Mercurial > hg > truffle
annotate src/share/vm/c1/c1_GraphBuilder.cpp @ 3639:2fd96b3040b9
Fixed build issue.
author | Thomas Wuerthinger <thomas.wuerthinger@oracle.com> |
---|---|
date | Wed, 16 Nov 2011 11:59:35 +0100 |
parents | 5d046bf49ce7 |
children | 2c359f27615c |
rev | line source |
---|---|
0 | 1 /* |
2166
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
2 * Copyright (c) 1999, 2011, Oracle and/or its affiliates. All rights reserved. |
0 | 3 * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. |
4 * | |
5 * This code is free software; you can redistribute it and/or modify it | |
6 * under the terms of the GNU General Public License version 2 only, as | |
7 * published by the Free Software Foundation. | |
8 * | |
9 * This code is distributed in the hope that it will be useful, but WITHOUT | |
10 * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
11 * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
12 * version 2 for more details (a copy is included in the LICENSE file that | |
13 * accompanied this code). | |
14 * | |
15 * You should have received a copy of the GNU General Public License version | |
16 * 2 along with this work; if not, write to the Free Software Foundation, | |
17 * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. | |
18 * | |
1552
c18cbe5936b8
6941466: Oracle rebranding changes for Hotspot repositories
trims
parents:
1540
diff
changeset
|
19 * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA |
c18cbe5936b8
6941466: Oracle rebranding changes for Hotspot repositories
trims
parents:
1540
diff
changeset
|
20 * or visit www.oracle.com if you need additional information or have any |
c18cbe5936b8
6941466: Oracle rebranding changes for Hotspot repositories
trims
parents:
1540
diff
changeset
|
21 * questions. |
0 | 22 * |
23 */ | |
24 | |
1972 | 25 #include "precompiled.hpp" |
26 #include "c1/c1_CFGPrinter.hpp" | |
27 #include "c1/c1_Canonicalizer.hpp" | |
28 #include "c1/c1_Compilation.hpp" | |
29 #include "c1/c1_GraphBuilder.hpp" | |
30 #include "c1/c1_InstructionPrinter.hpp" | |
31 #include "ci/ciField.hpp" | |
32 #include "ci/ciKlass.hpp" | |
2405
3d58a4983660
7022998: JSR 292 recursive method handle calls inline themselves infinitely
twisti
parents:
2376
diff
changeset
|
33 #include "compiler/compileBroker.hpp" |
1972 | 34 #include "interpreter/bytecode.hpp" |
35 #include "runtime/sharedRuntime.hpp" | |
36 #include "utilities/bitMap.inline.hpp" | |
0 | 37 |
38 class BlockListBuilder VALUE_OBJ_CLASS_SPEC { | |
39 private: | |
40 Compilation* _compilation; | |
41 IRScope* _scope; | |
42 | |
43 BlockList _blocks; // internal list of all blocks | |
44 BlockList* _bci2block; // mapping from bci to blocks for GraphBuilder | |
45 | |
46 // fields used by mark_loops | |
47 BitMap _active; // for iteration of control flow graph | |
48 BitMap _visited; // for iteration of control flow graph | |
49 intArray _loop_map; // caches the information if a block is contained in a loop | |
50 int _next_loop_index; // next free loop number | |
51 int _next_block_number; // for reverse postorder numbering of blocks | |
52 | |
53 // accessors | |
54 Compilation* compilation() const { return _compilation; } | |
55 IRScope* scope() const { return _scope; } | |
56 ciMethod* method() const { return scope()->method(); } | |
57 XHandlers* xhandlers() const { return scope()->xhandlers(); } | |
58 | |
59 // unified bailout support | |
60 void bailout(const char* msg) const { compilation()->bailout(msg); } | |
61 bool bailed_out() const { return compilation()->bailed_out(); } | |
62 | |
63 // helper functions | |
64 BlockBegin* make_block_at(int bci, BlockBegin* predecessor); | |
65 void handle_exceptions(BlockBegin* current, int cur_bci); | |
66 void handle_jsr(BlockBegin* current, int sr_bci, int next_bci); | |
67 void store_one(BlockBegin* current, int local); | |
68 void store_two(BlockBegin* current, int local); | |
69 void set_entries(int osr_bci); | |
70 void set_leaders(); | |
71 | |
72 void make_loop_header(BlockBegin* block); | |
73 void mark_loops(); | |
74 int mark_loops(BlockBegin* b, bool in_subroutine); | |
75 | |
76 // debugging | |
77 #ifndef PRODUCT | |
78 void print(); | |
79 #endif | |
80 | |
81 public: | |
82 // creation | |
83 BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci); | |
84 | |
85 // accessors for GraphBuilder | |
86 BlockList* bci2block() const { return _bci2block; } | |
87 }; | |
88 | |
89 | |
90 // Implementation of BlockListBuilder | |
91 | |
92 BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci) | |
93 : _compilation(compilation) | |
94 , _scope(scope) | |
95 , _blocks(16) | |
96 , _bci2block(new BlockList(scope->method()->code_size(), NULL)) | |
97 , _next_block_number(0) | |
98 , _active() // size not known yet | |
99 , _visited() // size not known yet | |
100 , _next_loop_index(0) | |
101 , _loop_map() // size not known yet | |
102 { | |
103 set_entries(osr_bci); | |
104 set_leaders(); | |
105 CHECK_BAILOUT(); | |
106 | |
107 mark_loops(); | |
108 NOT_PRODUCT(if (PrintInitialBlockList) print()); | |
109 | |
110 #ifndef PRODUCT | |
111 if (PrintCFGToFile) { | |
112 stringStream title; | |
113 title.print("BlockListBuilder "); | |
114 scope->method()->print_name(&title); | |
115 CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false); | |
116 } | |
117 #endif | |
118 } | |
119 | |
120 | |
121 void BlockListBuilder::set_entries(int osr_bci) { | |
122 // generate start blocks | |
123 BlockBegin* std_entry = make_block_at(0, NULL); | |
124 if (scope()->caller() == NULL) { | |
125 std_entry->set(BlockBegin::std_entry_flag); | |
126 } | |
127 if (osr_bci != -1) { | |
128 BlockBegin* osr_entry = make_block_at(osr_bci, NULL); | |
129 osr_entry->set(BlockBegin::osr_entry_flag); | |
130 } | |
131 | |
132 // generate exception entry blocks | |
133 XHandlers* list = xhandlers(); | |
134 const int n = list->length(); | |
135 for (int i = 0; i < n; i++) { | |
136 XHandler* h = list->handler_at(i); | |
137 BlockBegin* entry = make_block_at(h->handler_bci(), NULL); | |
138 entry->set(BlockBegin::exception_entry_flag); | |
139 h->set_entry_block(entry); | |
140 } | |
141 } | |
142 | |
143 | |
144 BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) { | |
145 assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer"); | |
146 | |
147 BlockBegin* block = _bci2block->at(cur_bci); | |
148 if (block == NULL) { | |
149 block = new BlockBegin(cur_bci); | |
150 block->init_stores_to_locals(method()->max_locals()); | |
151 _bci2block->at_put(cur_bci, block); | |
152 _blocks.append(block); | |
153 | |
154 assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist"); | |
155 } | |
156 | |
157 if (predecessor != NULL) { | |
158 if (block->is_set(BlockBegin::exception_entry_flag)) { | |
159 BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block); | |
160 } | |
161 | |
162 predecessor->add_successor(block); | |
163 block->increment_total_preds(); | |
164 } | |
165 | |
166 return block; | |
167 } | |
168 | |
169 | |
170 inline void BlockListBuilder::store_one(BlockBegin* current, int local) { | |
171 current->stores_to_locals().set_bit(local); | |
172 } | |
173 inline void BlockListBuilder::store_two(BlockBegin* current, int local) { | |
174 store_one(current, local); | |
175 store_one(current, local + 1); | |
176 } | |
177 | |
178 | |
179 void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) { | |
180 // Draws edges from a block to its exception handlers | |
181 XHandlers* list = xhandlers(); | |
182 const int n = list->length(); | |
183 | |
184 for (int i = 0; i < n; i++) { | |
185 XHandler* h = list->handler_at(i); | |
186 | |
187 if (h->covers(cur_bci)) { | |
188 BlockBegin* entry = h->entry_block(); | |
189 assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set"); | |
190 assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set"); | |
191 | |
192 // add each exception handler only once | |
193 if (!current->is_successor(entry)) { | |
194 current->add_successor(entry); | |
195 entry->increment_total_preds(); | |
196 } | |
197 | |
198 // stop when reaching catchall | |
199 if (h->catch_type() == 0) break; | |
200 } | |
201 } | |
202 } | |
203 | |
204 void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) { | |
205 // start a new block after jsr-bytecode and link this block into cfg | |
206 make_block_at(next_bci, current); | |
207 | |
208 // start a new block at the subroutine entry at mark it with special flag | |
209 BlockBegin* sr_block = make_block_at(sr_bci, current); | |
210 if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) { | |
211 sr_block->set(BlockBegin::subroutine_entry_flag); | |
212 } | |
213 } | |
214 | |
215 | |
216 void BlockListBuilder::set_leaders() { | |
217 bool has_xhandlers = xhandlers()->has_handlers(); | |
218 BlockBegin* current = NULL; | |
219 | |
220 // The information which bci starts a new block simplifies the analysis | |
221 // Without it, backward branches could jump to a bci where no block was created | |
222 // during bytecode iteration. This would require the creation of a new block at the | |
223 // branch target and a modification of the successor lists. | |
224 BitMap bci_block_start = method()->bci_block_start(); | |
225 | |
226 ciBytecodeStream s(method()); | |
227 while (s.next() != ciBytecodeStream::EOBC()) { | |
228 int cur_bci = s.cur_bci(); | |
229 | |
230 if (bci_block_start.at(cur_bci)) { | |
231 current = make_block_at(cur_bci, current); | |
232 } | |
233 assert(current != NULL, "must have current block"); | |
234 | |
235 if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) { | |
236 handle_exceptions(current, cur_bci); | |
237 } | |
238 | |
239 switch (s.cur_bc()) { | |
240 // track stores to local variables for selective creation of phi functions | |
241 case Bytecodes::_iinc: store_one(current, s.get_index()); break; | |
242 case Bytecodes::_istore: store_one(current, s.get_index()); break; | |
243 case Bytecodes::_lstore: store_two(current, s.get_index()); break; | |
244 case Bytecodes::_fstore: store_one(current, s.get_index()); break; | |
245 case Bytecodes::_dstore: store_two(current, s.get_index()); break; | |
246 case Bytecodes::_astore: store_one(current, s.get_index()); break; | |
247 case Bytecodes::_istore_0: store_one(current, 0); break; | |
248 case Bytecodes::_istore_1: store_one(current, 1); break; | |
249 case Bytecodes::_istore_2: store_one(current, 2); break; | |
250 case Bytecodes::_istore_3: store_one(current, 3); break; | |
251 case Bytecodes::_lstore_0: store_two(current, 0); break; | |
252 case Bytecodes::_lstore_1: store_two(current, 1); break; | |
253 case Bytecodes::_lstore_2: store_two(current, 2); break; | |
254 case Bytecodes::_lstore_3: store_two(current, 3); break; | |
255 case Bytecodes::_fstore_0: store_one(current, 0); break; | |
256 case Bytecodes::_fstore_1: store_one(current, 1); break; | |
257 case Bytecodes::_fstore_2: store_one(current, 2); break; | |
258 case Bytecodes::_fstore_3: store_one(current, 3); break; | |
259 case Bytecodes::_dstore_0: store_two(current, 0); break; | |
260 case Bytecodes::_dstore_1: store_two(current, 1); break; | |
261 case Bytecodes::_dstore_2: store_two(current, 2); break; | |
262 case Bytecodes::_dstore_3: store_two(current, 3); break; | |
263 case Bytecodes::_astore_0: store_one(current, 0); break; | |
264 case Bytecodes::_astore_1: store_one(current, 1); break; | |
265 case Bytecodes::_astore_2: store_one(current, 2); break; | |
266 case Bytecodes::_astore_3: store_one(current, 3); break; | |
267 | |
268 // track bytecodes that affect the control flow | |
269 case Bytecodes::_athrow: // fall through | |
270 case Bytecodes::_ret: // fall through | |
271 case Bytecodes::_ireturn: // fall through | |
272 case Bytecodes::_lreturn: // fall through | |
273 case Bytecodes::_freturn: // fall through | |
274 case Bytecodes::_dreturn: // fall through | |
275 case Bytecodes::_areturn: // fall through | |
276 case Bytecodes::_return: | |
277 current = NULL; | |
278 break; | |
279 | |
280 case Bytecodes::_ifeq: // fall through | |
281 case Bytecodes::_ifne: // fall through | |
282 case Bytecodes::_iflt: // fall through | |
283 case Bytecodes::_ifge: // fall through | |
284 case Bytecodes::_ifgt: // fall through | |
285 case Bytecodes::_ifle: // fall through | |
286 case Bytecodes::_if_icmpeq: // fall through | |
287 case Bytecodes::_if_icmpne: // fall through | |
288 case Bytecodes::_if_icmplt: // fall through | |
289 case Bytecodes::_if_icmpge: // fall through | |
290 case Bytecodes::_if_icmpgt: // fall through | |
291 case Bytecodes::_if_icmple: // fall through | |
292 case Bytecodes::_if_acmpeq: // fall through | |
293 case Bytecodes::_if_acmpne: // fall through | |
294 case Bytecodes::_ifnull: // fall through | |
295 case Bytecodes::_ifnonnull: | |
296 make_block_at(s.next_bci(), current); | |
297 make_block_at(s.get_dest(), current); | |
298 current = NULL; | |
299 break; | |
300 | |
301 case Bytecodes::_goto: | |
302 make_block_at(s.get_dest(), current); | |
303 current = NULL; | |
304 break; | |
305 | |
306 case Bytecodes::_goto_w: | |
307 make_block_at(s.get_far_dest(), current); | |
308 current = NULL; | |
309 break; | |
310 | |
311 case Bytecodes::_jsr: | |
312 handle_jsr(current, s.get_dest(), s.next_bci()); | |
313 current = NULL; | |
314 break; | |
315 | |
316 case Bytecodes::_jsr_w: | |
317 handle_jsr(current, s.get_far_dest(), s.next_bci()); | |
318 current = NULL; | |
319 break; | |
320 | |
321 case Bytecodes::_tableswitch: { | |
322 // set block for each case | |
2142 | 323 Bytecode_tableswitch sw(&s); |
324 int l = sw.length(); | |
0 | 325 for (int i = 0; i < l; i++) { |
2142 | 326 make_block_at(cur_bci + sw.dest_offset_at(i), current); |
0 | 327 } |
2142 | 328 make_block_at(cur_bci + sw.default_offset(), current); |
0 | 329 current = NULL; |
330 break; | |
331 } | |
332 | |
333 case Bytecodes::_lookupswitch: { | |
334 // set block for each case | |
2142 | 335 Bytecode_lookupswitch sw(&s); |
336 int l = sw.number_of_pairs(); | |
0 | 337 for (int i = 0; i < l; i++) { |
2142 | 338 make_block_at(cur_bci + sw.pair_at(i).offset(), current); |
0 | 339 } |
2142 | 340 make_block_at(cur_bci + sw.default_offset(), current); |
0 | 341 current = NULL; |
342 break; | |
343 } | |
344 } | |
345 } | |
346 } | |
347 | |
348 | |
349 void BlockListBuilder::mark_loops() { | |
350 ResourceMark rm; | |
351 | |
352 _active = BitMap(BlockBegin::number_of_blocks()); _active.clear(); | |
353 _visited = BitMap(BlockBegin::number_of_blocks()); _visited.clear(); | |
354 _loop_map = intArray(BlockBegin::number_of_blocks(), 0); | |
355 _next_loop_index = 0; | |
356 _next_block_number = _blocks.length(); | |
357 | |
358 // recursively iterate the control flow graph | |
359 mark_loops(_bci2block->at(0), false); | |
360 assert(_next_block_number >= 0, "invalid block numbers"); | |
361 } | |
362 | |
363 void BlockListBuilder::make_loop_header(BlockBegin* block) { | |
364 if (block->is_set(BlockBegin::exception_entry_flag)) { | |
365 // exception edges may look like loops but don't mark them as such | |
366 // since it screws up block ordering. | |
367 return; | |
368 } | |
369 if (!block->is_set(BlockBegin::parser_loop_header_flag)) { | |
370 block->set(BlockBegin::parser_loop_header_flag); | |
371 | |
372 assert(_loop_map.at(block->block_id()) == 0, "must not be set yet"); | |
373 assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer"); | |
374 _loop_map.at_put(block->block_id(), 1 << _next_loop_index); | |
375 if (_next_loop_index < 31) _next_loop_index++; | |
376 } else { | |
377 // block already marked as loop header | |
1060 | 378 assert(is_power_of_2((unsigned int)_loop_map.at(block->block_id())), "exactly one bit must be set"); |
0 | 379 } |
380 } | |
381 | |
382 int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) { | |
383 int block_id = block->block_id(); | |
384 | |
385 if (_visited.at(block_id)) { | |
386 if (_active.at(block_id)) { | |
387 // reached block via backward branch | |
388 make_loop_header(block); | |
389 } | |
390 // return cached loop information for this block | |
391 return _loop_map.at(block_id); | |
392 } | |
393 | |
394 if (block->is_set(BlockBegin::subroutine_entry_flag)) { | |
395 in_subroutine = true; | |
396 } | |
397 | |
398 // set active and visited bits before successors are processed | |
399 _visited.set_bit(block_id); | |
400 _active.set_bit(block_id); | |
401 | |
402 intptr_t loop_state = 0; | |
403 for (int i = block->number_of_sux() - 1; i >= 0; i--) { | |
404 // recursively process all successors | |
405 loop_state |= mark_loops(block->sux_at(i), in_subroutine); | |
406 } | |
407 | |
408 // clear active-bit after all successors are processed | |
409 _active.clear_bit(block_id); | |
410 | |
411 // reverse-post-order numbering of all blocks | |
412 block->set_depth_first_number(_next_block_number); | |
413 _next_block_number--; | |
414 | |
415 if (loop_state != 0 || in_subroutine ) { | |
416 // block is contained at least in one loop, so phi functions are necessary | |
417 // phi functions are also necessary for all locals stored in a subroutine | |
418 scope()->requires_phi_function().set_union(block->stores_to_locals()); | |
419 } | |
420 | |
421 if (block->is_set(BlockBegin::parser_loop_header_flag)) { | |
422 int header_loop_state = _loop_map.at(block_id); | |
423 assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set"); | |
424 | |
425 // If the highest bit is set (i.e. when integer value is negative), the method | |
426 // has 32 or more loops. This bit is never cleared because it is used for multiple loops | |
427 if (header_loop_state >= 0) { | |
428 clear_bits(loop_state, header_loop_state); | |
429 } | |
430 } | |
431 | |
432 // cache and return loop information for this block | |
433 _loop_map.at_put(block_id, loop_state); | |
434 return loop_state; | |
435 } | |
436 | |
437 | |
438 #ifndef PRODUCT | |
439 | |
440 int compare_depth_first(BlockBegin** a, BlockBegin** b) { | |
441 return (*a)->depth_first_number() - (*b)->depth_first_number(); | |
442 } | |
443 | |
444 void BlockListBuilder::print() { | |
445 tty->print("----- initial block list of BlockListBuilder for method "); | |
446 method()->print_short_name(); | |
447 tty->cr(); | |
448 | |
449 // better readability if blocks are sorted in processing order | |
450 _blocks.sort(compare_depth_first); | |
451 | |
452 for (int i = 0; i < _blocks.length(); i++) { | |
453 BlockBegin* cur = _blocks.at(i); | |
454 tty->print("%4d: B%-4d bci: %-4d preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds()); | |
455 | |
456 tty->print(cur->is_set(BlockBegin::std_entry_flag) ? " std" : " "); | |
457 tty->print(cur->is_set(BlockBegin::osr_entry_flag) ? " osr" : " "); | |
458 tty->print(cur->is_set(BlockBegin::exception_entry_flag) ? " ex" : " "); | |
459 tty->print(cur->is_set(BlockBegin::subroutine_entry_flag) ? " sr" : " "); | |
460 tty->print(cur->is_set(BlockBegin::parser_loop_header_flag) ? " lh" : " "); | |
461 | |
462 if (cur->number_of_sux() > 0) { | |
463 tty->print(" sux: "); | |
464 for (int j = 0; j < cur->number_of_sux(); j++) { | |
465 BlockBegin* sux = cur->sux_at(j); | |
466 tty->print("B%d ", sux->block_id()); | |
467 } | |
468 } | |
469 tty->cr(); | |
470 } | |
471 } | |
472 | |
473 #endif | |
474 | |
475 | |
476 // A simple growable array of Values indexed by ciFields | |
477 class FieldBuffer: public CompilationResourceObj { | |
478 private: | |
479 GrowableArray<Value> _values; | |
480 | |
481 public: | |
482 FieldBuffer() {} | |
483 | |
484 void kill() { | |
485 _values.trunc_to(0); | |
486 } | |
487 | |
488 Value at(ciField* field) { | |
489 assert(field->holder()->is_loaded(), "must be a loaded field"); | |
490 int offset = field->offset(); | |
491 if (offset < _values.length()) { | |
492 return _values.at(offset); | |
493 } else { | |
494 return NULL; | |
495 } | |
496 } | |
497 | |
498 void at_put(ciField* field, Value value) { | |
499 assert(field->holder()->is_loaded(), "must be a loaded field"); | |
500 int offset = field->offset(); | |
501 _values.at_put_grow(offset, value, NULL); | |
502 } | |
503 | |
504 }; | |
505 | |
506 | |
507 // MemoryBuffer is fairly simple model of the current state of memory. | |
508 // It partitions memory into several pieces. The first piece is | |
509 // generic memory where little is known about the owner of the memory. | |
510 // This is conceptually represented by the tuple <O, F, V> which says | |
511 // that the field F of object O has value V. This is flattened so | |
512 // that F is represented by the offset of the field and the parallel | |
513 // arrays _objects and _values are used for O and V. Loads of O.F can | |
514 // simply use V. Newly allocated objects are kept in a separate list | |
515 // along with a parallel array for each object which represents the | |
516 // current value of its fields. Stores of the default value to fields | |
517 // which have never been stored to before are eliminated since they | |
518 // are redundant. Once newly allocated objects are stored into | |
519 // another object or they are passed out of the current compile they | |
520 // are treated like generic memory. | |
