Mercurial > hg > graal-compiler
annotate src/share/vm/c1/c1_GraphBuilder.cpp @ 935:05f89f00a864
6798898: CMS: bugs related to class unloading
Summary: Override should_remember_klasses() and remember_klass() as needed.
Reviewed-by: ysr, jcoomes
author | jmasa |
---|---|
date | Mon, 24 Aug 2009 10:36:31 -0700 |
parents | bd02caa94611 |
children | 148e5441d916 |
rev | line source |
---|---|
0 | 1 /* |
844 | 2 * Copyright 1999-2009 Sun Microsystems, Inc. All Rights Reserved. |
0 | 3 * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. |
4 * | |
5 * This code is free software; you can redistribute it and/or modify it | |
6 * under the terms of the GNU General Public License version 2 only, as | |
7 * published by the Free Software Foundation. | |
8 * | |
9 * This code is distributed in the hope that it will be useful, but WITHOUT | |
10 * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
11 * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
12 * version 2 for more details (a copy is included in the LICENSE file that | |
13 * accompanied this code). | |
14 * | |
15 * You should have received a copy of the GNU General Public License version | |
16 * 2 along with this work; if not, write to the Free Software Foundation, | |
17 * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. | |
18 * | |
19 * Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara, | |
20 * CA 95054 USA or visit www.sun.com if you need additional information or | |
21 * have any questions. | |
22 * | |
23 */ | |
24 | |
25 #include "incls/_precompiled.incl" | |
26 #include "incls/_c1_GraphBuilder.cpp.incl" | |
27 | |
28 class BlockListBuilder VALUE_OBJ_CLASS_SPEC { | |
29 private: | |
30 Compilation* _compilation; | |
31 IRScope* _scope; | |
32 | |
33 BlockList _blocks; // internal list of all blocks | |
34 BlockList* _bci2block; // mapping from bci to blocks for GraphBuilder | |
35 | |
36 // fields used by mark_loops | |
37 BitMap _active; // for iteration of control flow graph | |
38 BitMap _visited; // for iteration of control flow graph | |
39 intArray _loop_map; // caches the information if a block is contained in a loop | |
40 int _next_loop_index; // next free loop number | |
41 int _next_block_number; // for reverse postorder numbering of blocks | |
42 | |
43 // accessors | |
44 Compilation* compilation() const { return _compilation; } | |
45 IRScope* scope() const { return _scope; } | |
46 ciMethod* method() const { return scope()->method(); } | |
47 XHandlers* xhandlers() const { return scope()->xhandlers(); } | |
48 | |
49 // unified bailout support | |
50 void bailout(const char* msg) const { compilation()->bailout(msg); } | |
51 bool bailed_out() const { return compilation()->bailed_out(); } | |
52 | |
53 // helper functions | |
54 BlockBegin* make_block_at(int bci, BlockBegin* predecessor); | |
55 void handle_exceptions(BlockBegin* current, int cur_bci); | |
56 void handle_jsr(BlockBegin* current, int sr_bci, int next_bci); | |
57 void store_one(BlockBegin* current, int local); | |
58 void store_two(BlockBegin* current, int local); | |
59 void set_entries(int osr_bci); | |
60 void set_leaders(); | |
61 | |
62 void make_loop_header(BlockBegin* block); | |
63 void mark_loops(); | |
64 int mark_loops(BlockBegin* b, bool in_subroutine); | |
65 | |
66 // debugging | |
67 #ifndef PRODUCT | |
68 void print(); | |
69 #endif | |
70 | |
71 public: | |
72 // creation | |
73 BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci); | |
74 | |
75 // accessors for GraphBuilder | |
76 BlockList* bci2block() const { return _bci2block; } | |
77 }; | |
78 | |
79 | |
80 // Implementation of BlockListBuilder | |
81 | |
82 BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci) | |
83 : _compilation(compilation) | |
84 , _scope(scope) | |
85 , _blocks(16) | |
86 , _bci2block(new BlockList(scope->method()->code_size(), NULL)) | |
87 , _next_block_number(0) | |
88 , _active() // size not known yet | |
89 , _visited() // size not known yet | |
90 , _next_loop_index(0) | |
91 , _loop_map() // size not known yet | |
92 { | |
93 set_entries(osr_bci); | |
94 set_leaders(); | |
95 CHECK_BAILOUT(); | |
96 | |
97 mark_loops(); | |
98 NOT_PRODUCT(if (PrintInitialBlockList) print()); | |
99 | |
100 #ifndef PRODUCT | |
101 if (PrintCFGToFile) { | |
102 stringStream title; | |
103 title.print("BlockListBuilder "); | |
104 scope->method()->print_name(&title); | |
105 CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false); | |
106 } | |
107 #endif | |
108 } | |
109 | |
110 | |
111 void BlockListBuilder::set_entries(int osr_bci) { | |
112 // generate start blocks | |
113 BlockBegin* std_entry = make_block_at(0, NULL); | |
114 if (scope()->caller() == NULL) { | |
115 std_entry->set(BlockBegin::std_entry_flag); | |
116 } | |
117 if (osr_bci != -1) { | |
118 BlockBegin* osr_entry = make_block_at(osr_bci, NULL); | |
119 osr_entry->set(BlockBegin::osr_entry_flag); | |
120 } | |
121 | |
122 // generate exception entry blocks | |
123 XHandlers* list = xhandlers(); | |
124 const int n = list->length(); | |
125 for (int i = 0; i < n; i++) { | |
126 XHandler* h = list->handler_at(i); | |
127 BlockBegin* entry = make_block_at(h->handler_bci(), NULL); | |
128 entry->set(BlockBegin::exception_entry_flag); | |
129 h->set_entry_block(entry); | |
130 } | |
131 } | |
132 | |
133 | |
134 BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) { | |
135 assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer"); | |
136 | |
137 BlockBegin* block = _bci2block->at(cur_bci); | |
138 if (block == NULL) { | |
139 block = new BlockBegin(cur_bci); | |
140 block->init_stores_to_locals(method()->max_locals()); | |
141 _bci2block->at_put(cur_bci, block); | |
142 _blocks.append(block); | |
143 | |
144 assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist"); | |
145 } | |
146 | |
147 if (predecessor != NULL) { | |
148 if (block->is_set(BlockBegin::exception_entry_flag)) { | |
149 BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block); | |
150 } | |
151 | |
152 predecessor->add_successor(block); | |
153 block->increment_total_preds(); | |
154 } | |
155 | |
156 return block; | |
157 } | |
158 | |
159 | |
160 inline void BlockListBuilder::store_one(BlockBegin* current, int local) { | |
161 current->stores_to_locals().set_bit(local); | |
162 } | |
163 inline void BlockListBuilder::store_two(BlockBegin* current, int local) { | |
164 store_one(current, local); | |
165 store_one(current, local + 1); | |
166 } | |
167 | |
168 | |
169 void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) { | |
170 // Draws edges from a block to its exception handlers | |
171 XHandlers* list = xhandlers(); | |
172 const int n = list->length(); | |
173 | |
174 for (int i = 0; i < n; i++) { | |
175 XHandler* h = list->handler_at(i); | |
176 | |
177 if (h->covers(cur_bci)) { | |
178 BlockBegin* entry = h->entry_block(); | |
179 assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set"); | |
180 assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set"); | |
181 | |
182 // add each exception handler only once | |
183 if (!current->is_successor(entry)) { | |
184 current->add_successor(entry); | |
185 entry->increment_total_preds(); | |
186 } | |
187 | |
188 // stop when reaching catchall | |
189 if (h->catch_type() == 0) break; | |
190 } | |
191 } | |
192 } | |
193 | |
194 void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) { | |
195 // start a new block after jsr-bytecode and link this block into cfg | |
196 make_block_at(next_bci, current); | |
197 | |
198 // start a new block at the subroutine entry at mark it with special flag | |
199 BlockBegin* sr_block = make_block_at(sr_bci, current); | |
200 if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) { | |
201 sr_block->set(BlockBegin::subroutine_entry_flag); | |
202 } | |
203 } | |
204 | |
205 | |
206 void BlockListBuilder::set_leaders() { | |
207 bool has_xhandlers = xhandlers()->has_handlers(); | |
208 BlockBegin* current = NULL; | |
209 | |
210 // The information which bci starts a new block simplifies the analysis | |
211 // Without it, backward branches could jump to a bci where no block was created | |
212 // during bytecode iteration. This would require the creation of a new block at the | |
213 // branch target and a modification of the successor lists. | |
214 BitMap bci_block_start = method()->bci_block_start(); | |
215 | |
216 ciBytecodeStream s(method()); | |
217 while (s.next() != ciBytecodeStream::EOBC()) { | |
218 int cur_bci = s.cur_bci(); | |
219 | |
220 if (bci_block_start.at(cur_bci)) { | |
221 current = make_block_at(cur_bci, current); | |
222 } | |
223 assert(current != NULL, "must have current block"); | |
224 | |
225 if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) { | |
226 handle_exceptions(current, cur_bci); | |
227 } | |
228 | |
229 switch (s.cur_bc()) { | |
230 // track stores to local variables for selective creation of phi functions | |
231 case Bytecodes::_iinc: store_one(current, s.get_index()); break; | |
232 case Bytecodes::_istore: store_one(current, s.get_index()); break; | |
233 case Bytecodes::_lstore: store_two(current, s.get_index()); break; | |
234 case Bytecodes::_fstore: store_one(current, s.get_index()); break; | |
235 case Bytecodes::_dstore: store_two(current, s.get_index()); break; | |
236 case Bytecodes::_astore: store_one(current, s.get_index()); break; | |
237 case Bytecodes::_istore_0: store_one(current, 0); break; | |
238 case Bytecodes::_istore_1: store_one(current, 1); break; | |
239 case Bytecodes::_istore_2: store_one(current, 2); break; | |
240 case Bytecodes::_istore_3: store_one(current, 3); break; | |
241 case Bytecodes::_lstore_0: store_two(current, 0); break; | |
242 case Bytecodes::_lstore_1: store_two(current, 1); break; | |
243 case Bytecodes::_lstore_2: store_two(current, 2); break; | |
244 case Bytecodes::_lstore_3: store_two(current, 3); break; | |
245 case Bytecodes::_fstore_0: store_one(current, 0); break; | |
246 case Bytecodes::_fstore_1: store_one(current, 1); break; | |
247 case Bytecodes::_fstore_2: store_one(current, 2); break; | |
248 case Bytecodes::_fstore_3: store_one(current, 3); break; | |
249 case Bytecodes::_dstore_0: store_two(current, 0); break; | |
250 case Bytecodes::_dstore_1: store_two(current, 1); break; | |
251 case Bytecodes::_dstore_2: store_two(current, 2); break; | |
252 case Bytecodes::_dstore_3: store_two(current, 3); break; | |
253 case Bytecodes::_astore_0: store_one(current, 0); break; | |
254 case Bytecodes::_astore_1: store_one(current, 1); break; | |
255 case Bytecodes::_astore_2: store_one(current, 2); break; | |
256 case Bytecodes::_astore_3: store_one(current, 3); break; | |
257 | |
258 // track bytecodes that affect the control flow | |
259 case Bytecodes::_athrow: // fall through | |
260 case Bytecodes::_ret: // fall through | |
261 case Bytecodes::_ireturn: // fall through | |
262 case Bytecodes::_lreturn: // fall through | |
263 case Bytecodes::_freturn: // fall through | |
264 case Bytecodes::_dreturn: // fall through | |
265 case Bytecodes::_areturn: // fall through | |
266 case Bytecodes::_return: | |
267 current = NULL; | |
268 break; | |
269 | |
270 case Bytecodes::_ifeq: // fall through | |
271 case Bytecodes::_ifne: // fall through | |
272 case Bytecodes::_iflt: // fall through | |
273 case Bytecodes::_ifge: // fall through | |
274 case Bytecodes::_ifgt: // fall through | |
275 case Bytecodes::_ifle: // fall through | |
276 case Bytecodes::_if_icmpeq: // fall through | |
277 case Bytecodes::_if_icmpne: // fall through | |
278 case Bytecodes::_if_icmplt: // fall through | |
279 case Bytecodes::_if_icmpge: // fall through | |
280 case Bytecodes::_if_icmpgt: // fall through | |
281 case Bytecodes::_if_icmple: // fall through | |
282 case Bytecodes::_if_acmpeq: // fall through | |
283 case Bytecodes::_if_acmpne: // fall through | |
284 case Bytecodes::_ifnull: // fall through | |
285 case Bytecodes::_ifnonnull: | |
286 make_block_at(s.next_bci(), current); | |
287 make_block_at(s.get_dest(), current); | |
288 current = NULL; | |
289 break; | |
290 | |
291 case Bytecodes::_goto: | |
292 make_block_at(s.get_dest(), current); | |
293 current = NULL; | |
294 break; | |
295 | |
296 case Bytecodes::_goto_w: | |
297 make_block_at(s.get_far_dest(), current); | |
298 current = NULL; | |
299 break; | |
300 | |
301 case Bytecodes::_jsr: | |
302 handle_jsr(current, s.get_dest(), s.next_bci()); | |
303 current = NULL; | |
304 break; | |
305 | |
306 case Bytecodes::_jsr_w: | |
307 handle_jsr(current, s.get_far_dest(), s.next_bci()); | |
308 current = NULL; | |
309 break; | |
310 | |
311 case Bytecodes::_tableswitch: { | |
312 // set block for each case | |
313 Bytecode_tableswitch *switch_ = Bytecode_tableswitch_at(s.cur_bcp()); | |
314 int l = switch_->length(); | |
315 for (int i = 0; i < l; i++) { | |
316 make_block_at(cur_bci + switch_->dest_offset_at(i), current); | |
317 } | |
318 make_block_at(cur_bci + switch_->default_offset(), current); | |
319 current = NULL; | |
320 break; | |
321 } | |
322 | |
323 case Bytecodes::_lookupswitch: { | |
324 // set block for each case | |
325 Bytecode_lookupswitch *switch_ = Bytecode_lookupswitch_at(s.cur_bcp()); | |
326 int l = switch_->number_of_pairs(); | |
327 for (int i = 0; i < l; i++) { | |
328 make_block_at(cur_bci + switch_->pair_at(i)->offset(), current); | |
329 } | |
330 make_block_at(cur_bci + switch_->default_offset(), current); | |
331 current = NULL; | |
332 break; | |
333 } | |
334 } | |
335 } | |
336 } | |
337 | |
338 | |
339 void BlockListBuilder::mark_loops() { | |
340 ResourceMark rm; | |
341 | |
342 _active = BitMap(BlockBegin::number_of_blocks()); _active.clear(); | |
343 _visited = BitMap(BlockBegin::number_of_blocks()); _visited.clear(); | |
344 _loop_map = intArray(BlockBegin::number_of_blocks(), 0); | |
345 _next_loop_index = 0; | |
346 _next_block_number = _blocks.length(); | |
347 | |
348 // recursively iterate the control flow graph | |
349 mark_loops(_bci2block->at(0), false); | |
350 assert(_next_block_number >= 0, "invalid block numbers"); | |
351 } | |
352 | |
353 void BlockListBuilder::make_loop_header(BlockBegin* block) { | |
354 if (block->is_set(BlockBegin::exception_entry_flag)) { | |
355 // exception edges may look like loops but don't mark them as such | |
356 // since it screws up block ordering. | |
357 return; | |
358 } | |
359 if (!block->is_set(BlockBegin::parser_loop_header_flag)) { | |
360 block->set(BlockBegin::parser_loop_header_flag); | |
361 | |
362 assert(_loop_map.at(block->block_id()) == 0, "must not be set yet"); | |
363 assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer"); | |
364 _loop_map.at_put(block->block_id(), 1 << _next_loop_index); | |
365 if (_next_loop_index < 31) _next_loop_index++; | |
366 } else { | |
367 // block already marked as loop header | |
368 assert(is_power_of_2(_loop_map.at(block->block_id())), "exactly one bit must be set"); | |
369 } | |
370 } | |
371 | |
372 int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) { | |
373 int block_id = block->block_id(); | |
374 | |
375 if (_visited.at(block_id)) { | |
376 if (_active.at(block_id)) { | |
377 // reached block via backward branch | |
378 make_loop_header(block); | |
379 } | |
380 // return cached loop information for this block | |
381 return _loop_map.at(block_id); | |
382 } | |
383 | |
384 if (block->is_set(BlockBegin::subroutine_entry_flag)) { | |
385 in_subroutine = true; | |
386 } | |
387 | |
388 // set active and visited bits before successors are processed | |
389 _visited.set_bit(block_id); | |
390 _active.set_bit(block_id); | |
391 | |
392 intptr_t loop_state = 0; | |
393 for (int i = block->number_of_sux() - 1; i >= 0; i--) { | |
394 // recursively process all successors | |
395 loop_state |= mark_loops(block->sux_at(i), in_subroutine); | |
396 } | |
397 | |
398 // clear active-bit after all successors are processed | |
399 _active.clear_bit(block_id); | |
400 | |
401 // reverse-post-order numbering of all blocks | |
402 block->set_depth_first_number(_next_block_number); | |
403 _next_block_number--; | |
404 | |
405 if (loop_state != 0 || in_subroutine ) { | |
406 // block is contained at least in one loop, so phi functions are necessary | |
407 // phi functions are also necessary for all locals stored in a subroutine | |
408 scope()->requires_phi_function().set_union(block->stores_to_locals()); | |
409 } | |
410 | |
411 if (block->is_set(BlockBegin::parser_loop_header_flag)) { | |
412 int header_loop_state = _loop_map.at(block_id); | |
413 assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set"); | |
414 | |
415 // If the highest bit is set (i.e. when integer value is negative), the method | |
416 // has 32 or more loops. This bit is never cleared because it is used for multiple loops | |
417 if (header_loop_state >= 0) { | |
418 clear_bits(loop_state, header_loop_state); | |
419 } | |
420 } | |
421 | |
422 // cache and return loop information for this block | |
423 _loop_map.at_put(block_id, loop_state); | |
424 return loop_state; | |
425 } | |
426 | |
427 | |
428 #ifndef PRODUCT | |
429 | |
430 int compare_depth_first(BlockBegin** a, BlockBegin** b) { | |
431 return (*a)->depth_first_number() - (*b)->depth_first_number(); | |
432 } | |
433 | |
434 void BlockListBuilder::print() { | |
435 tty->print("----- initial block list of BlockListBuilder for method "); | |
436 method()->print_short_name(); | |
437 tty->cr(); | |
438 | |
439 // better readability if blocks are sorted in processing order | |
440 _blocks.sort(compare_depth_first); | |
441 | |
442 for (int i = 0; i < _blocks.length(); i++) { | |
443 BlockBegin* cur = _blocks.at(i); | |
444 tty->print("%4d: B%-4d bci: %-4d preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds()); | |
445 | |
446 tty->print(cur->is_set(BlockBegin::std_entry_flag) ? " std" : " "); | |
447 tty->print(cur->is_set(BlockBegin::osr_entry_flag) ? " osr" : " "); | |
448 tty->print(cur->is_set(BlockBegin::exception_entry_flag) ? " ex" : " "); | |
449 tty->print(cur->is_set(BlockBegin::subroutine_entry_flag) ? " sr" : " "); | |
450 tty->print(cur->is_set(BlockBegin::parser_loop_header_flag) ? " lh" : " "); | |
451 | |
452 if (cur->number_of_sux() > 0) { | |
453 tty->print(" sux: "); | |
454 for (int j = 0; j < cur->number_of_sux(); j++) { | |
455 BlockBegin* sux = cur->sux_at(j); | |
456 tty->print("B%d ", sux->block_id()); | |
457 } | |
458 } | |
459 tty->cr(); | |
460 } | |
461 } | |
462 | |
463 #endif | |
464 | |
465 | |
466 // A simple growable array of Values indexed by ciFields | |
467 class FieldBuffer: public CompilationResourceObj { | |
468 private: | |
469 GrowableArray<Value> _values; | |
470 | |
471 public: | |
472 FieldBuffer() {} | |
473 | |
474 void kill() { | |
475 _values.trunc_to(0); | |
476 } | |
477 | |
478 Value at(ciField* field) { | |
479 assert(field->holder()->is_loaded(), "must be a loaded field"); | |
480 int offset = field->offset(); | |
481 if (offset < _values.length()) { | |
482 return _values.at(offset); | |
483 } else { | |
484 return NULL; | |
485 } | |
486 } | |
487 | |
488 void at_put(ciField* field, Value value) { | |
489 assert(field->holder()->is_loaded(), "must be a loaded field"); | |
490 int offset = field->offset(); | |
491 _values.at_put_grow(offset, value, NULL); | |
492 } | |
493 | |
494 }; | |
495 | |
496 | |
497 // MemoryBuffer is fairly simple model of the current state of memory. | |
498 // It partitions memory into several pieces. The first piece is | |
499 // generic memory where little is known about the owner of the memory. | |
500 // This is conceptually represented by the tuple <O, F, V> which says | |
501 // that the field F of object O has value V. This is flattened so | |
502 // that F is represented by the offset of the field and the parallel | |
503 // arrays _objects and _values are used for O and V. Loads of O.F can | |
