\n\t" | |
7688 "FISTp $dst" %} | |
7689 ins_encode(enc_loadL_volatile(mem,dst)); | |
7690 ins_pipe( fpu_reg_mem ); | |
7691 %} | |
7692 | |
7693 instruct loadLX_Locked(stackSlotL dst, load_long_memory mem, regXD tmp) %{ | |
7694 predicate(UseSSE>=2); | |
7695 match(Set dst (LoadLLocked mem)); | |
7696 effect(TEMP tmp); | |
7697 ins_cost(180); | |
7698 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
7699 "MOVSD $dst,$tmp" %} | |
7700 ins_encode(enc_loadLX_volatile(mem, dst, tmp)); | |
7701 ins_pipe( pipe_slow ); | |
7702 %} | |
7703 | |
7704 instruct loadLX_reg_Locked(eRegL dst, load_long_memory mem, regXD tmp) %{ | |
7705 predicate(UseSSE>=2); | |
7706 match(Set dst (LoadLLocked mem)); | |
7707 effect(TEMP tmp); | |
7708 ins_cost(160); | |
7709 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
7710 "MOVD $dst.lo,$tmp\n\t" | |
7711 "PSRLQ $tmp,32\n\t" | |
7712 "MOVD $dst.hi,$tmp" %} | |
7713 ins_encode(enc_loadLX_reg_volatile(mem, dst, tmp)); | |
7714 ins_pipe( pipe_slow ); | |
7715 %} | |
7716 | |
7717 // Conditional-store of the updated heap-top. | |
7718 // Used during allocation of the shared heap. | |
7719 // Sets flags (EQ) on success. Implemented with a CMPXCHG on Intel. | |
7720 instruct storePConditional( memory heap_top_ptr, eAXRegP oldval, eRegP newval, eFlagsReg cr ) %{ | |
7721 match(Set cr (StorePConditional heap_top_ptr (Binary oldval newval))); | |
7722 // EAX is killed if there is contention, but then it's also unused. | |
7723 // In the common case of no contention, EAX holds the new oop address. | |
7724 format %{ "CMPXCHG $heap_top_ptr,$newval\t# If EAX==$heap_top_ptr Then store $newval into $heap_top_ptr" %} | |
7725 ins_encode( lock_prefix, Opcode(0x0F), Opcode(0xB1), RegMem(newval,heap_top_ptr) ); | |
7726 ins_pipe( pipe_cmpxchg ); | |
7727 %} | |
7728 | |
7729 // Conditional-store of a long value | |
7730 // Returns a boolean value (0/1) on success. Implemented with a CMPXCHG8 on Intel. | |
7731 // mem_ptr can actually be in either ESI or EDI | |
7732 instruct storeLConditional( eRegI res, eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr ) %{ | |
7733 match(Set res (StoreLConditional mem_ptr (Binary oldval newval))); | |
7734 effect(KILL cr); | |
7735 // EDX:EAX is killed if there is contention, but then it's also unused. | |
7736 // In the common case of no contention, EDX:EAX holds the new oop address. | |
7737 format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EDX:EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
7738 "MOV $res,0\n\t" | |
7739 "JNE,s fail\n\t" | |
7740 "MOV $res,1\n" | |
7741 "fail:" %} | |
7742 ins_encode( enc_cmpxchg8(mem_ptr), | |
7743 enc_flags_ne_to_boolean(res) ); | |
7744 ins_pipe( pipe_cmpxchg ); | |
7745 %} | |
7746 | |
7747 // Conditional-store of a long value | |
7748 // ZF flag is set on success, reset otherwise. Implemented with a CMPXCHG8 on Intel. | |
7749 // mem_ptr can actually be in either ESI or EDI | |
7750 instruct storeLConditional_flags( eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr, immI0 zero ) %{ | |
7751 match(Set cr (CmpI (StoreLConditional mem_ptr (Binary oldval newval)) zero)); | |
7752 // EDX:EAX is killed if there is contention, but then it's also unused. | |
7753 // In the common case of no contention, EDX:EAX holds the new oop address. | |
7754 format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" %} | |
7755 ins_encode( enc_cmpxchg8(mem_ptr) ); | |
7756 ins_pipe( pipe_cmpxchg ); | |
7757 %} | |
7758 | |
7759 // No flag versions for CompareAndSwap{P,I,L} because matcher can't match them | |
7760 | |
7761 instruct compareAndSwapL( eRegI res, eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr ) %{ | |
7762 match(Set res (CompareAndSwapL mem_ptr (Binary oldval newval))); | |
7763 effect(KILL cr, KILL oldval); | |
7764 format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EDX:EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
7765 "MOV $res,0\n\t" | |
7766 "JNE,s fail\n\t" | |
7767 "MOV $res,1\n" | |
7768 "fail:" %} | |
7769 ins_encode( enc_cmpxchg8(mem_ptr), | |
7770 enc_flags_ne_to_boolean(res) ); | |
7771 ins_pipe( pipe_cmpxchg ); | |
7772 %} | |
7773 | |
7774 instruct compareAndSwapP( eRegI res, pRegP mem_ptr, eAXRegP oldval, eCXRegP newval, eFlagsReg cr) %{ | |
7775 match(Set res (CompareAndSwapP mem_ptr (Binary oldval newval))); | |
7776 effect(KILL cr, KILL oldval); | |
7777 format %{ "CMPXCHG [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
7778 "MOV $res,0\n\t" | |
7779 "JNE,s fail\n\t" | |
7780 "MOV $res,1\n" | |
7781 "fail:" %} | |
7782 ins_encode( enc_cmpxchg(mem_ptr), enc_flags_ne_to_boolean(res) ); | |
7783 ins_pipe( pipe_cmpxchg ); | |
7784 %} | |
7785 | |
7786 instruct compareAndSwapI( eRegI res, pRegP mem_ptr, eAXRegI oldval, eCXRegI newval, eFlagsReg cr) %{ | |
7787 match(Set res (CompareAndSwapI mem_ptr (Binary oldval newval))); | |
7788 effect(KILL cr, KILL oldval); | |
7789 format %{ "CMPXCHG [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
7790 "MOV $res,0\n\t" | |
7791 "JNE,s fail\n\t" | |
7792 "MOV $res,1\n" | |
7793 "fail:" %} | |
7794 ins_encode( enc_cmpxchg(mem_ptr), enc_flags_ne_to_boolean(res) ); | |
7795 ins_pipe( pipe_cmpxchg ); | |
7796 %} | |
7797 | |
7798 //----------Subtraction Instructions------------------------------------------- | |
7799 // Integer Subtraction Instructions | |
7800 instruct subI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
7801 match(Set dst (SubI dst src)); | |
7802 effect(KILL cr); | |
7803 | |
7804 size(2); | |
7805 format %{ "SUB $dst,$src" %} | |
7806 opcode(0x2B); | |
7807 ins_encode( OpcP, RegReg( dst, src) ); | |
7808 ins_pipe( ialu_reg_reg ); | |
7809 %} | |
7810 | |
7811 instruct subI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
7812 match(Set dst (SubI dst src)); | |
7813 effect(KILL cr); | |
7814 | |
7815 format %{ "SUB $dst,$src" %} | |
7816 opcode(0x81,0x05); /* Opcode 81 /5 */ | |
7817 // ins_encode( RegImm( dst, src) ); | |
7818 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
7819 ins_pipe( ialu_reg ); | |
7820 %} | |
7821 | |
7822 instruct subI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
7823 match(Set dst (SubI dst (LoadI src))); | |
7824 effect(KILL cr); | |
7825 | |
7826 ins_cost(125); | |
7827 format %{ "SUB $dst,$src" %} | |
7828 opcode(0x2B); | |
7829 ins_encode( OpcP, RegMem( dst, src) ); | |
7830 ins_pipe( ialu_reg_mem ); | |
7831 %} | |
7832 | |
7833 instruct subI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
7834 match(Set dst (StoreI dst (SubI (LoadI dst) src))); | |
7835 effect(KILL cr); | |
7836 | |
7837 ins_cost(150); | |
7838 format %{ "SUB $dst,$src" %} | |
7839 opcode(0x29); /* Opcode 29 /r */ | |
7840 ins_encode( OpcP, RegMem( src, dst ) ); | |
7841 ins_pipe( ialu_mem_reg ); | |
7842 %} | |
7843 | |
7844 // Subtract from a pointer | |
7845 instruct subP_eReg(eRegP dst, eRegI src, immI0 zero, eFlagsReg cr) %{ | |
7846 match(Set dst (AddP dst (SubI zero src))); | |
7847 effect(KILL cr); | |
7848 | |
7849 size(2); | |
7850 format %{ "SUB $dst,$src" %} | |
7851 opcode(0x2B); | |
7852 ins_encode( OpcP, RegReg( dst, src) ); | |
7853 ins_pipe( ialu_reg_reg ); | |
7854 %} | |
7855 | |
7856 instruct negI_eReg(eRegI dst, immI0 zero, eFlagsReg cr) %{ | |
7857 match(Set dst (SubI zero dst)); | |
7858 effect(KILL cr); | |
7859 | |
7860 size(2); | |
7861 format %{ "NEG $dst" %} | |
7862 opcode(0xF7,0x03); // Opcode F7 /3 | |
7863 ins_encode( OpcP, RegOpc( dst ) ); | |
7864 ins_pipe( ialu_reg ); | |
7865 %} | |
7866 | |
7867 | |
7868 //----------Multiplication/Division Instructions------------------------------- | |
7869 // Integer Multiplication Instructions | |
7870 // Multiply Register | |
7871 instruct mulI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
7872 match(Set dst (MulI dst src)); | |
7873 effect(KILL cr); | |
7874 | |
7875 size(3); | |
7876 ins_cost(300); | |
7877 format %{ "IMUL $dst,$src" %} | |
7878 opcode(0xAF, 0x0F); | |
7879 ins_encode( OpcS, OpcP, RegReg( dst, src) ); | |
7880 ins_pipe( ialu_reg_reg_alu0 ); | |
7881 %} | |
7882 | |
7883 // Multiply 32-bit Immediate | |
7884 instruct mulI_eReg_imm(eRegI dst, eRegI src, immI imm, eFlagsReg cr) %{ | |
7885 match(Set dst (MulI src imm)); | |
7886 effect(KILL cr); | |
7887 | |
7888 ins_cost(300); | |
7889 format %{ "IMUL $dst,$src,$imm" %} | |
7890 opcode(0x69); /* 69 /r id */ | |
7891 ins_encode( OpcSE(imm), RegReg( dst, src ), Con8or32( imm ) ); | |
7892 ins_pipe( ialu_reg_reg_alu0 ); | |
7893 %} | |
7894 | |
7895 instruct loadConL_low_only(eADXRegL_low_only dst, immL32 src, eFlagsReg cr) %{ | |
7896 match(Set dst src); | |
7897 effect(KILL cr); | |
7898 | |
7899 // Note that this is artificially increased to make it more expensive than loadConL | |
7900 ins_cost(250); | |
7901 format %{ "MOV EAX,$src\t// low word only" %} | |
7902 opcode(0xB8); | |
7903 ins_encode( LdImmL_Lo(dst, src) ); | |
7904 ins_pipe( ialu_reg_fat ); | |
7905 %} | |
7906 | |
7907 // Multiply by 32-bit Immediate, taking the shifted high order results | |
7908 // (special case for shift by 32) | |
7909 instruct mulI_imm_high(eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32 cnt, eFlagsReg cr) %{ | |
7910 match(Set dst (ConvL2I (RShiftL (MulL (ConvI2L src1) src2) cnt))); | |
7911 predicate( _kids[0]->_kids[0]->_kids[1]->_leaf->Opcode() == Op_ConL && | |
7912 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() >= min_jint && | |
7913 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() <= max_jint ); | |
7914 effect(USE src1, KILL cr); | |
7915 | |
7916 // Note that this is adjusted by 150 to compensate for the overcosting of loadConL_low_only | |
7917 ins_cost(0*100 + 1*400 - 150); | |
7918 format %{ "IMUL EDX:EAX,$src1" %} | |
7919 ins_encode( multiply_con_and_shift_high( dst, src1, src2, cnt, cr ) ); | |
7920 ins_pipe( pipe_slow ); | |
7921 %} | |
7922 | |
7923 // Multiply by 32-bit Immediate, taking the shifted high order results | |
7924 instruct mulI_imm_RShift_high(eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32_63 cnt, eFlagsReg cr) %{ | |
7925 match(Set dst (ConvL2I (RShiftL (MulL (ConvI2L src1) src2) cnt))); | |
7926 predicate( _kids[0]->_kids[0]->_kids[1]->_leaf->Opcode() == Op_ConL && | |
7927 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() >= min_jint && | |
7928 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() <= max_jint ); | |
7929 effect(USE src1, KILL cr); | |
7930 | |
7931 // Note that this is adjusted by 150 to compensate for the overcosting of loadConL_low_only | |
7932 ins_cost(1*100 + 1*400 - 150); | |
7933 format %{ "IMUL EDX:EAX,$src1\n\t" | |
7934 "SAR EDX,$cnt-32" %} | |
7935 ins_encode( multiply_con_and_shift_high( dst, src1, src2, cnt, cr ) ); | |
7936 ins_pipe( pipe_slow ); | |
7937 %} | |
7938 | |
7939 // Multiply Memory 32-bit Immediate | |
7940 instruct mulI_mem_imm(eRegI dst, memory src, immI imm, eFlagsReg cr) %{ | |
7941 match(Set dst (MulI (LoadI src) imm)); | |
7942 effect(KILL cr); | |
7943 | |
7944 ins_cost(300); | |
7945 format %{ "IMUL $dst,$src,$imm" %} | |
7946 opcode(0x69); /* 69 /r id */ | |
7947 ins_encode( OpcSE(imm), RegMem( dst, src ), Con8or32( imm ) ); | |
7948 ins_pipe( ialu_reg_mem_alu0 ); | |
7949 %} | |
7950 | |
7951 // Multiply Memory | |
7952 instruct mulI(eRegI dst, memory src, eFlagsReg cr) %{ | |
7953 match(Set dst (MulI dst (LoadI src))); | |
7954 effect(KILL cr); | |
7955 | |
7956 ins_cost(350); | |
7957 format %{ "IMUL $dst,$src" %} | |
7958 opcode(0xAF, 0x0F); | |
7959 ins_encode( OpcS, OpcP, RegMem( dst, src) ); | |
7960 ins_pipe( ialu_reg_mem_alu0 ); | |
7961 %} | |
7962 | |
7963 // Multiply Register Int to Long | |
7964 instruct mulI2L(eADXRegL dst, eAXRegI src, nadxRegI src1, eFlagsReg flags) %{ | |
7965 // Basic Idea: long = (long)int * (long)int | |
7966 match(Set dst (MulL (ConvI2L src) (ConvI2L src1))); | |
7967 effect(DEF dst, USE src, USE src1, KILL flags); | |
7968 | |
7969 ins_cost(300); | |
7970 format %{ "IMUL $dst,$src1" %} | |
7971 | |
7972 ins_encode( long_int_multiply( dst, src1 ) ); | |
7973 ins_pipe( ialu_reg_reg_alu0 ); | |
7974 %} | |
7975 | |
7976 instruct mulIS_eReg(eADXRegL dst, immL_32bits mask, eFlagsReg flags, eAXRegI src, nadxRegI src1) %{ | |
7977 // Basic Idea: long = (int & 0xffffffffL) * (int & 0xffffffffL) | |
7978 match(Set dst (MulL (AndL (ConvI2L src) mask) (AndL (ConvI2L src1) mask))); | |
7979 effect(KILL flags); | |
7980 | |
7981 ins_cost(300); | |
7982 format %{ "MUL $dst,$src1" %} | |
7983 | |
7984 ins_encode( long_uint_multiply(dst, src1) ); | |
7985 ins_pipe( ialu_reg_reg_alu0 ); | |
7986 %} | |
7987 | |
7988 // Multiply Register Long | |
7989 instruct mulL_eReg(eADXRegL dst, eRegL src, eRegI tmp, eFlagsReg cr) %{ | |
7990 match(Set dst (MulL dst src)); | |
7991 effect(KILL cr, TEMP tmp); | |
7992 ins_cost(4*100+3*400); | |
7993 // Basic idea: lo(result) = lo(x_lo * y_lo) | |
7994 // hi(result) = hi(x_lo * y_lo) + lo(x_hi * y_lo) + lo(x_lo * y_hi) | |
7995 format %{ "MOV $tmp,$src.lo\n\t" | |
7996 "IMUL $tmp,EDX\n\t" | |
7997 "MOV EDX,$src.hi\n\t" | |
7998 "IMUL EDX,EAX\n\t" | |
7999 "ADD $tmp,EDX\n\t" | |
8000 "MUL EDX:EAX,$src.lo\n\t" | |
8001 "ADD EDX,$tmp" %} | |
8002 ins_encode( long_multiply( dst, src, tmp ) ); | |
8003 ins_pipe( pipe_slow ); | |
8004 %} | |
8005 | |
8006 // Multiply Register Long by small constant | |
8007 instruct mulL_eReg_con(eADXRegL dst, immL_127 src, eRegI tmp, eFlagsReg cr) %{ | |
8008 match(Set dst (MulL dst src)); | |
8009 effect(KILL cr, TEMP tmp); | |
8010 ins_cost(2*100+2*400); | |
8011 size(12); | |
8012 // Basic idea: lo(result) = lo(src * EAX) | |
8013 // hi(result) = hi(src * EAX) + lo(src * EDX) | |
8014 format %{ "IMUL $tmp,EDX,$src\n\t" | |
8015 "MOV EDX,$src\n\t" | |
8016 "MUL EDX\t# EDX*EAX -> EDX:EAX\n\t" | |
8017 "ADD EDX,$tmp" %} | |
8018 ins_encode( long_multiply_con( dst, src, tmp ) ); | |
8019 ins_pipe( pipe_slow ); | |
8020 %} | |
8021 | |
8022 // Integer DIV with Register | |
8023 instruct divI_eReg(eAXRegI rax, eDXRegI rdx, eCXRegI div, eFlagsReg cr) %{ | |
8024 match(Set rax (DivI rax div)); | |
8025 effect(KILL rdx, KILL cr); | |
8026 size(26); | |
8027 ins_cost(30*100+10*100); | |
8028 format %{ "CMP EAX,0x80000000\n\t" | |
8029 "JNE,s normal\n\t" | |
8030 "XOR EDX,EDX\n\t" | |
8031 "CMP ECX,-1\n\t" | |
8032 "JE,s done\n" | |
8033 "normal: CDQ\n\t" | |
8034 "IDIV $div\n\t" | |
8035 "done:" %} | |
8036 opcode(0xF7, 0x7); /* Opcode F7 /7 */ | |
8037 ins_encode( cdq_enc, OpcP, RegOpc(div) ); | |
8038 ins_pipe( ialu_reg_reg_alu0 ); | |
8039 %} | |
8040 | |
8041 // Divide Register Long | |
8042 instruct divL_eReg( eADXRegL dst, eRegL src1, eRegL src2, eFlagsReg cr, eCXRegI cx, eBXRegI bx ) %{ | |
8043 match(Set dst (DivL src1 src2)); | |
8044 effect( KILL cr, KILL cx, KILL bx ); | |
8045 ins_cost(10000); | |
8046 format %{ "PUSH $src1.hi\n\t" | |
8047 "PUSH $src1.lo\n\t" | |
8048 "PUSH $src2.hi\n\t" | |
8049 "PUSH $src2.lo\n\t" | |
8050 "CALL SharedRuntime::ldiv\n\t" | |
8051 "ADD ESP,16" %} | |
8052 ins_encode( long_div(src1,src2) ); | |
8053 ins_pipe( pipe_slow ); | |
8054 %} | |
8055 | |
8056 // Integer DIVMOD with Register, both quotient and mod results | |
8057 instruct divModI_eReg_divmod(eAXRegI rax, eDXRegI rdx, eCXRegI div, eFlagsReg cr) %{ | |
8058 match(DivModI rax div); | |
8059 effect(KILL cr); | |
8060 size(26); | |
8061 ins_cost(30*100+10*100); | |
8062 format %{ "CMP EAX,0x80000000\n\t" | |
8063 "JNE,s normal\n\t" | |
8064 "XOR EDX,EDX\n\t" | |
8065 "CMP ECX,-1\n\t" | |
8066 "JE,s done\n" | |
8067 "normal: CDQ\n\t" | |
8068 "IDIV $div\n\t" | |
8069 "done:" %} | |
8070 opcode(0xF7, 0x7); /* Opcode F7 /7 */ | |
8071 ins_encode( cdq_enc, OpcP, RegOpc(div) ); | |
8072 ins_pipe( pipe_slow ); | |
8073 %} | |
8074 | |
8075 // Integer MOD with Register | |
8076 instruct modI_eReg(eDXRegI rdx, eAXRegI rax, eCXRegI div, eFlagsReg cr) %{ | |
8077 match(Set rdx (ModI rax div)); | |
8078 effect(KILL rax, KILL cr); | |
8079 | |
8080 size(26); | |
8081 ins_cost(300); | |
8082 format %{ "CDQ\n\t" | |
8083 "IDIV $div" %} | |
8084 opcode(0xF7, 0x7); /* Opcode F7 /7 */ | |
8085 ins_encode( cdq_enc, OpcP, RegOpc(div) ); | |
8086 ins_pipe( ialu_reg_reg_alu0 ); | |
8087 %} | |
8088 | |
8089 // Remainder Register Long | |
8090 instruct modL_eReg( eADXRegL dst, eRegL src1, eRegL src2, eFlagsReg cr, eCXRegI cx, eBXRegI bx ) %{ | |
8091 match(Set dst (ModL src1 src2)); | |
8092 effect( KILL cr, KILL cx, KILL bx ); | |
8093 ins_cost(10000); | |
8094 format %{ "PUSH $src1.hi\n\t" | |
8095 "PUSH $src1.lo\n\t" | |
8096 "PUSH $src2.hi\n\t" | |
8097 "PUSH $src2.lo\n\t" | |
8098 "CALL SharedRuntime::lrem\n\t" | |
8099 "ADD ESP,16" %} | |
8100 ins_encode( long_mod(src1,src2) ); | |
8101 ins_pipe( pipe_slow ); | |
8102 %} | |
8103 | |
8104 // Integer Shift Instructions | |
8105 // Shift Left by one | |
8106 instruct shlI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
8107 match(Set dst (LShiftI dst shift)); | |
8108 effect(KILL cr); | |
8109 | |
8110 size(2); | |
8111 format %{ "SHL $dst,$shift" %} | |
8112 opcode(0xD1, 0x4); /* D1 /4 */ | |
8113 ins_encode( OpcP, RegOpc( dst ) ); | |
8114 ins_pipe( ialu_reg ); | |
8115 %} | |
8116 | |
8117 // Shift Left by 8-bit immediate | |
8118 instruct salI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
8119 match(Set dst (LShiftI dst shift)); | |
8120 effect(KILL cr); | |
8121 | |
8122 size(3); | |
8123 format %{ "SHL $dst,$shift" %} | |
8124 opcode(0xC1, 0x4); /* C1 /4 ib */ | |
8125 ins_encode( RegOpcImm( dst, shift) ); | |
8126 ins_pipe( ialu_reg ); | |
8127 %} | |
8128 | |
8129 // Shift Left by variable | |
8130 instruct salI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
8131 match(Set dst (LShiftI dst shift)); | |
8132 effect(KILL cr); | |
8133 | |
8134 size(2); | |
8135 format %{ "SHL $dst,$shift" %} | |
8136 opcode(0xD3, 0x4); /* D3 /4 */ | |
8137 ins_encode( OpcP, RegOpc( dst ) ); | |
8138 ins_pipe( ialu_reg_reg ); | |
8139 %} | |
8140 | |
8141 // Arithmetic shift right by one | |
8142 instruct sarI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
8143 match(Set dst (RShiftI dst shift)); | |
8144 effect(KILL cr); | |
8145 | |
8146 size(2); | |
8147 format %{ "SAR $dst,$shift" %} | |
8148 opcode(0xD1, 0x7); /* D1 /7 */ | |
8149 ins_encode( OpcP, RegOpc( dst ) ); | |
8150 ins_pipe( ialu_reg ); | |
8151 %} | |
8152 | |
8153 // Arithmetic shift right by one | |
8154 instruct sarI_mem_1(memory dst, immI1 shift, eFlagsReg cr) %{ | |
8155 match(Set dst (StoreI dst (RShiftI (LoadI dst) shift))); | |
8156 effect(KILL cr); | |
8157 format %{ "SAR $dst,$shift" %} | |
8158 opcode(0xD1, 0x7); /* D1 /7 */ | |
8159 ins_encode( OpcP, RMopc_Mem(secondary,dst) ); | |
8160 ins_pipe( ialu_mem_imm ); | |
8161 %} | |
8162 | |
8163 // Arithmetic Shift Right by 8-bit immediate | |
8164 instruct sarI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
8165 match(Set dst (RShiftI dst shift)); | |
8166 effect(KILL cr); | |
8167 | |
8168 size(3); | |
8169 format %{ "SAR $dst,$shift" %} | |
8170 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
8171 ins_encode( RegOpcImm( dst, shift ) ); | |
8172 ins_pipe( ialu_mem_imm ); | |
8173 %} | |
8174 | |
8175 // Arithmetic Shift Right by 8-bit immediate | |
8176 instruct sarI_mem_imm(memory dst, immI8 shift, eFlagsReg cr) %{ | |
8177 match(Set dst (StoreI dst (RShiftI (LoadI dst) shift))); | |
8178 effect(KILL cr); | |
8179 | |
8180 format %{ "SAR $dst,$shift" %} | |
8181 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
8182 ins_encode( OpcP, RMopc_Mem(secondary, dst ), Con8or32( shift ) ); | |
8183 ins_pipe( ialu_mem_imm ); | |
8184 %} | |
8185 | |
8186 // Arithmetic Shift Right by variable | |
8187 instruct sarI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
8188 match(Set dst (RShiftI dst shift)); | |
8189 effect(KILL cr); | |
8190 | |
8191 size(2); | |
8192 format %{ "SAR $dst,$shift" %} | |
8193 opcode(0xD3, 0x7); /* D3 /7 */ | |
8194 ins_encode( OpcP, RegOpc( dst ) ); | |
8195 ins_pipe( ialu_reg_reg ); | |
8196 %} | |
8197 | |
8198 // Logical shift right by one | |
8199 instruct shrI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
8200 match(Set dst (URShiftI dst shift)); | |
8201 effect(KILL cr); | |
8202 | |
8203 size(2); | |
8204 format %{ "SHR $dst,$shift" %} | |
8205 opcode(0xD1, 0x5); /* D1 /5 */ | |
8206 ins_encode( OpcP, RegOpc( dst ) ); | |
8207 ins_pipe( ialu_reg ); | |
8208 %} | |
8209 | |
8210 // Logical Shift Right by 8-bit immediate | |
8211 instruct shrI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
8212 match(Set dst (URShiftI dst shift)); | |
8213 effect(KILL cr); | |
8214 | |
8215 size(3); | |
8216 format %{ "SHR $dst,$shift" %} | |
8217 opcode(0xC1, 0x5); /* C1 /5 ib */ | |
8218 ins_encode( RegOpcImm( dst, shift) ); | |
8219 ins_pipe( ialu_reg ); | |
8220 %} | |
8221 | |
8222 // Logical Shift Right by 24, followed by Arithmetic Shift Left by 24. | |
8223 // This idiom is used by the compiler for the i2b bytecode. | |
8224 instruct i2b(eRegI dst, xRegI src, immI_24 twentyfour, eFlagsReg cr) %{ | |
8225 match(Set dst (RShiftI (LShiftI src twentyfour) twentyfour)); | |
8226 effect(KILL cr); | |
8227 | |
8228 size(3); | |
8229 format %{ "MOVSX $dst,$src :8" %} | |
8230 opcode(0xBE, 0x0F); | |
8231 ins_encode( OpcS, OpcP, RegReg( dst, src)); | |
8232 ins_pipe( ialu_reg_reg ); | |
8233 %} | |
8234 | |
8235 // Logical Shift Right by 16, followed by Arithmetic Shift Left by 16. | |
8236 // This idiom is used by the compiler the i2s bytecode. | |
8237 instruct i2s(eRegI dst, xRegI src, immI_16 sixteen, eFlagsReg cr) %{ | |
8238 match(Set dst (RShiftI (LShiftI src sixteen) sixteen)); | |
8239 effect(KILL cr); | |
8240 | |
8241 size(3); | |
8242 format %{ "MOVSX $dst,$src :16" %} | |
8243 opcode(0xBF, 0x0F); | |
8244 ins_encode( OpcS, OpcP, RegReg( dst, src)); | |
8245 ins_pipe( ialu_reg_reg ); | |
8246 %} | |
8247 | |
8248 | |
8249 // Logical Shift Right by variable | |
8250 instruct shrI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
8251 match(Set dst (URShiftI dst shift)); | |
8252 effect(KILL cr); | |
8253 | |
8254 size(2); | |
8255 format %{ "SHR $dst,$shift" %} | |
8256 opcode(0xD3, 0x5); /* D3 /5 */ | |
8257 ins_encode( OpcP, RegOpc( dst ) ); | |
8258 ins_pipe( ialu_reg_reg ); | |
8259 %} | |
8260 | |
8261 | |
8262 //----------Logical Instructions----------------------------------------------- | |
8263 //----------Integer Logical Instructions--------------------------------------- | |
8264 // And Instructions | |
8265 // And Register with Register | |
8266 instruct andI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
8267 match(Set dst (AndI dst src)); | |
8268 effect(KILL cr); | |
8269 | |
8270 size(2); | |
8271 format %{ "AND $dst,$src" %} | |
8272 opcode(0x23); | |
8273 ins_encode( OpcP, RegReg( dst, src) ); | |
8274 ins_pipe( ialu_reg_reg ); | |
8275 %} | |
8276 | |
8277 // And Register with Immediate | |
8278 instruct andI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
8279 match(Set dst (AndI dst src)); | |
8280 effect(KILL cr); | |
8281 | |
8282 format %{ "AND $dst,$src" %} | |
8283 opcode(0x81,0x04); /* Opcode 81 /4 */ | |
8284 // ins_encode( RegImm( dst, src) ); | |
8285 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
8286 ins_pipe( ialu_reg ); | |
8287 %} | |
8288 | |
8289 // And Register with Memory | |
8290 instruct andI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
8291 match(Set dst (AndI dst (LoadI src))); | |
8292 effect(KILL cr); | |
8293 | |
8294 ins_cost(125); | |
8295 format %{ "AND $dst,$src" %} | |
8296 opcode(0x23); | |
8297 ins_encode( OpcP, RegMem( dst, src) ); | |
8298 ins_pipe( ialu_reg_mem ); | |
8299 %} | |
8300 | |
8301 // And Memory with Register | |
8302 instruct andI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
8303 match(Set dst (StoreI dst (AndI (LoadI dst) src))); | |
8304 effect(KILL cr); | |
8305 | |
8306 ins_cost(150); | |
8307 format %{ "AND $dst,$src" %} | |
8308 opcode(0x21); /* Opcode 21 /r */ | |
8309 ins_encode( OpcP, RegMem( src, dst ) ); | |
8310 ins_pipe( ialu_mem_reg ); | |
8311 %} | |
8312 | |
8313 // And Memory with Immediate | |
8314 instruct andI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
8315 match(Set dst (StoreI dst (AndI (LoadI dst) src))); | |
8316 effect(KILL cr); | |
8317 | |
8318 ins_cost(125); | |
8319 format %{ "AND $dst,$src" %} | |
