Mercurial > hg > truffle
annotate src/share/vm/c1/c1_GraphBuilder.cpp @ 844:bd02caa94611
6862919: Update copyright year
Summary: Update copyright for files that have been modified in 2009, up to 07/09
Reviewed-by: tbell, ohair
| author | xdono |
|---|---|
| date | Tue, 28 Jul 2009 12:12:40 -0700 |
| parents | c96bf21b756f |
| children | 148e5441d916 |
| rev | line source |
|---|---|
| 0 | 1 /* |
| 844 | 2 * Copyright 1999-2009 Sun Microsystems, Inc. All Rights Reserved. |
| 0 | 3 * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. |
| 4 * | |
| 5 * This code is free software; you can redistribute it and/or modify it | |
| 6 * under the terms of the GNU General Public License version 2 only, as | |
| 7 * published by the Free Software Foundation. | |
| 8 * | |
| 9 * This code is distributed in the hope that it will be useful, but WITHOUT | |
| 10 * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
| 11 * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
| 12 * version 2 for more details (a copy is included in the LICENSE file that | |
| 13 * accompanied this code). | |
| 14 * | |
| 15 * You should have received a copy of the GNU General Public License version | |
| 16 * 2 along with this work; if not, write to the Free Software Foundation, | |
| 17 * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. | |
| 18 * | |
| 19 * Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara, | |
| 20 * CA 95054 USA or visit www.sun.com if you need additional information or | |
| 21 * have any questions. | |
| 22 * | |
| 23 */ | |
| 24 | |
| 25 #include "incls/_precompiled.incl" | |
| 26 #include "incls/_c1_GraphBuilder.cpp.incl" | |
| 27 | |
| 28 class BlockListBuilder VALUE_OBJ_CLASS_SPEC { | |
| 29 private: | |
| 30 Compilation* _compilation; | |
| 31 IRScope* _scope; | |
| 32 | |
| 33 BlockList _blocks; // internal list of all blocks | |
| 34 BlockList* _bci2block; // mapping from bci to blocks for GraphBuilder | |
| 35 | |
| 36 // fields used by mark_loops | |
| 37 BitMap _active; // for iteration of control flow graph | |
| 38 BitMap _visited; // for iteration of control flow graph | |
| 39 intArray _loop_map; // caches the information if a block is contained in a loop | |
| 40 int _next_loop_index; // next free loop number | |
| 41 int _next_block_number; // for reverse postorder numbering of blocks | |
| 42 | |
| 43 // accessors | |
| 44 Compilation* compilation() const { return _compilation; } | |
| 45 IRScope* scope() const { return _scope; } | |
| 46 ciMethod* method() const { return scope()->method(); } | |
| 47 XHandlers* xhandlers() const { return scope()->xhandlers(); } | |
| 48 | |
| 49 // unified bailout support | |
| 50 void bailout(const char* msg) const { compilation()->bailout(msg); } | |
| 51 bool bailed_out() const { return compilation()->bailed_out(); } | |
| 52 | |
| 53 // helper functions | |
| 54 BlockBegin* make_block_at(int bci, BlockBegin* predecessor); | |
| 55 void handle_exceptions(BlockBegin* current, int cur_bci); | |
| 56 void handle_jsr(BlockBegin* current, int sr_bci, int next_bci); | |
| 57 void store_one(BlockBegin* current, int local); | |
| 58 void store_two(BlockBegin* current, int local); | |
| 59 void set_entries(int osr_bci); | |
| 60 void set_leaders(); | |
| 61 | |
| 62 void make_loop_header(BlockBegin* block); | |
| 63 void mark_loops(); | |
| 64 int mark_loops(BlockBegin* b, bool in_subroutine); | |
| 65 | |
| 66 // debugging | |
| 67 #ifndef PRODUCT | |
| 68 void print(); | |
| 69 #endif | |
| 70 | |
| 71 public: | |
| 72 // creation | |
| 73 BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci); | |
| 74 | |
| 75 // accessors for GraphBuilder | |
| 76 BlockList* bci2block() const { return _bci2block; } | |
| 77 }; | |
| 78 | |
| 79 | |
| 80 // Implementation of BlockListBuilder | |
| 81 | |
| 82 BlockListBuilder::BlockListBuilder(Compilation* compilation, IRScope* scope, int osr_bci) | |
| 83 : _compilation(compilation) | |
| 84 , _scope(scope) | |
| 85 , _blocks(16) | |
| 86 , _bci2block(new BlockList(scope->method()->code_size(), NULL)) | |
| 87 , _next_block_number(0) | |
| 88 , _active() // size not known yet | |
| 89 , _visited() // size not known yet | |
| 90 , _next_loop_index(0) | |
| 91 , _loop_map() // size not known yet | |
| 92 { | |
| 93 set_entries(osr_bci); | |
| 94 set_leaders(); | |
| 95 CHECK_BAILOUT(); | |
| 96 | |
| 97 mark_loops(); | |
| 98 NOT_PRODUCT(if (PrintInitialBlockList) print()); | |
| 99 | |
| 100 #ifndef PRODUCT | |
| 101 if (PrintCFGToFile) { | |
| 102 stringStream title; | |
| 103 title.print("BlockListBuilder "); | |
| 104 scope->method()->print_name(&title); | |
| 105 CFGPrinter::print_cfg(_bci2block, title.as_string(), false, false); | |
| 106 } | |
| 107 #endif | |
| 108 } | |
| 109 | |
| 110 | |
| 111 void BlockListBuilder::set_entries(int osr_bci) { | |
| 112 // generate start blocks | |
| 113 BlockBegin* std_entry = make_block_at(0, NULL); | |
| 114 if (scope()->caller() == NULL) { | |
| 115 std_entry->set(BlockBegin::std_entry_flag); | |
| 116 } | |
| 117 if (osr_bci != -1) { | |
| 118 BlockBegin* osr_entry = make_block_at(osr_bci, NULL); | |
| 119 osr_entry->set(BlockBegin::osr_entry_flag); | |
| 120 } | |
| 121 | |
| 122 // generate exception entry blocks | |
| 123 XHandlers* list = xhandlers(); | |
| 124 const int n = list->length(); | |
| 125 for (int i = 0; i < n; i++) { | |
| 126 XHandler* h = list->handler_at(i); | |
| 127 BlockBegin* entry = make_block_at(h->handler_bci(), NULL); | |
| 128 entry->set(BlockBegin::exception_entry_flag); | |
| 129 h->set_entry_block(entry); | |
| 130 } | |
| 131 } | |
| 132 | |
| 133 | |
| 134 BlockBegin* BlockListBuilder::make_block_at(int cur_bci, BlockBegin* predecessor) { | |
| 135 assert(method()->bci_block_start().at(cur_bci), "wrong block starts of MethodLivenessAnalyzer"); | |
| 136 | |
| 137 BlockBegin* block = _bci2block->at(cur_bci); | |
| 138 if (block == NULL) { | |
| 139 block = new BlockBegin(cur_bci); | |
| 140 block->init_stores_to_locals(method()->max_locals()); | |
| 141 _bci2block->at_put(cur_bci, block); | |
| 142 _blocks.append(block); | |
| 143 | |
| 144 assert(predecessor == NULL || predecessor->bci() < cur_bci, "targets for backward branches must already exist"); | |
| 145 } | |
| 146 | |
| 147 if (predecessor != NULL) { | |
| 148 if (block->is_set(BlockBegin::exception_entry_flag)) { | |
| 149 BAILOUT_("Exception handler can be reached by both normal and exceptional control flow", block); | |
| 150 } | |
| 151 | |
| 152 predecessor->add_successor(block); | |
| 153 block->increment_total_preds(); | |
| 154 } | |
| 155 | |
| 156 return block; | |
| 157 } | |
| 158 | |
| 159 | |
| 160 inline void BlockListBuilder::store_one(BlockBegin* current, int local) { | |
| 161 current->stores_to_locals().set_bit(local); | |
| 162 } | |
| 163 inline void BlockListBuilder::store_two(BlockBegin* current, int local) { | |
| 164 store_one(current, local); | |
| 165 store_one(current, local + 1); | |
| 166 } | |
| 167 | |
| 168 | |
| 169 void BlockListBuilder::handle_exceptions(BlockBegin* current, int cur_bci) { | |
| 170 // Draws edges from a block to its exception handlers | |
| 171 XHandlers* list = xhandlers(); | |
| 172 const int n = list->length(); | |
| 173 | |
| 174 for (int i = 0; i < n; i++) { | |
| 175 XHandler* h = list->handler_at(i); | |
| 176 | |
| 177 if (h->covers(cur_bci)) { | |
| 178 BlockBegin* entry = h->entry_block(); | |
| 179 assert(entry != NULL && entry == _bci2block->at(h->handler_bci()), "entry must be set"); | |
| 180 assert(entry->is_set(BlockBegin::exception_entry_flag), "flag must be set"); | |
| 181 | |
| 182 // add each exception handler only once | |
| 183 if (!current->is_successor(entry)) { | |
| 184 current->add_successor(entry); | |
| 185 entry->increment_total_preds(); | |
| 186 } | |
| 187 | |
| 188 // stop when reaching catchall | |
| 189 if (h->catch_type() == 0) break; | |
| 190 } | |
| 191 } | |
| 192 } | |
| 193 | |
| 194 void BlockListBuilder::handle_jsr(BlockBegin* current, int sr_bci, int next_bci) { | |
| 195 // start a new block after jsr-bytecode and link this block into cfg | |
| 196 make_block_at(next_bci, current); | |
| 197 | |
| 198 // start a new block at the subroutine entry at mark it with special flag | |
| 199 BlockBegin* sr_block = make_block_at(sr_bci, current); | |
| 200 if (!sr_block->is_set(BlockBegin::subroutine_entry_flag)) { | |
| 201 sr_block->set(BlockBegin::subroutine_entry_flag); | |
| 202 } | |
| 203 } | |
| 204 | |
| 205 | |
| 206 void BlockListBuilder::set_leaders() { | |
| 207 bool has_xhandlers = xhandlers()->has_handlers(); | |
| 208 BlockBegin* current = NULL; | |
| 209 | |
| 210 // The information which bci starts a new block simplifies the analysis | |
| 211 // Without it, backward branches could jump to a bci where no block was created | |
| 212 // during bytecode iteration. This would require the creation of a new block at the | |
| 213 // branch target and a modification of the successor lists. | |
| 214 BitMap bci_block_start = method()->bci_block_start(); | |
| 215 | |
| 216 ciBytecodeStream s(method()); | |
| 217 while (s.next() != ciBytecodeStream::EOBC()) { | |
| 218 int cur_bci = s.cur_bci(); | |
| 219 | |
| 220 if (bci_block_start.at(cur_bci)) { | |
| 221 current = make_block_at(cur_bci, current); | |
| 222 } | |
| 223 assert(current != NULL, "must have current block"); | |
| 224 | |
| 225 if (has_xhandlers && GraphBuilder::can_trap(method(), s.cur_bc())) { | |
| 226 handle_exceptions(current, cur_bci); | |
| 227 } | |
| 228 | |
| 229 switch (s.cur_bc()) { | |
| 230 // track stores to local variables for selective creation of phi functions | |
| 231 case Bytecodes::_iinc: store_one(current, s.get_index()); break; | |
| 232 case Bytecodes::_istore: store_one(current, s.get_index()); break; | |
| 233 case Bytecodes::_lstore: store_two(current, s.get_index()); break; | |
| 234 case Bytecodes::_fstore: store_one(current, s.get_index()); break; | |
| 235 case Bytecodes::_dstore: store_two(current, s.get_index()); break; | |
| 236 case Bytecodes::_astore: store_one(current, s.get_index()); break; | |
| 237 case Bytecodes::_istore_0: store_one(current, 0); break; | |
| 238 case Bytecodes::_istore_1: store_one(current, 1); break; | |
| 239 case Bytecodes::_istore_2: store_one(current, 2); break; | |
| 240 case Bytecodes::_istore_3: store_one(current, 3); break; | |
| 241 case Bytecodes::_lstore_0: store_two(current, 0); break; | |
| 242 case Bytecodes::_lstore_1: store_two(current, 1); break; | |
| 243 case Bytecodes::_lstore_2: store_two(current, 2); break; | |
| 244 case Bytecodes::_lstore_3: store_two(current, 3); break; | |
| 245 case Bytecodes::_fstore_0: store_one(current, 0); break; | |
| 246 case Bytecodes::_fstore_1: store_one(current, 1); break; | |
| 247 case Bytecodes::_fstore_2: store_one(current, 2); break; | |
| 248 case Bytecodes::_fstore_3: store_one(current, 3); break; | |
| 249 case Bytecodes::_dstore_0: store_two(current, 0); break; | |
| 250 case Bytecodes::_dstore_1: store_two(current, 1); break; | |
| 251 case Bytecodes::_dstore_2: store_two(current, 2); break; | |
| 252 case Bytecodes::_dstore_3: store_two(current, 3); break; | |
| 253 case Bytecodes::_astore_0: store_one(current, 0); break; | |
| 254 case Bytecodes::_astore_1: store_one(current, 1); break; | |
| 255 case Bytecodes::_astore_2: store_one(current, 2); break; | |
| 256 case Bytecodes::_astore_3: store_one(current, 3); break; | |
| 257 | |
| 258 // track bytecodes that affect the control flow | |
| 259 case Bytecodes::_athrow: // fall through | |
| 260 case Bytecodes::_ret: // fall through | |
| 261 case Bytecodes::_ireturn: // fall through | |
| 262 case Bytecodes::_lreturn: // fall through | |
| 263 case Bytecodes::_freturn: // fall through | |
| 264 case Bytecodes::_dreturn: // fall through | |
| 265 case Bytecodes::_areturn: // fall through | |
| 266 case Bytecodes::_return: | |
| 267 current = NULL; | |
| 268 break; | |
| 269 | |
| 270 case Bytecodes::_ifeq: // fall through | |
| 271 case Bytecodes::_ifne: // fall through | |
| 272 case Bytecodes::_iflt: // fall through | |
| 273 case Bytecodes::_ifge: // fall through | |
| 274 case Bytecodes::_ifgt: // fall through | |
| 275 case Bytecodes::_ifle: // fall through | |
| 276 case Bytecodes::_if_icmpeq: // fall through | |
| 277 case Bytecodes::_if_icmpne: // fall through | |
| 278 case Bytecodes::_if_icmplt: // fall through | |
| 279 case Bytecodes::_if_icmpge: // fall through | |
| 280 case Bytecodes::_if_icmpgt: // fall through | |
| 281 case Bytecodes::_if_icmple: // fall through | |
| 282 case Bytecodes::_if_acmpeq: // fall through | |
| 283 case Bytecodes::_if_acmpne: // fall through | |
| 284 case Bytecodes::_ifnull: // fall through | |
| 285 case Bytecodes::_ifnonnull: | |
| 286 make_block_at(s.next_bci(), current); | |
| 287 make_block_at(s.get_dest(), current); | |
| 288 current = NULL; | |
| 289 break; | |
| 290 | |
| 291 case Bytecodes::_goto: | |
| 292 make_block_at(s.get_dest(), current); | |
| 293 current = NULL; | |
| 294 break; | |
| 295 | |
| 296 case Bytecodes::_goto_w: | |
| 297 make_block_at(s.get_far_dest(), current); | |
| 298 current = NULL; | |
| 299 break; | |
| 300 | |
| 301 case Bytecodes::_jsr: | |
| 302 handle_jsr(current, s.get_dest(), s.next_bci()); | |
| 303 current = NULL; | |
| 304 break; | |
| 305 | |
| 306 case Bytecodes::_jsr_w: | |
| 307 handle_jsr(current, s.get_far_dest(), s.next_bci()); | |
| 308 current = NULL; | |
| 309 break; | |
| 310 | |
| 311 case Bytecodes::_tableswitch: { | |
| 312 // set block for each case | |
| 313 Bytecode_tableswitch *switch_ = Bytecode_tableswitch_at(s.cur_bcp()); | |
| 314 int l = switch_->length(); | |
| 315 for (int i = 0; i < l; i++) { | |
| 316 make_block_at(cur_bci + switch_->dest_offset_at(i), current); | |
| 317 } | |
| 318 make_block_at(cur_bci + switch_->default_offset(), current); | |
| 319 current = NULL; | |
| 320 break; | |
| 321 } | |
| 322 | |
| 323 case Bytecodes::_lookupswitch: { | |
| 324 // set block for each case | |
| 325 Bytecode_lookupswitch *switch_ = Bytecode_lookupswitch_at(s.cur_bcp()); | |
| 326 int l = switch_->number_of_pairs(); | |
| 327 for (int i = 0; i < l; i++) { | |
| 328 make_block_at(cur_bci + switch_->pair_at(i)->offset(), current); | |
| 329 } | |
| 330 make_block_at(cur_bci + switch_->default_offset(), current); | |
| 331 current = NULL; | |
| 332 break; | |
| 333 } | |
| 334 } | |
| 335 } | |
| 336 } | |
| 337 | |
| 338 | |
| 339 void BlockListBuilder::mark_loops() { | |
| 340 ResourceMark rm; | |
| 341 | |
| 342 _active = BitMap(BlockBegin::number_of_blocks()); _active.clear(); | |
| 343 _visited = BitMap(BlockBegin::number_of_blocks()); _visited.clear(); | |
| 344 _loop_map = intArray(BlockBegin::number_of_blocks(), 0); | |
| 345 _next_loop_index = 0; | |
| 346 _next_block_number = _blocks.length(); | |
| 347 | |
| 348 // recursively iterate the control flow graph | |
| 349 mark_loops(_bci2block->at(0), false); | |
| 350 assert(_next_block_number >= 0, "invalid block numbers"); | |
| 351 } | |
| 352 | |
| 353 void BlockListBuilder::make_loop_header(BlockBegin* block) { | |
| 354 if (block->is_set(BlockBegin::exception_entry_flag)) { | |
| 355 // exception edges may look like loops but don't mark them as such | |
| 356 // since it screws up block ordering. | |
| 357 return; | |
| 358 } | |
| 359 if (!block->is_set(BlockBegin::parser_loop_header_flag)) { | |
| 360 block->set(BlockBegin::parser_loop_header_flag); | |
| 361 | |
| 362 assert(_loop_map.at(block->block_id()) == 0, "must not be set yet"); | |
| 363 assert(0 <= _next_loop_index && _next_loop_index < BitsPerInt, "_next_loop_index is used as a bit-index in integer"); | |
| 364 _loop_map.at_put(block->block_id(), 1 << _next_loop_index); | |
| 365 if (_next_loop_index < 31) _next_loop_index++; | |
| 366 } else { | |
| 367 // block already marked as loop header | |
| 368 assert(is_power_of_2(_loop_map.at(block->block_id())), "exactly one bit must be set"); | |
| 369 } | |
| 370 } | |
| 371 | |
| 372 int BlockListBuilder::mark_loops(BlockBegin* block, bool in_subroutine) { | |
| 373 int block_id = block->block_id(); | |
| 374 | |
| 375 if (_visited.at(block_id)) { | |
| 376 if (_active.at(block_id)) { | |
| 377 // reached block via backward branch | |
| 378 make_loop_header(block); | |
| 379 } | |
| 380 // return cached loop information for this block | |
| 381 return _loop_map.at(block_id); | |
| 382 } | |
| 383 | |
| 384 if (block->is_set(BlockBegin::subroutine_entry_flag)) { | |
| 385 in_subroutine = true; | |
| 386 } | |
| 387 | |
| 388 // set active and visited bits before successors are processed | |
| 389 _visited.set_bit(block_id); | |
| 390 _active.set_bit(block_id); | |
| 391 | |
| 392 intptr_t loop_state = 0; | |
| 393 for (int i = block->number_of_sux() - 1; i >= 0; i--) { | |
| 394 // recursively process all successors | |
| 395 loop_state |= mark_loops(block->sux_at(i), in_subroutine); | |
| 396 } | |
| 397 | |
| 398 // clear active-bit after all successors are processed | |
| 399 _active.clear_bit(block_id); | |
| 400 | |
| 401 // reverse-post-order numbering of all blocks | |
| 402 block->set_depth_first_number(_next_block_number); | |
| 403 _next_block_number--; | |
| 404 | |
| 405 if (loop_state != 0 || in_subroutine ) { | |
| 406 // block is contained at least in one loop, so phi functions are necessary | |
| 407 // phi functions are also necessary for all locals stored in a subroutine | |
| 408 scope()->requires_phi_function().set_union(block->stores_to_locals()); | |
| 409 } | |
| 410 | |
| 411 if (block->is_set(BlockBegin::parser_loop_header_flag)) { | |
| 412 int header_loop_state = _loop_map.at(block_id); | |
| 413 assert(is_power_of_2((unsigned)header_loop_state), "exactly one bit must be set"); | |
| 414 | |
| 415 // If the highest bit is set (i.e. when integer value is negative), the method | |
| 416 // has 32 or more loops. This bit is never cleared because it is used for multiple loops | |
| 417 if (header_loop_state >= 0) { | |
| 418 clear_bits(loop_state, header_loop_state); | |
| 419 } | |
| 420 } | |
| 421 | |
| 422 // cache and return loop information for this block | |
| 423 _loop_map.at_put(block_id, loop_state); | |
| 424 return loop_state; | |
| 425 } | |
| 426 | |
| 427 | |
| 428 #ifndef PRODUCT | |
| 429 | |
| 430 int compare_depth_first(BlockBegin** a, BlockBegin** b) { | |
| 431 return (*a)->depth_first_number() - (*b)->depth_first_number(); | |
| 432 } | |
| 433 | |
| 434 void BlockListBuilder::print() { | |
| 435 tty->print("----- initial block list of BlockListBuilder for method "); | |
| 436 method()->print_short_name(); | |
| 437 tty->cr(); | |
| 438 | |
| 439 // better readability if blocks are sorted in processing order | |
| 440 _blocks.sort(compare_depth_first); | |
| 441 | |
| 442 for (int i = 0; i < _blocks.length(); i++) { | |
| 443 BlockBegin* cur = _blocks.at(i); | |
| 444 tty->print("%4d: B%-4d bci: %-4d preds: %-4d ", cur->depth_first_number(), cur->block_id(), cur->bci(), cur->total_preds()); | |
| 445 | |
| 446 tty->print(cur->is_set(BlockBegin::std_entry_flag) ? " std" : " "); | |
| 447 tty->print(cur->is_set(BlockBegin::osr_entry_flag) ? " osr" : " "); | |
| 448 tty->print(cur->is_set(BlockBegin::exception_entry_flag) ? " ex" : " "); | |
| 449 tty->print(cur->is_set(BlockBegin::subroutine_entry_flag) ? " sr" : " "); | |
| 450 tty->print(cur->is_set(BlockBegin::parser_loop_header_flag) ? " lh" : " "); | |
| 451 | |
| 452 if (cur->number_of_sux() > 0) { | |
| 453 tty->print(" sux: "); | |
| 454 for (int j = 0; j < cur->number_of_sux(); j++) { | |
| 455 BlockBegin* sux = cur->sux_at(j); | |
| 456 tty->print("B%d ", sux->block_id()); | |
| 457 } | |
| 458 } | |
| 459 tty->cr(); | |
| 460 } | |
| 461 } | |
| 462 | |
| 463 #endif | |
| 464 | |
| 465 | |
| 466 // A simple growable array of Values indexed by ciFields | |
| 467 class FieldBuffer: public CompilationResourceObj { | |
| 468 private: | |
| 469 GrowableArray<Value> _values; | |
| 470 | |
| 471 public: | |
| 472 FieldBuffer() {} | |
| 473 | |
| 474 void kill() { | |
| 475 _values.trunc_to(0); | |
| 476 } | |
| 477 | |
| 478 Value at(ciField* field) { | |
| 479 assert(field->holder()->is_loaded(), "must be a loaded field"); | |
| 480 int offset = field->offset(); | |
| 481 if (offset < _values.length()) { | |
| 482 return _values.at(offset); | |
| 483 } else { | |
| 484 return NULL; | |
| 485 } | |
| 486 } | |
| 487 | |
| 488 void at_put(ciField* field, Value value) { | |
| 489 assert(field->holder()->is_loaded(), "must be a loaded field"); | |
| 490 int offset = field->offset(); | |
| 491 _values.at_put_grow(offset, value, NULL); | |
| 492 } | |
| 493 | |
| 494 }; | |
| 495 | |
| 496 | |
| 497 // MemoryBuffer is fairly simple model of the current state of memory. | |
| 498 // It partitions memory into several pieces. The first piece is | |
| 499 // generic memory where little is known about the owner of the memory. | |
| 500 // This is conceptually represented by the tuple <O, F, V> which says | |
| 501 // that the field F of object O has value V. This is flattened so | |
| 502 // that F is represented by the offset of the field and the parallel | |