521 | |
522 class MemoryBuffer: public CompilationResourceObj { | |
523 private: | |
524 FieldBuffer _values; | |
525 GrowableArray<Value> _objects; | |
526 GrowableArray<Value> _newobjects; | |
527 GrowableArray<FieldBuffer*> _fields; | |
528 | |
529 public: | |
530 MemoryBuffer() {} | |
531 | |
532 StoreField* store(StoreField* st) { | |
533 if (!EliminateFieldAccess) { | |
534 return st; | |
535 } | |
536 | |
537 Value object = st->obj(); | |
538 Value value = st->value(); | |
539 ciField* field = st->field(); | |
540 if (field->holder()->is_loaded()) { | |
541 int offset = field->offset(); | |
542 int index = _newobjects.find(object); | |
543 if (index != -1) { | |
544 // newly allocated object with no other stores performed on this field | |
545 FieldBuffer* buf = _fields.at(index); | |
546 if (buf->at(field) == NULL && is_default_value(value)) { | |
547 #ifndef PRODUCT | |
548 if (PrintIRDuringConstruction && Verbose) { | |
549 tty->print_cr("Eliminated store for object %d:", index); | |
550 st->print_line(); | |
551 } | |
552 #endif | |
553 return NULL; | |
554 } else { | |
555 buf->at_put(field, value); | |
556 } | |
557 } else { | |
558 _objects.at_put_grow(offset, object, NULL); | |
559 _values.at_put(field, value); | |
560 } | |
561 | |
562 store_value(value); | |
563 } else { | |
564 // if we held onto field names we could alias based on names but | |
565 // we don't know what's being stored to so kill it all. | |
566 kill(); | |
567 } | |
568 return st; | |
569 } | |
570 | |
571 | |
572 // return true if this value correspond to the default value of a field. | |
573 bool is_default_value(Value value) { | |
574 Constant* con = value->as_Constant(); | |
575 if (con) { | |
576 switch (con->type()->tag()) { | |
577 case intTag: return con->type()->as_IntConstant()->value() == 0; | |
578 case longTag: return con->type()->as_LongConstant()->value() == 0; | |
579 case floatTag: return jint_cast(con->type()->as_FloatConstant()->value()) == 0; | |
580 case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0); | |
581 case objectTag: return con->type() == objectNull; | |
582 default: ShouldNotReachHere(); | |
583 } | |
584 } | |
585 return false; | |
586 } | |
587 | |
588 | |
589 // return either the actual value of a load or the load itself | |
590 Value load(LoadField* load) { | |
591 if (!EliminateFieldAccess) { | |
592 return load; | |
593 } | |
594 | |
595 if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) { | |
596 // can't skip load since value might get rounded as a side effect | |
597 return load; | |
598 } | |
599 | |
600 ciField* field = load->field(); | |
601 Value object = load->obj(); | |
602 if (field->holder()->is_loaded() && !field->is_volatile()) { | |
603 int offset = field->offset(); | |
604 Value result = NULL; | |
605 int index = _newobjects.find(object); | |
606 if (index != -1) { | |
607 result = _fields.at(index)->at(field); | |
608 } else if (_objects.at_grow(offset, NULL) == object) { | |
609 result = _values.at(field); | |
610 } | |
611 if (result != NULL) { | |
612 #ifndef PRODUCT | |
613 if (PrintIRDuringConstruction && Verbose) { | |
614 tty->print_cr("Eliminated load: "); | |
615 load->print_line(); | |
616 } | |
617 #endif | |
618 assert(result->type()->tag() == load->type()->tag(), "wrong types"); | |
619 return result; | |
620 } | |
621 } | |
622 return load; | |
623 } | |
624 | |
625 // Record this newly allocated object | |
626 void new_instance(NewInstance* object) { | |
627 int index = _newobjects.length(); | |
628 _newobjects.append(object); | |
629 if (_fields.at_grow(index, NULL) == NULL) { | |
630 _fields.at_put(index, new FieldBuffer()); | |
631 } else { | |
632 _fields.at(index)->kill(); | |
633 } | |
634 } | |
635 | |
636 void store_value(Value value) { | |
637 int index = _newobjects.find(value); | |
638 if (index != -1) { | |
639 // stored a newly allocated object into another object. | |
640 // Assume we've lost track of it as separate slice of memory. | |
641 // We could do better by keeping track of whether individual | |
642 // fields could alias each other. | |
643 _newobjects.remove_at(index); | |
644 // pull out the field info and store it at the end up the list | |
645 // of field info list to be reused later. | |
646 _fields.append(_fields.at(index)); | |
647 _fields.remove_at(index); | |
648 } | |
649 } | |
650 | |
651 void kill() { | |
652 _newobjects.trunc_to(0); | |
653 _objects.trunc_to(0); | |
654 _values.kill(); | |
655 } | |
656 }; | |
657 | |
658 | |
659 // Implementation of GraphBuilder's ScopeData | |
660 | |
661 GraphBuilder::ScopeData::ScopeData(ScopeData* parent) | |
662 : _parent(parent) | |
663 , _bci2block(NULL) | |
664 , _scope(NULL) | |
665 , _has_handler(false) | |
666 , _stream(NULL) | |
667 , _work_list(NULL) | |
668 , _parsing_jsr(false) | |
669 , _jsr_xhandlers(NULL) | |
670 , _caller_stack_size(-1) | |
671 , _continuation(NULL) | |
672 , _num_returns(0) | |
673 , _cleanup_block(NULL) | |
674 , _cleanup_return_prev(NULL) | |
675 , _cleanup_state(NULL) | |
676 { | |
677 if (parent != NULL) { | |
678 _max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f); | |
679 } else { | |
680 _max_inline_size = MaxInlineSize; | |
681 } | |
682 if (_max_inline_size < MaxTrivialSize) { | |
683 _max_inline_size = MaxTrivialSize; | |
684 } | |
685 } | |
686 | |
687 | |
688 void GraphBuilder::kill_all() { | |
689 if (UseLocalValueNumbering) { | |
690 vmap()->kill_all(); | |
691 } | |
692 _memory->kill(); | |
693 } | |
694 | |
695 | |
696 BlockBegin* GraphBuilder::ScopeData::block_at(int bci) { | |
697 if (parsing_jsr()) { | |
698 // It is necessary to clone all blocks associated with a | |
699 // subroutine, including those for exception handlers in the scope | |
700 // of the method containing the jsr (because those exception | |
701 // handlers may contain ret instructions in some cases). | |
702 BlockBegin* block = bci2block()->at(bci); | |
703 if (block != NULL && block == parent()->bci2block()->at(bci)) { | |
704 BlockBegin* new_block = new BlockBegin(block->bci()); | |
705 #ifndef PRODUCT | |
706 if (PrintInitialBlockList) { | |
707 tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr", | |
708 block->block_id(), block->bci(), new_block->block_id()); | |
709 } | |
710 #endif | |
711 // copy data from cloned blocked | |
712 new_block->set_depth_first_number(block->depth_first_number()); | |
713 if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag); | |
714 // Preserve certain flags for assertion checking | |
715 if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag); | |
716 if (block->is_set(BlockBegin::exception_entry_flag)) new_block->set(BlockBegin::exception_entry_flag); | |
717 | |
718 // copy was_visited_flag to allow early detection of bailouts | |
719 // if a block that is used in a jsr has already been visited before, | |
720 // it is shared between the normal control flow and a subroutine | |
721 // BlockBegin::try_merge returns false when the flag is set, this leads | |
722 // to a compilation bailout | |
723 if (block->is_set(BlockBegin::was_visited_flag)) new_block->set(BlockBegin::was_visited_flag); | |
724 | |
725 bci2block()->at_put(bci, new_block); | |
726 block = new_block; | |
727 } | |
728 return block; | |
729 } else { | |
730 return bci2block()->at(bci); | |
731 } | |
732 } | |
733 | |
734 | |
735 XHandlers* GraphBuilder::ScopeData::xhandlers() const { | |
736 if (_jsr_xhandlers == NULL) { | |
737 assert(!parsing_jsr(), ""); | |
738 return scope()->xhandlers(); | |
739 } | |
740 assert(parsing_jsr(), ""); | |
741 return _jsr_xhandlers; | |
742 } | |
743 | |
744 | |
745 void GraphBuilder::ScopeData::set_scope(IRScope* scope) { | |
746 _scope = scope; | |
747 bool parent_has_handler = false; | |
748 if (parent() != NULL) { | |
749 parent_has_handler = parent()->has_handler(); | |
750 } | |
751 _has_handler = parent_has_handler || scope->xhandlers()->has_handlers(); | |
752 } | |
753 | |
754 | |
755 void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block, | |
756 Instruction* return_prev, | |
757 ValueStack* return_state) { | |
758 _cleanup_block = block; | |
759 _cleanup_return_prev = return_prev; | |
760 _cleanup_state = return_state; | |
761 } | |
762 | |
763 | |
764 void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) { | |
765 if (_work_list == NULL) { | |
766 _work_list = new BlockList(); | |
767 } | |
768 | |
769 if (!block->is_set(BlockBegin::is_on_work_list_flag)) { | |
770 // Do not start parsing the continuation block while in a | |
771 // sub-scope | |
772 if (parsing_jsr()) { | |
773 if (block == jsr_continuation()) { | |
774 return; | |
775 } | |
776 } else { | |
777 if (block == continuation()) { | |
778 return; | |
779 } | |
780 } | |
781 block->set(BlockBegin::is_on_work_list_flag); | |
782 _work_list->push(block); | |
783 | |
784 sort_top_into_worklist(_work_list, block); | |
785 } | |
786 } | |
787 | |
788 | |
789 void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) { | |
790 assert(worklist->top() == top, ""); | |
791 // sort block descending into work list | |
792 const int dfn = top->depth_first_number(); | |
793 assert(dfn != -1, "unknown depth first number"); | |
794 int i = worklist->length()-2; | |
795 while (i >= 0) { | |
796 BlockBegin* b = worklist->at(i); | |
797 if (b->depth_first_number() < dfn) { | |
798 worklist->at_put(i+1, b); | |
799 } else { | |
800 break; | |
801 } | |
802 i --; | |
803 } | |
804 if (i >= -1) worklist->at_put(i + 1, top); | |
805 } | |
806 | |
807 | |
808 BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() { | |
809 if (is_work_list_empty()) { | |
810 return NULL; | |
811 } | |
812 return _work_list->pop(); | |
813 } | |
814 | |
815 | |
816 bool GraphBuilder::ScopeData::is_work_list_empty() const { | |
817 return (_work_list == NULL || _work_list->length() == 0); | |
818 } | |
819 | |
820 | |
821 void GraphBuilder::ScopeData::setup_jsr_xhandlers() { | |
822 assert(parsing_jsr(), ""); | |
823 // clone all the exception handlers from the scope | |
824 XHandlers* handlers = new XHandlers(scope()->xhandlers()); | |
825 const int n = handlers->length(); | |
826 for (int i = 0; i < n; i++) { | |
827 // The XHandlers need to be adjusted to dispatch to the cloned | |
828 // handler block instead of the default one but the synthetic | |
829 // unlocker needs to be handled specially. The synthetic unlocker | |
830 // should be left alone since there can be only one and all code | |
831 // should dispatch to the same one. | |
832 XHandler* h = handlers->handler_at(i); | |
1378
9f5b60a14736
6939930: exception unwind changes in 6919934 hurts compilation speed
never
parents:
1295
diff
changeset
|
833 assert(h->handler_bci() != SynchronizationEntryBCI, "must be real"); |
9f5b60a14736
6939930: exception unwind changes in 6919934 hurts compilation speed
never
parents:
1295
diff
changeset
|
834 h->set_entry_block(block_at(h->handler_bci())); |
0 | 835 } |
836 _jsr_xhandlers = handlers; | |
837 } | |
838 | |
839 | |
840 int GraphBuilder::ScopeData::num_returns() { | |
841 if (parsing_jsr()) { | |
842 return parent()->num_returns(); | |
843 } | |
844 return _num_returns; | |
845 } | |
846 | |
847 | |
848 void GraphBuilder::ScopeData::incr_num_returns() { | |
849 if (parsing_jsr()) { | |
850 parent()->incr_num_returns(); | |
851 } else { | |
852 ++_num_returns; | |
853 } | |
854 } | |
855 | |
856 | |
857 // Implementation of GraphBuilder | |
858 | |
859 #define INLINE_BAILOUT(msg) { inline_bailout(msg); return false; } | |
860 | |
861 | |
862 void GraphBuilder::load_constant() { | |
863 ciConstant con = stream()->get_constant(); | |
864 if (con.basic_type() == T_ILLEGAL) { | |
865 BAILOUT("could not resolve a constant"); | |
866 } else { | |
867 ValueType* t = illegalType; | |
868 ValueStack* patch_state = NULL; | |
869 switch (con.basic_type()) { | |
870 case T_BOOLEAN: t = new IntConstant (con.as_boolean()); break; | |
871 case T_BYTE : t = new IntConstant (con.as_byte ()); break; | |
872 case T_CHAR : t = new IntConstant (con.as_char ()); break; | |
873 case T_SHORT : t = new IntConstant (con.as_short ()); break; | |
874 case T_INT : t = new IntConstant (con.as_int ()); break; | |
875 case T_LONG : t = new LongConstant (con.as_long ()); break; | |
876 case T_FLOAT : t = new FloatConstant (con.as_float ()); break; | |
877 case T_DOUBLE : t = new DoubleConstant (con.as_double ()); break; | |
878 case T_ARRAY : t = new ArrayConstant (con.as_object ()->as_array ()); break; | |
879 case T_OBJECT : | |
880 { | |
881 ciObject* obj = con.as_object(); | |
1602 | 882 if (!obj->is_loaded() |
883 || (PatchALot && obj->klass() != ciEnv::current()->String_klass())) { | |
1819 | 884 patch_state = copy_state_before(); |
1602 | 885 t = new ObjectConstant(obj); |
0 | 886 } else { |
1602 | 887 assert(!obj->is_klass(), "must be java_mirror of klass"); |
0 | 888 t = new InstanceConstant(obj->as_instance()); |
889 } | |
890 break; | |
891 } | |
892 default : ShouldNotReachHere(); | |
893 } | |
894 Value x; | |
895 if (patch_state != NULL) { | |
896 x = new Constant(t, patch_state); | |
897 } else { | |
898 x = new Constant(t); | |
899 } | |
900 push(t, append(x)); | |
901 } | |
902 } | |
903 | |
904 | |
905 void GraphBuilder::load_local(ValueType* type, int index) { | |
1819 | 906 Value x = state()->local_at(index); |
907 assert(x != NULL && !x->type()->is_illegal(), "access of illegal local variable"); | |
0 | 908 push(type, x); |
909 } | |
910 | |
911 | |
912 void GraphBuilder::store_local(ValueType* type, int index) { | |
913 Value x = pop(type); | |
914 store_local(state(), x, type, index); | |
915 } | |
916 | |
917 | |
918 void GraphBuilder::store_local(ValueStack* state, Value x, ValueType* type, int index) { | |
919 if (parsing_jsr()) { | |
920 // We need to do additional tracking of the location of the return | |
921 // address for jsrs since we don't handle arbitrary jsr/ret | |
922 // constructs. Here we are figuring out in which circumstances we | |
923 // need to bail out. | |
924 if (x->type()->is_address()) { | |
925 scope_data()->set_jsr_return_address_local(index); | |
926 | |
927 // Also check parent jsrs (if any) at this time to see whether | |
928 // they are using this local. We don't handle skipping over a | |
929 // ret. | |
930 for (ScopeData* cur_scope_data = scope_data()->parent(); | |
931 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); | |
932 cur_scope_data = cur_scope_data->parent()) { | |
933 if (cur_scope_data->jsr_return_address_local() == index) { | |
934 BAILOUT("subroutine overwrites return address from previous subroutine"); | |
935 } | |
936 } | |
937 } else if (index == scope_data()->jsr_return_address_local()) { | |
938 scope_data()->set_jsr_return_address_local(-1); | |
939 } | |
940 } | |
941 | |
942 state->store_local(index, round_fp(x)); | |
943 } | |
944 | |
945 | |
946 void GraphBuilder::load_indexed(BasicType type) { | |
1819 | 947 ValueStack* state_before = copy_state_for_exception(); |
0 | 948 Value index = ipop(); |
949 Value array = apop(); | |
950 Value length = NULL; | |
951 if (CSEArrayLength || | |
952 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || | |
953 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { | |
1819 | 954 length = append(new ArrayLength(array, state_before)); |
0 | 955 } |
1819 | 956 push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, state_before))); |
0 | 957 } |
958 | |
959 | |
960 void GraphBuilder::store_indexed(BasicType type) { | |
1819 | 961 ValueStack* state_before = copy_state_for_exception(); |
0 | 962 Value value = pop(as_ValueType(type)); |
963 Value index = ipop(); | |
964 Value array = apop(); | |
965 Value length = NULL; | |
966 if (CSEArrayLength || | |
967 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || | |
968 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { | |
1819 | 969 length = append(new ArrayLength(array, state_before)); |
0 | 970 } |
1819 | 971 StoreIndexed* result = new StoreIndexed(array, index, length, type, value, state_before); |
0 | 972 append(result); |
459 | 973 _memory->store_value(value); |
1791
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
974 |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
975 if (type == T_OBJECT && is_profiling()) { |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
976 // Note that we'd collect profile data in this method if we wanted it. |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
977 compilation()->set_would_profile(true); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
978 |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
979 if (profile_checkcasts()) { |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
980 result->set_profiled_method(method()); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
981 result->set_profiled_bci(bci()); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
982 result->set_should_profile(true); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
983 } |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
984 } |
0 | 985 } |
986 | |
987 | |
988 void GraphBuilder::stack_op(Bytecodes::Code code) { | |
989 switch (code) { | |
990 case Bytecodes::_pop: | |
991 { state()->raw_pop(); | |
992 } | |
993 break; | |
994 case Bytecodes::_pop2: | |
995 { state()->raw_pop(); | |
996 state()->raw_pop(); | |
997 } | |
998 break; | |
999 case Bytecodes::_dup: | |
1000 { Value w = state()->raw_pop(); | |
1001 state()->raw_push(w); | |
1002 state()->raw_push(w); | |
1003 } | |
1004 break; | |
1005 case Bytecodes::_dup_x1: | |
1006 { Value w1 = state()->raw_pop(); | |
1007 Value w2 = state()->raw_pop(); | |
1008 state()->raw_push(w1); | |
1009 state()->raw_push(w2); | |
1010 state()->raw_push(w1); | |
1011 } | |
1012 break; | |
1013 case Bytecodes::_dup_x2: | |
1014 { Value w1 = state()->raw_pop(); | |
1015 Value w2 = state()->raw_pop(); | |
1016 Value w3 = state()->raw_pop(); | |
1017 state()->raw_push(w1); | |
1018 state()->raw_push(w3); | |
1019 state()->raw_push(w2); | |
1020 state()->raw_push(w1); | |
1021 } | |
1022 break; | |
1023 case Bytecodes::_dup2: | |
1024 { Value w1 = state()->raw_pop(); | |
1025 Value w2 = state()->raw_pop(); | |
1026 state()->raw_push(w2); | |
1027 state()->raw_push(w1); | |
1028 state()->raw_push(w2); | |
1029 state()->raw_push(w1); | |
1030 } | |
1031 break; | |
1032 case Bytecodes::_dup2_x1: | |
1033 { Value w1 = state()->raw_pop(); | |
1034 Value w2 = state()->raw_pop(); | |
1035 Value w3 = state()->raw_pop(); | |
1036 state()->raw_push(w2); | |
1037 state()->raw_push(w1); | |
1038 state()->raw_push(w3); | |
1039 state()->raw_push(w2); | |
1040 state()->raw_push(w1); | |
1041 } | |
1042 break; | |
1043 case Bytecodes::_dup2_x2: | |
1044 { Value w1 = state()->raw_pop(); | |
1045 Value w2 = state()->raw_pop(); | |
1046 Value w3 = state()->raw_pop(); | |
1047 Value w4 = state()->raw_pop(); | |
1048 state()->raw_push(w2); | |
1049 state()->raw_push(w1); | |
1050 state()->raw_push(w4); | |
1051 state()->raw_push(w3); | |
1052 state()->raw_push(w2); | |
1053 state()->raw_push(w1); | |
1054 } | |
1055 break; | |
1056 case Bytecodes::_swap: | |
1057 { Value w1 = state()->raw_pop(); | |
1058 Value w2 = state()->raw_pop(); | |
1059 state()->raw_push(w1); | |
1060 state()->raw_push(w2); | |
1061 } | |
1062 break; | |
1063 default: | |
1064 ShouldNotReachHere(); | |
1065 break; | |
1066 } | |
1067 } | |
1068 | |
1069 | |
1819 | 1070 void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* state_before) { |
0 | 1071 Value y = pop(type); |
1072 Value x = pop(type); | |
1073 // NOTE: strictfp can be queried from current method since we don't | |
1074 // inline methods with differing strictfp bits | |
1819 | 1075 Value res = new ArithmeticOp(code, x, y, method()->is_strict(), state_before); |
0 | 1076 // Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level |
1077 res = append(res); | |
1078 if (method()->is_strict()) { | |
1079 res = round_fp(res); | |
1080 } | |
1081 push(type, res); | |
1082 } | |
1083 | |
1084 | |
1085 void GraphBuilder::negate_op(ValueType* type) { | |
1086 push(type, append(new NegateOp(pop(type)))); | |
1087 } | |
1088 | |
1089 | |
1090 void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) { | |
1091 Value s = ipop(); | |
1092 Value x = pop(type); | |
1093 // try to simplify | |
1094 // Note: This code should go into the canonicalizer as soon as it can | |
1095 // can handle canonicalized forms that contain more than one node. | |
1096 if (CanonicalizeNodes && code == Bytecodes::_iushr) { | |
1097 // pattern: x >>> s | |
1098 IntConstant* s1 = s->type()->as_IntConstant(); | |
1099 if (s1 != NULL) { | |
1100 // pattern: x >>> s1, with s1 constant | |
1101 ShiftOp* l = x->as_ShiftOp(); | |
1102 if (l != NULL && l->op() == Bytecodes::_ishl) { | |
1103 // pattern: (a << b) >>> s1 | |
1104 IntConstant* s0 = l->y()->type()->as_IntConstant(); | |
1105 if (s0 != NULL) { | |
1106 // pattern: (a << s0) >>> s1 | |
1107 const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts | |
1108 const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts | |
1109 if (s0c == s1c) { | |
1110 if (s0c == 0) { | |