504 // simply use V. Newly allocated objects are kept in a separate list | |
505 // along with a parallel array for each object which represents the | |
506 // current value of its fields. Stores of the default value to fields | |
507 // which have never been stored to before are eliminated since they | |
508 // are redundant. Once newly allocated objects are stored into | |
509 // another object or they are passed out of the current compile they | |
510 // are treated like generic memory. | |
511 | |
512 class MemoryBuffer: public CompilationResourceObj { | |
513 private: | |
514 FieldBuffer _values; | |
515 GrowableArray<Value> _objects; | |
516 GrowableArray<Value> _newobjects; | |
517 GrowableArray<FieldBuffer*> _fields; | |
518 | |
519 public: | |
520 MemoryBuffer() {} | |
521 | |
522 StoreField* store(StoreField* st) { | |
523 if (!EliminateFieldAccess) { | |
524 return st; | |
525 } | |
526 | |
527 Value object = st->obj(); | |
528 Value value = st->value(); | |
529 ciField* field = st->field(); | |
530 if (field->holder()->is_loaded()) { | |
531 int offset = field->offset(); | |
532 int index = _newobjects.find(object); | |
533 if (index != -1) { | |
534 // newly allocated object with no other stores performed on this field | |
535 FieldBuffer* buf = _fields.at(index); | |
536 if (buf->at(field) == NULL && is_default_value(value)) { | |
537 #ifndef PRODUCT | |
538 if (PrintIRDuringConstruction && Verbose) { | |
539 tty->print_cr("Eliminated store for object %d:", index); | |
540 st->print_line(); | |
541 } | |
542 #endif | |
543 return NULL; | |
544 } else { | |
545 buf->at_put(field, value); | |
546 } | |
547 } else { | |
548 _objects.at_put_grow(offset, object, NULL); | |
549 _values.at_put(field, value); | |
550 } | |
551 | |
552 store_value(value); | |
553 } else { | |
554 // if we held onto field names we could alias based on names but | |
555 // we don't know what's being stored to so kill it all. | |
556 kill(); | |
557 } | |
558 return st; | |
559 } | |
560 | |
561 | |
562 // return true if this value correspond to the default value of a field. | |
563 bool is_default_value(Value value) { | |
564 Constant* con = value->as_Constant(); | |
565 if (con) { | |
566 switch (con->type()->tag()) { | |
567 case intTag: return con->type()->as_IntConstant()->value() == 0; | |
568 case longTag: return con->type()->as_LongConstant()->value() == 0; | |
569 case floatTag: return jint_cast(con->type()->as_FloatConstant()->value()) == 0; | |
570 case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0); | |
571 case objectTag: return con->type() == objectNull; | |
572 default: ShouldNotReachHere(); | |
573 } | |
574 } | |
575 return false; | |
576 } | |
577 | |
578 | |
579 // return either the actual value of a load or the load itself | |
580 Value load(LoadField* load) { | |
581 if (!EliminateFieldAccess) { | |
582 return load; | |
583 } | |
584 | |
585 if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) { | |
586 // can't skip load since value might get rounded as a side effect | |
587 return load; | |
588 } | |
589 | |
590 ciField* field = load->field(); | |
591 Value object = load->obj(); | |
592 if (field->holder()->is_loaded() && !field->is_volatile()) { | |
593 int offset = field->offset(); | |
594 Value result = NULL; | |
595 int index = _newobjects.find(object); | |
596 if (index != -1) { | |
597 result = _fields.at(index)->at(field); | |
598 } else if (_objects.at_grow(offset, NULL) == object) { | |
599 result = _values.at(field); | |
600 } | |
601 if (result != NULL) { | |
602 #ifndef PRODUCT | |
603 if (PrintIRDuringConstruction && Verbose) { | |
604 tty->print_cr("Eliminated load: "); | |
605 load->print_line(); | |
606 } | |
607 #endif | |
608 assert(result->type()->tag() == load->type()->tag(), "wrong types"); | |
609 return result; | |
610 } | |
611 } | |
612 return load; | |
613 } | |
614 | |
615 // Record this newly allocated object | |
616 void new_instance(NewInstance* object) { | |
617 int index = _newobjects.length(); | |
618 _newobjects.append(object); | |
619 if (_fields.at_grow(index, NULL) == NULL) { | |
620 _fields.at_put(index, new FieldBuffer()); | |
621 } else { | |
622 _fields.at(index)->kill(); | |
623 } | |
624 } | |
625 | |
626 void store_value(Value value) { | |
627 int index = _newobjects.find(value); | |
628 if (index != -1) { | |
629 // stored a newly allocated object into another object. | |
630 // Assume we've lost track of it as separate slice of memory. | |
631 // We could do better by keeping track of whether individual | |
632 // fields could alias each other. | |
633 _newobjects.remove_at(index); | |
634 // pull out the field info and store it at the end up the list | |
635 // of field info list to be reused later. | |
636 _fields.append(_fields.at(index)); | |
637 _fields.remove_at(index); | |
638 } | |
639 } | |
640 | |
641 void kill() { | |
642 _newobjects.trunc_to(0); | |
643 _objects.trunc_to(0); | |
644 _values.kill(); | |
645 } | |
646 }; | |
647 | |
648 | |
649 // Implementation of GraphBuilder's ScopeData | |
650 | |
651 GraphBuilder::ScopeData::ScopeData(ScopeData* parent) | |
652 : _parent(parent) | |
653 , _bci2block(NULL) | |
654 , _scope(NULL) | |
655 , _has_handler(false) | |
656 , _stream(NULL) | |
657 , _work_list(NULL) | |
658 , _parsing_jsr(false) | |
659 , _jsr_xhandlers(NULL) | |
660 , _caller_stack_size(-1) | |
661 , _continuation(NULL) | |
662 , _continuation_state(NULL) | |
663 , _num_returns(0) | |
664 , _cleanup_block(NULL) | |
665 , _cleanup_return_prev(NULL) | |
666 , _cleanup_state(NULL) | |
667 { | |
668 if (parent != NULL) { | |
669 _max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f); | |
670 } else { | |
671 _max_inline_size = MaxInlineSize; | |
672 } | |
673 if (_max_inline_size < MaxTrivialSize) { | |
674 _max_inline_size = MaxTrivialSize; | |
675 } | |
676 } | |
677 | |
678 | |
679 void GraphBuilder::kill_all() { | |
680 if (UseLocalValueNumbering) { | |
681 vmap()->kill_all(); | |
682 } | |
683 _memory->kill(); | |
684 } | |
685 | |
686 | |
687 BlockBegin* GraphBuilder::ScopeData::block_at(int bci) { | |
688 if (parsing_jsr()) { | |
689 // It is necessary to clone all blocks associated with a | |
690 // subroutine, including those for exception handlers in the scope | |
691 // of the method containing the jsr (because those exception | |
692 // handlers may contain ret instructions in some cases). | |
693 BlockBegin* block = bci2block()->at(bci); | |
694 if (block != NULL && block == parent()->bci2block()->at(bci)) { | |
695 BlockBegin* new_block = new BlockBegin(block->bci()); | |
696 #ifndef PRODUCT | |
697 if (PrintInitialBlockList) { | |
698 tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr", | |
699 block->block_id(), block->bci(), new_block->block_id()); | |
700 } | |
701 #endif | |
702 // copy data from cloned blocked | |
703 new_block->set_depth_first_number(block->depth_first_number()); | |
704 if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag); | |
705 // Preserve certain flags for assertion checking | |
706 if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag); | |
707 if (block->is_set(BlockBegin::exception_entry_flag)) new_block->set(BlockBegin::exception_entry_flag); | |
708 | |
709 // copy was_visited_flag to allow early detection of bailouts | |
710 // if a block that is used in a jsr has already been visited before, | |
711 // it is shared between the normal control flow and a subroutine | |
712 // BlockBegin::try_merge returns false when the flag is set, this leads | |
713 // to a compilation bailout | |
714 if (block->is_set(BlockBegin::was_visited_flag)) new_block->set(BlockBegin::was_visited_flag); | |
715 | |
716 bci2block()->at_put(bci, new_block); | |
717 block = new_block; | |
718 } | |
719 return block; | |
720 } else { | |
721 return bci2block()->at(bci); | |
722 } | |
723 } | |
724 | |
725 | |
726 XHandlers* GraphBuilder::ScopeData::xhandlers() const { | |
727 if (_jsr_xhandlers == NULL) { | |
728 assert(!parsing_jsr(), ""); | |
729 return scope()->xhandlers(); | |
730 } | |
731 assert(parsing_jsr(), ""); | |
732 return _jsr_xhandlers; | |
733 } | |
734 | |
735 | |
736 void GraphBuilder::ScopeData::set_scope(IRScope* scope) { | |
737 _scope = scope; | |
738 bool parent_has_handler = false; | |
739 if (parent() != NULL) { | |
740 parent_has_handler = parent()->has_handler(); | |
741 } | |
742 _has_handler = parent_has_handler || scope->xhandlers()->has_handlers(); | |
743 } | |
744 | |
745 | |
746 void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block, | |
747 Instruction* return_prev, | |
748 ValueStack* return_state) { | |
749 _cleanup_block = block; | |
750 _cleanup_return_prev = return_prev; | |
751 _cleanup_state = return_state; | |
752 } | |
753 | |
754 | |
755 void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) { | |
756 if (_work_list == NULL) { | |
757 _work_list = new BlockList(); | |
758 } | |
759 | |
760 if (!block->is_set(BlockBegin::is_on_work_list_flag)) { | |
761 // Do not start parsing the continuation block while in a | |
762 // sub-scope | |
763 if (parsing_jsr()) { | |
764 if (block == jsr_continuation()) { | |
765 return; | |
766 } | |
767 } else { | |
768 if (block == continuation()) { | |
769 return; | |
770 } | |
771 } | |
772 block->set(BlockBegin::is_on_work_list_flag); | |
773 _work_list->push(block); | |
774 | |
775 sort_top_into_worklist(_work_list, block); | |
776 } | |
777 } | |
778 | |
779 | |
780 void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) { | |
781 assert(worklist->top() == top, ""); | |
782 // sort block descending into work list | |
783 const int dfn = top->depth_first_number(); | |
784 assert(dfn != -1, "unknown depth first number"); | |
785 int i = worklist->length()-2; | |
786 while (i >= 0) { | |
787 BlockBegin* b = worklist->at(i); | |
788 if (b->depth_first_number() < dfn) { | |
789 worklist->at_put(i+1, b); | |
790 } else { | |
791 break; | |
792 } | |
793 i --; | |
794 } | |
795 if (i >= -1) worklist->at_put(i + 1, top); | |
796 } | |
797 | |
798 int GraphBuilder::ScopeData::caller_stack_size() const { | |
799 ValueStack* state = scope()->caller_state(); | |
800 if (state == NULL) { | |
801 return 0; | |
802 } | |
803 return state->stack_size(); | |
804 } | |
805 | |
806 | |
807 BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() { | |
808 if (is_work_list_empty()) { | |
809 return NULL; | |
810 } | |
811 return _work_list->pop(); | |
812 } | |
813 | |
814 | |
815 bool GraphBuilder::ScopeData::is_work_list_empty() const { | |
816 return (_work_list == NULL || _work_list->length() == 0); | |
817 } | |
818 | |
819 | |
820 void GraphBuilder::ScopeData::setup_jsr_xhandlers() { | |
821 assert(parsing_jsr(), ""); | |
822 // clone all the exception handlers from the scope | |
823 XHandlers* handlers = new XHandlers(scope()->xhandlers()); | |
824 const int n = handlers->length(); | |
825 for (int i = 0; i < n; i++) { | |
826 // The XHandlers need to be adjusted to dispatch to the cloned | |
827 // handler block instead of the default one but the synthetic | |
828 // unlocker needs to be handled specially. The synthetic unlocker | |
829 // should be left alone since there can be only one and all code | |
830 // should dispatch to the same one. | |
831 XHandler* h = handlers->handler_at(i); | |
832 if (h->handler_bci() != SynchronizationEntryBCI) { | |
833 h->set_entry_block(block_at(h->handler_bci())); | |
834 } else { | |
835 assert(h->entry_block()->is_set(BlockBegin::default_exception_handler_flag), | |
836 "should be the synthetic unlock block"); | |
837 } | |
838 } | |
839 _jsr_xhandlers = handlers; | |
840 } | |
841 | |
842 | |
843 int GraphBuilder::ScopeData::num_returns() { | |
844 if (parsing_jsr()) { | |
845 return parent()->num_returns(); | |
846 } | |
847 return _num_returns; | |
848 } | |
849 | |
850 | |
851 void GraphBuilder::ScopeData::incr_num_returns() { | |
852 if (parsing_jsr()) { | |
853 parent()->incr_num_returns(); | |
854 } else { | |
855 ++_num_returns; | |
856 } | |
857 } | |
858 | |
859 | |
860 // Implementation of GraphBuilder | |
861 | |
862 #define INLINE_BAILOUT(msg) { inline_bailout(msg); return false; } | |
863 | |
864 | |
865 void GraphBuilder::load_constant() { | |
866 ciConstant con = stream()->get_constant(); | |
867 if (con.basic_type() == T_ILLEGAL) { | |
868 BAILOUT("could not resolve a constant"); | |
869 } else { | |
870 ValueType* t = illegalType; | |
871 ValueStack* patch_state = NULL; | |
872 switch (con.basic_type()) { | |
873 case T_BOOLEAN: t = new IntConstant (con.as_boolean()); break; | |
874 case T_BYTE : t = new IntConstant (con.as_byte ()); break; | |
875 case T_CHAR : t = new IntConstant (con.as_char ()); break; | |
876 case T_SHORT : t = new IntConstant (con.as_short ()); break; | |
877 case T_INT : t = new IntConstant (con.as_int ()); break; | |
878 case T_LONG : t = new LongConstant (con.as_long ()); break; | |
879 case T_FLOAT : t = new FloatConstant (con.as_float ()); break; | |
880 case T_DOUBLE : t = new DoubleConstant (con.as_double ()); break; | |
881 case T_ARRAY : t = new ArrayConstant (con.as_object ()->as_array ()); break; | |
882 case T_OBJECT : | |
883 { | |
884 ciObject* obj = con.as_object(); | |
885 if (obj->is_klass()) { | |
886 ciKlass* klass = obj->as_klass(); | |
887 if (!klass->is_loaded() || PatchALot) { | |
888 patch_state = state()->copy(); | |
889 t = new ObjectConstant(obj); | |
890 } else { | |
891 t = new InstanceConstant(klass->java_mirror()); | |
892 } | |
893 } else { | |
894 t = new InstanceConstant(obj->as_instance()); | |
895 } | |
896 break; | |
897 } | |
898 default : ShouldNotReachHere(); | |
899 } | |
900 Value x; | |
901 if (patch_state != NULL) { | |
902 x = new Constant(t, patch_state); | |
903 } else { | |
904 x = new Constant(t); | |
905 } | |
906 push(t, append(x)); | |
907 } | |
908 } | |
909 | |
910 | |
911 void GraphBuilder::load_local(ValueType* type, int index) { | |
912 Value x = state()->load_local(index); | |
913 push(type, x); | |
914 } | |
915 | |
916 | |
917 void GraphBuilder::store_local(ValueType* type, int index) { | |
918 Value x = pop(type); | |
919 store_local(state(), x, type, index); | |
920 } | |
921 | |
922 | |
923 void GraphBuilder::store_local(ValueStack* state, Value x, ValueType* type, int index) { | |
924 if (parsing_jsr()) { | |
925 // We need to do additional tracking of the location of the return | |
926 // address for jsrs since we don't handle arbitrary jsr/ret | |
927 // constructs. Here we are figuring out in which circumstances we | |
928 // need to bail out. | |
929 if (x->type()->is_address()) { | |
930 scope_data()->set_jsr_return_address_local(index); | |
931 | |
932 // Also check parent jsrs (if any) at this time to see whether | |
933 // they are using this local. We don't handle skipping over a | |
934 // ret. | |
935 for (ScopeData* cur_scope_data = scope_data()->parent(); | |
936 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); | |
937 cur_scope_data = cur_scope_data->parent()) { | |
938 if (cur_scope_data->jsr_return_address_local() == index) { | |
939 BAILOUT("subroutine overwrites return address from previous subroutine"); | |
940 } | |
941 } | |
942 } else if (index == scope_data()->jsr_return_address_local()) { | |
943 scope_data()->set_jsr_return_address_local(-1); | |
944 } | |
945 } | |
946 | |
947 state->store_local(index, round_fp(x)); | |
948 } | |
949 | |
950 | |
951 void GraphBuilder::load_indexed(BasicType type) { | |
952 Value index = ipop(); | |
953 Value array = apop(); | |
954 Value length = NULL; | |
955 if (CSEArrayLength || | |
956 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || | |
957 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { | |
958 length = append(new ArrayLength(array, lock_stack())); | |
959 } | |
960 push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, lock_stack()))); | |
961 } | |
962 | |
963 | |
964 void GraphBuilder::store_indexed(BasicType type) { | |
965 Value value = pop(as_ValueType(type)); | |
966 Value index = ipop(); | |
967 Value array = apop(); | |
968 Value length = NULL; | |
969 if (CSEArrayLength || | |
970 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || | |
971 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { | |
972 length = append(new ArrayLength(array, lock_stack())); | |
973 } | |
974 StoreIndexed* result = new StoreIndexed(array, index, length, type, value, lock_stack()); | |
975 append(result); | |
459 | 976 _memory->store_value(value); |
0 | 977 } |
978 | |
979 | |
980 void GraphBuilder::stack_op(Bytecodes::Code code) { | |
981 switch (code) { | |
982 case Bytecodes::_pop: | |
983 { state()->raw_pop(); | |
984 } | |
985 break; | |
986 case Bytecodes::_pop2: | |
987 { state()->raw_pop(); | |
988 state()->raw_pop(); | |
989 } | |
990 break; | |
991 case Bytecodes::_dup: | |
992 { Value w = state()->raw_pop(); | |
993 state()->raw_push(w); | |
994 state()->raw_push(w); | |
995 } | |
996 break; | |
997 case Bytecodes::_dup_x1: | |
998 { Value w1 = state()->raw_pop(); | |
999 Value w2 = state()->raw_pop(); | |
1000 state()->raw_push(w1); | |
1001 state()->raw_push(w2); | |
1002 state()->raw_push(w1); | |
1003 } | |
1004 break; | |
1005 case Bytecodes::_dup_x2: | |
1006 { Value w1 = state()->raw_pop(); | |
1007 Value w2 = state()->raw_pop(); | |
1008 Value w3 = state()->raw_pop(); | |
1009 state()->raw_push(w1); | |
1010 state()->raw_push(w3); | |
1011 state()->raw_push(w2); | |
1012 state()->raw_push(w1); | |
1013 } | |
1014 break; | |
1015 case Bytecodes::_dup2: | |
1016 { Value w1 = state()->raw_pop(); | |
1017 Value w2 = state()->raw_pop(); | |
1018 state()->raw_push(w2); | |
1019 state()->raw_push(w1); | |
1020 state()->raw_push(w2); | |
1021 state()->raw_push(w1); | |
1022 } | |
1023 break; | |
1024 case Bytecodes::_dup2_x1: | |
1025 { Value w1 = state()->raw_pop(); | |
1026 Value w2 = state()->raw_pop(); | |
1027 Value w3 = state()->raw_pop(); | |
1028 state()->raw_push(w2); | |
1029 state()->raw_push(w1); | |
1030 state()->raw_push(w3); | |
1031 state()->raw_push(w2); | |
1032 state()->raw_push(w1); | |
1033 } | |
1034 break; | |
1035 case Bytecodes::_dup2_x2: | |
1036 { Value w1 = state()->raw_pop(); | |
1037 Value w2 = state()->raw_pop(); | |
1038 Value w3 = state()->raw_pop(); | |
1039 Value w4 = state()->raw_pop(); | |
1040 state()->raw_push(w2); | |
1041 state()->raw_push(w1); | |
1042 state()->raw_push(w4); | |
1043 state()->raw_push(w3); | |
1044 state()->raw_push(w2); | |
1045 state()->raw_push(w1); | |
1046 } | |
1047 break; | |
1048 case Bytecodes::_swap: | |
1049 { Value w1 = state()->raw_pop(); | |
1050 Value w2 = state()->raw_pop(); | |
1051 state()->raw_push(w1); | |
1052 state()->raw_push(w2); | |
1053 } | |
1054 break; | |
1055 default: | |
1056 ShouldNotReachHere(); | |
1057 break; | |
1058 } | |
1059 } | |
1060 | |
1061 | |
1062 void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* stack) { | |
1063 Value y = pop(type); | |
1064 Value x = pop(type); | |
1065 // NOTE: strictfp can be queried from current method since we don't | |
1066 // inline methods with differing strictfp bits | |
1067 Value res = new ArithmeticOp(code, x, y, method()->is_strict(), stack); | |
1068 // Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level | |
1069 res = append(res); | |
1070 if (method()->is_strict()) { | |
1071 res = round_fp(res); | |
1072 } | |
1073 push(type, res); | |
1074 } | |
1075 | |
1076 | |
1077 void GraphBuilder::negate_op(ValueType* type) { | |
1078 push(type, append(new NegateOp(pop(type)))); | |
1079 } | |
1080 | |
1081 | |
1082 void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) { | |
1083 Value s = ipop(); | |
1084 Value x = pop(type); | |
1085 // try to simplify | |
1086 // Note: This code should go into the canonicalizer as soon as it can | |