| 503 // arrays _objects and _values are used for O and V. Loads of O.F can | |
| 504 // simply use V. Newly allocated objects are kept in a separate list | |
| 505 // along with a parallel array for each object which represents the | |
| 506 // current value of its fields. Stores of the default value to fields | |
| 507 // which have never been stored to before are eliminated since they | |
| 508 // are redundant. Once newly allocated objects are stored into | |
| 509 // another object or they are passed out of the current compile they | |
| 510 // are treated like generic memory. | |
| 511 | |
| 512 class MemoryBuffer: public CompilationResourceObj { | |
| 513 private: | |
| 514 FieldBuffer _values; | |
| 515 GrowableArray<Value> _objects; | |
| 516 GrowableArray<Value> _newobjects; | |
| 517 GrowableArray<FieldBuffer*> _fields; | |
| 518 | |
| 519 public: | |
| 520 MemoryBuffer() {} | |
| 521 | |
| 522 StoreField* store(StoreField* st) { | |
| 523 if (!EliminateFieldAccess) { | |
| 524 return st; | |
| 525 } | |
| 526 | |
| 527 Value object = st->obj(); | |
| 528 Value value = st->value(); | |
| 529 ciField* field = st->field(); | |
| 530 if (field->holder()->is_loaded()) { | |
| 531 int offset = field->offset(); | |
| 532 int index = _newobjects.find(object); | |
| 533 if (index != -1) { | |
| 534 // newly allocated object with no other stores performed on this field | |
| 535 FieldBuffer* buf = _fields.at(index); | |
| 536 if (buf->at(field) == NULL && is_default_value(value)) { | |
| 537 #ifndef PRODUCT | |
| 538 if (PrintIRDuringConstruction && Verbose) { | |
| 539 tty->print_cr("Eliminated store for object %d:", index); | |
| 540 st->print_line(); | |
| 541 } | |
| 542 #endif | |
| 543 return NULL; | |
| 544 } else { | |
| 545 buf->at_put(field, value); | |
| 546 } | |
| 547 } else { | |
| 548 _objects.at_put_grow(offset, object, NULL); | |
| 549 _values.at_put(field, value); | |
| 550 } | |
| 551 | |
| 552 store_value(value); | |
| 553 } else { | |
| 554 // if we held onto field names we could alias based on names but | |
| 555 // we don't know what's being stored to so kill it all. | |
| 556 kill(); | |
| 557 } | |
| 558 return st; | |
| 559 } | |
| 560 | |
| 561 | |
| 562 // return true if this value correspond to the default value of a field. | |
| 563 bool is_default_value(Value value) { | |
| 564 Constant* con = value->as_Constant(); | |
| 565 if (con) { | |
| 566 switch (con->type()->tag()) { | |
| 567 case intTag: return con->type()->as_IntConstant()->value() == 0; | |
| 568 case longTag: return con->type()->as_LongConstant()->value() == 0; | |
| 569 case floatTag: return jint_cast(con->type()->as_FloatConstant()->value()) == 0; | |
| 570 case doubleTag: return jlong_cast(con->type()->as_DoubleConstant()->value()) == jlong_cast(0); | |
| 571 case objectTag: return con->type() == objectNull; | |
| 572 default: ShouldNotReachHere(); | |
| 573 } | |
| 574 } | |
| 575 return false; | |
| 576 } | |
| 577 | |
| 578 | |
| 579 // return either the actual value of a load or the load itself | |
| 580 Value load(LoadField* load) { | |
| 581 if (!EliminateFieldAccess) { | |
| 582 return load; | |
| 583 } | |
| 584 | |
| 585 if (RoundFPResults && UseSSE < 2 && load->type()->is_float_kind()) { | |
| 586 // can't skip load since value might get rounded as a side effect | |
| 587 return load; | |
| 588 } | |
| 589 | |
| 590 ciField* field = load->field(); | |
| 591 Value object = load->obj(); | |
| 592 if (field->holder()->is_loaded() && !field->is_volatile()) { | |
| 593 int offset = field->offset(); | |
| 594 Value result = NULL; | |
| 595 int index = _newobjects.find(object); | |
| 596 if (index != -1) { | |
| 597 result = _fields.at(index)->at(field); | |
| 598 } else if (_objects.at_grow(offset, NULL) == object) { | |
| 599 result = _values.at(field); | |
| 600 } | |
| 601 if (result != NULL) { | |
| 602 #ifndef PRODUCT | |
| 603 if (PrintIRDuringConstruction && Verbose) { | |
| 604 tty->print_cr("Eliminated load: "); | |
| 605 load->print_line(); | |
| 606 } | |
| 607 #endif | |
| 608 assert(result->type()->tag() == load->type()->tag(), "wrong types"); | |
| 609 return result; | |
| 610 } | |
| 611 } | |
| 612 return load; | |
| 613 } | |
| 614 | |
| 615 // Record this newly allocated object | |
| 616 void new_instance(NewInstance* object) { | |
| 617 int index = _newobjects.length(); | |
| 618 _newobjects.append(object); | |
| 619 if (_fields.at_grow(index, NULL) == NULL) { | |
| 620 _fields.at_put(index, new FieldBuffer()); | |
| 621 } else { | |
| 622 _fields.at(index)->kill(); | |
| 623 } | |
| 624 } | |
| 625 | |
| 626 void store_value(Value value) { | |
| 627 int index = _newobjects.find(value); | |
| 628 if (index != -1) { | |
| 629 // stored a newly allocated object into another object. | |
| 630 // Assume we've lost track of it as separate slice of memory. | |
| 631 // We could do better by keeping track of whether individual | |
| 632 // fields could alias each other. | |
| 633 _newobjects.remove_at(index); | |
| 634 // pull out the field info and store it at the end up the list | |
| 635 // of field info list to be reused later. | |
| 636 _fields.append(_fields.at(index)); | |
| 637 _fields.remove_at(index); | |
| 638 } | |
| 639 } | |
| 640 | |
| 641 void kill() { | |
| 642 _newobjects.trunc_to(0); | |
| 643 _objects.trunc_to(0); | |
| 644 _values.kill(); | |
| 645 } | |
| 646 }; | |
| 647 | |
| 648 | |
| 649 // Implementation of GraphBuilder's ScopeData | |
| 650 | |
| 651 GraphBuilder::ScopeData::ScopeData(ScopeData* parent) | |
| 652 : _parent(parent) | |
| 653 , _bci2block(NULL) | |
| 654 , _scope(NULL) | |
| 655 , _has_handler(false) | |
| 656 , _stream(NULL) | |
| 657 , _work_list(NULL) | |
| 658 , _parsing_jsr(false) | |
| 659 , _jsr_xhandlers(NULL) | |
| 660 , _caller_stack_size(-1) | |
| 661 , _continuation(NULL) | |
| 662 , _continuation_state(NULL) | |
| 663 , _num_returns(0) | |
| 664 , _cleanup_block(NULL) | |
| 665 , _cleanup_return_prev(NULL) | |
| 666 , _cleanup_state(NULL) | |
| 667 { | |
| 668 if (parent != NULL) { | |
| 669 _max_inline_size = (intx) ((float) NestedInliningSizeRatio * (float) parent->max_inline_size() / 100.0f); | |
| 670 } else { | |
| 671 _max_inline_size = MaxInlineSize; | |
| 672 } | |
| 673 if (_max_inline_size < MaxTrivialSize) { | |
| 674 _max_inline_size = MaxTrivialSize; | |
| 675 } | |
| 676 } | |
| 677 | |
| 678 | |
| 679 void GraphBuilder::kill_all() { | |
| 680 if (UseLocalValueNumbering) { | |
| 681 vmap()->kill_all(); | |
| 682 } | |
| 683 _memory->kill(); | |
| 684 } | |
| 685 | |
| 686 | |
| 687 BlockBegin* GraphBuilder::ScopeData::block_at(int bci) { | |
| 688 if (parsing_jsr()) { | |
| 689 // It is necessary to clone all blocks associated with a | |
| 690 // subroutine, including those for exception handlers in the scope | |
| 691 // of the method containing the jsr (because those exception | |
| 692 // handlers may contain ret instructions in some cases). | |
| 693 BlockBegin* block = bci2block()->at(bci); | |
| 694 if (block != NULL && block == parent()->bci2block()->at(bci)) { | |
| 695 BlockBegin* new_block = new BlockBegin(block->bci()); | |
| 696 #ifndef PRODUCT | |
| 697 if (PrintInitialBlockList) { | |
| 698 tty->print_cr("CFG: cloned block %d (bci %d) as block %d for jsr", | |
| 699 block->block_id(), block->bci(), new_block->block_id()); | |
| 700 } | |
| 701 #endif | |
| 702 // copy data from cloned blocked | |
| 703 new_block->set_depth_first_number(block->depth_first_number()); | |
| 704 if (block->is_set(BlockBegin::parser_loop_header_flag)) new_block->set(BlockBegin::parser_loop_header_flag); | |
| 705 // Preserve certain flags for assertion checking | |
| 706 if (block->is_set(BlockBegin::subroutine_entry_flag)) new_block->set(BlockBegin::subroutine_entry_flag); | |
| 707 if (block->is_set(BlockBegin::exception_entry_flag)) new_block->set(BlockBegin::exception_entry_flag); | |
| 708 | |
| 709 // copy was_visited_flag to allow early detection of bailouts | |
| 710 // if a block that is used in a jsr has already been visited before, | |
| 711 // it is shared between the normal control flow and a subroutine | |
| 712 // BlockBegin::try_merge returns false when the flag is set, this leads | |
| 713 // to a compilation bailout | |
| 714 if (block->is_set(BlockBegin::was_visited_flag)) new_block->set(BlockBegin::was_visited_flag); | |
| 715 | |
| 716 bci2block()->at_put(bci, new_block); | |
| 717 block = new_block; | |
| 718 } | |
| 719 return block; | |
| 720 } else { | |
| 721 return bci2block()->at(bci); | |
| 722 } | |
| 723 } | |
| 724 | |
| 725 | |
| 726 XHandlers* GraphBuilder::ScopeData::xhandlers() const { | |
| 727 if (_jsr_xhandlers == NULL) { | |
| 728 assert(!parsing_jsr(), ""); | |
| 729 return scope()->xhandlers(); | |
| 730 } | |
| 731 assert(parsing_jsr(), ""); | |
| 732 return _jsr_xhandlers; | |
| 733 } | |
| 734 | |
| 735 | |
| 736 void GraphBuilder::ScopeData::set_scope(IRScope* scope) { | |
| 737 _scope = scope; | |
| 738 bool parent_has_handler = false; | |
| 739 if (parent() != NULL) { | |
| 740 parent_has_handler = parent()->has_handler(); | |
| 741 } | |
| 742 _has_handler = parent_has_handler || scope->xhandlers()->has_handlers(); | |
| 743 } | |
| 744 | |
| 745 | |
| 746 void GraphBuilder::ScopeData::set_inline_cleanup_info(BlockBegin* block, | |
| 747 Instruction* return_prev, | |
| 748 ValueStack* return_state) { | |
| 749 _cleanup_block = block; | |
| 750 _cleanup_return_prev = return_prev; | |
| 751 _cleanup_state = return_state; | |
| 752 } | |
| 753 | |
| 754 | |
| 755 void GraphBuilder::ScopeData::add_to_work_list(BlockBegin* block) { | |
| 756 if (_work_list == NULL) { | |
| 757 _work_list = new BlockList(); | |
| 758 } | |
| 759 | |
| 760 if (!block->is_set(BlockBegin::is_on_work_list_flag)) { | |
| 761 // Do not start parsing the continuation block while in a | |
| 762 // sub-scope | |
| 763 if (parsing_jsr()) { | |
| 764 if (block == jsr_continuation()) { | |
| 765 return; | |
| 766 } | |
| 767 } else { | |
| 768 if (block == continuation()) { | |
| 769 return; | |
| 770 } | |
| 771 } | |
| 772 block->set(BlockBegin::is_on_work_list_flag); | |
| 773 _work_list->push(block); | |
| 774 | |
| 775 sort_top_into_worklist(_work_list, block); | |
| 776 } | |
| 777 } | |
| 778 | |
| 779 | |
| 780 void GraphBuilder::sort_top_into_worklist(BlockList* worklist, BlockBegin* top) { | |
| 781 assert(worklist->top() == top, ""); | |
| 782 // sort block descending into work list | |
| 783 const int dfn = top->depth_first_number(); | |
| 784 assert(dfn != -1, "unknown depth first number"); | |
| 785 int i = worklist->length()-2; | |
| 786 while (i >= 0) { | |
| 787 BlockBegin* b = worklist->at(i); | |
| 788 if (b->depth_first_number() < dfn) { | |
| 789 worklist->at_put(i+1, b); | |
| 790 } else { | |
| 791 break; | |
| 792 } | |
| 793 i --; | |
| 794 } | |
| 795 if (i >= -1) worklist->at_put(i + 1, top); | |
| 796 } | |
| 797 | |
| 798 int GraphBuilder::ScopeData::caller_stack_size() const { | |
| 799 ValueStack* state = scope()->caller_state(); | |
| 800 if (state == NULL) { | |
| 801 return 0; | |
| 802 } | |
| 803 return state->stack_size(); | |
| 804 } | |
| 805 | |
| 806 | |
| 807 BlockBegin* GraphBuilder::ScopeData::remove_from_work_list() { | |
| 808 if (is_work_list_empty()) { | |
| 809 return NULL; | |
| 810 } | |
| 811 return _work_list->pop(); | |
| 812 } | |
| 813 | |
| 814 | |
| 815 bool GraphBuilder::ScopeData::is_work_list_empty() const { | |
| 816 return (_work_list == NULL || _work_list->length() == 0); | |
| 817 } | |
| 818 | |
| 819 | |
| 820 void GraphBuilder::ScopeData::setup_jsr_xhandlers() { | |
| 821 assert(parsing_jsr(), ""); | |
| 822 // clone all the exception handlers from the scope | |
| 823 XHandlers* handlers = new XHandlers(scope()->xhandlers()); | |
| 824 const int n = handlers->length(); | |
| 825 for (int i = 0; i < n; i++) { | |
| 826 // The XHandlers need to be adjusted to dispatch to the cloned | |
| 827 // handler block instead of the default one but the synthetic | |
| 828 // unlocker needs to be handled specially. The synthetic unlocker | |
| 829 // should be left alone since there can be only one and all code | |
| 830 // should dispatch to the same one. | |
| 831 XHandler* h = handlers->handler_at(i); | |
| 832 if (h->handler_bci() != SynchronizationEntryBCI) { | |
| 833 h->set_entry_block(block_at(h->handler_bci())); | |
| 834 } else { | |
| 835 assert(h->entry_block()->is_set(BlockBegin::default_exception_handler_flag), | |
| 836 "should be the synthetic unlock block"); | |
| 837 } | |
| 838 } | |
| 839 _jsr_xhandlers = handlers; | |
| 840 } | |
| 841 | |
| 842 | |
| 843 int GraphBuilder::ScopeData::num_returns() { | |
| 844 if (parsing_jsr()) { | |
| 845 return parent()->num_returns(); | |
| 846 } | |
| 847 return _num_returns; | |
| 848 } | |
| 849 | |
| 850 | |
| 851 void GraphBuilder::ScopeData::incr_num_returns() { | |
| 852 if (parsing_jsr()) { | |
| 853 parent()->incr_num_returns(); | |
| 854 } else { | |
| 855 ++_num_returns; | |
| 856 } | |
| 857 } | |
| 858 | |
| 859 | |
| 860 // Implementation of GraphBuilder | |
| 861 | |
| 862 #define INLINE_BAILOUT(msg) { inline_bailout(msg); return false; } | |
| 863 | |
| 864 | |
| 865 void GraphBuilder::load_constant() { | |
| 866 ciConstant con = stream()->get_constant(); | |
| 867 if (con.basic_type() == T_ILLEGAL) { | |
| 868 BAILOUT("could not resolve a constant"); | |
| 869 } else { | |
| 870 ValueType* t = illegalType; | |
| 871 ValueStack* patch_state = NULL; | |
| 872 switch (con.basic_type()) { | |
| 873 case T_BOOLEAN: t = new IntConstant (con.as_boolean()); break; | |
| 874 case T_BYTE : t = new IntConstant (con.as_byte ()); break; | |
| 875 case T_CHAR : t = new IntConstant (con.as_char ()); break; | |
| 876 case T_SHORT : t = new IntConstant (con.as_short ()); break; | |
| 877 case T_INT : t = new IntConstant (con.as_int ()); break; | |
| 878 case T_LONG : t = new LongConstant (con.as_long ()); break; | |
| 879 case T_FLOAT : t = new FloatConstant (con.as_float ()); break; | |
| 880 case T_DOUBLE : t = new DoubleConstant (con.as_double ()); break; | |
| 881 case T_ARRAY : t = new ArrayConstant (con.as_object ()->as_array ()); break; | |
| 882 case T_OBJECT : | |
| 883 { | |
| 884 ciObject* obj = con.as_object(); | |
| 885 if (obj->is_klass()) { | |
| 886 ciKlass* klass = obj->as_klass(); | |
| 887 if (!klass->is_loaded() || PatchALot) { | |
| 888 patch_state = state()->copy(); | |
| 889 t = new ObjectConstant(obj); | |
| 890 } else { | |
| 891 t = new InstanceConstant(klass->java_mirror()); | |
| 892 } | |
| 893 } else { | |
| 894 t = new InstanceConstant(obj->as_instance()); | |
| 895 } | |
| 896 break; | |
| 897 } | |
| 898 default : ShouldNotReachHere(); | |
| 899 } | |
| 900 Value x; | |
| 901 if (patch_state != NULL) { | |
| 902 x = new Constant(t, patch_state); | |
| 903 } else { | |
| 904 x = new Constant(t); | |
| 905 } | |
| 906 push(t, append(x)); | |
| 907 } | |
| 908 } | |
| 909 | |
| 910 | |
| 911 void GraphBuilder::load_local(ValueType* type, int index) { | |
| 912 Value x = state()->load_local(index); | |
| 913 push(type, x); | |
| 914 } | |
| 915 | |
| 916 | |
| 917 void GraphBuilder::store_local(ValueType* type, int index) { | |
| 918 Value x = pop(type); | |
| 919 store_local(state(), x, type, index); | |
| 920 } | |
| 921 | |
| 922 | |
| 923 void GraphBuilder::store_local(ValueStack* state, Value x, ValueType* type, int index) { | |
| 924 if (parsing_jsr()) { | |
| 925 // We need to do additional tracking of the location of the return | |
| 926 // address for jsrs since we don't handle arbitrary jsr/ret | |
| 927 // constructs. Here we are figuring out in which circumstances we | |
| 928 // need to bail out. | |
| 929 if (x->type()->is_address()) { | |
| 930 scope_data()->set_jsr_return_address_local(index); | |
| 931 | |
| 932 // Also check parent jsrs (if any) at this time to see whether | |
| 933 // they are using this local. We don't handle skipping over a | |
| 934 // ret. | |
| 935 for (ScopeData* cur_scope_data = scope_data()->parent(); | |
| 936 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); | |
| 937 cur_scope_data = cur_scope_data->parent()) { | |
| 938 if (cur_scope_data->jsr_return_address_local() == index) { | |
| 939 BAILOUT("subroutine overwrites return address from previous subroutine"); | |
| 940 } | |
| 941 } | |
| 942 } else if (index == scope_data()->jsr_return_address_local()) { | |
| 943 scope_data()->set_jsr_return_address_local(-1); | |
| 944 } | |
| 945 } | |
| 946 | |
| 947 state->store_local(index, round_fp(x)); | |
| 948 } | |
| 949 | |
| 950 | |
| 951 void GraphBuilder::load_indexed(BasicType type) { | |
| 952 Value index = ipop(); | |
| 953 Value array = apop(); | |
| 954 Value length = NULL; | |
| 955 if (CSEArrayLength || | |
| 956 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || | |
| 957 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { | |
| 958 length = append(new ArrayLength(array, lock_stack())); | |
| 959 } | |
| 960 push(as_ValueType(type), append(new LoadIndexed(array, index, length, type, lock_stack()))); | |
| 961 } | |
| 962 | |
| 963 | |
| 964 void GraphBuilder::store_indexed(BasicType type) { | |
| 965 Value value = pop(as_ValueType(type)); | |
| 966 Value index = ipop(); | |
| 967 Value array = apop(); | |
| 968 Value length = NULL; | |
| 969 if (CSEArrayLength || | |
| 970 (array->as_AccessField() && array->as_AccessField()->field()->is_constant()) || | |
| 971 (array->as_NewArray() && array->as_NewArray()->length() && array->as_NewArray()->length()->type()->is_constant())) { | |
| 972 length = append(new ArrayLength(array, lock_stack())); | |
| 973 } | |
| 974 StoreIndexed* result = new StoreIndexed(array, index, length, type, value, lock_stack()); | |
| 975 append(result); | |
| 459 | 976 _memory->store_value(value); |
| 0 | 977 } |
| 978 | |
| 979 | |
| 980 void GraphBuilder::stack_op(Bytecodes::Code code) { | |
| 981 switch (code) { | |
| 982 case Bytecodes::_pop: | |
| 983 { state()->raw_pop(); | |
| 984 } | |
| 985 break; | |
| 986 case Bytecodes::_pop2: | |
| 987 { state()->raw_pop(); | |
| 988 state()->raw_pop(); | |
| 989 } | |
| 990 break; | |
| 991 case Bytecodes::_dup: | |
| 992 { Value w = state()->raw_pop(); | |
| 993 state()->raw_push(w); | |
| 994 state()->raw_push(w); | |
| 995 } | |
| 996 break; | |
| 997 case Bytecodes::_dup_x1: | |
| 998 { Value w1 = state()->raw_pop(); | |
| 999 Value w2 = state()->raw_pop(); | |
| 1000 state()->raw_push(w1); | |
| 1001 state()->raw_push(w2); | |
| 1002 state()->raw_push(w1); | |
| 1003 } | |
| 1004 break; | |
| 1005 case Bytecodes::_dup_x2: | |
| 1006 { Value w1 = state()->raw_pop(); | |
| 1007 Value w2 = state()->raw_pop(); | |
| 1008 Value w3 = state()->raw_pop(); | |
| 1009 state()->raw_push(w1); | |
| 1010 state()->raw_push(w3); | |
| 1011 state()->raw_push(w2); | |
| 1012 state()->raw_push(w1); | |
| 1013 } | |
| 1014 break; | |
| 1015 case Bytecodes::_dup2: | |
| 1016 { Value w1 = state()->raw_pop(); | |
| 1017 Value w2 = state()->raw_pop(); | |
| 1018 state()->raw_push(w2); | |
| 1019 state()->raw_push(w1); | |
| 1020 state()->raw_push(w2); | |
| 1021 state()->raw_push(w1); | |
| 1022 } | |
| 1023 break; | |
| 1024 case Bytecodes::_dup2_x1: | |
| 1025 { Value w1 = state()->raw_pop(); | |
| 1026 Value w2 = state()->raw_pop(); | |
| 1027 Value w3 = state()->raw_pop(); | |
| 1028 state()->raw_push(w2); | |
| 1029 state()->raw_push(w1); | |
| 1030 state()->raw_push(w3); | |
| 1031 state()->raw_push(w2); | |
| 1032 state()->raw_push(w1); | |
| 1033 } | |
| 1034 break; | |
| 1035 case Bytecodes::_dup2_x2: | |
| 1036 { Value w1 = state()->raw_pop(); | |
| 1037 Value w2 = state()->raw_pop(); | |
| 1038 Value w3 = state()->raw_pop(); | |
| 1039 Value w4 = state()->raw_pop(); | |
| 1040 state()->raw_push(w2); | |
| 1041 state()->raw_push(w1); | |
| 1042 state()->raw_push(w4); | |
| 1043 state()->raw_push(w3); | |
| 1044 state()->raw_push(w2); | |
| 1045 state()->raw_push(w1); | |
| 1046 } | |
| 1047 break; | |
| 1048 case Bytecodes::_swap: | |
| 1049 { Value w1 = state()->raw_pop(); | |
| 1050 Value w2 = state()->raw_pop(); | |
| 1051 state()->raw_push(w1); | |
| 1052 state()->raw_push(w2); | |
| 1053 } | |
| 1054 break; | |
| 1055 default: | |
| 1056 ShouldNotReachHere(); | |
| 1057 break; | |
| 1058 } | |
| 1059 } | |
| 1060 | |
| 1061 | |
| 1062 void GraphBuilder::arithmetic_op(ValueType* type, Bytecodes::Code code, ValueStack* stack) { | |
| 1063 Value y = pop(type); | |
| 1064 Value x = pop(type); | |
| 1065 // NOTE: strictfp can be queried from current method since we don't | |
| 1066 // inline methods with differing strictfp bits | |
| 1067 Value res = new ArithmeticOp(code, x, y, method()->is_strict(), stack); | |
| 1068 // Note: currently single-precision floating-point rounding on Intel is handled at the LIRGenerator level | |
| 1069 res = append(res); | |
| 1070 if (method()->is_strict()) { | |
| 1071 res = round_fp(res); | |
| 1072 } | |
| 1073 push(type, res); | |
| 1074 } | |
| 1075 | |
| 1076 | |
| 1077 void GraphBuilder::negate_op(ValueType* type) { | |
| 1078 push(type, append(new NegateOp(pop(type)))); | |
| 1079 } | |
| 1080 | |
| 1081 | |
| 1082 void GraphBuilder::shift_op(ValueType* type, Bytecodes::Code code) { | |