1111 // pattern: (a << 0) >>> 0 => simplify to: a | |
1112 ipush(l->x()); | |
1113 } else { | |
1114 // pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant | |
1115 assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases"); | |
1116 const int m = (1 << (BitsPerInt - s0c)) - 1; | |
1117 Value s = append(new Constant(new IntConstant(m))); | |
1118 ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s))); | |
1119 } | |
1120 return; | |
1121 } | |
1122 } | |
1123 } | |
1124 } | |
1125 } | |
1126 // could not simplify | |
1127 push(type, append(new ShiftOp(code, x, s))); | |
1128 } | |
1129 | |
1130 | |
1131 void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) { | |
1132 Value y = pop(type); | |
1133 Value x = pop(type); | |
1134 push(type, append(new LogicOp(code, x, y))); | |
1135 } | |
1136 | |
1137 | |
1138 void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) { | |
1819 | 1139 ValueStack* state_before = copy_state_before(); |
0 | 1140 Value y = pop(type); |
1141 Value x = pop(type); | |
1142 ipush(append(new CompareOp(code, x, y, state_before))); | |
1143 } | |
1144 | |
1145 | |
1146 void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) { | |
1147 push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to)))); | |
1148 } | |
1149 | |
1150 | |
1151 void GraphBuilder::increment() { | |
1152 int index = stream()->get_index(); | |
1153 int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]); | |
1154 load_local(intType, index); | |
1155 ipush(append(new Constant(new IntConstant(delta)))); | |
1156 arithmetic_op(intType, Bytecodes::_iadd); | |
1157 store_local(intType, index); | |
1158 } | |
1159 | |
1160 | |
1161 void GraphBuilder::_goto(int from_bci, int to_bci) { | |
1783 | 1162 Goto *x = new Goto(block_at(to_bci), to_bci <= from_bci); |
1163 if (is_profiling()) { | |
1164 compilation()->set_would_profile(true); | |
1165 } | |
1166 if (profile_branches()) { | |
1167 x->set_profiled_method(method()); | |
1168 x->set_profiled_bci(bci()); | |
1169 x->set_should_profile(true); | |
1170 } | |
1171 append(x); | |
0 | 1172 } |
1173 | |
1174 | |
1175 void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) { | |
1176 BlockBegin* tsux = block_at(stream()->get_dest()); | |
1177 BlockBegin* fsux = block_at(stream()->next_bci()); | |
1178 bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci(); | |
1783 | 1179 Instruction *i = append(new If(x, cond, false, y, tsux, fsux, is_bb ? state_before : NULL, is_bb)); |
1180 | |
1181 if (is_profiling()) { | |
1182 If* if_node = i->as_If(); | |
1183 if (if_node != NULL) { | |
1184 // Note that we'd collect profile data in this method if we wanted it. | |
1185 compilation()->set_would_profile(true); | |
1186 // At level 2 we need the proper bci to count backedges | |
1187 if_node->set_profiled_bci(bci()); | |
1188 if (profile_branches()) { | |
1189 // Successors can be rotated by the canonicalizer, check for this case. | |
1190 if_node->set_profiled_method(method()); | |
1191 if_node->set_should_profile(true); | |
1192 if (if_node->tsux() == fsux) { | |
1193 if_node->set_swapped(true); | |
1194 } | |
1195 } | |
1196 return; | |
1197 } | |
1198 | |
1199 // Check if this If was reduced to Goto. | |
1200 Goto *goto_node = i->as_Goto(); | |
1201 if (goto_node != NULL) { | |
1202 compilation()->set_would_profile(true); | |
1203 if (profile_branches()) { | |
1204 goto_node->set_profiled_method(method()); | |
1205 goto_node->set_profiled_bci(bci()); | |
1206 goto_node->set_should_profile(true); | |
1207 // Find out which successor is used. | |
1208 if (goto_node->default_sux() == tsux) { | |
1209 goto_node->set_direction(Goto::taken); | |
1210 } else if (goto_node->default_sux() == fsux) { | |
1211 goto_node->set_direction(Goto::not_taken); | |
1212 } else { | |
1213 ShouldNotReachHere(); | |
1214 } | |
1215 } | |
1216 return; | |
1217 } | |
0 | 1218 } |
1219 } | |
1220 | |
1221 | |
1222 void GraphBuilder::if_zero(ValueType* type, If::Condition cond) { | |
1223 Value y = append(new Constant(intZero)); | |
1819 | 1224 ValueStack* state_before = copy_state_before(); |
0 | 1225 Value x = ipop(); |
1226 if_node(x, cond, y, state_before); | |
1227 } | |
1228 | |
1229 | |
1230 void GraphBuilder::if_null(ValueType* type, If::Condition cond) { | |
1231 Value y = append(new Constant(objectNull)); | |
1819 | 1232 ValueStack* state_before = copy_state_before(); |
0 | 1233 Value x = apop(); |
1234 if_node(x, cond, y, state_before); | |
1235 } | |
1236 | |
1237 | |
1238 void GraphBuilder::if_same(ValueType* type, If::Condition cond) { | |
1819 | 1239 ValueStack* state_before = copy_state_before(); |
0 | 1240 Value y = pop(type); |
1241 Value x = pop(type); | |
1242 if_node(x, cond, y, state_before); | |
1243 } | |
1244 | |
1245 | |
1246 void GraphBuilder::jsr(int dest) { | |
1247 // We only handle well-formed jsrs (those which are "block-structured"). | |
1248 // If the bytecodes are strange (jumping out of a jsr block) then we | |
1249 // might end up trying to re-parse a block containing a jsr which | |
1250 // has already been activated. Watch for this case and bail out. | |
1251 for (ScopeData* cur_scope_data = scope_data(); | |
1252 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); | |
1253 cur_scope_data = cur_scope_data->parent()) { | |
1254 if (cur_scope_data->jsr_entry_bci() == dest) { | |
1255 BAILOUT("too-complicated jsr/ret structure"); | |
1256 } | |
1257 } | |
1258 | |
1259 push(addressType, append(new Constant(new AddressConstant(next_bci())))); | |
1260 if (!try_inline_jsr(dest)) { | |
1261 return; // bailed out while parsing and inlining subroutine | |
1262 } | |
1263 } | |
1264 | |
1265 | |
1266 void GraphBuilder::ret(int local_index) { | |
1267 if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine"); | |
1268 | |
1269 if (local_index != scope_data()->jsr_return_address_local()) { | |
1270 BAILOUT("can not handle complicated jsr/ret constructs"); | |
1271 } | |
1272 | |
1273 // Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation | |
1274 append(new Goto(scope_data()->jsr_continuation(), false)); | |
1275 } | |
1276 | |
1277 | |
1278 void GraphBuilder::table_switch() { | |
2142 | 1279 Bytecode_tableswitch sw(stream()); |
1280 const int l = sw.length(); | |
0 | 1281 if (CanonicalizeNodes && l == 1) { |
1282 // total of 2 successors => use If instead of switch | |
1283 // Note: This code should go into the canonicalizer as soon as it can | |
1284 // can handle canonicalized forms that contain more than one node. | |
2142 | 1285 Value key = append(new Constant(new IntConstant(sw.low_key()))); |
1286 BlockBegin* tsux = block_at(bci() + sw.dest_offset_at(0)); | |
1287 BlockBegin* fsux = block_at(bci() + sw.default_offset()); | |
0 | 1288 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); |
1819 | 1289 ValueStack* state_before = is_bb ? copy_state_before() : NULL; |
0 | 1290 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); |
1291 } else { | |
1292 // collect successors | |
1293 BlockList* sux = new BlockList(l + 1, NULL); | |
1294 int i; | |
1295 bool has_bb = false; | |
1296 for (i = 0; i < l; i++) { | |
2142 | 1297 sux->at_put(i, block_at(bci() + sw.dest_offset_at(i))); |
1298 if (sw.dest_offset_at(i) < 0) has_bb = true; | |
0 | 1299 } |
1300 // add default successor | |
2142 | 1301 sux->at_put(i, block_at(bci() + sw.default_offset())); |
1819 | 1302 ValueStack* state_before = has_bb ? copy_state_before() : NULL; |
2142 | 1303 append(new TableSwitch(ipop(), sux, sw.low_key(), state_before, has_bb)); |
0 | 1304 } |
1305 } | |
1306 | |
1307 | |
1308 void GraphBuilder::lookup_switch() { | |
2142 | 1309 Bytecode_lookupswitch sw(stream()); |
1310 const int l = sw.number_of_pairs(); | |
0 | 1311 if (CanonicalizeNodes && l == 1) { |
1312 // total of 2 successors => use If instead of switch | |
1313 // Note: This code should go into the canonicalizer as soon as it can | |
1314 // can handle canonicalized forms that contain more than one node. | |
1315 // simplify to If | |
2142 | 1316 LookupswitchPair pair = sw.pair_at(0); |
1317 Value key = append(new Constant(new IntConstant(pair.match()))); | |
1318 BlockBegin* tsux = block_at(bci() + pair.offset()); | |
1319 BlockBegin* fsux = block_at(bci() + sw.default_offset()); | |
0 | 1320 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); |
1819 | 1321 ValueStack* state_before = is_bb ? copy_state_before() : NULL; |
0 | 1322 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); |
1323 } else { | |
1324 // collect successors & keys | |
1325 BlockList* sux = new BlockList(l + 1, NULL); | |
1326 intArray* keys = new intArray(l, 0); | |
1327 int i; | |
1328 bool has_bb = false; | |
1329 for (i = 0; i < l; i++) { | |
2142 | 1330 LookupswitchPair pair = sw.pair_at(i); |
1331 if (pair.offset() < 0) has_bb = true; | |
1332 sux->at_put(i, block_at(bci() + pair.offset())); | |
1333 keys->at_put(i, pair.match()); | |
0 | 1334 } |
1335 // add default successor | |
2142 | 1336 sux->at_put(i, block_at(bci() + sw.default_offset())); |
1819 | 1337 ValueStack* state_before = has_bb ? copy_state_before() : NULL; |
0 | 1338 append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb)); |
1339 } | |
1340 } | |
1341 | |
1342 void GraphBuilder::call_register_finalizer() { | |
1343 // If the receiver requires finalization then emit code to perform | |
1344 // the registration on return. | |
1345 | |
1346 // Gather some type information about the receiver | |
1819 | 1347 Value receiver = state()->local_at(0); |
0 | 1348 assert(receiver != NULL, "must have a receiver"); |
1349 ciType* declared_type = receiver->declared_type(); | |
1350 ciType* exact_type = receiver->exact_type(); | |
1351 if (exact_type == NULL && | |
1352 receiver->as_Local() && | |
1353 receiver->as_Local()->java_index() == 0) { | |
1354 ciInstanceKlass* ik = compilation()->method()->holder(); | |
1355 if (ik->is_final()) { | |
1356 exact_type = ik; | |
1357 } else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) { | |
1358 // test class is leaf class | |
1359 compilation()->dependency_recorder()->assert_leaf_type(ik); | |
1360 exact_type = ik; | |
1361 } else { | |
1362 declared_type = ik; | |
1363 } | |
1364 } | |
1365 | |
1366 // see if we know statically that registration isn't required | |
1367 bool needs_check = true; | |
1368 if (exact_type != NULL) { | |
1369 needs_check = exact_type->as_instance_klass()->has_finalizer(); | |
1370 } else if (declared_type != NULL) { | |
1371 ciInstanceKlass* ik = declared_type->as_instance_klass(); | |
1372 if (!Dependencies::has_finalizable_subclass(ik)) { | |
1373 compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik); | |
1374 needs_check = false; | |
1375 } | |
1376 } | |
1377 | |
1378 if (needs_check) { | |
1379 // Perform the registration of finalizable objects. | |
1819 | 1380 ValueStack* state_before = copy_state_for_exception(); |
0 | 1381 load_local(objectType, 0); |
1382 append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init, | |
1383 state()->pop_arguments(1), | |
1819 | 1384 true, state_before, true)); |
0 | 1385 } |
1386 } | |
1387 | |
1388 | |
1389 void GraphBuilder::method_return(Value x) { | |
1390 if (RegisterFinalizersAtInit && | |
1391 method()->intrinsic_id() == vmIntrinsics::_Object_init) { | |
1392 call_register_finalizer(); | |
1393 } | |
1394 | |
1395 // Check to see whether we are inlining. If so, Return | |
1396 // instructions become Gotos to the continuation point. | |
1397 if (continuation() != NULL) { | |
1398 assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet"); | |
1399 | |
2166
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
1400 if (compilation()->env()->dtrace_method_probes()) { |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
1401 // Report exit from inline methods |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
1402 Values* args = new Values(1); |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
1403 args->push(append(new Constant(new ObjectConstant(method())))); |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
1404 append(new RuntimeCall(voidType, "dtrace_method_exit", CAST_FROM_FN_PTR(address, SharedRuntime::dtrace_method_exit), args)); |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
1405 } |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
1406 |
0 | 1407 // If the inlined method is synchronized, the monitor must be |
1408 // released before we jump to the continuation block. | |
1409 if (method()->is_synchronized()) { | |
1819 | 1410 assert(state()->locks_size() == 1, "receiver must be locked here"); |
1411 monitorexit(state()->lock_at(0), SynchronizationEntryBCI); | |
0 | 1412 } |
1413 | |
1819 | 1414 // State at end of inlined method is the state of the caller |
1415 // without the method parameters on stack, including the | |
1416 // return value, if any, of the inlined method on operand stack. | |
1417 set_state(state()->caller_state()->copy_for_parsing()); | |
0 | 1418 if (x != NULL) { |
1419 state()->push(x->type(), x); | |
1420 } | |
1421 Goto* goto_callee = new Goto(continuation(), false); | |
1422 | |
1423 // See whether this is the first return; if so, store off some | |
1424 // of the state for later examination | |
1425 if (num_returns() == 0) { | |
1426 set_inline_cleanup_info(_block, _last, state()); | |
1427 } | |
1428 | |
1429 // The current bci() is in the wrong scope, so use the bci() of | |
1430 // the continuation point. | |
1431 append_with_bci(goto_callee, scope_data()->continuation()->bci()); | |
1432 incr_num_returns(); | |
1433 | |
1434 return; | |
1435 } | |
1436 | |
1437 state()->truncate_stack(0); | |
1438 if (method()->is_synchronized()) { | |
1439 // perform the unlocking before exiting the method | |
1440 Value receiver; | |
1441 if (!method()->is_static()) { | |
1442 receiver = _initial_state->local_at(0); | |
1443 } else { | |
1444 receiver = append(new Constant(new ClassConstant(method()->holder()))); | |
1445 } | |
1446 append_split(new MonitorExit(receiver, state()->unlock())); | |
1447 } | |
1448 | |
1449 append(new Return(x)); | |
1450 } | |
1451 | |
1452 | |
1453 void GraphBuilder::access_field(Bytecodes::Code code) { | |
1454 bool will_link; | |
1455 ciField* field = stream()->get_field(will_link); | |
1456 ciInstanceKlass* holder = field->holder(); | |
1457 BasicType field_type = field->type()->basic_type(); | |
1458 ValueType* type = as_ValueType(field_type); | |
1459 // call will_link again to determine if the field is valid. | |
2352
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1460 const bool needs_patching = !holder->is_loaded() || |
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1461 !field->will_link(method()->holder(), code) || |
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1462 PatchALot; |
0 | 1463 |
1819 | 1464 ValueStack* state_before = NULL; |
2352
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1465 if (!holder->is_initialized() || needs_patching) { |
0 | 1466 // save state before instruction for debug info when |
1467 // deoptimization happens during patching | |
1819 | 1468 state_before = copy_state_before(); |
0 | 1469 } |
1470 | |
1471 Value obj = NULL; | |
1472 if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) { | |
1819 | 1473 if (state_before != NULL) { |
0 | 1474 // build a patching constant |
2376
c7f3d0b4570f
7017732: move static fields into Class to prepare for perm gen removal
never
parents:
2352
diff
changeset
|
1475 obj = new Constant(new InstanceConstant(holder->java_mirror()), state_before); |
0 | 1476 } else { |
2376
c7f3d0b4570f
7017732: move static fields into Class to prepare for perm gen removal
never
parents:
2352
diff
changeset
|
1477 obj = new Constant(new InstanceConstant(holder->java_mirror())); |
0 | 1478 } |
1479 } | |
1480 | |
1481 | |
2352
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1482 const int offset = !needs_patching ? field->offset() : -1; |
0 | 1483 switch (code) { |
1484 case Bytecodes::_getstatic: { | |
1485 // check for compile-time constants, i.e., initialized static final fields | |
1486 Instruction* constant = NULL; | |
1487 if (field->is_constant() && !PatchALot) { | |
1488 ciConstant field_val = field->constant_value(); | |
1489 BasicType field_type = field_val.basic_type(); | |
1490 switch (field_type) { | |
1491 case T_ARRAY: | |
1492 case T_OBJECT: | |
989
148e5441d916
6863023: need non-perm oops in code cache for JSR 292
jrose
parents:
844
diff
changeset
|
1493 if (field_val.as_object()->should_be_constant()) { |
0 | 1494 constant = new Constant(as_ValueType(field_val)); |
1495 } | |
1496 break; | |
1497 | |
1498 default: | |
1499 constant = new Constant(as_ValueType(field_val)); | |
1500 } | |
1501 } | |
1502 if (constant != NULL) { | |
1503 push(type, append(constant)); | |
1504 } else { | |
1819 | 1505 if (state_before == NULL) { |
1506 state_before = copy_state_for_exception(); | |
1507 } | |
0 | 1508 push(type, append(new LoadField(append(obj), offset, field, true, |
2352
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1509 state_before, needs_patching))); |
0 | 1510 } |
1511 break; | |
1512 } | |
1513 case Bytecodes::_putstatic: | |
1514 { Value val = pop(type); | |
1819 | 1515 if (state_before == NULL) { |
1516 state_before = copy_state_for_exception(); | |
1517 } | |
2352
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1518 append(new StoreField(append(obj), offset, field, val, true, state_before, needs_patching)); |
0 | 1519 } |
1520 break; | |
1521 case Bytecodes::_getfield : | |
1522 { | |
1819 | 1523 if (state_before == NULL) { |
1524 state_before = copy_state_for_exception(); | |
1525 } | |
2352
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1526 LoadField* load = new LoadField(apop(), offset, field, false, state_before, needs_patching); |
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1527 Value replacement = !needs_patching ? _memory->load(load) : load; |
0 | 1528 if (replacement != load) { |
1819 | 1529 assert(replacement->is_linked() || !replacement->can_be_linked(), "should already by linked"); |
0 | 1530 push(type, replacement); |
1531 } else { | |
1532 push(type, append(load)); | |
1533 } | |
1534 break; | |
1535 } | |
1536 | |
1537 case Bytecodes::_putfield : | |
1538 { Value val = pop(type); | |
1819 | 1539 if (state_before == NULL) { |
1540 state_before = copy_state_for_exception(); | |
1541 } | |
2352
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1542 StoreField* store = new StoreField(apop(), offset, field, val, false, state_before, needs_patching); |
425688247f3d
6965570: assert(!needs_patching && x->is_loaded(),"how do we know it's volatile if it's not loaded")
never
parents:
2318
diff
changeset
|
1543 if (!needs_patching) store = _memory->store(store); |
0 | 1544 if (store != NULL) { |
1545 append(store); | |
1546 } | |
1547 } | |
1548 break; | |
1549 default : | |
1550 ShouldNotReachHere(); | |
1551 break; | |
1552 } | |
1553 } | |
1554 | |
1555 | |
1556 Dependencies* GraphBuilder::dependency_recorder() const { | |
1557 assert(DeoptC1, "need debug information"); | |
1558 return compilation()->dependency_recorder(); | |
1559 } | |
1560 | |
1561 | |
1562 void GraphBuilder::invoke(Bytecodes::Code code) { | |
1563 bool will_link; | |
1564 ciMethod* target = stream()->get_method(will_link); | |
1565 // we have to make sure the argument size (incl. the receiver) | |
1566 // is correct for compilation (the call would fail later during | |
1567 // linkage anyway) - was bug (gri 7/28/99) | |
1568 if (target->is_loaded() && target->is_static() != (code == Bytecodes::_invokestatic)) BAILOUT("will cause link error"); | |
1569 ciInstanceKlass* klass = target->holder(); | |
1570 | |
1571 // check if CHA possible: if so, change the code to invoke_special | |
1572 ciInstanceKlass* calling_klass = method()->holder(); | |
1573 ciKlass* holder = stream()->get_declared_method_holder(); | |
1574 ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder); | |
1575 ciInstanceKlass* actual_recv = callee_holder; | |
1576 | |
1577 // some methods are obviously bindable without any type checks so | |
1578 // convert them directly to an invokespecial. | |
1579 if (target->is_loaded() && !target->is_abstract() && | |
1580 target->can_be_statically_bound() && code == Bytecodes::_invokevirtual) { | |
1581 code = Bytecodes::_invokespecial; | |
1582 } | |
1583 | |
1584 // NEEDS_CLEANUP | |
1585 // I've added the target-is_loaded() test below but I don't really understand | |
1586 // how klass->is_loaded() can be true and yet target->is_loaded() is false. | |
1587 // this happened while running the JCK invokevirtual tests under doit. TKR | |
1588 ciMethod* cha_monomorphic_target = NULL; | |
1589 ciMethod* exact_target = NULL; | |
1295 | 1590 if (UseCHA && DeoptC1 && klass->is_loaded() && target->is_loaded() && |
1591 !target->is_method_handle_invoke()) { | |
0 | 1592 Value receiver = NULL; |
1593 ciInstanceKlass* receiver_klass = NULL; | |
1594 bool type_is_exact = false; | |
1595 // try to find a precise receiver type | |
1596 if (will_link && !target->is_static()) { | |
1597 int index = state()->stack_size() - (target->arg_size_no_receiver() + 1); | |