1087 // can handle canonicalized forms that contain more than one node. | |
1088 if (CanonicalizeNodes && code == Bytecodes::_iushr) { | |
1089 // pattern: x >>> s | |
1090 IntConstant* s1 = s->type()->as_IntConstant(); | |
1091 if (s1 != NULL) { | |
1092 // pattern: x >>> s1, with s1 constant | |
1093 ShiftOp* l = x->as_ShiftOp(); | |
1094 if (l != NULL && l->op() == Bytecodes::_ishl) { | |
1095 // pattern: (a << b) >>> s1 | |
1096 IntConstant* s0 = l->y()->type()->as_IntConstant(); | |
1097 if (s0 != NULL) { | |
1098 // pattern: (a << s0) >>> s1 | |
1099 const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts | |
1100 const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts | |
1101 if (s0c == s1c) { | |
1102 if (s0c == 0) { | |
1103 // pattern: (a << 0) >>> 0 => simplify to: a | |
1104 ipush(l->x()); | |
1105 } else { | |
1106 // pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant | |
1107 assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases"); | |
1108 const int m = (1 << (BitsPerInt - s0c)) - 1; | |
1109 Value s = append(new Constant(new IntConstant(m))); | |
1110 ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s))); | |
1111 } | |
1112 return; | |
1113 } | |
1114 } | |
1115 } | |
1116 } | |
1117 } | |
1118 // could not simplify | |
1119 push(type, append(new ShiftOp(code, x, s))); | |
1120 } | |
1121 | |
1122 | |
1123 void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) { | |
1124 Value y = pop(type); | |
1125 Value x = pop(type); | |
1126 push(type, append(new LogicOp(code, x, y))); | |
1127 } | |
1128 | |
1129 | |
1130 void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) { | |
1131 ValueStack* state_before = state()->copy(); | |
1132 Value y = pop(type); | |
1133 Value x = pop(type); | |
1134 ipush(append(new CompareOp(code, x, y, state_before))); | |
1135 } | |
1136 | |
1137 | |
1138 void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) { | |
1139 push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to)))); | |
1140 } | |
1141 | |
1142 | |
1143 void GraphBuilder::increment() { | |
1144 int index = stream()->get_index(); | |
1145 int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]); | |
1146 load_local(intType, index); | |
1147 ipush(append(new Constant(new IntConstant(delta)))); | |
1148 arithmetic_op(intType, Bytecodes::_iadd); | |
1149 store_local(intType, index); | |
1150 } | |
1151 | |
1152 | |
1153 void GraphBuilder::_goto(int from_bci, int to_bci) { | |
1154 profile_bci(from_bci); | |
1155 append(new Goto(block_at(to_bci), to_bci <= from_bci)); | |
1156 } | |
1157 | |
1158 | |
1159 void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) { | |
1160 BlockBegin* tsux = block_at(stream()->get_dest()); | |
1161 BlockBegin* fsux = block_at(stream()->next_bci()); | |
1162 bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci(); | |
1163 If* if_node = append(new If(x, cond, false, y, tsux, fsux, is_bb ? state_before : NULL, is_bb))->as_If(); | |
1164 if (profile_branches() && (if_node != NULL)) { | |
1165 if_node->set_profiled_method(method()); | |
1166 if_node->set_profiled_bci(bci()); | |
1167 if_node->set_should_profile(true); | |
1168 } | |
1169 } | |
1170 | |
1171 | |
1172 void GraphBuilder::if_zero(ValueType* type, If::Condition cond) { | |
1173 Value y = append(new Constant(intZero)); | |
1174 ValueStack* state_before = state()->copy(); | |
1175 Value x = ipop(); | |
1176 if_node(x, cond, y, state_before); | |
1177 } | |
1178 | |
1179 | |
1180 void GraphBuilder::if_null(ValueType* type, If::Condition cond) { | |
1181 Value y = append(new Constant(objectNull)); | |
1182 ValueStack* state_before = state()->copy(); | |
1183 Value x = apop(); | |
1184 if_node(x, cond, y, state_before); | |
1185 } | |
1186 | |
1187 | |
1188 void GraphBuilder::if_same(ValueType* type, If::Condition cond) { | |
1189 ValueStack* state_before = state()->copy(); | |
1190 Value y = pop(type); | |
1191 Value x = pop(type); | |
1192 if_node(x, cond, y, state_before); | |
1193 } | |
1194 | |
1195 | |
1196 void GraphBuilder::jsr(int dest) { | |
1197 // We only handle well-formed jsrs (those which are "block-structured"). | |
1198 // If the bytecodes are strange (jumping out of a jsr block) then we | |
1199 // might end up trying to re-parse a block containing a jsr which | |
1200 // has already been activated. Watch for this case and bail out. | |
1201 for (ScopeData* cur_scope_data = scope_data(); | |
1202 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); | |
1203 cur_scope_data = cur_scope_data->parent()) { | |
1204 if (cur_scope_data->jsr_entry_bci() == dest) { | |
1205 BAILOUT("too-complicated jsr/ret structure"); | |
1206 } | |
1207 } | |
1208 | |
1209 push(addressType, append(new Constant(new AddressConstant(next_bci())))); | |
1210 if (!try_inline_jsr(dest)) { | |
1211 return; // bailed out while parsing and inlining subroutine | |
1212 } | |
1213 } | |
1214 | |
1215 | |
1216 void GraphBuilder::ret(int local_index) { | |
1217 if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine"); | |
1218 | |
1219 if (local_index != scope_data()->jsr_return_address_local()) { | |
1220 BAILOUT("can not handle complicated jsr/ret constructs"); | |
1221 } | |
1222 | |
1223 // Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation | |
1224 append(new Goto(scope_data()->jsr_continuation(), false)); | |
1225 } | |
1226 | |
1227 | |
1228 void GraphBuilder::table_switch() { | |
1229 Bytecode_tableswitch* switch_ = Bytecode_tableswitch_at(method()->code() + bci()); | |
1230 const int l = switch_->length(); | |
1231 if (CanonicalizeNodes && l == 1) { | |
1232 // total of 2 successors => use If instead of switch | |
1233 // Note: This code should go into the canonicalizer as soon as it can | |
1234 // can handle canonicalized forms that contain more than one node. | |
1235 Value key = append(new Constant(new IntConstant(switch_->low_key()))); | |
1236 BlockBegin* tsux = block_at(bci() + switch_->dest_offset_at(0)); | |
1237 BlockBegin* fsux = block_at(bci() + switch_->default_offset()); | |
1238 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); | |
1239 ValueStack* state_before = is_bb ? state() : NULL; | |
1240 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); | |
1241 } else { | |
1242 // collect successors | |
1243 BlockList* sux = new BlockList(l + 1, NULL); | |
1244 int i; | |
1245 bool has_bb = false; | |
1246 for (i = 0; i < l; i++) { | |
1247 sux->at_put(i, block_at(bci() + switch_->dest_offset_at(i))); | |
1248 if (switch_->dest_offset_at(i) < 0) has_bb = true; | |
1249 } | |
1250 // add default successor | |
1251 sux->at_put(i, block_at(bci() + switch_->default_offset())); | |
1252 ValueStack* state_before = has_bb ? state() : NULL; | |
1253 append(new TableSwitch(ipop(), sux, switch_->low_key(), state_before, has_bb)); | |
1254 } | |
1255 } | |
1256 | |
1257 | |
1258 void GraphBuilder::lookup_switch() { | |
1259 Bytecode_lookupswitch* switch_ = Bytecode_lookupswitch_at(method()->code() + bci()); | |
1260 const int l = switch_->number_of_pairs(); | |
1261 if (CanonicalizeNodes && l == 1) { | |
1262 // total of 2 successors => use If instead of switch | |
1263 // Note: This code should go into the canonicalizer as soon as it can | |
1264 // can handle canonicalized forms that contain more than one node. | |
1265 // simplify to If | |
1266 LookupswitchPair* pair = switch_->pair_at(0); | |
1267 Value key = append(new Constant(new IntConstant(pair->match()))); | |
1268 BlockBegin* tsux = block_at(bci() + pair->offset()); | |
1269 BlockBegin* fsux = block_at(bci() + switch_->default_offset()); | |
1270 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); | |
1271 ValueStack* state_before = is_bb ? state() : NULL; | |
1272 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); | |
1273 } else { | |
1274 // collect successors & keys | |
1275 BlockList* sux = new BlockList(l + 1, NULL); | |
1276 intArray* keys = new intArray(l, 0); | |
1277 int i; | |
1278 bool has_bb = false; | |
1279 for (i = 0; i < l; i++) { | |
1280 LookupswitchPair* pair = switch_->pair_at(i); | |
1281 if (pair->offset() < 0) has_bb = true; | |
1282 sux->at_put(i, block_at(bci() + pair->offset())); | |
1283 keys->at_put(i, pair->match()); | |
1284 } | |
1285 // add default successor | |
1286 sux->at_put(i, block_at(bci() + switch_->default_offset())); | |
1287 ValueStack* state_before = has_bb ? state() : NULL; | |
1288 append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb)); | |
1289 } | |
1290 } | |
1291 | |
1292 void GraphBuilder::call_register_finalizer() { | |
1293 // If the receiver requires finalization then emit code to perform | |
1294 // the registration on return. | |
1295 | |
1296 // Gather some type information about the receiver | |
1297 Value receiver = state()->load_local(0); | |
1298 assert(receiver != NULL, "must have a receiver"); | |
1299 ciType* declared_type = receiver->declared_type(); | |
1300 ciType* exact_type = receiver->exact_type(); | |
1301 if (exact_type == NULL && | |
1302 receiver->as_Local() && | |
1303 receiver->as_Local()->java_index() == 0) { | |
1304 ciInstanceKlass* ik = compilation()->method()->holder(); | |
1305 if (ik->is_final()) { | |
1306 exact_type = ik; | |
1307 } else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) { | |
1308 // test class is leaf class | |
1309 compilation()->dependency_recorder()->assert_leaf_type(ik); | |
1310 exact_type = ik; | |
1311 } else { | |
1312 declared_type = ik; | |
1313 } | |
1314 } | |
1315 | |
1316 // see if we know statically that registration isn't required | |
1317 bool needs_check = true; | |
1318 if (exact_type != NULL) { | |
1319 needs_check = exact_type->as_instance_klass()->has_finalizer(); | |
1320 } else if (declared_type != NULL) { | |
1321 ciInstanceKlass* ik = declared_type->as_instance_klass(); | |
1322 if (!Dependencies::has_finalizable_subclass(ik)) { | |
1323 compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik); | |
1324 needs_check = false; | |
1325 } | |
1326 } | |
1327 | |
1328 if (needs_check) { | |
1329 // Perform the registration of finalizable objects. | |
1330 load_local(objectType, 0); | |
1331 append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init, | |
1332 state()->pop_arguments(1), | |
1333 true, lock_stack(), true)); | |
1334 } | |
1335 } | |
1336 | |
1337 | |
1338 void GraphBuilder::method_return(Value x) { | |
1339 if (RegisterFinalizersAtInit && | |
1340 method()->intrinsic_id() == vmIntrinsics::_Object_init) { | |
1341 call_register_finalizer(); | |
1342 } | |
1343 | |
1344 // Check to see whether we are inlining. If so, Return | |
1345 // instructions become Gotos to the continuation point. | |
1346 if (continuation() != NULL) { | |
1347 assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet"); | |
1348 | |
1349 // If the inlined method is synchronized, the monitor must be | |
1350 // released before we jump to the continuation block. | |
1351 if (method()->is_synchronized()) { | |
1352 int i = state()->caller_state()->locks_size(); | |
1353 assert(state()->locks_size() == i + 1, "receiver must be locked here"); | |
1354 monitorexit(state()->lock_at(i), SynchronizationEntryBCI); | |
1355 } | |
1356 | |
1357 state()->truncate_stack(caller_stack_size()); | |
1358 if (x != NULL) { | |
1359 state()->push(x->type(), x); | |
1360 } | |
1361 Goto* goto_callee = new Goto(continuation(), false); | |
1362 | |
1363 // See whether this is the first return; if so, store off some | |
1364 // of the state for later examination | |
1365 if (num_returns() == 0) { | |
1366 set_inline_cleanup_info(_block, _last, state()); | |
1367 } | |
1368 | |
1369 // State at end of inlined method is the state of the caller | |
1370 // without the method parameters on stack, including the | |
1371 // return value, if any, of the inlined method on operand stack. | |
1372 set_state(scope_data()->continuation_state()->copy()); | |
1373 if (x) { | |
1374 state()->push(x->type(), x); | |
1375 } | |
1376 | |
1377 // The current bci() is in the wrong scope, so use the bci() of | |
1378 // the continuation point. | |
1379 append_with_bci(goto_callee, scope_data()->continuation()->bci()); | |
1380 incr_num_returns(); | |
1381 | |
1382 return; | |
1383 } | |
1384 | |
1385 state()->truncate_stack(0); | |
1386 if (method()->is_synchronized()) { | |
1387 // perform the unlocking before exiting the method | |
1388 Value receiver; | |
1389 if (!method()->is_static()) { | |
1390 receiver = _initial_state->local_at(0); | |
1391 } else { | |
1392 receiver = append(new Constant(new ClassConstant(method()->holder()))); | |
1393 } | |
1394 append_split(new MonitorExit(receiver, state()->unlock())); | |
1395 } | |
1396 | |
1397 append(new Return(x)); | |
1398 } | |
1399 | |
1400 | |
1401 void GraphBuilder::access_field(Bytecodes::Code code) { | |
1402 bool will_link; | |
1403 ciField* field = stream()->get_field(will_link); | |
1404 ciInstanceKlass* holder = field->holder(); | |
1405 BasicType field_type = field->type()->basic_type(); | |
1406 ValueType* type = as_ValueType(field_type); | |
1407 // call will_link again to determine if the field is valid. | |
1408 const bool is_loaded = holder->is_loaded() && | |
1409 field->will_link(method()->holder(), code); | |
1410 const bool is_initialized = is_loaded && holder->is_initialized(); | |
1411 | |
1412 ValueStack* state_copy = NULL; | |
1413 if (!is_initialized || PatchALot) { | |
1414 // save state before instruction for debug info when | |
1415 // deoptimization happens during patching | |
1416 state_copy = state()->copy(); | |
1417 } | |
1418 | |
1419 Value obj = NULL; | |
1420 if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) { | |
1421 // commoning of class constants should only occur if the class is | |
1422 // fully initialized and resolved in this constant pool. The will_link test | |
1423 // above essentially checks if this class is resolved in this constant pool | |
1424 // so, the is_initialized flag should be suffiect. | |
1425 if (state_copy != NULL) { | |
1426 // build a patching constant | |
1427 obj = new Constant(new ClassConstant(holder), state_copy); | |
1428 } else { | |
1429 obj = new Constant(new ClassConstant(holder)); | |
1430 } | |
1431 } | |
1432 | |
1433 | |
1434 const int offset = is_loaded ? field->offset() : -1; | |
1435 switch (code) { | |
1436 case Bytecodes::_getstatic: { | |
1437 // check for compile-time constants, i.e., initialized static final fields | |
1438 Instruction* constant = NULL; | |
1439 if (field->is_constant() && !PatchALot) { | |
1440 ciConstant field_val = field->constant_value(); | |
1441 BasicType field_type = field_val.basic_type(); | |
1442 switch (field_type) { | |
1443 case T_ARRAY: | |
1444 case T_OBJECT: | |
1445 if (field_val.as_object()->has_encoding()) { | |
1446 constant = new Constant(as_ValueType(field_val)); | |
1447 } | |
1448 break; | |
1449 | |
1450 default: | |
1451 constant = new Constant(as_ValueType(field_val)); | |
1452 } | |
1453 } | |
1454 if (constant != NULL) { | |
1455 push(type, append(constant)); | |
1456 state_copy = NULL; // Not a potential deoptimization point (see set_state_before logic below) | |
1457 } else { | |
1458 push(type, append(new LoadField(append(obj), offset, field, true, | |
1459 lock_stack(), state_copy, is_loaded, is_initialized))); | |
1460 } | |
1461 break; | |
1462 } | |
1463 case Bytecodes::_putstatic: | |
1464 { Value val = pop(type); | |
1465 append(new StoreField(append(obj), offset, field, val, true, lock_stack(), state_copy, is_loaded, is_initialized)); | |
1466 } | |
1467 break; | |
1468 case Bytecodes::_getfield : | |
1469 { | |
1470 LoadField* load = new LoadField(apop(), offset, field, false, lock_stack(), state_copy, is_loaded, true); | |
1471 Value replacement = is_loaded ? _memory->load(load) : load; | |
1472 if (replacement != load) { | |
1473 assert(replacement->bci() != -99 || replacement->as_Phi() || replacement->as_Local(), | |
1474 "should already by linked"); | |
1475 push(type, replacement); | |
1476 } else { | |
1477 push(type, append(load)); | |
1478 } | |
1479 break; | |
1480 } | |
1481 | |
1482 case Bytecodes::_putfield : | |
1483 { Value val = pop(type); | |
1484 StoreField* store = new StoreField(apop(), offset, field, val, false, lock_stack(), state_copy, is_loaded, true); | |
1485 if (is_loaded) store = _memory->store(store); | |
1486 if (store != NULL) { | |
1487 append(store); | |
1488 } | |
1489 } | |
1490 break; | |
1491 default : | |
1492 ShouldNotReachHere(); | |
1493 break; | |
1494 } | |
1495 } | |
1496 | |
1497 | |
1498 Dependencies* GraphBuilder::dependency_recorder() const { | |
1499 assert(DeoptC1, "need debug information"); | |
1500 compilation()->set_needs_debug_information(true); | |
1501 return compilation()->dependency_recorder(); | |
1502 } | |
1503 | |
1504 | |
1505 void GraphBuilder::invoke(Bytecodes::Code code) { | |
1506 bool will_link; | |
1507 ciMethod* target = stream()->get_method(will_link); | |
1508 // we have to make sure the argument size (incl. the receiver) | |
1509 // is correct for compilation (the call would fail later during | |
1510 // linkage anyway) - was bug (gri 7/28/99) | |
1511 if (target->is_loaded() && target->is_static() != (code == Bytecodes::_invokestatic)) BAILOUT("will cause link error"); | |
1512 ciInstanceKlass* klass = target->holder(); | |
1513 | |
1514 // check if CHA possible: if so, change the code to invoke_special | |
1515 ciInstanceKlass* calling_klass = method()->holder(); | |
1516 ciKlass* holder = stream()->get_declared_method_holder(); | |
1517 ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder); | |
1518 ciInstanceKlass* actual_recv = callee_holder; | |
1519 | |
1520 // some methods are obviously bindable without any type checks so | |
1521 // convert them directly to an invokespecial. | |
1522 if (target->is_loaded() && !target->is_abstract() && | |
1523 target->can_be_statically_bound() && code == Bytecodes::_invokevirtual) { | |
1524 code = Bytecodes::_invokespecial; | |
1525 } | |
1526 | |
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1527 if (code == Bytecodes::_invokedynamic) { |
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1528 BAILOUT("invokedynamic NYI"); // FIXME |
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1529 return; |
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1530 } |
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1531 |
0 | 1532 // NEEDS_CLEANUP |
1533 // I've added the target-is_loaded() test below but I don't really understand | |
1534 // how klass->is_loaded() can be true and yet target->is_loaded() is false. | |
1535 // this happened while running the JCK invokevirtual tests under doit. TKR | |
1536 ciMethod* cha_monomorphic_target = NULL; | |
1537 ciMethod* exact_target = NULL; | |
1538 if (UseCHA && DeoptC1 && klass->is_loaded() && target->is_loaded()) { | |
1539 Value receiver = NULL; | |
1540 ciInstanceKlass* receiver_klass = NULL; | |
1541 bool type_is_exact = false; | |
1542 // try to find a precise receiver type | |
1543 if (will_link && !target->is_static()) { | |
1544 int index = state()->stack_size() - (target->arg_size_no_receiver() + 1); | |
1545 receiver = state()->stack_at(index); | |
1546 ciType* type = receiver->exact_type(); | |
1547 if (type != NULL && type->is_loaded() && | |
1548 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { | |
1549 receiver_klass = (ciInstanceKlass*) type; | |
1550 type_is_exact = true; | |
1551 } | |
1552 if (type == NULL) { | |
1553 type = receiver->declared_type(); | |
1554 if (type != NULL && type->is_loaded() && | |
1555 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { | |
1556 receiver_klass = (ciInstanceKlass*) type; | |
1557 if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) { | |
1558 // Insert a dependency on this type since | |
1559 // find_monomorphic_target may assume it's already done. | |