| 1083 Value s = ipop(); | |
| 1084 Value x = pop(type); | |
| 1085 // try to simplify | |
| 1086 // Note: This code should go into the canonicalizer as soon as it can | |
| 1087 // can handle canonicalized forms that contain more than one node. | |
| 1088 if (CanonicalizeNodes && code == Bytecodes::_iushr) { | |
| 1089 // pattern: x >>> s | |
| 1090 IntConstant* s1 = s->type()->as_IntConstant(); | |
| 1091 if (s1 != NULL) { | |
| 1092 // pattern: x >>> s1, with s1 constant | |
| 1093 ShiftOp* l = x->as_ShiftOp(); | |
| 1094 if (l != NULL && l->op() == Bytecodes::_ishl) { | |
| 1095 // pattern: (a << b) >>> s1 | |
| 1096 IntConstant* s0 = l->y()->type()->as_IntConstant(); | |
| 1097 if (s0 != NULL) { | |
| 1098 // pattern: (a << s0) >>> s1 | |
| 1099 const int s0c = s0->value() & 0x1F; // only the low 5 bits are significant for shifts | |
| 1100 const int s1c = s1->value() & 0x1F; // only the low 5 bits are significant for shifts | |
| 1101 if (s0c == s1c) { | |
| 1102 if (s0c == 0) { | |
| 1103 // pattern: (a << 0) >>> 0 => simplify to: a | |
| 1104 ipush(l->x()); | |
| 1105 } else { | |
| 1106 // pattern: (a << s0c) >>> s0c => simplify to: a & m, with m constant | |
| 1107 assert(0 < s0c && s0c < BitsPerInt, "adjust code below to handle corner cases"); | |
| 1108 const int m = (1 << (BitsPerInt - s0c)) - 1; | |
| 1109 Value s = append(new Constant(new IntConstant(m))); | |
| 1110 ipush(append(new LogicOp(Bytecodes::_iand, l->x(), s))); | |
| 1111 } | |
| 1112 return; | |
| 1113 } | |
| 1114 } | |
| 1115 } | |
| 1116 } | |
| 1117 } | |
| 1118 // could not simplify | |
| 1119 push(type, append(new ShiftOp(code, x, s))); | |
| 1120 } | |
| 1121 | |
| 1122 | |
| 1123 void GraphBuilder::logic_op(ValueType* type, Bytecodes::Code code) { | |
| 1124 Value y = pop(type); | |
| 1125 Value x = pop(type); | |
| 1126 push(type, append(new LogicOp(code, x, y))); | |
| 1127 } | |
| 1128 | |
| 1129 | |
| 1130 void GraphBuilder::compare_op(ValueType* type, Bytecodes::Code code) { | |
| 1131 ValueStack* state_before = state()->copy(); | |
| 1132 Value y = pop(type); | |
| 1133 Value x = pop(type); | |
| 1134 ipush(append(new CompareOp(code, x, y, state_before))); | |
| 1135 } | |
| 1136 | |
| 1137 | |
| 1138 void GraphBuilder::convert(Bytecodes::Code op, BasicType from, BasicType to) { | |
| 1139 push(as_ValueType(to), append(new Convert(op, pop(as_ValueType(from)), as_ValueType(to)))); | |
| 1140 } | |
| 1141 | |
| 1142 | |
| 1143 void GraphBuilder::increment() { | |
| 1144 int index = stream()->get_index(); | |
| 1145 int delta = stream()->is_wide() ? (signed short)Bytes::get_Java_u2(stream()->cur_bcp() + 4) : (signed char)(stream()->cur_bcp()[2]); | |
| 1146 load_local(intType, index); | |
| 1147 ipush(append(new Constant(new IntConstant(delta)))); | |
| 1148 arithmetic_op(intType, Bytecodes::_iadd); | |
| 1149 store_local(intType, index); | |
| 1150 } | |
| 1151 | |
| 1152 | |
| 1153 void GraphBuilder::_goto(int from_bci, int to_bci) { | |
| 1154 profile_bci(from_bci); | |
| 1155 append(new Goto(block_at(to_bci), to_bci <= from_bci)); | |
| 1156 } | |
| 1157 | |
| 1158 | |
| 1159 void GraphBuilder::if_node(Value x, If::Condition cond, Value y, ValueStack* state_before) { | |
| 1160 BlockBegin* tsux = block_at(stream()->get_dest()); | |
| 1161 BlockBegin* fsux = block_at(stream()->next_bci()); | |
| 1162 bool is_bb = tsux->bci() < stream()->cur_bci() || fsux->bci() < stream()->cur_bci(); | |
| 1163 If* if_node = append(new If(x, cond, false, y, tsux, fsux, is_bb ? state_before : NULL, is_bb))->as_If(); | |
| 1164 if (profile_branches() && (if_node != NULL)) { | |
| 1165 if_node->set_profiled_method(method()); | |
| 1166 if_node->set_profiled_bci(bci()); | |
| 1167 if_node->set_should_profile(true); | |
| 1168 } | |
| 1169 } | |
| 1170 | |
| 1171 | |
| 1172 void GraphBuilder::if_zero(ValueType* type, If::Condition cond) { | |
| 1173 Value y = append(new Constant(intZero)); | |
| 1174 ValueStack* state_before = state()->copy(); | |
| 1175 Value x = ipop(); | |
| 1176 if_node(x, cond, y, state_before); | |
| 1177 } | |
| 1178 | |
| 1179 | |
| 1180 void GraphBuilder::if_null(ValueType* type, If::Condition cond) { | |
| 1181 Value y = append(new Constant(objectNull)); | |
| 1182 ValueStack* state_before = state()->copy(); | |
| 1183 Value x = apop(); | |
| 1184 if_node(x, cond, y, state_before); | |
| 1185 } | |
| 1186 | |
| 1187 | |
| 1188 void GraphBuilder::if_same(ValueType* type, If::Condition cond) { | |
| 1189 ValueStack* state_before = state()->copy(); | |
| 1190 Value y = pop(type); | |
| 1191 Value x = pop(type); | |
| 1192 if_node(x, cond, y, state_before); | |
| 1193 } | |
| 1194 | |
| 1195 | |
| 1196 void GraphBuilder::jsr(int dest) { | |
| 1197 // We only handle well-formed jsrs (those which are "block-structured"). | |
| 1198 // If the bytecodes are strange (jumping out of a jsr block) then we | |
| 1199 // might end up trying to re-parse a block containing a jsr which | |
| 1200 // has already been activated. Watch for this case and bail out. | |
| 1201 for (ScopeData* cur_scope_data = scope_data(); | |
| 1202 cur_scope_data != NULL && cur_scope_data->parsing_jsr() && cur_scope_data->scope() == scope(); | |
| 1203 cur_scope_data = cur_scope_data->parent()) { | |
| 1204 if (cur_scope_data->jsr_entry_bci() == dest) { | |
| 1205 BAILOUT("too-complicated jsr/ret structure"); | |
| 1206 } | |
| 1207 } | |
| 1208 | |
| 1209 push(addressType, append(new Constant(new AddressConstant(next_bci())))); | |
| 1210 if (!try_inline_jsr(dest)) { | |
| 1211 return; // bailed out while parsing and inlining subroutine | |
| 1212 } | |
| 1213 } | |
| 1214 | |
| 1215 | |
| 1216 void GraphBuilder::ret(int local_index) { | |
| 1217 if (!parsing_jsr()) BAILOUT("ret encountered while not parsing subroutine"); | |
| 1218 | |
| 1219 if (local_index != scope_data()->jsr_return_address_local()) { | |
| 1220 BAILOUT("can not handle complicated jsr/ret constructs"); | |
| 1221 } | |
| 1222 | |
| 1223 // Rets simply become (NON-SAFEPOINT) gotos to the jsr continuation | |
| 1224 append(new Goto(scope_data()->jsr_continuation(), false)); | |
| 1225 } | |
| 1226 | |
| 1227 | |
| 1228 void GraphBuilder::table_switch() { | |
| 1229 Bytecode_tableswitch* switch_ = Bytecode_tableswitch_at(method()->code() + bci()); | |
| 1230 const int l = switch_->length(); | |
| 1231 if (CanonicalizeNodes && l == 1) { | |
| 1232 // total of 2 successors => use If instead of switch | |
| 1233 // Note: This code should go into the canonicalizer as soon as it can | |
| 1234 // can handle canonicalized forms that contain more than one node. | |
| 1235 Value key = append(new Constant(new IntConstant(switch_->low_key()))); | |
| 1236 BlockBegin* tsux = block_at(bci() + switch_->dest_offset_at(0)); | |
| 1237 BlockBegin* fsux = block_at(bci() + switch_->default_offset()); | |
| 1238 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); | |
| 1239 ValueStack* state_before = is_bb ? state() : NULL; | |
| 1240 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); | |
| 1241 } else { | |
| 1242 // collect successors | |
| 1243 BlockList* sux = new BlockList(l + 1, NULL); | |
| 1244 int i; | |
| 1245 bool has_bb = false; | |
| 1246 for (i = 0; i < l; i++) { | |
| 1247 sux->at_put(i, block_at(bci() + switch_->dest_offset_at(i))); | |
| 1248 if (switch_->dest_offset_at(i) < 0) has_bb = true; | |
| 1249 } | |
| 1250 // add default successor | |
| 1251 sux->at_put(i, block_at(bci() + switch_->default_offset())); | |
| 1252 ValueStack* state_before = has_bb ? state() : NULL; | |
| 1253 append(new TableSwitch(ipop(), sux, switch_->low_key(), state_before, has_bb)); | |
| 1254 } | |
| 1255 } | |
| 1256 | |
| 1257 | |
| 1258 void GraphBuilder::lookup_switch() { | |
| 1259 Bytecode_lookupswitch* switch_ = Bytecode_lookupswitch_at(method()->code() + bci()); | |
| 1260 const int l = switch_->number_of_pairs(); | |
| 1261 if (CanonicalizeNodes && l == 1) { | |
| 1262 // total of 2 successors => use If instead of switch | |
| 1263 // Note: This code should go into the canonicalizer as soon as it can | |
| 1264 // can handle canonicalized forms that contain more than one node. | |
| 1265 // simplify to If | |
| 1266 LookupswitchPair* pair = switch_->pair_at(0); | |
| 1267 Value key = append(new Constant(new IntConstant(pair->match()))); | |
| 1268 BlockBegin* tsux = block_at(bci() + pair->offset()); | |
| 1269 BlockBegin* fsux = block_at(bci() + switch_->default_offset()); | |
| 1270 bool is_bb = tsux->bci() < bci() || fsux->bci() < bci(); | |
| 1271 ValueStack* state_before = is_bb ? state() : NULL; | |
| 1272 append(new If(ipop(), If::eql, true, key, tsux, fsux, state_before, is_bb)); | |
| 1273 } else { | |
| 1274 // collect successors & keys | |
| 1275 BlockList* sux = new BlockList(l + 1, NULL); | |
| 1276 intArray* keys = new intArray(l, 0); | |
| 1277 int i; | |
| 1278 bool has_bb = false; | |
| 1279 for (i = 0; i < l; i++) { | |
| 1280 LookupswitchPair* pair = switch_->pair_at(i); | |
| 1281 if (pair->offset() < 0) has_bb = true; | |
| 1282 sux->at_put(i, block_at(bci() + pair->offset())); | |
| 1283 keys->at_put(i, pair->match()); | |
| 1284 } | |
| 1285 // add default successor | |
| 1286 sux->at_put(i, block_at(bci() + switch_->default_offset())); | |
| 1287 ValueStack* state_before = has_bb ? state() : NULL; | |
| 1288 append(new LookupSwitch(ipop(), sux, keys, state_before, has_bb)); | |
| 1289 } | |
| 1290 } | |
| 1291 | |
| 1292 void GraphBuilder::call_register_finalizer() { | |
| 1293 // If the receiver requires finalization then emit code to perform | |
| 1294 // the registration on return. | |
| 1295 | |
| 1296 // Gather some type information about the receiver | |
| 1297 Value receiver = state()->load_local(0); | |
| 1298 assert(receiver != NULL, "must have a receiver"); | |
| 1299 ciType* declared_type = receiver->declared_type(); | |
| 1300 ciType* exact_type = receiver->exact_type(); | |
| 1301 if (exact_type == NULL && | |
| 1302 receiver->as_Local() && | |
| 1303 receiver->as_Local()->java_index() == 0) { | |
| 1304 ciInstanceKlass* ik = compilation()->method()->holder(); | |
| 1305 if (ik->is_final()) { | |
| 1306 exact_type = ik; | |
| 1307 } else if (UseCHA && !(ik->has_subklass() || ik->is_interface())) { | |
| 1308 // test class is leaf class | |
| 1309 compilation()->dependency_recorder()->assert_leaf_type(ik); | |
| 1310 exact_type = ik; | |
| 1311 } else { | |
| 1312 declared_type = ik; | |
| 1313 } | |
| 1314 } | |
| 1315 | |
| 1316 // see if we know statically that registration isn't required | |
| 1317 bool needs_check = true; | |
| 1318 if (exact_type != NULL) { | |
| 1319 needs_check = exact_type->as_instance_klass()->has_finalizer(); | |
| 1320 } else if (declared_type != NULL) { | |
| 1321 ciInstanceKlass* ik = declared_type->as_instance_klass(); | |
| 1322 if (!Dependencies::has_finalizable_subclass(ik)) { | |
| 1323 compilation()->dependency_recorder()->assert_has_no_finalizable_subclasses(ik); | |
| 1324 needs_check = false; | |
| 1325 } | |
| 1326 } | |
| 1327 | |
| 1328 if (needs_check) { | |
| 1329 // Perform the registration of finalizable objects. | |
| 1330 load_local(objectType, 0); | |
| 1331 append_split(new Intrinsic(voidType, vmIntrinsics::_Object_init, | |
| 1332 state()->pop_arguments(1), | |
| 1333 true, lock_stack(), true)); | |
| 1334 } | |
| 1335 } | |
| 1336 | |
| 1337 | |
| 1338 void GraphBuilder::method_return(Value x) { | |
| 1339 if (RegisterFinalizersAtInit && | |
| 1340 method()->intrinsic_id() == vmIntrinsics::_Object_init) { | |
| 1341 call_register_finalizer(); | |
| 1342 } | |
| 1343 | |
| 1344 // Check to see whether we are inlining. If so, Return | |
| 1345 // instructions become Gotos to the continuation point. | |
| 1346 if (continuation() != NULL) { | |
| 1347 assert(!method()->is_synchronized() || InlineSynchronizedMethods, "can not inline synchronized methods yet"); | |
| 1348 | |
| 1349 // If the inlined method is synchronized, the monitor must be | |
| 1350 // released before we jump to the continuation block. | |
| 1351 if (method()->is_synchronized()) { | |
| 1352 int i = state()->caller_state()->locks_size(); | |
| 1353 assert(state()->locks_size() == i + 1, "receiver must be locked here"); | |
| 1354 monitorexit(state()->lock_at(i), SynchronizationEntryBCI); | |
| 1355 } | |
| 1356 | |
| 1357 state()->truncate_stack(caller_stack_size()); | |
| 1358 if (x != NULL) { | |
| 1359 state()->push(x->type(), x); | |
| 1360 } | |
| 1361 Goto* goto_callee = new Goto(continuation(), false); | |
| 1362 | |
| 1363 // See whether this is the first return; if so, store off some | |
| 1364 // of the state for later examination | |
| 1365 if (num_returns() == 0) { | |
| 1366 set_inline_cleanup_info(_block, _last, state()); | |
| 1367 } | |
| 1368 | |
| 1369 // State at end of inlined method is the state of the caller | |
| 1370 // without the method parameters on stack, including the | |
| 1371 // return value, if any, of the inlined method on operand stack. | |
| 1372 set_state(scope_data()->continuation_state()->copy()); | |
| 1373 if (x) { | |
| 1374 state()->push(x->type(), x); | |
| 1375 } | |
| 1376 | |
| 1377 // The current bci() is in the wrong scope, so use the bci() of | |
| 1378 // the continuation point. | |
| 1379 append_with_bci(goto_callee, scope_data()->continuation()->bci()); | |
| 1380 incr_num_returns(); | |
| 1381 | |
| 1382 return; | |
| 1383 } | |
| 1384 | |
| 1385 state()->truncate_stack(0); | |
| 1386 if (method()->is_synchronized()) { | |
| 1387 // perform the unlocking before exiting the method | |
| 1388 Value receiver; | |
| 1389 if (!method()->is_static()) { | |
| 1390 receiver = _initial_state->local_at(0); | |
| 1391 } else { | |
| 1392 receiver = append(new Constant(new ClassConstant(method()->holder()))); | |
| 1393 } | |
| 1394 append_split(new MonitorExit(receiver, state()->unlock())); | |
| 1395 } | |
| 1396 | |
| 1397 append(new Return(x)); | |
| 1398 } | |
| 1399 | |
| 1400 | |
| 1401 void GraphBuilder::access_field(Bytecodes::Code code) { | |
| 1402 bool will_link; | |
| 1403 ciField* field = stream()->get_field(will_link); | |
| 1404 ciInstanceKlass* holder = field->holder(); | |
| 1405 BasicType field_type = field->type()->basic_type(); | |
| 1406 ValueType* type = as_ValueType(field_type); | |
| 1407 // call will_link again to determine if the field is valid. | |
| 1408 const bool is_loaded = holder->is_loaded() && | |
| 1409 field->will_link(method()->holder(), code); | |
| 1410 const bool is_initialized = is_loaded && holder->is_initialized(); | |
| 1411 | |
| 1412 ValueStack* state_copy = NULL; | |
| 1413 if (!is_initialized || PatchALot) { | |
| 1414 // save state before instruction for debug info when | |
| 1415 // deoptimization happens during patching | |
| 1416 state_copy = state()->copy(); | |
| 1417 } | |
| 1418 | |
| 1419 Value obj = NULL; | |
| 1420 if (code == Bytecodes::_getstatic || code == Bytecodes::_putstatic) { | |
| 1421 // commoning of class constants should only occur if the class is | |
| 1422 // fully initialized and resolved in this constant pool. The will_link test | |
| 1423 // above essentially checks if this class is resolved in this constant pool | |
| 1424 // so, the is_initialized flag should be suffiect. | |
| 1425 if (state_copy != NULL) { | |
| 1426 // build a patching constant | |
| 1427 obj = new Constant(new ClassConstant(holder), state_copy); | |
| 1428 } else { | |
| 1429 obj = new Constant(new ClassConstant(holder)); | |
| 1430 } | |
| 1431 } | |
| 1432 | |
| 1433 | |
| 1434 const int offset = is_loaded ? field->offset() : -1; | |
| 1435 switch (code) { | |
| 1436 case Bytecodes::_getstatic: { | |
| 1437 // check for compile-time constants, i.e., initialized static final fields | |
| 1438 Instruction* constant = NULL; | |
| 1439 if (field->is_constant() && !PatchALot) { | |
| 1440 ciConstant field_val = field->constant_value(); | |
| 1441 BasicType field_type = field_val.basic_type(); | |
| 1442 switch (field_type) { | |
| 1443 case T_ARRAY: | |
| 1444 case T_OBJECT: | |
| 1445 if (field_val.as_object()->has_encoding()) { | |
| 1446 constant = new Constant(as_ValueType(field_val)); | |
| 1447 } | |
| 1448 break; | |
| 1449 | |
| 1450 default: | |
| 1451 constant = new Constant(as_ValueType(field_val)); | |
| 1452 } | |
| 1453 } | |
| 1454 if (constant != NULL) { | |
| 1455 push(type, append(constant)); | |
| 1456 state_copy = NULL; // Not a potential deoptimization point (see set_state_before logic below) | |
| 1457 } else { | |
| 1458 push(type, append(new LoadField(append(obj), offset, field, true, | |
| 1459 lock_stack(), state_copy, is_loaded, is_initialized))); | |
| 1460 } | |
| 1461 break; | |
| 1462 } | |
| 1463 case Bytecodes::_putstatic: | |
| 1464 { Value val = pop(type); | |
| 1465 append(new StoreField(append(obj), offset, field, val, true, lock_stack(), state_copy, is_loaded, is_initialized)); | |
| 1466 } | |
| 1467 break; | |
| 1468 case Bytecodes::_getfield : | |
| 1469 { | |
| 1470 LoadField* load = new LoadField(apop(), offset, field, false, lock_stack(), state_copy, is_loaded, true); | |
| 1471 Value replacement = is_loaded ? _memory->load(load) : load; | |
| 1472 if (replacement != load) { | |
| 1473 assert(replacement->bci() != -99 || replacement->as_Phi() || replacement->as_Local(), | |
| 1474 "should already by linked"); | |
| 1475 push(type, replacement); | |
| 1476 } else { | |
| 1477 push(type, append(load)); | |
| 1478 } | |
| 1479 break; | |
| 1480 } | |
| 1481 | |
| 1482 case Bytecodes::_putfield : | |
| 1483 { Value val = pop(type); | |
| 1484 StoreField* store = new StoreField(apop(), offset, field, val, false, lock_stack(), state_copy, is_loaded, true); | |
| 1485 if (is_loaded) store = _memory->store(store); | |
| 1486 if (store != NULL) { | |
| 1487 append(store); | |
| 1488 } | |
| 1489 } | |
| 1490 break; | |
| 1491 default : | |
| 1492 ShouldNotReachHere(); | |
| 1493 break; | |
| 1494 } | |
| 1495 } | |
| 1496 | |
| 1497 | |
| 1498 Dependencies* GraphBuilder::dependency_recorder() const { | |
| 1499 assert(DeoptC1, "need debug information"); | |
| 1500 compilation()->set_needs_debug_information(true); | |
| 1501 return compilation()->dependency_recorder(); | |
| 1502 } | |
| 1503 | |
| 1504 | |
| 1505 void GraphBuilder::invoke(Bytecodes::Code code) { | |
| 1506 bool will_link; | |
| 1507 ciMethod* target = stream()->get_method(will_link); | |
| 1508 // we have to make sure the argument size (incl. the receiver) | |
| 1509 // is correct for compilation (the call would fail later during | |
| 1510 // linkage anyway) - was bug (gri 7/28/99) | |
| 1511 if (target->is_loaded() && target->is_static() != (code == Bytecodes::_invokestatic)) BAILOUT("will cause link error"); | |
| 1512 ciInstanceKlass* klass = target->holder(); | |
| 1513 | |
| 1514 // check if CHA possible: if so, change the code to invoke_special | |
| 1515 ciInstanceKlass* calling_klass = method()->holder(); | |
| 1516 ciKlass* holder = stream()->get_declared_method_holder(); | |
| 1517 ciInstanceKlass* callee_holder = ciEnv::get_instance_klass_for_declared_method_holder(holder); | |
| 1518 ciInstanceKlass* actual_recv = callee_holder; | |
| 1519 | |
| 1520 // some methods are obviously bindable without any type checks so | |
| 1521 // convert them directly to an invokespecial. | |
| 1522 if (target->is_loaded() && !target->is_abstract() && | |
| 1523 target->can_be_statically_bound() && code == Bytecodes::_invokevirtual) { | |
| 1524 code = Bytecodes::_invokespecial; | |
| 1525 } | |
| 1526 | |
|
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1527 if (code == Bytecodes::_invokedynamic) { |
|
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1528 BAILOUT("invokedynamic NYI"); // FIXME |
|
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1529 return; |
|
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1530 } |
|
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
1531 |
| 0 | 1532 // NEEDS_CLEANUP |
| 1533 // I've added the target-is_loaded() test below but I don't really understand | |
| 1534 // how klass->is_loaded() can be true and yet target->is_loaded() is false. | |
| 1535 // this happened while running the JCK invokevirtual tests under doit. TKR | |
| 1536 ciMethod* cha_monomorphic_target = NULL; | |
| 1537 ciMethod* exact_target = NULL; | |
| 1538 if (UseCHA && DeoptC1 && klass->is_loaded() && target->is_loaded()) { | |
| 1539 Value receiver = NULL; | |
| 1540 ciInstanceKlass* receiver_klass = NULL; | |
| 1541 bool type_is_exact = false; | |
| 1542 // try to find a precise receiver type | |
| 1543 if (will_link && !target->is_static()) { | |
| 1544 int index = state()->stack_size() - (target->arg_size_no_receiver() + 1); | |
| 1545 receiver = state()->stack_at(index); | |
| 1546 ciType* type = receiver->exact_type(); | |
| 1547 if (type != NULL && type->is_loaded() && | |
| 1548 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { | |
| 1549 receiver_klass = (ciInstanceKlass*) type; | |
| 1550 type_is_exact = true; | |
| 1551 } | |
| 1552 if (type == NULL) { | |
| 1553 type = receiver->declared_type(); | |
| 1554 if (type != NULL && type->is_loaded() && | |
| 1555 type->is_instance_klass() && !type->as_instance_klass()->is_interface()) { | |