1598 receiver = state()->stack_at(index); | |
1599 ciType* type = receiver->exact_type(); | |
1600 if (type != NULL && type->is_loaded() && | |
1601 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { | |
1602 receiver_klass = (ciInstanceKlass*) type; | |
1603 type_is_exact = true; | |
1604 } | |
1605 if (type == NULL) { | |
1606 type = receiver->declared_type(); | |
1607 if (type != NULL && type->is_loaded() && | |
1608 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { | |
1609 receiver_klass = (ciInstanceKlass*) type; | |
1610 if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) { | |
1611 // Insert a dependency on this type since | |
1612 // find_monomorphic_target may assume it's already done. | |
1613 dependency_recorder()->assert_leaf_type(receiver_klass); | |
1614 type_is_exact = true; | |
1615 } | |
1616 } | |
1617 } | |
1618 } | |
1619 if (receiver_klass != NULL && type_is_exact && | |
1620 receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) { | |
1621 // If we have the exact receiver type we can bind directly to | |
1622 // the method to call. | |
1623 exact_target = target->resolve_invoke(calling_klass, receiver_klass); | |
1624 if (exact_target != NULL) { | |
1625 target = exact_target; | |
1626 code = Bytecodes::_invokespecial; | |
1627 } | |
1628 } | |
1629 if (receiver_klass != NULL && | |
1630 receiver_klass->is_subtype_of(actual_recv) && | |
1631 actual_recv->is_initialized()) { | |
1632 actual_recv = receiver_klass; | |
1633 } | |
1634 | |
1635 if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) || | |
1636 (code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) { | |
1637 // Use CHA on the receiver to select a more precise method. | |
1638 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv); | |
1639 } else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) { | |
1640 // if there is only one implementor of this interface then we | |
1641 // may be able bind this invoke directly to the implementing | |
1642 // klass but we need both a dependence on the single interface | |
1643 // and on the method we bind to. Additionally since all we know | |
1644 // about the receiver type is the it's supposed to implement the | |
1645 // interface we have to insert a check that it's the class we | |
1646 // expect. Interface types are not checked by the verifier so | |
1647 // they are roughly equivalent to Object. | |
1648 ciInstanceKlass* singleton = NULL; | |
1649 if (target->holder()->nof_implementors() == 1) { | |
1650 singleton = target->holder()->implementor(0); | |
1651 } | |
1652 if (singleton) { | |
1653 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton); | |
1654 if (cha_monomorphic_target != NULL) { | |
1655 // If CHA is able to bind this invoke then update the class | |
1656 // to match that class, otherwise klass will refer to the | |
1657 // interface. | |
1658 klass = cha_monomorphic_target->holder(); | |
1659 actual_recv = target->holder(); | |
1660 | |
1661 // insert a check it's really the expected class. | |
1819 | 1662 CheckCast* c = new CheckCast(klass, receiver, copy_state_for_exception()); |
0 | 1663 c->set_incompatible_class_change_check(); |
1664 c->set_direct_compare(klass->is_final()); | |
1665 append_split(c); | |
1666 } | |
1667 } | |
1668 } | |
1669 } | |
1670 | |
1671 if (cha_monomorphic_target != NULL) { | |
1672 if (cha_monomorphic_target->is_abstract()) { | |
1673 // Do not optimize for abstract methods | |
1674 cha_monomorphic_target = NULL; | |
1675 } | |
1676 } | |
1677 | |
1678 if (cha_monomorphic_target != NULL) { | |
1679 if (!(target->is_final_method())) { | |
1680 // If we inlined because CHA revealed only a single target method, | |
1681 // then we are dependent on that target method not getting overridden | |
1682 // by dynamic class loading. Be sure to test the "static" receiver | |
1683 // dest_method here, as opposed to the actual receiver, which may | |
1684 // falsely lead us to believe that the receiver is final or private. | |
1685 dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target); | |
1686 } | |
1687 code = Bytecodes::_invokespecial; | |
1688 } | |
1689 // check if we could do inlining | |
1690 if (!PatchALot && Inline && klass->is_loaded() && | |
1691 (klass->is_initialized() || klass->is_interface() && target->holder()->is_initialized()) | |
1692 && target->will_link(klass, callee_holder, code)) { | |
1693 // callee is known => check if we have static binding | |
1694 assert(target->is_loaded(), "callee must be known"); | |
1695 if (code == Bytecodes::_invokestatic | |
1696 || code == Bytecodes::_invokespecial | |
1697 || code == Bytecodes::_invokevirtual && target->is_final_method() | |
1698 ) { | |
1699 // static binding => check if callee is ok | |
1700 ciMethod* inline_target = (cha_monomorphic_target != NULL) | |
1701 ? cha_monomorphic_target | |
1702 : target; | |
1703 bool res = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL)); | |
1704 CHECK_BAILOUT(); | |
1705 | |
1706 #ifndef PRODUCT | |
1707 // printing | |
1708 if (PrintInlining && !res) { | |
1709 // if it was successfully inlined, then it was already printed. | |
1710 print_inline_result(inline_target, res); | |
1711 } | |
1712 #endif | |
1713 clear_inline_bailout(); | |
1714 if (res) { | |
1715 // Register dependence if JVMTI has either breakpoint | |
1716 // setting or hotswapping of methods capabilities since they may | |
1717 // cause deoptimization. | |
780
c96bf21b756f
6788527: Server vm intermittently fails with assertion "live value must not be garbage" with fastdebug bits
kvn
parents:
726
diff
changeset
|
1718 if (compilation()->env()->jvmti_can_hotswap_or_post_breakpoint()) { |
0 | 1719 dependency_recorder()->assert_evol_method(inline_target); |
1720 } | |
1721 return; | |
1722 } | |
1723 } | |
1724 } | |
1725 // If we attempted an inline which did not succeed because of a | |
1726 // bailout during construction of the callee graph, the entire | |
1727 // compilation has to be aborted. This is fairly rare and currently | |
1728 // seems to only occur for jasm-generated classes which contain | |
1729 // jsr/ret pairs which are not associated with finally clauses and | |
1730 // do not have exception handlers in the containing method, and are | |
1731 // therefore not caught early enough to abort the inlining without | |
1732 // corrupting the graph. (We currently bail out with a non-empty | |
1733 // stack at a ret in these situations.) | |
1734 CHECK_BAILOUT(); | |
1735 | |
1736 // inlining not successful => standard invoke | |
1295 | 1737 bool is_loaded = target->is_loaded(); |
1738 bool has_receiver = | |
1739 code == Bytecodes::_invokespecial || | |
1740 code == Bytecodes::_invokevirtual || | |
1741 code == Bytecodes::_invokeinterface; | |
1742 bool is_invokedynamic = code == Bytecodes::_invokedynamic; | |
0 | 1743 ValueType* result_type = as_ValueType(target->return_type()); |
1295 | 1744 |
1745 // We require the debug info to be the "state before" because | |
1746 // invokedynamics may deoptimize. | |
1819 | 1747 ValueStack* state_before = is_invokedynamic ? copy_state_before() : copy_state_exhandling(); |
1295 | 1748 |
0 | 1749 Values* args = state()->pop_arguments(target->arg_size_no_receiver()); |
1295 | 1750 Value recv = has_receiver ? apop() : NULL; |
0 | 1751 int vtable_index = methodOopDesc::invalid_vtable_index; |
1752 | |
1753 #ifdef SPARC | |
1754 // Currently only supported on Sparc. | |
1755 // The UseInlineCaches only controls dispatch to invokevirtuals for | |
1756 // loaded classes which we weren't able to statically bind. | |
1757 if (!UseInlineCaches && is_loaded && code == Bytecodes::_invokevirtual | |
1758 && !target->can_be_statically_bound()) { | |
1759 // Find a vtable index if one is available | |
1760 vtable_index = target->resolve_vtable_index(calling_klass, callee_holder); | |
1761 } | |
1762 #endif | |
1763 | |
1764 if (recv != NULL && | |
1765 (code == Bytecodes::_invokespecial || | |
1783 | 1766 !is_loaded || target->is_final())) { |
0 | 1767 // invokespecial always needs a NULL check. invokevirtual where |
1768 // the target is final or where it's not known that whether the | |
1769 // target is final requires a NULL check. Otherwise normal | |
1770 // invokevirtual will perform the null check during the lookup | |
1771 // logic or the unverified entry point. Profiling of calls | |
1772 // requires that the null check is performed in all cases. | |
1773 null_check(recv); | |
1774 } | |
1775 | |
1783 | 1776 if (is_profiling()) { |
1777 if (recv != NULL && profile_calls()) { | |
1778 null_check(recv); | |
0 | 1779 } |
1783 | 1780 // Note that we'd collect profile data in this method if we wanted it. |
1781 compilation()->set_would_profile(true); | |
1782 | |
1783 if (profile_calls()) { | |
1784 assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set"); | |
1785 ciKlass* target_klass = NULL; | |
1786 if (cha_monomorphic_target != NULL) { | |
1787 target_klass = cha_monomorphic_target->holder(); | |
1788 } else if (exact_target != NULL) { | |
1789 target_klass = exact_target->holder(); | |
1790 } | |
1791 profile_call(recv, target_klass); | |
1792 } | |
0 | 1793 } |
1794 | |
1295 | 1795 Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target, state_before); |
0 | 1796 // push result |
1797 append_split(result); | |
1798 | |
1799 if (result_type != voidType) { | |
1800 if (method()->is_strict()) { | |
1801 push(result_type, round_fp(result)); | |
1802 } else { | |
1803 push(result_type, result); | |
1804 } | |
1805 } | |
1806 } | |
1807 | |
1808 | |
1809 void GraphBuilder::new_instance(int klass_index) { | |
1819 | 1810 ValueStack* state_before = copy_state_exhandling(); |
0 | 1811 bool will_link; |
1812 ciKlass* klass = stream()->get_klass(will_link); | |
1813 assert(klass->is_instance_klass(), "must be an instance klass"); | |
1819 | 1814 NewInstance* new_instance = new NewInstance(klass->as_instance_klass(), state_before); |
0 | 1815 _memory->new_instance(new_instance); |
1816 apush(append_split(new_instance)); | |
1817 } | |
1818 | |
1819 | |
1820 void GraphBuilder::new_type_array() { | |
1819 | 1821 ValueStack* state_before = copy_state_exhandling(); |
1822 apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index(), state_before))); | |
0 | 1823 } |
1824 | |
1825 | |
1826 void GraphBuilder::new_object_array() { | |
1827 bool will_link; | |
1828 ciKlass* klass = stream()->get_klass(will_link); | |
1819 | 1829 ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_exhandling(); |
0 | 1830 NewArray* n = new NewObjectArray(klass, ipop(), state_before); |
1831 apush(append_split(n)); | |
1832 } | |
1833 | |
1834 | |
1835 bool GraphBuilder::direct_compare(ciKlass* k) { | |
1836 if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) { | |
1837 ciInstanceKlass* ik = k->as_instance_klass(); | |
1838 if (ik->is_final()) { | |
1839 return true; | |
1840 } else { | |
1841 if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) { | |
1842 // test class is leaf class | |
1843 dependency_recorder()->assert_leaf_type(ik); | |
1844 return true; | |
1845 } | |
1846 } | |
1847 } | |
1848 return false; | |
1849 } | |
1850 | |
1851 | |
1852 void GraphBuilder::check_cast(int klass_index) { | |
1853 bool will_link; | |
1854 ciKlass* klass = stream()->get_klass(will_link); | |
1819 | 1855 ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_for_exception(); |
0 | 1856 CheckCast* c = new CheckCast(klass, apop(), state_before); |
1857 apush(append_split(c)); | |
1858 c->set_direct_compare(direct_compare(klass)); | |
1783 | 1859 |
1860 if (is_profiling()) { | |
1861 // Note that we'd collect profile data in this method if we wanted it. | |
1862 compilation()->set_would_profile(true); | |
1863 | |
1864 if (profile_checkcasts()) { | |
1865 c->set_profiled_method(method()); | |
1866 c->set_profiled_bci(bci()); | |
1867 c->set_should_profile(true); | |
1868 } | |
0 | 1869 } |
1870 } | |
1871 | |
1872 | |
1873 void GraphBuilder::instance_of(int klass_index) { | |
1874 bool will_link; | |
1875 ciKlass* klass = stream()->get_klass(will_link); | |
1819 | 1876 ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_exhandling(); |
0 | 1877 InstanceOf* i = new InstanceOf(klass, apop(), state_before); |
1878 ipush(append_split(i)); | |
1879 i->set_direct_compare(direct_compare(klass)); | |
1791
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1880 |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1881 if (is_profiling()) { |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1882 // Note that we'd collect profile data in this method if we wanted it. |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1883 compilation()->set_would_profile(true); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1884 |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1885 if (profile_checkcasts()) { |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1886 i->set_profiled_method(method()); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1887 i->set_profiled_bci(bci()); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1888 i->set_should_profile(true); |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1889 } |
3a294e483abc
6919069: client compiler needs to capture more profile information for tiered work
iveresov
parents:
1783
diff
changeset
|
1890 } |
0 | 1891 } |
1892 | |
1893 | |
1894 void GraphBuilder::monitorenter(Value x, int bci) { | |
1895 // save state before locking in case of deoptimization after a NullPointerException | |
1819 | 1896 ValueStack* state_before = copy_state_for_exception_with_bci(bci); |
1897 append_with_bci(new MonitorEnter(x, state()->lock(x), state_before), bci); | |
0 | 1898 kill_all(); |
1899 } | |
1900 | |
1901 | |
1902 void GraphBuilder::monitorexit(Value x, int bci) { | |
1903 append_with_bci(new MonitorExit(x, state()->unlock()), bci); | |
1904 kill_all(); | |
1905 } | |
1906 | |
1907 | |
1908 void GraphBuilder::new_multi_array(int dimensions) { | |
1909 bool will_link; | |
1910 ciKlass* klass = stream()->get_klass(will_link); | |
1819 | 1911 ValueStack* state_before = !klass->is_loaded() || PatchALot ? copy_state_before() : copy_state_exhandling(); |
0 | 1912 |
1913 Values* dims = new Values(dimensions, NULL); | |
1914 // fill in all dimensions | |
1915 int i = dimensions; | |
1916 while (i-- > 0) dims->at_put(i, ipop()); | |
1917 // create array | |
1918 NewArray* n = new NewMultiArray(klass, dims, state_before); | |
1919 apush(append_split(n)); | |
1920 } | |
1921 | |
1922 | |
1923 void GraphBuilder::throw_op(int bci) { | |
1924 // We require that the debug info for a Throw be the "state before" | |
1925 // the Throw (i.e., exception oop is still on TOS) | |
1819 | 1926 ValueStack* state_before = copy_state_before_with_bci(bci); |
0 | 1927 Throw* t = new Throw(apop(), state_before); |
1819 | 1928 // operand stack not needed after a throw |
1929 state()->truncate_stack(0); | |
0 | 1930 append_with_bci(t, bci); |
1931 } | |
1932 | |
1933 | |
1934 Value GraphBuilder::round_fp(Value fp_value) { | |
1935 // no rounding needed if SSE2 is used | |
1936 if (RoundFPResults && UseSSE < 2) { | |
1937 // Must currently insert rounding node for doubleword values that | |
1938 // are results of expressions (i.e., not loads from memory or | |
1939 // constants) | |
1940 if (fp_value->type()->tag() == doubleTag && | |
1941 fp_value->as_Constant() == NULL && | |
1942 fp_value->as_Local() == NULL && // method parameters need no rounding | |
1943 fp_value->as_RoundFP() == NULL) { | |
1944 return append(new RoundFP(fp_value)); | |
1945 } | |
1946 } | |
1947 return fp_value; | |
1948 } | |
1949 | |
1950 | |
1951 Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) { | |
1783 | 1952 Canonicalizer canon(compilation(), instr, bci); |
0 | 1953 Instruction* i1 = canon.canonical(); |
1819 | 1954 if (i1->is_linked() || !i1->can_be_linked()) { |
0 | 1955 // Canonicalizer returned an instruction which was already |
1956 // appended so simply return it. | |
1957 return i1; | |
1819 | 1958 } |
1959 | |
1960 if (UseLocalValueNumbering) { | |
0 | 1961 // Lookup the instruction in the ValueMap and add it to the map if |
1962 // it's not found. | |
1963 Instruction* i2 = vmap()->find_insert(i1); | |
1964 if (i2 != i1) { | |
1965 // found an entry in the value map, so just return it. | |
1819 | 1966 assert(i2->is_linked(), "should already be linked"); |
0 | 1967 return i2; |
1968 } | |
459 | 1969 ValueNumberingEffects vne(vmap()); |
1970 i1->visit(&vne); | |
0 | 1971 } |
1972 | |
1819 | 1973 // i1 was not eliminated => append it |
1974 assert(i1->next() == NULL, "shouldn't already be linked"); | |
1975 _last = _last->set_next(i1, canon.bci()); | |
1976 | |
1977 if (++_instruction_count >= InstructionCountCutoff && !bailed_out()) { | |
1978 // set the bailout state but complete normal processing. We | |
1979 // might do a little more work before noticing the bailout so we | |
1980 // want processing to continue normally until it's noticed. | |
1981 bailout("Method and/or inlining is too large"); | |
1982 } | |
0 | 1983 |
1984 #ifndef PRODUCT | |
1819 | 1985 if (PrintIRDuringConstruction) { |
1986 InstructionPrinter ip; | |
1987 ip.print_line(i1); | |
1988 if (Verbose) { | |
1989 state()->print(); | |
1990 } | |
1991 } | |
1992 #endif | |
1993 | |
1994 // save state after modification of operand stack for StateSplit instructions | |
1995 StateSplit* s = i1->as_StateSplit(); | |
1996 if (s != NULL) { | |
1997 if (EliminateFieldAccess) { | |
1998 Intrinsic* intrinsic = s->as_Intrinsic(); | |
1999 if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) { | |
2000 _memory->kill(); | |
0 | 2001 } |
2002 } | |
1819 | 2003 s->set_state(state()->copy(ValueStack::StateAfter, canon.bci())); |
2004 } | |
2005 | |
2006 // set up exception handlers for this instruction if necessary | |
2007 if (i1->can_trap()) { | |
2008 i1->set_exception_handlers(handle_exception(i1)); | |
2009 assert(i1->exception_state() != NULL || !i1->needs_exception_state() || bailed_out(), "handle_exception must set exception state"); | |
0 | 2010 } |
2011 return i1; | |
2012 } | |
2013 | |
2014 | |
2015 Instruction* GraphBuilder::append(Instruction* instr) { | |
2016 assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used"); | |
2017 return append_with_bci(instr, bci()); | |
2018 } | |
2019 | |
2020 | |
2021 Instruction* GraphBuilder::append_split(StateSplit* instr) { | |
2022 return append_with_bci(instr, bci()); | |
2023 } | |
2024 | |
2025 | |
2026 void GraphBuilder::null_check(Value value) { | |
2027 if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) { | |
2028 return; | |
2029 } else { | |
2030 Constant* con = value->as_Constant(); | |
2031 if (con) { | |
2032 ObjectType* c = con->type()->as_ObjectType(); | |
2033 if (c && c->is_loaded()) { | |
2034 ObjectConstant* oc = c->as_ObjectConstant(); | |
2035 if (!oc || !oc->value()->is_null_object()) { | |
2036 return; | |
2037 } | |
2038 } | |
2039 } | |
2040 } | |
1819 | 2041 append(new NullCheck(value, copy_state_for_exception())); |
0 | 2042 } |
2043 | |
2044 | |
2045 | |
1819 | 2046 XHandlers* GraphBuilder::handle_exception(Instruction* instruction) { |
2047 if (!has_handler() && (!instruction->needs_exception_state() || instruction->exception_state() != NULL)) { | |
2048 assert(instruction->exception_state() == NULL | |
2049 || instruction->exception_state()->kind() == ValueStack::EmptyExceptionState | |
2050 || (instruction->exception_state()->kind() == ValueStack::ExceptionState && _compilation->env()->jvmti_can_access_local_variables()), | |
2051 "exception_state should be of exception kind"); | |
0 | 2052 return new XHandlers(); |
2053 } | |
2054 | |
2055 XHandlers* exception_handlers = new XHandlers(); | |
2056 ScopeData* cur_scope_data = scope_data(); | |
1819 | 2057 ValueStack* cur_state = instruction->state_before(); |
2058 ValueStack* prev_state = NULL; | |
0 | 2059 int scope_count = 0; |
2060 | |
1819 | 2061 assert(cur_state != NULL, "state_before must be set"); |
0 | 2062 do { |
1819 | 2063 int cur_bci = cur_state->bci(); |
2064 assert(cur_scope_data->scope() == cur_state->scope(), "scopes do not match"); | |
0 | 2065 assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci"); |
2066 | |
2067 // join with all potential exception handlers | |
2068 XHandlers* list = cur_scope_data->xhandlers(); | |
2069 const int n = list->length(); | |
2070 for (int i = 0; i < n; i++) { | |
2071 XHandler* h = list->handler_at(i); | |
2072 if (h->covers(cur_bci)) { | |
2073 // h is a potential exception handler => join it | |
2074 compilation()->set_has_exception_handlers(true); | |
2075 | |
2076 BlockBegin* entry = h->entry_block(); | |
2077 if (entry == block()) { | |
2078 // It's acceptable for an exception handler to cover itself | |
2079 // but we don't handle that in the parser currently. It's | |
2080 // very rare so we bailout instead of trying to handle it. | |
2081 BAILOUT_("exception handler covers itself", exception_handlers); | |
2082 } | |
2083 assert(entry->bci() == h->handler_bci(), "must match"); | |
2084 assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond"); | |
2085 | |