1560 dependency_recorder()->assert_leaf_type(receiver_klass); | |
1561 type_is_exact = true; | |
1562 } | |
1563 } | |
1564 } | |
1565 } | |
1566 if (receiver_klass != NULL && type_is_exact && | |
1567 receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) { | |
1568 // If we have the exact receiver type we can bind directly to | |
1569 // the method to call. | |
1570 exact_target = target->resolve_invoke(calling_klass, receiver_klass); | |
1571 if (exact_target != NULL) { | |
1572 target = exact_target; | |
1573 code = Bytecodes::_invokespecial; | |
1574 } | |
1575 } | |
1576 if (receiver_klass != NULL && | |
1577 receiver_klass->is_subtype_of(actual_recv) && | |
1578 actual_recv->is_initialized()) { | |
1579 actual_recv = receiver_klass; | |
1580 } | |
1581 | |
1582 if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) || | |
1583 (code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) { | |
1584 // Use CHA on the receiver to select a more precise method. | |
1585 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv); | |
1586 } else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) { | |
1587 // if there is only one implementor of this interface then we | |
1588 // may be able bind this invoke directly to the implementing | |
1589 // klass but we need both a dependence on the single interface | |
1590 // and on the method we bind to. Additionally since all we know | |
1591 // about the receiver type is the it's supposed to implement the | |
1592 // interface we have to insert a check that it's the class we | |
1593 // expect. Interface types are not checked by the verifier so | |
1594 // they are roughly equivalent to Object. | |
1595 ciInstanceKlass* singleton = NULL; | |
1596 if (target->holder()->nof_implementors() == 1) { | |
1597 singleton = target->holder()->implementor(0); | |
1598 } | |
1599 if (singleton) { | |
1600 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton); | |
1601 if (cha_monomorphic_target != NULL) { | |
1602 // If CHA is able to bind this invoke then update the class | |
1603 // to match that class, otherwise klass will refer to the | |
1604 // interface. | |
1605 klass = cha_monomorphic_target->holder(); | |
1606 actual_recv = target->holder(); | |
1607 | |
1608 // insert a check it's really the expected class. | |
1609 CheckCast* c = new CheckCast(klass, receiver, NULL); | |
1610 c->set_incompatible_class_change_check(); | |
1611 c->set_direct_compare(klass->is_final()); | |
1612 append_split(c); | |
1613 } | |
1614 } | |
1615 } | |
1616 } | |
1617 | |
1618 if (cha_monomorphic_target != NULL) { | |
1619 if (cha_monomorphic_target->is_abstract()) { | |
1620 // Do not optimize for abstract methods | |
1621 cha_monomorphic_target = NULL; | |
1622 } | |
1623 } | |
1624 | |
1625 if (cha_monomorphic_target != NULL) { | |
1626 if (!(target->is_final_method())) { | |
1627 // If we inlined because CHA revealed only a single target method, | |
1628 // then we are dependent on that target method not getting overridden | |
1629 // by dynamic class loading. Be sure to test the "static" receiver | |
1630 // dest_method here, as opposed to the actual receiver, which may | |
1631 // falsely lead us to believe that the receiver is final or private. | |
1632 dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target); | |
1633 } | |
1634 code = Bytecodes::_invokespecial; | |
1635 } | |
1636 // check if we could do inlining | |
1637 if (!PatchALot && Inline && klass->is_loaded() && | |
1638 (klass->is_initialized() || klass->is_interface() && target->holder()->is_initialized()) | |
1639 && target->will_link(klass, callee_holder, code)) { | |
1640 // callee is known => check if we have static binding | |
1641 assert(target->is_loaded(), "callee must be known"); | |
1642 if (code == Bytecodes::_invokestatic | |
1643 || code == Bytecodes::_invokespecial | |
1644 || code == Bytecodes::_invokevirtual && target->is_final_method() | |
1645 ) { | |
1646 // static binding => check if callee is ok | |
1647 ciMethod* inline_target = (cha_monomorphic_target != NULL) | |
1648 ? cha_monomorphic_target | |
1649 : target; | |
1650 bool res = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL)); | |
1651 CHECK_BAILOUT(); | |
1652 | |
1653 #ifndef PRODUCT | |
1654 // printing | |
1655 if (PrintInlining && !res) { | |
1656 // if it was successfully inlined, then it was already printed. | |
1657 print_inline_result(inline_target, res); | |
1658 } | |
1659 #endif | |
1660 clear_inline_bailout(); | |
1661 if (res) { | |
1662 // Register dependence if JVMTI has either breakpoint | |
1663 // setting or hotswapping of methods capabilities since they may | |
1664 // cause deoptimization. | |
780
c96bf21b756f
6788527: Server vm intermittently fails with assertion "live value must not be garbage" with fastdebug bits
kvn
parents:
726
diff
changeset
|
1665 if (compilation()->env()->jvmti_can_hotswap_or_post_breakpoint()) { |
0 | 1666 dependency_recorder()->assert_evol_method(inline_target); |
1667 } | |
1668 return; | |
1669 } | |
1670 } | |
1671 } | |
1672 // If we attempted an inline which did not succeed because of a | |
1673 // bailout during construction of the callee graph, the entire | |
1674 // compilation has to be aborted. This is fairly rare and currently | |
1675 // seems to only occur for jasm-generated classes which contain | |
1676 // jsr/ret pairs which are not associated with finally clauses and | |
1677 // do not have exception handlers in the containing method, and are | |
1678 // therefore not caught early enough to abort the inlining without | |
1679 // corrupting the graph. (We currently bail out with a non-empty | |
1680 // stack at a ret in these situations.) | |
1681 CHECK_BAILOUT(); | |
1682 | |
1683 // inlining not successful => standard invoke | |
1684 bool is_static = code == Bytecodes::_invokestatic; | |
1685 ValueType* result_type = as_ValueType(target->return_type()); | |
1686 Values* args = state()->pop_arguments(target->arg_size_no_receiver()); | |
1687 Value recv = is_static ? NULL : apop(); | |
1688 bool is_loaded = target->is_loaded(); | |
1689 int vtable_index = methodOopDesc::invalid_vtable_index; | |
1690 | |
1691 #ifdef SPARC | |
1692 // Currently only supported on Sparc. | |
1693 // The UseInlineCaches only controls dispatch to invokevirtuals for | |
1694 // loaded classes which we weren't able to statically bind. | |
1695 if (!UseInlineCaches && is_loaded && code == Bytecodes::_invokevirtual | |
1696 && !target->can_be_statically_bound()) { | |
1697 // Find a vtable index if one is available | |
1698 vtable_index = target->resolve_vtable_index(calling_klass, callee_holder); | |
1699 } | |
1700 #endif | |
1701 | |
1702 if (recv != NULL && | |
1703 (code == Bytecodes::_invokespecial || | |
1704 !is_loaded || target->is_final() || | |
1705 profile_calls())) { | |
1706 // invokespecial always needs a NULL check. invokevirtual where | |
1707 // the target is final or where it's not known that whether the | |
1708 // target is final requires a NULL check. Otherwise normal | |
1709 // invokevirtual will perform the null check during the lookup | |
1710 // logic or the unverified entry point. Profiling of calls | |
1711 // requires that the null check is performed in all cases. | |
1712 null_check(recv); | |
1713 } | |
1714 | |
1715 if (profile_calls()) { | |
1716 assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set"); | |
1717 ciKlass* target_klass = NULL; | |
1718 if (cha_monomorphic_target != NULL) { | |
1719 target_klass = cha_monomorphic_target->holder(); | |
1720 } else if (exact_target != NULL) { | |
1721 target_klass = exact_target->holder(); | |
1722 } | |
1723 profile_call(recv, target_klass); | |
1724 } | |
1725 | |
1726 Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target); | |
1727 // push result | |
1728 append_split(result); | |
1729 | |
1730 if (result_type != voidType) { | |
1731 if (method()->is_strict()) { | |
1732 push(result_type, round_fp(result)); | |
1733 } else { | |
1734 push(result_type, result); | |
1735 } | |
1736 } | |
1737 } | |
1738 | |
1739 | |
1740 void GraphBuilder::new_instance(int klass_index) { | |
1741 bool will_link; | |
1742 ciKlass* klass = stream()->get_klass(will_link); | |
1743 assert(klass->is_instance_klass(), "must be an instance klass"); | |
1744 NewInstance* new_instance = new NewInstance(klass->as_instance_klass()); | |
1745 _memory->new_instance(new_instance); | |
1746 apush(append_split(new_instance)); | |
1747 } | |
1748 | |
1749 | |
1750 void GraphBuilder::new_type_array() { | |
1751 apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index()))); | |
1752 } | |
1753 | |
1754 | |
1755 void GraphBuilder::new_object_array() { | |
1756 bool will_link; | |
1757 ciKlass* klass = stream()->get_klass(will_link); | |
1758 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
1759 NewArray* n = new NewObjectArray(klass, ipop(), state_before); | |
1760 apush(append_split(n)); | |
1761 } | |
1762 | |
1763 | |
1764 bool GraphBuilder::direct_compare(ciKlass* k) { | |
1765 if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) { | |
1766 ciInstanceKlass* ik = k->as_instance_klass(); | |
1767 if (ik->is_final()) { | |
1768 return true; | |
1769 } else { | |
1770 if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) { | |
1771 // test class is leaf class | |
1772 dependency_recorder()->assert_leaf_type(ik); | |
1773 return true; | |
1774 } | |
1775 } | |
1776 } | |
1777 return false; | |
1778 } | |
1779 | |
1780 | |
1781 void GraphBuilder::check_cast(int klass_index) { | |
1782 bool will_link; | |
1783 ciKlass* klass = stream()->get_klass(will_link); | |
1784 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
1785 CheckCast* c = new CheckCast(klass, apop(), state_before); | |
1786 apush(append_split(c)); | |
1787 c->set_direct_compare(direct_compare(klass)); | |
1788 if (profile_checkcasts()) { | |
1789 c->set_profiled_method(method()); | |
1790 c->set_profiled_bci(bci()); | |
1791 c->set_should_profile(true); | |
1792 } | |
1793 } | |
1794 | |
1795 | |
1796 void GraphBuilder::instance_of(int klass_index) { | |
1797 bool will_link; | |
1798 ciKlass* klass = stream()->get_klass(will_link); | |
1799 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
1800 InstanceOf* i = new InstanceOf(klass, apop(), state_before); | |
1801 ipush(append_split(i)); | |
1802 i->set_direct_compare(direct_compare(klass)); | |
1803 } | |
1804 | |
1805 | |
1806 void GraphBuilder::monitorenter(Value x, int bci) { | |
1807 // save state before locking in case of deoptimization after a NullPointerException | |
1808 ValueStack* lock_stack_before = lock_stack(); | |
1809 append_with_bci(new MonitorEnter(x, state()->lock(scope(), x), lock_stack_before), bci); | |
1810 kill_all(); | |
1811 } | |
1812 | |
1813 | |
1814 void GraphBuilder::monitorexit(Value x, int bci) { | |
1815 // Note: the comment below is only relevant for the case where we do | |
1816 // not deoptimize due to asynchronous exceptions (!(DeoptC1 && | |
1817 // DeoptOnAsyncException), which is not used anymore) | |
1818 | |
1819 // Note: Potentially, the monitor state in an exception handler | |
1820 // can be wrong due to wrong 'initialization' of the handler | |
1821 // via a wrong asynchronous exception path. This can happen, | |
1822 // if the exception handler range for asynchronous exceptions | |
1823 // is too long (see also java bug 4327029, and comment in | |
1824 // GraphBuilder::handle_exception()). This may cause 'under- | |
1825 // flow' of the monitor stack => bailout instead. | |
1826 if (state()->locks_size() < 1) BAILOUT("monitor stack underflow"); | |
1827 append_with_bci(new MonitorExit(x, state()->unlock()), bci); | |
1828 kill_all(); | |
1829 } | |
1830 | |
1831 | |
1832 void GraphBuilder::new_multi_array(int dimensions) { | |
1833 bool will_link; | |
1834 ciKlass* klass = stream()->get_klass(will_link); | |
1835 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
1836 | |
1837 Values* dims = new Values(dimensions, NULL); | |
1838 // fill in all dimensions | |
1839 int i = dimensions; | |
1840 while (i-- > 0) dims->at_put(i, ipop()); | |
1841 // create array | |
1842 NewArray* n = new NewMultiArray(klass, dims, state_before); | |
1843 apush(append_split(n)); | |
1844 } | |
1845 | |
1846 | |
1847 void GraphBuilder::throw_op(int bci) { | |
1848 // We require that the debug info for a Throw be the "state before" | |
1849 // the Throw (i.e., exception oop is still on TOS) | |
1850 ValueStack* state_before = state()->copy(); | |
1851 Throw* t = new Throw(apop(), state_before); | |
1852 append_with_bci(t, bci); | |
1853 } | |
1854 | |
1855 | |
1856 Value GraphBuilder::round_fp(Value fp_value) { | |
1857 // no rounding needed if SSE2 is used | |
1858 if (RoundFPResults && UseSSE < 2) { | |
1859 // Must currently insert rounding node for doubleword values that | |
1860 // are results of expressions (i.e., not loads from memory or | |
1861 // constants) | |
1862 if (fp_value->type()->tag() == doubleTag && | |
1863 fp_value->as_Constant() == NULL && | |
1864 fp_value->as_Local() == NULL && // method parameters need no rounding | |
1865 fp_value->as_RoundFP() == NULL) { | |
1866 return append(new RoundFP(fp_value)); | |
1867 } | |
1868 } | |
1869 return fp_value; | |
1870 } | |
1871 | |
1872 | |
1873 Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) { | |
1874 Canonicalizer canon(instr, bci); | |
1875 Instruction* i1 = canon.canonical(); | |
1876 if (i1->bci() != -99) { | |
1877 // Canonicalizer returned an instruction which was already | |
1878 // appended so simply return it. | |
1879 return i1; | |
1880 } else if (UseLocalValueNumbering) { | |
1881 // Lookup the instruction in the ValueMap and add it to the map if | |
1882 // it's not found. | |
1883 Instruction* i2 = vmap()->find_insert(i1); | |
1884 if (i2 != i1) { | |
1885 // found an entry in the value map, so just return it. | |
1886 assert(i2->bci() != -1, "should already be linked"); | |
1887 return i2; | |
1888 } | |
459 | 1889 ValueNumberingEffects vne(vmap()); |
1890 i1->visit(&vne); | |
0 | 1891 } |
1892 | |
1893 if (i1->as_Phi() == NULL && i1->as_Local() == NULL) { | |
1894 // i1 was not eliminated => append it | |
1895 assert(i1->next() == NULL, "shouldn't already be linked"); | |
1896 _last = _last->set_next(i1, canon.bci()); | |
1897 if (++_instruction_count >= InstructionCountCutoff | |
1898 && !bailed_out()) { | |
1899 // set the bailout state but complete normal processing. We | |
1900 // might do a little more work before noticing the bailout so we | |
1901 // want processing to continue normally until it's noticed. | |
1902 bailout("Method and/or inlining is too large"); | |
1903 } | |
1904 | |
1905 #ifndef PRODUCT | |
1906 if (PrintIRDuringConstruction) { | |
1907 InstructionPrinter ip; | |
1908 ip.print_line(i1); | |
1909 if (Verbose) { | |
1910 state()->print(); | |
1911 } | |
1912 } | |
1913 #endif | |
1914 assert(_last == i1, "adjust code below"); | |
1915 StateSplit* s = i1->as_StateSplit(); | |
1916 if (s != NULL && i1->as_BlockEnd() == NULL) { | |
1917 if (EliminateFieldAccess) { | |
459 | 1918 Intrinsic* intrinsic = s->as_Intrinsic(); |
0 | 1919 if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) { |
1920 _memory->kill(); | |
1921 } | |
1922 } | |
1923 s->set_state(state()->copy()); | |
1924 } | |
1925 // set up exception handlers for this instruction if necessary | |
1926 if (i1->can_trap()) { | |
1927 assert(exception_state() != NULL || !has_handler(), "must have setup exception state"); | |
1928 i1->set_exception_handlers(handle_exception(bci)); | |
1929 } | |
1930 } | |
1931 return i1; | |
1932 } | |
1933 | |
1934 | |
1935 Instruction* GraphBuilder::append(Instruction* instr) { | |
1936 assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used"); | |
1937 return append_with_bci(instr, bci()); | |
1938 } | |
1939 | |
1940 | |
1941 Instruction* GraphBuilder::append_split(StateSplit* instr) { | |
1942 return append_with_bci(instr, bci()); | |
1943 } | |
1944 | |
1945 | |
1946 void GraphBuilder::null_check(Value value) { | |
1947 if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) { | |
1948 return; | |
1949 } else { | |
1950 Constant* con = value->as_Constant(); | |
1951 if (con) { | |
1952 ObjectType* c = con->type()->as_ObjectType(); | |
1953 if (c && c->is_loaded()) { | |
1954 ObjectConstant* oc = c->as_ObjectConstant(); | |
1955 if (!oc || !oc->value()->is_null_object()) { | |
1956 return; | |
1957 } | |
1958 } | |
1959 } | |
1960 } | |
1961 append(new NullCheck(value, lock_stack())); | |
1962 } | |
1963 | |
1964 | |
1965 | |
1966 XHandlers* GraphBuilder::handle_exception(int cur_bci) { | |
1967 // fast path if it is guaranteed that no exception handlers are present | |
1968 if (!has_handler()) { | |
1969 // TODO: check if return NULL is possible (avoids empty lists) | |
1970 return new XHandlers(); | |
1971 } | |
1972 | |
1973 XHandlers* exception_handlers = new XHandlers(); | |
1974 ScopeData* cur_scope_data = scope_data(); | |
1975 ValueStack* s = exception_state(); | |
1976 int scope_count = 0; | |
1977 | |
1978 assert(s != NULL, "exception state must be set"); | |
1979 do { | |
1980 assert(cur_scope_data->scope() == s->scope(), "scopes do not match"); | |
1981 assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci"); | |
1982 | |
1983 // join with all potential exception handlers | |
1984 XHandlers* list = cur_scope_data->xhandlers(); | |
1985 const int n = list->length(); | |
1986 for (int i = 0; i < n; i++) { | |
1987 XHandler* h = list->handler_at(i); | |
1988 if (h->covers(cur_bci)) { | |
1989 // h is a potential exception handler => join it | |
1990 compilation()->set_has_exception_handlers(true); | |
1991 | |
1992 BlockBegin* entry = h->entry_block(); | |
1993 if (entry == block()) { | |
1994 // It's acceptable for an exception handler to cover itself | |
1995 // but we don't handle that in the parser currently. It's | |
1996 // very rare so we bailout instead of trying to handle it. | |
1997 BAILOUT_("exception handler covers itself", exception_handlers); | |
1998 } | |
1999 assert(entry->bci() == h->handler_bci(), "must match"); | |
2000 assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond"); | |
2001 | |
2002 // previously this was a BAILOUT, but this is not necessary | |
2003 // now because asynchronous exceptions are not handled this way. | |
2004 assert(entry->state() == NULL || s->locks_size() == entry->state()->locks_size(), "locks do not match"); | |
2005 | |
2006 // xhandler start with an empty expression stack | |
2007 s->truncate_stack(cur_scope_data->caller_stack_size()); | |
2008 | |
2009 // Note: Usually this join must work. However, very | |
2010 // complicated jsr-ret structures where we don't ret from | |
2011 // the subroutine can cause the objects on the monitor | |
2012 // stacks to not match because blocks can be parsed twice. | |
2013 // The only test case we've seen so far which exhibits this | |
2014 // problem is caught by the infinite recursion test in | |
2015 // GraphBuilder::jsr() if the join doesn't work. | |
2016 if (!entry->try_merge(s)) { | |
2017 BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers); | |
2018 } | |
2019 | |
2020 // add current state for correct handling of phi functions at begin of xhandler | |
2021 int phi_operand = entry->add_exception_state(s); | |
2022 | |
2023 // add entry to the list of xhandlers of this block | |
2024 _block->add_exception_handler(entry); | |
2025 | |
2026 // add back-edge from xhandler entry to this block | |
2027 if (!entry->is_predecessor(_block)) { | |
2028 entry->add_predecessor(_block); | |
2029 } | |
2030 | |
2031 // clone XHandler because phi_operand and scope_count can not be shared | |
2032 XHandler* new_xhandler = new XHandler(h); | |
2033 new_xhandler->set_phi_operand(phi_operand); | |