| 1556 receiver_klass = (ciInstanceKlass*) type; | |
| 1557 if (receiver_klass->is_leaf_type() && !receiver_klass->is_final()) { | |
| 1558 // Insert a dependency on this type since | |
| 1559 // find_monomorphic_target may assume it's already done. | |
| 1560 dependency_recorder()->assert_leaf_type(receiver_klass); | |
| 1561 type_is_exact = true; | |
| 1562 } | |
| 1563 } | |
| 1564 } | |
| 1565 } | |
| 1566 if (receiver_klass != NULL && type_is_exact && | |
| 1567 receiver_klass->is_loaded() && code != Bytecodes::_invokespecial) { | |
| 1568 // If we have the exact receiver type we can bind directly to | |
| 1569 // the method to call. | |
| 1570 exact_target = target->resolve_invoke(calling_klass, receiver_klass); | |
| 1571 if (exact_target != NULL) { | |
| 1572 target = exact_target; | |
| 1573 code = Bytecodes::_invokespecial; | |
| 1574 } | |
| 1575 } | |
| 1576 if (receiver_klass != NULL && | |
| 1577 receiver_klass->is_subtype_of(actual_recv) && | |
| 1578 actual_recv->is_initialized()) { | |
| 1579 actual_recv = receiver_klass; | |
| 1580 } | |
| 1581 | |
| 1582 if ((code == Bytecodes::_invokevirtual && callee_holder->is_initialized()) || | |
| 1583 (code == Bytecodes::_invokeinterface && callee_holder->is_initialized() && !actual_recv->is_interface())) { | |
| 1584 // Use CHA on the receiver to select a more precise method. | |
| 1585 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, callee_holder, actual_recv); | |
| 1586 } else if (code == Bytecodes::_invokeinterface && callee_holder->is_loaded() && receiver != NULL) { | |
| 1587 // if there is only one implementor of this interface then we | |
| 1588 // may be able bind this invoke directly to the implementing | |
| 1589 // klass but we need both a dependence on the single interface | |
| 1590 // and on the method we bind to. Additionally since all we know | |
| 1591 // about the receiver type is the it's supposed to implement the | |
| 1592 // interface we have to insert a check that it's the class we | |
| 1593 // expect. Interface types are not checked by the verifier so | |
| 1594 // they are roughly equivalent to Object. | |
| 1595 ciInstanceKlass* singleton = NULL; | |
| 1596 if (target->holder()->nof_implementors() == 1) { | |
| 1597 singleton = target->holder()->implementor(0); | |
| 1598 } | |
| 1599 if (singleton) { | |
| 1600 cha_monomorphic_target = target->find_monomorphic_target(calling_klass, target->holder(), singleton); | |
| 1601 if (cha_monomorphic_target != NULL) { | |
| 1602 // If CHA is able to bind this invoke then update the class | |
| 1603 // to match that class, otherwise klass will refer to the | |
| 1604 // interface. | |
| 1605 klass = cha_monomorphic_target->holder(); | |
| 1606 actual_recv = target->holder(); | |
| 1607 | |
| 1608 // insert a check it's really the expected class. | |
| 1609 CheckCast* c = new CheckCast(klass, receiver, NULL); | |
| 1610 c->set_incompatible_class_change_check(); | |
| 1611 c->set_direct_compare(klass->is_final()); | |
| 1612 append_split(c); | |
| 1613 } | |
| 1614 } | |
| 1615 } | |
| 1616 } | |
| 1617 | |
| 1618 if (cha_monomorphic_target != NULL) { | |
| 1619 if (cha_monomorphic_target->is_abstract()) { | |
| 1620 // Do not optimize for abstract methods | |
| 1621 cha_monomorphic_target = NULL; | |
| 1622 } | |
| 1623 } | |
| 1624 | |
| 1625 if (cha_monomorphic_target != NULL) { | |
| 1626 if (!(target->is_final_method())) { | |
| 1627 // If we inlined because CHA revealed only a single target method, | |
| 1628 // then we are dependent on that target method not getting overridden | |
| 1629 // by dynamic class loading. Be sure to test the "static" receiver | |
| 1630 // dest_method here, as opposed to the actual receiver, which may | |
| 1631 // falsely lead us to believe that the receiver is final or private. | |
| 1632 dependency_recorder()->assert_unique_concrete_method(actual_recv, cha_monomorphic_target); | |
| 1633 } | |
| 1634 code = Bytecodes::_invokespecial; | |
| 1635 } | |
| 1636 // check if we could do inlining | |
| 1637 if (!PatchALot && Inline && klass->is_loaded() && | |
| 1638 (klass->is_initialized() || klass->is_interface() && target->holder()->is_initialized()) | |
| 1639 && target->will_link(klass, callee_holder, code)) { | |
| 1640 // callee is known => check if we have static binding | |
| 1641 assert(target->is_loaded(), "callee must be known"); | |
| 1642 if (code == Bytecodes::_invokestatic | |
| 1643 || code == Bytecodes::_invokespecial | |
| 1644 || code == Bytecodes::_invokevirtual && target->is_final_method() | |
| 1645 ) { | |
| 1646 // static binding => check if callee is ok | |
| 1647 ciMethod* inline_target = (cha_monomorphic_target != NULL) | |
| 1648 ? cha_monomorphic_target | |
| 1649 : target; | |
| 1650 bool res = try_inline(inline_target, (cha_monomorphic_target != NULL) || (exact_target != NULL)); | |
| 1651 CHECK_BAILOUT(); | |
| 1652 | |
| 1653 #ifndef PRODUCT | |
| 1654 // printing | |
| 1655 if (PrintInlining && !res) { | |
| 1656 // if it was successfully inlined, then it was already printed. | |
| 1657 print_inline_result(inline_target, res); | |
| 1658 } | |
| 1659 #endif | |
| 1660 clear_inline_bailout(); | |
| 1661 if (res) { | |
| 1662 // Register dependence if JVMTI has either breakpoint | |
| 1663 // setting or hotswapping of methods capabilities since they may | |
| 1664 // cause deoptimization. | |
|
780
c96bf21b756f
6788527: Server vm intermittently fails with assertion "live value must not be garbage" with fastdebug bits
kvn
parents:
726
diff
changeset
|
1665 if (compilation()->env()->jvmti_can_hotswap_or_post_breakpoint()) { |
| 0 | 1666 dependency_recorder()->assert_evol_method(inline_target); |
| 1667 } | |
| 1668 return; | |
| 1669 } | |
| 1670 } | |
| 1671 } | |
| 1672 // If we attempted an inline which did not succeed because of a | |
| 1673 // bailout during construction of the callee graph, the entire | |
| 1674 // compilation has to be aborted. This is fairly rare and currently | |
| 1675 // seems to only occur for jasm-generated classes which contain | |
| 1676 // jsr/ret pairs which are not associated with finally clauses and | |
| 1677 // do not have exception handlers in the containing method, and are | |
| 1678 // therefore not caught early enough to abort the inlining without | |
| 1679 // corrupting the graph. (We currently bail out with a non-empty | |
| 1680 // stack at a ret in these situations.) | |
| 1681 CHECK_BAILOUT(); | |
| 1682 | |
| 1683 // inlining not successful => standard invoke | |
| 1684 bool is_static = code == Bytecodes::_invokestatic; | |
| 1685 ValueType* result_type = as_ValueType(target->return_type()); | |
| 1686 Values* args = state()->pop_arguments(target->arg_size_no_receiver()); | |
| 1687 Value recv = is_static ? NULL : apop(); | |
| 1688 bool is_loaded = target->is_loaded(); | |
| 1689 int vtable_index = methodOopDesc::invalid_vtable_index; | |
| 1690 | |
| 1691 #ifdef SPARC | |
| 1692 // Currently only supported on Sparc. | |
| 1693 // The UseInlineCaches only controls dispatch to invokevirtuals for | |
| 1694 // loaded classes which we weren't able to statically bind. | |
| 1695 if (!UseInlineCaches && is_loaded && code == Bytecodes::_invokevirtual | |
| 1696 && !target->can_be_statically_bound()) { | |
| 1697 // Find a vtable index if one is available | |
| 1698 vtable_index = target->resolve_vtable_index(calling_klass, callee_holder); | |
| 1699 } | |
| 1700 #endif | |
| 1701 | |
| 1702 if (recv != NULL && | |
| 1703 (code == Bytecodes::_invokespecial || | |
| 1704 !is_loaded || target->is_final() || | |
| 1705 profile_calls())) { | |
| 1706 // invokespecial always needs a NULL check. invokevirtual where | |
| 1707 // the target is final or where it's not known that whether the | |
| 1708 // target is final requires a NULL check. Otherwise normal | |
| 1709 // invokevirtual will perform the null check during the lookup | |
| 1710 // logic or the unverified entry point. Profiling of calls | |
| 1711 // requires that the null check is performed in all cases. | |
| 1712 null_check(recv); | |
| 1713 } | |
| 1714 | |
| 1715 if (profile_calls()) { | |
| 1716 assert(cha_monomorphic_target == NULL || exact_target == NULL, "both can not be set"); | |
| 1717 ciKlass* target_klass = NULL; | |
| 1718 if (cha_monomorphic_target != NULL) { | |
| 1719 target_klass = cha_monomorphic_target->holder(); | |
| 1720 } else if (exact_target != NULL) { | |
| 1721 target_klass = exact_target->holder(); | |
| 1722 } | |
| 1723 profile_call(recv, target_klass); | |
| 1724 } | |
| 1725 | |
| 1726 Invoke* result = new Invoke(code, result_type, recv, args, vtable_index, target); | |
| 1727 // push result | |
| 1728 append_split(result); | |
| 1729 | |
| 1730 if (result_type != voidType) { | |
| 1731 if (method()->is_strict()) { | |
| 1732 push(result_type, round_fp(result)); | |
| 1733 } else { | |
| 1734 push(result_type, result); | |
| 1735 } | |
| 1736 } | |
| 1737 } | |
| 1738 | |
| 1739 | |
| 1740 void GraphBuilder::new_instance(int klass_index) { | |
| 1741 bool will_link; | |
| 1742 ciKlass* klass = stream()->get_klass(will_link); | |
| 1743 assert(klass->is_instance_klass(), "must be an instance klass"); | |
| 1744 NewInstance* new_instance = new NewInstance(klass->as_instance_klass()); | |
| 1745 _memory->new_instance(new_instance); | |
| 1746 apush(append_split(new_instance)); | |
| 1747 } | |
| 1748 | |
| 1749 | |
| 1750 void GraphBuilder::new_type_array() { | |
| 1751 apush(append_split(new NewTypeArray(ipop(), (BasicType)stream()->get_index()))); | |
| 1752 } | |
| 1753 | |
| 1754 | |
| 1755 void GraphBuilder::new_object_array() { | |
| 1756 bool will_link; | |
| 1757 ciKlass* klass = stream()->get_klass(will_link); | |
| 1758 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
| 1759 NewArray* n = new NewObjectArray(klass, ipop(), state_before); | |
| 1760 apush(append_split(n)); | |
| 1761 } | |
| 1762 | |
| 1763 | |
| 1764 bool GraphBuilder::direct_compare(ciKlass* k) { | |
| 1765 if (k->is_loaded() && k->is_instance_klass() && !UseSlowPath) { | |
| 1766 ciInstanceKlass* ik = k->as_instance_klass(); | |
| 1767 if (ik->is_final()) { | |
| 1768 return true; | |
| 1769 } else { | |
| 1770 if (DeoptC1 && UseCHA && !(ik->has_subklass() || ik->is_interface())) { | |
| 1771 // test class is leaf class | |
| 1772 dependency_recorder()->assert_leaf_type(ik); | |
| 1773 return true; | |
| 1774 } | |
| 1775 } | |
| 1776 } | |
| 1777 return false; | |
| 1778 } | |
| 1779 | |
| 1780 | |
| 1781 void GraphBuilder::check_cast(int klass_index) { | |
| 1782 bool will_link; | |
| 1783 ciKlass* klass = stream()->get_klass(will_link); | |
| 1784 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
| 1785 CheckCast* c = new CheckCast(klass, apop(), state_before); | |
| 1786 apush(append_split(c)); | |
| 1787 c->set_direct_compare(direct_compare(klass)); | |
| 1788 if (profile_checkcasts()) { | |
| 1789 c->set_profiled_method(method()); | |
| 1790 c->set_profiled_bci(bci()); | |
| 1791 c->set_should_profile(true); | |
| 1792 } | |
| 1793 } | |
| 1794 | |
| 1795 | |
| 1796 void GraphBuilder::instance_of(int klass_index) { | |
| 1797 bool will_link; | |
| 1798 ciKlass* klass = stream()->get_klass(will_link); | |
| 1799 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
| 1800 InstanceOf* i = new InstanceOf(klass, apop(), state_before); | |
| 1801 ipush(append_split(i)); | |
| 1802 i->set_direct_compare(direct_compare(klass)); | |
| 1803 } | |
| 1804 | |
| 1805 | |
| 1806 void GraphBuilder::monitorenter(Value x, int bci) { | |
| 1807 // save state before locking in case of deoptimization after a NullPointerException | |
| 1808 ValueStack* lock_stack_before = lock_stack(); | |
| 1809 append_with_bci(new MonitorEnter(x, state()->lock(scope(), x), lock_stack_before), bci); | |
| 1810 kill_all(); | |
| 1811 } | |
| 1812 | |
| 1813 | |
| 1814 void GraphBuilder::monitorexit(Value x, int bci) { | |
| 1815 // Note: the comment below is only relevant for the case where we do | |
| 1816 // not deoptimize due to asynchronous exceptions (!(DeoptC1 && | |
| 1817 // DeoptOnAsyncException), which is not used anymore) | |
| 1818 | |
| 1819 // Note: Potentially, the monitor state in an exception handler | |
| 1820 // can be wrong due to wrong 'initialization' of the handler | |
| 1821 // via a wrong asynchronous exception path. This can happen, | |
| 1822 // if the exception handler range for asynchronous exceptions | |
| 1823 // is too long (see also java bug 4327029, and comment in | |
| 1824 // GraphBuilder::handle_exception()). This may cause 'under- | |
| 1825 // flow' of the monitor stack => bailout instead. | |
| 1826 if (state()->locks_size() < 1) BAILOUT("monitor stack underflow"); | |
| 1827 append_with_bci(new MonitorExit(x, state()->unlock()), bci); | |
| 1828 kill_all(); | |
| 1829 } | |
| 1830 | |
| 1831 | |
| 1832 void GraphBuilder::new_multi_array(int dimensions) { | |
| 1833 bool will_link; | |
| 1834 ciKlass* klass = stream()->get_klass(will_link); | |
| 1835 ValueStack* state_before = !klass->is_loaded() || PatchALot ? state()->copy() : NULL; | |
| 1836 | |
| 1837 Values* dims = new Values(dimensions, NULL); | |
| 1838 // fill in all dimensions | |
| 1839 int i = dimensions; | |
| 1840 while (i-- > 0) dims->at_put(i, ipop()); | |
| 1841 // create array | |
| 1842 NewArray* n = new NewMultiArray(klass, dims, state_before); | |
| 1843 apush(append_split(n)); | |
| 1844 } | |
| 1845 | |
| 1846 | |
| 1847 void GraphBuilder::throw_op(int bci) { | |
| 1848 // We require that the debug info for a Throw be the "state before" | |
| 1849 // the Throw (i.e., exception oop is still on TOS) | |
| 1850 ValueStack* state_before = state()->copy(); | |
| 1851 Throw* t = new Throw(apop(), state_before); | |
| 1852 append_with_bci(t, bci); | |
| 1853 } | |
| 1854 | |
| 1855 | |
| 1856 Value GraphBuilder::round_fp(Value fp_value) { | |
| 1857 // no rounding needed if SSE2 is used | |
| 1858 if (RoundFPResults && UseSSE < 2) { | |
| 1859 // Must currently insert rounding node for doubleword values that | |
| 1860 // are results of expressions (i.e., not loads from memory or | |
| 1861 // constants) | |
| 1862 if (fp_value->type()->tag() == doubleTag && | |
| 1863 fp_value->as_Constant() == NULL && | |
| 1864 fp_value->as_Local() == NULL && // method parameters need no rounding | |
| 1865 fp_value->as_RoundFP() == NULL) { | |
| 1866 return append(new RoundFP(fp_value)); | |
| 1867 } | |
| 1868 } | |
| 1869 return fp_value; | |
| 1870 } | |
| 1871 | |
| 1872 | |
| 1873 Instruction* GraphBuilder::append_with_bci(Instruction* instr, int bci) { | |
| 1874 Canonicalizer canon(instr, bci); | |
| 1875 Instruction* i1 = canon.canonical(); | |
| 1876 if (i1->bci() != -99) { | |
| 1877 // Canonicalizer returned an instruction which was already | |
| 1878 // appended so simply return it. | |
| 1879 return i1; | |
| 1880 } else if (UseLocalValueNumbering) { | |
| 1881 // Lookup the instruction in the ValueMap and add it to the map if | |
| 1882 // it's not found. | |
| 1883 Instruction* i2 = vmap()->find_insert(i1); | |
| 1884 if (i2 != i1) { | |
| 1885 // found an entry in the value map, so just return it. | |
| 1886 assert(i2->bci() != -1, "should already be linked"); | |
| 1887 return i2; | |
| 1888 } | |
| 459 | 1889 ValueNumberingEffects vne(vmap()); |
| 1890 i1->visit(&vne); | |
| 0 | 1891 } |
| 1892 | |
| 1893 if (i1->as_Phi() == NULL && i1->as_Local() == NULL) { | |
| 1894 // i1 was not eliminated => append it | |
| 1895 assert(i1->next() == NULL, "shouldn't already be linked"); | |
| 1896 _last = _last->set_next(i1, canon.bci()); | |
| 1897 if (++_instruction_count >= InstructionCountCutoff | |
| 1898 && !bailed_out()) { | |
| 1899 // set the bailout state but complete normal processing. We | |
| 1900 // might do a little more work before noticing the bailout so we | |
| 1901 // want processing to continue normally until it's noticed. | |
| 1902 bailout("Method and/or inlining is too large"); | |
| 1903 } | |
| 1904 | |
| 1905 #ifndef PRODUCT | |
| 1906 if (PrintIRDuringConstruction) { | |
| 1907 InstructionPrinter ip; | |
| 1908 ip.print_line(i1); | |
| 1909 if (Verbose) { | |
| 1910 state()->print(); | |
| 1911 } | |
| 1912 } | |
| 1913 #endif | |
| 1914 assert(_last == i1, "adjust code below"); | |
| 1915 StateSplit* s = i1->as_StateSplit(); | |
| 1916 if (s != NULL && i1->as_BlockEnd() == NULL) { | |
| 1917 if (EliminateFieldAccess) { | |
| 459 | 1918 Intrinsic* intrinsic = s->as_Intrinsic(); |
| 0 | 1919 if (s->as_Invoke() != NULL || (intrinsic && !intrinsic->preserves_state())) { |
| 1920 _memory->kill(); | |
| 1921 } | |
| 1922 } | |
| 1923 s->set_state(state()->copy()); | |
| 1924 } | |
| 1925 // set up exception handlers for this instruction if necessary | |
| 1926 if (i1->can_trap()) { | |
| 1927 assert(exception_state() != NULL || !has_handler(), "must have setup exception state"); | |
| 1928 i1->set_exception_handlers(handle_exception(bci)); | |
| 1929 } | |
| 1930 } | |
| 1931 return i1; | |
| 1932 } | |
| 1933 | |
| 1934 | |
| 1935 Instruction* GraphBuilder::append(Instruction* instr) { | |
| 1936 assert(instr->as_StateSplit() == NULL || instr->as_BlockEnd() != NULL, "wrong append used"); | |
| 1937 return append_with_bci(instr, bci()); | |
| 1938 } | |
| 1939 | |
| 1940 | |
| 1941 Instruction* GraphBuilder::append_split(StateSplit* instr) { | |
| 1942 return append_with_bci(instr, bci()); | |
| 1943 } | |
| 1944 | |
| 1945 | |
| 1946 void GraphBuilder::null_check(Value value) { | |
| 1947 if (value->as_NewArray() != NULL || value->as_NewInstance() != NULL) { | |
| 1948 return; | |
| 1949 } else { | |
| 1950 Constant* con = value->as_Constant(); | |
| 1951 if (con) { | |
| 1952 ObjectType* c = con->type()->as_ObjectType(); | |
| 1953 if (c && c->is_loaded()) { | |
| 1954 ObjectConstant* oc = c->as_ObjectConstant(); | |
| 1955 if (!oc || !oc->value()->is_null_object()) { | |
| 1956 return; | |
| 1957 } | |
| 1958 } | |
| 1959 } | |
| 1960 } | |
| 1961 append(new NullCheck(value, lock_stack())); | |
| 1962 } | |
| 1963 | |
| 1964 | |
| 1965 | |
| 1966 XHandlers* GraphBuilder::handle_exception(int cur_bci) { | |
| 1967 // fast path if it is guaranteed that no exception handlers are present | |
| 1968 if (!has_handler()) { | |
| 1969 // TODO: check if return NULL is possible (avoids empty lists) | |
| 1970 return new XHandlers(); | |
| 1971 } | |
| 1972 | |
| 1973 XHandlers* exception_handlers = new XHandlers(); | |
| 1974 ScopeData* cur_scope_data = scope_data(); | |
| 1975 ValueStack* s = exception_state(); | |
| 1976 int scope_count = 0; | |
| 1977 | |
| 1978 assert(s != NULL, "exception state must be set"); | |
| 1979 do { | |
| 1980 assert(cur_scope_data->scope() == s->scope(), "scopes do not match"); | |
| 1981 assert(cur_bci == SynchronizationEntryBCI || cur_bci == cur_scope_data->stream()->cur_bci(), "invalid bci"); | |
| 1982 | |
| 1983 // join with all potential exception handlers | |
| 1984 XHandlers* list = cur_scope_data->xhandlers(); | |
| 1985 const int n = list->length(); | |
| 1986 for (int i = 0; i < n; i++) { | |
| 1987 XHandler* h = list->handler_at(i); | |
| 1988 if (h->covers(cur_bci)) { | |
| 1989 // h is a potential exception handler => join it | |
| 1990 compilation()->set_has_exception_handlers(true); | |
| 1991 | |
| 1992 BlockBegin* entry = h->entry_block(); | |
| 1993 if (entry == block()) { | |
| 1994 // It's acceptable for an exception handler to cover itself | |
| 1995 // but we don't handle that in the parser currently. It's | |
| 1996 // very rare so we bailout instead of trying to handle it. | |
| 1997 BAILOUT_("exception handler covers itself", exception_handlers); | |
| 1998 } | |
| 1999 assert(entry->bci() == h->handler_bci(), "must match"); | |
| 2000 assert(entry->bci() == -1 || entry == cur_scope_data->block_at(entry->bci()), "blocks must correspond"); | |
| 2001 | |
| 2002 // previously this was a BAILOUT, but this is not necessary | |
| 2003 // now because asynchronous exceptions are not handled this way. | |
| 2004 assert(entry->state() == NULL || s->locks_size() == entry->state()->locks_size(), "locks do not match"); | |
| 2005 | |
| 2006 // xhandler start with an empty expression stack | |
| 2007 s->truncate_stack(cur_scope_data->caller_stack_size()); | |
| 2008 | |
| 2009 // Note: Usually this join must work. However, very | |
| 2010 // complicated jsr-ret structures where we don't ret from | |
| 2011 // the subroutine can cause the objects on the monitor | |
| 2012 // stacks to not match because blocks can be parsed twice. | |
| 2013 // The only test case we've seen so far which exhibits this | |
| 2014 // problem is caught by the infinite recursion test in | |
| 2015 // GraphBuilder::jsr() if the join doesn't work. | |
| 2016 if (!entry->try_merge(s)) { | |
| 2017 BAILOUT_("error while joining with exception handler, prob. due to complicated jsr/rets", exception_handlers); | |
| 2018 } | |
| 2019 | |
| 2020 // add current state for correct handling of phi functions at begin of xhandler | |
| 2021 int phi_operand = entry->add_exception_state(s); | |
| 2022 | |
| 2023 // add entry to the list of xhandlers of this block | |
| 2024 _block->add_exception_handler(entry); | |