2086 // previously this was a BAILOUT, but this is not necessary | |
2087 // now because asynchronous exceptions are not handled this way. | |
1819 | 2088 assert(entry->state() == NULL || cur_state->total_locks_size() == entry->state()->total_locks_size(), "locks do not match"); |
0 | 2089 |
2090 // xhandler start with an empty expression stack | |
1819 | 2091 if (cur_state->stack_size() != 0) { |
2092 cur_state = cur_state->copy(ValueStack::ExceptionState, cur_state->bci()); | |
2093 } | |
2094 if (instruction->exception_state() == NULL) { | |
2095 instruction->set_exception_state(cur_state); | |
2096 } | |
0 | 2097 |
2098 // Note: Usually this join must work. However, very | |
2099 // complicated jsr-ret structures where we don't ret from | |
2100 // the subroutine can cause the objects on the monitor | |
2101 // stacks to not match because blocks can be parsed twice. | |
2102 // The only test case we've seen so far which exhibits this | |
2103 // problem is caught by the infinite recursion test in | |
2104 // GraphBuilder::jsr() if the join doesn't work. | |
1819 | 2105 if (!entry->try_merge(cur_state)) { |
0 | 2106 BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers); |
2107 } | |
2108 | |
2109 // add current state for correct handling of phi functions at begin of xhandler | |
1819 | 2110 int phi_operand = entry->add_exception_state(cur_state); |
0 | 2111 |
2112 // add entry to the list of xhandlers of this block | |
2113 _block->add_exception_handler(entry); | |
2114 | |
2115 // add back-edge from xhandler entry to this block | |
2116 if (!entry->is_predecessor(_block)) { | |
2117 entry->add_predecessor(_block); | |
2118 } | |
2119 | |
2120 // clone XHandler because phi_operand and scope_count can not be shared | |
2121 XHandler* new_xhandler = new XHandler(h); | |
2122 new_xhandler->set_phi_operand(phi_operand); | |
2123 new_xhandler->set_scope_count(scope_count); | |
2124 exception_handlers->append(new_xhandler); | |
2125 | |
2126 // fill in exception handler subgraph lazily | |
2127 assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet"); | |
2128 cur_scope_data->add_to_work_list(entry); | |
2129 | |
2130 // stop when reaching catchall | |
2131 if (h->catch_type() == 0) { | |
2132 return exception_handlers; | |
2133 } | |
2134 } | |
2135 } | |
2136 | |
1819 | 2137 if (exception_handlers->length() == 0) { |
2138 // This scope and all callees do not handle exceptions, so the local | |
2139 // variables of this scope are not needed. However, the scope itself is | |
2140 // required for a correct exception stack trace -> clear out the locals. | |
2141 if (_compilation->env()->jvmti_can_access_local_variables()) { | |
2142 cur_state = cur_state->copy(ValueStack::ExceptionState, cur_state->bci()); | |
2143 } else { | |
2144 cur_state = cur_state->copy(ValueStack::EmptyExceptionState, cur_state->bci()); | |
2145 } | |
2146 if (prev_state != NULL) { | |
2147 prev_state->set_caller_state(cur_state); | |
2148 } | |
2149 if (instruction->exception_state() == NULL) { | |
2150 instruction->set_exception_state(cur_state); | |
2151 } | |
2152 } | |
2153 | |
0 | 2154 // Set up iteration for next time. |
2155 // If parsing a jsr, do not grab exception handlers from the | |
2156 // parent scopes for this method (already got them, and they | |
2157 // needed to be cloned) | |
1819 | 2158 |
2159 while (cur_scope_data->parsing_jsr()) { | |
2160 cur_scope_data = cur_scope_data->parent(); | |
0 | 2161 } |
1819 | 2162 |
2163 assert(cur_scope_data->scope() == cur_state->scope(), "scopes do not match"); | |
2164 assert(cur_state->locks_size() == 0 || cur_state->locks_size() == 1, "unlocking must be done in a catchall exception handler"); | |
2165 | |
2166 prev_state = cur_state; | |
2167 cur_state = cur_state->caller_state(); | |
2168 cur_scope_data = cur_scope_data->parent(); | |
2169 scope_count++; | |
0 | 2170 } while (cur_scope_data != NULL); |
2171 | |
2172 return exception_handlers; | |
2173 } | |
2174 | |
2175 | |
2176 // Helper class for simplifying Phis. | |
2177 class PhiSimplifier : public BlockClosure { | |
2178 private: | |
2179 bool _has_substitutions; | |
2180 Value simplify(Value v); | |
2181 | |
2182 public: | |
2183 PhiSimplifier(BlockBegin* start) : _has_substitutions(false) { | |
2184 start->iterate_preorder(this); | |
2185 if (_has_substitutions) { | |
2186 SubstitutionResolver sr(start); | |
2187 } | |
2188 } | |
2189 void block_do(BlockBegin* b); | |
2190 bool has_substitutions() const { return _has_substitutions; } | |
2191 }; | |
2192 | |
2193 | |
2194 Value PhiSimplifier::simplify(Value v) { | |
2195 Phi* phi = v->as_Phi(); | |
2196 | |
2197 if (phi == NULL) { | |
2198 // no phi function | |
2199 return v; | |
2200 } else if (v->has_subst()) { | |
2201 // already substituted; subst can be phi itself -> simplify | |
2202 return simplify(v->subst()); | |
2203 } else if (phi->is_set(Phi::cannot_simplify)) { | |
2204 // already tried to simplify phi before | |
2205 return phi; | |
2206 } else if (phi->is_set(Phi::visited)) { | |
2207 // break cycles in phi functions | |
2208 return phi; | |
2209 } else if (phi->type()->is_illegal()) { | |
2210 // illegal phi functions are ignored anyway | |
2211 return phi; | |
2212 | |
2213 } else { | |
2214 // mark phi function as processed to break cycles in phi functions | |
2215 phi->set(Phi::visited); | |
2216 | |
2217 // simplify x = [y, x] and x = [y, y] to y | |
2218 Value subst = NULL; | |
2219 int opd_count = phi->operand_count(); | |
2220 for (int i = 0; i < opd_count; i++) { | |
2221 Value opd = phi->operand_at(i); | |
2222 assert(opd != NULL, "Operand must exist!"); | |
2223 | |
2224 if (opd->type()->is_illegal()) { | |
2225 // if one operand is illegal, the entire phi function is illegal | |
2226 phi->make_illegal(); | |
2227 phi->clear(Phi::visited); | |
2228 return phi; | |
2229 } | |
2230 | |
2231 Value new_opd = simplify(opd); | |
2232 assert(new_opd != NULL, "Simplified operand must exist!"); | |
2233 | |
2234 if (new_opd != phi && new_opd != subst) { | |
2235 if (subst == NULL) { | |
2236 subst = new_opd; | |
2237 } else { | |
2238 // no simplification possible | |
2239 phi->set(Phi::cannot_simplify); | |
2240 phi->clear(Phi::visited); | |
2241 return phi; | |
2242 } | |
2243 } | |
2244 } | |
2245 | |
2246 // sucessfully simplified phi function | |
2247 assert(subst != NULL, "illegal phi function"); | |
2248 _has_substitutions = true; | |
2249 phi->clear(Phi::visited); | |
2250 phi->set_subst(subst); | |
2251 | |
2252 #ifndef PRODUCT | |
2253 if (PrintPhiFunctions) { | |
2254 tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id()); | |
2255 } | |
2256 #endif | |
2257 | |
2258 return subst; | |
2259 } | |
2260 } | |
2261 | |
2262 | |
2263 void PhiSimplifier::block_do(BlockBegin* b) { | |
2264 for_each_phi_fun(b, phi, | |
2265 simplify(phi); | |
2266 ); | |
2267 | |
2268 #ifdef ASSERT | |
2269 for_each_phi_fun(b, phi, | |
2270 assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification"); | |
2271 ); | |
2272 | |
2273 ValueStack* state = b->state()->caller_state(); | |
1819 | 2274 for_each_state_value(state, value, |
2275 Phi* phi = value->as_Phi(); | |
2276 assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state"); | |
2277 ); | |
0 | 2278 #endif |
2279 } | |
2280 | |
2281 // This method is called after all blocks are filled with HIR instructions | |
2282 // It eliminates all Phi functions of the form x = [y, y] and x = [y, x] | |
2283 void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) { | |
2284 PhiSimplifier simplifier(start); | |
2285 } | |
2286 | |
2287 | |
2288 void GraphBuilder::connect_to_end(BlockBegin* beg) { | |
2289 // setup iteration | |
2290 kill_all(); | |
2291 _block = beg; | |
1819 | 2292 _state = beg->state()->copy_for_parsing(); |
0 | 2293 _last = beg; |
2294 iterate_bytecodes_for_block(beg->bci()); | |
2295 } | |
2296 | |
2297 | |
2298 BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) { | |
2299 #ifndef PRODUCT | |
2300 if (PrintIRDuringConstruction) { | |
2301 tty->cr(); | |
2302 InstructionPrinter ip; | |
2303 ip.print_instr(_block); tty->cr(); | |
2304 ip.print_stack(_block->state()); tty->cr(); | |
2305 ip.print_inline_level(_block); | |
2306 ip.print_head(); | |
2307 tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size()); | |
2308 } | |
2309 #endif | |
2310 _skip_block = false; | |
2311 assert(state() != NULL, "ValueStack missing!"); | |
2312 ciBytecodeStream s(method()); | |
2313 s.reset_to_bci(bci); | |
2314 int prev_bci = bci; | |
2315 scope_data()->set_stream(&s); | |
2316 // iterate | |
2317 Bytecodes::Code code = Bytecodes::_illegal; | |
2318 bool push_exception = false; | |
2319 | |
2320 if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) { | |
2321 // first thing in the exception entry block should be the exception object. | |
2322 push_exception = true; | |
2323 } | |
2324 | |
2325 while (!bailed_out() && last()->as_BlockEnd() == NULL && | |
2326 (code = stream()->next()) != ciBytecodeStream::EOBC() && | |
2327 (block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) { | |
1819 | 2328 assert(state()->kind() == ValueStack::Parsing, "invalid state kind"); |
0 | 2329 |
2330 // Check for active jsr during OSR compilation | |
2331 if (compilation()->is_osr_compile() | |
2332 && scope()->is_top_scope() | |
2333 && parsing_jsr() | |
2334 && s.cur_bci() == compilation()->osr_bci()) { | |
2335 bailout("OSR not supported while a jsr is active"); | |
2336 } | |
2337 | |
2338 if (push_exception) { | |
2339 apush(append(new ExceptionObject())); | |
2340 push_exception = false; | |
2341 } | |
2342 | |
2343 // handle bytecode | |
2344 switch (code) { | |
2345 case Bytecodes::_nop : /* nothing to do */ break; | |
2346 case Bytecodes::_aconst_null : apush(append(new Constant(objectNull ))); break; | |
2347 case Bytecodes::_iconst_m1 : ipush(append(new Constant(new IntConstant (-1)))); break; | |
2348 case Bytecodes::_iconst_0 : ipush(append(new Constant(intZero ))); break; | |
2349 case Bytecodes::_iconst_1 : ipush(append(new Constant(intOne ))); break; | |
2350 case Bytecodes::_iconst_2 : ipush(append(new Constant(new IntConstant ( 2)))); break; | |
2351 case Bytecodes::_iconst_3 : ipush(append(new Constant(new IntConstant ( 3)))); break; | |
2352 case Bytecodes::_iconst_4 : ipush(append(new Constant(new IntConstant ( 4)))); break; | |
2353 case Bytecodes::_iconst_5 : ipush(append(new Constant(new IntConstant ( 5)))); break; | |
2354 case Bytecodes::_lconst_0 : lpush(append(new Constant(new LongConstant ( 0)))); break; | |
2355 case Bytecodes::_lconst_1 : lpush(append(new Constant(new LongConstant ( 1)))); break; | |
2356 case Bytecodes::_fconst_0 : fpush(append(new Constant(new FloatConstant ( 0)))); break; | |
2357 case Bytecodes::_fconst_1 : fpush(append(new Constant(new FloatConstant ( 1)))); break; | |
2358 case Bytecodes::_fconst_2 : fpush(append(new Constant(new FloatConstant ( 2)))); break; | |
2359 case Bytecodes::_dconst_0 : dpush(append(new Constant(new DoubleConstant( 0)))); break; | |
2360 case Bytecodes::_dconst_1 : dpush(append(new Constant(new DoubleConstant( 1)))); break; | |
2361 case Bytecodes::_bipush : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break; | |
2362 case Bytecodes::_sipush : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break; | |
2363 case Bytecodes::_ldc : // fall through | |
2364 case Bytecodes::_ldc_w : // fall through | |
2365 case Bytecodes::_ldc2_w : load_constant(); break; | |
2366 case Bytecodes::_iload : load_local(intType , s.get_index()); break; | |
2367 case Bytecodes::_lload : load_local(longType , s.get_index()); break; | |
2368 case Bytecodes::_fload : load_local(floatType , s.get_index()); break; | |
2369 case Bytecodes::_dload : load_local(doubleType , s.get_index()); break; | |
2370 case Bytecodes::_aload : load_local(instanceType, s.get_index()); break; | |
2371 case Bytecodes::_iload_0 : load_local(intType , 0); break; | |
2372 case Bytecodes::_iload_1 : load_local(intType , 1); break; | |
2373 case Bytecodes::_iload_2 : load_local(intType , 2); break; | |
2374 case Bytecodes::_iload_3 : load_local(intType , 3); break; | |
2375 case Bytecodes::_lload_0 : load_local(longType , 0); break; | |
2376 case Bytecodes::_lload_1 : load_local(longType , 1); break; | |
2377 case Bytecodes::_lload_2 : load_local(longType , 2); break; | |
2378 case Bytecodes::_lload_3 : load_local(longType , 3); break; | |
2379 case Bytecodes::_fload_0 : load_local(floatType , 0); break; | |
2380 case Bytecodes::_fload_1 : load_local(floatType , 1); break; | |
2381 case Bytecodes::_fload_2 : load_local(floatType , 2); break; | |
2382 case Bytecodes::_fload_3 : load_local(floatType , 3); break; | |
2383 case Bytecodes::_dload_0 : load_local(doubleType, 0); break; | |
2384 case Bytecodes::_dload_1 : load_local(doubleType, 1); break; | |
2385 case Bytecodes::_dload_2 : load_local(doubleType, 2); break; | |
2386 case Bytecodes::_dload_3 : load_local(doubleType, 3); break; | |
2387 case Bytecodes::_aload_0 : load_local(objectType, 0); break; | |
2388 case Bytecodes::_aload_1 : load_local(objectType, 1); break; | |
2389 case Bytecodes::_aload_2 : load_local(objectType, 2); break; | |
2390 case Bytecodes::_aload_3 : load_local(objectType, 3); break; | |
2391 case Bytecodes::_iaload : load_indexed(T_INT ); break; | |
2392 case Bytecodes::_laload : load_indexed(T_LONG ); break; | |
2393 case Bytecodes::_faload : load_indexed(T_FLOAT ); break; | |
2394 case Bytecodes::_daload : load_indexed(T_DOUBLE); break; | |
2395 case Bytecodes::_aaload : load_indexed(T_OBJECT); break; | |
2396 case Bytecodes::_baload : load_indexed(T_BYTE ); break; | |
2397 case Bytecodes::_caload : load_indexed(T_CHAR ); break; | |
2398 case Bytecodes::_saload : load_indexed(T_SHORT ); break; | |
2399 case Bytecodes::_istore : store_local(intType , s.get_index()); break; | |
2400 case Bytecodes::_lstore : store_local(longType , s.get_index()); break; | |
2401 case Bytecodes::_fstore : store_local(floatType , s.get_index()); break; | |
2402 case Bytecodes::_dstore : store_local(doubleType, s.get_index()); break; | |
2403 case Bytecodes::_astore : store_local(objectType, s.get_index()); break; | |
2404 case Bytecodes::_istore_0 : store_local(intType , 0); break; | |
2405 case Bytecodes::_istore_1 : store_local(intType , 1); break; | |
2406 case Bytecodes::_istore_2 : store_local(intType , 2); break; | |
2407 case Bytecodes::_istore_3 : store_local(intType , 3); break; | |
2408 case Bytecodes::_lstore_0 : store_local(longType , 0); break; | |
2409 case Bytecodes::_lstore_1 : store_local(longType , 1); break; | |
2410 case Bytecodes::_lstore_2 : store_local(longType , 2); break; | |
2411 case Bytecodes::_lstore_3 : store_local(longType , 3); break; | |
2412 case Bytecodes::_fstore_0 : store_local(floatType , 0); break; | |
2413 case Bytecodes::_fstore_1 : store_local(floatType , 1); break; | |
2414 case Bytecodes::_fstore_2 : store_local(floatType , 2); break; | |
2415 case Bytecodes::_fstore_3 : store_local(floatType , 3); break; | |
2416 case Bytecodes::_dstore_0 : store_local(doubleType, 0); break; | |
2417 case Bytecodes::_dstore_1 : store_local(doubleType, 1); break; | |
2418 case Bytecodes::_dstore_2 : store_local(doubleType, 2); break; | |
2419 case Bytecodes::_dstore_3 : store_local(doubleType, 3); break; | |
2420 case Bytecodes::_astore_0 : store_local(objectType, 0); break; | |
2421 case Bytecodes::_astore_1 : store_local(objectType, 1); break; | |
2422 case Bytecodes::_astore_2 : store_local(objectType, 2); break; | |
2423 case Bytecodes::_astore_3 : store_local(objectType, 3); break; | |
2424 case Bytecodes::_iastore : store_indexed(T_INT ); break; | |
2425 case Bytecodes::_lastore : store_indexed(T_LONG ); break; | |
2426 case Bytecodes::_fastore : store_indexed(T_FLOAT ); break; | |
2427 case Bytecodes::_dastore : store_indexed(T_DOUBLE); break; | |
2428 case Bytecodes::_aastore : store_indexed(T_OBJECT); break; | |
2429 case Bytecodes::_bastore : store_indexed(T_BYTE ); break; | |
2430 case Bytecodes::_castore : store_indexed(T_CHAR ); break; | |
2431 case Bytecodes::_sastore : store_indexed(T_SHORT ); break; | |
2432 case Bytecodes::_pop : // fall through | |
2433 case Bytecodes::_pop2 : // fall through | |
2434 case Bytecodes::_dup : // fall through | |
2435 case Bytecodes::_dup_x1 : // fall through | |
2436 case Bytecodes::_dup_x2 : // fall through | |
2437 case Bytecodes::_dup2 : // fall through | |
2438 case Bytecodes::_dup2_x1 : // fall through | |
2439 case Bytecodes::_dup2_x2 : // fall through | |
2440 case Bytecodes::_swap : stack_op(code); break; | |
2441 case Bytecodes::_iadd : arithmetic_op(intType , code); break; | |
2442 case Bytecodes::_ladd : arithmetic_op(longType , code); break; | |
2443 case Bytecodes::_fadd : arithmetic_op(floatType , code); break; | |
2444 case Bytecodes::_dadd : arithmetic_op(doubleType, code); break; | |
2445 case Bytecodes::_isub : arithmetic_op(intType , code); break; | |
2446 case Bytecodes::_lsub : arithmetic_op(longType , code); break; | |
2447 case Bytecodes::_fsub : arithmetic_op(floatType , code); break; | |
2448 case Bytecodes::_dsub : arithmetic_op(doubleType, code); break; | |
2449 case Bytecodes::_imul : arithmetic_op(intType , code); break; | |
2450 case Bytecodes::_lmul : arithmetic_op(longType , code); break; | |
2451 case Bytecodes::_fmul : arithmetic_op(floatType , code); break; | |
2452 case Bytecodes::_dmul : arithmetic_op(doubleType, code); break; | |
1819 | 2453 case Bytecodes::_idiv : arithmetic_op(intType , code, copy_state_for_exception()); break; |
2454 case Bytecodes::_ldiv : arithmetic_op(longType , code, copy_state_for_exception()); break; | |
0 | 2455 case Bytecodes::_fdiv : arithmetic_op(floatType , code); break; |
2456 case Bytecodes::_ddiv : arithmetic_op(doubleType, code); break; | |
1819 | 2457 case Bytecodes::_irem : arithmetic_op(intType , code, copy_state_for_exception()); break; |
2458 case Bytecodes::_lrem : arithmetic_op(longType , code, copy_state_for_exception()); break; | |
0 | 2459 case Bytecodes::_frem : arithmetic_op(floatType , code); break; |
2460 case Bytecodes::_drem : arithmetic_op(doubleType, code); break; | |
2461 case Bytecodes::_ineg : negate_op(intType ); break; | |
2462 case Bytecodes::_lneg : negate_op(longType ); break; | |
2463 case Bytecodes::_fneg : negate_op(floatType ); break; | |
2464 case Bytecodes::_dneg : negate_op(doubleType); break; | |
2465 case Bytecodes::_ishl : shift_op(intType , code); break; | |
2466 case Bytecodes::_lshl : shift_op(longType, code); break; | |
2467 case Bytecodes::_ishr : shift_op(intType , code); break; | |
2468 case Bytecodes::_lshr : shift_op(longType, code); break; | |
2469 case Bytecodes::_iushr : shift_op(intType , code); break; | |
2470 case Bytecodes::_lushr : shift_op(longType, code); break; | |
2471 case Bytecodes::_iand : logic_op(intType , code); break; | |
2472 case Bytecodes::_land : logic_op(longType, code); break; | |
2473 case Bytecodes::_ior : logic_op(intType , code); break; | |
2474 case Bytecodes::_lor : logic_op(longType, code); break; | |
2475 case Bytecodes::_ixor : logic_op(intType , code); break; | |
2476 case Bytecodes::_lxor : logic_op(longType, code); break; | |
2477 case Bytecodes::_iinc : increment(); break; | |
2478 case Bytecodes::_i2l : convert(code, T_INT , T_LONG ); break; | |
2479 case Bytecodes::_i2f : convert(code, T_INT , T_FLOAT ); break; | |
2480 case Bytecodes::_i2d : convert(code, T_INT , T_DOUBLE); break; | |
2481 case Bytecodes::_l2i : convert(code, T_LONG , T_INT ); break; | |
2482 case Bytecodes::_l2f : convert(code, T_LONG , T_FLOAT ); break; | |
2483 case Bytecodes::_l2d : convert(code, T_LONG , T_DOUBLE); break; | |
2484 case Bytecodes::_f2i : convert(code, T_FLOAT , T_INT ); break; | |
2485 case Bytecodes::_f2l : convert(code, T_FLOAT , T_LONG ); break; | |
2486 case Bytecodes::_f2d : convert(code, T_FLOAT , T_DOUBLE); break; | |
2487 case Bytecodes::_d2i : convert(code, T_DOUBLE, T_INT ); break; | |
2488 case Bytecodes::_d2l : convert(code, T_DOUBLE, T_LONG ); break; | |
2489 case Bytecodes::_d2f : convert(code, T_DOUBLE, T_FLOAT ); break; | |
2490 case Bytecodes::_i2b : convert(code, T_INT , T_BYTE ); break; | |
2491 case Bytecodes::_i2c : convert(code, T_INT , T_CHAR ); break; | |
2492 case Bytecodes::_i2s : convert(code, T_INT , T_SHORT ); break; | |
2493 case Bytecodes::_lcmp : compare_op(longType , code); break; | |
2494 case Bytecodes::_fcmpl : compare_op(floatType , code); break; | |
2495 case Bytecodes::_fcmpg : compare_op(floatType , code); break; | |
2496 case Bytecodes::_dcmpl : compare_op(doubleType, code); break; | |
2497 case Bytecodes::_dcmpg : compare_op(doubleType, code); break; | |
2498 case Bytecodes::_ifeq : if_zero(intType , If::eql); break; | |
2499 case Bytecodes::_ifne : if_zero(intType , If::neq); break; | |
2500 case Bytecodes::_iflt : if_zero(intType , If::lss); break; | |
2501 case Bytecodes::_ifge : if_zero(intType , If::geq); break; | |
2502 case Bytecodes::_ifgt : if_zero(intType , If::gtr); break; | |
2503 case Bytecodes::_ifle : if_zero(intType , If::leq); break; | |
2504 case Bytecodes::_if_icmpeq : if_same(intType , If::eql); break; | |