2034 new_xhandler->set_scope_count(scope_count); | |
2035 exception_handlers->append(new_xhandler); | |
2036 | |
2037 // fill in exception handler subgraph lazily | |
2038 assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet"); | |
2039 cur_scope_data->add_to_work_list(entry); | |
2040 | |
2041 // stop when reaching catchall | |
2042 if (h->catch_type() == 0) { | |
2043 return exception_handlers; | |
2044 } | |
2045 } | |
2046 } | |
2047 | |
2048 // Set up iteration for next time. | |
2049 // If parsing a jsr, do not grab exception handlers from the | |
2050 // parent scopes for this method (already got them, and they | |
2051 // needed to be cloned) | |
2052 if (cur_scope_data->parsing_jsr()) { | |
2053 IRScope* tmp_scope = cur_scope_data->scope(); | |
2054 while (cur_scope_data->parent() != NULL && | |
2055 cur_scope_data->parent()->scope() == tmp_scope) { | |
2056 cur_scope_data = cur_scope_data->parent(); | |
2057 } | |
2058 } | |
2059 if (cur_scope_data != NULL) { | |
2060 if (cur_scope_data->parent() != NULL) { | |
2061 // must use pop_scope instead of caller_state to preserve all monitors | |
2062 s = s->pop_scope(); | |
2063 } | |
2064 cur_bci = cur_scope_data->scope()->caller_bci(); | |
2065 cur_scope_data = cur_scope_data->parent(); | |
2066 scope_count++; | |
2067 } | |
2068 } while (cur_scope_data != NULL); | |
2069 | |
2070 return exception_handlers; | |
2071 } | |
2072 | |
2073 | |
2074 // Helper class for simplifying Phis. | |
2075 class PhiSimplifier : public BlockClosure { | |
2076 private: | |
2077 bool _has_substitutions; | |
2078 Value simplify(Value v); | |
2079 | |
2080 public: | |
2081 PhiSimplifier(BlockBegin* start) : _has_substitutions(false) { | |
2082 start->iterate_preorder(this); | |
2083 if (_has_substitutions) { | |
2084 SubstitutionResolver sr(start); | |
2085 } | |
2086 } | |
2087 void block_do(BlockBegin* b); | |
2088 bool has_substitutions() const { return _has_substitutions; } | |
2089 }; | |
2090 | |
2091 | |
2092 Value PhiSimplifier::simplify(Value v) { | |
2093 Phi* phi = v->as_Phi(); | |
2094 | |
2095 if (phi == NULL) { | |
2096 // no phi function | |
2097 return v; | |
2098 } else if (v->has_subst()) { | |
2099 // already substituted; subst can be phi itself -> simplify | |
2100 return simplify(v->subst()); | |
2101 } else if (phi->is_set(Phi::cannot_simplify)) { | |
2102 // already tried to simplify phi before | |
2103 return phi; | |
2104 } else if (phi->is_set(Phi::visited)) { | |
2105 // break cycles in phi functions | |
2106 return phi; | |
2107 } else if (phi->type()->is_illegal()) { | |
2108 // illegal phi functions are ignored anyway | |
2109 return phi; | |
2110 | |
2111 } else { | |
2112 // mark phi function as processed to break cycles in phi functions | |
2113 phi->set(Phi::visited); | |
2114 | |
2115 // simplify x = [y, x] and x = [y, y] to y | |
2116 Value subst = NULL; | |
2117 int opd_count = phi->operand_count(); | |
2118 for (int i = 0; i < opd_count; i++) { | |
2119 Value opd = phi->operand_at(i); | |
2120 assert(opd != NULL, "Operand must exist!"); | |
2121 | |
2122 if (opd->type()->is_illegal()) { | |
2123 // if one operand is illegal, the entire phi function is illegal | |
2124 phi->make_illegal(); | |
2125 phi->clear(Phi::visited); | |
2126 return phi; | |
2127 } | |
2128 | |
2129 Value new_opd = simplify(opd); | |
2130 assert(new_opd != NULL, "Simplified operand must exist!"); | |
2131 | |
2132 if (new_opd != phi && new_opd != subst) { | |
2133 if (subst == NULL) { | |
2134 subst = new_opd; | |
2135 } else { | |
2136 // no simplification possible | |
2137 phi->set(Phi::cannot_simplify); | |
2138 phi->clear(Phi::visited); | |
2139 return phi; | |
2140 } | |
2141 } | |
2142 } | |
2143 | |
2144 // sucessfully simplified phi function | |
2145 assert(subst != NULL, "illegal phi function"); | |
2146 _has_substitutions = true; | |
2147 phi->clear(Phi::visited); | |
2148 phi->set_subst(subst); | |
2149 | |
2150 #ifndef PRODUCT | |
2151 if (PrintPhiFunctions) { | |
2152 tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id()); | |
2153 } | |
2154 #endif | |
2155 | |
2156 return subst; | |
2157 } | |
2158 } | |
2159 | |
2160 | |
2161 void PhiSimplifier::block_do(BlockBegin* b) { | |
2162 for_each_phi_fun(b, phi, | |
2163 simplify(phi); | |
2164 ); | |
2165 | |
2166 #ifdef ASSERT | |
2167 for_each_phi_fun(b, phi, | |
2168 assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification"); | |
2169 ); | |
2170 | |
2171 ValueStack* state = b->state()->caller_state(); | |
2172 int index; | |
2173 Value value; | |
2174 for_each_state(state) { | |
2175 for_each_local_value(state, index, value) { | |
2176 Phi* phi = value->as_Phi(); | |
2177 assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state"); | |
2178 } | |
2179 } | |
2180 #endif | |
2181 } | |
2182 | |
2183 // This method is called after all blocks are filled with HIR instructions | |
2184 // It eliminates all Phi functions of the form x = [y, y] and x = [y, x] | |
2185 void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) { | |
2186 PhiSimplifier simplifier(start); | |
2187 } | |
2188 | |
2189 | |
2190 void GraphBuilder::connect_to_end(BlockBegin* beg) { | |
2191 // setup iteration | |
2192 kill_all(); | |
2193 _block = beg; | |
2194 _state = beg->state()->copy(); | |
2195 _last = beg; | |
2196 iterate_bytecodes_for_block(beg->bci()); | |
2197 } | |
2198 | |
2199 | |
2200 BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) { | |
2201 #ifndef PRODUCT | |
2202 if (PrintIRDuringConstruction) { | |
2203 tty->cr(); | |
2204 InstructionPrinter ip; | |
2205 ip.print_instr(_block); tty->cr(); | |
2206 ip.print_stack(_block->state()); tty->cr(); | |
2207 ip.print_inline_level(_block); | |
2208 ip.print_head(); | |
2209 tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size()); | |
2210 } | |
2211 #endif | |
2212 _skip_block = false; | |
2213 assert(state() != NULL, "ValueStack missing!"); | |
2214 ciBytecodeStream s(method()); | |
2215 s.reset_to_bci(bci); | |
2216 int prev_bci = bci; | |
2217 scope_data()->set_stream(&s); | |
2218 // iterate | |
2219 Bytecodes::Code code = Bytecodes::_illegal; | |
2220 bool push_exception = false; | |
2221 | |
2222 if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) { | |
2223 // first thing in the exception entry block should be the exception object. | |
2224 push_exception = true; | |
2225 } | |
2226 | |
2227 while (!bailed_out() && last()->as_BlockEnd() == NULL && | |
2228 (code = stream()->next()) != ciBytecodeStream::EOBC() && | |
2229 (block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) { | |
2230 | |
2231 if (has_handler() && can_trap(method(), code)) { | |
2232 // copy the state because it is modified before handle_exception is called | |
2233 set_exception_state(state()->copy()); | |
2234 } else { | |
2235 // handle_exception is not called for this bytecode | |
2236 set_exception_state(NULL); | |
2237 } | |
2238 | |
2239 // Check for active jsr during OSR compilation | |
2240 if (compilation()->is_osr_compile() | |
2241 && scope()->is_top_scope() | |
2242 && parsing_jsr() | |
2243 && s.cur_bci() == compilation()->osr_bci()) { | |
2244 bailout("OSR not supported while a jsr is active"); | |
2245 } | |
2246 | |
2247 if (push_exception) { | |
2248 apush(append(new ExceptionObject())); | |
2249 push_exception = false; | |
2250 } | |
2251 | |
2252 // handle bytecode | |
2253 switch (code) { | |
2254 case Bytecodes::_nop : /* nothing to do */ break; | |
2255 case Bytecodes::_aconst_null : apush(append(new Constant(objectNull ))); break; | |
2256 case Bytecodes::_iconst_m1 : ipush(append(new Constant(new IntConstant (-1)))); break; | |
2257 case Bytecodes::_iconst_0 : ipush(append(new Constant(intZero ))); break; | |
2258 case Bytecodes::_iconst_1 : ipush(append(new Constant(intOne ))); break; | |
2259 case Bytecodes::_iconst_2 : ipush(append(new Constant(new IntConstant ( 2)))); break; | |
2260 case Bytecodes::_iconst_3 : ipush(append(new Constant(new IntConstant ( 3)))); break; | |
2261 case Bytecodes::_iconst_4 : ipush(append(new Constant(new IntConstant ( 4)))); break; | |
2262 case Bytecodes::_iconst_5 : ipush(append(new Constant(new IntConstant ( 5)))); break; | |
2263 case Bytecodes::_lconst_0 : lpush(append(new Constant(new LongConstant ( 0)))); break; | |
2264 case Bytecodes::_lconst_1 : lpush(append(new Constant(new LongConstant ( 1)))); break; | |
2265 case Bytecodes::_fconst_0 : fpush(append(new Constant(new FloatConstant ( 0)))); break; | |
2266 case Bytecodes::_fconst_1 : fpush(append(new Constant(new FloatConstant ( 1)))); break; | |
2267 case Bytecodes::_fconst_2 : fpush(append(new Constant(new FloatConstant ( 2)))); break; | |
2268 case Bytecodes::_dconst_0 : dpush(append(new Constant(new DoubleConstant( 0)))); break; | |
2269 case Bytecodes::_dconst_1 : dpush(append(new Constant(new DoubleConstant( 1)))); break; | |
2270 case Bytecodes::_bipush : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break; | |
2271 case Bytecodes::_sipush : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break; | |
2272 case Bytecodes::_ldc : // fall through | |
2273 case Bytecodes::_ldc_w : // fall through | |
2274 case Bytecodes::_ldc2_w : load_constant(); break; | |
2275 case Bytecodes::_iload : load_local(intType , s.get_index()); break; | |
2276 case Bytecodes::_lload : load_local(longType , s.get_index()); break; | |
2277 case Bytecodes::_fload : load_local(floatType , s.get_index()); break; | |
2278 case Bytecodes::_dload : load_local(doubleType , s.get_index()); break; | |
2279 case Bytecodes::_aload : load_local(instanceType, s.get_index()); break; | |
2280 case Bytecodes::_iload_0 : load_local(intType , 0); break; | |
2281 case Bytecodes::_iload_1 : load_local(intType , 1); break; | |
2282 case Bytecodes::_iload_2 : load_local(intType , 2); break; | |
2283 case Bytecodes::_iload_3 : load_local(intType , 3); break; | |
2284 case Bytecodes::_lload_0 : load_local(longType , 0); break; | |
2285 case Bytecodes::_lload_1 : load_local(longType , 1); break; | |
2286 case Bytecodes::_lload_2 : load_local(longType , 2); break; | |
2287 case Bytecodes::_lload_3 : load_local(longType , 3); break; | |
2288 case Bytecodes::_fload_0 : load_local(floatType , 0); break; | |
2289 case Bytecodes::_fload_1 : load_local(floatType , 1); break; | |
2290 case Bytecodes::_fload_2 : load_local(floatType , 2); break; | |
2291 case Bytecodes::_fload_3 : load_local(floatType , 3); break; | |
2292 case Bytecodes::_dload_0 : load_local(doubleType, 0); break; | |
2293 case Bytecodes::_dload_1 : load_local(doubleType, 1); break; | |
2294 case Bytecodes::_dload_2 : load_local(doubleType, 2); break; | |
2295 case Bytecodes::_dload_3 : load_local(doubleType, 3); break; | |
2296 case Bytecodes::_aload_0 : load_local(objectType, 0); break; | |
2297 case Bytecodes::_aload_1 : load_local(objectType, 1); break; | |
2298 case Bytecodes::_aload_2 : load_local(objectType, 2); break; | |
2299 case Bytecodes::_aload_3 : load_local(objectType, 3); break; | |
2300 case Bytecodes::_iaload : load_indexed(T_INT ); break; | |
2301 case Bytecodes::_laload : load_indexed(T_LONG ); break; | |
2302 case Bytecodes::_faload : load_indexed(T_FLOAT ); break; | |
2303 case Bytecodes::_daload : load_indexed(T_DOUBLE); break; | |
2304 case Bytecodes::_aaload : load_indexed(T_OBJECT); break; | |
2305 case Bytecodes::_baload : load_indexed(T_BYTE ); break; | |
2306 case Bytecodes::_caload : load_indexed(T_CHAR ); break; | |
2307 case Bytecodes::_saload : load_indexed(T_SHORT ); break; | |
2308 case Bytecodes::_istore : store_local(intType , s.get_index()); break; | |
2309 case Bytecodes::_lstore : store_local(longType , s.get_index()); break; | |
2310 case Bytecodes::_fstore : store_local(floatType , s.get_index()); break; | |
2311 case Bytecodes::_dstore : store_local(doubleType, s.get_index()); break; | |
2312 case Bytecodes::_astore : store_local(objectType, s.get_index()); break; | |
2313 case Bytecodes::_istore_0 : store_local(intType , 0); break; | |
2314 case Bytecodes::_istore_1 : store_local(intType , 1); break; | |
2315 case Bytecodes::_istore_2 : store_local(intType , 2); break; | |
2316 case Bytecodes::_istore_3 : store_local(intType , 3); break; | |
2317 case Bytecodes::_lstore_0 : store_local(longType , 0); break; | |
2318 case Bytecodes::_lstore_1 : store_local(longType , 1); break; | |
2319 case Bytecodes::_lstore_2 : store_local(longType , 2); break; | |
2320 case Bytecodes::_lstore_3 : store_local(longType , 3); break; | |
2321 case Bytecodes::_fstore_0 : store_local(floatType , 0); break; | |
2322 case Bytecodes::_fstore_1 : store_local(floatType , 1); break; | |
2323 case Bytecodes::_fstore_2 : store_local(floatType , 2); break; | |
2324 case Bytecodes::_fstore_3 : store_local(floatType , 3); break; | |
2325 case Bytecodes::_dstore_0 : store_local(doubleType, 0); break; | |
2326 case Bytecodes::_dstore_1 : store_local(doubleType, 1); break; | |
2327 case Bytecodes::_dstore_2 : store_local(doubleType, 2); break; | |
2328 case Bytecodes::_dstore_3 : store_local(doubleType, 3); break; | |
2329 case Bytecodes::_astore_0 : store_local(objectType, 0); break; | |
2330 case Bytecodes::_astore_1 : store_local(objectType, 1); break; | |
2331 case Bytecodes::_astore_2 : store_local(objectType, 2); break; | |
2332 case Bytecodes::_astore_3 : store_local(objectType, 3); break; | |
2333 case Bytecodes::_iastore : store_indexed(T_INT ); break; | |
2334 case Bytecodes::_lastore : store_indexed(T_LONG ); break; | |
2335 case Bytecodes::_fastore : store_indexed(T_FLOAT ); break; | |
2336 case Bytecodes::_dastore : store_indexed(T_DOUBLE); break; | |
2337 case Bytecodes::_aastore : store_indexed(T_OBJECT); break; | |
2338 case Bytecodes::_bastore : store_indexed(T_BYTE ); break; | |
2339 case Bytecodes::_castore : store_indexed(T_CHAR ); break; | |
2340 case Bytecodes::_sastore : store_indexed(T_SHORT ); break; | |
2341 case Bytecodes::_pop : // fall through | |
2342 case Bytecodes::_pop2 : // fall through | |
2343 case Bytecodes::_dup : // fall through | |
2344 case Bytecodes::_dup_x1 : // fall through | |
2345 case Bytecodes::_dup_x2 : // fall through | |
2346 case Bytecodes::_dup2 : // fall through | |
2347 case Bytecodes::_dup2_x1 : // fall through | |
2348 case Bytecodes::_dup2_x2 : // fall through | |
2349 case Bytecodes::_swap : stack_op(code); break; | |
2350 case Bytecodes::_iadd : arithmetic_op(intType , code); break; | |
2351 case Bytecodes::_ladd : arithmetic_op(longType , code); break; | |
2352 case Bytecodes::_fadd : arithmetic_op(floatType , code); break; | |
2353 case Bytecodes::_dadd : arithmetic_op(doubleType, code); break; | |
2354 case Bytecodes::_isub : arithmetic_op(intType , code); break; | |
2355 case Bytecodes::_lsub : arithmetic_op(longType , code); break; | |
2356 case Bytecodes::_fsub : arithmetic_op(floatType , code); break; | |
2357 case Bytecodes::_dsub : arithmetic_op(doubleType, code); break; | |
2358 case Bytecodes::_imul : arithmetic_op(intType , code); break; | |
2359 case Bytecodes::_lmul : arithmetic_op(longType , code); break; | |
2360 case Bytecodes::_fmul : arithmetic_op(floatType , code); break; | |
2361 case Bytecodes::_dmul : arithmetic_op(doubleType, code); break; | |
2362 case Bytecodes::_idiv : arithmetic_op(intType , code, lock_stack()); break; | |
2363 case Bytecodes::_ldiv : arithmetic_op(longType , code, lock_stack()); break; | |
2364 case Bytecodes::_fdiv : arithmetic_op(floatType , code); break; | |
2365 case Bytecodes::_ddiv : arithmetic_op(doubleType, code); break; | |
2366 case Bytecodes::_irem : arithmetic_op(intType , code, lock_stack()); break; | |
2367 case Bytecodes::_lrem : arithmetic_op(longType , code, lock_stack()); break; | |
2368 case Bytecodes::_frem : arithmetic_op(floatType , code); break; | |
2369 case Bytecodes::_drem : arithmetic_op(doubleType, code); break; | |
2370 case Bytecodes::_ineg : negate_op(intType ); break; | |
2371 case Bytecodes::_lneg : negate_op(longType ); break; | |
2372 case Bytecodes::_fneg : negate_op(floatType ); break; | |
2373 case Bytecodes::_dneg : negate_op(doubleType); break; | |
2374 case Bytecodes::_ishl : shift_op(intType , code); break; | |
2375 case Bytecodes::_lshl : shift_op(longType, code); break; | |
2376 case Bytecodes::_ishr : shift_op(intType , code); break; | |
2377 case Bytecodes::_lshr : shift_op(longType, code); break; | |
2378 case Bytecodes::_iushr : shift_op(intType , code); break; | |
2379 case Bytecodes::_lushr : shift_op(longType, code); break; | |
2380 case Bytecodes::_iand : logic_op(intType , code); break; | |
2381 case Bytecodes::_land : logic_op(longType, code); break; | |
2382 case Bytecodes::_ior : logic_op(intType , code); break; | |
2383 case Bytecodes::_lor : logic_op(longType, code); break; | |
2384 case Bytecodes::_ixor : logic_op(intType , code); break; | |
2385 case Bytecodes::_lxor : logic_op(longType, code); break; | |
2386 case Bytecodes::_iinc : increment(); break; | |
2387 case Bytecodes::_i2l : convert(code, T_INT , T_LONG ); break; | |
2388 case Bytecodes::_i2f : convert(code, T_INT , T_FLOAT ); break; | |
2389 case Bytecodes::_i2d : convert(code, T_INT , T_DOUBLE); break; | |
2390 case Bytecodes::_l2i : convert(code, T_LONG , T_INT ); break; | |
2391 case Bytecodes::_l2f : convert(code, T_LONG , T_FLOAT ); break; | |
2392 case Bytecodes::_l2d : convert(code, T_LONG , T_DOUBLE); break; | |
2393 case Bytecodes::_f2i : convert(code, T_FLOAT , T_INT ); break; | |
2394 case Bytecodes::_f2l : convert(code, T_FLOAT , T_LONG ); break; | |
2395 case Bytecodes::_f2d : convert(code, T_FLOAT , T_DOUBLE); break; | |
2396 case Bytecodes::_d2i : convert(code, T_DOUBLE, T_INT ); break; | |
2397 case Bytecodes::_d2l : convert(code, T_DOUBLE, T_LONG ); break; | |
2398 case Bytecodes::_d2f : convert(code, T_DOUBLE, T_FLOAT ); break; | |
2399 case Bytecodes::_i2b : convert(code, T_INT , T_BYTE ); break; | |
2400 case Bytecodes::_i2c : convert(code, T_INT , T_CHAR ); break; | |
2401 case Bytecodes::_i2s : convert(code, T_INT , T_SHORT ); break; | |
2402 case Bytecodes::_lcmp : compare_op(longType , code); break; | |
2403 case Bytecodes::_fcmpl : compare_op(floatType , code); break; | |
2404 case Bytecodes::_fcmpg : compare_op(floatType , code); break; | |
2405 case Bytecodes::_dcmpl : compare_op(doubleType, code); break; | |
2406 case Bytecodes::_dcmpg : compare_op(doubleType, code); break; | |
2407 case Bytecodes::_ifeq : if_zero(intType , If::eql); break; | |
2408 case Bytecodes::_ifne : if_zero(intType , If::neq); break; | |
2409 case Bytecodes::_iflt : if_zero(intType , If::lss); break; | |
2410 case Bytecodes::_ifge : if_zero(intType , If::geq); break; | |
2411 case Bytecodes::_ifgt : if_zero(intType , If::gtr); break; | |
2412 case Bytecodes::_ifle : if_zero(intType , If::leq); break; | |
2413 case Bytecodes::_if_icmpeq : if_same(intType , If::eql); break; | |
2414 case Bytecodes::_if_icmpne : if_same(intType , If::neq); break; | |
2415 case Bytecodes::_if_icmplt : if_same(intType , If::lss); break; | |
2416 case Bytecodes::_if_icmpge : if_same(intType , If::geq); break; | |
2417 case Bytecodes::_if_icmpgt : if_same(intType , If::gtr); break; | |
2418 case Bytecodes::_if_icmple : if_same(intType , If::leq); break; | |
2419 case Bytecodes::_if_acmpeq : if_same(objectType, If::eql); break; | |
2420 case Bytecodes::_if_acmpne : if_same(objectType, If::neq); break; | |
2421 case Bytecodes::_goto : _goto(s.cur_bci(), s.get_dest()); break; | |
2422 case Bytecodes::_jsr : jsr(s.get_dest()); break; | |
2423 case Bytecodes::_ret : ret(s.get_index()); break; | |
2424 case Bytecodes::_tableswitch : table_switch(); break; | |
2425 case Bytecodes::_lookupswitch : lookup_switch(); break; | |
2426 case Bytecodes::_ireturn : method_return(ipop()); break; | |
2427 case Bytecodes::_lreturn : method_return(lpop()); break; | |