| 2025 | |
| 2026 // add back-edge from xhandler entry to this block | |
| 2027 if (!entry->is_predecessor(_block)) { | |
| 2028 entry->add_predecessor(_block); | |
| 2029 } | |
| 2030 | |
| 2031 // clone XHandler because phi_operand and scope_count can not be shared | |
| 2032 XHandler* new_xhandler = new XHandler(h); | |
| 2033 new_xhandler->set_phi_operand(phi_operand); | |
| 2034 new_xhandler->set_scope_count(scope_count); | |
| 2035 exception_handlers->append(new_xhandler); | |
| 2036 | |
| 2037 // fill in exception handler subgraph lazily | |
| 2038 assert(!entry->is_set(BlockBegin::was_visited_flag), "entry must not be visited yet"); | |
| 2039 cur_scope_data->add_to_work_list(entry); | |
| 2040 | |
| 2041 // stop when reaching catchall | |
| 2042 if (h->catch_type() == 0) { | |
| 2043 return exception_handlers; | |
| 2044 } | |
| 2045 } | |
| 2046 } | |
| 2047 | |
| 2048 // Set up iteration for next time. | |
| 2049 // If parsing a jsr, do not grab exception handlers from the | |
| 2050 // parent scopes for this method (already got them, and they | |
| 2051 // needed to be cloned) | |
| 2052 if (cur_scope_data->parsing_jsr()) { | |
| 2053 IRScope* tmp_scope = cur_scope_data->scope(); | |
| 2054 while (cur_scope_data->parent() != NULL && | |
| 2055 cur_scope_data->parent()->scope() == tmp_scope) { | |
| 2056 cur_scope_data = cur_scope_data->parent(); | |
| 2057 } | |
| 2058 } | |
| 2059 if (cur_scope_data != NULL) { | |
| 2060 if (cur_scope_data->parent() != NULL) { | |
| 2061 // must use pop_scope instead of caller_state to preserve all monitors | |
| 2062 s = s->pop_scope(); | |
| 2063 } | |
| 2064 cur_bci = cur_scope_data->scope()->caller_bci(); | |
| 2065 cur_scope_data = cur_scope_data->parent(); | |
| 2066 scope_count++; | |
| 2067 } | |
| 2068 } while (cur_scope_data != NULL); | |
| 2069 | |
| 2070 return exception_handlers; | |
| 2071 } | |
| 2072 | |
| 2073 | |
| 2074 // Helper class for simplifying Phis. | |
| 2075 class PhiSimplifier : public BlockClosure { | |
| 2076 private: | |
| 2077 bool _has_substitutions; | |
| 2078 Value simplify(Value v); | |
| 2079 | |
| 2080 public: | |
| 2081 PhiSimplifier(BlockBegin* start) : _has_substitutions(false) { | |
| 2082 start->iterate_preorder(this); | |
| 2083 if (_has_substitutions) { | |
| 2084 SubstitutionResolver sr(start); | |
| 2085 } | |
| 2086 } | |
| 2087 void block_do(BlockBegin* b); | |
| 2088 bool has_substitutions() const { return _has_substitutions; } | |
| 2089 }; | |
| 2090 | |
| 2091 | |
| 2092 Value PhiSimplifier::simplify(Value v) { | |
| 2093 Phi* phi = v->as_Phi(); | |
| 2094 | |
| 2095 if (phi == NULL) { | |
| 2096 // no phi function | |
| 2097 return v; | |
| 2098 } else if (v->has_subst()) { | |
| 2099 // already substituted; subst can be phi itself -> simplify | |
| 2100 return simplify(v->subst()); | |
| 2101 } else if (phi->is_set(Phi::cannot_simplify)) { | |
| 2102 // already tried to simplify phi before | |
| 2103 return phi; | |
| 2104 } else if (phi->is_set(Phi::visited)) { | |
| 2105 // break cycles in phi functions | |
| 2106 return phi; | |
| 2107 } else if (phi->type()->is_illegal()) { | |
| 2108 // illegal phi functions are ignored anyway | |
| 2109 return phi; | |
| 2110 | |
| 2111 } else { | |
| 2112 // mark phi function as processed to break cycles in phi functions | |
| 2113 phi->set(Phi::visited); | |
| 2114 | |
| 2115 // simplify x = [y, x] and x = [y, y] to y | |
| 2116 Value subst = NULL; | |
| 2117 int opd_count = phi->operand_count(); | |
| 2118 for (int i = 0; i < opd_count; i++) { | |
| 2119 Value opd = phi->operand_at(i); | |
| 2120 assert(opd != NULL, "Operand must exist!"); | |
| 2121 | |
| 2122 if (opd->type()->is_illegal()) { | |
| 2123 // if one operand is illegal, the entire phi function is illegal | |
| 2124 phi->make_illegal(); | |
| 2125 phi->clear(Phi::visited); | |
| 2126 return phi; | |
| 2127 } | |
| 2128 | |
| 2129 Value new_opd = simplify(opd); | |
| 2130 assert(new_opd != NULL, "Simplified operand must exist!"); | |
| 2131 | |
| 2132 if (new_opd != phi && new_opd != subst) { | |
| 2133 if (subst == NULL) { | |
| 2134 subst = new_opd; | |
| 2135 } else { | |
| 2136 // no simplification possible | |
| 2137 phi->set(Phi::cannot_simplify); | |
| 2138 phi->clear(Phi::visited); | |
| 2139 return phi; | |
| 2140 } | |
| 2141 } | |
| 2142 } | |
| 2143 | |
| 2144 // sucessfully simplified phi function | |
| 2145 assert(subst != NULL, "illegal phi function"); | |
| 2146 _has_substitutions = true; | |
| 2147 phi->clear(Phi::visited); | |
| 2148 phi->set_subst(subst); | |
| 2149 | |
| 2150 #ifndef PRODUCT | |
| 2151 if (PrintPhiFunctions) { | |
| 2152 tty->print_cr("simplified phi function %c%d to %c%d (Block B%d)", phi->type()->tchar(), phi->id(), subst->type()->tchar(), subst->id(), phi->block()->block_id()); | |
| 2153 } | |
| 2154 #endif | |
| 2155 | |
| 2156 return subst; | |
| 2157 } | |
| 2158 } | |
| 2159 | |
| 2160 | |
| 2161 void PhiSimplifier::block_do(BlockBegin* b) { | |
| 2162 for_each_phi_fun(b, phi, | |
| 2163 simplify(phi); | |
| 2164 ); | |
| 2165 | |
| 2166 #ifdef ASSERT | |
| 2167 for_each_phi_fun(b, phi, | |
| 2168 assert(phi->operand_count() != 1 || phi->subst() != phi, "missed trivial simplification"); | |
| 2169 ); | |
| 2170 | |
| 2171 ValueStack* state = b->state()->caller_state(); | |
| 2172 int index; | |
| 2173 Value value; | |
| 2174 for_each_state(state) { | |
| 2175 for_each_local_value(state, index, value) { | |
| 2176 Phi* phi = value->as_Phi(); | |
| 2177 assert(phi == NULL || phi->block() != b, "must not have phi function to simplify in caller state"); | |
| 2178 } | |
| 2179 } | |
| 2180 #endif | |
| 2181 } | |
| 2182 | |
| 2183 // This method is called after all blocks are filled with HIR instructions | |
| 2184 // It eliminates all Phi functions of the form x = [y, y] and x = [y, x] | |
| 2185 void GraphBuilder::eliminate_redundant_phis(BlockBegin* start) { | |
| 2186 PhiSimplifier simplifier(start); | |
| 2187 } | |
| 2188 | |
| 2189 | |
| 2190 void GraphBuilder::connect_to_end(BlockBegin* beg) { | |
| 2191 // setup iteration | |
| 2192 kill_all(); | |
| 2193 _block = beg; | |
| 2194 _state = beg->state()->copy(); | |
| 2195 _last = beg; | |
| 2196 iterate_bytecodes_for_block(beg->bci()); | |
| 2197 } | |
| 2198 | |
| 2199 | |
| 2200 BlockEnd* GraphBuilder::iterate_bytecodes_for_block(int bci) { | |
| 2201 #ifndef PRODUCT | |
| 2202 if (PrintIRDuringConstruction) { | |
| 2203 tty->cr(); | |
| 2204 InstructionPrinter ip; | |
| 2205 ip.print_instr(_block); tty->cr(); | |
| 2206 ip.print_stack(_block->state()); tty->cr(); | |
| 2207 ip.print_inline_level(_block); | |
| 2208 ip.print_head(); | |
| 2209 tty->print_cr("locals size: %d stack size: %d", state()->locals_size(), state()->stack_size()); | |
| 2210 } | |
| 2211 #endif | |
| 2212 _skip_block = false; | |
| 2213 assert(state() != NULL, "ValueStack missing!"); | |
| 2214 ciBytecodeStream s(method()); | |
| 2215 s.reset_to_bci(bci); | |
| 2216 int prev_bci = bci; | |
| 2217 scope_data()->set_stream(&s); | |
| 2218 // iterate | |
| 2219 Bytecodes::Code code = Bytecodes::_illegal; | |
| 2220 bool push_exception = false; | |
| 2221 | |
| 2222 if (block()->is_set(BlockBegin::exception_entry_flag) && block()->next() == NULL) { | |
| 2223 // first thing in the exception entry block should be the exception object. | |
| 2224 push_exception = true; | |
| 2225 } | |
| 2226 | |
| 2227 while (!bailed_out() && last()->as_BlockEnd() == NULL && | |
| 2228 (code = stream()->next()) != ciBytecodeStream::EOBC() && | |
| 2229 (block_at(s.cur_bci()) == NULL || block_at(s.cur_bci()) == block())) { | |
| 2230 | |
| 2231 if (has_handler() && can_trap(method(), code)) { | |
| 2232 // copy the state because it is modified before handle_exception is called | |
| 2233 set_exception_state(state()->copy()); | |
| 2234 } else { | |
| 2235 // handle_exception is not called for this bytecode | |
| 2236 set_exception_state(NULL); | |
| 2237 } | |
| 2238 | |
| 2239 // Check for active jsr during OSR compilation | |
| 2240 if (compilation()->is_osr_compile() | |
| 2241 && scope()->is_top_scope() | |
| 2242 && parsing_jsr() | |
| 2243 && s.cur_bci() == compilation()->osr_bci()) { | |
| 2244 bailout("OSR not supported while a jsr is active"); | |
| 2245 } | |
| 2246 | |
| 2247 if (push_exception) { | |
| 2248 apush(append(new ExceptionObject())); | |
| 2249 push_exception = false; | |
| 2250 } | |
| 2251 | |
| 2252 // handle bytecode | |
| 2253 switch (code) { | |
| 2254 case Bytecodes::_nop : /* nothing to do */ break; | |
| 2255 case Bytecodes::_aconst_null : apush(append(new Constant(objectNull ))); break; | |
| 2256 case Bytecodes::_iconst_m1 : ipush(append(new Constant(new IntConstant (-1)))); break; | |
| 2257 case Bytecodes::_iconst_0 : ipush(append(new Constant(intZero ))); break; | |
| 2258 case Bytecodes::_iconst_1 : ipush(append(new Constant(intOne ))); break; | |
| 2259 case Bytecodes::_iconst_2 : ipush(append(new Constant(new IntConstant ( 2)))); break; | |
| 2260 case Bytecodes::_iconst_3 : ipush(append(new Constant(new IntConstant ( 3)))); break; | |
| 2261 case Bytecodes::_iconst_4 : ipush(append(new Constant(new IntConstant ( 4)))); break; | |
| 2262 case Bytecodes::_iconst_5 : ipush(append(new Constant(new IntConstant ( 5)))); break; | |
| 2263 case Bytecodes::_lconst_0 : lpush(append(new Constant(new LongConstant ( 0)))); break; | |
| 2264 case Bytecodes::_lconst_1 : lpush(append(new Constant(new LongConstant ( 1)))); break; | |
| 2265 case Bytecodes::_fconst_0 : fpush(append(new Constant(new FloatConstant ( 0)))); break; | |
| 2266 case Bytecodes::_fconst_1 : fpush(append(new Constant(new FloatConstant ( 1)))); break; | |
| 2267 case Bytecodes::_fconst_2 : fpush(append(new Constant(new FloatConstant ( 2)))); break; | |
| 2268 case Bytecodes::_dconst_0 : dpush(append(new Constant(new DoubleConstant( 0)))); break; | |
| 2269 case Bytecodes::_dconst_1 : dpush(append(new Constant(new DoubleConstant( 1)))); break; | |
| 2270 case Bytecodes::_bipush : ipush(append(new Constant(new IntConstant(((signed char*)s.cur_bcp())[1])))); break; | |
| 2271 case Bytecodes::_sipush : ipush(append(new Constant(new IntConstant((short)Bytes::get_Java_u2(s.cur_bcp()+1))))); break; | |
| 2272 case Bytecodes::_ldc : // fall through | |
| 2273 case Bytecodes::_ldc_w : // fall through | |
| 2274 case Bytecodes::_ldc2_w : load_constant(); break; | |
| 2275 case Bytecodes::_iload : load_local(intType , s.get_index()); break; | |
| 2276 case Bytecodes::_lload : load_local(longType , s.get_index()); break; | |
| 2277 case Bytecodes::_fload : load_local(floatType , s.get_index()); break; | |
| 2278 case Bytecodes::_dload : load_local(doubleType , s.get_index()); break; | |
| 2279 case Bytecodes::_aload : load_local(instanceType, s.get_index()); break; | |
| 2280 case Bytecodes::_iload_0 : load_local(intType , 0); break; | |
| 2281 case Bytecodes::_iload_1 : load_local(intType , 1); break; | |
| 2282 case Bytecodes::_iload_2 : load_local(intType , 2); break; | |
| 2283 case Bytecodes::_iload_3 : load_local(intType , 3); break; | |
| 2284 case Bytecodes::_lload_0 : load_local(longType , 0); break; | |
| 2285 case Bytecodes::_lload_1 : load_local(longType , 1); break; | |
| 2286 case Bytecodes::_lload_2 : load_local(longType , 2); break; | |
| 2287 case Bytecodes::_lload_3 : load_local(longType , 3); break; | |
| 2288 case Bytecodes::_fload_0 : load_local(floatType , 0); break; | |
| 2289 case Bytecodes::_fload_1 : load_local(floatType , 1); break; | |
| 2290 case Bytecodes::_fload_2 : load_local(floatType , 2); break; | |
| 2291 case Bytecodes::_fload_3 : load_local(floatType , 3); break; | |
| 2292 case Bytecodes::_dload_0 : load_local(doubleType, 0); break; | |
| 2293 case Bytecodes::_dload_1 : load_local(doubleType, 1); break; | |
| 2294 case Bytecodes::_dload_2 : load_local(doubleType, 2); break; | |
| 2295 case Bytecodes::_dload_3 : load_local(doubleType, 3); break; | |
| 2296 case Bytecodes::_aload_0 : load_local(objectType, 0); break; | |
| 2297 case Bytecodes::_aload_1 : load_local(objectType, 1); break; | |
| 2298 case Bytecodes::_aload_2 : load_local(objectType, 2); break; | |
| 2299 case Bytecodes::_aload_3 : load_local(objectType, 3); break; | |
| 2300 case Bytecodes::_iaload : load_indexed(T_INT ); break; | |
| 2301 case Bytecodes::_laload : load_indexed(T_LONG ); break; | |
| 2302 case Bytecodes::_faload : load_indexed(T_FLOAT ); break; | |
| 2303 case Bytecodes::_daload : load_indexed(T_DOUBLE); break; | |
| 2304 case Bytecodes::_aaload : load_indexed(T_OBJECT); break; | |
| 2305 case Bytecodes::_baload : load_indexed(T_BYTE ); break; | |
| 2306 case Bytecodes::_caload : load_indexed(T_CHAR ); break; | |
| 2307 case Bytecodes::_saload : load_indexed(T_SHORT ); break; | |
| 2308 case Bytecodes::_istore : store_local(intType , s.get_index()); break; | |
| 2309 case Bytecodes::_lstore : store_local(longType , s.get_index()); break; | |
| 2310 case Bytecodes::_fstore : store_local(floatType , s.get_index()); break; | |
| 2311 case Bytecodes::_dstore : store_local(doubleType, s.get_index()); break; | |
| 2312 case Bytecodes::_astore : store_local(objectType, s.get_index()); break; | |
| 2313 case Bytecodes::_istore_0 : store_local(intType , 0); break; | |
| 2314 case Bytecodes::_istore_1 : store_local(intType , 1); break; | |
| 2315 case Bytecodes::_istore_2 : store_local(intType , 2); break; | |
| 2316 case Bytecodes::_istore_3 : store_local(intType , 3); break; | |
| 2317 case Bytecodes::_lstore_0 : store_local(longType , 0); break; | |
| 2318 case Bytecodes::_lstore_1 : store_local(longType , 1); break; | |
| 2319 case Bytecodes::_lstore_2 : store_local(longType , 2); break; | |
| 2320 case Bytecodes::_lstore_3 : store_local(longType , 3); break; | |
| 2321 case Bytecodes::_fstore_0 : store_local(floatType , 0); break; | |
| 2322 case Bytecodes::_fstore_1 : store_local(floatType , 1); break; | |
| 2323 case Bytecodes::_fstore_2 : store_local(floatType , 2); break; | |
| 2324 case Bytecodes::_fstore_3 : store_local(floatType , 3); break; | |
| 2325 case Bytecodes::_dstore_0 : store_local(doubleType, 0); break; | |
| 2326 case Bytecodes::_dstore_1 : store_local(doubleType, 1); break; | |
| 2327 case Bytecodes::_dstore_2 : store_local(doubleType, 2); break; | |
| 2328 case Bytecodes::_dstore_3 : store_local(doubleType, 3); break; | |
| 2329 case Bytecodes::_astore_0 : store_local(objectType, 0); break; | |
| 2330 case Bytecodes::_astore_1 : store_local(objectType, 1); break; | |
| 2331 case Bytecodes::_astore_2 : store_local(objectType, 2); break; | |
| 2332 case Bytecodes::_astore_3 : store_local(objectType, 3); break; | |
| 2333 case Bytecodes::_iastore : store_indexed(T_INT ); break; | |
| 2334 case Bytecodes::_lastore : store_indexed(T_LONG ); break; | |
| 2335 case Bytecodes::_fastore : store_indexed(T_FLOAT ); break; | |
| 2336 case Bytecodes::_dastore : store_indexed(T_DOUBLE); break; | |
| 2337 case Bytecodes::_aastore : store_indexed(T_OBJECT); break; | |
| 2338 case Bytecodes::_bastore : store_indexed(T_BYTE ); break; | |
| 2339 case Bytecodes::_castore : store_indexed(T_CHAR ); break; | |
| 2340 case Bytecodes::_sastore : store_indexed(T_SHORT ); break; | |
| 2341 case Bytecodes::_pop : // fall through | |
| 2342 case Bytecodes::_pop2 : // fall through | |
| 2343 case Bytecodes::_dup : // fall through | |
| 2344 case Bytecodes::_dup_x1 : // fall through | |
| 2345 case Bytecodes::_dup_x2 : // fall through | |
| 2346 case Bytecodes::_dup2 : // fall through | |
| 2347 case Bytecodes::_dup2_x1 : // fall through | |
| 2348 case Bytecodes::_dup2_x2 : // fall through | |
| 2349 case Bytecodes::_swap : stack_op(code); break; | |
| 2350 case Bytecodes::_iadd : arithmetic_op(intType , code); break; | |
| 2351 case Bytecodes::_ladd : arithmetic_op(longType , code); break; | |
| 2352 case Bytecodes::_fadd : arithmetic_op(floatType , code); break; | |
| 2353 case Bytecodes::_dadd : arithmetic_op(doubleType, code); break; | |
| 2354 case Bytecodes::_isub : arithmetic_op(intType , code); break; | |
| 2355 case Bytecodes::_lsub : arithmetic_op(longType , code); break; | |
| 2356 case Bytecodes::_fsub : arithmetic_op(floatType , code); break; | |
| 2357 case Bytecodes::_dsub : arithmetic_op(doubleType, code); break; | |
| 2358 case Bytecodes::_imul : arithmetic_op(intType , code); break; | |
| 2359 case Bytecodes::_lmul : arithmetic_op(longType , code); break; | |
| 2360 case Bytecodes::_fmul : arithmetic_op(floatType , code); break; | |
| 2361 case Bytecodes::_dmul : arithmetic_op(doubleType, code); break; | |
| 2362 case Bytecodes::_idiv : arithmetic_op(intType , code, lock_stack()); break; | |
| 2363 case Bytecodes::_ldiv : arithmetic_op(longType , code, lock_stack()); break; | |
| 2364 case Bytecodes::_fdiv : arithmetic_op(floatType , code); break; | |
| 2365 case Bytecodes::_ddiv : arithmetic_op(doubleType, code); break; | |
| 2366 case Bytecodes::_irem : arithmetic_op(intType , code, lock_stack()); break; | |
| 2367 case Bytecodes::_lrem : arithmetic_op(longType , code, lock_stack()); break; | |
| 2368 case Bytecodes::_frem : arithmetic_op(floatType , code); break; | |
| 2369 case Bytecodes::_drem : arithmetic_op(doubleType, code); break; | |
| 2370 case Bytecodes::_ineg : negate_op(intType ); break; | |
| 2371 case Bytecodes::_lneg : negate_op(longType ); break; | |
| 2372 case Bytecodes::_fneg : negate_op(floatType ); break; | |
| 2373 case Bytecodes::_dneg : negate_op(doubleType); break; | |
| 2374 case Bytecodes::_ishl : shift_op(intType , code); break; | |
| 2375 case Bytecodes::_lshl : shift_op(longType, code); break; | |
| 2376 case Bytecodes::_ishr : shift_op(intType , code); break; | |
| 2377 case Bytecodes::_lshr : shift_op(longType, code); break; | |
| 2378 case Bytecodes::_iushr : shift_op(intType , code); break; | |
| 2379 case Bytecodes::_lushr : shift_op(longType, code); break; | |
| 2380 case Bytecodes::_iand : logic_op(intType , code); break; | |
| 2381 case Bytecodes::_land : logic_op(longType, code); break; | |
| 2382 case Bytecodes::_ior : logic_op(intType , code); break; | |
| 2383 case Bytecodes::_lor : logic_op(longType, code); break; | |
| 2384 case Bytecodes::_ixor : logic_op(intType , code); break; | |
| 2385 case Bytecodes::_lxor : logic_op(longType, code); break; | |
| 2386 case Bytecodes::_iinc : increment(); break; | |
| 2387 case Bytecodes::_i2l : convert(code, T_INT , T_LONG ); break; | |
| 2388 case Bytecodes::_i2f : convert(code, T_INT , T_FLOAT ); break; | |
| 2389 case Bytecodes::_i2d : convert(code, T_INT , T_DOUBLE); break; | |
| 2390 case Bytecodes::_l2i : convert(code, T_LONG , T_INT ); break; | |
| 2391 case Bytecodes::_l2f : convert(code, T_LONG , T_FLOAT ); break; | |
| 2392 case Bytecodes::_l2d : convert(code, T_LONG , T_DOUBLE); break; | |
| 2393 case Bytecodes::_f2i : convert(code, T_FLOAT , T_INT ); break; | |
| 2394 case Bytecodes::_f2l : convert(code, T_FLOAT , T_LONG ); break; | |
| 2395 case Bytecodes::_f2d : convert(code, T_FLOAT , T_DOUBLE); break; | |
| 2396 case Bytecodes::_d2i : convert(code, T_DOUBLE, T_INT ); break; | |
| 2397 case Bytecodes::_d2l : convert(code, T_DOUBLE, T_LONG ); break; | |
| 2398 case Bytecodes::_d2f : convert(code, T_DOUBLE, T_FLOAT ); break; | |
| 2399 case Bytecodes::_i2b : convert(code, T_INT , T_BYTE ); break; | |
| 2400 case Bytecodes::_i2c : convert(code, T_INT , T_CHAR ); break; | |
| 2401 case Bytecodes::_i2s : convert(code, T_INT , T_SHORT ); break; | |
| 2402 case Bytecodes::_lcmp : compare_op(longType , code); break; | |
| 2403 case Bytecodes::_fcmpl : compare_op(floatType , code); break; | |
| 2404 case Bytecodes::_fcmpg : compare_op(floatType , code); break; | |
| 2405 case Bytecodes::_dcmpl : compare_op(doubleType, code); break; | |
| 2406 case Bytecodes::_dcmpg : compare_op(doubleType, code); break; | |
| 2407 case Bytecodes::_ifeq : if_zero(intType , If::eql); break; | |
| 2408 case Bytecodes::_ifne : if_zero(intType , If::neq); break; | |
| 2409 case Bytecodes::_iflt : if_zero(intType , If::lss); break; | |
| 2410 case Bytecodes::_ifge : if_zero(intType , If::geq); break; | |
| 2411 case Bytecodes::_ifgt : if_zero(intType , If::gtr); break; | |
| 2412 case Bytecodes::_ifle : if_zero(intType , If::leq); break; | |
| 2413 case Bytecodes::_if_icmpeq : if_same(intType , If::eql); break; | |
| 2414 case Bytecodes::_if_icmpne : if_same(intType , If::neq); break; | |
| 2415 case Bytecodes::_if_icmplt : if_same(intType , If::lss); break; | |
| 2416 case Bytecodes::_if_icmpge : if_same(intType , If::geq); break; | |
| 2417 case Bytecodes::_if_icmpgt : if_same(intType , If::gtr); break; | |
| 2418 case Bytecodes::_if_icmple : if_same(intType , If::leq); break; | |
| 2419 case Bytecodes::_if_acmpeq : if_same(objectType, If::eql); break; | |
| 2420 case Bytecodes::_if_acmpne : if_same(objectType, If::neq); break; | |
| 2421 case Bytecodes::_goto : _goto(s.cur_bci(), s.get_dest()); break; | |
| 2422 case Bytecodes::_jsr : jsr(s.get_dest()); break; | |
| 2423 case Bytecodes::_ret : ret(s.get_index()); break; | |
| 2424 case Bytecodes::_tableswitch : table_switch(); break; | |
| 2425 case Bytecodes::_lookupswitch : lookup_switch(); break; | |