8320 opcode(0x81, 0x4); /* Opcode 81 /4 id */ | |
8321 // ins_encode( MemImm( dst, src) ); | |
8322 ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); | |
8323 ins_pipe( ialu_mem_imm ); | |
8324 %} | |
8325 | |
8326 // Or Instructions | |
8327 // Or Register with Register | |
8328 instruct orI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
8329 match(Set dst (OrI dst src)); | |
8330 effect(KILL cr); | |
8331 | |
8332 size(2); | |
8333 format %{ "OR $dst,$src" %} | |
8334 opcode(0x0B); | |
8335 ins_encode( OpcP, RegReg( dst, src) ); | |
8336 ins_pipe( ialu_reg_reg ); | |
8337 %} | |
8338 | |
8339 // Or Register with Immediate | |
8340 instruct orI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
8341 match(Set dst (OrI dst src)); | |
8342 effect(KILL cr); | |
8343 | |
8344 format %{ "OR $dst,$src" %} | |
8345 opcode(0x81,0x01); /* Opcode 81 /1 id */ | |
8346 // ins_encode( RegImm( dst, src) ); | |
8347 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
8348 ins_pipe( ialu_reg ); | |
8349 %} | |
8350 | |
8351 // Or Register with Memory | |
8352 instruct orI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
8353 match(Set dst (OrI dst (LoadI src))); | |
8354 effect(KILL cr); | |
8355 | |
8356 ins_cost(125); | |
8357 format %{ "OR $dst,$src" %} | |
8358 opcode(0x0B); | |
8359 ins_encode( OpcP, RegMem( dst, src) ); | |
8360 ins_pipe( ialu_reg_mem ); | |
8361 %} | |
8362 | |
8363 // Or Memory with Register | |
8364 instruct orI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
8365 match(Set dst (StoreI dst (OrI (LoadI dst) src))); | |
8366 effect(KILL cr); | |
8367 | |
8368 ins_cost(150); | |
8369 format %{ "OR $dst,$src" %} | |
8370 opcode(0x09); /* Opcode 09 /r */ | |
8371 ins_encode( OpcP, RegMem( src, dst ) ); | |
8372 ins_pipe( ialu_mem_reg ); | |
8373 %} | |
8374 | |
8375 // Or Memory with Immediate | |
8376 instruct orI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
8377 match(Set dst (StoreI dst (OrI (LoadI dst) src))); | |
8378 effect(KILL cr); | |
8379 | |
8380 ins_cost(125); | |
8381 format %{ "OR $dst,$src" %} | |
8382 opcode(0x81,0x1); /* Opcode 81 /1 id */ | |
8383 // ins_encode( MemImm( dst, src) ); | |
8384 ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); | |
8385 ins_pipe( ialu_mem_imm ); | |
8386 %} | |
8387 | |
8388 // ROL/ROR | |
8389 // ROL expand | |
8390 instruct rolI_eReg_imm1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
8391 effect(USE_DEF dst, USE shift, KILL cr); | |
8392 | |
8393 format %{ "ROL $dst, $shift" %} | |
8394 opcode(0xD1, 0x0); /* Opcode D1 /0 */ | |
8395 ins_encode( OpcP, RegOpc( dst )); | |
8396 ins_pipe( ialu_reg ); | |
8397 %} | |
8398 | |
8399 instruct rolI_eReg_imm8(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
8400 effect(USE_DEF dst, USE shift, KILL cr); | |
8401 | |
8402 format %{ "ROL $dst, $shift" %} | |
8403 opcode(0xC1, 0x0); /*Opcode /C1 /0 */ | |
8404 ins_encode( RegOpcImm(dst, shift) ); | |
8405 ins_pipe(ialu_reg); | |
8406 %} | |
8407 | |
8408 instruct rolI_eReg_CL(ncxRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
8409 effect(USE_DEF dst, USE shift, KILL cr); | |
8410 | |
8411 format %{ "ROL $dst, $shift" %} | |
8412 opcode(0xD3, 0x0); /* Opcode D3 /0 */ | |
8413 ins_encode(OpcP, RegOpc(dst)); | |
8414 ins_pipe( ialu_reg_reg ); | |
8415 %} | |
8416 // end of ROL expand | |
8417 | |
8418 // ROL 32bit by one once | |
8419 instruct rolI_eReg_i1(eRegI dst, immI1 lshift, immI_M1 rshift, eFlagsReg cr) %{ | |
8420 match(Set dst ( OrI (LShiftI dst lshift) (URShiftI dst rshift))); | |
8421 | |
8422 expand %{ | |
8423 rolI_eReg_imm1(dst, lshift, cr); | |
8424 %} | |
8425 %} | |
8426 | |
8427 // ROL 32bit var by imm8 once | |
8428 instruct rolI_eReg_i8(eRegI dst, immI8 lshift, immI8 rshift, eFlagsReg cr) %{ | |
8429 predicate( 0 == ((n->in(1)->in(2)->get_int() + n->in(2)->in(2)->get_int()) & 0x1f)); | |
8430 match(Set dst ( OrI (LShiftI dst lshift) (URShiftI dst rshift))); | |
8431 | |
8432 expand %{ | |
8433 rolI_eReg_imm8(dst, lshift, cr); | |
8434 %} | |
8435 %} | |
8436 | |
8437 // ROL 32bit var by var once | |
8438 instruct rolI_eReg_Var_C0(ncxRegI dst, eCXRegI shift, immI0 zero, eFlagsReg cr) %{ | |
8439 match(Set dst ( OrI (LShiftI dst shift) (URShiftI dst (SubI zero shift)))); | |
8440 | |
8441 expand %{ | |
8442 rolI_eReg_CL(dst, shift, cr); | |
8443 %} | |
8444 %} | |
8445 | |
8446 // ROL 32bit var by var once | |
8447 instruct rolI_eReg_Var_C32(ncxRegI dst, eCXRegI shift, immI_32 c32, eFlagsReg cr) %{ | |
8448 match(Set dst ( OrI (LShiftI dst shift) (URShiftI dst (SubI c32 shift)))); | |
8449 | |
8450 expand %{ | |
8451 rolI_eReg_CL(dst, shift, cr); | |
8452 %} | |
8453 %} | |
8454 | |
8455 // ROR expand | |
8456 instruct rorI_eReg_imm1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
8457 effect(USE_DEF dst, USE shift, KILL cr); | |
8458 | |
8459 format %{ "ROR $dst, $shift" %} | |
8460 opcode(0xD1,0x1); /* Opcode D1 /1 */ | |
8461 ins_encode( OpcP, RegOpc( dst ) ); | |
8462 ins_pipe( ialu_reg ); | |
8463 %} | |
8464 | |
8465 instruct rorI_eReg_imm8(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
8466 effect (USE_DEF dst, USE shift, KILL cr); | |
8467 | |
8468 format %{ "ROR $dst, $shift" %} | |
8469 opcode(0xC1, 0x1); /* Opcode /C1 /1 ib */ | |
8470 ins_encode( RegOpcImm(dst, shift) ); | |
8471 ins_pipe( ialu_reg ); | |
8472 %} | |
8473 | |
8474 instruct rorI_eReg_CL(ncxRegI dst, eCXRegI shift, eFlagsReg cr)%{ | |
8475 effect(USE_DEF dst, USE shift, KILL cr); | |
8476 | |
8477 format %{ "ROR $dst, $shift" %} | |
8478 opcode(0xD3, 0x1); /* Opcode D3 /1 */ | |
8479 ins_encode(OpcP, RegOpc(dst)); | |
8480 ins_pipe( ialu_reg_reg ); | |
8481 %} | |
8482 // end of ROR expand | |
8483 | |
8484 // ROR right once | |
8485 instruct rorI_eReg_i1(eRegI dst, immI1 rshift, immI_M1 lshift, eFlagsReg cr) %{ | |
8486 match(Set dst ( OrI (URShiftI dst rshift) (LShiftI dst lshift))); | |
8487 | |
8488 expand %{ | |
8489 rorI_eReg_imm1(dst, rshift, cr); | |
8490 %} | |
8491 %} | |
8492 | |
8493 // ROR 32bit by immI8 once | |
8494 instruct rorI_eReg_i8(eRegI dst, immI8 rshift, immI8 lshift, eFlagsReg cr) %{ | |
8495 predicate( 0 == ((n->in(1)->in(2)->get_int() + n->in(2)->in(2)->get_int()) & 0x1f)); | |
8496 match(Set dst ( OrI (URShiftI dst rshift) (LShiftI dst lshift))); | |
8497 | |
8498 expand %{ | |
8499 rorI_eReg_imm8(dst, rshift, cr); | |
8500 %} | |
8501 %} | |
8502 | |
8503 // ROR 32bit var by var once | |
8504 instruct rorI_eReg_Var_C0(ncxRegI dst, eCXRegI shift, immI0 zero, eFlagsReg cr) %{ | |
8505 match(Set dst ( OrI (URShiftI dst shift) (LShiftI dst (SubI zero shift)))); | |
8506 | |
8507 expand %{ | |
8508 rorI_eReg_CL(dst, shift, cr); | |
8509 %} | |
8510 %} | |
8511 | |
8512 // ROR 32bit var by var once | |
8513 instruct rorI_eReg_Var_C32(ncxRegI dst, eCXRegI shift, immI_32 c32, eFlagsReg cr) %{ | |
8514 match(Set dst ( OrI (URShiftI dst shift) (LShiftI dst (SubI c32 shift)))); | |
8515 | |
8516 expand %{ | |
8517 rorI_eReg_CL(dst, shift, cr); | |
8518 %} | |
8519 %} | |
8520 | |
8521 // Xor Instructions | |
8522 // Xor Register with Register | |
8523 instruct xorI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
8524 match(Set dst (XorI dst src)); | |
8525 effect(KILL cr); | |
8526 | |
8527 size(2); | |
8528 format %{ "XOR $dst,$src" %} | |
8529 opcode(0x33); | |
8530 ins_encode( OpcP, RegReg( dst, src) ); | |
8531 ins_pipe( ialu_reg_reg ); | |
8532 %} | |
8533 | |
8534 // Xor Register with Immediate | |
8535 instruct xorI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
8536 match(Set dst (XorI dst src)); | |
8537 effect(KILL cr); | |
8538 | |
8539 format %{ "XOR $dst,$src" %} | |
8540 opcode(0x81,0x06); /* Opcode 81 /6 id */ | |
8541 // ins_encode( RegImm( dst, src) ); | |
8542 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
8543 ins_pipe( ialu_reg ); | |
8544 %} | |
8545 | |
8546 // Xor Register with Memory | |
8547 instruct xorI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
8548 match(Set dst (XorI dst (LoadI src))); | |
8549 effect(KILL cr); | |
8550 | |
8551 ins_cost(125); | |
8552 format %{ "XOR $dst,$src" %} | |
8553 opcode(0x33); | |
8554 ins_encode( OpcP, RegMem(dst, src) ); | |
8555 ins_pipe( ialu_reg_mem ); | |
8556 %} | |
8557 | |
8558 // Xor Memory with Register | |
8559 instruct xorI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
8560 match(Set dst (StoreI dst (XorI (LoadI dst) src))); | |
8561 effect(KILL cr); | |
8562 | |
8563 ins_cost(150); | |
8564 format %{ "XOR $dst,$src" %} | |
8565 opcode(0x31); /* Opcode 31 /r */ | |
8566 ins_encode( OpcP, RegMem( src, dst ) ); | |
8567 ins_pipe( ialu_mem_reg ); | |
8568 %} | |
8569 | |
8570 // Xor Memory with Immediate | |
8571 instruct xorI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
8572 match(Set dst (StoreI dst (XorI (LoadI dst) src))); | |
8573 effect(KILL cr); | |
8574 | |
8575 ins_cost(125); | |
8576 format %{ "XOR $dst,$src" %} | |
8577 opcode(0x81,0x6); /* Opcode 81 /6 id */ | |
8578 ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); | |
8579 ins_pipe( ialu_mem_imm ); | |
8580 %} | |
8581 | |
8582 //----------Convert Int to Boolean--------------------------------------------- | |
8583 | |
8584 instruct movI_nocopy(eRegI dst, eRegI src) %{ | |
8585 effect( DEF dst, USE src ); | |
8586 format %{ "MOV $dst,$src" %} | |
8587 ins_encode( enc_Copy( dst, src) ); | |
8588 ins_pipe( ialu_reg_reg ); | |
8589 %} | |
8590 | |
8591 instruct ci2b( eRegI dst, eRegI src, eFlagsReg cr ) %{ | |
8592 effect( USE_DEF dst, USE src, KILL cr ); | |
8593 | |
8594 size(4); | |
8595 format %{ "NEG $dst\n\t" | |
8596 "ADC $dst,$src" %} | |
8597 ins_encode( neg_reg(dst), | |
8598 OpcRegReg(0x13,dst,src) ); | |
8599 ins_pipe( ialu_reg_reg_long ); | |
8600 %} | |
8601 | |
8602 instruct convI2B( eRegI dst, eRegI src, eFlagsReg cr ) %{ | |
8603 match(Set dst (Conv2B src)); | |
8604 | |
8605 expand %{ | |
8606 movI_nocopy(dst,src); | |
8607 ci2b(dst,src,cr); | |
8608 %} | |
8609 %} | |
8610 | |
8611 instruct movP_nocopy(eRegI dst, eRegP src) %{ | |
8612 effect( DEF dst, USE src ); | |
8613 format %{ "MOV $dst,$src" %} | |
8614 ins_encode( enc_Copy( dst, src) ); | |
8615 ins_pipe( ialu_reg_reg ); | |
8616 %} | |
8617 | |
8618 instruct cp2b( eRegI dst, eRegP src, eFlagsReg cr ) %{ | |
8619 effect( USE_DEF dst, USE src, KILL cr ); | |
8620 format %{ "NEG $dst\n\t" | |
8621 "ADC $dst,$src" %} | |
8622 ins_encode( neg_reg(dst), | |
8623 OpcRegReg(0x13,dst,src) ); | |
8624 ins_pipe( ialu_reg_reg_long ); | |
8625 %} | |
8626 | |
8627 instruct convP2B( eRegI dst, eRegP src, eFlagsReg cr ) %{ | |
8628 match(Set dst (Conv2B src)); | |
8629 | |
8630 expand %{ | |
8631 movP_nocopy(dst,src); | |
8632 cp2b(dst,src,cr); | |
8633 %} | |
8634 %} | |
8635 | |
8636 instruct cmpLTMask( eCXRegI dst, ncxRegI p, ncxRegI q, eFlagsReg cr ) %{ | |
8637 match(Set dst (CmpLTMask p q)); | |
8638 effect( KILL cr ); | |
8639 ins_cost(400); | |
8640 | |
8641 // SETlt can only use low byte of EAX,EBX, ECX, or EDX as destination | |
8642 format %{ "XOR $dst,$dst\n\t" | |
8643 "CMP $p,$q\n\t" | |
8644 "SETlt $dst\n\t" | |
8645 "NEG $dst" %} | |
8646 ins_encode( OpcRegReg(0x33,dst,dst), | |
8647 OpcRegReg(0x3B,p,q), | |
8648 setLT_reg(dst), neg_reg(dst) ); | |
8649 ins_pipe( pipe_slow ); | |
8650 %} | |
8651 | |
8652 instruct cmpLTMask0( eRegI dst, immI0 zero, eFlagsReg cr ) %{ | |
8653 match(Set dst (CmpLTMask dst zero)); | |
8654 effect( DEF dst, KILL cr ); | |
8655 ins_cost(100); | |
8656 | |
8657 format %{ "SAR $dst,31" %} | |
8658 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
8659 ins_encode( RegOpcImm( dst, 0x1F ) ); | |
8660 ins_pipe( ialu_reg ); | |
8661 %} | |
8662 | |
8663 | |
8664 instruct cadd_cmpLTMask( ncxRegI p, ncxRegI q, ncxRegI y, eCXRegI tmp, eFlagsReg cr ) %{ | |
8665 match(Set p (AddI (AndI (CmpLTMask p q) y) (SubI p q))); | |
8666 effect( KILL tmp, KILL cr ); | |
8667 ins_cost(400); | |
8668 // annoyingly, $tmp has no edges so you cant ask for it in | |
8669 // any format or encoding | |
8670 format %{ "SUB $p,$q\n\t" | |
8671 "SBB ECX,ECX\n\t" | |
8672 "AND ECX,$y\n\t" | |
8673 "ADD $p,ECX" %} | |
8674 ins_encode( enc_cmpLTP(p,q,y,tmp) ); | |
8675 ins_pipe( pipe_cmplt ); | |
8676 %} | |
8677 | |
8678 /* If I enable this, I encourage spilling in the inner loop of compress. | |
8679 instruct cadd_cmpLTMask_mem( ncxRegI p, ncxRegI q, memory y, eCXRegI tmp, eFlagsReg cr ) %{ | |
8680 match(Set p (AddI (AndI (CmpLTMask p q) (LoadI y)) (SubI p q))); | |
8681 effect( USE_KILL tmp, KILL cr ); | |
8682 ins_cost(400); | |
8683 | |
8684 format %{ "SUB $p,$q\n\t" | |
8685 "SBB ECX,ECX\n\t" | |
8686 "AND ECX,$y\n\t" | |
8687 "ADD $p,ECX" %} | |
8688 ins_encode( enc_cmpLTP_mem(p,q,y,tmp) ); | |
8689 %} | |
8690 */ | |
8691 | |
8692 //----------Long Instructions------------------------------------------------ | |
8693 // Add Long Register with Register | |
8694 instruct addL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
8695 match(Set dst (AddL dst src)); | |
8696 effect(KILL cr); | |
8697 ins_cost(200); | |
8698 format %{ "ADD $dst.lo,$src.lo\n\t" | |
8699 "ADC $dst.hi,$src.hi" %} | |
8700 opcode(0x03, 0x13); | |
8701 ins_encode( RegReg_Lo(dst, src), RegReg_Hi(dst,src) ); | |
8702 ins_pipe( ialu_reg_reg_long ); | |
8703 %} | |
8704 | |
8705 // Add Long Register with Immediate | |
8706 instruct addL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
8707 match(Set dst (AddL dst src)); | |
8708 effect(KILL cr); | |
8709 format %{ "ADD $dst.lo,$src.lo\n\t" | |
8710 "ADC $dst.hi,$src.hi" %} | |
8711 opcode(0x81,0x00,0x02); /* Opcode 81 /0, 81 /2 */ | |
8712 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
8713 ins_pipe( ialu_reg_long ); | |
8714 %} | |
8715 | |
8716 // Add Long Register with Memory | |
8717 instruct addL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
8718 match(Set dst (AddL dst (LoadL mem))); | |
8719 effect(KILL cr); | |
8720 ins_cost(125); | |
8721 format %{ "ADD $dst.lo,$mem\n\t" | |
8722 "ADC $dst.hi,$mem+4" %} | |
8723 opcode(0x03, 0x13); | |
8724 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
8725 ins_pipe( ialu_reg_long_mem ); | |
8726 %} | |
8727 | |
8728 // Subtract Long Register with Register. | |
8729 instruct subL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
8730 match(Set dst (SubL dst src)); | |
8731 effect(KILL cr); | |
8732 ins_cost(200); | |
8733 format %{ "SUB $dst.lo,$src.lo\n\t" | |
8734 "SBB $dst.hi,$src.hi" %} | |
8735 opcode(0x2B, 0x1B); | |
8736 ins_encode( RegReg_Lo(dst, src), RegReg_Hi(dst,src) ); | |
8737 ins_pipe( ialu_reg_reg_long ); | |
8738 %} | |
8739 | |
8740 // Subtract Long Register with Immediate | |
8741 instruct subL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
8742 match(Set dst (SubL dst src)); | |
8743 effect(KILL cr); | |
8744 format %{ "SUB $dst.lo,$src.lo\n\t" | |
8745 "SBB $dst.hi,$src.hi" %} | |
8746 opcode(0x81,0x05,0x03); /* Opcode 81 /5, 81 /3 */ | |
8747 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
8748 ins_pipe( ialu_reg_long ); | |
8749 %} | |
8750 | |
8751 // Subtract Long Register with Memory | |
8752 instruct subL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
8753 match(Set dst (SubL dst (LoadL mem))); | |
8754 effect(KILL cr); | |
8755 ins_cost(125); | |
8756 format %{ "SUB $dst.lo,$mem\n\t" | |
8757 "SBB $dst.hi,$mem+4" %} | |
8758 opcode(0x2B, 0x1B); | |
8759 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
8760 ins_pipe( ialu_reg_long_mem ); | |
8761 %} | |
8762 | |
8763 instruct negL_eReg(eRegL dst, immL0 zero, eFlagsReg cr) %{ | |
8764 match(Set dst (SubL zero dst)); | |
8765 effect(KILL cr); | |
8766 ins_cost(300); | |
8767 format %{ "NEG $dst.hi\n\tNEG $dst.lo\n\tSBB $dst.hi,0" %} | |
8768 ins_encode( neg_long(dst) ); | |
8769 ins_pipe( ialu_reg_reg_long ); | |
8770 %} | |
8771 | |
8772 // And Long Register with Register | |
8773 instruct andL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
8774 match(Set dst (AndL dst src)); | |
8775 effect(KILL cr); | |
8776 format %{ "AND $dst.lo,$src.lo\n\t" | |
8777 "AND $dst.hi,$src.hi" %} | |
8778 opcode(0x23,0x23); | |
8779 ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); | |
8780 ins_pipe( ialu_reg_reg_long ); | |
8781 %} | |
8782 | |
8783 // And Long Register with Immediate | |
8784 instruct andL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
8785 match(Set dst (AndL dst src)); | |
8786 effect(KILL cr); | |
8787 format %{ "AND $dst.lo,$src.lo\n\t" | |
8788 "AND $dst.hi,$src.hi" %} | |
8789 opcode(0x81,0x04,0x04); /* Opcode 81 /4, 81 /4 */ | |
8790 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
8791 ins_pipe( ialu_reg_long ); | |
8792 %} | |
8793 | |
8794 // And Long Register with Memory | |
8795 instruct andL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
8796 match(Set dst (AndL dst (LoadL mem))); | |
8797 effect(KILL cr); | |
8798 ins_cost(125); | |
8799 format %{ "AND $dst.lo,$mem\n\t" | |
8800 "AND $dst.hi,$mem+4" %} | |
8801 opcode(0x23, 0x23); | |
8802 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
8803 ins_pipe( ialu_reg_long_mem ); | |
8804 %} | |
8805 | |
8806 // Or Long Register with Register | |
8807 instruct orl_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
8808 match(Set dst (OrL dst src)); | |
8809 effect(KILL cr); | |
8810 format %{ "OR $dst.lo,$src.lo\n\t" | |
8811 "OR $dst.hi,$src.hi" %} | |
8812 opcode(0x0B,0x0B); | |
8813 ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); | |
8814 ins_pipe( ialu_reg_reg_long ); | |
8815 %} | |
8816 | |
8817 // Or Long Register with Immediate | |
8818 instruct orl_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
8819 match(Set dst (OrL dst src)); | |
8820 effect(KILL cr); | |
8821 format %{ "OR $dst.lo,$src.lo\n\t" | |
8822 "OR $dst.hi,$src.hi" %} | |
8823 opcode(0x81,0x01,0x01); /* Opcode 81 /1, 81 /1 */ | |
8824 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
8825 ins_pipe( ialu_reg_long ); | |
8826 %} | |
8827 | |
8828 // Or Long Register with Memory | |
8829 instruct orl_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
8830 match(Set dst (OrL dst (LoadL mem))); | |
8831 effect(KILL cr); | |
8832 ins_cost(125); | |
8833 format %{ "OR $dst.lo,$mem\n\t" | |
8834 "OR $dst.hi,$mem+4" %} | |
8835 opcode(0x0B,0x0B); | |
8836 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
8837 ins_pipe( ialu_reg_long_mem ); | |
8838 %} | |
8839 | |
8840 // Xor Long Register with Register | |
8841 instruct xorl_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
8842 match(Set dst (XorL dst src)); | |
8843 effect(KILL cr); | |
8844 format %{ "XOR $dst.lo,$src.lo\n\t" | |
8845 "XOR $dst.hi,$src.hi" %} | |
8846 opcode(0x33,0x33); | |
8847 ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); | |
8848 ins_pipe( ialu_reg_reg_long ); | |
8849 %} | |
8850 | |
8851 // Xor Long Register with Immediate | |
8852 instruct xorl_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
8853 match(Set dst (XorL dst src)); | |
8854 effect(KILL cr); | |
8855 format %{ "XOR $dst.lo,$src.lo\n\t" | |
8856 "XOR $dst.hi,$src.hi" %} | |
8857 opcode(0x81,0x06,0x06); /* Opcode 81 /6, 81 /6 */ | |
8858 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
8859 ins_pipe( ialu_reg_long ); | |
8860 %} | |
8861 | |
8862 // Xor Long Register with Memory | |
8863 instruct xorl_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
8864 match(Set dst (XorL dst (LoadL mem))); | |
8865 effect(KILL cr); | |
8866 ins_cost(125); | |
8867 format %{ "XOR $dst.lo,$mem\n\t" | |
8868 "XOR $dst.hi,$mem+4" %} | |
8869 opcode(0x33,0x33); | |
8870 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
8871 ins_pipe( ialu_reg_long_mem ); | |
8872 %} | |
8873 | |
8874 // Shift Left Long by 1-31 | |
8875 instruct shlL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ | |
8876 match(Set dst (LShiftL dst cnt)); | |
8877 effect(KILL cr); | |
8878 ins_cost(200); | |
8879 format %{ "SHLD $dst.hi,$dst.lo,$cnt\n\t" | |
8880 "SHL $dst.lo,$cnt" %} | |
8881 opcode(0xC1, 0x4, 0xA4); /* 0F/A4, then C1 /4 ib */ | |
8882 ins_encode( move_long_small_shift(dst,cnt) ); | |
8883 ins_pipe( ialu_reg_long ); | |
8884 %} | |
8885 | |
8886 // Shift Left Long by 32-63 | |
8887 instruct shlL_eReg_32_63(eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ | |
8888 match(Set dst (LShiftL dst cnt)); | |
8889 effect(KILL cr); | |
8890 ins_cost(300); | |
8891 format %{ "MOV $dst.hi,$dst.lo\n" | |
8892 "\tSHL $dst.hi,$cnt-32\n" | |
8893 "\tXOR $dst.lo,$dst.lo" %} | |
8894 opcode(0xC1, 0x4); /* C1 /4 ib */ | |
8895 ins_encode( move_long_big_shift_clr(dst,cnt) ); | |
8896 ins_pipe( ialu_reg_long ); | |
8897 %} | |
8898 | |
8899 // Shift Left Long by variable | |
8900 instruct salL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ | |
8901 match(Set dst (LShiftL dst shift)); | |
8902 effect(KILL cr); | |
8903 ins_cost(500+200); | |
8904 size(17); | |
8905 format %{ "TEST $shift,32\n\t" | |
8906 "JEQ,s small\n\t" | |
8907 "MOV $dst.hi,$dst.lo\n\t" | |
8908 "XOR $dst.lo,$dst.lo\n" | |
8909 "small:\tSHLD $dst.hi,$dst.lo,$shift\n\t" | |
8910 "SHL $dst.lo,$shift" %} | |
8911 ins_encode( shift_left_long( dst, shift ) ); | |
8912 ins_pipe( pipe_slow ); | |
8913 %} | |
8914 | |
8915 // Shift Right Long by 1-31 | |
8916 instruct shrL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ | |
8917 match(Set dst (URShiftL dst cnt)); | |
8918 effect(KILL cr); | |
8919 ins_cost(200); | |
8920 format %{ "SHRD $dst.lo,$dst.hi,$cnt\n\t" | |
8921 "SHR $dst.hi,$cnt" %} | |
8922 opcode(0xC1, 0x5, 0xAC); /* 0F/AC, then C1 /5 ib */ | |
8923 ins_encode( move_long_small_shift(dst,cnt) ); | |
8924 ins_pipe( ialu_reg_long ); | |
8925 %} | |
8926 | |
8927 // Shift Right Long by 32-63 | |
8928 instruct shrL_eReg_32_63(eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ | |
8929 match(Set dst (URShiftL dst cnt)); | |
8930 effect(KILL cr); | |
8931 ins_cost(300); | |
8932 format %{ "MOV $dst.lo,$dst.hi\n" | |
8933 "\tSHR $dst.lo,$cnt-32\n" | |
8934 "\tXOR $dst.hi,$dst.hi" %} | |
8935 opcode(0xC1, 0x5); /* C1 /5 ib */ | |
8936 ins_encode( move_long_big_shift_clr(dst,cnt) ); | |
8937 ins_pipe( ialu_reg_long ); | |
8938 %} | |
8939 | |
8940 // Shift Right Long by variable | |
8941 instruct shrL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ | |
8942 match(Set dst (URShiftL dst shift)); | |
8943 effect(KILL cr); | |
8944 ins_cost(600); | |
8945 size(17); | |
8946 format %{ "TEST $shift,32\n\t" | |
8947 "JEQ,s small\n\t" | |
8948 "MOV $dst.lo,$dst.hi\n\t" | |
8949 "XOR $dst.hi,$dst.hi\n" | |
8950 "small:\tSHRD $dst.lo,$dst.hi,$shift\n\t" | |
8951 "SHR $dst.hi,$shift" %} | |
8952 ins_encode( shift_right_long( dst, shift ) ); | |
8953 ins_pipe( pipe_slow ); | |
8954 %} | |
8955 | |
8956 // Shift Right Long by 1-31 | |
8957 instruct sarL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ | |
8958 match(Set dst (RShiftL dst cnt)); | |
8959 effect(KILL cr); | |
8960 ins_cost(200); | |
8961 format %{ "SHRD $dst.lo,$dst.hi,$cnt\n\t" | |
8962 "SAR $dst.hi,$cnt" %} | |
8963 opcode(0xC1, 0x7, 0xAC); /* 0F/AC, then C1 /7 ib */ | |
8964 ins_encode( move_long_small_shift(dst,cnt) ); | |
8965 ins_pipe( ialu_reg_long ); | |
8966 %} | |
8967 | |
8968 // Shift Right Long by 32-63 | |
8969 instruct sarL_eReg_32_63( eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ | |
8970 match(Set dst (RShiftL dst cnt)); | |
8971 effect(KILL cr); | |
8972 ins_cost(300); | |
8973 format %{ "MOV $dst.lo,$dst.hi\n" | |
8974 "\tSAR $dst.lo,$cnt-32\n" | |
8975 "\tSAR $dst.hi,31" %} | |
8976 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
8977 ins_encode( move_long_big_shift_sign(dst,cnt) ); | |
8978 ins_pipe( ialu_reg_long ); | |
8979 %} | |
8980 | |
8981 // Shift Right arithmetic Long by variable | |
8982 instruct sarL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ | |
8983 match(Set dst (RShiftL dst shift)); | |
8984 effect(KILL cr); | |
8985 ins_cost(600); | |
8986 size(18); | |
8987 format %{ "TEST $shift,32\n\t" | |
8988 "JEQ,s small\n\t" | |
8989 "MOV $dst.lo,$dst.hi\n\t" | |
8990 "SAR $dst.hi,31\n" | |
8991 "small:\tSHRD $dst.lo,$dst.hi,$shift\n\t" | |
8992 "SAR $dst.hi,$shift" %} | |
8993 ins_encode( shift_right_arith_long( dst, shift ) ); | |
8994 ins_pipe( pipe_slow ); | |
8995 %} | |
8996 | |
8997 | |
8998 //----------Double Instructions------------------------------------------------ | |
8999 // Double Math | |
9000 | |