2428 case Bytecodes::_freturn : method_return(fpop()); break; | |
2429 case Bytecodes::_dreturn : method_return(dpop()); break; | |
2430 case Bytecodes::_areturn : method_return(apop()); break; | |
2431 case Bytecodes::_return : method_return(NULL ); break; | |
2432 case Bytecodes::_getstatic : // fall through | |
2433 case Bytecodes::_putstatic : // fall through | |
2434 case Bytecodes::_getfield : // fall through | |
2435 case Bytecodes::_putfield : access_field(code); break; | |
2436 case Bytecodes::_invokevirtual : // fall through | |
2437 case Bytecodes::_invokespecial : // fall through | |
2438 case Bytecodes::_invokestatic : // fall through | |
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
2439 case Bytecodes::_invokedynamic : // fall through |
0 | 2440 case Bytecodes::_invokeinterface: invoke(code); break; |
2441 case Bytecodes::_new : new_instance(s.get_index_big()); break; | |
2442 case Bytecodes::_newarray : new_type_array(); break; | |
2443 case Bytecodes::_anewarray : new_object_array(); break; | |
2444 case Bytecodes::_arraylength : ipush(append(new ArrayLength(apop(), lock_stack()))); break; | |
2445 case Bytecodes::_athrow : throw_op(s.cur_bci()); break; | |
2446 case Bytecodes::_checkcast : check_cast(s.get_index_big()); break; | |
2447 case Bytecodes::_instanceof : instance_of(s.get_index_big()); break; | |
2448 // Note: we do not have special handling for the monitorenter bytecode if DeoptC1 && DeoptOnAsyncException | |
2449 case Bytecodes::_monitorenter : monitorenter(apop(), s.cur_bci()); break; | |
2450 case Bytecodes::_monitorexit : monitorexit (apop(), s.cur_bci()); break; | |
2451 case Bytecodes::_wide : ShouldNotReachHere(); break; | |
2452 case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break; | |
2453 case Bytecodes::_ifnull : if_null(objectType, If::eql); break; | |
2454 case Bytecodes::_ifnonnull : if_null(objectType, If::neq); break; | |
2455 case Bytecodes::_goto_w : _goto(s.cur_bci(), s.get_far_dest()); break; | |
2456 case Bytecodes::_jsr_w : jsr(s.get_far_dest()); break; | |
2457 case Bytecodes::_breakpoint : BAILOUT_("concurrent setting of breakpoint", NULL); | |
2458 default : ShouldNotReachHere(); break; | |
2459 } | |
2460 // save current bci to setup Goto at the end | |
2461 prev_bci = s.cur_bci(); | |
2462 } | |
2463 CHECK_BAILOUT_(NULL); | |
2464 // stop processing of this block (see try_inline_full) | |
2465 if (_skip_block) { | |
2466 _skip_block = false; | |
2467 assert(_last && _last->as_BlockEnd(), ""); | |
2468 return _last->as_BlockEnd(); | |
2469 } | |
2470 // if there are any, check if last instruction is a BlockEnd instruction | |
2471 BlockEnd* end = last()->as_BlockEnd(); | |
2472 if (end == NULL) { | |
2473 // all blocks must end with a BlockEnd instruction => add a Goto | |
2474 end = new Goto(block_at(s.cur_bci()), false); | |
2475 _last = _last->set_next(end, prev_bci); | |
2476 } | |
2477 assert(end == last()->as_BlockEnd(), "inconsistency"); | |
2478 | |
2479 // if the method terminates, we don't need the stack anymore | |
2480 if (end->as_Return() != NULL) { | |
2481 state()->clear_stack(); | |
2482 } else if (end->as_Throw() != NULL) { | |
2483 // May have exception handler in caller scopes | |
2484 state()->truncate_stack(scope()->lock_stack_size()); | |
2485 } | |
2486 | |
2487 // connect to begin & set state | |
2488 // NOTE that inlining may have changed the block we are parsing | |
2489 block()->set_end(end); | |
2490 end->set_state(state()); | |
2491 // propagate state | |
2492 for (int i = end->number_of_sux() - 1; i >= 0; i--) { | |
2493 BlockBegin* sux = end->sux_at(i); | |
2494 assert(sux->is_predecessor(block()), "predecessor missing"); | |
2495 // be careful, bailout if bytecodes are strange | |
2496 if (!sux->try_merge(state())) BAILOUT_("block join failed", NULL); | |
2497 scope_data()->add_to_work_list(end->sux_at(i)); | |
2498 } | |
2499 | |
2500 scope_data()->set_stream(NULL); | |
2501 | |
2502 // done | |
2503 return end; | |
2504 } | |
2505 | |
2506 | |
2507 void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) { | |
2508 do { | |
2509 if (start_in_current_block_for_inlining && !bailed_out()) { | |
2510 iterate_bytecodes_for_block(0); | |
2511 start_in_current_block_for_inlining = false; | |
2512 } else { | |
2513 BlockBegin* b; | |
2514 while ((b = scope_data()->remove_from_work_list()) != NULL) { | |
2515 if (!b->is_set(BlockBegin::was_visited_flag)) { | |
2516 if (b->is_set(BlockBegin::osr_entry_flag)) { | |
2517 // we're about to parse the osr entry block, so make sure | |
2518 // we setup the OSR edge leading into this block so that | |
2519 // Phis get setup correctly. | |
2520 setup_osr_entry_block(); | |
2521 // this is no longer the osr entry block, so clear it. | |
2522 b->clear(BlockBegin::osr_entry_flag); | |
2523 } | |
2524 b->set(BlockBegin::was_visited_flag); | |
2525 connect_to_end(b); | |
2526 } | |
2527 } | |
2528 } | |
2529 } while (!bailed_out() && !scope_data()->is_work_list_empty()); | |
2530 } | |
2531 | |
2532 | |
2533 bool GraphBuilder::_is_initialized = false; | |
2534 bool GraphBuilder::_can_trap [Bytecodes::number_of_java_codes]; | |
2535 bool GraphBuilder::_is_async[Bytecodes::number_of_java_codes]; | |
2536 | |
2537 void GraphBuilder::initialize() { | |
2538 // make sure initialization happens only once (need a | |
2539 // lock here, if we allow the compiler to be re-entrant) | |
2540 if (is_initialized()) return; | |
2541 _is_initialized = true; | |
2542 | |
2543 // the following bytecodes are assumed to potentially | |
2544 // throw exceptions in compiled code - note that e.g. | |
2545 // monitorexit & the return bytecodes do not throw | |
2546 // exceptions since monitor pairing proved that they | |
2547 // succeed (if monitor pairing succeeded) | |
2548 Bytecodes::Code can_trap_list[] = | |
2549 { Bytecodes::_ldc | |
2550 , Bytecodes::_ldc_w | |
2551 , Bytecodes::_ldc2_w | |
2552 , Bytecodes::_iaload | |
2553 , Bytecodes::_laload | |
2554 , Bytecodes::_faload | |
2555 , Bytecodes::_daload | |
2556 , Bytecodes::_aaload | |
2557 , Bytecodes::_baload | |
2558 , Bytecodes::_caload | |
2559 , Bytecodes::_saload | |
2560 , Bytecodes::_iastore | |
2561 , Bytecodes::_lastore | |
2562 , Bytecodes::_fastore | |
2563 , Bytecodes::_dastore | |
2564 , Bytecodes::_aastore | |
2565 , Bytecodes::_bastore | |
2566 , Bytecodes::_castore | |
2567 , Bytecodes::_sastore | |
2568 , Bytecodes::_idiv | |
2569 , Bytecodes::_ldiv | |
2570 , Bytecodes::_irem | |
2571 , Bytecodes::_lrem | |
2572 , Bytecodes::_getstatic | |
2573 , Bytecodes::_putstatic | |
2574 , Bytecodes::_getfield | |
2575 , Bytecodes::_putfield | |
2576 , Bytecodes::_invokevirtual | |
2577 , Bytecodes::_invokespecial | |
2578 , Bytecodes::_invokestatic | |
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
2579 , Bytecodes::_invokedynamic |
0 | 2580 , Bytecodes::_invokeinterface |
2581 , Bytecodes::_new | |
2582 , Bytecodes::_newarray | |
2583 , Bytecodes::_anewarray | |
2584 , Bytecodes::_arraylength | |
2585 , Bytecodes::_athrow | |
2586 , Bytecodes::_checkcast | |
2587 , Bytecodes::_instanceof | |
2588 , Bytecodes::_monitorenter | |
2589 , Bytecodes::_multianewarray | |
2590 }; | |
2591 | |
2592 // the following bytecodes are assumed to potentially | |
2593 // throw asynchronous exceptions in compiled code due | |
2594 // to safepoints (note: these entries could be merged | |
2595 // with the can_trap_list - however, we need to know | |
2596 // which ones are asynchronous for now - see also the | |
2597 // comment in GraphBuilder::handle_exception) | |
2598 Bytecodes::Code is_async_list[] = | |
2599 { Bytecodes::_ifeq | |
2600 , Bytecodes::_ifne | |
2601 , Bytecodes::_iflt | |
2602 , Bytecodes::_ifge | |
2603 , Bytecodes::_ifgt | |
2604 , Bytecodes::_ifle | |
2605 , Bytecodes::_if_icmpeq | |
2606 , Bytecodes::_if_icmpne | |
2607 , Bytecodes::_if_icmplt | |
2608 , Bytecodes::_if_icmpge | |
2609 , Bytecodes::_if_icmpgt | |
2610 , Bytecodes::_if_icmple | |
2611 , Bytecodes::_if_acmpeq | |
2612 , Bytecodes::_if_acmpne | |
2613 , Bytecodes::_goto | |
2614 , Bytecodes::_jsr | |
2615 , Bytecodes::_ret | |
2616 , Bytecodes::_tableswitch | |
2617 , Bytecodes::_lookupswitch | |
2618 , Bytecodes::_ireturn | |
2619 , Bytecodes::_lreturn | |
2620 , Bytecodes::_freturn | |
2621 , Bytecodes::_dreturn | |
2622 , Bytecodes::_areturn | |
2623 , Bytecodes::_return | |
2624 , Bytecodes::_ifnull | |
2625 , Bytecodes::_ifnonnull | |
2626 , Bytecodes::_goto_w | |
2627 , Bytecodes::_jsr_w | |
2628 }; | |
2629 | |
2630 // inititialize trap tables | |
2631 for (int i = 0; i < Bytecodes::number_of_java_codes; i++) { | |
2632 _can_trap[i] = false; | |
2633 _is_async[i] = false; | |
2634 } | |
2635 // set standard trap info | |
2636 for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) { | |
2637 _can_trap[can_trap_list[j]] = true; | |
2638 } | |
2639 | |
2640 // We now deoptimize if an asynchronous exception is thrown. This | |
2641 // considerably cleans up corner case issues related to javac's | |
2642 // incorrect exception handler ranges for async exceptions and | |
2643 // allows us to precisely analyze the types of exceptions from | |
2644 // certain bytecodes. | |
2645 if (!(DeoptC1 && DeoptOnAsyncException)) { | |
2646 // set asynchronous trap info | |
2647 for (uint k = 0; k < ARRAY_SIZE(is_async_list); k++) { | |
2648 assert(!_can_trap[is_async_list[k]], "can_trap_list and is_async_list should be disjoint"); | |
2649 _can_trap[is_async_list[k]] = true; | |
2650 _is_async[is_async_list[k]] = true; | |
2651 } | |
2652 } | |
2653 } | |
2654 | |
2655 | |
2656 BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) { | |
2657 assert(entry->is_set(f), "entry/flag mismatch"); | |
2658 // create header block | |
2659 BlockBegin* h = new BlockBegin(entry->bci()); | |
2660 h->set_depth_first_number(0); | |
2661 | |
2662 Value l = h; | |
2663 if (profile_branches()) { | |
2664 // Increment the invocation count on entry to the method. We | |
2665 // can't use profile_invocation here because append isn't setup to | |
2666 // work properly at this point. The instruction have to be | |
2667 // appended to the instruction stream by hand. | |
2668 Value m = new Constant(new ObjectConstant(compilation()->method())); | |
2669 h->set_next(m, 0); | |
2670 Value p = new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1); | |
2671 m->set_next(p, 0); | |
2672 l = p; | |
2673 } | |
2674 | |
2675 BlockEnd* g = new Goto(entry, false); | |
2676 l->set_next(g, entry->bci()); | |
2677 h->set_end(g); | |
2678 h->set(f); | |
2679 // setup header block end state | |
2680 ValueStack* s = state->copy(); // can use copy since stack is empty (=> no phis) | |
2681 assert(s->stack_is_empty(), "must have empty stack at entry point"); | |
2682 g->set_state(s); | |
2683 return h; | |
2684 } | |
2685 | |
2686 | |
2687 | |
2688 BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) { | |
2689 BlockBegin* start = new BlockBegin(0); | |
2690 | |
2691 // This code eliminates the empty start block at the beginning of | |
2692 // each method. Previously, each method started with the | |
2693 // start-block created below, and this block was followed by the | |
2694 // header block that was always empty. This header block is only | |
2695 // necesary if std_entry is also a backward branch target because | |
2696 // then phi functions may be necessary in the header block. It's | |
2697 // also necessary when profiling so that there's a single block that | |
2698 // can increment the interpreter_invocation_count. | |
2699 BlockBegin* new_header_block; | |
2700 if (std_entry->number_of_preds() == 0 && !profile_branches()) { | |
2701 new_header_block = std_entry; | |
2702 } else { | |
2703 new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state); | |
2704 } | |
2705 | |
2706 // setup start block (root for the IR graph) | |
2707 Base* base = | |
2708 new Base( | |
2709 new_header_block, | |
2710 osr_entry | |
2711 ); | |
2712 start->set_next(base, 0); | |
2713 start->set_end(base); | |
2714 // create & setup state for start block | |
2715 start->set_state(state->copy()); | |
2716 base->set_state(state->copy()); | |
2717 | |
2718 if (base->std_entry()->state() == NULL) { | |
2719 // setup states for header blocks | |
2720 base->std_entry()->merge(state); | |
2721 } | |
2722 | |
2723 assert(base->std_entry()->state() != NULL, ""); | |
2724 return start; | |
2725 } | |
2726 | |
2727 | |
2728 void GraphBuilder::setup_osr_entry_block() { | |
2729 assert(compilation()->is_osr_compile(), "only for osrs"); | |
2730 | |
2731 int osr_bci = compilation()->osr_bci(); | |
2732 ciBytecodeStream s(method()); | |
2733 s.reset_to_bci(osr_bci); | |
2734 s.next(); | |
2735 scope_data()->set_stream(&s); | |
2736 | |
2737 // create a new block to be the osr setup code | |
2738 _osr_entry = new BlockBegin(osr_bci); | |
2739 _osr_entry->set(BlockBegin::osr_entry_flag); | |
2740 _osr_entry->set_depth_first_number(0); | |
2741 BlockBegin* target = bci2block()->at(osr_bci); | |
2742 assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there"); | |
2743 // the osr entry has no values for locals | |
2744 ValueStack* state = target->state()->copy(); | |
2745 _osr_entry->set_state(state); | |
2746 | |
2747 kill_all(); | |
2748 _block = _osr_entry; | |
2749 _state = _osr_entry->state()->copy(); | |
2750 _last = _osr_entry; | |
2751 Value e = append(new OsrEntry()); | |
2752 e->set_needs_null_check(false); | |
2753 | |
2754 // OSR buffer is | |
2755 // | |
2756 // locals[nlocals-1..0] | |
2757 // monitors[number_of_locks-1..0] | |
2758 // | |
2759 // locals is a direct copy of the interpreter frame so in the osr buffer | |
2760 // so first slot in the local array is the last local from the interpreter | |
2761 // and last slot is local[0] (receiver) from the interpreter | |
2762 // | |
2763 // Similarly with locks. The first lock slot in the osr buffer is the nth lock | |
2764 // from the interpreter frame, the nth lock slot in the osr buffer is 0th lock | |
2765 // in the interpreter frame (the method lock if a sync method) | |
2766 | |
2767 // Initialize monitors in the compiled activation. | |
2768 | |
2769 int index; | |
2770 Value local; | |
2771 | |
2772 // find all the locals that the interpreter thinks contain live oops | |
2773 const BitMap live_oops = method()->live_local_oops_at_bci(osr_bci); | |
2774 | |
2775 // compute the offset into the locals so that we can treat the buffer | |
2776 // as if the locals were still in the interpreter frame | |
2777 int locals_offset = BytesPerWord * (method()->max_locals() - 1); | |
2778 for_each_local_value(state, index, local) { | |
2779 int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord; | |
2780 Value get; | |
2781 if (local->type()->is_object_kind() && !live_oops.at(index)) { | |
2782 // The interpreter thinks this local is dead but the compiler | |
2783 // doesn't so pretend that the interpreter passed in null. | |
2784 get = append(new Constant(objectNull)); | |
2785 } else { | |
2786 get = append(new UnsafeGetRaw(as_BasicType(local->type()), e, | |
2787 append(new Constant(new IntConstant(offset))), | |
2788 0, | |
2789 true)); | |
2790 } | |
2791 _state->store_local(index, get); | |
2792 } | |
2793 | |
2794 // the storage for the OSR buffer is freed manually in the LIRGenerator. | |
2795 | |
2796 assert(state->caller_state() == NULL, "should be top scope"); | |
2797 state->clear_locals(); | |
2798 Goto* g = new Goto(target, false); | |
2799 g->set_state(_state->copy()); | |
2800 append(g); | |
2801 _osr_entry->set_end(g); | |
2802 target->merge(_osr_entry->end()->state()); | |
2803 | |
2804 scope_data()->set_stream(NULL); | |
2805 } | |
2806 | |
2807 | |
2808 ValueStack* GraphBuilder::state_at_entry() { | |
2809 ValueStack* state = new ValueStack(scope(), method()->max_locals(), method()->max_stack()); | |
2810 | |
2811 // Set up locals for receiver | |
2812 int idx = 0; | |
2813 if (!method()->is_static()) { | |
2814 // we should always see the receiver | |
2815 state->store_local(idx, new Local(objectType, idx)); | |
2816 idx = 1; | |
2817 } | |
2818 | |
2819 // Set up locals for incoming arguments | |
2820 ciSignature* sig = method()->signature(); | |
2821 for (int i = 0; i < sig->count(); i++) { | |
2822 ciType* type = sig->type_at(i); | |
2823 BasicType basic_type = type->basic_type(); | |
2824 // don't allow T_ARRAY to propagate into locals types | |
2825 if (basic_type == T_ARRAY) basic_type = T_OBJECT; | |
2826 ValueType* vt = as_ValueType(basic_type); | |
2827 state->store_local(idx, new Local(vt, idx)); | |
2828 idx += type->size(); | |
2829 } | |
2830 | |
2831 // lock synchronized method | |
2832 if (method()->is_synchronized()) { | |
2833 state->lock(scope(), NULL); | |
2834 } | |
2835 | |
2836 return state; | |
2837 } | |
2838 | |
2839 | |
2840 GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope) | |
2841 : _scope_data(NULL) | |
2842 , _exception_state(NULL) | |
2843 , _instruction_count(0) | |
2844 , _osr_entry(NULL) | |
2845 , _memory(new MemoryBuffer()) | |
2846 , _compilation(compilation) | |
2847 , _inline_bailout_msg(NULL) | |
2848 { | |
2849 int osr_bci = compilation->osr_bci(); | |
2850 | |
2851 // determine entry points and bci2block mapping | |
2852 BlockListBuilder blm(compilation, scope, osr_bci); | |
2853 CHECK_BAILOUT(); | |
2854 | |
2855 BlockList* bci2block = blm.bci2block(); | |
2856 BlockBegin* start_block = bci2block->at(0); | |
2857 | |
2858 assert(is_initialized(), "GraphBuilder must have been initialized"); | |
2859 push_root_scope(scope, bci2block, start_block); | |
2860 | |
2861 // setup state for std entry | |
2862 _initial_state = state_at_entry(); | |
2863 start_block->merge(_initial_state); | |
2864 | |
2865 BlockBegin* sync_handler = NULL; | |
780
c96bf21b756f
6788527: Server vm intermittently fails with assertion "live value must not be garbage" with fastdebug bits
kvn
parents:
726
diff
changeset
|
2866 if (method()->is_synchronized() || _compilation->env()->dtrace_method_probes()) { |
0 | 2867 // setup an exception handler to do the unlocking and/or notification |
2868 sync_handler = new BlockBegin(-1); | |
2869 sync_handler->set(BlockBegin::exception_entry_flag); | |
2870 sync_handler->set(BlockBegin::is_on_work_list_flag); | |
2871 sync_handler->set(BlockBegin::default_exception_handler_flag); | |
2872 | |
2873 ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); | |
2874 XHandler* h = new XHandler(desc); | |
2875 h->set_entry_block(sync_handler); | |
2876 scope_data()->xhandlers()->append(h); | |
2877 scope_data()->set_has_handler(); | |
2878 } | |
2879 | |
2880 // complete graph | |
2881 _vmap = new ValueMap(); | |
2882 scope->compute_lock_stack_size(); | |
2883 switch (scope->method()->intrinsic_id()) { | |
2884 case vmIntrinsics::_dabs : // fall through | |
2885 case vmIntrinsics::_dsqrt : // fall through | |
2886 case vmIntrinsics::_dsin : // fall through | |
2887 case vmIntrinsics::_dcos : // fall through | |
2888 case vmIntrinsics::_dtan : // fall through | |
2889 case vmIntrinsics::_dlog : // fall through | |
2890 case vmIntrinsics::_dlog10 : // fall through | |
2891 { | |
2892 // Compiles where the root method is an intrinsic need a special | |
2893 // compilation environment because the bytecodes for the method | |
2894 // shouldn't be parsed during the compilation, only the special | |
2895 // Intrinsic node should be emitted. If this isn't done the the | |
2896 // code for the inlined version will be different than the root | |
2897 // compiled version which could lead to monotonicity problems on | |
2898 // intel. | |
2899 | |
2900 // Set up a stream so that appending instructions works properly. | |
2901 ciBytecodeStream s(scope->method()); | |
2902 s.reset_to_bci(0); | |
2903 scope_data()->set_stream(&s); | |
2904 s.next(); | |