| 2426 case Bytecodes::_ireturn : method_return(ipop()); break; | |
| 2427 case Bytecodes::_lreturn : method_return(lpop()); break; | |
| 2428 case Bytecodes::_freturn : method_return(fpop()); break; | |
| 2429 case Bytecodes::_dreturn : method_return(dpop()); break; | |
| 2430 case Bytecodes::_areturn : method_return(apop()); break; | |
| 2431 case Bytecodes::_return : method_return(NULL ); break; | |
| 2432 case Bytecodes::_getstatic : // fall through | |
| 2433 case Bytecodes::_putstatic : // fall through | |
| 2434 case Bytecodes::_getfield : // fall through | |
| 2435 case Bytecodes::_putfield : access_field(code); break; | |
| 2436 case Bytecodes::_invokevirtual : // fall through | |
| 2437 case Bytecodes::_invokespecial : // fall through | |
| 2438 case Bytecodes::_invokestatic : // fall through | |
|
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
2439 case Bytecodes::_invokedynamic : // fall through |
| 0 | 2440 case Bytecodes::_invokeinterface: invoke(code); break; |
| 2441 case Bytecodes::_new : new_instance(s.get_index_big()); break; | |
| 2442 case Bytecodes::_newarray : new_type_array(); break; | |
| 2443 case Bytecodes::_anewarray : new_object_array(); break; | |
| 2444 case Bytecodes::_arraylength : ipush(append(new ArrayLength(apop(), lock_stack()))); break; | |
| 2445 case Bytecodes::_athrow : throw_op(s.cur_bci()); break; | |
| 2446 case Bytecodes::_checkcast : check_cast(s.get_index_big()); break; | |
| 2447 case Bytecodes::_instanceof : instance_of(s.get_index_big()); break; | |
| 2448 // Note: we do not have special handling for the monitorenter bytecode if DeoptC1 && DeoptOnAsyncException | |
| 2449 case Bytecodes::_monitorenter : monitorenter(apop(), s.cur_bci()); break; | |
| 2450 case Bytecodes::_monitorexit : monitorexit (apop(), s.cur_bci()); break; | |
| 2451 case Bytecodes::_wide : ShouldNotReachHere(); break; | |
| 2452 case Bytecodes::_multianewarray : new_multi_array(s.cur_bcp()[3]); break; | |
| 2453 case Bytecodes::_ifnull : if_null(objectType, If::eql); break; | |
| 2454 case Bytecodes::_ifnonnull : if_null(objectType, If::neq); break; | |
| 2455 case Bytecodes::_goto_w : _goto(s.cur_bci(), s.get_far_dest()); break; | |
| 2456 case Bytecodes::_jsr_w : jsr(s.get_far_dest()); break; | |
| 2457 case Bytecodes::_breakpoint : BAILOUT_("concurrent setting of breakpoint", NULL); | |
| 2458 default : ShouldNotReachHere(); break; | |
| 2459 } | |
| 2460 // save current bci to setup Goto at the end | |
| 2461 prev_bci = s.cur_bci(); | |
| 2462 } | |
| 2463 CHECK_BAILOUT_(NULL); | |
| 2464 // stop processing of this block (see try_inline_full) | |
| 2465 if (_skip_block) { | |
| 2466 _skip_block = false; | |
| 2467 assert(_last && _last->as_BlockEnd(), ""); | |
| 2468 return _last->as_BlockEnd(); | |
| 2469 } | |
| 2470 // if there are any, check if last instruction is a BlockEnd instruction | |
| 2471 BlockEnd* end = last()->as_BlockEnd(); | |
| 2472 if (end == NULL) { | |
| 2473 // all blocks must end with a BlockEnd instruction => add a Goto | |
| 2474 end = new Goto(block_at(s.cur_bci()), false); | |
| 2475 _last = _last->set_next(end, prev_bci); | |
| 2476 } | |
| 2477 assert(end == last()->as_BlockEnd(), "inconsistency"); | |
| 2478 | |
| 2479 // if the method terminates, we don't need the stack anymore | |
| 2480 if (end->as_Return() != NULL) { | |
| 2481 state()->clear_stack(); | |
| 2482 } else if (end->as_Throw() != NULL) { | |
| 2483 // May have exception handler in caller scopes | |
| 2484 state()->truncate_stack(scope()->lock_stack_size()); | |
| 2485 } | |
| 2486 | |
| 2487 // connect to begin & set state | |
| 2488 // NOTE that inlining may have changed the block we are parsing | |
| 2489 block()->set_end(end); | |
| 2490 end->set_state(state()); | |
| 2491 // propagate state | |
| 2492 for (int i = end->number_of_sux() - 1; i >= 0; i--) { | |
| 2493 BlockBegin* sux = end->sux_at(i); | |
| 2494 assert(sux->is_predecessor(block()), "predecessor missing"); | |
| 2495 // be careful, bailout if bytecodes are strange | |
| 2496 if (!sux->try_merge(state())) BAILOUT_("block join failed", NULL); | |
| 2497 scope_data()->add_to_work_list(end->sux_at(i)); | |
| 2498 } | |
| 2499 | |
| 2500 scope_data()->set_stream(NULL); | |
| 2501 | |
| 2502 // done | |
| 2503 return end; | |
| 2504 } | |
| 2505 | |
| 2506 | |
| 2507 void GraphBuilder::iterate_all_blocks(bool start_in_current_block_for_inlining) { | |
| 2508 do { | |
| 2509 if (start_in_current_block_for_inlining && !bailed_out()) { | |
| 2510 iterate_bytecodes_for_block(0); | |
| 2511 start_in_current_block_for_inlining = false; | |
| 2512 } else { | |
| 2513 BlockBegin* b; | |
| 2514 while ((b = scope_data()->remove_from_work_list()) != NULL) { | |
| 2515 if (!b->is_set(BlockBegin::was_visited_flag)) { | |
| 2516 if (b->is_set(BlockBegin::osr_entry_flag)) { | |
| 2517 // we're about to parse the osr entry block, so make sure | |
| 2518 // we setup the OSR edge leading into this block so that | |
| 2519 // Phis get setup correctly. | |
| 2520 setup_osr_entry_block(); | |
| 2521 // this is no longer the osr entry block, so clear it. | |
| 2522 b->clear(BlockBegin::osr_entry_flag); | |
| 2523 } | |
| 2524 b->set(BlockBegin::was_visited_flag); | |
| 2525 connect_to_end(b); | |
| 2526 } | |
| 2527 } | |
| 2528 } | |
| 2529 } while (!bailed_out() && !scope_data()->is_work_list_empty()); | |
| 2530 } | |
| 2531 | |
| 2532 | |
| 2533 bool GraphBuilder::_is_initialized = false; | |
| 2534 bool GraphBuilder::_can_trap [Bytecodes::number_of_java_codes]; | |
| 2535 bool GraphBuilder::_is_async[Bytecodes::number_of_java_codes]; | |
| 2536 | |
| 2537 void GraphBuilder::initialize() { | |
| 2538 // make sure initialization happens only once (need a | |
| 2539 // lock here, if we allow the compiler to be re-entrant) | |
| 2540 if (is_initialized()) return; | |
| 2541 _is_initialized = true; | |
| 2542 | |
| 2543 // the following bytecodes are assumed to potentially | |
| 2544 // throw exceptions in compiled code - note that e.g. | |
| 2545 // monitorexit & the return bytecodes do not throw | |
| 2546 // exceptions since monitor pairing proved that they | |
| 2547 // succeed (if monitor pairing succeeded) | |
| 2548 Bytecodes::Code can_trap_list[] = | |
| 2549 { Bytecodes::_ldc | |
| 2550 , Bytecodes::_ldc_w | |
| 2551 , Bytecodes::_ldc2_w | |
| 2552 , Bytecodes::_iaload | |
| 2553 , Bytecodes::_laload | |
| 2554 , Bytecodes::_faload | |
| 2555 , Bytecodes::_daload | |
| 2556 , Bytecodes::_aaload | |
| 2557 , Bytecodes::_baload | |
| 2558 , Bytecodes::_caload | |
| 2559 , Bytecodes::_saload | |
| 2560 , Bytecodes::_iastore | |
| 2561 , Bytecodes::_lastore | |
| 2562 , Bytecodes::_fastore | |
| 2563 , Bytecodes::_dastore | |
| 2564 , Bytecodes::_aastore | |
| 2565 , Bytecodes::_bastore | |
| 2566 , Bytecodes::_castore | |
| 2567 , Bytecodes::_sastore | |
| 2568 , Bytecodes::_idiv | |
| 2569 , Bytecodes::_ldiv | |
| 2570 , Bytecodes::_irem | |
| 2571 , Bytecodes::_lrem | |
| 2572 , Bytecodes::_getstatic | |
| 2573 , Bytecodes::_putstatic | |
| 2574 , Bytecodes::_getfield | |
| 2575 , Bytecodes::_putfield | |
| 2576 , Bytecodes::_invokevirtual | |
| 2577 , Bytecodes::_invokespecial | |
| 2578 , Bytecodes::_invokestatic | |
|
726
be93aad57795
6655646: dynamic languages need dynamically linked call sites
jrose
parents:
470
diff
changeset
|
2579 , Bytecodes::_invokedynamic |
| 0 | 2580 , Bytecodes::_invokeinterface |
| 2581 , Bytecodes::_new | |
| 2582 , Bytecodes::_newarray | |
| 2583 , Bytecodes::_anewarray | |
| 2584 , Bytecodes::_arraylength | |
| 2585 , Bytecodes::_athrow | |
| 2586 , Bytecodes::_checkcast | |
| 2587 , Bytecodes::_instanceof | |
| 2588 , Bytecodes::_monitorenter | |
| 2589 , Bytecodes::_multianewarray | |
| 2590 }; | |
| 2591 | |
| 2592 // the following bytecodes are assumed to potentially | |
| 2593 // throw asynchronous exceptions in compiled code due | |
| 2594 // to safepoints (note: these entries could be merged | |
| 2595 // with the can_trap_list - however, we need to know | |
| 2596 // which ones are asynchronous for now - see also the | |
| 2597 // comment in GraphBuilder::handle_exception) | |
| 2598 Bytecodes::Code is_async_list[] = | |
| 2599 { Bytecodes::_ifeq | |
| 2600 , Bytecodes::_ifne | |
| 2601 , Bytecodes::_iflt | |
| 2602 , Bytecodes::_ifge | |
| 2603 , Bytecodes::_ifgt | |
| 2604 , Bytecodes::_ifle | |
| 2605 , Bytecodes::_if_icmpeq | |
| 2606 , Bytecodes::_if_icmpne | |
| 2607 , Bytecodes::_if_icmplt | |
| 2608 , Bytecodes::_if_icmpge | |
| 2609 , Bytecodes::_if_icmpgt | |
| 2610 , Bytecodes::_if_icmple | |
| 2611 , Bytecodes::_if_acmpeq | |
| 2612 , Bytecodes::_if_acmpne | |
| 2613 , Bytecodes::_goto | |
| 2614 , Bytecodes::_jsr | |
| 2615 , Bytecodes::_ret | |
| 2616 , Bytecodes::_tableswitch | |
| 2617 , Bytecodes::_lookupswitch | |
| 2618 , Bytecodes::_ireturn | |
| 2619 , Bytecodes::_lreturn | |
| 2620 , Bytecodes::_freturn | |
| 2621 , Bytecodes::_dreturn | |
| 2622 , Bytecodes::_areturn | |
| 2623 , Bytecodes::_return | |
| 2624 , Bytecodes::_ifnull | |
| 2625 , Bytecodes::_ifnonnull | |
| 2626 , Bytecodes::_goto_w | |
| 2627 , Bytecodes::_jsr_w | |
| 2628 }; | |
| 2629 | |
| 2630 // inititialize trap tables | |
| 2631 for (int i = 0; i < Bytecodes::number_of_java_codes; i++) { | |
| 2632 _can_trap[i] = false; | |
| 2633 _is_async[i] = false; | |
| 2634 } | |
| 2635 // set standard trap info | |
| 2636 for (uint j = 0; j < ARRAY_SIZE(can_trap_list); j++) { | |
| 2637 _can_trap[can_trap_list[j]] = true; | |
| 2638 } | |
| 2639 | |
| 2640 // We now deoptimize if an asynchronous exception is thrown. This | |
| 2641 // considerably cleans up corner case issues related to javac's | |
| 2642 // incorrect exception handler ranges for async exceptions and | |
| 2643 // allows us to precisely analyze the types of exceptions from | |
| 2644 // certain bytecodes. | |
| 2645 if (!(DeoptC1 && DeoptOnAsyncException)) { | |
| 2646 // set asynchronous trap info | |
| 2647 for (uint k = 0; k < ARRAY_SIZE(is_async_list); k++) { | |
| 2648 assert(!_can_trap[is_async_list[k]], "can_trap_list and is_async_list should be disjoint"); | |
| 2649 _can_trap[is_async_list[k]] = true; | |
| 2650 _is_async[is_async_list[k]] = true; | |
| 2651 } | |
| 2652 } | |
| 2653 } | |
| 2654 | |
| 2655 | |
| 2656 BlockBegin* GraphBuilder::header_block(BlockBegin* entry, BlockBegin::Flag f, ValueStack* state) { | |
| 2657 assert(entry->is_set(f), "entry/flag mismatch"); | |
| 2658 // create header block | |
| 2659 BlockBegin* h = new BlockBegin(entry->bci()); | |
| 2660 h->set_depth_first_number(0); | |
| 2661 | |
| 2662 Value l = h; | |
| 2663 if (profile_branches()) { | |
| 2664 // Increment the invocation count on entry to the method. We | |
| 2665 // can't use profile_invocation here because append isn't setup to | |
| 2666 // work properly at this point. The instruction have to be | |
| 2667 // appended to the instruction stream by hand. | |
| 2668 Value m = new Constant(new ObjectConstant(compilation()->method())); | |
| 2669 h->set_next(m, 0); | |
| 2670 Value p = new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1); | |
| 2671 m->set_next(p, 0); | |
| 2672 l = p; | |
| 2673 } | |
| 2674 | |
| 2675 BlockEnd* g = new Goto(entry, false); | |
| 2676 l->set_next(g, entry->bci()); | |
| 2677 h->set_end(g); | |
| 2678 h->set(f); | |
| 2679 // setup header block end state | |
| 2680 ValueStack* s = state->copy(); // can use copy since stack is empty (=> no phis) | |
| 2681 assert(s->stack_is_empty(), "must have empty stack at entry point"); | |
| 2682 g->set_state(s); | |
| 2683 return h; | |
| 2684 } | |
| 2685 | |
| 2686 | |
| 2687 | |
| 2688 BlockBegin* GraphBuilder::setup_start_block(int osr_bci, BlockBegin* std_entry, BlockBegin* osr_entry, ValueStack* state) { | |
| 2689 BlockBegin* start = new BlockBegin(0); | |
| 2690 | |
| 2691 // This code eliminates the empty start block at the beginning of | |
| 2692 // each method. Previously, each method started with the | |
| 2693 // start-block created below, and this block was followed by the | |
| 2694 // header block that was always empty. This header block is only | |
| 2695 // necesary if std_entry is also a backward branch target because | |
| 2696 // then phi functions may be necessary in the header block. It's | |
| 2697 // also necessary when profiling so that there's a single block that | |
| 2698 // can increment the interpreter_invocation_count. | |
| 2699 BlockBegin* new_header_block; | |
| 2700 if (std_entry->number_of_preds() == 0 && !profile_branches()) { | |
| 2701 new_header_block = std_entry; | |
| 2702 } else { | |
| 2703 new_header_block = header_block(std_entry, BlockBegin::std_entry_flag, state); | |
| 2704 } | |
| 2705 | |
| 2706 // setup start block (root for the IR graph) | |
| 2707 Base* base = | |
| 2708 new Base( | |
| 2709 new_header_block, | |
| 2710 osr_entry | |
| 2711 ); | |
| 2712 start->set_next(base, 0); | |
| 2713 start->set_end(base); | |
| 2714 // create & setup state for start block | |
| 2715 start->set_state(state->copy()); | |
| 2716 base->set_state(state->copy()); | |
| 2717 | |
| 2718 if (base->std_entry()->state() == NULL) { | |
| 2719 // setup states for header blocks | |
| 2720 base->std_entry()->merge(state); | |
| 2721 } | |
| 2722 | |
| 2723 assert(base->std_entry()->state() != NULL, ""); | |
| 2724 return start; | |
| 2725 } | |
| 2726 | |
| 2727 | |
| 2728 void GraphBuilder::setup_osr_entry_block() { | |
| 2729 assert(compilation()->is_osr_compile(), "only for osrs"); | |
| 2730 | |
| 2731 int osr_bci = compilation()->osr_bci(); | |
| 2732 ciBytecodeStream s(method()); | |
| 2733 s.reset_to_bci(osr_bci); | |
| 2734 s.next(); | |
| 2735 scope_data()->set_stream(&s); | |
| 2736 | |
| 2737 // create a new block to be the osr setup code | |
| 2738 _osr_entry = new BlockBegin(osr_bci); | |
| 2739 _osr_entry->set(BlockBegin::osr_entry_flag); | |
| 2740 _osr_entry->set_depth_first_number(0); | |
| 2741 BlockBegin* target = bci2block()->at(osr_bci); | |
| 2742 assert(target != NULL && target->is_set(BlockBegin::osr_entry_flag), "must be there"); | |
| 2743 // the osr entry has no values for locals | |
| 2744 ValueStack* state = target->state()->copy(); | |
| 2745 _osr_entry->set_state(state); | |
| 2746 | |
| 2747 kill_all(); | |
| 2748 _block = _osr_entry; | |
| 2749 _state = _osr_entry->state()->copy(); | |
| 2750 _last = _osr_entry; | |
| 2751 Value e = append(new OsrEntry()); | |
| 2752 e->set_needs_null_check(false); | |
| 2753 | |
| 2754 // OSR buffer is | |
| 2755 // | |
| 2756 // locals[nlocals-1..0] | |
| 2757 // monitors[number_of_locks-1..0] | |
| 2758 // | |
| 2759 // locals is a direct copy of the interpreter frame so in the osr buffer | |
| 2760 // so first slot in the local array is the last local from the interpreter | |
| 2761 // and last slot is local[0] (receiver) from the interpreter | |
| 2762 // | |
| 2763 // Similarly with locks. The first lock slot in the osr buffer is the nth lock | |
| 2764 // from the interpreter frame, the nth lock slot in the osr buffer is 0th lock | |
| 2765 // in the interpreter frame (the method lock if a sync method) | |
| 2766 | |
| 2767 // Initialize monitors in the compiled activation. | |
| 2768 | |
| 2769 int index; | |
| 2770 Value local; | |
| 2771 | |
| 2772 // find all the locals that the interpreter thinks contain live oops | |
| 2773 const BitMap live_oops = method()->live_local_oops_at_bci(osr_bci); | |
| 2774 | |
| 2775 // compute the offset into the locals so that we can treat the buffer | |
| 2776 // as if the locals were still in the interpreter frame | |
| 2777 int locals_offset = BytesPerWord * (method()->max_locals() - 1); | |
| 2778 for_each_local_value(state, index, local) { | |
| 2779 int offset = locals_offset - (index + local->type()->size() - 1) * BytesPerWord; | |
| 2780 Value get; | |
| 2781 if (local->type()->is_object_kind() && !live_oops.at(index)) { | |
| 2782 // The interpreter thinks this local is dead but the compiler | |
| 2783 // doesn't so pretend that the interpreter passed in null. | |
| 2784 get = append(new Constant(objectNull)); | |
| 2785 } else { | |
| 2786 get = append(new UnsafeGetRaw(as_BasicType(local->type()), e, | |
| 2787 append(new Constant(new IntConstant(offset))), | |
| 2788 0, | |
| 2789 true)); | |
| 2790 } | |
| 2791 _state->store_local(index, get); | |
| 2792 } | |
| 2793 | |
| 2794 // the storage for the OSR buffer is freed manually in the LIRGenerator. | |
| 2795 | |
| 2796 assert(state->caller_state() == NULL, "should be top scope"); | |
| 2797 state->clear_locals(); | |
| 2798 Goto* g = new Goto(target, false); | |
| 2799 g->set_state(_state->copy()); | |
| 2800 append(g); | |
| 2801 _osr_entry->set_end(g); | |
| 2802 target->merge(_osr_entry->end()->state()); | |
| 2803 | |
| 2804 scope_data()->set_stream(NULL); | |
| 2805 } | |
| 2806 | |
| 2807 | |
| 2808 ValueStack* GraphBuilder::state_at_entry() { | |
| 2809 ValueStack* state = new ValueStack(scope(), method()->max_locals(), method()->max_stack()); | |
| 2810 | |
| 2811 // Set up locals for receiver | |
| 2812 int idx = 0; | |
| 2813 if (!method()->is_static()) { | |
| 2814 // we should always see the receiver | |
| 2815 state->store_local(idx, new Local(objectType, idx)); | |
| 2816 idx = 1; | |
| 2817 } | |
| 2818 | |
| 2819 // Set up locals for incoming arguments | |
| 2820 ciSignature* sig = method()->signature(); | |
| 2821 for (int i = 0; i < sig->count(); i++) { | |
| 2822 ciType* type = sig->type_at(i); | |
| 2823 BasicType basic_type = type->basic_type(); | |
| 2824 // don't allow T_ARRAY to propagate into locals types | |
| 2825 if (basic_type == T_ARRAY) basic_type = T_OBJECT; | |
| 2826 ValueType* vt = as_ValueType(basic_type); | |
| 2827 state->store_local(idx, new Local(vt, idx)); | |
| 2828 idx += type->size(); | |
| 2829 } | |
| 2830 | |
| 2831 // lock synchronized method | |
| 2832 if (method()->is_synchronized()) { | |
| 2833 state->lock(scope(), NULL); | |
| 2834 } | |
| 2835 | |
| 2836 return state; | |
| 2837 } | |
| 2838 | |
| 2839 | |
| 2840 GraphBuilder::GraphBuilder(Compilation* compilation, IRScope* scope) | |
| 2841 : _scope_data(NULL) | |
| 2842 , _exception_state(NULL) | |
| 2843 , _instruction_count(0) | |
| 2844 , _osr_entry(NULL) | |
| 2845 , _memory(new MemoryBuffer()) | |
| 2846 , _compilation(compilation) | |
| 2847 , _inline_bailout_msg(NULL) | |
| 2848 { | |
| 2849 int osr_bci = compilation->osr_bci(); | |
| 2850 | |
| 2851 // determine entry points and bci2block mapping | |
| 2852 BlockListBuilder blm(compilation, scope, osr_bci); | |
| 2853 CHECK_BAILOUT(); | |
| 2854 | |
| 2855 BlockList* bci2block = blm.bci2block(); | |
| 2856 BlockBegin* start_block = bci2block->at(0); | |
| 2857 | |
| 2858 assert(is_initialized(), "GraphBuilder must have been initialized"); | |
| 2859 push_root_scope(scope, bci2block, start_block); | |
| 2860 | |
| 2861 // setup state for std entry | |
| 2862 _initial_state = state_at_entry(); | |
| 2863 start_block->merge(_initial_state); | |
| 2864 | |
| 2865 BlockBegin* sync_handler = NULL; | |
|
780
c96bf21b756f
6788527: Server vm intermittently fails with assertion "live value must not be garbage" with fastdebug bits
kvn
parents:
726
diff
changeset
|
2866 if (method()->is_synchronized() || _compilation->env()->dtrace_method_probes()) { |
| 0 | 2867 // setup an exception handler to do the unlocking and/or notification |
| 2868 sync_handler = new BlockBegin(-1); | |
| 2869 sync_handler->set(BlockBegin::exception_entry_flag); | |
| 2870 sync_handler->set(BlockBegin::is_on_work_list_flag); | |
| 2871 sync_handler->set(BlockBegin::default_exception_handler_flag); | |
| 2872 | |
| 2873 ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); | |
| 2874 XHandler* h = new XHandler(desc); | |
| 2875 h->set_entry_block(sync_handler); | |
| 2876 scope_data()->xhandlers()->append(h); | |
| 2877 scope_data()->set_has_handler(); | |
| 2878 } | |
| 2879 | |
| 2880 // complete graph | |
| 2881 _vmap = new ValueMap(); | |
| 2882 scope->compute_lock_stack_size(); | |
| 2883 switch (scope->method()->intrinsic_id()) { | |
| 2884 case vmIntrinsics::_dabs : // fall through | |
| 2885 case vmIntrinsics::_dsqrt : // fall through | |
| 2886 case vmIntrinsics::_dsin : // fall through | |
| 2887 case vmIntrinsics::_dcos : // fall through | |
| 2888 case vmIntrinsics::_dtan : // fall through | |
| 2889 case vmIntrinsics::_dlog : // fall through | |
| 2890 case vmIntrinsics::_dlog10 : // fall through | |
| 2891 { | |
| 2892 // Compiles where the root method is an intrinsic need a special | |
| 2893 // compilation environment because the bytecodes for the method | |
| 2894 // shouldn't be parsed during the compilation, only the special | |
| 2895 // Intrinsic node should be emitted. If this isn't done the the | |
| 2896 // code for the inlined version will be different than the root | |
| 2897 // compiled version which could lead to monotonicity problems on | |
| 2898 // intel. | |
| 2899 | |
| 2900 // Set up a stream so that appending instructions works properly. | |
| 2901 ciBytecodeStream s(scope->method()); | |
| 2902 s.reset_to_bci(0); | |
| 2903 scope_data()->set_stream(&s); | |
| 2904 s.next(); | |
| 2905 | |
| 2906 // setup the initial block state | |