9001 // Compare & branch | |
9002 | |
9003 // P6 version of float compare, sets condition codes in EFLAGS | |
9004 instruct cmpD_cc_P6(eFlagsRegU cr, regD src1, regD src2, eAXRegI rax) %{ | |
9005 predicate(VM_Version::supports_cmov() && UseSSE <=1); | |
9006 match(Set cr (CmpD src1 src2)); | |
9007 effect(KILL rax); | |
9008 ins_cost(150); | |
9009 format %{ "FLD $src1\n\t" | |
9010 "FUCOMIP ST,$src2 // P6 instruction\n\t" | |
9011 "JNP exit\n\t" | |
9012 "MOV ah,1 // saw a NaN, set CF\n\t" | |
9013 "SAHF\n" | |
9014 "exit:\tNOP // avoid branch to branch" %} | |
9015 opcode(0xDF, 0x05); /* DF E8+i or DF /5 */ | |
9016 ins_encode( Push_Reg_D(src1), | |
9017 OpcP, RegOpc(src2), | |
9018 cmpF_P6_fixup ); | |
9019 ins_pipe( pipe_slow ); | |
9020 %} | |
9021 | |
9022 // Compare & branch | |
9023 instruct cmpD_cc(eFlagsRegU cr, regD src1, regD src2, eAXRegI rax) %{ | |
9024 predicate(UseSSE<=1); | |
9025 match(Set cr (CmpD src1 src2)); | |
9026 effect(KILL rax); | |
9027 ins_cost(200); | |
9028 format %{ "FLD $src1\n\t" | |
9029 "FCOMp $src2\n\t" | |
9030 "FNSTSW AX\n\t" | |
9031 "TEST AX,0x400\n\t" | |
9032 "JZ,s flags\n\t" | |
9033 "MOV AH,1\t# unordered treat as LT\n" | |
9034 "flags:\tSAHF" %} | |
9035 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
9036 ins_encode( Push_Reg_D(src1), | |
9037 OpcP, RegOpc(src2), | |
9038 fpu_flags); | |
9039 ins_pipe( pipe_slow ); | |
9040 %} | |
9041 | |
9042 // Compare vs zero into -1,0,1 | |
9043 instruct cmpD_0(eRegI dst, regD src1, immD0 zero, eAXRegI rax, eFlagsReg cr) %{ | |
9044 predicate(UseSSE<=1); | |
9045 match(Set dst (CmpD3 src1 zero)); | |
9046 effect(KILL cr, KILL rax); | |
9047 ins_cost(280); | |
9048 format %{ "FTSTD $dst,$src1" %} | |
9049 opcode(0xE4, 0xD9); | |
9050 ins_encode( Push_Reg_D(src1), | |
9051 OpcS, OpcP, PopFPU, | |
9052 CmpF_Result(dst)); | |
9053 ins_pipe( pipe_slow ); | |
9054 %} | |
9055 | |
9056 // Compare into -1,0,1 | |
9057 instruct cmpD_reg(eRegI dst, regD src1, regD src2, eAXRegI rax, eFlagsReg cr) %{ | |
9058 predicate(UseSSE<=1); | |
9059 match(Set dst (CmpD3 src1 src2)); | |
9060 effect(KILL cr, KILL rax); | |
9061 ins_cost(300); | |
9062 format %{ "FCMPD $dst,$src1,$src2" %} | |
9063 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
9064 ins_encode( Push_Reg_D(src1), | |
9065 OpcP, RegOpc(src2), | |
9066 CmpF_Result(dst)); | |
9067 ins_pipe( pipe_slow ); | |
9068 %} | |
9069 | |
9070 // float compare and set condition codes in EFLAGS by XMM regs | |
9071 instruct cmpXD_cc(eFlagsRegU cr, regXD dst, regXD src, eAXRegI rax) %{ | |
9072 predicate(UseSSE>=2); | |
9073 match(Set cr (CmpD dst src)); | |
9074 effect(KILL rax); | |
9075 ins_cost(125); | |
9076 format %{ "COMISD $dst,$src\n" | |
9077 "\tJNP exit\n" | |
9078 "\tMOV ah,1 // saw a NaN, set CF\n" | |
9079 "\tSAHF\n" | |
9080 "exit:\tNOP // avoid branch to branch" %} | |
9081 opcode(0x66, 0x0F, 0x2F); | |
9082 ins_encode(OpcP, OpcS, Opcode(tertiary), RegReg(dst, src), cmpF_P6_fixup); | |
9083 ins_pipe( pipe_slow ); | |
9084 %} | |
9085 | |
9086 // float compare and set condition codes in EFLAGS by XMM regs | |
9087 instruct cmpXD_ccmem(eFlagsRegU cr, regXD dst, memory src, eAXRegI rax) %{ | |
9088 predicate(UseSSE>=2); | |
9089 match(Set cr (CmpD dst (LoadD src))); | |
9090 effect(KILL rax); | |
9091 ins_cost(145); | |
9092 format %{ "COMISD $dst,$src\n" | |
9093 "\tJNP exit\n" | |
9094 "\tMOV ah,1 // saw a NaN, set CF\n" | |
9095 "\tSAHF\n" | |
9096 "exit:\tNOP // avoid branch to branch" %} | |
9097 opcode(0x66, 0x0F, 0x2F); | |
9098 ins_encode(OpcP, OpcS, Opcode(tertiary), RegMem(dst, src), cmpF_P6_fixup); | |
9099 ins_pipe( pipe_slow ); | |
9100 %} | |
9101 | |
9102 // Compare into -1,0,1 in XMM | |
9103 instruct cmpXD_reg(eRegI dst, regXD src1, regXD src2, eFlagsReg cr) %{ | |
9104 predicate(UseSSE>=2); | |
9105 match(Set dst (CmpD3 src1 src2)); | |
9106 effect(KILL cr); | |
9107 ins_cost(255); | |
9108 format %{ "XOR $dst,$dst\n" | |
9109 "\tCOMISD $src1,$src2\n" | |
9110 "\tJP,s nan\n" | |
9111 "\tJEQ,s exit\n" | |
9112 "\tJA,s inc\n" | |
9113 "nan:\tDEC $dst\n" | |
9114 "\tJMP,s exit\n" | |
9115 "inc:\tINC $dst\n" | |
9116 "exit:" | |
9117 %} | |
9118 opcode(0x66, 0x0F, 0x2F); | |
9119 ins_encode(Xor_Reg(dst), OpcP, OpcS, Opcode(tertiary), RegReg(src1, src2), | |
9120 CmpX_Result(dst)); | |
9121 ins_pipe( pipe_slow ); | |
9122 %} | |
9123 | |
9124 // Compare into -1,0,1 in XMM and memory | |
9125 instruct cmpXD_regmem(eRegI dst, regXD src1, memory mem, eFlagsReg cr) %{ | |
9126 predicate(UseSSE>=2); | |
9127 match(Set dst (CmpD3 src1 (LoadD mem))); | |
9128 effect(KILL cr); | |
9129 ins_cost(275); | |
9130 format %{ "COMISD $src1,$mem\n" | |
9131 "\tMOV $dst,0\t\t# do not blow flags\n" | |
9132 "\tJP,s nan\n" | |
9133 "\tJEQ,s exit\n" | |
9134 "\tJA,s inc\n" | |
9135 "nan:\tDEC $dst\n" | |
9136 "\tJMP,s exit\n" | |
9137 "inc:\tINC $dst\n" | |
9138 "exit:" | |
9139 %} | |
9140 opcode(0x66, 0x0F, 0x2F); | |
9141 ins_encode(OpcP, OpcS, Opcode(tertiary), RegMem(src1, mem), | |
9142 LdImmI(dst,0x0), CmpX_Result(dst)); | |
9143 ins_pipe( pipe_slow ); | |
9144 %} | |
9145 | |
9146 | |
9147 instruct subD_reg(regD dst, regD src) %{ | |
9148 predicate (UseSSE <=1); | |
9149 match(Set dst (SubD dst src)); | |
9150 | |
9151 format %{ "FLD $src\n\t" | |
9152 "DSUBp $dst,ST" %} | |
9153 opcode(0xDE, 0x5); /* DE E8+i or DE /5 */ | |
9154 ins_cost(150); | |
9155 ins_encode( Push_Reg_D(src), | |
9156 OpcP, RegOpc(dst) ); | |
9157 ins_pipe( fpu_reg_reg ); | |
9158 %} | |
9159 | |
9160 instruct subD_reg_round(stackSlotD dst, regD src1, regD src2) %{ | |
9161 predicate (UseSSE <=1); | |
9162 match(Set dst (RoundDouble (SubD src1 src2))); | |
9163 ins_cost(250); | |
9164 | |
9165 format %{ "FLD $src2\n\t" | |
9166 "DSUB ST,$src1\n\t" | |
9167 "FSTP_D $dst\t# D-round" %} | |
9168 opcode(0xD8, 0x5); | |
9169 ins_encode( Push_Reg_D(src2), | |
9170 OpcP, RegOpc(src1), Pop_Mem_D(dst) ); | |
9171 ins_pipe( fpu_mem_reg_reg ); | |
9172 %} | |
9173 | |
9174 | |
9175 instruct subD_reg_mem(regD dst, memory src) %{ | |
9176 predicate (UseSSE <=1); | |
9177 match(Set dst (SubD dst (LoadD src))); | |
9178 ins_cost(150); | |
9179 | |
9180 format %{ "FLD $src\n\t" | |
9181 "DSUBp $dst,ST" %} | |
9182 opcode(0xDE, 0x5, 0xDD); /* DE C0+i */ /* LoadD DD /0 */ | |
9183 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
9184 OpcP, RegOpc(dst) ); | |
9185 ins_pipe( fpu_reg_mem ); | |
9186 %} | |
9187 | |
9188 instruct absD_reg(regDPR1 dst, regDPR1 src) %{ | |
9189 predicate (UseSSE<=1); | |
9190 match(Set dst (AbsD src)); | |
9191 ins_cost(100); | |
9192 format %{ "FABS" %} | |
9193 opcode(0xE1, 0xD9); | |
9194 ins_encode( OpcS, OpcP ); | |
9195 ins_pipe( fpu_reg_reg ); | |
9196 %} | |
9197 | |
9198 instruct absXD_reg( regXD dst ) %{ | |
9199 predicate(UseSSE>=2); | |
9200 match(Set dst (AbsD dst)); | |
9201 format %{ "ANDPD $dst,[0x7FFFFFFFFFFFFFFF]\t# ABS D by sign masking" %} | |
9202 ins_encode( AbsXD_encoding(dst)); | |
9203 ins_pipe( pipe_slow ); | |
9204 %} | |
9205 | |
9206 instruct negD_reg(regDPR1 dst, regDPR1 src) %{ | |
9207 predicate(UseSSE<=1); | |
9208 match(Set dst (NegD src)); | |
9209 ins_cost(100); | |
9210 format %{ "FCHS" %} | |
9211 opcode(0xE0, 0xD9); | |
9212 ins_encode( OpcS, OpcP ); | |
9213 ins_pipe( fpu_reg_reg ); | |
9214 %} | |
9215 | |
9216 instruct negXD_reg( regXD dst ) %{ | |
9217 predicate(UseSSE>=2); | |
9218 match(Set dst (NegD dst)); | |
9219 format %{ "XORPD $dst,[0x8000000000000000]\t# CHS D by sign flipping" %} | |
9220 ins_encode %{ | |
9221 __ xorpd($dst$$XMMRegister, | |
9222 ExternalAddress((address)double_signflip_pool)); | |
9223 %} | |
9224 ins_pipe( pipe_slow ); | |
9225 %} | |
9226 | |
9227 instruct addD_reg(regD dst, regD src) %{ | |
9228 predicate(UseSSE<=1); | |
9229 match(Set dst (AddD dst src)); | |
9230 format %{ "FLD $src\n\t" | |
9231 "DADD $dst,ST" %} | |
9232 size(4); | |
9233 ins_cost(150); | |
9234 opcode(0xDE, 0x0); /* DE C0+i or DE /0*/ | |
9235 ins_encode( Push_Reg_D(src), | |
9236 OpcP, RegOpc(dst) ); | |
9237 ins_pipe( fpu_reg_reg ); | |
9238 %} | |
9239 | |
9240 | |
9241 instruct addD_reg_round(stackSlotD dst, regD src1, regD src2) %{ | |
9242 predicate(UseSSE<=1); | |
9243 match(Set dst (RoundDouble (AddD src1 src2))); | |
9244 ins_cost(250); | |
9245 | |
9246 format %{ "FLD $src2\n\t" | |
9247 "DADD ST,$src1\n\t" | |
9248 "FSTP_D $dst\t# D-round" %} | |
9249 opcode(0xD8, 0x0); /* D8 C0+i or D8 /0*/ | |
9250 ins_encode( Push_Reg_D(src2), | |
9251 OpcP, RegOpc(src1), Pop_Mem_D(dst) ); | |
9252 ins_pipe( fpu_mem_reg_reg ); | |
9253 %} | |
9254 | |
9255 | |
9256 instruct addD_reg_mem(regD dst, memory src) %{ | |
9257 predicate(UseSSE<=1); | |
9258 match(Set dst (AddD dst (LoadD src))); | |
9259 ins_cost(150); | |
9260 | |
9261 format %{ "FLD $src\n\t" | |
9262 "DADDp $dst,ST" %} | |
9263 opcode(0xDE, 0x0, 0xDD); /* DE C0+i */ /* LoadD DD /0 */ | |
9264 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
9265 OpcP, RegOpc(dst) ); | |
9266 ins_pipe( fpu_reg_mem ); | |
9267 %} | |
9268 | |
9269 // add-to-memory | |
9270 instruct addD_mem_reg(memory dst, regD src) %{ | |
9271 predicate(UseSSE<=1); | |
9272 match(Set dst (StoreD dst (RoundDouble (AddD (LoadD dst) src)))); | |
9273 ins_cost(150); | |
9274 | |
9275 format %{ "FLD_D $dst\n\t" | |
9276 "DADD ST,$src\n\t" | |
9277 "FST_D $dst" %} | |
9278 opcode(0xDD, 0x0); | |
9279 ins_encode( Opcode(0xDD), RMopc_Mem(0x00,dst), | |
9280 Opcode(0xD8), RegOpc(src), | |
9281 set_instruction_start, | |
9282 Opcode(0xDD), RMopc_Mem(0x03,dst) ); | |
9283 ins_pipe( fpu_reg_mem ); | |
9284 %} | |
9285 | |
9286 instruct addD_reg_imm1(regD dst, immD1 src) %{ | |
9287 predicate(UseSSE<=1); | |
9288 match(Set dst (AddD dst src)); | |
9289 ins_cost(125); | |
9290 format %{ "FLD1\n\t" | |
9291 "DADDp $dst,ST" %} | |
9292 opcode(0xDE, 0x00); | |
9293 ins_encode( LdImmD(src), | |
9294 OpcP, RegOpc(dst) ); | |
9295 ins_pipe( fpu_reg ); | |
9296 %} | |
9297 | |
9298 instruct addD_reg_imm(regD dst, immD src) %{ | |
9299 predicate(UseSSE<=1 && _kids[1]->_leaf->getd() != 0.0 && _kids[1]->_leaf->getd() != 1.0 ); | |
9300 match(Set dst (AddD dst src)); | |
9301 ins_cost(200); | |
9302 format %{ "FLD_D [$src]\n\t" | |
9303 "DADDp $dst,ST" %} | |
9304 opcode(0xDE, 0x00); /* DE /0 */ | |
9305 ins_encode( LdImmD(src), | |
9306 OpcP, RegOpc(dst)); | |
9307 ins_pipe( fpu_reg_mem ); | |
9308 %} | |
9309 | |
9310 instruct addD_reg_imm_round(stackSlotD dst, regD src, immD con) %{ | |
9311 predicate(UseSSE<=1 && _kids[0]->_kids[1]->_leaf->getd() != 0.0 && _kids[0]->_kids[1]->_leaf->getd() != 1.0 ); | |
9312 match(Set dst (RoundDouble (AddD src con))); | |
9313 ins_cost(200); | |
9314 format %{ "FLD_D [$con]\n\t" | |
9315 "DADD ST,$src\n\t" | |
9316 "FSTP_D $dst\t# D-round" %} | |
9317 opcode(0xD8, 0x00); /* D8 /0 */ | |
9318 ins_encode( LdImmD(con), | |
9319 OpcP, RegOpc(src), Pop_Mem_D(dst)); | |
9320 ins_pipe( fpu_mem_reg_con ); | |
9321 %} | |
9322 | |
9323 // Add two double precision floating point values in xmm | |
9324 instruct addXD_reg(regXD dst, regXD src) %{ | |
9325 predicate(UseSSE>=2); | |
9326 match(Set dst (AddD dst src)); | |
9327 format %{ "ADDSD $dst,$src" %} | |
9328 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), RegReg(dst, src)); | |
9329 ins_pipe( pipe_slow ); | |
9330 %} | |
9331 | |
9332 instruct addXD_imm(regXD dst, immXD con) %{ | |
9333 predicate(UseSSE>=2); | |
9334 match(Set dst (AddD dst con)); | |
9335 format %{ "ADDSD $dst,[$con]" %} | |
9336 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), LdImmXD(dst, con) ); | |
9337 ins_pipe( pipe_slow ); | |
9338 %} | |
9339 | |
9340 instruct addXD_mem(regXD dst, memory mem) %{ | |
9341 predicate(UseSSE>=2); | |
9342 match(Set dst (AddD dst (LoadD mem))); | |
9343 format %{ "ADDSD $dst,$mem" %} | |
9344 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), RegMem(dst,mem)); | |
9345 ins_pipe( pipe_slow ); | |
9346 %} | |
9347 | |
9348 // Sub two double precision floating point values in xmm | |
9349 instruct subXD_reg(regXD dst, regXD src) %{ | |
9350 predicate(UseSSE>=2); | |
9351 match(Set dst (SubD dst src)); | |
9352 format %{ "SUBSD $dst,$src" %} | |
9353 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), RegReg(dst, src)); | |
9354 ins_pipe( pipe_slow ); | |
9355 %} | |
9356 | |
9357 instruct subXD_imm(regXD dst, immXD con) %{ | |
9358 predicate(UseSSE>=2); | |
9359 match(Set dst (SubD dst con)); | |
9360 format %{ "SUBSD $dst,[$con]" %} | |
9361 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), LdImmXD(dst, con) ); | |
9362 ins_pipe( pipe_slow ); | |
9363 %} | |
9364 | |
9365 instruct subXD_mem(regXD dst, memory mem) %{ | |
9366 predicate(UseSSE>=2); | |
9367 match(Set dst (SubD dst (LoadD mem))); | |
9368 format %{ "SUBSD $dst,$mem" %} | |
9369 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), RegMem(dst,mem)); | |
9370 ins_pipe( pipe_slow ); | |
9371 %} | |
9372 | |
9373 // Mul two double precision floating point values in xmm | |
9374 instruct mulXD_reg(regXD dst, regXD src) %{ | |
9375 predicate(UseSSE>=2); | |
9376 match(Set dst (MulD dst src)); | |
9377 format %{ "MULSD $dst,$src" %} | |
9378 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), RegReg(dst, src)); | |
9379 ins_pipe( pipe_slow ); | |
9380 %} | |
9381 | |
9382 instruct mulXD_imm(regXD dst, immXD con) %{ | |
9383 predicate(UseSSE>=2); | |
9384 match(Set dst (MulD dst con)); | |
9385 format %{ "MULSD $dst,[$con]" %} | |
9386 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), LdImmXD(dst, con) ); | |
9387 ins_pipe( pipe_slow ); | |
9388 %} | |
9389 | |
9390 instruct mulXD_mem(regXD dst, memory mem) %{ | |
9391 predicate(UseSSE>=2); | |
9392 match(Set dst (MulD dst (LoadD mem))); | |
9393 format %{ "MULSD $dst,$mem" %} | |
9394 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), RegMem(dst,mem)); | |
9395 ins_pipe( pipe_slow ); | |
9396 %} | |
9397 | |
9398 // Div two double precision floating point values in xmm | |
9399 instruct divXD_reg(regXD dst, regXD src) %{ | |
9400 predicate(UseSSE>=2); | |
9401 match(Set dst (DivD dst src)); | |
9402 format %{ "DIVSD $dst,$src" %} | |
9403 opcode(0xF2, 0x0F, 0x5E); | |
9404 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), RegReg(dst, src)); | |
9405 ins_pipe( pipe_slow ); | |
9406 %} | |
9407 | |
9408 instruct divXD_imm(regXD dst, immXD con) %{ | |
9409 predicate(UseSSE>=2); | |
9410 match(Set dst (DivD dst con)); | |
9411 format %{ "DIVSD $dst,[$con]" %} | |
9412 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), LdImmXD(dst, con)); | |
9413 ins_pipe( pipe_slow ); | |
9414 %} | |
9415 | |
9416 instruct divXD_mem(regXD dst, memory mem) %{ | |
9417 predicate(UseSSE>=2); | |
9418 match(Set dst (DivD dst (LoadD mem))); | |
9419 format %{ "DIVSD $dst,$mem" %} | |
9420 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), RegMem(dst,mem)); | |
9421 ins_pipe( pipe_slow ); | |
9422 %} | |
9423 | |
9424 | |
9425 instruct mulD_reg(regD dst, regD src) %{ | |
9426 predicate(UseSSE<=1); | |
9427 match(Set dst (MulD dst src)); | |
9428 format %{ "FLD $src\n\t" | |
9429 "DMULp $dst,ST" %} | |
9430 opcode(0xDE, 0x1); /* DE C8+i or DE /1*/ | |
9431 ins_cost(150); | |
9432 ins_encode( Push_Reg_D(src), | |
9433 OpcP, RegOpc(dst) ); | |
9434 ins_pipe( fpu_reg_reg ); | |
9435 %} | |
9436 | |
9437 // Strict FP instruction biases argument before multiply then | |
9438 // biases result to avoid double rounding of subnormals. | |
9439 // | |
9440 // scale arg1 by multiplying arg1 by 2^(-15360) | |
9441 // load arg2 | |
9442 // multiply scaled arg1 by arg2 | |
9443 // rescale product by 2^(15360) | |
9444 // | |
9445 instruct strictfp_mulD_reg(regDPR1 dst, regnotDPR1 src) %{ | |
9446 predicate( UseSSE<=1 && Compile::current()->has_method() && Compile::current()->method()->is_strict() ); | |
9447 match(Set dst (MulD dst src)); | |
9448 ins_cost(1); // Select this instruction for all strict FP double multiplies | |
9449 | |
9450 format %{ "FLD StubRoutines::_fpu_subnormal_bias1\n\t" | |
9451 "DMULp $dst,ST\n\t" | |
9452 "FLD $src\n\t" | |
9453 "DMULp $dst,ST\n\t" | |
9454 "FLD StubRoutines::_fpu_subnormal_bias2\n\t" | |
9455 "DMULp $dst,ST\n\t" %} | |
9456 opcode(0xDE, 0x1); /* DE C8+i or DE /1*/ | |
9457 ins_encode( strictfp_bias1(dst), | |
9458 Push_Reg_D(src), | |
9459 OpcP, RegOpc(dst), | |
9460 strictfp_bias2(dst) ); | |
9461 ins_pipe( fpu_reg_reg ); | |
9462 %} | |
9463 | |
9464 instruct mulD_reg_imm(regD dst, immD src) %{ | |
9465 predicate( UseSSE<=1 && _kids[1]->_leaf->getd() != 0.0 && _kids[1]->_leaf->getd() != 1.0 ); | |
9466 match(Set dst (MulD dst src)); | |
9467 ins_cost(200); | |
9468 format %{ "FLD_D [$src]\n\t" | |
9469 "DMULp $dst,ST" %} | |
9470 opcode(0xDE, 0x1); /* DE /1 */ | |
9471 ins_encode( LdImmD(src), | |
9472 OpcP, RegOpc(dst) ); | |
9473 ins_pipe( fpu_reg_mem ); | |
9474 %} | |
9475 | |
9476 | |
9477 instruct mulD_reg_mem(regD dst, memory src) %{ | |
9478 predicate( UseSSE<=1 ); | |
9479 match(Set dst (MulD dst (LoadD src))); | |
9480 ins_cost(200); | |
9481 format %{ "FLD_D $src\n\t" | |
9482 "DMULp $dst,ST" %} | |
9483 opcode(0xDE, 0x1, 0xDD); /* DE C8+i or DE /1*/ /* LoadD DD /0 */ | |
9484 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
9485 OpcP, RegOpc(dst) ); | |
9486 ins_pipe( fpu_reg_mem ); | |
9487 %} | |
9488 | |
9489 // | |
9490 // Cisc-alternate to reg-reg multiply | |
9491 instruct mulD_reg_mem_cisc(regD dst, regD src, memory mem) %{ | |
9492 predicate( UseSSE<=1 ); | |
9493 match(Set dst (MulD src (LoadD mem))); | |
9494 ins_cost(250); | |
9495 format %{ "FLD_D $mem\n\t" | |
9496 "DMUL ST,$src\n\t" | |
9497 "FSTP_D $dst" %} | |
9498 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i */ /* LoadD D9 /0 */ | |
9499 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,mem), | |
9500 OpcReg_F(src), | |
9501 Pop_Reg_D(dst) ); | |
9502 ins_pipe( fpu_reg_reg_mem ); | |
9503 %} | |
9504 | |
9505 | |
9506 // MACRO3 -- addD a mulD | |
9507 // This instruction is a '2-address' instruction in that the result goes | |
9508 // back to src2. This eliminates a move from the macro; possibly the | |
9509 // register allocator will have to add it back (and maybe not). | |
9510 instruct addD_mulD_reg(regD src2, regD src1, regD src0) %{ | |
9511 predicate( UseSSE<=1 ); | |
9512 match(Set src2 (AddD (MulD src0 src1) src2)); | |
9513 format %{ "FLD $src0\t# ===MACRO3d===\n\t" | |
9514 "DMUL ST,$src1\n\t" | |
9515 "DADDp $src2,ST" %} | |
9516 ins_cost(250); | |
9517 opcode(0xDD); /* LoadD DD /0 */ | |
9518 ins_encode( Push_Reg_F(src0), | |
9519 FMul_ST_reg(src1), | |
9520 FAddP_reg_ST(src2) ); | |
9521 ins_pipe( fpu_reg_reg_reg ); | |
9522 %} | |
9523 | |
9524 | |
9525 // MACRO3 -- subD a mulD | |
9526 instruct subD_mulD_reg(regD src2, regD src1, regD src0) %{ | |
9527 predicate( UseSSE<=1 ); | |
9528 match(Set src2 (SubD (MulD src0 src1) src2)); | |
9529 format %{ "FLD $src0\t# ===MACRO3d===\n\t" | |
9530 "DMUL ST,$src1\n\t" | |
9531 "DSUBRp $src2,ST" %} | |
9532 ins_cost(250); | |
9533 ins_encode( Push_Reg_F(src0), | |
9534 FMul_ST_reg(src1), | |
9535 Opcode(0xDE), Opc_plus(0xE0,src2)); | |
9536 ins_pipe( fpu_reg_reg_reg ); | |
9537 %} | |
9538 | |
9539 | |
9540 instruct divD_reg(regD dst, regD src) %{ | |
9541 predicate( UseSSE<=1 ); | |
9542 match(Set dst (DivD dst src)); | |
9543 | |
9544 format %{ "FLD $src\n\t" | |
9545 "FDIVp $dst,ST" %} | |
9546 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
9547 ins_cost(150); | |
9548 ins_encode( Push_Reg_D(src), | |
9549 OpcP, RegOpc(dst) ); | |
9550 ins_pipe( fpu_reg_reg ); | |
9551 %} | |
9552 | |
9553 // Strict FP instruction biases argument before division then | |
9554 // biases result, to avoid double rounding of subnormals. | |
9555 // | |
9556 // scale dividend by multiplying dividend by 2^(-15360) | |
9557 // load divisor | |
9558 // divide scaled dividend by divisor | |
9559 // rescale quotient by 2^(15360) | |
9560 // | |
9561 instruct strictfp_divD_reg(regDPR1 dst, regnotDPR1 src) %{ | |
9562 predicate (UseSSE<=1); | |
9563 match(Set dst (DivD dst src)); | |
9564 predicate( UseSSE<=1 && Compile::current()->has_method() && Compile::current()->method()->is_strict() ); | |
9565 ins_cost(01); | |
9566 | |
9567 format %{ "FLD StubRoutines::_fpu_subnormal_bias1\n\t" | |
9568 "DMULp $dst,ST\n\t" | |
9569 "FLD $src\n\t" | |
9570 "FDIVp $dst,ST\n\t" | |
9571 "FLD StubRoutines::_fpu_subnormal_bias2\n\t" | |
9572 "DMULp $dst,ST\n\t" %} | |
9573 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
9574 ins_encode( strictfp_bias1(dst), | |
9575 Push_Reg_D(src), | |
9576 OpcP, RegOpc(dst), | |
9577 strictfp_bias2(dst) ); | |
9578 ins_pipe( fpu_reg_reg ); | |
9579 %} | |
9580 | |
9581 instruct divD_reg_round(stackSlotD dst, regD src1, regD src2) %{ | |
9582 predicate( UseSSE<=1 && !(Compile::current()->has_method() && Compile::current()->method()->is_strict()) ); | |
9583 match(Set dst (RoundDouble (DivD src1 src2))); | |
9584 | |
9585 format %{ "FLD $src1\n\t" | |
9586 "FDIV ST,$src2\n\t" | |
9587 "FSTP_D $dst\t# D-round" %} | |
9588 opcode(0xD8, 0x6); /* D8 F0+i or D8 /6 */ | |
9589 ins_encode( Push_Reg_D(src1), | |
9590 OpcP, RegOpc(src2), Pop_Mem_D(dst) ); | |
9591 ins_pipe( fpu_mem_reg_reg ); | |
9592 %} | |
9593 | |
9594 | |
9595 instruct modD_reg(regD dst, regD src, eAXRegI rax, eFlagsReg cr) %{ | |
9596 predicate(UseSSE<=1); | |
9597 match(Set dst (ModD dst src)); | |
9598 effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS | |
9599 | |
9600 format %{ "DMOD $dst,$src" %} | |
9601 ins_cost(250); | |
9602 ins_encode(Push_Reg_Mod_D(dst, src), | |
9603 emitModD(), | |
9604 Push_Result_Mod_D(src), | |
9605 Pop_Reg_D(dst)); | |
9606 ins_pipe( pipe_slow ); | |
9607 %} | |
9608 | |
9609 instruct modXD_reg(regXD dst, regXD src0, regXD src1, eAXRegI rax, eFlagsReg cr) %{ | |
9610 predicate(UseSSE>=2); | |
9611 match(Set dst (ModD src0 src1)); | |
9612 effect(KILL rax, KILL cr); | |
9613 | |
9614 format %{ "SUB ESP,8\t # DMOD\n" | |
9615 "\tMOVSD [ESP+0],$src1\n" | |
9616 "\tFLD_D [ESP+0]\n" | |
9617 "\tMOVSD [ESP+0],$src0\n" | |
9618 "\tFLD_D [ESP+0]\n" | |
9619 "loop:\tFPREM\n" | |
9620 "\tFWAIT\n" | |
9621 "\tFNSTSW AX\n" | |
9622 "\tSAHF\n" | |
9623 "\tJP loop\n" | |
9624 "\tFSTP_D [ESP+0]\n" | |
9625 "\tMOVSD $dst,[ESP+0]\n" | |
9626 "\tADD ESP,8\n" | |
9627 "\tFSTP ST0\t # Restore FPU Stack" | |
9628 %} | |
9629 ins_cost(250); | |
9630 ins_encode( Push_ModD_encoding(src0, src1), emitModD(), Push_ResultXD(dst), PopFPU); | |
9631 ins_pipe( pipe_slow ); | |
9632 %} | |
9633 | |
9634 instruct sinD_reg(regDPR1 dst, regDPR1 src) %{ | |
9635 predicate (UseSSE<=1); | |
9636 match(Set dst (SinD src)); | |
9637 ins_cost(1800); | |
9638 format %{ "DSIN $dst" %} | |
9639 opcode(0xD9, 0xFE); | |
9640 ins_encode( OpcP, OpcS ); | |
9641 ins_pipe( pipe_slow ); | |
9642 %} | |
9643 | |
9644 instruct sinXD_reg(regXD dst, eFlagsReg cr) %{ | |
9645 predicate (UseSSE>=2); | |
9646 match(Set dst (SinD dst)); | |
9647 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
9648 ins_cost(1800); | |
9649 format %{ "DSIN $dst" %} | |
9650 opcode(0xD9, 0xFE); | |
9651 ins_encode( Push_SrcXD(dst), OpcP, OpcS, Push_ResultXD(dst) ); | |
9652 ins_pipe( pipe_slow ); | |
9653 %} | |
9654 | |
9655 instruct cosD_reg(regDPR1 dst, regDPR1 src) %{ | |
9656 predicate (UseSSE<=1); | |
9657 match(Set dst (CosD src)); | |
9658 ins_cost(1800); | |
9659 format %{ "DCOS $dst" %} | |
9660 opcode(0xD9, 0xFF); | |
9661 ins_encode( OpcP, OpcS ); | |
9662 ins_pipe( pipe_slow ); | |
9663 %} | |
9664 | |
9665 instruct cosXD_reg(regXD dst, eFlagsReg cr) %{ | |
9666 predicate (UseSSE>=2); | |
9667 match(Set dst (CosD dst)); | |
9668 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
9669 ins_cost(1800); | |
9670 format %{ "DCOS $dst" %} | |
9671 opcode(0xD9, 0xFF); | |
9672 ins_encode( Push_SrcXD(dst), OpcP, OpcS, Push_ResultXD(dst) ); | |
9673 ins_pipe( pipe_slow ); | |
9674 %} | |
9675 | |
9676 instruct tanD_reg(regDPR1 dst, regDPR1 src) %{ | |
9677 predicate (UseSSE<=1); | |
9678 match(Set dst(TanD src)); | |
9679 format %{ "DTAN $dst" %} | |
9680 ins_encode( Opcode(0xD9), Opcode(0xF2), // fptan | |
9681 Opcode(0xDD), Opcode(0xD8)); // fstp st | |
9682 ins_pipe( pipe_slow ); | |
9683 %} | |
9684 | |
9685 instruct tanXD_reg(regXD dst, eFlagsReg cr) %{ | |
9686 predicate (UseSSE>=2); | |
9687 match(Set dst(TanD dst)); | |