2905 | |
2906 // setup the initial block state | |
2907 _block = start_block; | |
2908 _state = start_block->state()->copy(); | |
2909 _last = start_block; | |
2910 load_local(doubleType, 0); | |
2911 | |
2912 // Emit the intrinsic node. | |
2913 bool result = try_inline_intrinsics(scope->method()); | |
2914 if (!result) BAILOUT("failed to inline intrinsic"); | |
2915 method_return(dpop()); | |
2916 | |
2917 // connect the begin and end blocks and we're all done. | |
2918 BlockEnd* end = last()->as_BlockEnd(); | |
2919 block()->set_end(end); | |
2920 end->set_state(state()); | |
2921 break; | |
2922 } | |
2923 default: | |
2924 scope_data()->add_to_work_list(start_block); | |
2925 iterate_all_blocks(); | |
2926 break; | |
2927 } | |
2928 CHECK_BAILOUT(); | |
2929 | |
2930 if (sync_handler && sync_handler->state() != NULL) { | |
2931 Value lock = NULL; | |
2932 if (method()->is_synchronized()) { | |
2933 lock = method()->is_static() ? new Constant(new InstanceConstant(method()->holder()->java_mirror())) : | |
2934 _initial_state->local_at(0); | |
2935 | |
2936 sync_handler->state()->unlock(); | |
2937 sync_handler->state()->lock(scope, lock); | |
2938 | |
2939 } | |
2940 fill_sync_handler(lock, sync_handler, true); | |
2941 } | |
2942 | |
2943 _start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state); | |
2944 | |
2945 eliminate_redundant_phis(_start); | |
2946 | |
2947 NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats()); | |
2948 // for osr compile, bailout if some requirements are not fulfilled | |
2949 if (osr_bci != -1) { | |
2950 BlockBegin* osr_block = blm.bci2block()->at(osr_bci); | |
2951 assert(osr_block->is_set(BlockBegin::was_visited_flag),"osr entry must have been visited for osr compile"); | |
2952 | |
2953 // check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points | |
2954 if (!osr_block->state()->stack_is_empty()) { | |
2955 BAILOUT("stack not empty at OSR entry point"); | |
2956 } | |
2957 } | |
2958 #ifndef PRODUCT | |
2959 if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count); | |
2960 #endif | |
2961 } | |
2962 | |
2963 | |
2964 ValueStack* GraphBuilder::lock_stack() { | |
2965 // return a new ValueStack representing just the current lock stack | |
2966 // (for debug info at safepoints in exception throwing or handling) | |
2967 ValueStack* new_stack = state()->copy_locks(); | |
2968 return new_stack; | |
2969 } | |
2970 | |
2971 | |
2972 int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const { | |
2973 int recur_level = 0; | |
2974 for (IRScope* s = scope(); s != NULL; s = s->caller()) { | |
2975 if (s->method() == cur_callee) { | |
2976 ++recur_level; | |
2977 } | |
2978 } | |
2979 return recur_level; | |
2980 } | |
2981 | |
2982 | |
2983 bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known) { | |
2984 // Clear out any existing inline bailout condition | |
2985 clear_inline_bailout(); | |
2986 | |
2987 if (callee->should_exclude()) { | |
2988 // callee is excluded | |
2989 INLINE_BAILOUT("excluded by CompilerOracle") | |
2990 } else if (!callee->can_be_compiled()) { | |
2991 // callee is not compilable (prob. has breakpoints) | |
2992 INLINE_BAILOUT("not compilable") | |
2993 } else if (callee->intrinsic_id() != vmIntrinsics::_none && try_inline_intrinsics(callee)) { | |
2994 // intrinsics can be native or not | |
2995 return true; | |
2996 } else if (callee->is_native()) { | |
2997 // non-intrinsic natives cannot be inlined | |
2998 INLINE_BAILOUT("non-intrinsic native") | |
2999 } else if (callee->is_abstract()) { | |
3000 INLINE_BAILOUT("abstract") | |
3001 } else { | |
3002 return try_inline_full(callee, holder_known); | |
3003 } | |
3004 } | |
3005 | |
3006 | |
3007 bool GraphBuilder::try_inline_intrinsics(ciMethod* callee) { | |
3008 if (!InlineNatives ) INLINE_BAILOUT("intrinsic method inlining disabled"); | |
3009 if (callee->is_synchronized()) INLINE_BAILOUT("intrinsic method is synchronized"); | |
3010 // callee seems like a good candidate | |
3011 // determine id | |
3012 bool preserves_state = false; | |
3013 bool cantrap = true; | |
3014 vmIntrinsics::ID id = callee->intrinsic_id(); | |
3015 switch (id) { | |
3016 case vmIntrinsics::_arraycopy : | |
3017 if (!InlineArrayCopy) return false; | |
3018 break; | |
3019 | |
3020 case vmIntrinsics::_currentTimeMillis: | |
3021 case vmIntrinsics::_nanoTime: | |
3022 preserves_state = true; | |
3023 cantrap = false; | |
3024 break; | |
3025 | |
3026 case vmIntrinsics::_floatToRawIntBits : | |
3027 case vmIntrinsics::_intBitsToFloat : | |
3028 case vmIntrinsics::_doubleToRawLongBits : | |
3029 case vmIntrinsics::_longBitsToDouble : | |
3030 if (!InlineMathNatives) return false; | |
3031 preserves_state = true; | |
3032 cantrap = false; | |
3033 break; | |
3034 | |
3035 case vmIntrinsics::_getClass : | |
3036 if (!InlineClassNatives) return false; | |
3037 preserves_state = true; | |
3038 break; | |
3039 | |
3040 case vmIntrinsics::_currentThread : | |
3041 if (!InlineThreadNatives) return false; | |
3042 preserves_state = true; | |
3043 cantrap = false; | |
3044 break; | |
3045 | |
3046 case vmIntrinsics::_dabs : // fall through | |
3047 case vmIntrinsics::_dsqrt : // fall through | |
3048 case vmIntrinsics::_dsin : // fall through | |
3049 case vmIntrinsics::_dcos : // fall through | |
3050 case vmIntrinsics::_dtan : // fall through | |
3051 case vmIntrinsics::_dlog : // fall through | |
3052 case vmIntrinsics::_dlog10 : // fall through | |
3053 if (!InlineMathNatives) return false; | |
3054 cantrap = false; | |
3055 preserves_state = true; | |
3056 break; | |
3057 | |
3058 // sun/misc/AtomicLong.attemptUpdate | |
3059 case vmIntrinsics::_attemptUpdate : | |
3060 if (!VM_Version::supports_cx8()) return false; | |
3061 if (!InlineAtomicLong) return false; | |
3062 preserves_state = true; | |
3063 break; | |
3064 | |
3065 // Use special nodes for Unsafe instructions so we can more easily | |
3066 // perform an address-mode optimization on the raw variants | |
3067 case vmIntrinsics::_getObject : return append_unsafe_get_obj(callee, T_OBJECT, false); | |
3068 case vmIntrinsics::_getBoolean: return append_unsafe_get_obj(callee, T_BOOLEAN, false); | |
3069 case vmIntrinsics::_getByte : return append_unsafe_get_obj(callee, T_BYTE, false); | |
3070 case vmIntrinsics::_getShort : return append_unsafe_get_obj(callee, T_SHORT, false); | |
3071 case vmIntrinsics::_getChar : return append_unsafe_get_obj(callee, T_CHAR, false); | |
3072 case vmIntrinsics::_getInt : return append_unsafe_get_obj(callee, T_INT, false); | |
3073 case vmIntrinsics::_getLong : return append_unsafe_get_obj(callee, T_LONG, false); | |
3074 case vmIntrinsics::_getFloat : return append_unsafe_get_obj(callee, T_FLOAT, false); | |
3075 case vmIntrinsics::_getDouble : return append_unsafe_get_obj(callee, T_DOUBLE, false); | |
3076 | |
3077 case vmIntrinsics::_putObject : return append_unsafe_put_obj(callee, T_OBJECT, false); | |
3078 case vmIntrinsics::_putBoolean: return append_unsafe_put_obj(callee, T_BOOLEAN, false); | |
3079 case vmIntrinsics::_putByte : return append_unsafe_put_obj(callee, T_BYTE, false); | |
3080 case vmIntrinsics::_putShort : return append_unsafe_put_obj(callee, T_SHORT, false); | |
3081 case vmIntrinsics::_putChar : return append_unsafe_put_obj(callee, T_CHAR, false); | |
3082 case vmIntrinsics::_putInt : return append_unsafe_put_obj(callee, T_INT, false); | |
3083 case vmIntrinsics::_putLong : return append_unsafe_put_obj(callee, T_LONG, false); | |
3084 case vmIntrinsics::_putFloat : return append_unsafe_put_obj(callee, T_FLOAT, false); | |
3085 case vmIntrinsics::_putDouble : return append_unsafe_put_obj(callee, T_DOUBLE, false); | |
3086 | |
3087 case vmIntrinsics::_getObjectVolatile : return append_unsafe_get_obj(callee, T_OBJECT, true); | |
3088 case vmIntrinsics::_getBooleanVolatile: return append_unsafe_get_obj(callee, T_BOOLEAN, true); | |
3089 case vmIntrinsics::_getByteVolatile : return append_unsafe_get_obj(callee, T_BYTE, true); | |
3090 case vmIntrinsics::_getShortVolatile : return append_unsafe_get_obj(callee, T_SHORT, true); | |
3091 case vmIntrinsics::_getCharVolatile : return append_unsafe_get_obj(callee, T_CHAR, true); | |
3092 case vmIntrinsics::_getIntVolatile : return append_unsafe_get_obj(callee, T_INT, true); | |
3093 case vmIntrinsics::_getLongVolatile : return append_unsafe_get_obj(callee, T_LONG, true); | |
3094 case vmIntrinsics::_getFloatVolatile : return append_unsafe_get_obj(callee, T_FLOAT, true); | |
3095 case vmIntrinsics::_getDoubleVolatile : return append_unsafe_get_obj(callee, T_DOUBLE, true); | |
3096 | |
3097 case vmIntrinsics::_putObjectVolatile : return append_unsafe_put_obj(callee, T_OBJECT, true); | |
3098 case vmIntrinsics::_putBooleanVolatile: return append_unsafe_put_obj(callee, T_BOOLEAN, true); | |
3099 case vmIntrinsics::_putByteVolatile : return append_unsafe_put_obj(callee, T_BYTE, true); | |
3100 case vmIntrinsics::_putShortVolatile : return append_unsafe_put_obj(callee, T_SHORT, true); | |
3101 case vmIntrinsics::_putCharVolatile : return append_unsafe_put_obj(callee, T_CHAR, true); | |
3102 case vmIntrinsics::_putIntVolatile : return append_unsafe_put_obj(callee, T_INT, true); | |
3103 case vmIntrinsics::_putLongVolatile : return append_unsafe_put_obj(callee, T_LONG, true); | |
3104 case vmIntrinsics::_putFloatVolatile : return append_unsafe_put_obj(callee, T_FLOAT, true); | |
3105 case vmIntrinsics::_putDoubleVolatile : return append_unsafe_put_obj(callee, T_DOUBLE, true); | |
3106 | |
3107 case vmIntrinsics::_getByte_raw : return append_unsafe_get_raw(callee, T_BYTE); | |
3108 case vmIntrinsics::_getShort_raw : return append_unsafe_get_raw(callee, T_SHORT); | |
3109 case vmIntrinsics::_getChar_raw : return append_unsafe_get_raw(callee, T_CHAR); | |
3110 case vmIntrinsics::_getInt_raw : return append_unsafe_get_raw(callee, T_INT); | |
3111 case vmIntrinsics::_getLong_raw : return append_unsafe_get_raw(callee, T_LONG); | |
3112 case vmIntrinsics::_getFloat_raw : return append_unsafe_get_raw(callee, T_FLOAT); | |
3113 case vmIntrinsics::_getDouble_raw : return append_unsafe_get_raw(callee, T_DOUBLE); | |
3114 | |
3115 case vmIntrinsics::_putByte_raw : return append_unsafe_put_raw(callee, T_BYTE); | |
3116 case vmIntrinsics::_putShort_raw : return append_unsafe_put_raw(callee, T_SHORT); | |
3117 case vmIntrinsics::_putChar_raw : return append_unsafe_put_raw(callee, T_CHAR); | |
3118 case vmIntrinsics::_putInt_raw : return append_unsafe_put_raw(callee, T_INT); | |
3119 case vmIntrinsics::_putLong_raw : return append_unsafe_put_raw(callee, T_LONG); | |
3120 case vmIntrinsics::_putFloat_raw : return append_unsafe_put_raw(callee, T_FLOAT); | |
3121 case vmIntrinsics::_putDouble_raw : return append_unsafe_put_raw(callee, T_DOUBLE); | |
3122 | |
3123 case vmIntrinsics::_prefetchRead : return append_unsafe_prefetch(callee, false, false); | |
3124 case vmIntrinsics::_prefetchWrite : return append_unsafe_prefetch(callee, false, true); | |
3125 case vmIntrinsics::_prefetchReadStatic : return append_unsafe_prefetch(callee, true, false); | |
3126 case vmIntrinsics::_prefetchWriteStatic : return append_unsafe_prefetch(callee, true, true); | |
3127 | |
3128 case vmIntrinsics::_checkIndex : | |
3129 if (!InlineNIOCheckIndex) return false; | |
3130 preserves_state = true; | |
3131 break; | |
3132 case vmIntrinsics::_putOrderedObject : return append_unsafe_put_obj(callee, T_OBJECT, true); | |
3133 case vmIntrinsics::_putOrderedInt : return append_unsafe_put_obj(callee, T_INT, true); | |
3134 case vmIntrinsics::_putOrderedLong : return append_unsafe_put_obj(callee, T_LONG, true); | |
3135 | |
3136 case vmIntrinsics::_compareAndSwapLong: | |
3137 if (!VM_Version::supports_cx8()) return false; | |
3138 // fall through | |
3139 case vmIntrinsics::_compareAndSwapInt: | |
3140 case vmIntrinsics::_compareAndSwapObject: | |
3141 append_unsafe_CAS(callee); | |
3142 return true; | |
3143 | |
3144 default : return false; // do not inline | |
3145 } | |
3146 // create intrinsic node | |
3147 const bool has_receiver = !callee->is_static(); | |
3148 ValueType* result_type = as_ValueType(callee->return_type()); | |
3149 | |
3150 Values* args = state()->pop_arguments(callee->arg_size()); | |
3151 ValueStack* locks = lock_stack(); | |
3152 if (profile_calls()) { | |
3153 // Don't profile in the special case where the root method | |
3154 // is the intrinsic | |
3155 if (callee != method()) { | |
3156 Value recv = NULL; | |
3157 if (has_receiver) { | |
3158 recv = args->at(0); | |
3159 null_check(recv); | |
3160 } | |
3161 profile_call(recv, NULL); | |
3162 } | |
3163 } | |
3164 | |
3165 Intrinsic* result = new Intrinsic(result_type, id, args, has_receiver, lock_stack(), | |
3166 preserves_state, cantrap); | |
3167 // append instruction & push result | |
3168 Value value = append_split(result); | |
3169 if (result_type != voidType) push(result_type, value); | |
3170 | |
3171 #ifndef PRODUCT | |
3172 // printing | |
3173 if (PrintInlining) { | |
3174 print_inline_result(callee, true); | |
3175 } | |
3176 #endif | |
3177 | |
3178 // done | |
3179 return true; | |
3180 } | |
3181 | |
3182 | |
3183 bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) { | |
3184 // Introduce a new callee continuation point - all Ret instructions | |
3185 // will be replaced with Gotos to this point. | |
3186 BlockBegin* cont = block_at(next_bci()); | |
3187 assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr"); | |
3188 | |
3189 // Note: can not assign state to continuation yet, as we have to | |
3190 // pick up the state from the Ret instructions. | |
3191 | |
3192 // Push callee scope | |
3193 push_scope_for_jsr(cont, jsr_dest_bci); | |
3194 | |
3195 // Temporarily set up bytecode stream so we can append instructions | |
3196 // (only using the bci of this stream) | |
3197 scope_data()->set_stream(scope_data()->parent()->stream()); | |
3198 | |
3199 BlockBegin* jsr_start_block = block_at(jsr_dest_bci); | |
3200 assert(jsr_start_block != NULL, "jsr start block must exist"); | |
3201 assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet"); | |
3202 Goto* goto_sub = new Goto(jsr_start_block, false); | |
3203 goto_sub->set_state(state()); | |
3204 // Must copy state to avoid wrong sharing when parsing bytecodes | |
3205 assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block"); | |
3206 jsr_start_block->set_state(state()->copy()); | |
3207 append(goto_sub); | |
3208 _block->set_end(goto_sub); | |
3209 _last = _block = jsr_start_block; | |
3210 | |
3211 // Clear out bytecode stream | |
3212 scope_data()->set_stream(NULL); | |
3213 | |
3214 scope_data()->add_to_work_list(jsr_start_block); | |
3215 | |
3216 // Ready to resume parsing in subroutine | |
3217 iterate_all_blocks(); | |
3218 | |
3219 // If we bailed out during parsing, return immediately (this is bad news) | |
3220 CHECK_BAILOUT_(false); | |
3221 | |
3222 // Detect whether the continuation can actually be reached. If not, | |
3223 // it has not had state set by the join() operations in | |
3224 // iterate_bytecodes_for_block()/ret() and we should not touch the | |
3225 // iteration state. The calling activation of | |
3226 // iterate_bytecodes_for_block will then complete normally. | |
3227 if (cont->state() != NULL) { | |
3228 if (!cont->is_set(BlockBegin::was_visited_flag)) { | |
3229 // add continuation to work list instead of parsing it immediately | |
3230 scope_data()->parent()->add_to_work_list(cont); | |
3231 } | |
3232 } | |
3233 | |
3234 assert(jsr_continuation() == cont, "continuation must not have changed"); | |
3235 assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) || | |
3236 jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag), | |
3237 "continuation can only be visited in case of backward branches"); | |
3238 assert(_last && _last->as_BlockEnd(), "block must have end"); | |
3239 | |
3240 // continuation is in work list, so end iteration of current block | |
3241 _skip_block = true; | |
3242 pop_scope_for_jsr(); | |
3243 | |
3244 return true; | |
3245 } | |
3246 | |
3247 | |
3248 // Inline the entry of a synchronized method as a monitor enter and | |
3249 // register the exception handler which releases the monitor if an | |
3250 // exception is thrown within the callee. Note that the monitor enter | |
3251 // cannot throw an exception itself, because the receiver is | |
3252 // guaranteed to be non-null by the explicit null check at the | |
3253 // beginning of inlining. | |
3254 void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) { | |
3255 assert(lock != NULL && sync_handler != NULL, "lock or handler missing"); | |
3256 | |
3257 set_exception_state(state()->copy()); | |
3258 monitorenter(lock, SynchronizationEntryBCI); | |
3259 assert(_last->as_MonitorEnter() != NULL, "monitor enter expected"); | |
3260 _last->set_needs_null_check(false); | |
3261 | |
3262 sync_handler->set(BlockBegin::exception_entry_flag); | |
3263 sync_handler->set(BlockBegin::is_on_work_list_flag); | |
3264 | |
3265 ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); | |
3266 XHandler* h = new XHandler(desc); | |
3267 h->set_entry_block(sync_handler); | |
3268 scope_data()->xhandlers()->append(h); | |
3269 scope_data()->set_has_handler(); | |
3270 } | |
3271 | |
3272 | |
3273 // If an exception is thrown and not handled within an inlined | |
3274 // synchronized method, the monitor must be released before the | |
3275 // exception is rethrown in the outer scope. Generate the appropriate | |
3276 // instructions here. | |
3277 void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) { | |
3278 BlockBegin* orig_block = _block; | |
3279 ValueStack* orig_state = _state; | |
3280 Instruction* orig_last = _last; | |
3281 _last = _block = sync_handler; | |
3282 _state = sync_handler->state()->copy(); | |
3283 | |
3284 assert(sync_handler != NULL, "handler missing"); | |
3285 assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here"); | |
3286 | |
3287 assert(lock != NULL || default_handler, "lock or handler missing"); | |
3288 | |
3289 XHandler* h = scope_data()->xhandlers()->remove_last(); | |
3290 assert(h->entry_block() == sync_handler, "corrupt list of handlers"); | |
3291 | |
3292 block()->set(BlockBegin::was_visited_flag); | |
3293 Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI); | |
3294 assert(exception->is_pinned(), "must be"); | |
3295 | |
3296 int bci = SynchronizationEntryBCI; | |
3297 if (lock) { | |
3298 assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing"); | |
3299 if (lock->bci() == -99) { | |
3300 lock = append_with_bci(lock, -1); | |
3301 } | |
3302 | |
3303 // exit the monitor in the context of the synchronized method | |
3304 monitorexit(lock, SynchronizationEntryBCI); | |
3305 | |
3306 // exit the context of the synchronized method | |
3307 if (!default_handler) { | |
3308 pop_scope(); | |
3309 _state = _state->copy(); | |
3310 bci = _state->scope()->caller_bci(); | |
3311 _state = _state->pop_scope()->copy(); | |
3312 } | |
3313 } | |
3314 | |
3315 // perform the throw as if at the the call site | |
3316 apush(exception); | |
3317 | |
3318 set_exception_state(state()->copy()); | |
3319 throw_op(bci); | |
3320 | |
3321 BlockEnd* end = last()->as_BlockEnd(); | |
3322 block()->set_end(end); | |
3323 end->set_state(state()); | |
3324 | |
3325 _block = orig_block; | |
3326 _state = orig_state; | |
3327 _last = orig_last; | |
3328 } | |
3329 | |
3330 | |
3331 bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known) { | |
3332 assert(!callee->is_native(), "callee must not be native"); | |
3333 | |
3334 // first perform tests of things it's not possible to inline | |
3335 if (callee->has_exception_handlers() && | |
3336 !InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers"); | |
3337 if (callee->is_synchronized() && | |