2505 case Bytecodes::_if_icmpne : if_same(intType , If::neq); break; | |
2506 case Bytecodes::_if_icmplt : if_same(intType , If::lss); break; | |
2507 case Bytecodes::_if_icmpge : if_same(intType , If::geq); break; | |
2508 case Bytecodes::_if_icmpgt : if_same(intType , If::gtr); break; | |
2509 case Bytecodes::_if_icmple : if_same(intType , If::leq); break; | |
2510 case Bytecodes::_if_acmpeq : if_same(objectType, If::eql); break; | |
2511 case Bytecodes::_if_acmpne : if_same(objectType, If::neq); break; | |
2512 case Bytecodes::_goto : _goto(s.cur_bci(), s.get_dest()); break; | |
2513 case Bytecodes::_jsr : jsr(s.get_dest()); break; | |
2514 case Bytecodes::_ret : ret(s.get_index()); break; | |
2515 case Bytecodes::_tableswitch : table_switch(); break; | |
2516 case Bytecodes::_lookupswitch : lookup_switch(); break; | |
2517 case Bytecodes::_ireturn : method_return(ipop()); break; | |
2518 case Bytecodes::_lreturn : method_return(lpop()); break; | |
2519 case Bytecodes::_freturn : method_return(fpop()); break; | |
2520 case Bytecodes::_dreturn : method_return(dpop()); break; | |
2521 case Bytecodes::_areturn : method_return(apop()); break; | |
2522 case Bytecodes::_return : method_return(NULL ); break; | |
2523 case Bytecodes::_getstatic : // fall through | |
2524 case Bytecodes::_putstatic : // fall through | |
2525 case Bytecodes::_getfield : // fall through | |
2526 case Bytecodes::_putfield : access_field(code); break; | |
2527 case Bytecodes::_invokevirtual : // fall through | |
2528 case Bytecodes::_invokespecial : // fall through | |
2529 case Bytecodes::_invokestatic : // fall through | |
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
2530 case Bytecodes::_invokedynamic : // fall through |
0 | 2531 case Bytecodes::_invokeinterface: invoke(code); break; |
1565 | 2532 case Bytecodes::_new : new_instance(s.get_index_u2()); break; |
0 | 2533 case Bytecodes::_newarray : new_type_array(); break; |
2534 case Bytecodes::_anewarray : new_object_array(); break; | |
1819 | 2535 case Bytecodes::_arraylength : { ValueStack* state_before = copy_state_for_exception(); ipush(append(new ArrayLength(apop(), state_before))); break; } |
0 | 2536 case Bytecodes::_athrow : throw_op(s.cur_bci()); break; |
1565 | 2537 case Bytecodes::_checkcast : check_cast(s.get_index_u2()); break; |
2538 case Bytecodes::_instanceof : instance_of(s.get_index_u2()); break; | |
0 | 2539 case Bytecodes::_monitorenter : monitorenter(apop(), s.cur_bci()); break; |
2540 case Bytecodes::_monitorexit : monitorexit (apop(), s.cur_bci()); break; | |
2541 case Bytecodes::_wide : ShouldNotReachHere(); break; | |
2542 case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break; | |
2543 case Bytecodes::_ifnull : if_null(objectType, If::eql); break; | |
2544 case Bytecodes::_ifnonnull : if_null(objectType, If::neq); break; | |
2545 case Bytecodes::_goto_w : _goto(s.cur_bci(), s.get_far_dest()); break; | |
2546 case Bytecodes::_jsr_w : jsr(s.get_far_dest()); break; | |
2547 case Bytecodes::_breakpoint : BAILOUT_("concurrent setting of breakpoint", NULL); | |
2548 default : ShouldNotReachHere(); break; | |
2549 } | |
2550 // save current bci to setup Goto at the end | |
2551 prev_bci = s.cur_bci(); | |
2552 } | |
2553 CHECK_BAILOUT_(NULL); | |
2554 // stop processing of this block (see try_inline_full) | |
2555 if (_skip_block) { | |
2556 _skip_block = false; | |
2557 assert(_last && _last->as_BlockEnd(), ""); | |
2558 return _last->as_BlockEnd(); | |
2559 } | |
2560 // if there are any, check if last instruction is a BlockEnd instruction | |
2561 BlockEnd* end = last()->as_BlockEnd(); | |
2562 if (end == NULL) { | |
2563 // all blocks must end with a BlockEnd instruction => add a Goto | |
2564 end = new Goto(block_at(s.cur_bci()), false); | |
1819 | 2565 append(end); |
0 | 2566 } |
2567 assert(end == last()->as_BlockEnd(), "inconsistency"); | |
2568 | |
1819 | 2569 assert(end->state() != NULL, "state must already be present"); |
2570 assert(end->as_Return() == NULL || end->as_Throw() == NULL || end->state()->stack_size() == 0, "stack not needed for return and throw"); | |
0 | 2571 |
2572 // connect to begin & set state | |
2573 // NOTE that inlining may have changed the block we are parsing | |
2574 block()->set_end(end); | |
2575 // propagate state | |
2576 for (int i = end->number_of_sux() - 1; i >= 0; i--) { | |
2577 BlockBegin* sux = end->sux_at(i); | |
2578 assert(sux->is_predecessor(block()), "predecessor missing"); | |
2579 // be careful, bailout if bytecodes are strange | |
1819 | 2580 if (!sux->try_merge(end->state())) BAILOUT_("block join failed", NULL); |
0 | 2581 scope_data()->add_to_work_list(end->sux_at(i)); |
2582 } | |
2583 | |
2584 scope_data()->set_stream(NULL); | |
2585 | |
2586 // done | |
2587 return end; | |
2588 } | |
2589 | |
2590 | |
2591 void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) { | |
2592 do { | |
2593 if (start_in_current_block_for_inlining && !bailed_out()) { | |
2594 iterate_bytecodes_for_block(0); | |
2595 start_in_current_block_for_inlining = false; | |
2596 } else { | |
2597 BlockBegin* b; | |
2598 while ((b = scope_data()->remove_from_work_list()) != NULL) { | |
2599 if (!b->is_set(BlockBegin::was_visited_flag)) { | |
2600 if (b->is_set(BlockBegin::osr_entry_flag)) { | |
2601 // we're about to parse the osr entry block, so make sure | |
2602 // we setup the OSR edge leading into this block so that | |
2603 // Phis get setup correctly. | |
2604 setup_osr_entry_block(); | |
2605 // this is no longer the osr entry block, so clear it. | |
2606 b->clear(BlockBegin::osr_entry_flag); | |
2607 } | |
2608 b->set(BlockBegin::was_visited_flag); | |
2609 connect_to_end(b); | |
2610 } | |
2611 } | |
2612 } | |
2613 } while (!bailed_out() && !scope_data()->is_work_list_empty()); | |
2614 } | |
2615 | |
2616 | |
2617 bool GraphBuilder::_can_trap [Bytecodes::number_of_java_codes]; | |
2618 | |
2619 void GraphBuilder::initialize() { | |
2620 // the following bytecodes are assumed to potentially | |
2621 // throw exceptions in compiled code - note that e.g. | |
2622 // monitorexit & the return bytecodes do not throw | |
2623 // exceptions since monitor pairing proved that they | |
2624 // succeed (if monitor pairing succeeded) | |
2625 Bytecodes::Code can_trap_list[] = | |
2626 { Bytecodes::_ldc | |
2627 , Bytecodes::_ldc_w | |
2628 , Bytecodes::_ldc2_w | |
2629 , Bytecodes::_iaload | |
2630 , Bytecodes::_laload | |
2631 , Bytecodes::_faload | |
2632 , Bytecodes::_daload | |
2633 , Bytecodes::_aaload | |
2634 , Bytecodes::_baload | |
2635 , Bytecodes::_caload | |
2636 , Bytecodes::_saload | |
2637 , Bytecodes::_iastore | |
2638 , Bytecodes::_lastore | |
2639 , Bytecodes::_fastore | |
2640 , Bytecodes::_dastore | |
2641 , Bytecodes::_aastore | |
2642 , Bytecodes::_bastore | |
2643 , Bytecodes::_castore | |
2644 , Bytecodes::_sastore | |
2645 , Bytecodes::_idiv | |
2646 , Bytecodes::_ldiv | |
2647 , Bytecodes::_irem | |
2648 , Bytecodes::_lrem | |
2649 , Bytecodes::_getstatic | |
2650 , Bytecodes::_putstatic | |
2651 , Bytecodes::_getfield | |
2652 , Bytecodes::_putfield | |
2653 , Bytecodes::_invokevirtual | |
2654 , Bytecodes::_invokespecial | |
2655 , Bytecodes::_invokestatic | |
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
2656 , Bytecodes::_invokedynamic |
0 | 2657 , Bytecodes::_invokeinterface |
2658 , Bytecodes::_new | |
2659 , Bytecodes::_newarray | |
2660 , Bytecodes::_anewarray | |
2661 , Bytecodes::_arraylength | |
2662 , Bytecodes::_athrow | |
2663 , Bytecodes::_checkcast | |
2664 , Bytecodes::_instanceof | |
2665 , Bytecodes::_monitorenter | |
2666 , Bytecodes::_multianewarray | |
2667 }; | |
2668 | |
2669 // inititialize trap tables | |
2670 for (int i = 0; i < Bytecodes::number_of_java_codes; i++) { | |
2671 _can_trap[i] = false; | |
2672 } | |
2673 // set standard trap info | |
2674 for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) { | |
2675 _can_trap[can_trap_list[j]] = true; | |
2676 } | |
2677 } | |
2678 | |
2679 | |
2680 BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) { | |
2681 assert(entry->is_set(f), "entry/flag mismatch"); | |
2682 // create header block | |
2683 BlockBegin* h = new BlockBegin(entry->bci()); | |
2684 h->set_depth_first_number(0); | |
2685 | |
2686 Value l = h; | |
2687 BlockEnd* g = new Goto(entry, false); | |
2688 l->set_next(g, entry->bci()); | |
2689 h->set_end(g); | |
2690 h->set(f); | |
2691 // setup header block end state | |
1819 | 2692 ValueStack* s = state->copy(ValueStack::StateAfter, entry->bci()); // can use copy since stack is empty (=> no phis) |
0 | 2693 assert(s->stack_is_empty(), "must have empty stack at entry point"); |
2694 g->set_state(s); | |
2695 return h; | |
2696 } | |
2697 | |
2698 | |
2699 | |
2700 BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) { | |
2701 BlockBegin* start = new BlockBegin(0); | |
2702 | |
2703 // This code eliminates the empty start block at the beginning of | |
2704 // each method. Previously, each method started with the | |
2705 // start-block created below, and this block was followed by the | |
2706 // header block that was always empty. This header block is only | |
2707 // necesary if std_entry is also a backward branch target because | |
2708 // then phi functions may be necessary in the header block. It's | |
2709 // also necessary when profiling so that there's a single block that | |
2710 // can increment the interpreter_invocation_count. | |
2711 BlockBegin* new_header_block; | |
1783 | 2712 if (std_entry->number_of_preds() > 0 || count_invocations() || count_backedges()) { |
2713 new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state); | |
2714 } else { | |
0 | 2715 new_header_block = std_entry; |
2716 } | |
2717 | |
2718 // setup start block (root for the IR graph) | |
2719 Base* base = | |
2720 new Base( | |
2721 new_header_block, | |
2722 osr_entry | |
2723 ); | |
2724 start->set_next(base, 0); | |
2725 start->set_end(base); | |
2726 // create & setup state for start block | |
1819 | 2727 start->set_state(state->copy(ValueStack::StateAfter, std_entry->bci())); |
2728 base->set_state(state->copy(ValueStack::StateAfter, std_entry->bci())); | |
0 | 2729 |
2730 if (base->std_entry()->state() == NULL) { | |
2731 // setup states for header blocks | |
2732 base->std_entry()->merge(state); | |
2733 } | |
2734 | |
2735 assert(base->std_entry()->state() != NULL, ""); | |
2736 return start; | |
2737 } | |
2738 | |
2739 | |
2740 void GraphBuilder::setup_osr_entry_block() { | |
2741 assert(compilation()->is_osr_compile(), "only for osrs"); | |
2742 | |
2743 int osr_bci = compilation()->osr_bci(); | |
2744 ciBytecodeStream s(method()); | |
2745 s.reset_to_bci(osr_bci); | |
2746 s.next(); | |
2747 scope_data()->set_stream(&s); | |
2748 | |
2749 // create a new block to be the osr setup code | |
2750 _osr_entry = new BlockBegin(osr_bci); | |
2751 _osr_entry->set(BlockBegin::osr_entry_flag); | |
2752 _osr_entry->set_depth_first_number(0); | |
2753 BlockBegin* target = bci2block()->at(osr_bci); | |
2754 assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there"); | |
2755 // the osr entry has no values for locals | |
2756 ValueStack* state = target->state()->copy(); | |
2757 _osr_entry->set_state(state); | |
2758 | |
2759 kill_all(); | |
2760 _block = _osr_entry; | |
2761 _state = _osr_entry->state()->copy(); | |
1819 | 2762 assert(_state->bci() == osr_bci, "mismatch"); |
0 | 2763 _last = _osr_entry; |
2764 Value e = append(new OsrEntry()); | |
2765 e->set_needs_null_check(false); | |
2766 | |
2767 // OSR buffer is | |
2768 // | |
2769 // locals[nlocals-1..0] | |
2770 // monitors[number_of_locks-1..0] | |
2771 // | |
2772 // locals is a direct copy of the interpreter frame so in the osr buffer | |
2773 // so first slot in the local array is the last local from the interpreter | |
2774 // and last slot is local[0] (receiver) from the interpreter | |
2775 // | |
2776 // Similarly with locks. The first lock slot in the osr buffer is the nth lock | |
2777 // from the interpreter frame, the nth lock slot in the osr buffer is 0th lock | |
2778 // in the interpreter frame (the method lock if a sync method) | |
2779 | |
2780 // Initialize monitors in the compiled activation. | |
2781 | |
2782 int index; | |
2783 Value local; | |
2784 | |
2785 // find all the locals that the interpreter thinks contain live oops | |
2786 const BitMap live_oops = method()->live_local_oops_at_bci(osr_bci); | |
2787 | |
2788 // compute the offset into the locals so that we can treat the buffer | |
2789 // as if the locals were still in the interpreter frame | |
2790 int locals_offset = BytesPerWord * (method()->max_locals() - 1); | |
2791 for_each_local_value(state, index, local) { | |
2792 int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord; | |
2793 Value get; | |
2794 if (local->type()->is_object_kind() && !live_oops.at(index)) { | |
2795 // The interpreter thinks this local is dead but the compiler | |
2796 // doesn't so pretend that the interpreter passed in null. | |
2797 get = append(new Constant(objectNull)); | |
2798 } else { | |
2799 get = append(new UnsafeGetRaw(as_BasicType(local->type()), e, | |
2800 append(new Constant(new IntConstant(offset))), | |
2801 0, | |
2002 | 2802 true /*unaligned*/, true /*wide*/)); |
0 | 2803 } |
2804 _state->store_local(index, get); | |
2805 } | |
2806 | |
2807 // the storage for the OSR buffer is freed manually in the LIRGenerator. | |
2808 | |
2809 assert(state->caller_state() == NULL, "should be top scope"); | |
2810 state->clear_locals(); | |
2811 Goto* g = new Goto(target, false); | |
2812 append(g); | |
2813 _osr_entry->set_end(g); | |
2814 target->merge(_osr_entry->end()->state()); | |
2815 | |
2816 scope_data()->set_stream(NULL); | |
2817 } | |
2818 | |
2819 | |
2820 ValueStack* GraphBuilder::state_at_entry() { | |
1819 | 2821 ValueStack* state = new ValueStack(scope(), NULL); |
0 | 2822 |
2823 // Set up locals for receiver | |
2824 int idx = 0; | |
2825 if (!method()->is_static()) { | |
2826 // we should always see the receiver | |
2446 | 2827 state->store_local(idx, new Local(method()->holder(), objectType, idx)); |
0 | 2828 idx = 1; |
2829 } | |
2830 | |
2831 // Set up locals for incoming arguments | |
2832 ciSignature* sig = method()->signature(); | |
2833 for (int i = 0; i < sig->count(); i++) { | |
2834 ciType* type = sig->type_at(i); | |
2835 BasicType basic_type = type->basic_type(); | |
2836 // don't allow T_ARRAY to propagate into locals types | |
2837 if (basic_type == T_ARRAY) basic_type = T_OBJECT; | |
2838 ValueType* vt = as_ValueType(basic_type); | |
2446 | 2839 state->store_local(idx, new Local(type, vt, idx)); |
0 | 2840 idx += type->size(); |
2841 } | |
2842 | |
2843 // lock synchronized method | |
2844 if (method()->is_synchronized()) { | |
1819 | 2845 state->lock(NULL); |
0 | 2846 } |
2847 | |
2848 return state; | |
2849 } | |
2850 | |
2851 | |
2852 GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope) | |
2853 : _scope_data(NULL) | |
2854 , _instruction_count(0) | |
2855 , _osr_entry(NULL) | |
2856 , _memory(new MemoryBuffer()) | |
2857 , _compilation(compilation) | |
2858 , _inline_bailout_msg(NULL) | |
2859 { | |
2860 int osr_bci = compilation->osr_bci(); | |
2861 | |
2862 // determine entry points and bci2block mapping | |
2863 BlockListBuilder blm(compilation, scope, osr_bci); | |
2864 CHECK_BAILOUT(); | |
2865 | |
2866 BlockList* bci2block = blm.bci2block(); | |
2867 BlockBegin* start_block = bci2block->at(0); | |
2868 | |
2869 push_root_scope(scope, bci2block, start_block); | |
2870 | |
2871 // setup state for std entry | |
2872 _initial_state = state_at_entry(); | |
2873 start_block->merge(_initial_state); | |
2874 | |
2875 // complete graph | |
2876 _vmap = new ValueMap(); | |
2877 switch (scope->method()->intrinsic_id()) { | |
2878 case vmIntrinsics::_dabs : // fall through | |
2879 case vmIntrinsics::_dsqrt : // fall through | |
2880 case vmIntrinsics::_dsin : // fall through | |
2881 case vmIntrinsics::_dcos : // fall through | |
2882 case vmIntrinsics::_dtan : // fall through | |
2883 case vmIntrinsics::_dlog : // fall through | |
2884 case vmIntrinsics::_dlog10 : // fall through | |
2885 { | |
2886 // Compiles where the root method is an intrinsic need a special | |
2887 // compilation environment because the bytecodes for the method | |
2888 // shouldn't be parsed during the compilation, only the special | |
2889 // Intrinsic node should be emitted. If this isn't done the the | |
2890 // code for the inlined version will be different than the root | |
2891 // compiled version which could lead to monotonicity problems on | |
2892 // intel. | |
2893 | |
2894 // Set up a stream so that appending instructions works properly. | |
2895 ciBytecodeStream s(scope->method()); | |
2896 s.reset_to_bci(0); | |
2897 scope_data()->set_stream(&s); | |
2898 s.next(); | |
2899 | |
2900 // setup the initial block state | |
2901 _block = start_block; | |
1819 | 2902 _state = start_block->state()->copy_for_parsing(); |
0 | 2903 _last = start_block; |
2904 load_local(doubleType, 0); | |
2905 | |
2906 // Emit the intrinsic node. | |
2907 bool result = try_inline_intrinsics(scope->method()); | |
2908 if (!result) BAILOUT("failed to inline intrinsic"); | |
2909 method_return(dpop()); | |
2910 | |
2911 // connect the begin and end blocks and we're all done. | |
2912 BlockEnd* end = last()->as_BlockEnd(); | |
2913 block()->set_end(end); | |
2914 break; | |
2915 } | |
3249
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2916 |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2917 case vmIntrinsics::_Reference_get: |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2918 { |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2919 if (UseG1GC) { |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2920 // With java.lang.ref.reference.get() we must go through the |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2921 // intrinsic - when G1 is enabled - even when get() is the root |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2922 // method of the compile so that, if necessary, the value in |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2923 // the referent field of the reference object gets recorded by |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2924 // the pre-barrier code. |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2925 // Specifically, if G1 is enabled, the value in the referent |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2926 // field is recorded by the G1 SATB pre barrier. This will |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2927 // result in the referent being marked live and the reference |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2928 // object removed from the list of discovered references during |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2929 // reference processing. |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2930 |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2931 // Set up a stream so that appending instructions works properly. |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2932 ciBytecodeStream s(scope->method()); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2933 s.reset_to_bci(0); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2934 scope_data()->set_stream(&s); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2935 s.next(); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2936 |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2937 // setup the initial block state |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2938 _block = start_block; |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2939 _state = start_block->state()->copy_for_parsing(); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2940 _last = start_block; |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2941 load_local(objectType, 0); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2942 |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2943 // Emit the intrinsic node. |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2944 bool result = try_inline_intrinsics(scope->method()); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2945 if (!result) BAILOUT("failed to inline intrinsic"); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2946 method_return(apop()); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2947 |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2948 // connect the begin and end blocks and we're all done. |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2949 BlockEnd* end = last()->as_BlockEnd(); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2950 block()->set_end(end); |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2951 break; |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2952 } |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2953 // Otherwise, fall thru |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2954 } |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
2955 |
0 | 2956 default: |
2957 scope_data()->add_to_work_list(start_block); | |