9688 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
9689 format %{ "DTAN $dst" %} | |
9690 ins_encode( Push_SrcXD(dst), | |
9691 Opcode(0xD9), Opcode(0xF2), // fptan | |
9692 Opcode(0xDD), Opcode(0xD8), // fstp st | |
9693 Push_ResultXD(dst) ); | |
9694 ins_pipe( pipe_slow ); | |
9695 %} | |
9696 | |
9697 instruct atanD_reg(regD dst, regD src) %{ | |
9698 predicate (UseSSE<=1); | |
9699 match(Set dst(AtanD dst src)); | |
9700 format %{ "DATA $dst,$src" %} | |
9701 opcode(0xD9, 0xF3); | |
9702 ins_encode( Push_Reg_D(src), | |
9703 OpcP, OpcS, RegOpc(dst) ); | |
9704 ins_pipe( pipe_slow ); | |
9705 %} | |
9706 | |
9707 instruct atanXD_reg(regXD dst, regXD src, eFlagsReg cr) %{ | |
9708 predicate (UseSSE>=2); | |
9709 match(Set dst(AtanD dst src)); | |
9710 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
9711 format %{ "DATA $dst,$src" %} | |
9712 opcode(0xD9, 0xF3); | |
9713 ins_encode( Push_SrcXD(src), | |
9714 OpcP, OpcS, Push_ResultXD(dst) ); | |
9715 ins_pipe( pipe_slow ); | |
9716 %} | |
9717 | |
9718 instruct sqrtD_reg(regD dst, regD src) %{ | |
9719 predicate (UseSSE<=1); | |
9720 match(Set dst (SqrtD src)); | |
9721 format %{ "DSQRT $dst,$src" %} | |
9722 opcode(0xFA, 0xD9); | |
9723 ins_encode( Push_Reg_D(src), | |
9724 OpcS, OpcP, Pop_Reg_D(dst) ); | |
9725 ins_pipe( pipe_slow ); | |
9726 %} | |
9727 | |
9728 instruct powD_reg(regD X, regDPR1 Y, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ | |
9729 predicate (UseSSE<=1); | |
9730 match(Set Y (PowD X Y)); // Raise X to the Yth power | |
9731 effect(KILL rax, KILL rbx, KILL rcx); | |
9732 format %{ "SUB ESP,8\t\t# Fast-path POW encoding\n\t" | |
9733 "FLD_D $X\n\t" | |
9734 "FYL2X \t\t\t# Q=Y*ln2(X)\n\t" | |
9735 | |
9736 "FDUP \t\t\t# Q Q\n\t" | |
9737 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
9738 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
9739 "FISTP dword [ESP]\n\t" | |
9740 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
9741 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
9742 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
9743 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
9744 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
9745 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
9746 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
9747 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
9748 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
9749 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
9750 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
9751 "MOV [ESP+0],0\n\t" | |
9752 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
9753 | |
9754 "ADD ESP,8" | |
9755 %} | |
9756 ins_encode( push_stack_temp_qword, | |
9757 Push_Reg_D(X), | |
9758 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
9759 pow_exp_core_encoding, | |
9760 pop_stack_temp_qword); | |
9761 ins_pipe( pipe_slow ); | |
9762 %} | |
9763 | |
9764 instruct powXD_reg(regXD dst, regXD src0, regXD src1, regDPR1 tmp1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx ) %{ | |
9765 predicate (UseSSE>=2); | |
9766 match(Set dst (PowD src0 src1)); // Raise src0 to the src1'th power | |
9767 effect(KILL tmp1, KILL rax, KILL rbx, KILL rcx ); | |
9768 format %{ "SUB ESP,8\t\t# Fast-path POW encoding\n\t" | |
9769 "MOVSD [ESP],$src1\n\t" | |
9770 "FLD FPR1,$src1\n\t" | |
9771 "MOVSD [ESP],$src0\n\t" | |
9772 "FLD FPR1,$src0\n\t" | |
9773 "FYL2X \t\t\t# Q=Y*ln2(X)\n\t" | |
9774 | |
9775 "FDUP \t\t\t# Q Q\n\t" | |
9776 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
9777 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
9778 "FISTP dword [ESP]\n\t" | |
9779 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
9780 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
9781 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
9782 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
9783 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
9784 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
9785 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
9786 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
9787 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
9788 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
9789 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
9790 "MOV [ESP+0],0\n\t" | |
9791 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
9792 | |
9793 "FST_D [ESP]\n\t" | |
9794 "MOVSD $dst,[ESP]\n\t" | |
9795 "ADD ESP,8" | |
9796 %} | |
9797 ins_encode( push_stack_temp_qword, | |
9798 push_xmm_to_fpr1(src1), | |
9799 push_xmm_to_fpr1(src0), | |
9800 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
9801 pow_exp_core_encoding, | |
9802 Push_ResultXD(dst) ); | |
9803 ins_pipe( pipe_slow ); | |
9804 %} | |
9805 | |
9806 | |
9807 instruct expD_reg(regDPR1 dpr1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ | |
9808 predicate (UseSSE<=1); | |
9809 match(Set dpr1 (ExpD dpr1)); | |
9810 effect(KILL rax, KILL rbx, KILL rcx); | |
9811 format %{ "SUB ESP,8\t\t# Fast-path EXP encoding" | |
9812 "FLDL2E \t\t\t# Ld log2(e) X\n\t" | |
9813 "FMULP \t\t\t# Q=X*log2(e)\n\t" | |
9814 | |
9815 "FDUP \t\t\t# Q Q\n\t" | |
9816 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
9817 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
9818 "FISTP dword [ESP]\n\t" | |
9819 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
9820 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
9821 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
9822 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
9823 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
9824 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
9825 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
9826 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
9827 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
9828 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
9829 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
9830 "MOV [ESP+0],0\n\t" | |
9831 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
9832 | |
9833 "ADD ESP,8" | |
9834 %} | |
9835 ins_encode( push_stack_temp_qword, | |
9836 Opcode(0xD9), Opcode(0xEA), // fldl2e | |
9837 Opcode(0xDE), Opcode(0xC9), // fmulp | |
9838 pow_exp_core_encoding, | |
9839 pop_stack_temp_qword); | |
9840 ins_pipe( pipe_slow ); | |
9841 %} | |
9842 | |
9843 instruct expXD_reg(regXD dst, regXD src, regDPR1 tmp1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ | |
9844 predicate (UseSSE>=2); | |
9845 match(Set dst (ExpD src)); | |
9846 effect(KILL tmp1, KILL rax, KILL rbx, KILL rcx); | |
9847 format %{ "SUB ESP,8\t\t# Fast-path EXP encoding\n\t" | |
9848 "MOVSD [ESP],$src\n\t" | |
9849 "FLDL2E \t\t\t# Ld log2(e) X\n\t" | |
9850 "FMULP \t\t\t# Q=X*log2(e) X\n\t" | |
9851 | |
9852 "FDUP \t\t\t# Q Q\n\t" | |
9853 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
9854 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
9855 "FISTP dword [ESP]\n\t" | |
9856 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
9857 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
9858 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
9859 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
9860 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
9861 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
9862 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
9863 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
9864 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
9865 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
9866 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
9867 "MOV [ESP+0],0\n\t" | |
9868 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
9869 | |
9870 "FST_D [ESP]\n\t" | |
9871 "MOVSD $dst,[ESP]\n\t" | |
9872 "ADD ESP,8" | |
9873 %} | |
9874 ins_encode( Push_SrcXD(src), | |
9875 Opcode(0xD9), Opcode(0xEA), // fldl2e | |
9876 Opcode(0xDE), Opcode(0xC9), // fmulp | |
9877 pow_exp_core_encoding, | |
9878 Push_ResultXD(dst) ); | |
9879 ins_pipe( pipe_slow ); | |
9880 %} | |
9881 | |
9882 | |
9883 | |
9884 instruct log10D_reg(regDPR1 dst, regDPR1 src) %{ | |
9885 predicate (UseSSE<=1); | |
9886 // The source Double operand on FPU stack | |
9887 match(Set dst (Log10D src)); | |
9888 // fldlg2 ; push log_10(2) on the FPU stack; full 80-bit number | |
9889 // fxch ; swap ST(0) with ST(1) | |
9890 // fyl2x ; compute log_10(2) * log_2(x) | |
9891 format %{ "FLDLG2 \t\t\t#Log10\n\t" | |
9892 "FXCH \n\t" | |
9893 "FYL2X \t\t\t# Q=Log10*Log_2(x)" | |
9894 %} | |
9895 ins_encode( Opcode(0xD9), Opcode(0xEC), // fldlg2 | |
9896 Opcode(0xD9), Opcode(0xC9), // fxch | |
9897 Opcode(0xD9), Opcode(0xF1)); // fyl2x | |
9898 | |
9899 ins_pipe( pipe_slow ); | |
9900 %} | |
9901 | |
9902 instruct log10XD_reg(regXD dst, regXD src, eFlagsReg cr) %{ | |
9903 predicate (UseSSE>=2); | |
9904 effect(KILL cr); | |
9905 match(Set dst (Log10D src)); | |
9906 // fldlg2 ; push log_10(2) on the FPU stack; full 80-bit number | |
9907 // fyl2x ; compute log_10(2) * log_2(x) | |
9908 format %{ "FLDLG2 \t\t\t#Log10\n\t" | |
9909 "FYL2X \t\t\t# Q=Log10*Log_2(x)" | |
9910 %} | |
9911 ins_encode( Opcode(0xD9), Opcode(0xEC), // fldlg2 | |
9912 Push_SrcXD(src), | |
9913 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
9914 Push_ResultXD(dst)); | |
9915 | |
9916 ins_pipe( pipe_slow ); | |
9917 %} | |
9918 | |
9919 instruct logD_reg(regDPR1 dst, regDPR1 src) %{ | |
9920 predicate (UseSSE<=1); | |
9921 // The source Double operand on FPU stack | |
9922 match(Set dst (LogD src)); | |
9923 // fldln2 ; push log_e(2) on the FPU stack; full 80-bit number | |
9924 // fxch ; swap ST(0) with ST(1) | |
9925 // fyl2x ; compute log_e(2) * log_2(x) | |
9926 format %{ "FLDLN2 \t\t\t#Log_e\n\t" | |
9927 "FXCH \n\t" | |
9928 "FYL2X \t\t\t# Q=Log_e*Log_2(x)" | |
9929 %} | |
9930 ins_encode( Opcode(0xD9), Opcode(0xED), // fldln2 | |
9931 Opcode(0xD9), Opcode(0xC9), // fxch | |
9932 Opcode(0xD9), Opcode(0xF1)); // fyl2x | |
9933 | |
9934 ins_pipe( pipe_slow ); | |
9935 %} | |
9936 | |
9937 instruct logXD_reg(regXD dst, regXD src, eFlagsReg cr) %{ | |
9938 predicate (UseSSE>=2); | |
9939 effect(KILL cr); | |
9940 // The source and result Double operands in XMM registers | |
9941 match(Set dst (LogD src)); | |
9942 // fldln2 ; push log_e(2) on the FPU stack; full 80-bit number | |
9943 // fyl2x ; compute log_e(2) * log_2(x) | |
9944 format %{ "FLDLN2 \t\t\t#Log_e\n\t" | |
9945 "FYL2X \t\t\t# Q=Log_e*Log_2(x)" | |
9946 %} | |
9947 ins_encode( Opcode(0xD9), Opcode(0xED), // fldln2 | |
9948 Push_SrcXD(src), | |
9949 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
9950 Push_ResultXD(dst)); | |
9951 ins_pipe( pipe_slow ); | |
9952 %} | |
9953 | |
9954 //-------------Float Instructions------------------------------- | |
9955 // Float Math | |
9956 | |
9957 // Code for float compare: | |
9958 // fcompp(); | |
9959 // fwait(); fnstsw_ax(); | |
9960 // sahf(); | |
9961 // movl(dst, unordered_result); | |
9962 // jcc(Assembler::parity, exit); | |
9963 // movl(dst, less_result); | |
9964 // jcc(Assembler::below, exit); | |
9965 // movl(dst, equal_result); | |
9966 // jcc(Assembler::equal, exit); | |
9967 // movl(dst, greater_result); | |
9968 // exit: | |
9969 | |
9970 // P6 version of float compare, sets condition codes in EFLAGS | |
9971 instruct cmpF_cc_P6(eFlagsRegU cr, regF src1, regF src2, eAXRegI rax) %{ | |
9972 predicate(VM_Version::supports_cmov() && UseSSE == 0); | |
9973 match(Set cr (CmpF src1 src2)); | |
9974 effect(KILL rax); | |
9975 ins_cost(150); | |
9976 format %{ "FLD $src1\n\t" | |
9977 "FUCOMIP ST,$src2 // P6 instruction\n\t" | |
9978 "JNP exit\n\t" | |
9979 "MOV ah,1 // saw a NaN, set CF (treat as LT)\n\t" | |
9980 "SAHF\n" | |
9981 "exit:\tNOP // avoid branch to branch" %} | |
9982 opcode(0xDF, 0x05); /* DF E8+i or DF /5 */ | |
9983 ins_encode( Push_Reg_D(src1), | |
9984 OpcP, RegOpc(src2), | |
9985 cmpF_P6_fixup ); | |
9986 ins_pipe( pipe_slow ); | |
9987 %} | |
9988 | |
9989 | |
9990 // Compare & branch | |
9991 instruct cmpF_cc(eFlagsRegU cr, regF src1, regF src2, eAXRegI rax) %{ | |
9992 predicate(UseSSE == 0); | |
9993 match(Set cr (CmpF src1 src2)); | |
9994 effect(KILL rax); | |
9995 ins_cost(200); | |
9996 format %{ "FLD $src1\n\t" | |
9997 "FCOMp $src2\n\t" | |
9998 "FNSTSW AX\n\t" | |
9999 "TEST AX,0x400\n\t" | |
10000 "JZ,s flags\n\t" | |
10001 "MOV AH,1\t# unordered treat as LT\n" | |
10002 "flags:\tSAHF" %} | |
10003 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
10004 ins_encode( Push_Reg_D(src1), | |
10005 OpcP, RegOpc(src2), | |
10006 fpu_flags); | |
10007 ins_pipe( pipe_slow ); | |
10008 %} | |
10009 | |
10010 // Compare vs zero into -1,0,1 | |
10011 instruct cmpF_0(eRegI dst, regF src1, immF0 zero, eAXRegI rax, eFlagsReg cr) %{ | |
10012 predicate(UseSSE == 0); | |
10013 match(Set dst (CmpF3 src1 zero)); | |
10014 effect(KILL cr, KILL rax); | |
10015 ins_cost(280); | |
10016 format %{ "FTSTF $dst,$src1" %} | |
10017 opcode(0xE4, 0xD9); | |
10018 ins_encode( Push_Reg_D(src1), | |
10019 OpcS, OpcP, PopFPU, | |
10020 CmpF_Result(dst)); | |
10021 ins_pipe( pipe_slow ); | |
10022 %} | |
10023 | |
10024 // Compare into -1,0,1 | |
10025 instruct cmpF_reg(eRegI dst, regF src1, regF src2, eAXRegI rax, eFlagsReg cr) %{ | |
10026 predicate(UseSSE == 0); | |
10027 match(Set dst (CmpF3 src1 src2)); | |
10028 effect(KILL cr, KILL rax); | |
10029 ins_cost(300); | |
10030 format %{ "FCMPF $dst,$src1,$src2" %} | |
10031 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
10032 ins_encode( Push_Reg_D(src1), | |
10033 OpcP, RegOpc(src2), | |
10034 CmpF_Result(dst)); | |
10035 ins_pipe( pipe_slow ); | |
10036 %} | |
10037 | |
10038 // float compare and set condition codes in EFLAGS by XMM regs | |
10039 instruct cmpX_cc(eFlagsRegU cr, regX dst, regX src, eAXRegI rax) %{ | |
10040 predicate(UseSSE>=1); | |
10041 match(Set cr (CmpF dst src)); | |
10042 effect(KILL rax); | |
10043 ins_cost(145); | |
10044 format %{ "COMISS $dst,$src\n" | |
10045 "\tJNP exit\n" | |
10046 "\tMOV ah,1 // saw a NaN, set CF\n" | |
10047 "\tSAHF\n" | |
10048 "exit:\tNOP // avoid branch to branch" %} | |
10049 opcode(0x0F, 0x2F); | |
10050 ins_encode(OpcP, OpcS, RegReg(dst, src), cmpF_P6_fixup); | |
10051 ins_pipe( pipe_slow ); | |
10052 %} | |
10053 | |
10054 // float compare and set condition codes in EFLAGS by XMM regs | |
10055 instruct cmpX_ccmem(eFlagsRegU cr, regX dst, memory src, eAXRegI rax) %{ | |
10056 predicate(UseSSE>=1); | |
10057 match(Set cr (CmpF dst (LoadF src))); | |
10058 effect(KILL rax); | |
10059 ins_cost(165); | |
10060 format %{ "COMISS $dst,$src\n" | |
10061 "\tJNP exit\n" | |
10062 "\tMOV ah,1 // saw a NaN, set CF\n" | |
10063 "\tSAHF\n" | |
10064 "exit:\tNOP // avoid branch to branch" %} | |
10065 opcode(0x0F, 0x2F); | |
10066 ins_encode(OpcP, OpcS, RegMem(dst, src), cmpF_P6_fixup); | |
10067 ins_pipe( pipe_slow ); | |
10068 %} | |
10069 | |
10070 // Compare into -1,0,1 in XMM | |
10071 instruct cmpX_reg(eRegI dst, regX src1, regX src2, eFlagsReg cr) %{ | |
10072 predicate(UseSSE>=1); | |
10073 match(Set dst (CmpF3 src1 src2)); | |
10074 effect(KILL cr); | |
10075 ins_cost(255); | |
10076 format %{ "XOR $dst,$dst\n" | |
10077 "\tCOMISS $src1,$src2\n" | |
10078 "\tJP,s nan\n" | |
10079 "\tJEQ,s exit\n" | |
10080 "\tJA,s inc\n" | |
10081 "nan:\tDEC $dst\n" | |
10082 "\tJMP,s exit\n" | |
10083 "inc:\tINC $dst\n" | |
10084 "exit:" | |
10085 %} | |
10086 opcode(0x0F, 0x2F); | |
10087 ins_encode(Xor_Reg(dst), OpcP, OpcS, RegReg(src1, src2), CmpX_Result(dst)); | |
10088 ins_pipe( pipe_slow ); | |
10089 %} | |
10090 | |
10091 // Compare into -1,0,1 in XMM and memory | |
10092 instruct cmpX_regmem(eRegI dst, regX src1, memory mem, eFlagsReg cr) %{ | |
10093 predicate(UseSSE>=1); | |
10094 match(Set dst (CmpF3 src1 (LoadF mem))); | |
10095 effect(KILL cr); | |
10096 ins_cost(275); | |
10097 format %{ "COMISS $src1,$mem\n" | |
10098 "\tMOV $dst,0\t\t# do not blow flags\n" | |
10099 "\tJP,s nan\n" | |
10100 "\tJEQ,s exit\n" | |
10101 "\tJA,s inc\n" | |
10102 "nan:\tDEC $dst\n" | |
10103 "\tJMP,s exit\n" | |
10104 "inc:\tINC $dst\n" | |
10105 "exit:" | |
10106 %} | |
10107 opcode(0x0F, 0x2F); | |
10108 ins_encode(OpcP, OpcS, RegMem(src1, mem), LdImmI(dst,0x0), CmpX_Result(dst)); | |
10109 ins_pipe( pipe_slow ); | |
10110 %} | |
10111 | |
10112 // Spill to obtain 24-bit precision | |
10113 instruct subF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
10114 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10115 match(Set dst (SubF src1 src2)); | |
10116 | |
10117 format %{ "FSUB $dst,$src1 - $src2" %} | |
10118 opcode(0xD8, 0x4); /* D8 E0+i or D8 /4 mod==0x3 ;; result in TOS */ | |
10119 ins_encode( Push_Reg_F(src1), | |
10120 OpcReg_F(src2), | |
10121 Pop_Mem_F(dst) ); | |
10122 ins_pipe( fpu_mem_reg_reg ); | |
10123 %} | |
10124 // | |
10125 // This instruction does not round to 24-bits | |
10126 instruct subF_reg(regF dst, regF src) %{ | |
10127 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10128 match(Set dst (SubF dst src)); | |
10129 | |
10130 format %{ "FSUB $dst,$src" %} | |
10131 opcode(0xDE, 0x5); /* DE E8+i or DE /5 */ | |
10132 ins_encode( Push_Reg_F(src), | |
10133 OpcP, RegOpc(dst) ); | |
10134 ins_pipe( fpu_reg_reg ); | |
10135 %} | |
10136 | |
10137 // Spill to obtain 24-bit precision | |
10138 instruct addF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
10139 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10140 match(Set dst (AddF src1 src2)); | |
10141 | |
10142 format %{ "FADD $dst,$src1,$src2" %} | |
10143 opcode(0xD8, 0x0); /* D8 C0+i */ | |
10144 ins_encode( Push_Reg_F(src2), | |
10145 OpcReg_F(src1), | |
10146 Pop_Mem_F(dst) ); | |
10147 ins_pipe( fpu_mem_reg_reg ); | |
10148 %} | |
10149 // | |
10150 // This instruction does not round to 24-bits | |
10151 instruct addF_reg(regF dst, regF src) %{ | |
10152 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10153 match(Set dst (AddF dst src)); | |
10154 | |
10155 format %{ "FLD $src\n\t" | |
10156 "FADDp $dst,ST" %} | |
10157 opcode(0xDE, 0x0); /* DE C0+i or DE /0*/ | |
10158 ins_encode( Push_Reg_F(src), | |
10159 OpcP, RegOpc(dst) ); | |
10160 ins_pipe( fpu_reg_reg ); | |
10161 %} | |
10162 | |
10163 // Add two single precision floating point values in xmm | |
10164 instruct addX_reg(regX dst, regX src) %{ | |
10165 predicate(UseSSE>=1); | |
10166 match(Set dst (AddF dst src)); | |
10167 format %{ "ADDSS $dst,$src" %} | |
10168 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), RegReg(dst, src)); | |
10169 ins_pipe( pipe_slow ); | |
10170 %} | |
10171 | |
10172 instruct addX_imm(regX dst, immXF con) %{ | |
10173 predicate(UseSSE>=1); | |
10174 match(Set dst (AddF dst con)); | |
10175 format %{ "ADDSS $dst,[$con]" %} | |
10176 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), LdImmX(dst, con) ); | |
10177 ins_pipe( pipe_slow ); | |
10178 %} | |
10179 | |
10180 instruct addX_mem(regX dst, memory mem) %{ | |
10181 predicate(UseSSE>=1); | |
10182 match(Set dst (AddF dst (LoadF mem))); | |
10183 format %{ "ADDSS $dst,$mem" %} | |
10184 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), RegMem(dst, mem)); | |
10185 ins_pipe( pipe_slow ); | |
10186 %} | |
10187 | |
10188 // Subtract two single precision floating point values in xmm | |
10189 instruct subX_reg(regX dst, regX src) %{ | |
10190 predicate(UseSSE>=1); | |
10191 match(Set dst (SubF dst src)); | |
10192 format %{ "SUBSS $dst,$src" %} | |
10193 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), RegReg(dst, src)); | |
10194 ins_pipe( pipe_slow ); | |
10195 %} | |
10196 | |
10197 instruct subX_imm(regX dst, immXF con) %{ | |
10198 predicate(UseSSE>=1); | |
10199 match(Set dst (SubF dst con)); | |
10200 format %{ "SUBSS $dst,[$con]" %} | |
10201 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), LdImmX(dst, con) ); | |
10202 ins_pipe( pipe_slow ); | |
10203 %} | |
10204 | |
10205 instruct subX_mem(regX dst, memory mem) %{ | |
10206 predicate(UseSSE>=1); | |
10207 match(Set dst (SubF dst (LoadF mem))); | |
10208 format %{ "SUBSS $dst,$mem" %} | |
10209 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), RegMem(dst,mem)); | |
10210 ins_pipe( pipe_slow ); | |
10211 %} | |
10212 | |
10213 // Multiply two single precision floating point values in xmm | |
10214 instruct mulX_reg(regX dst, regX src) %{ | |
10215 predicate(UseSSE>=1); | |
10216 match(Set dst (MulF dst src)); | |
10217 format %{ "MULSS $dst,$src" %} | |
10218 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), RegReg(dst, src)); | |
10219 ins_pipe( pipe_slow ); | |
10220 %} | |
10221 | |
10222 instruct mulX_imm(regX dst, immXF con) %{ | |
10223 predicate(UseSSE>=1); | |
10224 match(Set dst (MulF dst con)); | |
10225 format %{ "MULSS $dst,[$con]" %} | |
10226 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), LdImmX(dst, con) ); | |
10227 ins_pipe( pipe_slow ); | |
10228 %} | |
10229 | |
10230 instruct mulX_mem(regX dst, memory mem) %{ | |
10231 predicate(UseSSE>=1); | |
10232 match(Set dst (MulF dst (LoadF mem))); | |
10233 format %{ "MULSS $dst,$mem" %} | |
10234 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), RegMem(dst,mem)); | |
10235 ins_pipe( pipe_slow ); | |
10236 %} | |
10237 | |
10238 // Divide two single precision floating point values in xmm | |
10239 instruct divX_reg(regX dst, regX src) %{ | |
10240 predicate(UseSSE>=1); | |
10241 match(Set dst (DivF dst src)); | |
10242 format %{ "DIVSS $dst,$src" %} | |
10243 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), RegReg(dst, src)); | |
10244 ins_pipe( pipe_slow ); | |
10245 %} | |
10246 | |
10247 instruct divX_imm(regX dst, immXF con) %{ | |
10248 predicate(UseSSE>=1); | |
10249 match(Set dst (DivF dst con)); | |
10250 format %{ "DIVSS $dst,[$con]" %} | |
10251 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), LdImmX(dst, con) ); | |
10252 ins_pipe( pipe_slow ); | |
10253 %} | |
10254 | |
10255 instruct divX_mem(regX dst, memory mem) %{ | |
10256 predicate(UseSSE>=1); | |
10257 match(Set dst (DivF dst (LoadF mem))); | |
10258 format %{ "DIVSS $dst,$mem" %} | |
10259 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), RegMem(dst,mem)); | |
10260 ins_pipe( pipe_slow ); | |
10261 %} | |
10262 | |
10263 // Get the square root of a single precision floating point values in xmm | |
10264 instruct sqrtX_reg(regX dst, regX src) %{ | |
10265 predicate(UseSSE>=1); | |
10266 match(Set dst (ConvD2F (SqrtD (ConvF2D src)))); | |
10267 format %{ "SQRTSS $dst,$src" %} | |
10268 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x51), RegReg(dst, src)); | |
10269 ins_pipe( pipe_slow ); | |
10270 %} | |
10271 | |
10272 instruct sqrtX_mem(regX dst, memory mem) %{ | |
10273 predicate(UseSSE>=1); | |
10274 match(Set dst (ConvD2F (SqrtD (ConvF2D (LoadF mem))))); | |
10275 format %{ "SQRTSS $dst,$mem" %} | |
10276 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x51), RegMem(dst, mem)); | |
10277 ins_pipe( pipe_slow ); | |
10278 %} | |
10279 | |
10280 // Get the square root of a double precision floating point values in xmm | |
10281 instruct sqrtXD_reg(regXD dst, regXD src) %{ | |
10282 predicate(UseSSE>=2); | |
10283 match(Set dst (SqrtD src)); | |
10284 format %{ "SQRTSD $dst,$src" %} | |
10285 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x51), RegReg(dst, src)); | |
10286 ins_pipe( pipe_slow ); | |
10287 %} | |
10288 | |
10289 instruct sqrtXD_mem(regXD dst, memory mem) %{ | |
10290 predicate(UseSSE>=2); | |
10291 match(Set dst (SqrtD (LoadD mem))); | |
10292 format %{ "SQRTSD $dst,$mem" %} | |
10293 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x51), RegMem(dst, mem)); | |
10294 ins_pipe( pipe_slow ); | |
10295 %} | |
10296 | |
10297 instruct absF_reg(regFPR1 dst, regFPR1 src) %{ | |
10298 predicate(UseSSE==0); | |
10299 match(Set dst (AbsF src)); | |
10300 ins_cost(100); | |
10301 format %{ "FABS" %} | |
10302 opcode(0xE1, 0xD9); | |
10303 ins_encode( OpcS, OpcP ); | |
10304 ins_pipe( fpu_reg_reg ); | |
10305 %} | |
10306 | |
10307 instruct absX_reg(regX dst ) %{ | |
10308 predicate(UseSSE>=1); | |
10309 match(Set dst (AbsF dst)); | |
10310 format %{ "ANDPS $dst,[0x7FFFFFFF]\t# ABS F by sign masking" %} | |
10311 ins_encode( AbsXF_encoding(dst)); | |
10312 ins_pipe( pipe_slow ); | |
10313 %} | |
10314 | |
10315 instruct negF_reg(regFPR1 dst, regFPR1 src) %{ | |