3338 !InlineSynchronizedMethods ) INLINE_BAILOUT("callee is synchronized"); | |
3339 if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet"); | |
3340 if (!callee->has_balanced_monitors()) INLINE_BAILOUT("callee's monitors do not match"); | |
3341 | |
3342 // Proper inlining of methods with jsrs requires a little more work. | |
3343 if (callee->has_jsrs() ) INLINE_BAILOUT("jsrs not handled properly by inliner yet"); | |
3344 | |
3345 // now perform tests that are based on flag settings | |
3346 if (inline_level() > MaxInlineLevel ) INLINE_BAILOUT("too-deep inlining"); | |
3347 if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("too-deep recursive inlining"); | |
3348 if (callee->code_size() > max_inline_size() ) INLINE_BAILOUT("callee is too large"); | |
3349 | |
3350 // don't inline throwable methods unless the inlining tree is rooted in a throwable class | |
3351 if (callee->name() == ciSymbol::object_initializer_name() && | |
3352 callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { | |
3353 // Throwable constructor call | |
3354 IRScope* top = scope(); | |
3355 while (top->caller() != NULL) { | |
3356 top = top->caller(); | |
3357 } | |
3358 if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { | |
3359 INLINE_BAILOUT("don't inline Throwable constructors"); | |
3360 } | |
3361 } | |
3362 | |
3363 // When SSE2 is used on intel, then no special handling is needed | |
3364 // for strictfp because the enum-constant is fixed at compile time, | |
3365 // the check for UseSSE2 is needed here | |
3366 if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) { | |
3367 INLINE_BAILOUT("caller and callee have different strict fp requirements"); | |
3368 } | |
3369 | |
3370 if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) { | |
3371 INLINE_BAILOUT("total inlining greater than DesiredMethodLimit"); | |
3372 } | |
3373 | |
3374 #ifndef PRODUCT | |
3375 // printing | |
3376 if (PrintInlining) { | |
3377 print_inline_result(callee, true); | |
3378 } | |
3379 #endif | |
3380 | |
3381 // NOTE: Bailouts from this point on, which occur at the | |
3382 // GraphBuilder level, do not cause bailout just of the inlining but | |
3383 // in fact of the entire compilation. | |
3384 | |
3385 BlockBegin* orig_block = block(); | |
3386 | |
3387 const int args_base = state()->stack_size() - callee->arg_size(); | |
3388 assert(args_base >= 0, "stack underflow during inlining"); | |
3389 | |
3390 // Insert null check if necessary | |
3391 Value recv = NULL; | |
3392 if (code() != Bytecodes::_invokestatic) { | |
3393 // note: null check must happen even if first instruction of callee does | |
3394 // an implicit null check since the callee is in a different scope | |
3395 // and we must make sure exception handling does the right thing | |
3396 assert(!callee->is_static(), "callee must not be static"); | |
3397 assert(callee->arg_size() > 0, "must have at least a receiver"); | |
3398 recv = state()->stack_at(args_base); | |
3399 null_check(recv); | |
3400 } | |
3401 | |
3402 if (profile_inlined_calls()) { | |
3403 profile_call(recv, holder_known ? callee->holder() : NULL); | |
3404 } | |
3405 | |
3406 profile_invocation(callee); | |
3407 | |
3408 // Introduce a new callee continuation point - if the callee has | |
3409 // more than one return instruction or the return does not allow | |
3410 // fall-through of control flow, all return instructions of the | |
3411 // callee will need to be replaced by Goto's pointing to this | |
3412 // continuation point. | |
3413 BlockBegin* cont = block_at(next_bci()); | |
3414 bool continuation_existed = true; | |
3415 if (cont == NULL) { | |
3416 cont = new BlockBegin(next_bci()); | |
3417 // low number so that continuation gets parsed as early as possible | |
3418 cont->set_depth_first_number(0); | |
3419 #ifndef PRODUCT | |
3420 if (PrintInitialBlockList) { | |
3421 tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d", | |
3422 cont->block_id(), cont->bci(), bci()); | |
3423 } | |
3424 #endif | |
3425 continuation_existed = false; | |
3426 } | |
3427 // Record number of predecessors of continuation block before | |
3428 // inlining, to detect if inlined method has edges to its | |
3429 // continuation after inlining. | |
3430 int continuation_preds = cont->number_of_preds(); | |
3431 | |
3432 // Push callee scope | |
3433 push_scope(callee, cont); | |
3434 | |
3435 // the BlockListBuilder for the callee could have bailed out | |
3436 CHECK_BAILOUT_(false); | |
3437 | |
3438 // Temporarily set up bytecode stream so we can append instructions | |
3439 // (only using the bci of this stream) | |
3440 scope_data()->set_stream(scope_data()->parent()->stream()); | |
3441 | |
3442 // Pass parameters into callee state: add assignments | |
3443 // note: this will also ensure that all arguments are computed before being passed | |
3444 ValueStack* callee_state = state(); | |
3445 ValueStack* caller_state = scope()->caller_state(); | |
3446 { int i = args_base; | |
3447 while (i < caller_state->stack_size()) { | |
3448 const int par_no = i - args_base; | |
3449 Value arg = caller_state->stack_at_inc(i); | |
3450 // NOTE: take base() of arg->type() to avoid problems storing | |
3451 // constants | |
3452 store_local(callee_state, arg, arg->type()->base(), par_no); | |
3453 } | |
3454 } | |
3455 | |
3456 // Remove args from stack. | |
3457 // Note that we preserve locals state in case we can use it later | |
3458 // (see use of pop_scope() below) | |
3459 caller_state->truncate_stack(args_base); | |
3460 callee_state->truncate_stack(args_base); | |
3461 | |
3462 // Setup state that is used at returns form the inlined method. | |
3463 // This is essentially the state of the continuation block, | |
3464 // but without the return value on stack, if any, this will | |
3465 // be pushed at the return instruction (see method_return). | |
3466 scope_data()->set_continuation_state(caller_state->copy()); | |
3467 | |
3468 // Compute lock stack size for callee scope now that args have been passed | |
3469 scope()->compute_lock_stack_size(); | |
3470 | |
3471 Value lock; | |
3472 BlockBegin* sync_handler; | |
3473 | |
3474 // Inline the locking of the receiver if the callee is synchronized | |
3475 if (callee->is_synchronized()) { | |
3476 lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror()))) | |
3477 : state()->local_at(0); | |
3478 sync_handler = new BlockBegin(-1); | |
3479 inline_sync_entry(lock, sync_handler); | |
3480 | |
3481 // recompute the lock stack size | |
3482 scope()->compute_lock_stack_size(); | |
3483 } | |
3484 | |
3485 | |
3486 BlockBegin* callee_start_block = block_at(0); | |
3487 if (callee_start_block != NULL) { | |
3488 assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header"); | |
3489 Goto* goto_callee = new Goto(callee_start_block, false); | |
3490 goto_callee->set_state(state()); | |
3491 // The state for this goto is in the scope of the callee, so use | |
3492 // the entry bci for the callee instead of the call site bci. | |
3493 append_with_bci(goto_callee, 0); | |
3494 _block->set_end(goto_callee); | |
3495 callee_start_block->merge(callee_state); | |
3496 | |
3497 _last = _block = callee_start_block; | |
3498 | |
3499 scope_data()->add_to_work_list(callee_start_block); | |
3500 } | |
3501 | |
3502 // Clear out bytecode stream | |
3503 scope_data()->set_stream(NULL); | |
3504 | |
3505 // Ready to resume parsing in callee (either in the same block we | |
3506 // were in before or in the callee's start block) | |
3507 iterate_all_blocks(callee_start_block == NULL); | |
3508 | |
3509 // If we bailed out during parsing, return immediately (this is bad news) | |
3510 if (bailed_out()) return false; | |
3511 | |
3512 // iterate_all_blocks theoretically traverses in random order; in | |
3513 // practice, we have only traversed the continuation if we are | |
3514 // inlining into a subroutine | |
3515 assert(continuation_existed || | |
3516 !continuation()->is_set(BlockBegin::was_visited_flag), | |
3517 "continuation should not have been parsed yet if we created it"); | |
3518 | |
3519 // If we bailed out during parsing, return immediately (this is bad news) | |
3520 CHECK_BAILOUT_(false); | |
3521 | |
3522 // At this point we are almost ready to return and resume parsing of | |
3523 // the caller back in the GraphBuilder. The only thing we want to do | |
3524 // first is an optimization: during parsing of the callee we | |
3525 // generated at least one Goto to the continuation block. If we | |
3526 // generated exactly one, and if the inlined method spanned exactly | |
3527 // one block (and we didn't have to Goto its entry), then we snip | |
3528 // off the Goto to the continuation, allowing control to fall | |
3529 // through back into the caller block and effectively performing | |
3530 // block merging. This allows load elimination and CSE to take place | |
3531 // across multiple callee scopes if they are relatively simple, and | |
3532 // is currently essential to making inlining profitable. | |
3533 if ( num_returns() == 1 | |
3534 && block() == orig_block | |
3535 && block() == inline_cleanup_block()) { | |
3536 _last = inline_cleanup_return_prev(); | |
3537 _state = inline_cleanup_state()->pop_scope(); | |
3538 } else if (continuation_preds == cont->number_of_preds()) { | |
3539 // Inlining caused that the instructions after the invoke in the | |
3540 // caller are not reachable any more. So skip filling this block | |
3541 // with instructions! | |
3542 assert (cont == continuation(), ""); | |
3543 assert(_last && _last->as_BlockEnd(), ""); | |
3544 _skip_block = true; | |
3545 } else { | |
3546 // Resume parsing in continuation block unless it was already parsed. | |
3547 // Note that if we don't change _last here, iteration in | |
3548 // iterate_bytecodes_for_block will stop when we return. | |
3549 if (!continuation()->is_set(BlockBegin::was_visited_flag)) { | |
3550 // add continuation to work list instead of parsing it immediately | |
3551 assert(_last && _last->as_BlockEnd(), ""); | |
3552 scope_data()->parent()->add_to_work_list(continuation()); | |
3553 _skip_block = true; | |
3554 } | |
3555 } | |
3556 | |
3557 // Fill the exception handler for synchronized methods with instructions | |
3558 if (callee->is_synchronized() && sync_handler->state() != NULL) { | |
3559 fill_sync_handler(lock, sync_handler); | |
3560 } else { | |
3561 pop_scope(); | |
3562 } | |
3563 | |
3564 compilation()->notice_inlined_method(callee); | |
3565 | |
3566 return true; | |
3567 } | |
3568 | |
3569 | |
3570 void GraphBuilder::inline_bailout(const char* msg) { | |
3571 assert(msg != NULL, "inline bailout msg must exist"); | |
3572 _inline_bailout_msg = msg; | |
3573 } | |
3574 | |
3575 | |
3576 void GraphBuilder::clear_inline_bailout() { | |
3577 _inline_bailout_msg = NULL; | |
3578 } | |
3579 | |
3580 | |
3581 void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) { | |
3582 ScopeData* data = new ScopeData(NULL); | |
3583 data->set_scope(scope); | |
3584 data->set_bci2block(bci2block); | |
3585 _scope_data = data; | |
3586 _block = start; | |
3587 } | |
3588 | |
3589 | |
3590 void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) { | |
3591 IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false); | |
3592 scope()->add_callee(callee_scope); | |
3593 | |
3594 BlockListBuilder blb(compilation(), callee_scope, -1); | |
3595 CHECK_BAILOUT(); | |
3596 | |
3597 if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) { | |
3598 // this scope can be inlined directly into the caller so remove | |
3599 // the block at bci 0. | |
3600 blb.bci2block()->at_put(0, NULL); | |
3601 } | |
3602 | |
3603 callee_scope->set_caller_state(state()); | |
3604 set_state(state()->push_scope(callee_scope)); | |
3605 | |
3606 ScopeData* data = new ScopeData(scope_data()); | |
3607 data->set_scope(callee_scope); | |
3608 data->set_bci2block(blb.bci2block()); | |
3609 data->set_continuation(continuation); | |
3610 _scope_data = data; | |
3611 } | |
3612 | |
3613 | |
3614 void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) { | |
3615 ScopeData* data = new ScopeData(scope_data()); | |
3616 data->set_parsing_jsr(); | |
3617 data->set_jsr_entry_bci(jsr_dest_bci); | |
3618 data->set_jsr_return_address_local(-1); | |
3619 // Must clone bci2block list as we will be mutating it in order to | |
3620 // properly clone all blocks in jsr region as well as exception | |
3621 // handlers containing rets | |
3622 BlockList* new_bci2block = new BlockList(bci2block()->length()); | |
3623 new_bci2block->push_all(bci2block()); | |
3624 data->set_bci2block(new_bci2block); | |
3625 data->set_scope(scope()); | |
3626 data->setup_jsr_xhandlers(); | |
3627 data->set_continuation(continuation()); | |
3628 if (continuation() != NULL) { | |
3629 assert(continuation_state() != NULL, ""); | |
3630 data->set_continuation_state(continuation_state()->copy()); | |
3631 } | |
3632 data->set_jsr_continuation(jsr_continuation); | |
3633 _scope_data = data; | |
3634 } | |
3635 | |
3636 | |
3637 void GraphBuilder::pop_scope() { | |
3638 int number_of_locks = scope()->number_of_locks(); | |
3639 _scope_data = scope_data()->parent(); | |
3640 // accumulate minimum number of monitor slots to be reserved | |
3641 scope()->set_min_number_of_locks(number_of_locks); | |
3642 } | |
3643 | |
3644 | |
3645 void GraphBuilder::pop_scope_for_jsr() { | |
3646 _scope_data = scope_data()->parent(); | |
3647 } | |
3648 | |
3649 bool GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) { | |
3650 if (InlineUnsafeOps) { | |
3651 Values* args = state()->pop_arguments(callee->arg_size()); | |
3652 null_check(args->at(0)); | |
3653 Instruction* offset = args->at(2); | |
3654 #ifndef _LP64 | |
3655 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3656 #endif | |
3657 Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile)); | |
3658 push(op->type(), op); | |
3659 compilation()->set_has_unsafe_access(true); | |
3660 } | |
3661 return InlineUnsafeOps; | |
3662 } | |
3663 | |
3664 | |
3665 bool GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) { | |
3666 if (InlineUnsafeOps) { | |
3667 Values* args = state()->pop_arguments(callee->arg_size()); | |
3668 null_check(args->at(0)); | |
3669 Instruction* offset = args->at(2); | |
3670 #ifndef _LP64 | |
3671 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3672 #endif | |
3673 Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, args->at(3), is_volatile)); | |
3674 compilation()->set_has_unsafe_access(true); | |
3675 kill_all(); | |
3676 } | |
3677 return InlineUnsafeOps; | |
3678 } | |
3679 | |
3680 | |
3681 bool GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) { | |
3682 if (InlineUnsafeOps) { | |
3683 Values* args = state()->pop_arguments(callee->arg_size()); | |
3684 null_check(args->at(0)); | |
3685 Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false)); | |
3686 push(op->type(), op); | |
3687 compilation()->set_has_unsafe_access(true); | |
3688 } | |
3689 return InlineUnsafeOps; | |
3690 } | |
3691 | |
3692 | |
3693 bool GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) { | |
3694 if (InlineUnsafeOps) { | |
3695 Values* args = state()->pop_arguments(callee->arg_size()); | |
3696 null_check(args->at(0)); | |
3697 Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2))); | |
3698 compilation()->set_has_unsafe_access(true); | |
3699 } | |
3700 return InlineUnsafeOps; | |
3701 } | |
3702 | |
3703 | |
3704 bool GraphBuilder::append_unsafe_prefetch(ciMethod* callee, bool is_static, bool is_store) { | |
3705 if (InlineUnsafeOps) { | |
3706 Values* args = state()->pop_arguments(callee->arg_size()); | |
3707 int obj_arg_index = 1; // Assume non-static case | |
3708 if (is_static) { | |
3709 obj_arg_index = 0; | |
3710 } else { | |
3711 null_check(args->at(0)); | |
3712 } | |
3713 Instruction* offset = args->at(obj_arg_index + 1); | |
3714 #ifndef _LP64 | |
3715 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3716 #endif | |
3717 Instruction* op = is_store ? append(new UnsafePrefetchWrite(args->at(obj_arg_index), offset)) | |
3718 : append(new UnsafePrefetchRead (args->at(obj_arg_index), offset)); | |
3719 compilation()->set_has_unsafe_access(true); | |
3720 } | |
3721 return InlineUnsafeOps; | |
3722 } | |
3723 | |
3724 | |
3725 void GraphBuilder::append_unsafe_CAS(ciMethod* callee) { | |
3726 ValueType* result_type = as_ValueType(callee->return_type()); | |
3727 assert(result_type->is_int(), "int result"); | |
3728 Values* args = state()->pop_arguments(callee->arg_size()); | |
3729 | |
3730 // Pop off some args to speically handle, then push back | |
3731 Value newval = args->pop(); | |
3732 Value cmpval = args->pop(); | |
3733 Value offset = args->pop(); | |
3734 Value src = args->pop(); | |
3735 Value unsafe_obj = args->pop(); | |
3736 | |
3737 // Separately handle the unsafe arg. It is not needed for code | |
3738 // generation, but must be null checked | |
3739 null_check(unsafe_obj); | |
3740 | |
3741 #ifndef _LP64 | |
3742 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3743 #endif | |
3744 | |
3745 args->push(src); | |
3746 args->push(offset); | |
3747 args->push(cmpval); | |
3748 args->push(newval); | |
3749 | |
3750 // An unsafe CAS can alias with other field accesses, but we don't | |
3751 // know which ones so mark the state as no preserved. This will | |
3752 // cause CSE to invalidate memory across it. | |
3753 bool preserves_state = false; | |
3754 Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, lock_stack(), preserves_state); | |
3755 append_split(result); | |
3756 push(result_type, result); | |
3757 compilation()->set_has_unsafe_access(true); | |
3758 } | |
3759 | |
3760 | |
3761 #ifndef PRODUCT | |
3762 void GraphBuilder::print_inline_result(ciMethod* callee, bool res) { | |
3763 const char sync_char = callee->is_synchronized() ? 's' : ' '; | |
3764 const char exception_char = callee->has_exception_handlers() ? '!' : ' '; | |
3765 const char monitors_char = callee->has_monitor_bytecodes() ? 'm' : ' '; | |
3766 tty->print(" %c%c%c ", sync_char, exception_char, monitors_char); | |
3767 for (int i = 0; i < scope()->level(); i++) tty->print(" "); | |
3768 if (res) { | |
3769 tty->print(" "); | |
3770 } else { | |
3771 tty->print("- "); | |
3772 } | |
3773 tty->print("@ %d ", bci()); | |
3774 callee->print_short_name(); | |
3775 tty->print(" (%d bytes)", callee->code_size()); | |
3776 if (_inline_bailout_msg) { | |
3777 tty->print(" %s", _inline_bailout_msg); | |
3778 } | |
3779 tty->cr(); | |
3780 | |
3781 if (res && CIPrintMethodCodes) { | |
3782 callee->print_codes(); | |
3783 } | |
3784 } | |
3785 | |
3786 | |
3787 void GraphBuilder::print_stats() { | |
3788 vmap()->print(); | |
3789 } | |
3790 #endif // PRODUCT | |
3791 | |
3792 | |
3793 void GraphBuilder::profile_call(Value recv, ciKlass* known_holder) { | |
3794 append(new ProfileCall(method(), bci(), recv, known_holder)); | |
3795 } | |
3796 | |
3797 | |
3798 void GraphBuilder::profile_invocation(ciMethod* callee) { | |
3799 if (profile_calls()) { | |
3800 // increment the interpreter_invocation_count for the inlinee | |
3801 Value m = append(new Constant(new ObjectConstant(callee))); | |
3802 append(new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1)); | |
3803 } | |
3804 } | |
3805 | |
3806 | |
3807 void GraphBuilder::profile_bci(int bci) { | |
3808 if (profile_branches()) { | |
3809 ciMethodData* md = method()->method_data(); | |
3810 if (md == NULL) { | |
3811 BAILOUT("out of memory building methodDataOop"); | |
3812 } | |
3813 ciProfileData* data = md->bci_to_data(bci); | |
3814 assert(data != NULL && data->is_JumpData(), "need JumpData for goto"); | |
3815 Value mdo = append(new Constant(new ObjectConstant(md))); | |
3816 append(new ProfileCounter(mdo, md->byte_offset_of_slot(data, JumpData::taken_offset()), 1)); | |
3817 } | |
3818 } |