2958 iterate_all_blocks(); | |
2959 break; | |
2960 } | |
2961 CHECK_BAILOUT(); | |
2962 | |
2963 _start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state); | |
2964 | |
2965 eliminate_redundant_phis(_start); | |
2966 | |
2967 NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats()); | |
2968 // for osr compile, bailout if some requirements are not fulfilled | |
2969 if (osr_bci != -1) { | |
2970 BlockBegin* osr_block = blm.bci2block()->at(osr_bci); | |
2971 assert(osr_block->is_set(BlockBegin::was_visited_flag),"osr entry must have been visited for osr compile"); | |
2972 | |
2973 // check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points | |
2974 if (!osr_block->state()->stack_is_empty()) { | |
2975 BAILOUT("stack not empty at OSR entry point"); | |
2976 } | |
2977 } | |
2978 #ifndef PRODUCT | |
2979 if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count); | |
2980 #endif | |
2981 } | |
2982 | |
2983 | |
1819 | 2984 ValueStack* GraphBuilder::copy_state_before() { |
2985 return copy_state_before_with_bci(bci()); | |
2986 } | |
2987 | |
2988 ValueStack* GraphBuilder::copy_state_exhandling() { | |
2989 return copy_state_exhandling_with_bci(bci()); | |
2990 } | |
2991 | |
2992 ValueStack* GraphBuilder::copy_state_for_exception() { | |
2993 return copy_state_for_exception_with_bci(bci()); | |
2994 } | |
2995 | |
2996 ValueStack* GraphBuilder::copy_state_before_with_bci(int bci) { | |
2997 return state()->copy(ValueStack::StateBefore, bci); | |
0 | 2998 } |
2999 | |
1819 | 3000 ValueStack* GraphBuilder::copy_state_exhandling_with_bci(int bci) { |
3001 if (!has_handler()) return NULL; | |
3002 return state()->copy(ValueStack::StateBefore, bci); | |
3003 } | |
3004 | |
3005 ValueStack* GraphBuilder::copy_state_for_exception_with_bci(int bci) { | |
3006 ValueStack* s = copy_state_exhandling_with_bci(bci); | |
3007 if (s == NULL) { | |
3008 if (_compilation->env()->jvmti_can_access_local_variables()) { | |
3009 s = state()->copy(ValueStack::ExceptionState, bci); | |
3010 } else { | |
3011 s = state()->copy(ValueStack::EmptyExceptionState, bci); | |
3012 } | |
3013 } | |
3014 return s; | |
3015 } | |
0 | 3016 |
3017 int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const { | |
3018 int recur_level = 0; | |
3019 for (IRScope* s = scope(); s != NULL; s = s->caller()) { | |
3020 if (s->method() == cur_callee) { | |
3021 ++recur_level; | |
3022 } | |
3023 } | |
3024 return recur_level; | |
3025 } | |
3026 | |
3027 | |
3028 bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known) { | |
3029 // Clear out any existing inline bailout condition | |
3030 clear_inline_bailout(); | |
3031 | |
3032 if (callee->should_exclude()) { | |
3033 // callee is excluded | |
3034 INLINE_BAILOUT("excluded by CompilerOracle") | |
3035 } else if (!callee->can_be_compiled()) { | |
3036 // callee is not compilable (prob. has breakpoints) | |
3037 INLINE_BAILOUT("not compilable") | |
3038 } else if (callee->intrinsic_id() != vmIntrinsics::_none && try_inline_intrinsics(callee)) { | |
3039 // intrinsics can be native or not | |
3040 return true; | |
3041 } else if (callee->is_native()) { | |
3042 // non-intrinsic natives cannot be inlined | |
3043 INLINE_BAILOUT("non-intrinsic native") | |
3044 } else if (callee->is_abstract()) { | |
3045 INLINE_BAILOUT("abstract") | |
3046 } else { | |
3047 return try_inline_full(callee, holder_known); | |
3048 } | |
3049 } | |
3050 | |
3051 | |
3052 bool GraphBuilder::try_inline_intrinsics(ciMethod* callee) { | |
3053 if (!InlineNatives ) INLINE_BAILOUT("intrinsic method inlining disabled"); | |
1540
99791ad65936
6953539: after 6892658 c1 reports that it doesn't inline StringBuffer.append
never
parents:
1397
diff
changeset
|
3054 if (callee->is_synchronized()) { |
99791ad65936
6953539: after 6892658 c1 reports that it doesn't inline StringBuffer.append
never
parents:
1397
diff
changeset
|
3055 // We don't currently support any synchronized intrinsics |
99791ad65936
6953539: after 6892658 c1 reports that it doesn't inline StringBuffer.append
never
parents:
1397
diff
changeset
|
3056 return false; |
99791ad65936
6953539: after 6892658 c1 reports that it doesn't inline StringBuffer.append
never
parents:
1397
diff
changeset
|
3057 } |
99791ad65936
6953539: after 6892658 c1 reports that it doesn't inline StringBuffer.append
never
parents:
1397
diff
changeset
|
3058 |
0 | 3059 // callee seems like a good candidate |
3060 // determine id | |
3061 bool preserves_state = false; | |
3062 bool cantrap = true; | |
3063 vmIntrinsics::ID id = callee->intrinsic_id(); | |
3064 switch (id) { | |
3065 case vmIntrinsics::_arraycopy : | |
3066 if (!InlineArrayCopy) return false; | |
3067 break; | |
3068 | |
3069 case vmIntrinsics::_currentTimeMillis: | |
3070 case vmIntrinsics::_nanoTime: | |
3071 preserves_state = true; | |
3072 cantrap = false; | |
3073 break; | |
3074 | |
3075 case vmIntrinsics::_floatToRawIntBits : | |
3076 case vmIntrinsics::_intBitsToFloat : | |
3077 case vmIntrinsics::_doubleToRawLongBits : | |
3078 case vmIntrinsics::_longBitsToDouble : | |
3079 if (!InlineMathNatives) return false; | |
3080 preserves_state = true; | |
3081 cantrap = false; | |
3082 break; | |
3083 | |
3084 case vmIntrinsics::_getClass : | |
3085 if (!InlineClassNatives) return false; | |
3086 preserves_state = true; | |
3087 break; | |
3088 | |
3089 case vmIntrinsics::_currentThread : | |
3090 if (!InlineThreadNatives) return false; | |
3091 preserves_state = true; | |
3092 cantrap = false; | |
3093 break; | |
3094 | |
3095 case vmIntrinsics::_dabs : // fall through | |
3096 case vmIntrinsics::_dsqrt : // fall through | |
3097 case vmIntrinsics::_dsin : // fall through | |
3098 case vmIntrinsics::_dcos : // fall through | |
3099 case vmIntrinsics::_dtan : // fall through | |
3100 case vmIntrinsics::_dlog : // fall through | |
3101 case vmIntrinsics::_dlog10 : // fall through | |
3102 if (!InlineMathNatives) return false; | |
3103 cantrap = false; | |
3104 preserves_state = true; | |
3105 break; | |
3106 | |
3107 // sun/misc/AtomicLong.attemptUpdate | |
3108 case vmIntrinsics::_attemptUpdate : | |
3109 if (!VM_Version::supports_cx8()) return false; | |
3110 if (!InlineAtomicLong) return false; | |
3111 preserves_state = true; | |
3112 break; | |
3113 | |
3114 // Use special nodes for Unsafe instructions so we can more easily | |
3115 // perform an address-mode optimization on the raw variants | |
3116 case vmIntrinsics::_getObject : return append_unsafe_get_obj(callee, T_OBJECT, false); | |
3117 case vmIntrinsics::_getBoolean: return append_unsafe_get_obj(callee, T_BOOLEAN, false); | |
3118 case vmIntrinsics::_getByte : return append_unsafe_get_obj(callee, T_BYTE, false); | |
3119 case vmIntrinsics::_getShort : return append_unsafe_get_obj(callee, T_SHORT, false); | |
3120 case vmIntrinsics::_getChar : return append_unsafe_get_obj(callee, T_CHAR, false); | |
3121 case vmIntrinsics::_getInt : return append_unsafe_get_obj(callee, T_INT, false); | |
3122 case vmIntrinsics::_getLong : return append_unsafe_get_obj(callee, T_LONG, false); | |
3123 case vmIntrinsics::_getFloat : return append_unsafe_get_obj(callee, T_FLOAT, false); | |
3124 case vmIntrinsics::_getDouble : return append_unsafe_get_obj(callee, T_DOUBLE, false); | |
3125 | |
3126 case vmIntrinsics::_putObject : return append_unsafe_put_obj(callee, T_OBJECT, false); | |
3127 case vmIntrinsics::_putBoolean: return append_unsafe_put_obj(callee, T_BOOLEAN, false); | |
3128 case vmIntrinsics::_putByte : return append_unsafe_put_obj(callee, T_BYTE, false); | |
3129 case vmIntrinsics::_putShort : return append_unsafe_put_obj(callee, T_SHORT, false); | |
3130 case vmIntrinsics::_putChar : return append_unsafe_put_obj(callee, T_CHAR, false); | |
3131 case vmIntrinsics::_putInt : return append_unsafe_put_obj(callee, T_INT, false); | |
3132 case vmIntrinsics::_putLong : return append_unsafe_put_obj(callee, T_LONG, false); | |
3133 case vmIntrinsics::_putFloat : return append_unsafe_put_obj(callee, T_FLOAT, false); | |
3134 case vmIntrinsics::_putDouble : return append_unsafe_put_obj(callee, T_DOUBLE, false); | |
3135 | |
3136 case vmIntrinsics::_getObjectVolatile : return append_unsafe_get_obj(callee, T_OBJECT, true); | |
3137 case vmIntrinsics::_getBooleanVolatile: return append_unsafe_get_obj(callee, T_BOOLEAN, true); | |
3138 case vmIntrinsics::_getByteVolatile : return append_unsafe_get_obj(callee, T_BYTE, true); | |
3139 case vmIntrinsics::_getShortVolatile : return append_unsafe_get_obj(callee, T_SHORT, true); | |
3140 case vmIntrinsics::_getCharVolatile : return append_unsafe_get_obj(callee, T_CHAR, true); | |
3141 case vmIntrinsics::_getIntVolatile : return append_unsafe_get_obj(callee, T_INT, true); | |
3142 case vmIntrinsics::_getLongVolatile : return append_unsafe_get_obj(callee, T_LONG, true); | |
3143 case vmIntrinsics::_getFloatVolatile : return append_unsafe_get_obj(callee, T_FLOAT, true); | |
3144 case vmIntrinsics::_getDoubleVolatile : return append_unsafe_get_obj(callee, T_DOUBLE, true); | |
3145 | |
3146 case vmIntrinsics::_putObjectVolatile : return append_unsafe_put_obj(callee, T_OBJECT, true); | |
3147 case vmIntrinsics::_putBooleanVolatile: return append_unsafe_put_obj(callee, T_BOOLEAN, true); | |
3148 case vmIntrinsics::_putByteVolatile : return append_unsafe_put_obj(callee, T_BYTE, true); | |
3149 case vmIntrinsics::_putShortVolatile : return append_unsafe_put_obj(callee, T_SHORT, true); | |
3150 case vmIntrinsics::_putCharVolatile : return append_unsafe_put_obj(callee, T_CHAR, true); | |
3151 case vmIntrinsics::_putIntVolatile : return append_unsafe_put_obj(callee, T_INT, true); | |
3152 case vmIntrinsics::_putLongVolatile : return append_unsafe_put_obj(callee, T_LONG, true); | |
3153 case vmIntrinsics::_putFloatVolatile : return append_unsafe_put_obj(callee, T_FLOAT, true); | |
3154 case vmIntrinsics::_putDoubleVolatile : return append_unsafe_put_obj(callee, T_DOUBLE, true); | |
3155 | |
3156 case vmIntrinsics::_getByte_raw : return append_unsafe_get_raw(callee, T_BYTE); | |
3157 case vmIntrinsics::_getShort_raw : return append_unsafe_get_raw(callee, T_SHORT); | |
3158 case vmIntrinsics::_getChar_raw : return append_unsafe_get_raw(callee, T_CHAR); | |
3159 case vmIntrinsics::_getInt_raw : return append_unsafe_get_raw(callee, T_INT); | |
3160 case vmIntrinsics::_getLong_raw : return append_unsafe_get_raw(callee, T_LONG); | |
3161 case vmIntrinsics::_getFloat_raw : return append_unsafe_get_raw(callee, T_FLOAT); | |
3162 case vmIntrinsics::_getDouble_raw : return append_unsafe_get_raw(callee, T_DOUBLE); | |
3163 | |
3164 case vmIntrinsics::_putByte_raw : return append_unsafe_put_raw(callee, T_BYTE); | |
3165 case vmIntrinsics::_putShort_raw : return append_unsafe_put_raw(callee, T_SHORT); | |
3166 case vmIntrinsics::_putChar_raw : return append_unsafe_put_raw(callee, T_CHAR); | |
3167 case vmIntrinsics::_putInt_raw : return append_unsafe_put_raw(callee, T_INT); | |
3168 case vmIntrinsics::_putLong_raw : return append_unsafe_put_raw(callee, T_LONG); | |
3169 case vmIntrinsics::_putFloat_raw : return append_unsafe_put_raw(callee, T_FLOAT); | |
3170 case vmIntrinsics::_putDouble_raw : return append_unsafe_put_raw(callee, T_DOUBLE); | |
3171 | |
3172 case vmIntrinsics::_prefetchRead : return append_unsafe_prefetch(callee, false, false); | |
3173 case vmIntrinsics::_prefetchWrite : return append_unsafe_prefetch(callee, false, true); | |
3174 case vmIntrinsics::_prefetchReadStatic : return append_unsafe_prefetch(callee, true, false); | |
3175 case vmIntrinsics::_prefetchWriteStatic : return append_unsafe_prefetch(callee, true, true); | |
3176 | |
3177 case vmIntrinsics::_checkIndex : | |
3178 if (!InlineNIOCheckIndex) return false; | |
3179 preserves_state = true; | |
3180 break; | |
3181 case vmIntrinsics::_putOrderedObject : return append_unsafe_put_obj(callee, T_OBJECT, true); | |
3182 case vmIntrinsics::_putOrderedInt : return append_unsafe_put_obj(callee, T_INT, true); | |
3183 case vmIntrinsics::_putOrderedLong : return append_unsafe_put_obj(callee, T_LONG, true); | |
3184 | |
3185 case vmIntrinsics::_compareAndSwapLong: | |
3186 if (!VM_Version::supports_cx8()) return false; | |
3187 // fall through | |
3188 case vmIntrinsics::_compareAndSwapInt: | |
3189 case vmIntrinsics::_compareAndSwapObject: | |
3190 append_unsafe_CAS(callee); | |
3191 return true; | |
3192 | |
3249
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3193 case vmIntrinsics::_Reference_get: |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3194 // It is only when G1 is enabled that we absolutely |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3195 // need to use the intrinsic version of Reference.get() |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3196 // so that the value in the referent field, if necessary, |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3197 // can be registered by the pre-barrier code. |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3198 if (!UseG1GC) return false; |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3199 preserves_state = true; |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3200 break; |
e1162778c1c8
7009266: G1: assert(obj->is_oop_or_null(true )) failed: Error
johnc
parents:
2376
diff
changeset
|
3201 |
0 | 3202 default : return false; // do not inline |
3203 } | |
3204 // create intrinsic node | |
3205 const bool has_receiver = !callee->is_static(); | |
3206 ValueType* result_type = as_ValueType(callee->return_type()); | |
1819 | 3207 ValueStack* state_before = copy_state_for_exception(); |
0 | 3208 |
3209 Values* args = state()->pop_arguments(callee->arg_size()); | |
1783 | 3210 |
3211 if (is_profiling()) { | |
0 | 3212 // Don't profile in the special case where the root method |
3213 // is the intrinsic | |
3214 if (callee != method()) { | |
1783 | 3215 // Note that we'd collect profile data in this method if we wanted it. |
3216 compilation()->set_would_profile(true); | |
3217 if (profile_calls()) { | |
3218 Value recv = NULL; | |
3219 if (has_receiver) { | |
3220 recv = args->at(0); | |
3221 null_check(recv); | |
3222 } | |
3223 profile_call(recv, NULL); | |
0 | 3224 } |
3225 } | |
3226 } | |
3227 | |
1819 | 3228 Intrinsic* result = new Intrinsic(result_type, id, args, has_receiver, state_before, |
0 | 3229 preserves_state, cantrap); |
3230 // append instruction & push result | |
3231 Value value = append_split(result); | |
3232 if (result_type != voidType) push(result_type, value); | |
3233 | |
3234 #ifndef PRODUCT | |
3235 // printing | |
3236 if (PrintInlining) { | |
3237 print_inline_result(callee, true); | |
3238 } | |
3239 #endif | |
3240 | |
3241 // done | |
3242 return true; | |
3243 } | |
3244 | |
3245 | |
3246 bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) { | |
3247 // Introduce a new callee continuation point - all Ret instructions | |
3248 // will be replaced with Gotos to this point. | |
3249 BlockBegin* cont = block_at(next_bci()); | |
3250 assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr"); | |
3251 | |
3252 // Note: can not assign state to continuation yet, as we have to | |
3253 // pick up the state from the Ret instructions. | |
3254 | |
3255 // Push callee scope | |
3256 push_scope_for_jsr(cont, jsr_dest_bci); | |
3257 | |
3258 // Temporarily set up bytecode stream so we can append instructions | |
3259 // (only using the bci of this stream) | |
3260 scope_data()->set_stream(scope_data()->parent()->stream()); | |
3261 | |
3262 BlockBegin* jsr_start_block = block_at(jsr_dest_bci); | |
3263 assert(jsr_start_block != NULL, "jsr start block must exist"); | |
3264 assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet"); | |
3265 Goto* goto_sub = new Goto(jsr_start_block, false); | |
3266 // Must copy state to avoid wrong sharing when parsing bytecodes | |
3267 assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block"); | |
1819 | 3268 jsr_start_block->set_state(copy_state_before_with_bci(jsr_dest_bci)); |
0 | 3269 append(goto_sub); |
3270 _block->set_end(goto_sub); | |
3271 _last = _block = jsr_start_block; | |
3272 | |
3273 // Clear out bytecode stream | |
3274 scope_data()->set_stream(NULL); | |
3275 | |
3276 scope_data()->add_to_work_list(jsr_start_block); | |
3277 | |
3278 // Ready to resume parsing in subroutine | |
3279 iterate_all_blocks(); | |
3280 | |
3281 // If we bailed out during parsing, return immediately (this is bad news) | |
3282 CHECK_BAILOUT_(false); | |
3283 | |
3284 // Detect whether the continuation can actually be reached. If not, | |
3285 // it has not had state set by the join() operations in | |
3286 // iterate_bytecodes_for_block()/ret() and we should not touch the | |
3287 // iteration state. The calling activation of | |
3288 // iterate_bytecodes_for_block will then complete normally. | |
3289 if (cont->state() != NULL) { | |
3290 if (!cont->is_set(BlockBegin::was_visited_flag)) { | |
3291 // add continuation to work list instead of parsing it immediately | |
3292 scope_data()->parent()->add_to_work_list(cont); | |
3293 } | |
3294 } | |
3295 | |
3296 assert(jsr_continuation() == cont, "continuation must not have changed"); | |
3297 assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) || | |
3298 jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag), | |
3299 "continuation can only be visited in case of backward branches"); | |
3300 assert(_last && _last->as_BlockEnd(), "block must have end"); | |
3301 | |
3302 // continuation is in work list, so end iteration of current block | |
3303 _skip_block = true; | |
3304 pop_scope_for_jsr(); | |
3305 | |
3306 return true; | |
3307 } | |
3308 | |
3309 | |
3310 // Inline the entry of a synchronized method as a monitor enter and | |
3311 // register the exception handler which releases the monitor if an | |
3312 // exception is thrown within the callee. Note that the monitor enter | |
3313 // cannot throw an exception itself, because the receiver is | |
3314 // guaranteed to be non-null by the explicit null check at the | |
3315 // beginning of inlining. | |
3316 void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) { | |
3317 assert(lock != NULL && sync_handler != NULL, "lock or handler missing"); | |
3318 | |
3319 monitorenter(lock, SynchronizationEntryBCI); | |
3320 assert(_last->as_MonitorEnter() != NULL, "monitor enter expected"); | |
3321 _last->set_needs_null_check(false); | |
3322 | |
3323 sync_handler->set(BlockBegin::exception_entry_flag); | |
3324 sync_handler->set(BlockBegin::is_on_work_list_flag); | |
3325 | |
3326 ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); | |
3327 XHandler* h = new XHandler(desc); | |
3328 h->set_entry_block(sync_handler); | |
3329 scope_data()->xhandlers()->append(h); | |
3330 scope_data()->set_has_handler(); | |
3331 } | |
3332 | |
3333 | |
3334 // If an exception is thrown and not handled within an inlined | |
3335 // synchronized method, the monitor must be released before the | |
3336 // exception is rethrown in the outer scope. Generate the appropriate | |
3337 // instructions here. | |
3338 void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) { | |
3339 BlockBegin* orig_block = _block; | |
3340 ValueStack* orig_state = _state; | |
3341 Instruction* orig_last = _last; | |
3342 _last = _block = sync_handler; | |
3343 _state = sync_handler->state()->copy(); | |
3344 | |
3345 assert(sync_handler != NULL, "handler missing"); | |
3346 assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here"); | |
3347 | |
3348 assert(lock != NULL || default_handler, "lock or handler missing"); | |
3349 | |
3350 XHandler* h = scope_data()->xhandlers()->remove_last(); | |
3351 assert(h->entry_block() == sync_handler, "corrupt list of handlers"); | |
3352 | |
3353 block()->set(BlockBegin::was_visited_flag); | |
3354 Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI); | |
3355 assert(exception->is_pinned(), "must be"); | |
3356 | |
2318
6f3746e69a78
7021603: crash in fill_sync_handler with ExtendedDTrace probes
never
parents:
2167
diff
changeset
|
3357 int bci = SynchronizationEntryBCI; |
2166
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3358 if (compilation()->env()->dtrace_method_probes()) { |
2318
6f3746e69a78
7021603: crash in fill_sync_handler with ExtendedDTrace probes
never
parents:
2167
diff
changeset
|
3359 // Report exit from inline methods. We don't have a stream here |
6f3746e69a78
7021603: crash in fill_sync_handler with ExtendedDTrace probes
never
parents:
2167
diff
changeset
|
3360 // so pass an explicit bci of SynchronizationEntryBCI. |
2166
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3361 Values* args = new Values(1); |
2318
6f3746e69a78
7021603: crash in fill_sync_handler with ExtendedDTrace probes
never
parents:
2167
diff
changeset
|
3362 args->push(append_with_bci(new Constant(new ObjectConstant(method())), bci)); |
6f3746e69a78
7021603: crash in fill_sync_handler with ExtendedDTrace probes
never
parents:
2167
diff
changeset
|
3363 append_with_bci(new RuntimeCall(voidType, "dtrace_method_exit", CAST_FROM_FN_PTR(address, SharedRuntime::dtrace_method_exit), args), bci); |
2166