10316 predicate(UseSSE==0); | |
10317 match(Set dst (NegF src)); | |
10318 ins_cost(100); | |
10319 format %{ "FCHS" %} | |
10320 opcode(0xE0, 0xD9); | |
10321 ins_encode( OpcS, OpcP ); | |
10322 ins_pipe( fpu_reg_reg ); | |
10323 %} | |
10324 | |
10325 instruct negX_reg( regX dst ) %{ | |
10326 predicate(UseSSE>=1); | |
10327 match(Set dst (NegF dst)); | |
10328 format %{ "XORPS $dst,[0x80000000]\t# CHS F by sign flipping" %} | |
10329 ins_encode( NegXF_encoding(dst)); | |
10330 ins_pipe( pipe_slow ); | |
10331 %} | |
10332 | |
10333 // Cisc-alternate to addF_reg | |
10334 // Spill to obtain 24-bit precision | |
10335 instruct addF24_reg_mem(stackSlotF dst, regF src1, memory src2) %{ | |
10336 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10337 match(Set dst (AddF src1 (LoadF src2))); | |
10338 | |
10339 format %{ "FLD $src2\n\t" | |
10340 "FADD ST,$src1\n\t" | |
10341 "FSTP_S $dst" %} | |
10342 opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ | |
10343 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
10344 OpcReg_F(src1), | |
10345 Pop_Mem_F(dst) ); | |
10346 ins_pipe( fpu_mem_reg_mem ); | |
10347 %} | |
10348 // | |
10349 // Cisc-alternate to addF_reg | |
10350 // This instruction does not round to 24-bits | |
10351 instruct addF_reg_mem(regF dst, memory src) %{ | |
10352 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10353 match(Set dst (AddF dst (LoadF src))); | |
10354 | |
10355 format %{ "FADD $dst,$src" %} | |
10356 opcode(0xDE, 0x0, 0xD9); /* DE C0+i or DE /0*/ /* LoadF D9 /0 */ | |
10357 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
10358 OpcP, RegOpc(dst) ); | |
10359 ins_pipe( fpu_reg_mem ); | |
10360 %} | |
10361 | |
10362 // // Following two instructions for _222_mpegaudio | |
10363 // Spill to obtain 24-bit precision | |
10364 instruct addF24_mem_reg(stackSlotF dst, regF src2, memory src1 ) %{ | |
10365 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10366 match(Set dst (AddF src1 src2)); | |
10367 | |
10368 format %{ "FADD $dst,$src1,$src2" %} | |
10369 opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ | |
10370 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src1), | |
10371 OpcReg_F(src2), | |
10372 Pop_Mem_F(dst) ); | |
10373 ins_pipe( fpu_mem_reg_mem ); | |
10374 %} | |
10375 | |
10376 // Cisc-spill variant | |
10377 // Spill to obtain 24-bit precision | |
10378 instruct addF24_mem_cisc(stackSlotF dst, memory src1, memory src2) %{ | |
10379 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10380 match(Set dst (AddF src1 (LoadF src2))); | |
10381 | |
10382 format %{ "FADD $dst,$src1,$src2 cisc" %} | |
10383 opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ | |
10384 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
10385 set_instruction_start, | |
10386 OpcP, RMopc_Mem(secondary,src1), | |
10387 Pop_Mem_F(dst) ); | |
10388 ins_pipe( fpu_mem_mem_mem ); | |
10389 %} | |
10390 | |
10391 // Spill to obtain 24-bit precision | |
10392 instruct addF24_mem_mem(stackSlotF dst, memory src1, memory src2) %{ | |
10393 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10394 match(Set dst (AddF src1 src2)); | |
10395 | |
10396 format %{ "FADD $dst,$src1,$src2" %} | |
10397 opcode(0xD8, 0x0, 0xD9); /* D8 /0 */ /* LoadF D9 /0 */ | |
10398 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
10399 set_instruction_start, | |
10400 OpcP, RMopc_Mem(secondary,src1), | |
10401 Pop_Mem_F(dst) ); | |
10402 ins_pipe( fpu_mem_mem_mem ); | |
10403 %} | |
10404 | |
10405 | |
10406 // Spill to obtain 24-bit precision | |
10407 instruct addF24_reg_imm(stackSlotF dst, regF src1, immF src2) %{ | |
10408 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10409 match(Set dst (AddF src1 src2)); | |
10410 format %{ "FLD $src1\n\t" | |
10411 "FADD $src2\n\t" | |
10412 "FSTP_S $dst" %} | |
10413 opcode(0xD8, 0x00); /* D8 /0 */ | |
10414 ins_encode( Push_Reg_F(src1), | |
10415 Opc_MemImm_F(src2), | |
10416 Pop_Mem_F(dst)); | |
10417 ins_pipe( fpu_mem_reg_con ); | |
10418 %} | |
10419 // | |
10420 // This instruction does not round to 24-bits | |
10421 instruct addF_reg_imm(regF dst, regF src1, immF src2) %{ | |
10422 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10423 match(Set dst (AddF src1 src2)); | |
10424 format %{ "FLD $src1\n\t" | |
10425 "FADD $src2\n\t" | |
10426 "FSTP_S $dst" %} | |
10427 opcode(0xD8, 0x00); /* D8 /0 */ | |
10428 ins_encode( Push_Reg_F(src1), | |
10429 Opc_MemImm_F(src2), | |
10430 Pop_Reg_F(dst)); | |
10431 ins_pipe( fpu_reg_reg_con ); | |
10432 %} | |
10433 | |
10434 // Spill to obtain 24-bit precision | |
10435 instruct mulF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
10436 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10437 match(Set dst (MulF src1 src2)); | |
10438 | |
10439 format %{ "FLD $src1\n\t" | |
10440 "FMUL $src2\n\t" | |
10441 "FSTP_S $dst" %} | |
10442 opcode(0xD8, 0x1); /* D8 C8+i or D8 /1 ;; result in TOS */ | |
10443 ins_encode( Push_Reg_F(src1), | |
10444 OpcReg_F(src2), | |
10445 Pop_Mem_F(dst) ); | |
10446 ins_pipe( fpu_mem_reg_reg ); | |
10447 %} | |
10448 // | |
10449 // This instruction does not round to 24-bits | |
10450 instruct mulF_reg(regF dst, regF src1, regF src2) %{ | |
10451 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10452 match(Set dst (MulF src1 src2)); | |
10453 | |
10454 format %{ "FLD $src1\n\t" | |
10455 "FMUL $src2\n\t" | |
10456 "FSTP_S $dst" %} | |
10457 opcode(0xD8, 0x1); /* D8 C8+i */ | |
10458 ins_encode( Push_Reg_F(src2), | |
10459 OpcReg_F(src1), | |
10460 Pop_Reg_F(dst) ); | |
10461 ins_pipe( fpu_reg_reg_reg ); | |
10462 %} | |
10463 | |
10464 | |
10465 // Spill to obtain 24-bit precision | |
10466 // Cisc-alternate to reg-reg multiply | |
10467 instruct mulF24_reg_mem(stackSlotF dst, regF src1, memory src2) %{ | |
10468 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10469 match(Set dst (MulF src1 (LoadF src2))); | |
10470 | |
10471 format %{ "FLD_S $src2\n\t" | |
10472 "FMUL $src1\n\t" | |
10473 "FSTP_S $dst" %} | |
10474 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i or DE /1*/ /* LoadF D9 /0 */ | |
10475 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
10476 OpcReg_F(src1), | |
10477 Pop_Mem_F(dst) ); | |
10478 ins_pipe( fpu_mem_reg_mem ); | |
10479 %} | |
10480 // | |
10481 // This instruction does not round to 24-bits | |
10482 // Cisc-alternate to reg-reg multiply | |
10483 instruct mulF_reg_mem(regF dst, regF src1, memory src2) %{ | |
10484 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10485 match(Set dst (MulF src1 (LoadF src2))); | |
10486 | |
10487 format %{ "FMUL $dst,$src1,$src2" %} | |
10488 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i */ /* LoadF D9 /0 */ | |
10489 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
10490 OpcReg_F(src1), | |
10491 Pop_Reg_F(dst) ); | |
10492 ins_pipe( fpu_reg_reg_mem ); | |
10493 %} | |
10494 | |
10495 // Spill to obtain 24-bit precision | |
10496 instruct mulF24_mem_mem(stackSlotF dst, memory src1, memory src2) %{ | |
10497 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10498 match(Set dst (MulF src1 src2)); | |
10499 | |
10500 format %{ "FMUL $dst,$src1,$src2" %} | |
10501 opcode(0xD8, 0x1, 0xD9); /* D8 /1 */ /* LoadF D9 /0 */ | |
10502 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
10503 set_instruction_start, | |
10504 OpcP, RMopc_Mem(secondary,src1), | |
10505 Pop_Mem_F(dst) ); | |
10506 ins_pipe( fpu_mem_mem_mem ); | |
10507 %} | |
10508 | |
10509 // Spill to obtain 24-bit precision | |
10510 instruct mulF24_reg_imm(stackSlotF dst, regF src1, immF src2) %{ | |
10511 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10512 match(Set dst (MulF src1 src2)); | |
10513 | |
10514 format %{ "FMULc $dst,$src1,$src2" %} | |
10515 opcode(0xD8, 0x1); /* D8 /1*/ | |
10516 ins_encode( Push_Reg_F(src1), | |
10517 Opc_MemImm_F(src2), | |
10518 Pop_Mem_F(dst)); | |
10519 ins_pipe( fpu_mem_reg_con ); | |
10520 %} | |
10521 // | |
10522 // This instruction does not round to 24-bits | |
10523 instruct mulF_reg_imm(regF dst, regF src1, immF src2) %{ | |
10524 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10525 match(Set dst (MulF src1 src2)); | |
10526 | |
10527 format %{ "FMULc $dst. $src1, $src2" %} | |
10528 opcode(0xD8, 0x1); /* D8 /1*/ | |
10529 ins_encode( Push_Reg_F(src1), | |
10530 Opc_MemImm_F(src2), | |
10531 Pop_Reg_F(dst)); | |
10532 ins_pipe( fpu_reg_reg_con ); | |
10533 %} | |
10534 | |
10535 | |
10536 // | |
10537 // MACRO1 -- subsume unshared load into mulF | |
10538 // This instruction does not round to 24-bits | |
10539 instruct mulF_reg_load1(regF dst, regF src, memory mem1 ) %{ | |
10540 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10541 match(Set dst (MulF (LoadF mem1) src)); | |
10542 | |
10543 format %{ "FLD $mem1 ===MACRO1===\n\t" | |
10544 "FMUL ST,$src\n\t" | |
10545 "FSTP $dst" %} | |
10546 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i or D8 /1 */ /* LoadF D9 /0 */ | |
10547 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,mem1), | |
10548 OpcReg_F(src), | |
10549 Pop_Reg_F(dst) ); | |
10550 ins_pipe( fpu_reg_reg_mem ); | |
10551 %} | |
10552 // | |
10553 // MACRO2 -- addF a mulF which subsumed an unshared load | |
10554 // This instruction does not round to 24-bits | |
10555 instruct addF_mulF_reg_load1(regF dst, memory mem1, regF src1, regF src2) %{ | |
10556 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10557 match(Set dst (AddF (MulF (LoadF mem1) src1) src2)); | |
10558 ins_cost(95); | |
10559 | |
10560 format %{ "FLD $mem1 ===MACRO2===\n\t" | |
10561 "FMUL ST,$src1 subsume mulF left load\n\t" | |
10562 "FADD ST,$src2\n\t" | |
10563 "FSTP $dst" %} | |
10564 opcode(0xD9); /* LoadF D9 /0 */ | |
10565 ins_encode( OpcP, RMopc_Mem(0x00,mem1), | |
10566 FMul_ST_reg(src1), | |
10567 FAdd_ST_reg(src2), | |
10568 Pop_Reg_F(dst) ); | |
10569 ins_pipe( fpu_reg_mem_reg_reg ); | |
10570 %} | |
10571 | |
10572 // MACRO3 -- addF a mulF | |
10573 // This instruction does not round to 24-bits. It is a '2-address' | |
10574 // instruction in that the result goes back to src2. This eliminates | |
10575 // a move from the macro; possibly the register allocator will have | |
10576 // to add it back (and maybe not). | |
10577 instruct addF_mulF_reg(regF src2, regF src1, regF src0) %{ | |
10578 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10579 match(Set src2 (AddF (MulF src0 src1) src2)); | |
10580 | |
10581 format %{ "FLD $src0 ===MACRO3===\n\t" | |
10582 "FMUL ST,$src1\n\t" | |
10583 "FADDP $src2,ST" %} | |
10584 opcode(0xD9); /* LoadF D9 /0 */ | |
10585 ins_encode( Push_Reg_F(src0), | |
10586 FMul_ST_reg(src1), | |
10587 FAddP_reg_ST(src2) ); | |
10588 ins_pipe( fpu_reg_reg_reg ); | |
10589 %} | |
10590 | |
10591 // MACRO4 -- divF subF | |
10592 // This instruction does not round to 24-bits | |
10593 instruct subF_divF_reg(regF dst, regF src1, regF src2, regF src3) %{ | |
10594 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10595 match(Set dst (DivF (SubF src2 src1) src3)); | |
10596 | |
10597 format %{ "FLD $src2 ===MACRO4===\n\t" | |
10598 "FSUB ST,$src1\n\t" | |
10599 "FDIV ST,$src3\n\t" | |
10600 "FSTP $dst" %} | |
10601 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
10602 ins_encode( Push_Reg_F(src2), | |
10603 subF_divF_encode(src1,src3), | |
10604 Pop_Reg_F(dst) ); | |
10605 ins_pipe( fpu_reg_reg_reg_reg ); | |
10606 %} | |
10607 | |
10608 // Spill to obtain 24-bit precision | |
10609 instruct divF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
10610 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10611 match(Set dst (DivF src1 src2)); | |
10612 | |
10613 format %{ "FDIV $dst,$src1,$src2" %} | |
10614 opcode(0xD8, 0x6); /* D8 F0+i or DE /6*/ | |
10615 ins_encode( Push_Reg_F(src1), | |
10616 OpcReg_F(src2), | |
10617 Pop_Mem_F(dst) ); | |
10618 ins_pipe( fpu_mem_reg_reg ); | |
10619 %} | |
10620 // | |
10621 // This instruction does not round to 24-bits | |
10622 instruct divF_reg(regF dst, regF src) %{ | |
10623 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10624 match(Set dst (DivF dst src)); | |
10625 | |
10626 format %{ "FDIV $dst,$src" %} | |
10627 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
10628 ins_encode( Push_Reg_F(src), | |
10629 OpcP, RegOpc(dst) ); | |
10630 ins_pipe( fpu_reg_reg ); | |
10631 %} | |
10632 | |
10633 | |
10634 // Spill to obtain 24-bit precision | |
10635 instruct modF24_reg(stackSlotF dst, regF src1, regF src2, eAXRegI rax, eFlagsReg cr) %{ | |
10636 predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
10637 match(Set dst (ModF src1 src2)); | |
10638 effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS | |
10639 | |
10640 format %{ "FMOD $dst,$src1,$src2" %} | |
10641 ins_encode( Push_Reg_Mod_D(src1, src2), | |
10642 emitModD(), | |
10643 Push_Result_Mod_D(src2), | |
10644 Pop_Mem_F(dst)); | |
10645 ins_pipe( pipe_slow ); | |
10646 %} | |
10647 // | |
10648 // This instruction does not round to 24-bits | |
10649 instruct modF_reg(regF dst, regF src, eAXRegI rax, eFlagsReg cr) %{ | |
10650 predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
10651 match(Set dst (ModF dst src)); | |
10652 effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS | |
10653 | |
10654 format %{ "FMOD $dst,$src" %} | |
10655 ins_encode(Push_Reg_Mod_D(dst, src), | |
10656 emitModD(), | |
10657 Push_Result_Mod_D(src), | |
10658 Pop_Reg_F(dst)); | |
10659 ins_pipe( pipe_slow ); | |
10660 %} | |
10661 | |
10662 instruct modX_reg(regX dst, regX src0, regX src1, eAXRegI rax, eFlagsReg cr) %{ | |
10663 predicate(UseSSE>=1); | |
10664 match(Set dst (ModF src0 src1)); | |
10665 effect(KILL rax, KILL cr); | |
10666 format %{ "SUB ESP,4\t # FMOD\n" | |
10667 "\tMOVSS [ESP+0],$src1\n" | |
10668 "\tFLD_S [ESP+0]\n" | |
10669 "\tMOVSS [ESP+0],$src0\n" | |
10670 "\tFLD_S [ESP+0]\n" | |
10671 "loop:\tFPREM\n" | |
10672 "\tFWAIT\n" | |
10673 "\tFNSTSW AX\n" | |
10674 "\tSAHF\n" | |
10675 "\tJP loop\n" | |
10676 "\tFSTP_S [ESP+0]\n" | |
10677 "\tMOVSS $dst,[ESP+0]\n" | |
10678 "\tADD ESP,4\n" | |
10679 "\tFSTP ST0\t # Restore FPU Stack" | |
10680 %} | |
10681 ins_cost(250); | |
10682 ins_encode( Push_ModX_encoding(src0, src1), emitModD(), Push_ResultX(dst,0x4), PopFPU); | |
10683 ins_pipe( pipe_slow ); | |
10684 %} | |
10685 | |
10686 | |
10687 //----------Arithmetic Conversion Instructions--------------------------------- | |
10688 // The conversions operations are all Alpha sorted. Please keep it that way! | |
10689 | |
10690 instruct roundFloat_mem_reg(stackSlotF dst, regF src) %{ | |
10691 predicate(UseSSE==0); | |
10692 match(Set dst (RoundFloat src)); | |
10693 ins_cost(125); | |
10694 format %{ "FST_S $dst,$src\t# F-round" %} | |
10695 ins_encode( Pop_Mem_Reg_F(dst, src) ); | |
10696 ins_pipe( fpu_mem_reg ); | |
10697 %} | |
10698 | |
10699 instruct roundDouble_mem_reg(stackSlotD dst, regD src) %{ | |
10700 predicate(UseSSE<=1); | |
10701 match(Set dst (RoundDouble src)); | |
10702 ins_cost(125); | |
10703 format %{ "FST_D $dst,$src\t# D-round" %} | |
10704 ins_encode( Pop_Mem_Reg_D(dst, src) ); | |
10705 ins_pipe( fpu_mem_reg ); | |
10706 %} | |
10707 | |
10708 // Force rounding to 24-bit precision and 6-bit exponent | |
10709 instruct convD2F_reg(stackSlotF dst, regD src) %{ | |
10710 predicate(UseSSE==0); | |
10711 match(Set dst (ConvD2F src)); | |
10712 format %{ "FST_S $dst,$src\t# F-round" %} | |
10713 expand %{ | |
10714 roundFloat_mem_reg(dst,src); | |
10715 %} | |
10716 %} | |
10717 | |
10718 // Force rounding to 24-bit precision and 6-bit exponent | |
10719 instruct convD2X_reg(regX dst, regD src, eFlagsReg cr) %{ | |
10720 predicate(UseSSE==1); | |
10721 match(Set dst (ConvD2F src)); | |
10722 effect( KILL cr ); | |
10723 format %{ "SUB ESP,4\n\t" | |
10724 "FST_S [ESP],$src\t# F-round\n\t" | |
10725 "MOVSS $dst,[ESP]\n\t" | |
10726 "ADD ESP,4" %} | |
10727 ins_encode( D2X_encoding(dst, src) ); | |
10728 ins_pipe( pipe_slow ); | |
10729 %} | |
10730 | |
10731 // Force rounding double precision to single precision | |
10732 instruct convXD2X_reg(regX dst, regXD src) %{ | |
10733 predicate(UseSSE>=2); | |
10734 match(Set dst (ConvD2F src)); | |
10735 format %{ "CVTSD2SS $dst,$src\t# F-round" %} | |
10736 opcode(0xF2, 0x0F, 0x5A); | |
10737 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
10738 ins_pipe( pipe_slow ); | |
10739 %} | |
10740 | |
10741 instruct convF2D_reg_reg(regD dst, regF src) %{ | |
10742 predicate(UseSSE==0); | |
10743 match(Set dst (ConvF2D src)); | |
10744 format %{ "FST_S $dst,$src\t# D-round" %} | |
10745 ins_encode( Pop_Reg_Reg_D(dst, src)); | |
10746 ins_pipe( fpu_reg_reg ); | |
10747 %} | |
10748 | |
10749 instruct convF2D_reg(stackSlotD dst, regF src) %{ | |
10750 predicate(UseSSE==1); | |
10751 match(Set dst (ConvF2D src)); | |
10752 format %{ "FST_D $dst,$src\t# D-round" %} | |
10753 expand %{ | |
10754 roundDouble_mem_reg(dst,src); | |
10755 %} | |
10756 %} | |
10757 | |
10758 instruct convX2D_reg(regD dst, regX src, eFlagsReg cr) %{ | |
10759 predicate(UseSSE==1); | |
10760 match(Set dst (ConvF2D src)); | |
10761 effect( KILL cr ); | |
10762 format %{ "SUB ESP,4\n\t" | |
10763 "MOVSS [ESP] $src\n\t" | |
10764 "FLD_S [ESP]\n\t" | |
10765 "ADD ESP,4\n\t" | |
10766 "FSTP $dst\t# D-round" %} | |
10767 ins_encode( X2D_encoding(dst, src), Pop_Reg_D(dst)); | |
10768 ins_pipe( pipe_slow ); | |
10769 %} | |
10770 | |
10771 instruct convX2XD_reg(regXD dst, regX src) %{ | |
10772 predicate(UseSSE>=2); | |
10773 match(Set dst (ConvF2D src)); | |
10774 format %{ "CVTSS2SD $dst,$src\t# D-round" %} | |
10775 opcode(0xF3, 0x0F, 0x5A); | |
10776 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
10777 ins_pipe( pipe_slow ); | |
10778 %} | |
10779 | |
10780 // Convert a double to an int. If the double is a NAN, stuff a zero in instead. | |
10781 instruct convD2I_reg_reg( eAXRegI dst, eDXRegI tmp, regD src, eFlagsReg cr ) %{ | |
10782 predicate(UseSSE<=1); | |
10783 match(Set dst (ConvD2I src)); | |
10784 effect( KILL tmp, KILL cr ); | |
10785 format %{ "FLD $src\t# Convert double to int \n\t" | |
10786 "FLDCW trunc mode\n\t" | |
10787 "SUB ESP,4\n\t" | |
10788 "FISTp [ESP + #0]\n\t" | |
10789 "FLDCW std/24-bit mode\n\t" | |
10790 "POP EAX\n\t" | |
10791 "CMP EAX,0x80000000\n\t" | |
10792 "JNE,s fast\n\t" | |
10793 "FLD_D $src\n\t" | |
10794 "CALL d2i_wrapper\n" | |
10795 "fast:" %} | |
10796 ins_encode( Push_Reg_D(src), D2I_encoding(src) ); | |
10797 ins_pipe( pipe_slow ); | |
10798 %} | |
10799 | |
10800 // Convert a double to an int. If the double is a NAN, stuff a zero in instead. | |
10801 instruct convXD2I_reg_reg( eAXRegI dst, eDXRegI tmp, regXD src, eFlagsReg cr ) %{ | |
10802 predicate(UseSSE>=2); | |
10803 match(Set dst (ConvD2I src)); | |
10804 effect( KILL tmp, KILL cr ); | |
10805 format %{ "CVTTSD2SI $dst, $src\n\t" | |
10806 "CMP $dst,0x80000000\n\t" | |
10807 "JNE,s fast\n\t" | |
10808 "SUB ESP, 8\n\t" | |
10809 "MOVSD [ESP], $src\n\t" | |
10810 "FLD_D [ESP]\n\t" | |
10811 "ADD ESP, 8\n\t" | |
10812 "CALL d2i_wrapper\n" | |
10813 "fast:" %} | |
10814 opcode(0x1); // double-precision conversion | |
10815 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x2C), FX2I_encoding(src,dst)); | |
10816 ins_pipe( pipe_slow ); | |
10817 %} | |
10818 | |
10819 instruct convD2L_reg_reg( eADXRegL dst, regD src, eFlagsReg cr ) %{ | |
10820 predicate(UseSSE<=1); | |
10821 match(Set dst (ConvD2L src)); | |
10822 effect( KILL cr ); | |
10823 format %{ "FLD $src\t# Convert double to long\n\t" | |
10824 "FLDCW trunc mode\n\t" | |
10825 "SUB ESP,8\n\t" | |
10826 "FISTp [ESP + #0]\n\t" | |
10827 "FLDCW std/24-bit mode\n\t" | |
10828 "POP EAX\n\t" | |
10829 "POP EDX\n\t" | |
10830 "CMP EDX,0x80000000\n\t" | |
10831 "JNE,s fast\n\t" | |
10832 "TEST EAX,EAX\n\t" | |
10833 "JNE,s fast\n\t" | |
10834 "FLD $src\n\t" | |
10835 "CALL d2l_wrapper\n" | |
10836 "fast:" %} | |
10837 ins_encode( Push_Reg_D(src), D2L_encoding(src) ); | |
10838 ins_pipe( pipe_slow ); | |
10839 %} | |
10840 | |
10841 // XMM lacks a float/double->long conversion, so use the old FPU stack. | |
10842 instruct convXD2L_reg_reg( eADXRegL dst, regXD src, eFlagsReg cr ) %{ | |
10843 predicate (UseSSE>=2); | |
10844 match(Set dst (ConvD2L src)); | |
10845 effect( KILL cr ); | |
10846 format %{ "SUB ESP,8\t# Convert double to long\n\t" | |
10847 "MOVSD [ESP],$src\n\t" | |
10848 "FLD_D [ESP]\n\t" | |
10849 "FLDCW trunc mode\n\t" | |
10850 "FISTp [ESP + #0]\n\t" | |
10851 "FLDCW std/24-bit mode\n\t" | |
10852 "POP EAX\n\t" | |
10853 "POP EDX\n\t" | |
10854 "CMP EDX,0x80000000\n\t" | |
10855 "JNE,s fast\n\t" | |
10856 "TEST EAX,EAX\n\t" | |
10857 "JNE,s fast\n\t" | |
10858 "SUB ESP,8\n\t" | |
10859 "MOVSD [ESP],$src\n\t" | |
10860 "FLD_D [ESP]\n\t" | |
10861 "CALL d2l_wrapper\n" | |
10862 "fast:" %} | |
10863 ins_encode( XD2L_encoding(src) ); | |
10864 ins_pipe( pipe_slow ); | |
10865 %} | |
10866 | |
10867 // Convert a double to an int. Java semantics require we do complex | |
10868 // manglations in the corner cases. So we set the rounding mode to | |
10869 // 'zero', store the darned double down as an int, and reset the | |
10870 // rounding mode to 'nearest'. The hardware stores a flag value down | |
10871 // if we would overflow or converted a NAN; we check for this and | |
10872 // and go the slow path if needed. | |
10873 instruct convF2I_reg_reg(eAXRegI dst, eDXRegI tmp, regF src, eFlagsReg cr ) %{ | |
10874 predicate(UseSSE==0); | |
10875 match(Set dst (ConvF2I src)); | |
10876 effect( KILL tmp, KILL cr ); | |
10877 format %{ "FLD $src\t# Convert float to int \n\t" | |
10878 "FLDCW trunc mode\n\t" | |
10879 "SUB ESP,4\n\t" | |
10880 "FISTp [ESP + #0]\n\t" | |
10881 "FLDCW std/24-bit mode\n\t" | |
10882 "POP EAX\n\t" | |
10883 "CMP EAX,0x80000000\n\t" | |
10884 "JNE,s fast\n\t" | |
10885 "FLD $src\n\t" | |
10886 "CALL d2i_wrapper\n" | |
10887 "fast:" %} | |
10888 // D2I_encoding works for F2I | |
10889 ins_encode( Push_Reg_F(src), D2I_encoding(src) ); | |
10890 ins_pipe( pipe_slow ); | |
10891 %} | |
10892 | |
10893 // Convert a float in xmm to an int reg. | |
10894 instruct convX2I_reg(eAXRegI dst, eDXRegI tmp, regX src, eFlagsReg cr ) %{ | |
10895 predicate(UseSSE>=1); | |
10896 match(Set dst (ConvF2I src)); | |
10897 effect( KILL tmp, KILL cr ); | |
10898 format %{ "CVTTSS2SI $dst, $src\n\t" | |
10899 "CMP $dst,0x80000000\n\t" | |
10900 "JNE,s fast\n\t" | |
10901 "SUB ESP, 4\n\t" | |
10902 "MOVSS [ESP], $src\n\t" | |
10903 "FLD [ESP]\n\t" | |
10904 "ADD ESP, 4\n\t" | |
10905 "CALL d2i_wrapper\n" | |
10906 "fast:" %} | |
10907 opcode(0x0); // single-precision conversion | |
10908 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x2C), FX2I_encoding(src,dst)); | |
10909 ins_pipe( pipe_slow ); | |
10910 %} | |
10911 | |
10912 instruct convF2L_reg_reg( eADXRegL dst, regF src, eFlagsReg cr ) %{ | |
10913 predicate(UseSSE==0); | |
10914 match(Set dst (ConvF2L src)); | |
10915 effect( KILL cr ); | |
10916 format %{ "FLD $src\t# Convert float to long\n\t" | |
10917 "FLDCW trunc mode\n\t" | |
10918 "SUB ESP,8\n\t" | |
10919 "FISTp [ESP + #0]\n\t" | |
10920 "FLDCW std/24-bit mode\n\t" | |
10921 "POP EAX\n\t" | |
10922 "POP EDX\n\t" | |
10923 "CMP EDX,0x80000000\n\t" | |
10924 "JNE,s fast\n\t" | |
10925 "TEST EAX,EAX\n\t" | |
10926 "JNE,s fast\n\t" | |
10927 "FLD $src\n\t" | |
10928 "CALL d2l_wrapper\n" | |
10929 "fast:" %} | |
10930 // D2L_encoding works for F2L | |
10931 ins_encode( Push_Reg_F(src), D2L_encoding(src) ); | |
10932 ins_pipe( pipe_slow ); | |
10933 %} | |
10934 | |
10935 // XMM lacks a float/double->long conversion, so use the old FPU stack. | |
10936 instruct convX2L_reg_reg( eADXRegL dst, regX src, eFlagsReg cr ) %{ | |
10937 predicate (UseSSE>=1); | |
10938 match(Set dst (ConvF2L src)); | |
10939 effect( KILL cr ); | |
10940 format %{ "SUB ESP,8\t# Convert float to long\n\t" | |
10941 "MOVSS [ESP],$src\n\t" | |
10942 "FLD_S [ESP]\n\t" | |
10943 "FLDCW trunc mode\n\t" | |
10944 "FISTp [ESP + #0]\n\t" | |
10945 "FLDCW std/24-bit mode\n\t" | |
10946 "POP EAX\n\t" | |
10947 "POP EDX\n\t" | |
10948 "CMP EDX,0x80000000\n\t" | |
10949 "JNE,s fast\n\t" | |
10950 "TEST EAX,EAX\n\t" | |
10951 "JNE,s fast\n\t" | |
10952 "SUB ESP,4\t# Convert float to long\n\t" | |
10953 "MOVSS [ESP],$src\n\t" | |
10954 "FLD_S [ESP]\n\t" | |
10955 "ADD ESP,4\n\t" | |
10956 "CALL d2l_wrapper\n" | |
10957 "fast:" %} | |