| 2907 _block = start_block; | |
| 2908 _state = start_block->state()->copy(); | |
| 2909 _last = start_block; | |
| 2910 load_local(doubleType, 0); | |
| 2911 | |
| 2912 // Emit the intrinsic node. | |
| 2913 bool result = try_inline_intrinsics(scope->method()); | |
| 2914 if (!result) BAILOUT("failed to inline intrinsic"); | |
| 2915 method_return(dpop()); | |
| 2916 | |
| 2917 // connect the begin and end blocks and we're all done. | |
| 2918 BlockEnd* end = last()->as_BlockEnd(); | |
| 2919 block()->set_end(end); | |
| 2920 end->set_state(state()); | |
| 2921 break; | |
| 2922 } | |
| 2923 default: | |
| 2924 scope_data()->add_to_work_list(start_block); | |
| 2925 iterate_all_blocks(); | |
| 2926 break; | |
| 2927 } | |
| 2928 CHECK_BAILOUT(); | |
| 2929 | |
| 2930 if (sync_handler && sync_handler->state() != NULL) { | |
| 2931 Value lock = NULL; | |
| 2932 if (method()->is_synchronized()) { | |
| 2933 lock = method()->is_static() ? new Constant(new InstanceConstant(method()->holder()->java_mirror())) : | |
| 2934 _initial_state->local_at(0); | |
| 2935 | |
| 2936 sync_handler->state()->unlock(); | |
| 2937 sync_handler->state()->lock(scope, lock); | |
| 2938 | |
| 2939 } | |
| 2940 fill_sync_handler(lock, sync_handler, true); | |
| 2941 } | |
| 2942 | |
| 2943 _start = setup_start_block(osr_bci, start_block, _osr_entry, _initial_state); | |
| 2944 | |
| 2945 eliminate_redundant_phis(_start); | |
| 2946 | |
| 2947 NOT_PRODUCT(if (PrintValueNumbering && Verbose) print_stats()); | |
| 2948 // for osr compile, bailout if some requirements are not fulfilled | |
| 2949 if (osr_bci != -1) { | |
| 2950 BlockBegin* osr_block = blm.bci2block()->at(osr_bci); | |
| 2951 assert(osr_block->is_set(BlockBegin::was_visited_flag),"osr entry must have been visited for osr compile"); | |
| 2952 | |
| 2953 // check if osr entry point has empty stack - we cannot handle non-empty stacks at osr entry points | |
| 2954 if (!osr_block->state()->stack_is_empty()) { | |
| 2955 BAILOUT("stack not empty at OSR entry point"); | |
| 2956 } | |
| 2957 } | |
| 2958 #ifndef PRODUCT | |
| 2959 if (PrintCompilation && Verbose) tty->print_cr("Created %d Instructions", _instruction_count); | |
| 2960 #endif | |
| 2961 } | |
| 2962 | |
| 2963 | |
| 2964 ValueStack* GraphBuilder::lock_stack() { | |
| 2965 // return a new ValueStack representing just the current lock stack | |
| 2966 // (for debug info at safepoints in exception throwing or handling) | |
| 2967 ValueStack* new_stack = state()->copy_locks(); | |
| 2968 return new_stack; | |
| 2969 } | |
| 2970 | |
| 2971 | |
| 2972 int GraphBuilder::recursive_inline_level(ciMethod* cur_callee) const { | |
| 2973 int recur_level = 0; | |
| 2974 for (IRScope* s = scope(); s != NULL; s = s->caller()) { | |
| 2975 if (s->method() == cur_callee) { | |
| 2976 ++recur_level; | |
| 2977 } | |
| 2978 } | |
| 2979 return recur_level; | |
| 2980 } | |
| 2981 | |
| 2982 | |
| 2983 bool GraphBuilder::try_inline(ciMethod* callee, bool holder_known) { | |
| 2984 // Clear out any existing inline bailout condition | |
| 2985 clear_inline_bailout(); | |
| 2986 | |
| 2987 if (callee->should_exclude()) { | |
| 2988 // callee is excluded | |
| 2989 INLINE_BAILOUT("excluded by CompilerOracle") | |
| 2990 } else if (!callee->can_be_compiled()) { | |
| 2991 // callee is not compilable (prob. has breakpoints) | |
| 2992 INLINE_BAILOUT("not compilable") | |
| 2993 } else if (callee->intrinsic_id() != vmIntrinsics::_none && try_inline_intrinsics(callee)) { | |
| 2994 // intrinsics can be native or not | |
| 2995 return true; | |
| 2996 } else if (callee->is_native()) { | |
| 2997 // non-intrinsic natives cannot be inlined | |
| 2998 INLINE_BAILOUT("non-intrinsic native") | |
| 2999 } else if (callee->is_abstract()) { | |
| 3000 INLINE_BAILOUT("abstract") | |
| 3001 } else { | |
| 3002 return try_inline_full(callee, holder_known); | |
| 3003 } | |
| 3004 } | |
| 3005 | |
| 3006 | |
| 3007 bool GraphBuilder::try_inline_intrinsics(ciMethod* callee) { | |
| 3008 if (!InlineNatives ) INLINE_BAILOUT("intrinsic method inlining disabled"); | |
| 3009 if (callee->is_synchronized()) INLINE_BAILOUT("intrinsic method is synchronized"); | |
| 3010 // callee seems like a good candidate | |
| 3011 // determine id | |
| 3012 bool preserves_state = false; | |
| 3013 bool cantrap = true; | |
| 3014 vmIntrinsics::ID id = callee->intrinsic_id(); | |
| 3015 switch (id) { | |
| 3016 case vmIntrinsics::_arraycopy : | |
| 3017 if (!InlineArrayCopy) return false; | |
| 3018 break; | |
| 3019 | |
| 3020 case vmIntrinsics::_currentTimeMillis: | |
| 3021 case vmIntrinsics::_nanoTime: | |
| 3022 preserves_state = true; | |
| 3023 cantrap = false; | |
| 3024 break; | |
| 3025 | |
| 3026 case vmIntrinsics::_floatToRawIntBits : | |
| 3027 case vmIntrinsics::_intBitsToFloat : | |
| 3028 case vmIntrinsics::_doubleToRawLongBits : | |
| 3029 case vmIntrinsics::_longBitsToDouble : | |
| 3030 if (!InlineMathNatives) return false; | |
| 3031 preserves_state = true; | |
| 3032 cantrap = false; | |
| 3033 break; | |
| 3034 | |
| 3035 case vmIntrinsics::_getClass : | |
| 3036 if (!InlineClassNatives) return false; | |
| 3037 preserves_state = true; | |
| 3038 break; | |
| 3039 | |
| 3040 case vmIntrinsics::_currentThread : | |
| 3041 if (!InlineThreadNatives) return false; | |
| 3042 preserves_state = true; | |
| 3043 cantrap = false; | |
| 3044 break; | |
| 3045 | |
| 3046 case vmIntrinsics::_dabs : // fall through | |
| 3047 case vmIntrinsics::_dsqrt : // fall through | |
| 3048 case vmIntrinsics::_dsin : // fall through | |
| 3049 case vmIntrinsics::_dcos : // fall through | |
| 3050 case vmIntrinsics::_dtan : // fall through | |
| 3051 case vmIntrinsics::_dlog : // fall through | |
| 3052 case vmIntrinsics::_dlog10 : // fall through | |
| 3053 if (!InlineMathNatives) return false; | |
| 3054 cantrap = false; | |
| 3055 preserves_state = true; | |
| 3056 break; | |
| 3057 | |
| 3058 // sun/misc/AtomicLong.attemptUpdate | |
| 3059 case vmIntrinsics::_attemptUpdate : | |
| 3060 if (!VM_Version::supports_cx8()) return false; | |
| 3061 if (!InlineAtomicLong) return false; | |
| 3062 preserves_state = true; | |
| 3063 break; | |
| 3064 | |
| 3065 // Use special nodes for Unsafe instructions so we can more easily | |
| 3066 // perform an address-mode optimization on the raw variants | |
| 3067 case vmIntrinsics::_getObject : return append_unsafe_get_obj(callee, T_OBJECT, false); | |
| 3068 case vmIntrinsics::_getBoolean: return append_unsafe_get_obj(callee, T_BOOLEAN, false); | |
| 3069 case vmIntrinsics::_getByte : return append_unsafe_get_obj(callee, T_BYTE, false); | |
| 3070 case vmIntrinsics::_getShort : return append_unsafe_get_obj(callee, T_SHORT, false); | |
| 3071 case vmIntrinsics::_getChar : return append_unsafe_get_obj(callee, T_CHAR, false); | |
| 3072 case vmIntrinsics::_getInt : return append_unsafe_get_obj(callee, T_INT, false); | |
| 3073 case vmIntrinsics::_getLong : return append_unsafe_get_obj(callee, T_LONG, false); | |
| 3074 case vmIntrinsics::_getFloat : return append_unsafe_get_obj(callee, T_FLOAT, false); | |
| 3075 case vmIntrinsics::_getDouble : return append_unsafe_get_obj(callee, T_DOUBLE, false); | |
| 3076 | |
| 3077 case vmIntrinsics::_putObject : return append_unsafe_put_obj(callee, T_OBJECT, false); | |
| 3078 case vmIntrinsics::_putBoolean: return append_unsafe_put_obj(callee, T_BOOLEAN, false); | |
| 3079 case vmIntrinsics::_putByte : return append_unsafe_put_obj(callee, T_BYTE, false); | |
| 3080 case vmIntrinsics::_putShort : return append_unsafe_put_obj(callee, T_SHORT, false); | |
| 3081 case vmIntrinsics::_putChar : return append_unsafe_put_obj(callee, T_CHAR, false); | |
| 3082 case vmIntrinsics::_putInt : return append_unsafe_put_obj(callee, T_INT, false); | |
| 3083 case vmIntrinsics::_putLong : return append_unsafe_put_obj(callee, T_LONG, false); | |
| 3084 case vmIntrinsics::_putFloat : return append_unsafe_put_obj(callee, T_FLOAT, false); | |
| 3085 case vmIntrinsics::_putDouble : return append_unsafe_put_obj(callee, T_DOUBLE, false); | |
| 3086 | |
| 3087 case vmIntrinsics::_getObjectVolatile : return append_unsafe_get_obj(callee, T_OBJECT, true); | |
| 3088 case vmIntrinsics::_getBooleanVolatile: return append_unsafe_get_obj(callee, T_BOOLEAN, true); | |
| 3089 case vmIntrinsics::_getByteVolatile : return append_unsafe_get_obj(callee, T_BYTE, true); | |
| 3090 case vmIntrinsics::_getShortVolatile : return append_unsafe_get_obj(callee, T_SHORT, true); | |
| 3091 case vmIntrinsics::_getCharVolatile : return append_unsafe_get_obj(callee, T_CHAR, true); | |
| 3092 case vmIntrinsics::_getIntVolatile : return append_unsafe_get_obj(callee, T_INT, true); | |
| 3093 case vmIntrinsics::_getLongVolatile : return append_unsafe_get_obj(callee, T_LONG, true); | |
| 3094 case vmIntrinsics::_getFloatVolatile : return append_unsafe_get_obj(callee, T_FLOAT, true); | |
| 3095 case vmIntrinsics::_getDoubleVolatile : return append_unsafe_get_obj(callee, T_DOUBLE, true); | |
| 3096 | |
| 3097 case vmIntrinsics::_putObjectVolatile : return append_unsafe_put_obj(callee, T_OBJECT, true); | |
| 3098 case vmIntrinsics::_putBooleanVolatile: return append_unsafe_put_obj(callee, T_BOOLEAN, true); | |
| 3099 case vmIntrinsics::_putByteVolatile : return append_unsafe_put_obj(callee, T_BYTE, true); | |
| 3100 case vmIntrinsics::_putShortVolatile : return append_unsafe_put_obj(callee, T_SHORT, true); | |
| 3101 case vmIntrinsics::_putCharVolatile : return append_unsafe_put_obj(callee, T_CHAR, true); | |
| 3102 case vmIntrinsics::_putIntVolatile : return append_unsafe_put_obj(callee, T_INT, true); | |
| 3103 case vmIntrinsics::_putLongVolatile : return append_unsafe_put_obj(callee, T_LONG, true); | |
| 3104 case vmIntrinsics::_putFloatVolatile : return append_unsafe_put_obj(callee, T_FLOAT, true); | |
| 3105 case vmIntrinsics::_putDoubleVolatile : return append_unsafe_put_obj(callee, T_DOUBLE, true); | |
| 3106 | |
| 3107 case vmIntrinsics::_getByte_raw : return append_unsafe_get_raw(callee, T_BYTE); | |
| 3108 case vmIntrinsics::_getShort_raw : return append_unsafe_get_raw(callee, T_SHORT); | |
| 3109 case vmIntrinsics::_getChar_raw : return append_unsafe_get_raw(callee, T_CHAR); | |
| 3110 case vmIntrinsics::_getInt_raw : return append_unsafe_get_raw(callee, T_INT); | |
| 3111 case vmIntrinsics::_getLong_raw : return append_unsafe_get_raw(callee, T_LONG); | |
| 3112 case vmIntrinsics::_getFloat_raw : return append_unsafe_get_raw(callee, T_FLOAT); | |
| 3113 case vmIntrinsics::_getDouble_raw : return append_unsafe_get_raw(callee, T_DOUBLE); | |
| 3114 | |
| 3115 case vmIntrinsics::_putByte_raw : return append_unsafe_put_raw(callee, T_BYTE); | |
| 3116 case vmIntrinsics::_putShort_raw : return append_unsafe_put_raw(callee, T_SHORT); | |
| 3117 case vmIntrinsics::_putChar_raw : return append_unsafe_put_raw(callee, T_CHAR); | |
| 3118 case vmIntrinsics::_putInt_raw : return append_unsafe_put_raw(callee, T_INT); | |
| 3119 case vmIntrinsics::_putLong_raw : return append_unsafe_put_raw(callee, T_LONG); | |
| 3120 case vmIntrinsics::_putFloat_raw : return append_unsafe_put_raw(callee, T_FLOAT); | |
| 3121 case vmIntrinsics::_putDouble_raw : return append_unsafe_put_raw(callee, T_DOUBLE); | |
| 3122 | |
| 3123 case vmIntrinsics::_prefetchRead : return append_unsafe_prefetch(callee, false, false); | |
| 3124 case vmIntrinsics::_prefetchWrite : return append_unsafe_prefetch(callee, false, true); | |
| 3125 case vmIntrinsics::_prefetchReadStatic : return append_unsafe_prefetch(callee, true, false); | |
| 3126 case vmIntrinsics::_prefetchWriteStatic : return append_unsafe_prefetch(callee, true, true); | |
| 3127 | |
| 3128 case vmIntrinsics::_checkIndex : | |
| 3129 if (!InlineNIOCheckIndex) return false; | |
| 3130 preserves_state = true; | |
| 3131 break; | |
| 3132 case vmIntrinsics::_putOrderedObject : return append_unsafe_put_obj(callee, T_OBJECT, true); | |
| 3133 case vmIntrinsics::_putOrderedInt : return append_unsafe_put_obj(callee, T_INT, true); | |
| 3134 case vmIntrinsics::_putOrderedLong : return append_unsafe_put_obj(callee, T_LONG, true); | |
| 3135 | |
| 3136 case vmIntrinsics::_compareAndSwapLong: | |
| 3137 if (!VM_Version::supports_cx8()) return false; | |
| 3138 // fall through | |
| 3139 case vmIntrinsics::_compareAndSwapInt: | |
| 3140 case vmIntrinsics::_compareAndSwapObject: | |
| 3141 append_unsafe_CAS(callee); | |
| 3142 return true; | |
| 3143 | |
| 3144 default : return false; // do not inline | |
| 3145 } | |
| 3146 // create intrinsic node | |
| 3147 const bool has_receiver = !callee->is_static(); | |
| 3148 ValueType* result_type = as_ValueType(callee->return_type()); | |
| 3149 | |
| 3150 Values* args = state()->pop_arguments(callee->arg_size()); | |
| 3151 ValueStack* locks = lock_stack(); | |
| 3152 if (profile_calls()) { | |
| 3153 // Don't profile in the special case where the root method | |
| 3154 // is the intrinsic | |
| 3155 if (callee != method()) { | |
| 3156 Value recv = NULL; | |
| 3157 if (has_receiver) { | |
| 3158 recv = args->at(0); | |
| 3159 null_check(recv); | |
| 3160 } | |
| 3161 profile_call(recv, NULL); | |
| 3162 } | |
| 3163 } | |
| 3164 | |
| 3165 Intrinsic* result = new Intrinsic(result_type, id, args, has_receiver, lock_stack(), | |
| 3166 preserves_state, cantrap); | |
| 3167 // append instruction & push result | |
| 3168 Value value = append_split(result); | |
| 3169 if (result_type != voidType) push(result_type, value); | |
| 3170 | |
| 3171 #ifndef PRODUCT | |
| 3172 // printing | |
| 3173 if (PrintInlining) { | |
| 3174 print_inline_result(callee, true); | |
| 3175 } | |
| 3176 #endif | |
| 3177 | |
| 3178 // done | |
| 3179 return true; | |
| 3180 } | |
| 3181 | |
| 3182 | |
| 3183 bool GraphBuilder::try_inline_jsr(int jsr_dest_bci) { | |
| 3184 // Introduce a new callee continuation point - all Ret instructions | |
| 3185 // will be replaced with Gotos to this point. | |
| 3186 BlockBegin* cont = block_at(next_bci()); | |
| 3187 assert(cont != NULL, "continuation must exist (BlockListBuilder starts a new block after a jsr"); | |
| 3188 | |
| 3189 // Note: can not assign state to continuation yet, as we have to | |
| 3190 // pick up the state from the Ret instructions. | |
| 3191 | |
| 3192 // Push callee scope | |
| 3193 push_scope_for_jsr(cont, jsr_dest_bci); | |
| 3194 | |
| 3195 // Temporarily set up bytecode stream so we can append instructions | |
| 3196 // (only using the bci of this stream) | |
| 3197 scope_data()->set_stream(scope_data()->parent()->stream()); | |
| 3198 | |
| 3199 BlockBegin* jsr_start_block = block_at(jsr_dest_bci); | |
| 3200 assert(jsr_start_block != NULL, "jsr start block must exist"); | |
| 3201 assert(!jsr_start_block->is_set(BlockBegin::was_visited_flag), "should not have visited jsr yet"); | |
| 3202 Goto* goto_sub = new Goto(jsr_start_block, false); | |
| 3203 goto_sub->set_state(state()); | |
| 3204 // Must copy state to avoid wrong sharing when parsing bytecodes | |
| 3205 assert(jsr_start_block->state() == NULL, "should have fresh jsr starting block"); | |
| 3206 jsr_start_block->set_state(state()->copy()); | |
| 3207 append(goto_sub); | |
| 3208 _block->set_end(goto_sub); | |
| 3209 _last = _block = jsr_start_block; | |
| 3210 | |
| 3211 // Clear out bytecode stream | |
| 3212 scope_data()->set_stream(NULL); | |
| 3213 | |
| 3214 scope_data()->add_to_work_list(jsr_start_block); | |
| 3215 | |
| 3216 // Ready to resume parsing in subroutine | |
| 3217 iterate_all_blocks(); | |
| 3218 | |
| 3219 // If we bailed out during parsing, return immediately (this is bad news) | |
| 3220 CHECK_BAILOUT_(false); | |
| 3221 | |
| 3222 // Detect whether the continuation can actually be reached. If not, | |
| 3223 // it has not had state set by the join() operations in | |
| 3224 // iterate_bytecodes_for_block()/ret() and we should not touch the | |
| 3225 // iteration state. The calling activation of | |
| 3226 // iterate_bytecodes_for_block will then complete normally. | |
| 3227 if (cont->state() != NULL) { | |
| 3228 if (!cont->is_set(BlockBegin::was_visited_flag)) { | |
| 3229 // add continuation to work list instead of parsing it immediately | |
| 3230 scope_data()->parent()->add_to_work_list(cont); | |
| 3231 } | |
| 3232 } | |
| 3233 | |
| 3234 assert(jsr_continuation() == cont, "continuation must not have changed"); | |
| 3235 assert(!jsr_continuation()->is_set(BlockBegin::was_visited_flag) || | |
| 3236 jsr_continuation()->is_set(BlockBegin::parser_loop_header_flag), | |
| 3237 "continuation can only be visited in case of backward branches"); | |
| 3238 assert(_last && _last->as_BlockEnd(), "block must have end"); | |
| 3239 | |
| 3240 // continuation is in work list, so end iteration of current block | |
| 3241 _skip_block = true; | |
| 3242 pop_scope_for_jsr(); | |
| 3243 | |
| 3244 return true; | |
| 3245 } | |
| 3246 | |
| 3247 | |
| 3248 // Inline the entry of a synchronized method as a monitor enter and | |
| 3249 // register the exception handler which releases the monitor if an | |
| 3250 // exception is thrown within the callee. Note that the monitor enter | |
| 3251 // cannot throw an exception itself, because the receiver is | |
| 3252 // guaranteed to be non-null by the explicit null check at the | |
| 3253 // beginning of inlining. | |
| 3254 void GraphBuilder::inline_sync_entry(Value lock, BlockBegin* sync_handler) { | |
| 3255 assert(lock != NULL && sync_handler != NULL, "lock or handler missing"); | |
| 3256 | |
| 3257 set_exception_state(state()->copy()); | |
| 3258 monitorenter(lock, SynchronizationEntryBCI); | |
| 3259 assert(_last->as_MonitorEnter() != NULL, "monitor enter expected"); | |
| 3260 _last->set_needs_null_check(false); | |
| 3261 | |
| 3262 sync_handler->set(BlockBegin::exception_entry_flag); | |
| 3263 sync_handler->set(BlockBegin::is_on_work_list_flag); | |
| 3264 | |
| 3265 ciExceptionHandler* desc = new ciExceptionHandler(method()->holder(), 0, method()->code_size(), -1, 0); | |
| 3266 XHandler* h = new XHandler(desc); | |
| 3267 h->set_entry_block(sync_handler); | |
| 3268 scope_data()->xhandlers()->append(h); | |
| 3269 scope_data()->set_has_handler(); | |
| 3270 } | |
| 3271 | |
| 3272 | |
| 3273 // If an exception is thrown and not handled within an inlined | |
| 3274 // synchronized method, the monitor must be released before the | |
| 3275 // exception is rethrown in the outer scope. Generate the appropriate | |
| 3276 // instructions here. | |
| 3277 void GraphBuilder::fill_sync_handler(Value lock, BlockBegin* sync_handler, bool default_handler) { | |
| 3278 BlockBegin* orig_block = _block; | |
| 3279 ValueStack* orig_state = _state; | |
| 3280 Instruction* orig_last = _last; | |
| 3281 _last = _block = sync_handler; | |
| 3282 _state = sync_handler->state()->copy(); | |
| 3283 | |
| 3284 assert(sync_handler != NULL, "handler missing"); | |
| 3285 assert(!sync_handler->is_set(BlockBegin::was_visited_flag), "is visited here"); | |
| 3286 | |
| 3287 assert(lock != NULL || default_handler, "lock or handler missing"); | |
| 3288 | |
| 3289 XHandler* h = scope_data()->xhandlers()->remove_last(); | |
| 3290 assert(h->entry_block() == sync_handler, "corrupt list of handlers"); | |
| 3291 | |
| 3292 block()->set(BlockBegin::was_visited_flag); | |
| 3293 Value exception = append_with_bci(new ExceptionObject(), SynchronizationEntryBCI); | |
| 3294 assert(exception->is_pinned(), "must be"); | |
| 3295 | |
| 3296 int bci = SynchronizationEntryBCI; | |
| 3297 if (lock) { | |
| 3298 assert(state()->locks_size() > 0 && state()->lock_at(state()->locks_size() - 1) == lock, "lock is missing"); | |
| 3299 if (lock->bci() == -99) { | |
| 3300 lock = append_with_bci(lock, -1); | |
| 3301 } | |
| 3302 | |
| 3303 // exit the monitor in the context of the synchronized method | |
| 3304 monitorexit(lock, SynchronizationEntryBCI); | |
| 3305 | |
| 3306 // exit the context of the synchronized method | |
| 3307 if (!default_handler) { | |
| 3308 pop_scope(); | |
| 3309 _state = _state->copy(); | |
| 3310 bci = _state->scope()->caller_bci(); | |
| 3311 _state = _state->pop_scope()->copy(); | |
| 3312 } | |
| 3313 } | |
| 3314 | |
| 3315 // perform the throw as if at the the call site | |
| 3316 apush(exception); | |
| 3317 | |
| 3318 set_exception_state(state()->copy()); | |
| 3319 throw_op(bci); | |
| 3320 | |
| 3321 BlockEnd* end = last()->as_BlockEnd(); | |
| 3322 block()->set_end(end); | |
| 3323 end->set_state(state()); | |
| 3324 | |
| 3325 _block = orig_block; | |
| 3326 _state = orig_state; | |
| 3327 _last = orig_last; | |
| 3328 } | |
| 3329 | |
| 3330 | |
| 3331 bool GraphBuilder::try_inline_full(ciMethod* callee, bool holder_known) { | |
| 3332 assert(!callee->is_native(), "callee must not be native"); | |
| 3333 | |
| 3334 // first perform tests of things it's not possible to inline | |
| 3335 if (callee->has_exception_handlers() && | |
| 3336 !InlineMethodsWithExceptionHandlers) INLINE_BAILOUT("callee has exception handlers"); | |
| 3337 if (callee->is_synchronized() && | |
| 3338 !InlineSynchronizedMethods ) INLINE_BAILOUT("callee is synchronized"); | |
| 3339 if (!callee->holder()->is_initialized()) INLINE_BAILOUT("callee's klass not initialized yet"); | |