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3364 } |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3365 |
0 | 3366 if (lock) { |
3367 assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing"); | |
1819 | 3368 if (!lock->is_linked()) { |
2318
6f3746e69a78
7021603: crash in fill_sync_handler with ExtendedDTrace probes
never
parents:
2167
diff
changeset
|
3369 lock = append_with_bci(lock, bci); |
0 | 3370 } |
3371 | |
3372 // exit the monitor in the context of the synchronized method | |
2318
6f3746e69a78
7021603: crash in fill_sync_handler with ExtendedDTrace probes
never
parents:
2167
diff
changeset
|
3373 monitorexit(lock, bci); |
0 | 3374 |
3375 // exit the context of the synchronized method | |
3376 if (!default_handler) { | |
3377 pop_scope(); | |
1819 | 3378 bci = _state->caller_state()->bci(); |
3379 _state = _state->caller_state()->copy_for_parsing(); | |
0 | 3380 } |
3381 } | |
3382 | |
3383 // perform the throw as if at the the call site | |
3384 apush(exception); | |
3385 throw_op(bci); | |
3386 | |
3387 BlockEnd* end = last()->as_BlockEnd(); | |
3388 block()->set_end(end); | |
3389 | |
3390 _block = orig_block; | |
3391 _state = orig_state; | |
3392 _last = orig_last; | |
3393 } | |
3394 | |
3395 | |
3396 bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known) { | |
3397 assert(!callee->is_native(), "callee must not be native"); | |
1783 | 3398 if (count_backedges() && callee->has_loops()) { |
3399 INLINE_BAILOUT("too complex for tiered"); | |
3400 } | |
0 | 3401 // first perform tests of things it's not possible to inline |
3402 if (callee->has_exception_handlers() && | |
3403 !InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers"); | |
3404 if (callee->is_synchronized() && | |
3405 !InlineSynchronizedMethods ) INLINE_BAILOUT("callee is synchronized"); | |
3406 if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet"); | |
3407 if (!callee->has_balanced_monitors()) INLINE_BAILOUT("callee's monitors do not match"); | |
3408 | |
3409 // Proper inlining of methods with jsrs requires a little more work. | |
3410 if (callee->has_jsrs() ) INLINE_BAILOUT("jsrs not handled properly by inliner yet"); | |
3411 | |
3412 // now perform tests that are based on flag settings | |
3413 if (inline_level() > MaxInlineLevel ) INLINE_BAILOUT("too-deep inlining"); | |
3414 if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("too-deep recursive inlining"); | |
3415 if (callee->code_size() > max_inline_size() ) INLINE_BAILOUT("callee is too large"); | |
3416 | |
3417 // don't inline throwable methods unless the inlining tree is rooted in a throwable class | |
3418 if (callee->name() == ciSymbol::object_initializer_name() && | |
3419 callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { | |
3420 // Throwable constructor call | |
3421 IRScope* top = scope(); | |
3422 while (top->caller() != NULL) { | |
3423 top = top->caller(); | |
3424 } | |
3425 if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { | |
3426 INLINE_BAILOUT("don't inline Throwable constructors"); | |
3427 } | |
3428 } | |
3429 | |
3430 // When SSE2 is used on intel, then no special handling is needed | |
3431 // for strictfp because the enum-constant is fixed at compile time, | |
3432 // the check for UseSSE2 is needed here | |
3433 if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) { | |
3434 INLINE_BAILOUT("caller and callee have different strict fp requirements"); | |
3435 } | |
3436 | |
3437 if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) { | |
3438 INLINE_BAILOUT("total inlining greater than DesiredMethodLimit"); | |
3439 } | |
3440 | |
2007
5ddfcf4b079e
7003554: (tiered) assert(is_null_object() || handle() != NULL) failed: cannot embed null pointer
iveresov
parents:
2002
diff
changeset
|
3441 if (is_profiling() && !callee->ensure_method_data()) { |
5ddfcf4b079e
7003554: (tiered) assert(is_null_object() || handle() != NULL) failed: cannot embed null pointer
iveresov
parents:
2002
diff
changeset
|
3442 INLINE_BAILOUT("mdo allocation failed"); |
5ddfcf4b079e
7003554: (tiered) assert(is_null_object() || handle() != NULL) failed: cannot embed null pointer
iveresov
parents:
2002
diff
changeset
|
3443 } |
0 | 3444 #ifndef PRODUCT |
3445 // printing | |
3446 if (PrintInlining) { | |
3447 print_inline_result(callee, true); | |
3448 } | |
3449 #endif | |
3450 | |
3451 // NOTE: Bailouts from this point on, which occur at the | |
3452 // GraphBuilder level, do not cause bailout just of the inlining but | |
3453 // in fact of the entire compilation. | |
3454 | |
3455 BlockBegin* orig_block = block(); | |
3456 | |
3457 const int args_base = state()->stack_size() - callee->arg_size(); | |
3458 assert(args_base >= 0, "stack underflow during inlining"); | |
3459 | |
3460 // Insert null check if necessary | |
3461 Value recv = NULL; | |
3462 if (code() != Bytecodes::_invokestatic) { | |
3463 // note: null check must happen even if first instruction of callee does | |
3464 // an implicit null check since the callee is in a different scope | |
3465 // and we must make sure exception handling does the right thing | |
3466 assert(!callee->is_static(), "callee must not be static"); | |
3467 assert(callee->arg_size() > 0, "must have at least a receiver"); | |
3468 recv = state()->stack_at(args_base); | |
3469 null_check(recv); | |
3470 } | |
3471 | |
1783 | 3472 if (is_profiling()) { |
3473 // Note that we'd collect profile data in this method if we wanted it. | |
3474 // this may be redundant here... | |
3475 compilation()->set_would_profile(true); | |
3476 | |
3477 if (profile_calls()) { | |
3478 profile_call(recv, holder_known ? callee->holder() : NULL); | |
3479 } | |
3480 if (profile_inlined_calls()) { | |
1825 | 3481 profile_invocation(callee, copy_state_before()); |
1783 | 3482 } |
0 | 3483 } |
3484 | |
3485 // Introduce a new callee continuation point - if the callee has | |
3486 // more than one return instruction or the return does not allow | |
3487 // fall-through of control flow, all return instructions of the | |
3488 // callee will need to be replaced by Goto's pointing to this | |
3489 // continuation point. | |
3490 BlockBegin* cont = block_at(next_bci()); | |
3491 bool continuation_existed = true; | |
3492 if (cont == NULL) { | |
3493 cont = new BlockBegin(next_bci()); | |
3494 // low number so that continuation gets parsed as early as possible | |
3495 cont->set_depth_first_number(0); | |
3496 #ifndef PRODUCT | |
3497 if (PrintInitialBlockList) { | |
3498 tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d", | |
3499 cont->block_id(), cont->bci(), bci()); | |
3500 } | |
3501 #endif | |
3502 continuation_existed = false; | |
3503 } | |
3504 // Record number of predecessors of continuation block before | |
3505 // inlining, to detect if inlined method has edges to its | |
3506 // continuation after inlining. | |
3507 int continuation_preds = cont->number_of_preds(); | |
3508 | |
3509 // Push callee scope | |
3510 push_scope(callee, cont); | |
3511 | |
3512 // the BlockListBuilder for the callee could have bailed out | |
3513 CHECK_BAILOUT_(false); | |
3514 | |
3515 // Temporarily set up bytecode stream so we can append instructions | |
3516 // (only using the bci of this stream) | |
3517 scope_data()->set_stream(scope_data()->parent()->stream()); | |
3518 | |
3519 // Pass parameters into callee state: add assignments | |
3520 // note: this will also ensure that all arguments are computed before being passed | |
3521 ValueStack* callee_state = state(); | |
1819 | 3522 ValueStack* caller_state = state()->caller_state(); |
0 | 3523 { int i = args_base; |
3524 while (i < caller_state->stack_size()) { | |
3525 const int par_no = i - args_base; | |
3526 Value arg = caller_state->stack_at_inc(i); | |
3527 // NOTE: take base() of arg->type() to avoid problems storing | |
3528 // constants | |
3529 store_local(callee_state, arg, arg->type()->base(), par_no); | |
3530 } | |
3531 } | |
3532 | |
3533 // Remove args from stack. | |
3534 // Note that we preserve locals state in case we can use it later | |
3535 // (see use of pop_scope() below) | |
3536 caller_state->truncate_stack(args_base); | |
1819 | 3537 assert(callee_state->stack_size() == 0, "callee stack must be empty"); |
0 | 3538 |
3539 Value lock; | |
3540 BlockBegin* sync_handler; | |
3541 | |
3542 // Inline the locking of the receiver if the callee is synchronized | |
3543 if (callee->is_synchronized()) { | |
3544 lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror()))) | |
3545 : state()->local_at(0); | |
1819 | 3546 sync_handler = new BlockBegin(SynchronizationEntryBCI); |
0 | 3547 inline_sync_entry(lock, sync_handler); |
3548 } | |
3549 | |
2166
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3550 if (compilation()->env()->dtrace_method_probes()) { |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3551 Values* args = new Values(1); |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3552 args->push(append(new Constant(new ObjectConstant(method())))); |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3553 append(new RuntimeCall(voidType, "dtrace_method_entry", CAST_FROM_FN_PTR(address, SharedRuntime::dtrace_method_entry), args)); |
403dc4c1d7f5
6809483: hotspot:::method_entry are not correctly generated for "method()V"
never
parents:
2007
diff
changeset
|
3554 } |
0 | 3555 |
3556 BlockBegin* callee_start_block = block_at(0); | |
3557 if (callee_start_block != NULL) { | |
3558 assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header"); | |
3559 Goto* goto_callee = new Goto(callee_start_block, false); | |
3560 // The state for this goto is in the scope of the callee, so use | |
3561 // the entry bci for the callee instead of the call site bci. | |
3562 append_with_bci(goto_callee, 0); | |
3563 _block->set_end(goto_callee); | |
3564 callee_start_block->merge(callee_state); | |
3565 | |
3566 _last = _block = callee_start_block; | |
3567 | |
3568 scope_data()->add_to_work_list(callee_start_block); | |
3569 } | |
3570 | |
3571 // Clear out bytecode stream | |
3572 scope_data()->set_stream(NULL); | |
3573 | |
3574 // Ready to resume parsing in callee (either in the same block we | |
3575 // were in before or in the callee's start block) | |
3576 iterate_all_blocks(callee_start_block == NULL); | |
3577 | |
3578 // If we bailed out during parsing, return immediately (this is bad news) | |
3579 if (bailed_out()) return false; | |
3580 | |
3581 // iterate_all_blocks theoretically traverses in random order; in | |
3582 // practice, we have only traversed the continuation if we are | |
3583 // inlining into a subroutine | |
3584 assert(continuation_existed || | |
3585 !continuation()->is_set(BlockBegin::was_visited_flag), | |
3586 "continuation should not have been parsed yet if we created it"); | |
3587 | |
3588 // If we bailed out during parsing, return immediately (this is bad news) | |
3589 CHECK_BAILOUT_(false); | |
3590 | |
3591 // At this point we are almost ready to return and resume parsing of | |
3592 // the caller back in the GraphBuilder. The only thing we want to do | |
3593 // first is an optimization: during parsing of the callee we | |
3594 // generated at least one Goto to the continuation block. If we | |
3595 // generated exactly one, and if the inlined method spanned exactly | |
3596 // one block (and we didn't have to Goto its entry), then we snip | |
3597 // off the Goto to the continuation, allowing control to fall | |
3598 // through back into the caller block and effectively performing | |
3599 // block merging. This allows load elimination and CSE to take place | |
3600 // across multiple callee scopes if they are relatively simple, and | |
3601 // is currently essential to making inlining profitable. | |
3602 if ( num_returns() == 1 | |
3603 && block() == orig_block | |
3604 && block() == inline_cleanup_block()) { | |
3605 _last = inline_cleanup_return_prev(); | |
1819 | 3606 _state = inline_cleanup_state(); |
0 | 3607 } else if (continuation_preds == cont->number_of_preds()) { |
3608 // Inlining caused that the instructions after the invoke in the | |
3609 // caller are not reachable any more. So skip filling this block | |
3610 // with instructions! | |
3611 assert (cont == continuation(), ""); | |
3612 assert(_last && _last->as_BlockEnd(), ""); | |
3613 _skip_block = true; | |
3614 } else { | |
3615 // Resume parsing in continuation block unless it was already parsed. | |
3616 // Note that if we don't change _last here, iteration in | |
3617 // iterate_bytecodes_for_block will stop when we return. | |
3618 if (!continuation()->is_set(BlockBegin::was_visited_flag)) { | |
3619 // add continuation to work list instead of parsing it immediately | |
3620 assert(_last && _last->as_BlockEnd(), ""); | |
3621 scope_data()->parent()->add_to_work_list(continuation()); | |
3622 _skip_block = true; | |
3623 } | |
3624 } | |
3625 | |
3626 // Fill the exception handler for synchronized methods with instructions | |
3627 if (callee->is_synchronized() && sync_handler->state() != NULL) { | |
3628 fill_sync_handler(lock, sync_handler); | |
3629 } else { | |
3630 pop_scope(); | |
3631 } | |
3632 | |
3633 compilation()->notice_inlined_method(callee); | |
3634 | |
3635 return true; | |
3636 } | |
3637 | |
3638 | |
3639 void GraphBuilder::inline_bailout(const char* msg) { | |
3640 assert(msg != NULL, "inline bailout msg must exist"); | |
3641 _inline_bailout_msg = msg; | |
3642 } | |
3643 | |
3644 | |
3645 void GraphBuilder::clear_inline_bailout() { | |
3646 _inline_bailout_msg = NULL; | |
3647 } | |
3648 | |
3649 | |
3650 void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) { | |
3651 ScopeData* data = new ScopeData(NULL); | |
3652 data->set_scope(scope); | |
3653 data->set_bci2block(bci2block); | |
3654 _scope_data = data; | |
3655 _block = start; | |
3656 } | |
3657 | |
3658 | |
3659 void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) { | |
3660 IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false); | |
3661 scope()->add_callee(callee_scope); | |
3662 | |
3663 BlockListBuilder blb(compilation(), callee_scope, -1); | |
3664 CHECK_BAILOUT(); | |
3665 | |
3666 if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) { | |
3667 // this scope can be inlined directly into the caller so remove | |
3668 // the block at bci 0. | |
3669 blb.bci2block()->at_put(0, NULL); | |
3670 } | |
3671 | |
1819 | 3672 set_state(new ValueStack(callee_scope, state()->copy(ValueStack::CallerState, bci()))); |
0 | 3673 |
3674 ScopeData* data = new ScopeData(scope_data()); | |
3675 data->set_scope(callee_scope); | |
3676 data->set_bci2block(blb.bci2block()); | |
3677 data->set_continuation(continuation); | |
3678 _scope_data = data; | |
3679 } | |
3680 | |
3681 | |
3682 void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) { | |
3683 ScopeData* data = new ScopeData(scope_data()); | |
3684 data->set_parsing_jsr(); | |
3685 data->set_jsr_entry_bci(jsr_dest_bci); | |
3686 data->set_jsr_return_address_local(-1); | |
3687 // Must clone bci2block list as we will be mutating it in order to | |
3688 // properly clone all blocks in jsr region as well as exception | |
3689 // handlers containing rets | |
3690 BlockList* new_bci2block = new BlockList(bci2block()->length()); | |
3691 new_bci2block->push_all(bci2block()); | |
3692 data->set_bci2block(new_bci2block); | |
3693 data->set_scope(scope()); | |
3694 data->setup_jsr_xhandlers(); | |
3695 data->set_continuation(continuation()); | |
3696 data->set_jsr_continuation(jsr_continuation); | |
3697 _scope_data = data; | |
3698 } | |
3699 | |
3700 | |
3701 void GraphBuilder::pop_scope() { | |
3702 int number_of_locks = scope()->number_of_locks(); | |
3703 _scope_data = scope_data()->parent(); | |
3704 // accumulate minimum number of monitor slots to be reserved | |
3705 scope()->set_min_number_of_locks(number_of_locks); | |
3706 } | |
3707 | |
3708 | |
3709 void GraphBuilder::pop_scope_for_jsr() { | |
3710 _scope_data = scope_data()->parent(); | |
3711 } | |
3712 | |
3713 bool GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) { | |
3714 if (InlineUnsafeOps) { | |
3715 Values* args = state()->pop_arguments(callee->arg_size()); | |
3716 null_check(args->at(0)); | |
3717 Instruction* offset = args->at(2); | |
3718 #ifndef _LP64 | |
3719 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3720 #endif | |
3721 Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile)); | |
3722 push(op->type(), op); | |
3723 compilation()->set_has_unsafe_access(true); | |
3724 } | |
3725 return InlineUnsafeOps; | |
3726 } | |
3727 | |
3728 | |
3729 bool GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) { | |
3730 if (InlineUnsafeOps) { | |
3731 Values* args = state()->pop_arguments(callee->arg_size()); | |
3732 null_check(args->at(0)); | |
3733 Instruction* offset = args->at(2); | |
3734 #ifndef _LP64 | |
3735 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3736 #endif | |
3737 Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, args->at(3), is_volatile)); | |
3738 compilation()->set_has_unsafe_access(true); | |
3739 kill_all(); | |
3740 } | |
3741 return InlineUnsafeOps; | |
3742 } | |
3743 | |
3744 | |
3745 bool GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) { | |
3746 if (InlineUnsafeOps) { | |
3747 Values* args = state()->pop_arguments(callee->arg_size()); | |
3748 null_check(args->at(0)); | |
3749 Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false)); | |
3750 push(op->type(), op); | |
3751 compilation()->set_has_unsafe_access(true); | |
3752 } | |
3753 return InlineUnsafeOps; | |
3754 } | |
3755 | |
3756 | |
3757 bool GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) { | |
3758 if (InlineUnsafeOps) { | |
3759 Values* args = state()->pop_arguments(callee->arg_size()); | |
3760 null_check(args->at(0)); | |
3761 Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2))); | |
3762 compilation()->set_has_unsafe_access(true); | |
3763 } | |
3764 return InlineUnsafeOps; | |
3765 } | |
3766 | |
3767 | |
3768 bool GraphBuilder::append_unsafe_prefetch(ciMethod* callee, bool is_static, bool is_store) { | |
3769 if (InlineUnsafeOps) { | |
3770 Values* args = state()->pop_arguments(callee->arg_size()); | |
3771 int obj_arg_index = 1; // Assume non-static case | |
3772 if (is_static) { | |
3773 obj_arg_index = 0; | |
3774 } else { | |
3775 null_check(args->at(0)); | |
3776 } | |
3777 Instruction* offset = args->at(obj_arg_index + 1); | |
3778 #ifndef _LP64 | |
3779 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3780 #endif | |
3781 Instruction* op = is_store ? append(new UnsafePrefetchWrite(args->at(obj_arg_index), offset)) | |
3782 : append(new UnsafePrefetchRead (args->at(obj_arg_index), offset)); | |
3783 compilation()->set_has_unsafe_access(true); | |
3784 } | |
3785 return InlineUnsafeOps; | |
3786 } | |
3787 | |
3788 | |
3789 void GraphBuilder::append_unsafe_CAS(ciMethod* callee) { | |
1819 | 3790 ValueStack* state_before = copy_state_for_exception(); |
0 | 3791 ValueType* result_type = as_ValueType(callee->return_type()); |
3792 assert(result_type->is_int(), "int result"); | |
3793 Values* args = state()->pop_arguments(callee->arg_size()); | |
3794 | |
3795 // Pop off some args to speically handle, then push back | |
3796 Value newval = args->pop(); | |
3797 Value cmpval = args->pop(); | |
3798 Value offset = args->pop(); | |
3799 Value src = args->pop(); | |
3800 Value unsafe_obj = args->pop(); | |
3801 | |
3802 // Separately handle the unsafe arg. It is not needed for code | |
3803 // generation, but must be null checked | |
3804 null_check(unsafe_obj); | |
3805 | |
3806 #ifndef _LP64 | |
3807 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
3808 #endif | |
3809 | |
3810 args->push(src); | |
3811 args->push(offset); | |
3812 args->push(cmpval); | |
3813 args->push(newval); | |
3814 | |
3815 // An unsafe CAS can alias with other field accesses, but we don't | |
3816 // know which ones so mark the state as no preserved. This will | |
3817 // cause CSE to invalidate memory across it. | |
3818 bool preserves_state = false; | |
1819 | 3819 Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, state_before, preserves_state); |
0 | 3820 append_split(result); |
3821 push(result_type, result); | |
3822 compilation()->set_has_unsafe_access(true); | |
3823 } | |
3824 | |
3825 | |
3826 #ifndef PRODUCT | |
3827 void GraphBuilder::print_inline_result(ciMethod* callee, bool res) { | |
2405
3d58a4983660
7022998: JSR 292 recursive method handle calls inline themselves infinitely
twisti
parents:
2376
diff
changeset
|
3828 CompileTask::print_inlining(callee, scope()->level(), bci(), _inline_bailout_msg); |
0 | 3829 if (res && CIPrintMethodCodes) { |
3830 callee->print_codes(); | |
3831 } | |
3832 } | |
3833 | |
3834 | |
3835 void GraphBuilder::print_stats() { | |
3836 vmap()->print(); | |
3837 } | |
3838 #endif // PRODUCT | |
3839 | |
3840 void GraphBuilder::profile_call(Value recv, ciKlass* known_holder) { | |
3841 append(new ProfileCall(method(), bci(), recv, known_holder)); | |
3842 } | |
3843 | |
1825 | 3844 void GraphBuilder::profile_invocation(ciMethod* callee, ValueStack* state) { |
3845 append(new ProfileInvoke(callee, state)); | |
0 | 3846 } |