10958 ins_encode( X2L_encoding(src) ); | |
10959 ins_pipe( pipe_slow ); | |
10960 %} | |
10961 | |
10962 instruct convI2D_reg(regD dst, stackSlotI src) %{ | |
10963 predicate( UseSSE<=1 ); | |
10964 match(Set dst (ConvI2D src)); | |
10965 format %{ "FILD $src\n\t" | |
10966 "FSTP $dst" %} | |
10967 opcode(0xDB, 0x0); /* DB /0 */ | |
10968 ins_encode(Push_Mem_I(src), Pop_Reg_D(dst)); | |
10969 ins_pipe( fpu_reg_mem ); | |
10970 %} | |
10971 | |
10972 instruct convI2XD_reg(regXD dst, eRegI src) %{ | |
10973 predicate( UseSSE>=2 ); | |
10974 match(Set dst (ConvI2D src)); | |
10975 format %{ "CVTSI2SD $dst,$src" %} | |
10976 opcode(0xF2, 0x0F, 0x2A); | |
10977 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
10978 ins_pipe( pipe_slow ); | |
10979 %} | |
10980 | |
10981 instruct convI2XD_mem(regXD dst, memory mem) %{ | |
10982 predicate( UseSSE>=2 ); | |
10983 match(Set dst (ConvI2D (LoadI mem))); | |
10984 format %{ "CVTSI2SD $dst,$mem" %} | |
10985 opcode(0xF2, 0x0F, 0x2A); | |
10986 ins_encode( OpcP, OpcS, Opcode(tertiary), RegMem(dst, mem)); | |
10987 ins_pipe( pipe_slow ); | |
10988 %} | |
10989 | |
10990 instruct convI2D_mem(regD dst, memory mem) %{ | |
10991 predicate( UseSSE<=1 && !Compile::current()->select_24_bit_instr()); | |
10992 match(Set dst (ConvI2D (LoadI mem))); | |
10993 format %{ "FILD $mem\n\t" | |
10994 "FSTP $dst" %} | |
10995 opcode(0xDB); /* DB /0 */ | |
10996 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
10997 Pop_Reg_D(dst)); | |
10998 ins_pipe( fpu_reg_mem ); | |
10999 %} | |
11000 | |
11001 // Convert a byte to a float; no rounding step needed. | |
11002 instruct conv24I2F_reg(regF dst, stackSlotI src) %{ | |
11003 predicate( UseSSE==0 && n->in(1)->Opcode() == Op_AndI && n->in(1)->in(2)->is_Con() && n->in(1)->in(2)->get_int() == 255 ); | |
11004 match(Set dst (ConvI2F src)); | |
11005 format %{ "FILD $src\n\t" | |
11006 "FSTP $dst" %} | |
11007 | |
11008 opcode(0xDB, 0x0); /* DB /0 */ | |
11009 ins_encode(Push_Mem_I(src), Pop_Reg_F(dst)); | |
11010 ins_pipe( fpu_reg_mem ); | |
11011 %} | |
11012 | |
11013 // In 24-bit mode, force exponent rounding by storing back out | |
11014 instruct convI2F_SSF(stackSlotF dst, stackSlotI src) %{ | |
11015 predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
11016 match(Set dst (ConvI2F src)); | |
11017 ins_cost(200); | |
11018 format %{ "FILD $src\n\t" | |
11019 "FSTP_S $dst" %} | |
11020 opcode(0xDB, 0x0); /* DB /0 */ | |
11021 ins_encode( Push_Mem_I(src), | |
11022 Pop_Mem_F(dst)); | |
11023 ins_pipe( fpu_mem_mem ); | |
11024 %} | |
11025 | |
11026 // In 24-bit mode, force exponent rounding by storing back out | |
11027 instruct convI2F_SSF_mem(stackSlotF dst, memory mem) %{ | |
11028 predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
11029 match(Set dst (ConvI2F (LoadI mem))); | |
11030 ins_cost(200); | |
11031 format %{ "FILD $mem\n\t" | |
11032 "FSTP_S $dst" %} | |
11033 opcode(0xDB); /* DB /0 */ | |
11034 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
11035 Pop_Mem_F(dst)); | |
11036 ins_pipe( fpu_mem_mem ); | |
11037 %} | |
11038 | |
11039 // This instruction does not round to 24-bits | |
11040 instruct convI2F_reg(regF dst, stackSlotI src) %{ | |
11041 predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
11042 match(Set dst (ConvI2F src)); | |
11043 format %{ "FILD $src\n\t" | |
11044 "FSTP $dst" %} | |
11045 opcode(0xDB, 0x0); /* DB /0 */ | |
11046 ins_encode( Push_Mem_I(src), | |
11047 Pop_Reg_F(dst)); | |
11048 ins_pipe( fpu_reg_mem ); | |
11049 %} | |
11050 | |
11051 // This instruction does not round to 24-bits | |
11052 instruct convI2F_mem(regF dst, memory mem) %{ | |
11053 predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
11054 match(Set dst (ConvI2F (LoadI mem))); | |
11055 format %{ "FILD $mem\n\t" | |
11056 "FSTP $dst" %} | |
11057 opcode(0xDB); /* DB /0 */ | |
11058 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
11059 Pop_Reg_F(dst)); | |
11060 ins_pipe( fpu_reg_mem ); | |
11061 %} | |
11062 | |
11063 // Convert an int to a float in xmm; no rounding step needed. | |
11064 instruct convI2X_reg(regX dst, eRegI src) %{ | |
11065 predicate(UseSSE>=1); | |
11066 match(Set dst (ConvI2F src)); | |
11067 format %{ "CVTSI2SS $dst, $src" %} | |
11068 | |
11069 opcode(0xF3, 0x0F, 0x2A); /* F3 0F 2A /r */ | |
11070 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
11071 ins_pipe( pipe_slow ); | |
11072 %} | |
11073 | |
11074 instruct convI2L_reg( eRegL dst, eRegI src, eFlagsReg cr) %{ | |
11075 match(Set dst (ConvI2L src)); | |
11076 effect(KILL cr); | |
11077 format %{ "MOV $dst.lo,$src\n\t" | |
11078 "MOV $dst.hi,$src\n\t" | |
11079 "SAR $dst.hi,31" %} | |
11080 ins_encode(convert_int_long(dst,src)); | |
11081 ins_pipe( ialu_reg_reg_long ); | |
11082 %} | |
11083 | |
11084 // Zero-extend convert int to long | |
11085 instruct convI2L_reg_zex(eRegL dst, eRegI src, immL_32bits mask, eFlagsReg flags ) %{ | |
11086 match(Set dst (AndL (ConvI2L src) mask) ); | |
11087 effect( KILL flags ); | |
11088 format %{ "MOV $dst.lo,$src\n\t" | |
11089 "XOR $dst.hi,$dst.hi" %} | |
11090 opcode(0x33); // XOR | |
11091 ins_encode(enc_Copy(dst,src), OpcP, RegReg_Hi2(dst,dst) ); | |
11092 ins_pipe( ialu_reg_reg_long ); | |
11093 %} | |
11094 | |
11095 // Zero-extend long | |
11096 instruct zerox_long(eRegL dst, eRegL src, immL_32bits mask, eFlagsReg flags ) %{ | |
11097 match(Set dst (AndL src mask) ); | |
11098 effect( KILL flags ); | |
11099 format %{ "MOV $dst.lo,$src.lo\n\t" | |
11100 "XOR $dst.hi,$dst.hi\n\t" %} | |
11101 opcode(0x33); // XOR | |
11102 ins_encode(enc_Copy(dst,src), OpcP, RegReg_Hi2(dst,dst) ); | |
11103 ins_pipe( ialu_reg_reg_long ); | |
11104 %} | |
11105 | |
11106 instruct convL2D_reg( stackSlotD dst, eRegL src, eFlagsReg cr) %{ | |
11107 predicate (UseSSE<=1); | |
11108 match(Set dst (ConvL2D src)); | |
11109 effect( KILL cr ); | |
11110 format %{ "PUSH $src.hi\t# Convert long to double\n\t" | |
11111 "PUSH $src.lo\n\t" | |
11112 "FILD ST,[ESP + #0]\n\t" | |
11113 "ADD ESP,8\n\t" | |
11114 "FSTP_D $dst\t# D-round" %} | |
11115 opcode(0xDF, 0x5); /* DF /5 */ | |
11116 ins_encode(convert_long_double(src), Pop_Mem_D(dst)); | |
11117 ins_pipe( pipe_slow ); | |
11118 %} | |
11119 | |
11120 instruct convL2XD_reg( regXD dst, eRegL src, eFlagsReg cr) %{ | |
11121 predicate (UseSSE>=2); | |
11122 match(Set dst (ConvL2D src)); | |
11123 effect( KILL cr ); | |
11124 format %{ "PUSH $src.hi\t# Convert long to double\n\t" | |
11125 "PUSH $src.lo\n\t" | |
11126 "FILD_D [ESP]\n\t" | |
11127 "FSTP_D [ESP]\n\t" | |
11128 "MOVSD $dst,[ESP]\n\t" | |
11129 "ADD ESP,8" %} | |
11130 opcode(0xDF, 0x5); /* DF /5 */ | |
11131 ins_encode(convert_long_double2(src), Push_ResultXD(dst)); | |
11132 ins_pipe( pipe_slow ); | |
11133 %} | |
11134 | |
11135 instruct convL2X_reg( regX dst, eRegL src, eFlagsReg cr) %{ | |
11136 predicate (UseSSE>=1); | |
11137 match(Set dst (ConvL2F src)); | |
11138 effect( KILL cr ); | |
11139 format %{ "PUSH $src.hi\t# Convert long to single float\n\t" | |
11140 "PUSH $src.lo\n\t" | |
11141 "FILD_D [ESP]\n\t" | |
11142 "FSTP_S [ESP]\n\t" | |
11143 "MOVSS $dst,[ESP]\n\t" | |
11144 "ADD ESP,8" %} | |
11145 opcode(0xDF, 0x5); /* DF /5 */ | |
11146 ins_encode(convert_long_double2(src), Push_ResultX(dst,0x8)); | |
11147 ins_pipe( pipe_slow ); | |
11148 %} | |
11149 | |
11150 instruct convL2F_reg( stackSlotF dst, eRegL src, eFlagsReg cr) %{ | |
11151 match(Set dst (ConvL2F src)); | |
11152 effect( KILL cr ); | |
11153 format %{ "PUSH $src.hi\t# Convert long to single float\n\t" | |
11154 "PUSH $src.lo\n\t" | |
11155 "FILD ST,[ESP + #0]\n\t" | |
11156 "ADD ESP,8\n\t" | |
11157 "FSTP_S $dst\t# F-round" %} | |
11158 opcode(0xDF, 0x5); /* DF /5 */ | |
11159 ins_encode(convert_long_double(src), Pop_Mem_F(dst)); | |
11160 ins_pipe( pipe_slow ); | |
11161 %} | |
11162 | |
11163 instruct convL2I_reg( eRegI dst, eRegL src ) %{ | |
11164 match(Set dst (ConvL2I src)); | |
11165 effect( DEF dst, USE src ); | |
11166 format %{ "MOV $dst,$src.lo" %} | |
11167 ins_encode(enc_CopyL_Lo(dst,src)); | |
11168 ins_pipe( ialu_reg_reg ); | |
11169 %} | |
11170 | |
11171 | |
11172 instruct MoveF2I_stack_reg(eRegI dst, stackSlotF src) %{ | |
11173 match(Set dst (MoveF2I src)); | |
11174 effect( DEF dst, USE src ); | |
11175 ins_cost(100); | |
11176 format %{ "MOV $dst,$src\t# MoveF2I_stack_reg" %} | |
11177 opcode(0x8B); | |
11178 ins_encode( OpcP, RegMem(dst,src)); | |
11179 ins_pipe( ialu_reg_mem ); | |
11180 %} | |
11181 | |
11182 instruct MoveF2I_reg_stack(stackSlotI dst, regF src) %{ | |
11183 predicate(UseSSE==0); | |
11184 match(Set dst (MoveF2I src)); | |
11185 effect( DEF dst, USE src ); | |
11186 | |
11187 ins_cost(125); | |
11188 format %{ "FST_S $dst,$src\t# MoveF2I_reg_stack" %} | |
11189 ins_encode( Pop_Mem_Reg_F(dst, src) ); | |
11190 ins_pipe( fpu_mem_reg ); | |
11191 %} | |
11192 | |
11193 instruct MoveF2I_reg_stack_sse(stackSlotI dst, regX src) %{ | |
11194 predicate(UseSSE>=1); | |
11195 match(Set dst (MoveF2I src)); | |
11196 effect( DEF dst, USE src ); | |
11197 | |
11198 ins_cost(95); | |
11199 format %{ "MOVSS $dst,$src\t# MoveF2I_reg_stack_sse" %} | |
11200 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x11), RegMem(src, dst)); | |
11201 ins_pipe( pipe_slow ); | |
11202 %} | |
11203 | |
11204 instruct MoveF2I_reg_reg_sse(eRegI dst, regX src) %{ | |
11205 predicate(UseSSE>=2); | |
11206 match(Set dst (MoveF2I src)); | |
11207 effect( DEF dst, USE src ); | |
11208 ins_cost(85); | |
11209 format %{ "MOVD $dst,$src\t# MoveF2I_reg_reg_sse" %} | |
11210 ins_encode( MovX2I_reg(dst, src)); | |
11211 ins_pipe( pipe_slow ); | |
11212 %} | |
11213 | |
11214 instruct MoveI2F_reg_stack(stackSlotF dst, eRegI src) %{ | |
11215 match(Set dst (MoveI2F src)); | |
11216 effect( DEF dst, USE src ); | |
11217 | |
11218 ins_cost(100); | |
11219 format %{ "MOV $dst,$src\t# MoveI2F_reg_stack" %} | |
11220 opcode(0x89); | |
11221 ins_encode( OpcPRegSS( dst, src ) ); | |
11222 ins_pipe( ialu_mem_reg ); | |
11223 %} | |
11224 | |
11225 | |
11226 instruct MoveI2F_stack_reg(regF dst, stackSlotI src) %{ | |
11227 predicate(UseSSE==0); | |
11228 match(Set dst (MoveI2F src)); | |
11229 effect(DEF dst, USE src); | |
11230 | |
11231 ins_cost(125); | |
11232 format %{ "FLD_S $src\n\t" | |
11233 "FSTP $dst\t# MoveI2F_stack_reg" %} | |
11234 opcode(0xD9); /* D9 /0, FLD m32real */ | |
11235 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
11236 Pop_Reg_F(dst) ); | |
11237 ins_pipe( fpu_reg_mem ); | |
11238 %} | |
11239 | |
11240 instruct MoveI2F_stack_reg_sse(regX dst, stackSlotI src) %{ | |
11241 predicate(UseSSE>=1); | |
11242 match(Set dst (MoveI2F src)); | |
11243 effect( DEF dst, USE src ); | |
11244 | |
11245 ins_cost(95); | |
11246 format %{ "MOVSS $dst,$src\t# MoveI2F_stack_reg_sse" %} | |
11247 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), RegMem(dst,src)); | |
11248 ins_pipe( pipe_slow ); | |
11249 %} | |
11250 | |
11251 instruct MoveI2F_reg_reg_sse(regX dst, eRegI src) %{ | |
11252 predicate(UseSSE>=2); | |
11253 match(Set dst (MoveI2F src)); | |
11254 effect( DEF dst, USE src ); | |
11255 | |
11256 ins_cost(85); | |
11257 format %{ "MOVD $dst,$src\t# MoveI2F_reg_reg_sse" %} | |
11258 ins_encode( MovI2X_reg(dst, src) ); | |
11259 ins_pipe( pipe_slow ); | |
11260 %} | |
11261 | |
11262 instruct MoveD2L_stack_reg(eRegL dst, stackSlotD src) %{ | |
11263 match(Set dst (MoveD2L src)); | |
11264 effect(DEF dst, USE src); | |
11265 | |
11266 ins_cost(250); | |
11267 format %{ "MOV $dst.lo,$src\n\t" | |
11268 "MOV $dst.hi,$src+4\t# MoveD2L_stack_reg" %} | |
11269 opcode(0x8B, 0x8B); | |
11270 ins_encode( OpcP, RegMem(dst,src), OpcS, RegMem_Hi(dst,src)); | |
11271 ins_pipe( ialu_mem_long_reg ); | |
11272 %} | |
11273 | |
11274 instruct MoveD2L_reg_stack(stackSlotL dst, regD src) %{ | |
11275 predicate(UseSSE<=1); | |
11276 match(Set dst (MoveD2L src)); | |
11277 effect(DEF dst, USE src); | |
11278 | |
11279 ins_cost(125); | |
11280 format %{ "FST_D $dst,$src\t# MoveD2L_reg_stack" %} | |
11281 ins_encode( Pop_Mem_Reg_D(dst, src) ); | |
11282 ins_pipe( fpu_mem_reg ); | |
11283 %} | |
11284 | |
11285 instruct MoveD2L_reg_stack_sse(stackSlotL dst, regXD src) %{ | |
11286 predicate(UseSSE>=2); | |
11287 match(Set dst (MoveD2L src)); | |
11288 effect(DEF dst, USE src); | |
11289 ins_cost(95); | |
11290 | |
11291 format %{ "MOVSD $dst,$src\t# MoveD2L_reg_stack_sse" %} | |
11292 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x11), RegMem(src,dst)); | |
11293 ins_pipe( pipe_slow ); | |
11294 %} | |
11295 | |
11296 instruct MoveD2L_reg_reg_sse(eRegL dst, regXD src, regXD tmp) %{ | |
11297 predicate(UseSSE>=2); | |
11298 match(Set dst (MoveD2L src)); | |
11299 effect(DEF dst, USE src, TEMP tmp); | |
11300 ins_cost(85); | |
11301 format %{ "MOVD $dst.lo,$src\n\t" | |
11302 "PSHUFLW $tmp,$src,0x4E\n\t" | |
11303 "MOVD $dst.hi,$tmp\t# MoveD2L_reg_reg_sse" %} | |
11304 ins_encode( MovXD2L_reg(dst, src, tmp) ); | |
11305 ins_pipe( pipe_slow ); | |
11306 %} | |
11307 | |
11308 instruct MoveL2D_reg_stack(stackSlotD dst, eRegL src) %{ | |
11309 match(Set dst (MoveL2D src)); | |
11310 effect(DEF dst, USE src); | |
11311 | |
11312 ins_cost(200); | |
11313 format %{ "MOV $dst,$src.lo\n\t" | |
11314 "MOV $dst+4,$src.hi\t# MoveL2D_reg_stack" %} | |
11315 opcode(0x89, 0x89); | |
11316 ins_encode( OpcP, RegMem( src, dst ), OpcS, RegMem_Hi( src, dst ) ); | |
11317 ins_pipe( ialu_mem_long_reg ); | |
11318 %} | |
11319 | |
11320 | |
11321 instruct MoveL2D_stack_reg(regD dst, stackSlotL src) %{ | |
11322 predicate(UseSSE<=1); | |
11323 match(Set dst (MoveL2D src)); | |
11324 effect(DEF dst, USE src); | |
11325 ins_cost(125); | |
11326 | |
11327 format %{ "FLD_D $src\n\t" | |
11328 "FSTP $dst\t# MoveL2D_stack_reg" %} | |
11329 opcode(0xDD); /* DD /0, FLD m64real */ | |
11330 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
11331 Pop_Reg_D(dst) ); | |
11332 ins_pipe( fpu_reg_mem ); | |
11333 %} | |
11334 | |
11335 | |
11336 instruct MoveL2D_stack_reg_sse(regXD dst, stackSlotL src) %{ | |
11337 predicate(UseSSE>=2 && UseXmmLoadAndClearUpper); | |
11338 match(Set dst (MoveL2D src)); | |
11339 effect(DEF dst, USE src); | |
11340 | |
11341 ins_cost(95); | |
11342 format %{ "MOVSD $dst,$src\t# MoveL2D_stack_reg_sse" %} | |
11343 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x10), RegMem(dst,src)); | |
11344 ins_pipe( pipe_slow ); | |
11345 %} | |
11346 | |
11347 instruct MoveL2D_stack_reg_sse_partial(regXD dst, stackSlotL src) %{ | |
11348 predicate(UseSSE>=2 && !UseXmmLoadAndClearUpper); | |
11349 match(Set dst (MoveL2D src)); | |
11350 effect(DEF dst, USE src); | |
11351 | |
11352 ins_cost(95); | |
11353 format %{ "MOVLPD $dst,$src\t# MoveL2D_stack_reg_sse" %} | |
11354 ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x12), RegMem(dst,src)); | |
11355 ins_pipe( pipe_slow ); | |
11356 %} | |
11357 | |
11358 instruct MoveL2D_reg_reg_sse(regXD dst, eRegL src, regXD tmp) %{ | |
11359 predicate(UseSSE>=2); | |
11360 match(Set dst (MoveL2D src)); | |
11361 effect(TEMP dst, USE src, TEMP tmp); | |
11362 ins_cost(85); | |
11363 format %{ "MOVD $dst,$src.lo\n\t" | |
11364 "MOVD $tmp,$src.hi\n\t" | |
11365 "PUNPCKLDQ $dst,$tmp\t# MoveL2D_reg_reg_sse" %} | |
11366 ins_encode( MovL2XD_reg(dst, src, tmp) ); | |
11367 ins_pipe( pipe_slow ); | |
11368 %} | |
11369 | |
11370 // Replicate scalar to packed byte (1 byte) values in xmm | |
11371 instruct Repl8B_reg(regXD dst, regXD src) %{ | |
11372 predicate(UseSSE>=2); | |
11373 match(Set dst (Replicate8B src)); | |
11374 format %{ "MOVDQA $dst,$src\n\t" | |
11375 "PUNPCKLBW $dst,$dst\n\t" | |
11376 "PSHUFLW $dst,$dst,0x00\t! replicate8B" %} | |
11377 ins_encode( pshufd_8x8(dst, src)); | |
11378 ins_pipe( pipe_slow ); | |
11379 %} | |
11380 | |
11381 // Replicate scalar to packed byte (1 byte) values in xmm | |
11382 instruct Repl8B_eRegI(regXD dst, eRegI src) %{ | |
11383 predicate(UseSSE>=2); | |
11384 match(Set dst (Replicate8B src)); | |
11385 format %{ "MOVD $dst,$src\n\t" | |
11386 "PUNPCKLBW $dst,$dst\n\t" | |
11387 "PSHUFLW $dst,$dst,0x00\t! replicate8B" %} | |
11388 ins_encode( mov_i2x(dst, src), pshufd_8x8(dst, dst)); | |
11389 ins_pipe( pipe_slow ); | |
11390 %} | |
11391 | |
11392 // Replicate scalar zero to packed byte (1 byte) values in xmm | |
11393 instruct Repl8B_immI0(regXD dst, immI0 zero) %{ | |
11394 predicate(UseSSE>=2); | |
11395 match(Set dst (Replicate8B zero)); | |
11396 format %{ "PXOR $dst,$dst\t! replicate8B" %} | |
11397 ins_encode( pxor(dst, dst)); | |
11398 ins_pipe( fpu_reg_reg ); | |
11399 %} | |
11400 | |
11401 // Replicate scalar to packed shore (2 byte) values in xmm | |
11402 instruct Repl4S_reg(regXD dst, regXD src) %{ | |
11403 predicate(UseSSE>=2); | |
11404 match(Set dst (Replicate4S src)); | |
11405 format %{ "PSHUFLW $dst,$src,0x00\t! replicate4S" %} | |
11406 ins_encode( pshufd_4x16(dst, src)); | |
11407 ins_pipe( fpu_reg_reg ); | |
11408 %} | |
11409 | |
11410 // Replicate scalar to packed shore (2 byte) values in xmm | |
11411 instruct Repl4S_eRegI(regXD dst, eRegI src) %{ | |
11412 predicate(UseSSE>=2); | |
11413 match(Set dst (Replicate4S src)); | |
11414 format %{ "MOVD $dst,$src\n\t" | |
11415 "PSHUFLW $dst,$dst,0x00\t! replicate4S" %} | |
11416 ins_encode( mov_i2x(dst, src), pshufd_4x16(dst, dst)); | |
11417 ins_pipe( fpu_reg_reg ); | |
11418 %} | |
11419 | |
11420 // Replicate scalar zero to packed short (2 byte) values in xmm | |
11421 instruct Repl4S_immI0(regXD dst, immI0 zero) %{ | |
11422 predicate(UseSSE>=2); | |
11423 match(Set dst (Replicate4S zero)); | |
11424 format %{ "PXOR $dst,$dst\t! replicate4S" %} | |
11425 ins_encode( pxor(dst, dst)); | |
11426 ins_pipe( fpu_reg_reg ); | |
11427 %} | |
11428 | |
11429 // Replicate scalar to packed char (2 byte) values in xmm | |
11430 instruct Repl4C_reg(regXD dst, regXD src) %{ | |
11431 predicate(UseSSE>=2); | |
11432 match(Set dst (Replicate4C src)); | |
11433 format %{ "PSHUFLW $dst,$src,0x00\t! replicate4C" %} | |
11434 ins_encode( pshufd_4x16(dst, src)); | |
11435 ins_pipe( fpu_reg_reg ); | |
11436 %} | |
11437 | |
11438 // Replicate scalar to packed char (2 byte) values in xmm | |
11439 instruct Repl4C_eRegI(regXD dst, eRegI src) %{ | |
11440 predicate(UseSSE>=2); | |
11441 match(Set dst (Replicate4C src)); | |
11442 format %{ "MOVD $dst,$src\n\t" | |
11443 "PSHUFLW $dst,$dst,0x00\t! replicate4C" %} | |
11444 ins_encode( mov_i2x(dst, src), pshufd_4x16(dst, dst)); | |
11445 ins_pipe( fpu_reg_reg ); | |
11446 %} | |
11447 | |
11448 // Replicate scalar zero to packed char (2 byte) values in xmm | |
11449 instruct Repl4C_immI0(regXD dst, immI0 zero) %{ | |
11450 predicate(UseSSE>=2); | |
11451 match(Set dst (Replicate4C zero)); | |
11452 format %{ "PXOR $dst,$dst\t! replicate4C" %} | |
11453 ins_encode( pxor(dst, dst)); | |
11454 ins_pipe( fpu_reg_reg ); | |
11455 %} | |
11456 | |
11457 // Replicate scalar to packed integer (4 byte) values in xmm | |
11458 instruct Repl2I_reg(regXD dst, regXD src) %{ | |
11459 predicate(UseSSE>=2); | |
11460 match(Set dst (Replicate2I src)); | |
11461 format %{ "PSHUFD $dst,$src,0x00\t! replicate2I" %} | |
11462 ins_encode( pshufd(dst, src, 0x00)); | |
11463 ins_pipe( fpu_reg_reg ); | |
11464 %} | |
11465 | |
11466 // Replicate scalar to packed integer (4 byte) values in xmm | |
11467 instruct Repl2I_eRegI(regXD dst, eRegI src) %{ | |
11468 predicate(UseSSE>=2); | |
11469 match(Set dst (Replicate2I src)); | |
11470 format %{ "MOVD $dst,$src\n\t" | |
11471 "PSHUFD $dst,$dst,0x00\t! replicate2I" %} | |
11472 ins_encode( mov_i2x(dst, src), pshufd(dst, dst, 0x00)); | |
11473 ins_pipe( fpu_reg_reg ); | |
11474 %} | |
11475 | |
11476 // Replicate scalar zero to packed integer (2 byte) values in xmm | |
11477 instruct Repl2I_immI0(regXD dst, immI0 zero) %{ | |
11478 predicate(UseSSE>=2); | |
11479 match(Set dst (Replicate2I zero)); | |
11480 format %{ "PXOR $dst,$dst\t! replicate2I" %} | |
11481 ins_encode( pxor(dst, dst)); | |
11482 ins_pipe( fpu_reg_reg ); | |
11483 %} | |
11484 | |
11485 // Replicate scalar to packed single precision floating point values in xmm | |
11486 instruct Repl2F_reg(regXD dst, regXD src) %{ | |
11487 predicate(UseSSE>=2); | |
11488 match(Set dst (Replicate2F src)); | |
11489 format %{ "PSHUFD $dst,$src,0xe0\t! replicate2F" %} | |
11490 ins_encode( pshufd(dst, src, 0xe0)); | |
11491 ins_pipe( fpu_reg_reg ); | |
11492 %} | |
11493 | |
11494 // Replicate scalar to packed single precision floating point values in xmm | |
11495 instruct Repl2F_regX(regXD dst, regX src) %{ | |
11496 predicate(UseSSE>=2); | |
11497 match(Set dst (Replicate2F src)); | |
11498 format %{ "PSHUFD $dst,$src,0xe0\t! replicate2F" %} | |
11499 ins_encode( pshufd(dst, src, 0xe0)); | |
11500 ins_pipe( fpu_reg_reg ); | |
11501 %} | |
11502 | |
11503 // Replicate scalar to packed single precision floating point values in xmm | |
11504 instruct Repl2F_immXF0(regXD dst, immXF0 zero) %{ | |
11505 predicate(UseSSE>=2); | |
11506 match(Set dst (Replicate2F zero)); | |
11507 format %{ "PXOR $dst,$dst\t! replicate2F" %} | |
11508 ins_encode( pxor(dst, dst)); | |
11509 ins_pipe( fpu_reg_reg ); | |
11510 %} | |
11511 | |
11512 | |
11513 | |
11514 // ======================================================================= | |
11515 // fast clearing of an array | |
11516 | |
11517 instruct rep_stos(eCXRegI cnt, eDIRegP base, eAXRegI zero, Universe dummy, eFlagsReg cr) %{ | |
11518 match(Set dummy (ClearArray cnt base)); | |
11519 effect(USE_KILL cnt, USE_KILL base, KILL zero, KILL cr); | |
11520 format %{ "SHL ECX,1\t# Convert doublewords to words\n\t" | |
11521 "XOR EAX,EAX\n\t" | |
11522 "REP STOS\t# store EAX into [EDI++] while ECX--" %} | |
11523 opcode(0,0x4); | |
11524 ins_encode( Opcode(0xD1), RegOpc(ECX), | |
11525 OpcRegReg(0x33,EAX,EAX), | |
11526 Opcode(0xF3), Opcode(0xAB) ); | |
11527 ins_pipe( pipe_slow ); | |
11528 %} | |
11529 | |
11530 instruct string_compare(eDIRegP str1, eSIRegP str2, eAXRegI tmp1, eBXRegI tmp2, eCXRegI result, eFlagsReg cr) %{ | |
11531 match(Set result (StrComp str1 str2)); | |
11532 effect(USE_KILL str1, USE_KILL str2, KILL tmp1, KILL tmp2, KILL cr); | |
11533 //ins_cost(300); | |
11534 | |
11535 format %{ "String Compare $str1,$str2 -> $result // KILL EAX, EBX" %} | |
11536 ins_encode( enc_String_Compare() ); | |
11537 ins_pipe( pipe_slow ); | |
11538 %} | |
11539 | |
11540 //----------Control Flow Instructions------------------------------------------ | |
11541 // Signed compare Instructions | |
11542 instruct compI_eReg(eFlagsReg cr, eRegI op1, eRegI op2) %{ | |
11543 match(Set cr (CmpI op1 op2)); | |
11544 effect( DEF cr, USE op1, USE op2 ); | |
11545 format %{ "CMP $op1,$op2" %} | |
11546 opcode(0x3B); /* Opcode 3B /r */ | |
11547 ins_encode( OpcP, RegReg( op1, op2) ); | |
11548 ins_pipe( ialu_cr_reg_reg ); | |
11549 %} | |
11550 | |
11551 instruct compI_eReg_imm(eFlagsReg cr, eRegI op1, immI op2) %{ | |
11552 match(Set cr (CmpI op1 op2)); | |
11553 effect( DEF cr, USE op1 ); | |
11554 format %{ "CMP $op1,$op2" %} | |
11555 opcode(0x81,0x07); /* Opcode 81 /7 */ | |
11556 // ins_encode( RegImm( op1, op2) ); /* Was CmpImm */ | |
11557 ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); | |
11558 ins_pipe( ialu_cr_reg_imm ); | |
11559 %} | |
11560 | |
11561 // Cisc-spilled version of cmpI_eReg | |
11562 instruct compI_eReg_mem(eFlagsReg cr, eRegI op1, memory op2) %{ | |
11563 match(Set cr (CmpI op1 (LoadI op2))); | |
11564 | |
11565 format %{ "CMP $op1,$op2" %} | |
11566 ins_cost(500); | |
11567 opcode(0x3B); /* Opcode 3B /r */ | |
11568 ins_encode( OpcP, RegMem( op1, op2) ); | |
11569 ins_pipe( ialu_cr_reg_mem ); | |
11570 %} | |
11571 | |
11572 instruct testI_reg( eFlagsReg cr, eRegI src, immI0 zero ) %{ | |
11573 match(Set cr (CmpI src zero)); | |
11574 effect( DEF cr, USE src ); | |
11575 | |
11576 format %{ "TEST $src,$src" %} | |
11577 opcode(0x85); | |
11578 ins_encode( OpcP, RegReg( src, src ) ); | |
11579 ins_pipe( ialu_cr_reg_imm ); | |
11580 %} | |
11581 | |
11582 instruct testI_reg_imm( eFlagsReg cr, eRegI src, immI con, immI0 zero ) %{ | |
11583 match(Set cr (CmpI (AndI src con) zero)); | |
11584 | |
11585 format %{ "TEST $src,$con" %} | |
11586 opcode(0xF7,0x00); | |
11587 ins_encode( OpcP, RegOpc(src), Con32(con) ); | |
11588 ins_pipe( ialu_cr_reg_imm ); | |