| 3340 if (!callee->has_balanced_monitors()) INLINE_BAILOUT("callee's monitors do not match"); | |
| 3341 | |
| 3342 // Proper inlining of methods with jsrs requires a little more work. | |
| 3343 if (callee->has_jsrs() ) INLINE_BAILOUT("jsrs not handled properly by inliner yet"); | |
| 3344 | |
| 3345 // now perform tests that are based on flag settings | |
| 3346 if (inline_level() > MaxInlineLevel ) INLINE_BAILOUT("too-deep inlining"); | |
| 3347 if (recursive_inline_level(callee) > MaxRecursiveInlineLevel) INLINE_BAILOUT("too-deep recursive inlining"); | |
| 3348 if (callee->code_size() > max_inline_size() ) INLINE_BAILOUT("callee is too large"); | |
| 3349 | |
| 3350 // don't inline throwable methods unless the inlining tree is rooted in a throwable class | |
| 3351 if (callee->name() == ciSymbol::object_initializer_name() && | |
| 3352 callee->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { | |
| 3353 // Throwable constructor call | |
| 3354 IRScope* top = scope(); | |
| 3355 while (top->caller() != NULL) { | |
| 3356 top = top->caller(); | |
| 3357 } | |
| 3358 if (!top->method()->holder()->is_subclass_of(ciEnv::current()->Throwable_klass())) { | |
| 3359 INLINE_BAILOUT("don't inline Throwable constructors"); | |
| 3360 } | |
| 3361 } | |
| 3362 | |
| 3363 // When SSE2 is used on intel, then no special handling is needed | |
| 3364 // for strictfp because the enum-constant is fixed at compile time, | |
| 3365 // the check for UseSSE2 is needed here | |
| 3366 if (strict_fp_requires_explicit_rounding && UseSSE < 2 && method()->is_strict() != callee->is_strict()) { | |
| 3367 INLINE_BAILOUT("caller and callee have different strict fp requirements"); | |
| 3368 } | |
| 3369 | |
| 3370 if (compilation()->env()->num_inlined_bytecodes() > DesiredMethodLimit) { | |
| 3371 INLINE_BAILOUT("total inlining greater than DesiredMethodLimit"); | |
| 3372 } | |
| 3373 | |
| 3374 #ifndef PRODUCT | |
| 3375 // printing | |
| 3376 if (PrintInlining) { | |
| 3377 print_inline_result(callee, true); | |
| 3378 } | |
| 3379 #endif | |
| 3380 | |
| 3381 // NOTE: Bailouts from this point on, which occur at the | |
| 3382 // GraphBuilder level, do not cause bailout just of the inlining but | |
| 3383 // in fact of the entire compilation. | |
| 3384 | |
| 3385 BlockBegin* orig_block = block(); | |
| 3386 | |
| 3387 const int args_base = state()->stack_size() - callee->arg_size(); | |
| 3388 assert(args_base >= 0, "stack underflow during inlining"); | |
| 3389 | |
| 3390 // Insert null check if necessary | |
| 3391 Value recv = NULL; | |
| 3392 if (code() != Bytecodes::_invokestatic) { | |
| 3393 // note: null check must happen even if first instruction of callee does | |
| 3394 // an implicit null check since the callee is in a different scope | |
| 3395 // and we must make sure exception handling does the right thing | |
| 3396 assert(!callee->is_static(), "callee must not be static"); | |
| 3397 assert(callee->arg_size() > 0, "must have at least a receiver"); | |
| 3398 recv = state()->stack_at(args_base); | |
| 3399 null_check(recv); | |
| 3400 } | |
| 3401 | |
| 3402 if (profile_inlined_calls()) { | |
| 3403 profile_call(recv, holder_known ? callee->holder() : NULL); | |
| 3404 } | |
| 3405 | |
| 3406 profile_invocation(callee); | |
| 3407 | |
| 3408 // Introduce a new callee continuation point - if the callee has | |
| 3409 // more than one return instruction or the return does not allow | |
| 3410 // fall-through of control flow, all return instructions of the | |
| 3411 // callee will need to be replaced by Goto's pointing to this | |
| 3412 // continuation point. | |
| 3413 BlockBegin* cont = block_at(next_bci()); | |
| 3414 bool continuation_existed = true; | |
| 3415 if (cont == NULL) { | |
| 3416 cont = new BlockBegin(next_bci()); | |
| 3417 // low number so that continuation gets parsed as early as possible | |
| 3418 cont->set_depth_first_number(0); | |
| 3419 #ifndef PRODUCT | |
| 3420 if (PrintInitialBlockList) { | |
| 3421 tty->print_cr("CFG: created block %d (bci %d) as continuation for inline at bci %d", | |
| 3422 cont->block_id(), cont->bci(), bci()); | |
| 3423 } | |
| 3424 #endif | |
| 3425 continuation_existed = false; | |
| 3426 } | |
| 3427 // Record number of predecessors of continuation block before | |
| 3428 // inlining, to detect if inlined method has edges to its | |
| 3429 // continuation after inlining. | |
| 3430 int continuation_preds = cont->number_of_preds(); | |
| 3431 | |
| 3432 // Push callee scope | |
| 3433 push_scope(callee, cont); | |
| 3434 | |
| 3435 // the BlockListBuilder for the callee could have bailed out | |
| 3436 CHECK_BAILOUT_(false); | |
| 3437 | |
| 3438 // Temporarily set up bytecode stream so we can append instructions | |
| 3439 // (only using the bci of this stream) | |
| 3440 scope_data()->set_stream(scope_data()->parent()->stream()); | |
| 3441 | |
| 3442 // Pass parameters into callee state: add assignments | |
| 3443 // note: this will also ensure that all arguments are computed before being passed | |
| 3444 ValueStack* callee_state = state(); | |
| 3445 ValueStack* caller_state = scope()->caller_state(); | |
| 3446 { int i = args_base; | |
| 3447 while (i < caller_state->stack_size()) { | |
| 3448 const int par_no = i - args_base; | |
| 3449 Value arg = caller_state->stack_at_inc(i); | |
| 3450 // NOTE: take base() of arg->type() to avoid problems storing | |
| 3451 // constants | |
| 3452 store_local(callee_state, arg, arg->type()->base(), par_no); | |
| 3453 } | |
| 3454 } | |
| 3455 | |
| 3456 // Remove args from stack. | |
| 3457 // Note that we preserve locals state in case we can use it later | |
| 3458 // (see use of pop_scope() below) | |
| 3459 caller_state->truncate_stack(args_base); | |
| 3460 callee_state->truncate_stack(args_base); | |
| 3461 | |
| 3462 // Setup state that is used at returns form the inlined method. | |
| 3463 // This is essentially the state of the continuation block, | |
| 3464 // but without the return value on stack, if any, this will | |
| 3465 // be pushed at the return instruction (see method_return). | |
| 3466 scope_data()->set_continuation_state(caller_state->copy()); | |
| 3467 | |
| 3468 // Compute lock stack size for callee scope now that args have been passed | |
| 3469 scope()->compute_lock_stack_size(); | |
| 3470 | |
| 3471 Value lock; | |
| 3472 BlockBegin* sync_handler; | |
| 3473 | |
| 3474 // Inline the locking of the receiver if the callee is synchronized | |
| 3475 if (callee->is_synchronized()) { | |
| 3476 lock = callee->is_static() ? append(new Constant(new InstanceConstant(callee->holder()->java_mirror()))) | |
| 3477 : state()->local_at(0); | |
| 3478 sync_handler = new BlockBegin(-1); | |
| 3479 inline_sync_entry(lock, sync_handler); | |
| 3480 | |
| 3481 // recompute the lock stack size | |
| 3482 scope()->compute_lock_stack_size(); | |
| 3483 } | |
| 3484 | |
| 3485 | |
| 3486 BlockBegin* callee_start_block = block_at(0); | |
| 3487 if (callee_start_block != NULL) { | |
| 3488 assert(callee_start_block->is_set(BlockBegin::parser_loop_header_flag), "must be loop header"); | |
| 3489 Goto* goto_callee = new Goto(callee_start_block, false); | |
| 3490 goto_callee->set_state(state()); | |
| 3491 // The state for this goto is in the scope of the callee, so use | |
| 3492 // the entry bci for the callee instead of the call site bci. | |
| 3493 append_with_bci(goto_callee, 0); | |
| 3494 _block->set_end(goto_callee); | |
| 3495 callee_start_block->merge(callee_state); | |
| 3496 | |
| 3497 _last = _block = callee_start_block; | |
| 3498 | |
| 3499 scope_data()->add_to_work_list(callee_start_block); | |
| 3500 } | |
| 3501 | |
| 3502 // Clear out bytecode stream | |
| 3503 scope_data()->set_stream(NULL); | |
| 3504 | |
| 3505 // Ready to resume parsing in callee (either in the same block we | |
| 3506 // were in before or in the callee's start block) | |
| 3507 iterate_all_blocks(callee_start_block == NULL); | |
| 3508 | |
| 3509 // If we bailed out during parsing, return immediately (this is bad news) | |
| 3510 if (bailed_out()) return false; | |
| 3511 | |
| 3512 // iterate_all_blocks theoretically traverses in random order; in | |
| 3513 // practice, we have only traversed the continuation if we are | |
| 3514 // inlining into a subroutine | |
| 3515 assert(continuation_existed || | |
| 3516 !continuation()->is_set(BlockBegin::was_visited_flag), | |
| 3517 "continuation should not have been parsed yet if we created it"); | |
| 3518 | |
| 3519 // If we bailed out during parsing, return immediately (this is bad news) | |
| 3520 CHECK_BAILOUT_(false); | |
| 3521 | |
| 3522 // At this point we are almost ready to return and resume parsing of | |
| 3523 // the caller back in the GraphBuilder. The only thing we want to do | |
| 3524 // first is an optimization: during parsing of the callee we | |
| 3525 // generated at least one Goto to the continuation block. If we | |
| 3526 // generated exactly one, and if the inlined method spanned exactly | |
| 3527 // one block (and we didn't have to Goto its entry), then we snip | |
| 3528 // off the Goto to the continuation, allowing control to fall | |
| 3529 // through back into the caller block and effectively performing | |
| 3530 // block merging. This allows load elimination and CSE to take place | |
| 3531 // across multiple callee scopes if they are relatively simple, and | |
| 3532 // is currently essential to making inlining profitable. | |
| 3533 if ( num_returns() == 1 | |
| 3534 && block() == orig_block | |
| 3535 && block() == inline_cleanup_block()) { | |
| 3536 _last = inline_cleanup_return_prev(); | |
| 3537 _state = inline_cleanup_state()->pop_scope(); | |
| 3538 } else if (continuation_preds == cont->number_of_preds()) { | |
| 3539 // Inlining caused that the instructions after the invoke in the | |
| 3540 // caller are not reachable any more. So skip filling this block | |
| 3541 // with instructions! | |
| 3542 assert (cont == continuation(), ""); | |
| 3543 assert(_last && _last->as_BlockEnd(), ""); | |
| 3544 _skip_block = true; | |
| 3545 } else { | |
| 3546 // Resume parsing in continuation block unless it was already parsed. | |
| 3547 // Note that if we don't change _last here, iteration in | |
| 3548 // iterate_bytecodes_for_block will stop when we return. | |
| 3549 if (!continuation()->is_set(BlockBegin::was_visited_flag)) { | |
| 3550 // add continuation to work list instead of parsing it immediately | |
| 3551 assert(_last && _last->as_BlockEnd(), ""); | |
| 3552 scope_data()->parent()->add_to_work_list(continuation()); | |
| 3553 _skip_block = true; | |
| 3554 } | |
| 3555 } | |
| 3556 | |
| 3557 // Fill the exception handler for synchronized methods with instructions | |
| 3558 if (callee->is_synchronized() && sync_handler->state() != NULL) { | |
| 3559 fill_sync_handler(lock, sync_handler); | |
| 3560 } else { | |
| 3561 pop_scope(); | |
| 3562 } | |
| 3563 | |
| 3564 compilation()->notice_inlined_method(callee); | |
| 3565 | |
| 3566 return true; | |
| 3567 } | |
| 3568 | |
| 3569 | |
| 3570 void GraphBuilder::inline_bailout(const char* msg) { | |
| 3571 assert(msg != NULL, "inline bailout msg must exist"); | |
| 3572 _inline_bailout_msg = msg; | |
| 3573 } | |
| 3574 | |
| 3575 | |
| 3576 void GraphBuilder::clear_inline_bailout() { | |
| 3577 _inline_bailout_msg = NULL; | |
| 3578 } | |
| 3579 | |
| 3580 | |
| 3581 void GraphBuilder::push_root_scope(IRScope* scope, BlockList* bci2block, BlockBegin* start) { | |
| 3582 ScopeData* data = new ScopeData(NULL); | |
| 3583 data->set_scope(scope); | |
| 3584 data->set_bci2block(bci2block); | |
| 3585 _scope_data = data; | |
| 3586 _block = start; | |
| 3587 } | |
| 3588 | |
| 3589 | |
| 3590 void GraphBuilder::push_scope(ciMethod* callee, BlockBegin* continuation) { | |
| 3591 IRScope* callee_scope = new IRScope(compilation(), scope(), bci(), callee, -1, false); | |
| 3592 scope()->add_callee(callee_scope); | |
| 3593 | |
| 3594 BlockListBuilder blb(compilation(), callee_scope, -1); | |
| 3595 CHECK_BAILOUT(); | |
| 3596 | |
| 3597 if (!blb.bci2block()->at(0)->is_set(BlockBegin::parser_loop_header_flag)) { | |
| 3598 // this scope can be inlined directly into the caller so remove | |
| 3599 // the block at bci 0. | |
| 3600 blb.bci2block()->at_put(0, NULL); | |
| 3601 } | |
| 3602 | |
| 3603 callee_scope->set_caller_state(state()); | |
| 3604 set_state(state()->push_scope(callee_scope)); | |
| 3605 | |
| 3606 ScopeData* data = new ScopeData(scope_data()); | |
| 3607 data->set_scope(callee_scope); | |
| 3608 data->set_bci2block(blb.bci2block()); | |
| 3609 data->set_continuation(continuation); | |
| 3610 _scope_data = data; | |
| 3611 } | |
| 3612 | |
| 3613 | |
| 3614 void GraphBuilder::push_scope_for_jsr(BlockBegin* jsr_continuation, int jsr_dest_bci) { | |
| 3615 ScopeData* data = new ScopeData(scope_data()); | |
| 3616 data->set_parsing_jsr(); | |
| 3617 data->set_jsr_entry_bci(jsr_dest_bci); | |
| 3618 data->set_jsr_return_address_local(-1); | |
| 3619 // Must clone bci2block list as we will be mutating it in order to | |
| 3620 // properly clone all blocks in jsr region as well as exception | |
| 3621 // handlers containing rets | |
| 3622 BlockList* new_bci2block = new BlockList(bci2block()->length()); | |
| 3623 new_bci2block->push_all(bci2block()); | |
| 3624 data->set_bci2block(new_bci2block); | |
| 3625 data->set_scope(scope()); | |
| 3626 data->setup_jsr_xhandlers(); | |
| 3627 data->set_continuation(continuation()); | |
| 3628 if (continuation() != NULL) { | |
| 3629 assert(continuation_state() != NULL, ""); | |
| 3630 data->set_continuation_state(continuation_state()->copy()); | |
| 3631 } | |
| 3632 data->set_jsr_continuation(jsr_continuation); | |
| 3633 _scope_data = data; | |
| 3634 } | |
| 3635 | |
| 3636 | |
| 3637 void GraphBuilder::pop_scope() { | |
| 3638 int number_of_locks = scope()->number_of_locks(); | |
| 3639 _scope_data = scope_data()->parent(); | |
| 3640 // accumulate minimum number of monitor slots to be reserved | |
| 3641 scope()->set_min_number_of_locks(number_of_locks); | |
| 3642 } | |
| 3643 | |
| 3644 | |
| 3645 void GraphBuilder::pop_scope_for_jsr() { | |
| 3646 _scope_data = scope_data()->parent(); | |
| 3647 } | |
| 3648 | |
| 3649 bool GraphBuilder::append_unsafe_get_obj(ciMethod* callee, BasicType t, bool is_volatile) { | |
| 3650 if (InlineUnsafeOps) { | |
| 3651 Values* args = state()->pop_arguments(callee->arg_size()); | |
| 3652 null_check(args->at(0)); | |
| 3653 Instruction* offset = args->at(2); | |
| 3654 #ifndef _LP64 | |
| 3655 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
| 3656 #endif | |
| 3657 Instruction* op = append(new UnsafeGetObject(t, args->at(1), offset, is_volatile)); | |
| 3658 push(op->type(), op); | |
| 3659 compilation()->set_has_unsafe_access(true); | |
| 3660 } | |
| 3661 return InlineUnsafeOps; | |
| 3662 } | |
| 3663 | |
| 3664 | |
| 3665 bool GraphBuilder::append_unsafe_put_obj(ciMethod* callee, BasicType t, bool is_volatile) { | |
| 3666 if (InlineUnsafeOps) { | |
| 3667 Values* args = state()->pop_arguments(callee->arg_size()); | |
| 3668 null_check(args->at(0)); | |
| 3669 Instruction* offset = args->at(2); | |
| 3670 #ifndef _LP64 | |
| 3671 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
| 3672 #endif | |
| 3673 Instruction* op = append(new UnsafePutObject(t, args->at(1), offset, args->at(3), is_volatile)); | |
| 3674 compilation()->set_has_unsafe_access(true); | |
| 3675 kill_all(); | |
| 3676 } | |
| 3677 return InlineUnsafeOps; | |
| 3678 } | |
| 3679 | |
| 3680 | |
| 3681 bool GraphBuilder::append_unsafe_get_raw(ciMethod* callee, BasicType t) { | |
| 3682 if (InlineUnsafeOps) { | |
| 3683 Values* args = state()->pop_arguments(callee->arg_size()); | |
| 3684 null_check(args->at(0)); | |
| 3685 Instruction* op = append(new UnsafeGetRaw(t, args->at(1), false)); | |
| 3686 push(op->type(), op); | |
| 3687 compilation()->set_has_unsafe_access(true); | |
| 3688 } | |
| 3689 return InlineUnsafeOps; | |
| 3690 } | |
| 3691 | |
| 3692 | |
| 3693 bool GraphBuilder::append_unsafe_put_raw(ciMethod* callee, BasicType t) { | |
| 3694 if (InlineUnsafeOps) { | |
| 3695 Values* args = state()->pop_arguments(callee->arg_size()); | |
| 3696 null_check(args->at(0)); | |
| 3697 Instruction* op = append(new UnsafePutRaw(t, args->at(1), args->at(2))); | |
| 3698 compilation()->set_has_unsafe_access(true); | |
| 3699 } | |
| 3700 return InlineUnsafeOps; | |
| 3701 } | |
| 3702 | |
| 3703 | |
| 3704 bool GraphBuilder::append_unsafe_prefetch(ciMethod* callee, bool is_static, bool is_store) { | |
| 3705 if (InlineUnsafeOps) { | |
| 3706 Values* args = state()->pop_arguments(callee->arg_size()); | |
| 3707 int obj_arg_index = 1; // Assume non-static case | |
| 3708 if (is_static) { | |
| 3709 obj_arg_index = 0; | |
| 3710 } else { | |
| 3711 null_check(args->at(0)); | |
| 3712 } | |
| 3713 Instruction* offset = args->at(obj_arg_index + 1); | |
| 3714 #ifndef _LP64 | |
| 3715 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
| 3716 #endif | |
| 3717 Instruction* op = is_store ? append(new UnsafePrefetchWrite(args->at(obj_arg_index), offset)) | |
| 3718 : append(new UnsafePrefetchRead (args->at(obj_arg_index), offset)); | |
| 3719 compilation()->set_has_unsafe_access(true); | |
| 3720 } | |
| 3721 return InlineUnsafeOps; | |
| 3722 } | |
| 3723 | |
| 3724 | |
| 3725 void GraphBuilder::append_unsafe_CAS(ciMethod* callee) { | |
| 3726 ValueType* result_type = as_ValueType(callee->return_type()); | |
| 3727 assert(result_type->is_int(), "int result"); | |
| 3728 Values* args = state()->pop_arguments(callee->arg_size()); | |
| 3729 | |
| 3730 // Pop off some args to speically handle, then push back | |
| 3731 Value newval = args->pop(); | |
| 3732 Value cmpval = args->pop(); | |
| 3733 Value offset = args->pop(); | |
| 3734 Value src = args->pop(); | |
| 3735 Value unsafe_obj = args->pop(); | |
| 3736 | |
| 3737 // Separately handle the unsafe arg. It is not needed for code | |
| 3738 // generation, but must be null checked | |
| 3739 null_check(unsafe_obj); | |
| 3740 | |
| 3741 #ifndef _LP64 | |
| 3742 offset = append(new Convert(Bytecodes::_l2i, offset, as_ValueType(T_INT))); | |
| 3743 #endif | |
| 3744 | |
| 3745 args->push(src); | |
| 3746 args->push(offset); | |
| 3747 args->push(cmpval); | |
| 3748 args->push(newval); | |
| 3749 | |
| 3750 // An unsafe CAS can alias with other field accesses, but we don't | |
| 3751 // know which ones so mark the state as no preserved. This will | |
| 3752 // cause CSE to invalidate memory across it. | |
| 3753 bool preserves_state = false; | |
| 3754 Intrinsic* result = new Intrinsic(result_type, callee->intrinsic_id(), args, false, lock_stack(), preserves_state); | |
| 3755 append_split(result); | |
| 3756 push(result_type, result); | |
| 3757 compilation()->set_has_unsafe_access(true); | |
| 3758 } | |
| 3759 | |
| 3760 | |
| 3761 #ifndef PRODUCT | |
| 3762 void GraphBuilder::print_inline_result(ciMethod* callee, bool res) { | |
| 3763 const char sync_char = callee->is_synchronized() ? 's' : ' '; | |
| 3764 const char exception_char = callee->has_exception_handlers() ? '!' : ' '; | |
| 3765 const char monitors_char = callee->has_monitor_bytecodes() ? 'm' : ' '; | |
| 3766 tty->print(" %c%c%c ", sync_char, exception_char, monitors_char); | |
| 3767 for (int i = 0; i < scope()->level(); i++) tty->print(" "); | |
| 3768 if (res) { | |
| 3769 tty->print(" "); | |
| 3770 } else { | |
| 3771 tty->print("- "); | |
| 3772 } | |
| 3773 tty->print("@ %d ", bci()); | |
| 3774 callee->print_short_name(); | |
| 3775 tty->print(" (%d bytes)", callee->code_size()); | |
| 3776 if (_inline_bailout_msg) { | |
| 3777 tty->print(" %s", _inline_bailout_msg); | |
| 3778 } | |
| 3779 tty->cr(); | |
| 3780 | |
| 3781 if (res && CIPrintMethodCodes) { | |
| 3782 callee->print_codes(); | |
| 3783 } | |
| 3784 } | |
| 3785 | |
| 3786 | |
| 3787 void GraphBuilder::print_stats() { | |
| 3788 vmap()->print(); | |
| 3789 } | |
| 3790 #endif // PRODUCT | |
| 3791 | |
| 3792 | |
| 3793 void GraphBuilder::profile_call(Value recv, ciKlass* known_holder) { | |
| 3794 append(new ProfileCall(method(), bci(), recv, known_holder)); | |
| 3795 } | |
| 3796 | |
| 3797 | |
| 3798 void GraphBuilder::profile_invocation(ciMethod* callee) { | |
| 3799 if (profile_calls()) { | |
| 3800 // increment the interpreter_invocation_count for the inlinee | |
| 3801 Value m = append(new Constant(new ObjectConstant(callee))); | |
| 3802 append(new ProfileCounter(m, methodOopDesc::interpreter_invocation_counter_offset_in_bytes(), 1)); | |
| 3803 } | |
| 3804 } | |
| 3805 | |
| 3806 | |
| 3807 void GraphBuilder::profile_bci(int bci) { | |
| 3808 if (profile_branches()) { | |
| 3809 ciMethodData* md = method()->method_data(); | |
| 3810 if (md == NULL) { | |
| 3811 BAILOUT("out of memory building methodDataOop"); | |
| 3812 } | |
| 3813 ciProfileData* data = md->bci_to_data(bci); | |
| 3814 assert(data != NULL && data->is_JumpData(), "need JumpData for goto"); | |
| 3815 Value mdo = append(new Constant(new ObjectConstant(md))); | |
| 3816 append(new ProfileCounter(mdo, md->byte_offset_of_slot(data, JumpData::taken_offset()), 1)); | |
| 3817 } | |
| 3818 } |