11589 %} | |
11590 | |
11591 instruct testI_reg_mem( eFlagsReg cr, eRegI src, memory mem, immI0 zero ) %{ | |
11592 match(Set cr (CmpI (AndI src mem) zero)); | |
11593 | |
11594 format %{ "TEST $src,$mem" %} | |
11595 opcode(0x85); | |
11596 ins_encode( OpcP, RegMem( src, mem ) ); | |
11597 ins_pipe( ialu_cr_reg_mem ); | |
11598 %} | |
11599 | |
11600 // Unsigned compare Instructions; really, same as signed except they | |
11601 // produce an eFlagsRegU instead of eFlagsReg. | |
11602 instruct compU_eReg(eFlagsRegU cr, eRegI op1, eRegI op2) %{ | |
11603 match(Set cr (CmpU op1 op2)); | |
11604 | |
11605 format %{ "CMPu $op1,$op2" %} | |
11606 opcode(0x3B); /* Opcode 3B /r */ | |
11607 ins_encode( OpcP, RegReg( op1, op2) ); | |
11608 ins_pipe( ialu_cr_reg_reg ); | |
11609 %} | |
11610 | |
11611 instruct compU_eReg_imm(eFlagsRegU cr, eRegI op1, immI op2) %{ | |
11612 match(Set cr (CmpU op1 op2)); | |
11613 | |
11614 format %{ "CMPu $op1,$op2" %} | |
11615 opcode(0x81,0x07); /* Opcode 81 /7 */ | |
11616 ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); | |
11617 ins_pipe( ialu_cr_reg_imm ); | |
11618 %} | |
11619 | |
11620 // // Cisc-spilled version of cmpU_eReg | |
11621 instruct compU_eReg_mem(eFlagsRegU cr, eRegI op1, memory op2) %{ | |
11622 match(Set cr (CmpU op1 (LoadI op2))); | |
11623 | |
11624 format %{ "CMPu $op1,$op2" %} | |
11625 ins_cost(500); | |
11626 opcode(0x3B); /* Opcode 3B /r */ | |
11627 ins_encode( OpcP, RegMem( op1, op2) ); | |
11628 ins_pipe( ialu_cr_reg_mem ); | |
11629 %} | |
11630 | |
11631 // // Cisc-spilled version of cmpU_eReg | |
11632 //instruct compU_mem_eReg(eFlagsRegU cr, memory op1, eRegI op2) %{ | |
11633 // match(Set cr (CmpU (LoadI op1) op2)); | |
11634 // | |
11635 // format %{ "CMPu $op1,$op2" %} | |
11636 // ins_cost(500); | |
11637 // opcode(0x39); /* Opcode 39 /r */ | |
11638 // ins_encode( OpcP, RegMem( op1, op2) ); | |
11639 //%} | |
11640 | |
11641 instruct testU_reg( eFlagsRegU cr, eRegI src, immI0 zero ) %{ | |
11642 match(Set cr (CmpU src zero)); | |
11643 | |
11644 format %{ "TESTu $src,$src" %} | |
11645 opcode(0x85); | |
11646 ins_encode( OpcP, RegReg( src, src ) ); | |
11647 ins_pipe( ialu_cr_reg_imm ); | |
11648 %} | |
11649 | |
11650 // Unsigned pointer compare Instructions | |
11651 instruct compP_eReg(eFlagsRegU cr, eRegP op1, eRegP op2) %{ | |
11652 match(Set cr (CmpP op1 op2)); | |
11653 | |
11654 format %{ "CMPu $op1,$op2" %} | |
11655 opcode(0x3B); /* Opcode 3B /r */ | |
11656 ins_encode( OpcP, RegReg( op1, op2) ); | |
11657 ins_pipe( ialu_cr_reg_reg ); | |
11658 %} | |
11659 | |
11660 instruct compP_eReg_imm(eFlagsRegU cr, eRegP op1, immP op2) %{ | |
11661 match(Set cr (CmpP op1 op2)); | |
11662 | |
11663 format %{ "CMPu $op1,$op2" %} | |
11664 opcode(0x81,0x07); /* Opcode 81 /7 */ | |
11665 ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); | |
11666 ins_pipe( ialu_cr_reg_imm ); | |
11667 %} | |
11668 | |
11669 // // Cisc-spilled version of cmpP_eReg | |
11670 instruct compP_eReg_mem(eFlagsRegU cr, eRegP op1, memory op2) %{ | |
11671 match(Set cr (CmpP op1 (LoadP op2))); | |
11672 | |
11673 format %{ "CMPu $op1,$op2" %} | |
11674 ins_cost(500); | |
11675 opcode(0x3B); /* Opcode 3B /r */ | |
11676 ins_encode( OpcP, RegMem( op1, op2) ); | |
11677 ins_pipe( ialu_cr_reg_mem ); | |
11678 %} | |
11679 | |
11680 // // Cisc-spilled version of cmpP_eReg | |
11681 //instruct compP_mem_eReg(eFlagsRegU cr, memory op1, eRegP op2) %{ | |
11682 // match(Set cr (CmpP (LoadP op1) op2)); | |
11683 // | |
11684 // format %{ "CMPu $op1,$op2" %} | |
11685 // ins_cost(500); | |
11686 // opcode(0x39); /* Opcode 39 /r */ | |
11687 // ins_encode( OpcP, RegMem( op1, op2) ); | |
11688 //%} | |
11689 | |
11690 // Compare raw pointer (used in out-of-heap check). | |
11691 // Only works because non-oop pointers must be raw pointers | |
11692 // and raw pointers have no anti-dependencies. | |
11693 instruct compP_mem_eReg( eFlagsRegU cr, eRegP op1, memory op2 ) %{ | |
11694 predicate( !n->in(2)->in(2)->bottom_type()->isa_oop_ptr() ); | |
11695 match(Set cr (CmpP op1 (LoadP op2))); | |
11696 | |
11697 format %{ "CMPu $op1,$op2" %} | |
11698 opcode(0x3B); /* Opcode 3B /r */ | |
11699 ins_encode( OpcP, RegMem( op1, op2) ); | |
11700 ins_pipe( ialu_cr_reg_mem ); | |
11701 %} | |
11702 | |
11703 // | |
11704 // This will generate a signed flags result. This should be ok | |
11705 // since any compare to a zero should be eq/neq. | |
11706 instruct testP_reg( eFlagsReg cr, eRegP src, immP0 zero ) %{ | |
11707 match(Set cr (CmpP src zero)); | |
11708 | |
11709 format %{ "TEST $src,$src" %} | |
11710 opcode(0x85); | |
11711 ins_encode( OpcP, RegReg( src, src ) ); | |
11712 ins_pipe( ialu_cr_reg_imm ); | |
11713 %} | |
11714 | |
11715 // Cisc-spilled version of testP_reg | |
11716 // This will generate a signed flags result. This should be ok | |
11717 // since any compare to a zero should be eq/neq. | |
11718 instruct testP_Reg_mem( eFlagsReg cr, memory op, immI0 zero ) %{ | |
11719 match(Set cr (CmpP (LoadP op) zero)); | |
11720 | |
11721 format %{ "TEST $op,0xFFFFFFFF" %} | |
11722 ins_cost(500); | |
11723 opcode(0xF7); /* Opcode F7 /0 */ | |
11724 ins_encode( OpcP, RMopc_Mem(0x00,op), Con_d32(0xFFFFFFFF) ); | |
11725 ins_pipe( ialu_cr_reg_imm ); | |
11726 %} | |
11727 | |
11728 // Yanked all unsigned pointer compare operations. | |
11729 // Pointer compares are done with CmpP which is already unsigned. | |
11730 | |
11731 //----------Max and Min-------------------------------------------------------- | |
11732 // Min Instructions | |
11733 //// | |
11734 // *** Min and Max using the conditional move are slower than the | |
11735 // *** branch version on a Pentium III. | |
11736 // // Conditional move for min | |
11737 //instruct cmovI_reg_lt( eRegI op2, eRegI op1, eFlagsReg cr ) %{ | |
11738 // effect( USE_DEF op2, USE op1, USE cr ); | |
11739 // format %{ "CMOVlt $op2,$op1\t! min" %} | |
11740 // opcode(0x4C,0x0F); | |
11741 // ins_encode( OpcS, OpcP, RegReg( op2, op1 ) ); | |
11742 // ins_pipe( pipe_cmov_reg ); | |
11743 //%} | |
11744 // | |
11745 //// Min Register with Register (P6 version) | |
11746 //instruct minI_eReg_p6( eRegI op1, eRegI op2 ) %{ | |
11747 // predicate(VM_Version::supports_cmov() ); | |
11748 // match(Set op2 (MinI op1 op2)); | |
11749 // ins_cost(200); | |
11750 // expand %{ | |
11751 // eFlagsReg cr; | |
11752 // compI_eReg(cr,op1,op2); | |
11753 // cmovI_reg_lt(op2,op1,cr); | |
11754 // %} | |
11755 //%} | |
11756 | |
11757 // Min Register with Register (generic version) | |
11758 instruct minI_eReg(eRegI dst, eRegI src, eFlagsReg flags) %{ | |
11759 match(Set dst (MinI dst src)); | |
11760 effect(KILL flags); | |
11761 ins_cost(300); | |
11762 | |
11763 format %{ "MIN $dst,$src" %} | |
11764 opcode(0xCC); | |
11765 ins_encode( min_enc(dst,src) ); | |
11766 ins_pipe( pipe_slow ); | |
11767 %} | |
11768 | |
11769 // Max Register with Register | |
11770 // *** Min and Max using the conditional move are slower than the | |
11771 // *** branch version on a Pentium III. | |
11772 // // Conditional move for max | |
11773 //instruct cmovI_reg_gt( eRegI op2, eRegI op1, eFlagsReg cr ) %{ | |
11774 // effect( USE_DEF op2, USE op1, USE cr ); | |
11775 // format %{ "CMOVgt $op2,$op1\t! max" %} | |
11776 // opcode(0x4F,0x0F); | |
11777 // ins_encode( OpcS, OpcP, RegReg( op2, op1 ) ); | |
11778 // ins_pipe( pipe_cmov_reg ); | |
11779 //%} | |
11780 // | |
11781 // // Max Register with Register (P6 version) | |
11782 //instruct maxI_eReg_p6( eRegI op1, eRegI op2 ) %{ | |
11783 // predicate(VM_Version::supports_cmov() ); | |
11784 // match(Set op2 (MaxI op1 op2)); | |
11785 // ins_cost(200); | |
11786 // expand %{ | |
11787 // eFlagsReg cr; | |
11788 // compI_eReg(cr,op1,op2); | |
11789 // cmovI_reg_gt(op2,op1,cr); | |
11790 // %} | |
11791 //%} | |
11792 | |
11793 // Max Register with Register (generic version) | |
11794 instruct maxI_eReg(eRegI dst, eRegI src, eFlagsReg flags) %{ | |
11795 match(Set dst (MaxI dst src)); | |
11796 effect(KILL flags); | |
11797 ins_cost(300); | |
11798 | |
11799 format %{ "MAX $dst,$src" %} | |
11800 opcode(0xCC); | |
11801 ins_encode( max_enc(dst,src) ); | |
11802 ins_pipe( pipe_slow ); | |
11803 %} | |
11804 | |
11805 // ============================================================================ | |
11806 // Branch Instructions | |
11807 // Jump Table | |
11808 instruct jumpXtnd(eRegI switch_val) %{ | |
11809 match(Jump switch_val); | |
11810 ins_cost(350); | |
11811 | |
11812 format %{ "JMP [table_base](,$switch_val,1)\n\t" %} | |
11813 | |
11814 ins_encode %{ | |
11815 address table_base = __ address_table_constant(_index2label); | |
11816 | |
11817 // Jump to Address(table_base + switch_reg) | |
11818 InternalAddress table(table_base); | |
11819 Address index(noreg, $switch_val$$Register, Address::times_1); | |
11820 __ jump(ArrayAddress(table, index)); | |
11821 %} | |
11822 ins_pc_relative(1); | |
11823 ins_pipe(pipe_jmp); | |
11824 %} | |
11825 | |
11826 // Jump Direct - Label defines a relative address from JMP+1 | |
11827 instruct jmpDir(label labl) %{ | |
11828 match(Goto); | |
11829 effect(USE labl); | |
11830 | |
11831 ins_cost(300); | |
11832 format %{ "JMP $labl" %} | |
11833 size(5); | |
11834 opcode(0xE9); | |
11835 ins_encode( OpcP, Lbl( labl ) ); | |
11836 ins_pipe( pipe_jmp ); | |
11837 ins_pc_relative(1); | |
11838 %} | |
11839 | |
11840 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
11841 instruct jmpCon(cmpOp cop, eFlagsReg cr, label labl) %{ | |
11842 match(If cop cr); | |
11843 effect(USE labl); | |
11844 | |
11845 ins_cost(300); | |
11846 format %{ "J$cop $labl" %} | |
11847 size(6); | |
11848 opcode(0x0F, 0x80); | |
11849 ins_encode( Jcc( cop, labl) ); | |
11850 ins_pipe( pipe_jcc ); | |
11851 ins_pc_relative(1); | |
11852 %} | |
11853 | |
11854 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
11855 instruct jmpLoopEnd(cmpOp cop, eFlagsReg cr, label labl) %{ | |
11856 match(CountedLoopEnd cop cr); | |
11857 effect(USE labl); | |
11858 | |
11859 ins_cost(300); | |
11860 format %{ "J$cop $labl\t# Loop end" %} | |
11861 size(6); | |
11862 opcode(0x0F, 0x80); | |
11863 ins_encode( Jcc( cop, labl) ); | |
11864 ins_pipe( pipe_jcc ); | |
11865 ins_pc_relative(1); | |
11866 %} | |
11867 | |
11868 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
11869 instruct jmpLoopEndU(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
11870 match(CountedLoopEnd cop cmp); | |
11871 effect(USE labl); | |
11872 | |
11873 ins_cost(300); | |
11874 format %{ "J$cop,u $labl\t# Loop end" %} | |
11875 size(6); | |
11876 opcode(0x0F, 0x80); | |
11877 ins_encode( Jcc( cop, labl) ); | |
11878 ins_pipe( pipe_jcc ); | |
11879 ins_pc_relative(1); | |
11880 %} | |
11881 | |
11882 // Jump Direct Conditional - using unsigned comparison | |
11883 instruct jmpConU(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
11884 match(If cop cmp); | |
11885 effect(USE labl); | |
11886 | |
11887 ins_cost(300); | |
11888 format %{ "J$cop,u $labl" %} | |
11889 size(6); | |
11890 opcode(0x0F, 0x80); | |
11891 ins_encode( Jcc( cop, labl) ); | |
11892 ins_pipe( pipe_jcc ); | |
11893 ins_pc_relative(1); | |
11894 %} | |
11895 | |
11896 // ============================================================================ | |
11897 // The 2nd slow-half of a subtype check. Scan the subklass's 2ndary superklass | |
11898 // array for an instance of the superklass. Set a hidden internal cache on a | |
11899 // hit (cache is checked with exposed code in gen_subtype_check()). Return | |
11900 // NZ for a miss or zero for a hit. The encoding ALSO sets flags. | |
11901 instruct partialSubtypeCheck( eDIRegP result, eSIRegP sub, eAXRegP super, eCXRegI rcx, eFlagsReg cr ) %{ | |
11902 match(Set result (PartialSubtypeCheck sub super)); | |
11903 effect( KILL rcx, KILL cr ); | |
11904 | |
11905 ins_cost(1100); // slightly larger than the next version | |
11906 format %{ "CMPL EAX,ESI\n\t" | |
11907 "JEQ,s hit\n\t" | |
11908 "MOV EDI,[$sub+Klass::secondary_supers]\n\t" | |
11909 "MOV ECX,[EDI+arrayKlass::length]\t# length to scan\n\t" | |
11910 "ADD EDI,arrayKlass::base_offset\t# Skip to start of data; set NZ in case count is zero\n\t" | |
11911 "REPNE SCASD\t# Scan *EDI++ for a match with EAX while CX-- != 0\n\t" | |
11912 "JNE,s miss\t\t# Missed: EDI not-zero\n\t" | |
11913 "MOV [$sub+Klass::secondary_super_cache],$super\t# Hit: update cache\n\t" | |
11914 "hit:\n\t" | |
11915 "XOR $result,$result\t\t Hit: EDI zero\n\t" | |
11916 "miss:\t" %} | |
11917 | |
11918 opcode(0x1); // Force a XOR of EDI | |
11919 ins_encode( enc_PartialSubtypeCheck() ); | |
11920 ins_pipe( pipe_slow ); | |
11921 %} | |
11922 | |
11923 instruct partialSubtypeCheck_vs_Zero( eFlagsReg cr, eSIRegP sub, eAXRegP super, eCXRegI rcx, eDIRegP result, immP0 zero ) %{ | |
11924 match(Set cr (CmpP (PartialSubtypeCheck sub super) zero)); | |
11925 effect( KILL rcx, KILL result ); | |
11926 | |
11927 ins_cost(1000); | |
11928 format %{ "CMPL EAX,ESI\n\t" | |
11929 "JEQ,s miss\t# Actually a hit; we are done.\n\t" | |
11930 "MOV EDI,[$sub+Klass::secondary_supers]\n\t" | |
11931 "MOV ECX,[EDI+arrayKlass::length]\t# length to scan\n\t" | |
11932 "ADD EDI,arrayKlass::base_offset\t# Skip to start of data; set NZ in case count is zero\n\t" | |
11933 "REPNE SCASD\t# Scan *EDI++ for a match with EAX while CX-- != 0\n\t" | |
11934 "JNE,s miss\t\t# Missed: flags NZ\n\t" | |
11935 "MOV [$sub+Klass::secondary_super_cache],$super\t# Hit: update cache, flags Z\n\t" | |
11936 "miss:\t" %} | |
11937 | |
11938 opcode(0x0); // No need to XOR EDI | |
11939 ins_encode( enc_PartialSubtypeCheck() ); | |
11940 ins_pipe( pipe_slow ); | |
11941 %} | |
11942 | |
11943 // ============================================================================ | |
11944 // Branch Instructions -- short offset versions | |
11945 // | |
11946 // These instructions are used to replace jumps of a long offset (the default | |
11947 // match) with jumps of a shorter offset. These instructions are all tagged | |
11948 // with the ins_short_branch attribute, which causes the ADLC to suppress the | |
11949 // match rules in general matching. Instead, the ADLC generates a conversion | |
11950 // method in the MachNode which can be used to do in-place replacement of the | |
11951 // long variant with the shorter variant. The compiler will determine if a | |
11952 // branch can be taken by the is_short_branch_offset() predicate in the machine | |
11953 // specific code section of the file. | |
11954 | |
11955 // Jump Direct - Label defines a relative address from JMP+1 | |
11956 instruct jmpDir_short(label labl) %{ | |
11957 match(Goto); | |
11958 effect(USE labl); | |
11959 | |
11960 ins_cost(300); | |
11961 format %{ "JMP,s $labl" %} | |
11962 size(2); | |
11963 opcode(0xEB); | |
11964 ins_encode( OpcP, LblShort( labl ) ); | |
11965 ins_pipe( pipe_jmp ); | |
11966 ins_pc_relative(1); | |
11967 ins_short_branch(1); | |
11968 %} | |
11969 | |
11970 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
11971 instruct jmpCon_short(cmpOp cop, eFlagsReg cr, label labl) %{ | |
11972 match(If cop cr); | |
11973 effect(USE labl); | |
11974 | |
11975 ins_cost(300); | |
11976 format %{ "J$cop,s $labl" %} | |
11977 size(2); | |
11978 opcode(0x70); | |
11979 ins_encode( JccShort( cop, labl) ); | |
11980 ins_pipe( pipe_jcc ); | |
11981 ins_pc_relative(1); | |
11982 ins_short_branch(1); | |
11983 %} | |
11984 | |
11985 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
11986 instruct jmpLoopEnd_short(cmpOp cop, eFlagsReg cr, label labl) %{ | |
11987 match(CountedLoopEnd cop cr); | |
11988 effect(USE labl); | |
11989 | |
11990 ins_cost(300); | |
11991 format %{ "J$cop,s $labl" %} | |
11992 size(2); | |
11993 opcode(0x70); | |
11994 ins_encode( JccShort( cop, labl) ); | |
11995 ins_pipe( pipe_jcc ); | |
11996 ins_pc_relative(1); | |
11997 ins_short_branch(1); | |
11998 %} | |
11999 | |
12000 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
12001 instruct jmpLoopEndU_short(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
12002 match(CountedLoopEnd cop cmp); | |
12003 effect(USE labl); | |
12004 | |
12005 ins_cost(300); | |
12006 format %{ "J$cop,us $labl" %} | |
12007 size(2); | |
12008 opcode(0x70); | |
12009 ins_encode( JccShort( cop, labl) ); | |
12010 ins_pipe( pipe_jcc ); | |
12011 ins_pc_relative(1); | |
12012 ins_short_branch(1); | |
12013 %} | |
12014 | |
12015 // Jump Direct Conditional - using unsigned comparison | |
12016 instruct jmpConU_short(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
12017 match(If cop cmp); | |
12018 effect(USE labl); | |
12019 | |
12020 ins_cost(300); | |
12021 format %{ "J$cop,us $labl" %} | |
12022 size(2); | |
12023 opcode(0x70); | |
12024 ins_encode( JccShort( cop, labl) ); | |
12025 ins_pipe( pipe_jcc ); | |
12026 ins_pc_relative(1); | |
12027 ins_short_branch(1); | |
12028 %} | |
12029 | |
12030 // ============================================================================ | |
12031 // Long Compare | |
12032 // | |
12033 // Currently we hold longs in 2 registers. Comparing such values efficiently | |
12034 // is tricky. The flavor of compare used depends on whether we are testing | |
12035 // for LT, LE, or EQ. For a simple LT test we can check just the sign bit. | |
12036 // The GE test is the negated LT test. The LE test can be had by commuting | |
12037 // the operands (yielding a GE test) and then negating; negate again for the | |
12038 // GT test. The EQ test is done by ORcc'ing the high and low halves, and the | |
12039 // NE test is negated from that. | |
12040 | |
12041 // Due to a shortcoming in the ADLC, it mixes up expressions like: | |
12042 // (foo (CmpI (CmpL X Y) 0)) and (bar (CmpI (CmpL X 0L) 0)). Note the | |
12043 // difference between 'Y' and '0L'. The tree-matches for the CmpI sections | |
12044 // are collapsed internally in the ADLC's dfa-gen code. The match for | |
12045 // (CmpI (CmpL X Y) 0) is silently replaced with (CmpI (CmpL X 0L) 0) and the | |
12046 // foo match ends up with the wrong leaf. One fix is to not match both | |
12047 // reg-reg and reg-zero forms of long-compare. This is unfortunate because | |
12048 // both forms beat the trinary form of long-compare and both are very useful | |
12049 // on Intel which has so few registers. | |
12050 | |
12051 // Manifest a CmpL result in an integer register. Very painful. | |
12052 // This is the test to avoid. | |
12053 instruct cmpL3_reg_reg(eSIRegI dst, eRegL src1, eRegL src2, eFlagsReg flags ) %{ | |
12054 match(Set dst (CmpL3 src1 src2)); | |
12055 effect( KILL flags ); | |
12056 ins_cost(1000); | |
12057 format %{ "XOR $dst,$dst\n\t" | |
12058 "CMP $src1.hi,$src2.hi\n\t" | |
12059 "JLT,s m_one\n\t" | |
12060 "JGT,s p_one\n\t" | |
12061 "CMP $src1.lo,$src2.lo\n\t" | |
12062 "JB,s m_one\n\t" | |
12063 "JEQ,s done\n" | |
12064 "p_one:\tINC $dst\n\t" | |
12065 "JMP,s done\n" | |
12066 "m_one:\tDEC $dst\n" | |
12067 "done:" %} | |
12068 ins_encode %{ | |
12069 Label p_one, m_one, done; | |
12070 __ xorl($dst$$Register, $dst$$Register); | |
12071 __ cmpl(HIGH_FROM_LOW($src1$$Register), HIGH_FROM_LOW($src2$$Register)); | |
12072 __ jccb(Assembler::less, m_one); | |
12073 __ jccb(Assembler::greater, p_one); | |
12074 __ cmpl($src1$$Register, $src2$$Register); | |
12075 __ jccb(Assembler::below, m_one); | |
12076 __ jccb(Assembler::equal, done); | |
12077 __ bind(p_one); | |
12078 __ increment($dst$$Register); | |
12079 __ jmpb(done); | |
12080 __ bind(m_one); | |
12081 __ decrement($dst$$Register); | |
12082 __ bind(done); | |
12083 %} | |
12084 ins_pipe( pipe_slow ); | |
12085 %} | |
12086 | |
12087 //====== | |
12088 // Manifest a CmpL result in the normal flags. Only good for LT or GE | |
12089 // compares. Can be used for LE or GT compares by reversing arguments. | |
12090 // NOT GOOD FOR EQ/NE tests. | |
12091 instruct cmpL_zero_flags_LTGE( flagsReg_long_LTGE flags, eRegL src, immL0 zero ) %{ | |
12092 match( Set flags (CmpL src zero )); | |
12093 ins_cost(100); | |
12094 format %{ "TEST $src.hi,$src.hi" %} | |
12095 opcode(0x85); | |
12096 ins_encode( OpcP, RegReg_Hi2( src, src ) ); | |
12097 ins_pipe( ialu_cr_reg_reg ); | |
12098 %} | |
12099 | |
12100 // Manifest a CmpL result in the normal flags. Only good for LT or GE | |
12101 // compares. Can be used for LE or GT compares by reversing arguments. | |
12102 // NOT GOOD FOR EQ/NE tests. | |
12103 instruct cmpL_reg_flags_LTGE( flagsReg_long_LTGE flags, eRegL src1, eRegL src2, eRegI tmp ) %{ | |
12104 match( Set flags (CmpL src1 src2 )); | |
12105 effect( TEMP tmp ); | |
12106 ins_cost(300); | |
12107 format %{ "CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits\n\t" | |
12108 "MOV $tmp,$src1.hi\n\t" | |
12109 "SBB $tmp,$src2.hi\t! Compute flags for long compare" %} | |
12110 ins_encode( long_cmp_flags2( src1, src2, tmp ) ); | |
12111 ins_pipe( ialu_cr_reg_reg ); | |
12112 %} | |
12113 | |
12114 // Long compares reg < zero/req OR reg >= zero/req. | |
12115 // Just a wrapper for a normal branch, plus the predicate test. | |
12116 instruct cmpL_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, label labl) %{ | |
12117 match(If cmp flags); | |
12118 effect(USE labl); | |
12119 predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
12120 expand %{ | |
12121 jmpCon(cmp,flags,labl); // JLT or JGE... | |
12122 %} | |
12123 %} | |
12124 | |
12125 // Compare 2 longs and CMOVE longs. | |
12126 instruct cmovLL_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegL dst, eRegL src) %{ | |
12127 match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); | |
12128 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
12129 ins_cost(400); | |
12130 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
12131 "CMOV$cmp $dst.hi,$src.hi" %} | |
12132 opcode(0x0F,0x40); | |
12133 ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); | |
12134 ins_pipe( pipe_cmov_reg_long ); | |
12135 %} | |
12136 | |
12137 instruct cmovLL_mem_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegL dst, load_long_memory src) %{ | |
12138 match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); | |
12139 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
12140 ins_cost(500); | |
12141 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
12142 "CMOV$cmp $dst.hi,$src.hi" %} | |
12143 opcode(0x0F,0x40); | |
12144 ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); | |
12145 ins_pipe( pipe_cmov_reg_long ); | |
12146 %} | |
12147 | |
12148 // Compare 2 longs and CMOVE ints. | |
12149 instruct cmovII_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegI dst, eRegI src) %{ | |
12150 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
12151 match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); | |
12152 ins_cost(200); | |
12153 format %{ "CMOV$cmp $dst,$src" %} | |
12154 opcode(0x0F,0x40); | |
12155 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
12156 ins_pipe( pipe_cmov_reg ); | |
12157 %} | |
12158 | |
12159 instruct cmovII_mem_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegI dst, memory src) %{ | |
12160 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
12161 match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); | |
12162 ins_cost(250); | |
12163 format %{ "CMOV$cmp $dst,$src" %} | |
12164 opcode(0x0F,0x40); | |
12165 ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); | |
12166 ins_pipe( pipe_cmov_mem ); | |
12167 %} | |
12168 | |
12169 // Compare 2 longs and CMOVE ints. | |
12170 instruct cmovPP_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegP dst, eRegP src) %{ | |
12171 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
12172 match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); | |
12173 ins_cost(200); | |
12174 format %{ "CMOV$cmp $dst,$src" %} | |
12175 opcode(0x0F,0x40); | |
12176 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
12177 ins_pipe( pipe_cmov_reg ); | |
12178 %} | |
12179 | |
12180 // Compare 2 longs and CMOVE doubles | |
12181 instruct cmovDD_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regD dst, regD src) %{ | |
12182 predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
12183 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
12184 ins_cost(200); | |
12185 expand %{ | |
12186 fcmovD_regS(cmp,flags,dst,src); | |
12187 %} | |
12188 %} | |
12189 | |
12190 // Compare 2 longs and CMOVE doubles | |
12191 instruct cmovXDD_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regXD dst, regXD src) %{ | |
12192 predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
12193 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
12194 ins_cost(200); | |
12195 expand %{ | |
12196 fcmovXD_regS(cmp,flags,dst,src); | |
12197 %} | |
12198 %} | |
12199 | |
12200 instruct cmovFF_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regF dst, regF src) %{ | |
12201 predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
12202 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
12203 ins_cost(200); | |
12204 expand %{ | |
12205 fcmovF_regS(cmp,flags,dst,src); | |
12206 %} | |
12207 %} | |
12208 | |
12209 instruct cmovXX_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regX dst, regX src) %{ | |
12210 predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
12211 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
12212 ins_cost(200); | |
12213 expand %{ | |
12214 fcmovX_regS(cmp,flags,dst,src); | |
12215 %} | |
12216 %} | |
12217 | |
12218 //====== | |
12219 // Manifest a CmpL result in the normal flags. Only good for EQ/NE compares. | |
12220 instruct cmpL_zero_flags_EQNE( flagsReg_long_EQNE flags, eRegL src, immL0 zero, eRegI tmp ) %{ | |
12221 match( Set flags (CmpL src zero )); | |
12222 effect(TEMP tmp); | |
12223 ins_cost(200); | |
12224 format %{ "MOV $tmp,$src.lo\n\t" | |
12225 "OR $tmp,$src.hi\t! Long is EQ/NE 0?" %} | |
12226 ins_encode( long_cmp_flags0( src, tmp ) ); | |
12227 ins_pipe( ialu_reg_reg_long ); | |
12228 %} | |
12229 | |
12230 // Manifest a CmpL result in the normal flags. Only good for EQ/NE compares. | |
12231 instruct cmpL_reg_flags_EQNE( flagsReg_long_EQNE flags, eRegL src1, eRegL src2 ) %{ | |
12232 match( Set flags (CmpL src1 src2 )); | |
12233 ins_cost(200+300); | |
12234 format %{ "CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits\n\t" | |
12235 "JNE,s skip\n\t" | |
12236 "CMP $src1.hi,$src2.hi\n\t" | |
12237 "skip:\t" %} | |
12238 ins_encode( long_cmp_flags1( src1, src2 ) ); | |
12239 ins_pipe( ialu_cr_reg_reg ); | |
12240 %} | |
12241 | |
12242 // Long compare reg == zero/reg OR reg != zero/reg | |
12243 // Just a wrapper for a normal branch, plus the predicate test. | |
12244 instruct cmpL_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, label labl) %{ | |
12245 match(If cmp flags); | |
12246 effect(USE labl); | |
12247 predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
12248 expand %{ | |
12249 jmpCon(cmp,flags,labl); // JEQ or JNE... | |
12250 %} | |
12251 %} | |
12252 | |
12253 // Compare 2 longs and CMOVE longs. | |
12254 instruct cmovLL_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegL dst, eRegL src) %{ | |
12255 match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); | |
12256 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
12257 ins_cost(400); | |
12258 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
12259 "CMOV$cmp $dst.hi,$src.hi" %} | |
12260 opcode(0x0F,0x40); | |
12261 ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); | |
12262 ins_pipe( pipe_cmov_reg_long ); | |
12263 %} | |
12264 | |
12265 instruct cmovLL_mem_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegL dst, load_long_memory src) %{ | |
12266 match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); | |
12267 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
12268 ins_cost(500); | |
12269 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
12270 "CMOV$cmp $dst.hi,$src.hi" %} | |
12271 opcode(0x0F,0x40); | |
12272 ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); | |
12273 ins_pipe( pipe_cmov_reg_long ); | |
12274 %} | |
12275 | |
12276 // Compare 2 longs and CMOVE ints. | |
12277 instruct cmovII_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegI dst, eRegI src) %{ | |
12278 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
12279 match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); | |
12280 ins_cost(200); | |
12281 format %{ "CMOV$cmp $dst,$src" %} | |
12282 opcode(0x0F,0x40); | |
12283 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
12284 ins_pipe( pipe_cmov_reg ); | |
12285 %} | |
12286 | |
12287 instruct cmovII_mem_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegI dst, memory src) %{ | |
12288 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
12289 match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); | |
12290 ins_cost(250); | |
12291 format %{ "CMOV$cmp $dst,$src" %} | |
12292 opcode(0x0F,0x40); | |
12293 ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); | |
12294 ins_pipe( pipe_cmov_mem ); | |
12295 %} | |
12296 | |
12297 // Compare 2 longs and CMOVE ints. | |
12298 instruct cmovPP_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegP dst, eRegP src) %{ | |
12299 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
12300 match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); | |
12301 ins_cost(200); | |
12302 format %{ "CMOV$cmp $dst,$src" %} | |
12303 opcode(0x0F,0x40); | |
12304 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
12305 ins_pipe( pipe_cmov_reg ); | |
12306 %} | |
12307 | |
12308 // Compare 2 longs and CMOVE doubles | |
12309 instruct cmovDD_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regD dst, regD src) %{ | |
12310 predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
12311 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
12312 ins_cost(200); | |
12313 expand %{ | |
12314 fcmovD_regS(cmp,flags,dst,src); | |
12315 %} | |
12316 %} | |
12317 | |
12318 // Compare 2 longs and CMOVE doubles | |
12319 instruct cmovXDD_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regXD dst, regXD src) %{ | |
12320 predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
12321 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
12322 ins_cost(200); | |
12323 expand %{ | |
12324 fcmovXD_regS(cmp,flags,dst,src); | |
12325 %} | |
12326 %} | |
12327 | |
12328 instruct cmovFF_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regF dst, regF src) %{ | |
12329 predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
12330 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
12331 ins_cost(200); | |
12332 expand %{ | |
12333 fcmovF_regS(cmp,flags,dst,src); | |
12334 %} | |
12335 %} | |
12336 | |
12337 instruct cmovXX_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regX dst, regX src) %{ | |
12338 predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
12339 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
12340 ins_cost(200); | |
12341 expand %{ | |
12342 fcmovX_regS(cmp,flags,dst,src); | |
12343 %} | |
12344 %} | |
12345 | |
12346 //====== | |
12347 // Manifest a CmpL result in the normal flags. Only good for LE or GT compares. | |
12348 // Same as cmpL_reg_flags_LEGT except must negate src | |
12349 instruct cmpL_zero_flags_LEGT( flagsReg_long_LEGT flags, eRegL src, immL0 zero, eRegI tmp ) %{ | |
12350 match( Set flags (CmpL src zero )); | |
12351 effect( TEMP tmp ); | |
12352 ins_cost(300); | |
12353 format %{ "XOR $tmp,$tmp\t# Long compare for -$src < 0, use commuted test\n\t" | |
12354 "CMP $tmp,$src.lo\n\t" | |
12355 "SBB $tmp,$src.hi\n\t" %} | |
12356 ins_encode( long_cmp_flags3(src, tmp) ); | |
12357 ins_pipe( ialu_reg_reg_long ); | |
12358 %} | |
12359 | |
12360 // Manifest a CmpL result in the normal flags. Only good for LE or GT compares. | |
12361 // Same as cmpL_reg_flags_LTGE except operands swapped. Swapping operands | |
12362 // requires a commuted test to get the same result. | |
12363 instruct cmpL_reg_flags_LEGT( flagsReg_long_LEGT flags, eRegL src1, eRegL src2, eRegI tmp ) %{ | |
12364 match( Set flags (CmpL src1 src2 )); | |
12365 effect( TEMP tmp ); | |
12366 ins_cost(300); | |
12367 format %{ "CMP $src2.lo,$src1.lo\t! Long compare, swapped operands, use with commuted test\n\t" | |
12368 "MOV $tmp,$src2.hi\n\t" | |
12369 "SBB $tmp,$src1.hi\t! Compute flags for long compare" %} | |
12370 ins_encode( long_cmp_flags2( src2, src1, tmp ) ); | |
12371 ins_pipe( ialu_cr_reg_reg ); | |
12372 %} | |
12373 | |
12374 // Long compares reg < zero/req OR reg >= zero/req. | |
12375 // Just a wrapper for a normal branch, plus the predicate test | |
12376 instruct cmpL_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, label labl) %{ | |
12377 match(If cmp flags); | |
12378 effect(USE labl); | |
12379 predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le ); | |
12380 ins_cost(300); | |
12381 expand %{ | |
12382 jmpCon(cmp,flags,labl); // JGT or JLE... | |
12383 %} | |
12384 %} | |
12385 | |
12386 // Compare 2 longs and CMOVE longs. | |
12387 instruct cmovLL_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegL dst, eRegL src) %{ | |
12388 match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); | |
12389 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
12390 ins_cost(400); | |
12391 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
12392 "CMOV$cmp $dst.hi,$src.hi" %} | |
12393 opcode(0x0F,0x40); | |
12394 ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); | |
12395 ins_pipe( pipe_cmov_reg_long ); | |
12396 %} | |
12397 | |
12398 instruct cmovLL_mem_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegL dst, load_long_memory src) %{ | |
12399 match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); | |
12400 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
12401 ins_cost(500); | |
12402 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
12403 "CMOV$cmp $dst.hi,$src.hi+4" %} | |
12404 opcode(0x0F,0x40); | |
12405 ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); | |
12406 ins_pipe( pipe_cmov_reg_long ); | |
12407 %} | |
12408 | |
12409 // Compare 2 longs and CMOVE ints. | |
12410 instruct cmovII_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegI dst, eRegI src) %{ | |
12411 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
12412 match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); | |
12413 ins_cost(200); | |
12414 format %{ "CMOV$cmp $dst,$src" %} | |
12415 opcode(0x0F,0x40); | |
12416 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
12417 ins_pipe( pipe_cmov_reg ); | |
12418 %} | |
12419 | |
12420 instruct cmovII_mem_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegI dst, memory src) %{ | |
12421 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
12422 match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); | |
12423 ins_cost(250); | |
12424 format %{ "CMOV$cmp $dst,$src" %} | |
12425 opcode(0x0F,0x40); | |
12426 ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); | |
12427 ins_pipe( pipe_cmov_mem ); | |
12428 %} | |
12429 | |
12430 // Compare 2 longs and CMOVE ptrs. | |
12431 instruct cmovPP_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegP dst, eRegP src) %{ | |
12432 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
12433 match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); | |
12434 ins_cost(200); | |
12435 format %{ "CMOV$cmp $dst,$src" %} | |
12436 opcode(0x0F,0x40); | |
12437 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
12438 ins_pipe( pipe_cmov_reg ); | |
12439 %} | |
12440 | |
12441 // Compare 2 longs and CMOVE doubles | |
12442 instruct cmovDD_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regD dst, regD src) %{ | |
12443 predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
12444 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
12445 ins_cost(200); | |
12446 expand %{ | |
12447 fcmovD_regS(cmp,flags,dst,src); | |
12448 %} | |
12449 %} | |
12450 | |
12451 // Compare 2 longs and CMOVE doubles | |
12452 instruct cmovXDD_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regXD dst, regXD src) %{ | |
12453 predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
12454 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
12455 ins_cost(200); | |
12456 expand %{ | |
12457 fcmovXD_regS(cmp,flags,dst,src); | |
12458 %} | |
12459 %} | |
12460 | |
12461 instruct cmovFF_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regF dst, regF src) %{ | |
12462 predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
12463 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
12464 ins_cost(200); | |
12465 expand %{ | |
12466 fcmovF_regS(cmp,flags,dst,src); | |
12467 %} | |
12468 %} | |
12469 | |
12470 | |
12471 instruct cmovXX_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regX dst, regX src) %{ | |
12472 predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
12473 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
12474 ins_cost(200); | |
12475 expand %{ | |
12476 fcmovX_regS(cmp,flags,dst,src); | |
12477 %} | |
12478 %} | |
12479 | |
12480 | |
12481 // ============================================================================ | |
12482 // Procedure Call/Return Instructions | |
12483 // Call Java Static Instruction | |
12484 // Note: If this code changes, the corresponding ret_addr_offset() and | |
12485 // compute_padding() functions will have to be adjusted. | |
12486 instruct CallStaticJavaDirect(method meth) %{ | |
12487 match(CallStaticJava); | |
12488 effect(USE meth); | |
12489 | |
12490 ins_cost(300); | |
12491 format %{ "CALL,static " %} | |
12492 opcode(0xE8); /* E8 cd */ | |
12493 ins_encode( pre_call_FPU, | |
12494 Java_Static_Call( meth ), | |
12495 call_epilog, | |
12496 post_call_FPU ); | |
12497 ins_pipe( pipe_slow ); | |
12498 ins_pc_relative(1); | |
12499 ins_alignment(4); | |
12500 %} | |
12501 | |
12502 // Call Java Dynamic Instruction | |
12503 // Note: If this code changes, the corresponding ret_addr_offset() and | |
12504 // compute_padding() functions will have to be adjusted. | |
12505 instruct CallDynamicJavaDirect(method meth) %{ | |
12506 match(CallDynamicJava); | |
12507 effect(USE meth); | |
12508 | |
12509 ins_cost(300); | |
12510 format %{ "MOV EAX,(oop)-1\n\t" | |
12511 "CALL,dynamic" %} | |
12512 opcode(0xE8); /* E8 cd */ | |
12513 ins_encode( pre_call_FPU, | |
12514 Java_Dynamic_Call( meth ), | |
12515 call_epilog, | |
12516 post_call_FPU ); | |
12517 ins_pipe( pipe_slow ); | |
12518 ins_pc_relative(1); | |
12519 ins_alignment(4); | |
12520 %} | |
12521 | |
12522 // Call Runtime Instruction | |
12523 instruct CallRuntimeDirect(method meth) %{ | |
12524 match(CallRuntime ); | |
12525 effect(USE meth); | |
12526 | |
12527 ins_cost(300); | |
12528 format %{ "CALL,runtime " %} | |
12529 opcode(0xE8); /* E8 cd */ | |
12530 // Use FFREEs to clear entries in float stack | |
12531 ins_encode( pre_call_FPU, | |
12532 FFree_Float_Stack_All, | |
12533 Java_To_Runtime( meth ), | |
12534 post_call_FPU ); | |
12535 ins_pipe( pipe_slow ); | |
12536 ins_pc_relative(1); | |
12537 %} | |
12538 | |
12539 // Call runtime without safepoint | |
12540 instruct CallLeafDirect(method meth) %{ | |
12541 match(CallLeaf); | |
12542 effect(USE meth); | |
12543 | |
12544 ins_cost(300); | |
12545 format %{ "CALL_LEAF,runtime " %} | |
12546 opcode(0xE8); /* E8 cd */ | |
12547 ins_encode( pre_call_FPU, | |
12548 FFree_Float_Stack_All, | |
12549 Java_To_Runtime( meth ), | |
12550 Verify_FPU_For_Leaf, post_call_FPU ); | |
12551 ins_pipe( pipe_slow ); | |
12552 ins_pc_relative(1); | |
12553 %} | |
12554 | |
12555 instruct CallLeafNoFPDirect(method meth) %{ | |
12556 match(CallLeafNoFP); | |
12557 effect(USE meth); | |
12558 | |
12559 ins_cost(300); | |
12560 format %{ "CALL_LEAF_NOFP,runtime " %} | |
12561 opcode(0xE8); /* E8 cd */ | |
12562 ins_encode(Java_To_Runtime(meth)); | |
12563 ins_pipe( pipe_slow ); | |
12564 ins_pc_relative(1); | |
12565 %} | |
12566 | |
12567 | |
12568 // Return Instruction | |
12569 // Remove the return address & jump to it. | |
12570 instruct Ret() %{ | |
12571 match(Return); | |
12572 format %{ "RET" %} | |
12573 opcode(0xC3); | |
12574 ins_encode(OpcP); | |
12575 ins_pipe( pipe_jmp ); | |
12576 %} | |
12577 | |
12578 // Tail Call; Jump from runtime stub to Java code. | |
12579 // Also known as an 'interprocedural jump'. | |
12580 // Target of jump will eventually return to caller. | |
12581 // TailJump below removes the return address. | |
12582 instruct TailCalljmpInd(eRegP_no_EBP jump_target, eBXRegP method_oop) %{ | |
12583 match(TailCall jump_target method_oop ); | |
12584 ins_cost(300); | |
12585 format %{ "JMP $jump_target \t# EBX holds method oop" %} | |
12586 opcode(0xFF, 0x4); /* Opcode FF /4 */ | |
12587 ins_encode( OpcP, RegOpc(jump_target) ); | |
12588 ins_pipe( pipe_jmp ); | |
12589 %} | |
12590 | |
12591 | |
12592 // Tail Jump; remove the return address; jump to target. | |
12593 // TailCall above leaves the return address around. | |
12594 instruct tailjmpInd(eRegP_no_EBP jump_target, eAXRegP ex_oop) %{ | |
12595 match( TailJump jump_target ex_oop ); | |
12596 ins_cost(300); | |
12597 format %{ "POP EDX\t# pop return address into dummy\n\t" | |
12598 "JMP $jump_target " %} | |
12599 opcode(0xFF, 0x4); /* Opcode FF /4 */ | |
12600 ins_encode( enc_pop_rdx, | |
12601 OpcP, RegOpc(jump_target) ); | |
12602 ins_pipe( pipe_jmp ); | |
12603 %} | |
12604 | |
12605 // Create exception oop: created by stack-crawling runtime code. | |
12606 // Created exception is now available to this handler, and is setup | |
12607 // just prior to jumping to this handler. No code emitted. | |
12608 instruct CreateException( eAXRegP ex_oop ) | |
12609 %{ | |
12610 match(Set ex_oop (CreateEx)); | |
12611 | |
12612 size(0); | |
12613 // use the following format syntax | |
12614 format %{ "# exception oop is in EAX; no code emitted" %} | |
12615 ins_encode(); | |
12616 ins_pipe( empty ); | |
12617 %} | |
12618 | |
12619 | |
12620 // Rethrow exception: | |
12621 // The exception oop will come in the first argument position. | |
12622 // Then JUMP (not call) to the rethrow stub code. | |
12623 instruct RethrowException() | |
12624 %{ | |
12625 match(Rethrow); | |
12626 | |
12627 // use the following format syntax | |
12628 format %{ "JMP rethrow_stub" %} | |
12629 ins_encode(enc_rethrow); | |
12630 ins_pipe( pipe_jmp ); | |
12631 %} | |
12632 | |
12633 // inlined locking and unlocking | |
12634 | |
12635 | |
12636 instruct cmpFastLock( eFlagsReg cr, eRegP object, eRegP box, eAXRegI tmp, eRegP scr) %{ | |
12637 match( Set cr (FastLock object box) ); | |
12638 effect( TEMP tmp, TEMP scr ); | |
12639 ins_cost(300); | |
12640 format %{ "FASTLOCK $object, $box KILLS $tmp,$scr" %} | |
12641 ins_encode( Fast_Lock(object,box,tmp,scr) ); | |
12642 ins_pipe( pipe_slow ); | |
12643 ins_pc_relative(1); | |
12644 %} | |
12645 | |
12646 instruct cmpFastUnlock( eFlagsReg cr, eRegP object, eAXRegP box, eRegP tmp ) %{ | |
12647 match( Set cr (FastUnlock object box) ); | |
12648 effect( TEMP tmp ); | |
12649 ins_cost(300); | |
12650 format %{ "FASTUNLOCK $object, $box, $tmp" %} | |
12651 ins_encode( Fast_Unlock(object,box,tmp) ); | |
12652 ins_pipe( pipe_slow ); | |
12653 ins_pc_relative(1); | |
12654 %} | |
12655 | |
12656 | |
12657 | |
12658 // ============================================================================ | |
12659 // Safepoint Instruction | |
12660 instruct safePoint_poll(eFlagsReg cr) %{ | |
12661 match(SafePoint); | |
12662 effect(KILL cr); | |
12663 | |
12664 // TODO-FIXME: we currently poll at offset 0 of the safepoint polling page. | |
12665 // On SPARC that might be acceptable as we can generate the address with | |
12666 // just a sethi, saving an or. By polling at offset 0 we can end up | |
12667 // putting additional pressure on the index-0 in the D$. Because of | |
12668 // alignment (just like the situation at hand) the lower indices tend | |
12669 // to see more traffic. It'd be better to change the polling address | |
12670 // to offset 0 of the last $line in the polling page. | |
12671 | |
12672 format %{ "TSTL #polladdr,EAX\t! Safepoint: poll for GC" %} | |
12673 ins_cost(125); | |
12674 size(6) ; | |
12675 ins_encode( Safepoint_Poll() ); | |
12676 ins_pipe( ialu_reg_mem ); | |
12677 %} | |
12678 | |
12679 //----------PEEPHOLE RULES----------------------------------------------------- | |
12680 // These must follow all instruction definitions as they use the names | |
12681 // defined in the instructions definitions. | |
12682 // | |
12683 // peepmatch ( root_instr_name [preceeding_instruction]* ); | |
12684 // | |
12685 // peepconstraint %{ | |
12686 // (instruction_number.operand_name relational_op instruction_number.operand_name | |
12687 // [, ...] ); | |
12688 // // instruction numbers are zero-based using left to right order in peepmatch | |
12689 // | |
12690 // peepreplace ( instr_name ( [instruction_number.operand_name]* ) ); | |
12691 // // provide an instruction_number.operand_name for each operand that appears | |
12692 // // in the replacement instruction's match rule | |
12693 // | |
12694 // ---------VM FLAGS--------------------------------------------------------- | |
12695 // | |
12696 // All peephole optimizations can be turned off using -XX:-OptoPeephole | |
12697 // | |
12698 // Each peephole rule is given an identifying number starting with zero and | |
12699 // increasing by one in the order seen by the parser. An individual peephole | |
12700 // can be enabled, and all others disabled, by using -XX:OptoPeepholeAt=# | |
12701 // on the command-line. | |
12702 // | |
12703 // ---------CURRENT LIMITATIONS---------------------------------------------- | |
12704 // | |
12705 // Only match adjacent instructions in same basic block | |
12706 // Only equality constraints | |
12707 // Only constraints between operands, not (0.dest_reg == EAX_enc) | |
12708 // Only one replacement instruction | |
12709 // | |
12710 // ---------EXAMPLE---------------------------------------------------------- | |
12711 // | |
12712 // // pertinent parts of existing instructions in architecture description | |
12713 // instruct movI(eRegI dst, eRegI src) %{ | |
12714 // match(Set dst (CopyI src)); | |
12715 // %} | |
12716 // | |
12717 // instruct incI_eReg(eRegI dst, immI1 src, eFlagsReg cr) %{ | |
12718 // match(Set dst (AddI dst src)); | |
12719 // effect(KILL cr); | |
12720 // %} | |
12721 // | |
12722 // // Change (inc mov) to lea | |
12723 // peephole %{ | |
12724 // // increment preceeded by register-register move | |
12725 // peepmatch ( incI_eReg movI ); | |
12726 // // require that the destination register of the increment | |
12727 // // match the destination register of the move | |
12728 // peepconstraint ( 0.dst == 1.dst ); | |
12729 // // construct a replacement instruction that sets | |
12730 // // the destination to ( move's source register + one ) | |
12731 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
12732 // %} | |
12733 // | |
12734 // Implementation no longer uses movX instructions since | |
12735 // machine-independent system no longer uses CopyX nodes. | |
12736 // | |
12737 // peephole %{ | |
12738 // peepmatch ( incI_eReg movI ); | |
12739 // peepconstraint ( 0.dst == 1.dst ); | |
12740 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
12741 // %} | |
12742 // | |
12743 // peephole %{ | |
12744 // peepmatch ( decI_eReg movI ); | |
12745 // peepconstraint ( 0.dst == 1.dst ); | |
12746 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
12747 // %} | |
12748 // | |
12749 // peephole %{ | |
12750 // peepmatch ( addI_eReg_imm movI ); | |
12751 // peepconstraint ( 0.dst == 1.dst ); | |
12752 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
12753 // %} | |
12754 // | |
12755 // peephole %{ | |
12756 // peepmatch ( addP_eReg_imm movP ); | |
12757 // peepconstraint ( 0.dst == 1.dst ); | |
12758 // peepreplace ( leaP_eReg_immI( 0.dst 1.src 0.src ) ); | |
12759 // %} | |
12760 | |
12761 // // Change load of spilled value to only a spill | |
12762 // instruct storeI(memory mem, eRegI src) %{ | |
12763 // match(Set mem (StoreI mem src)); | |
12764 // %} | |
12765 // | |
12766 // instruct loadI(eRegI dst, memory mem) %{ | |
12767 // match(Set dst (LoadI mem)); | |
12768 // %} | |
12769 // | |
12770 peephole %{ | |
12771 peepmatch ( loadI storeI ); | |
12772 peepconstraint ( 1.src == 0.dst, 1.mem == 0.mem ); | |
12773 peepreplace ( storeI( 1.mem 1.mem 1.src ) ); | |
12774 %} | |
12775 | |
12776 //----------SMARTSPILL RULES--------------------------------------------------- | |
12777 // These must follow all instruction definitions as they use the names | |
12778 // defined in the instructions definitions. |