Mercurial > hg > truffle
annotate src/cpu/x86/vm/x86_32.ad @ 113:ba764ed4b6f2
6420645: Create a vm that uses compressed oops for up to 32gb heapsizes
Summary: Compressed oops in instances, arrays, and headers. Code contributors are coleenp, phh, never, swamyv
Reviewed-by: jmasa, kamg, acorn, tbell, kvn, rasbold
| author | coleenp |
|---|---|
| date | Sun, 13 Apr 2008 17:43:42 -0400 |
| parents | 3d62cb85208d |
| children | 9148c65abefc |
| rev | line source |
|---|---|
| 0 | 1 // |
| 2 // Copyright 1997-2007 Sun Microsystems, Inc. All Rights Reserved. | |
| 3 // DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. | |
| 4 // | |
| 5 // This code is free software; you can redistribute it and/or modify it | |
| 6 // under the terms of the GNU General Public License version 2 only, as | |
| 7 // published by the Free Software Foundation. | |
| 8 // | |
| 9 // This code is distributed in the hope that it will be useful, but WITHOUT | |
| 10 // ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or | |
| 11 // FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License | |
| 12 // version 2 for more details (a copy is included in the LICENSE file that | |
| 13 // accompanied this code). | |
| 14 // | |
| 15 // You should have received a copy of the GNU General Public License version | |
| 16 // 2 along with this work; if not, write to the Free Software Foundation, | |
| 17 // Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. | |
| 18 // | |
| 19 // Please contact Sun Microsystems, Inc., 4150 Network Circle, Santa Clara, | |
| 20 // CA 95054 USA or visit www.sun.com if you need additional information or | |
| 21 // have any questions. | |
| 22 // | |
| 23 // | |
| 24 | |
| 25 // X86 Architecture Description File | |
| 26 | |
| 27 //----------REGISTER DEFINITION BLOCK------------------------------------------ | |
| 28 // This information is used by the matcher and the register allocator to | |
| 29 // describe individual registers and classes of registers within the target | |
| 30 // archtecture. | |
| 31 | |
| 32 register %{ | |
| 33 //----------Architecture Description Register Definitions---------------------- | |
| 34 // General Registers | |
| 35 // "reg_def" name ( register save type, C convention save type, | |
| 36 // ideal register type, encoding ); | |
| 37 // Register Save Types: | |
| 38 // | |
| 39 // NS = No-Save: The register allocator assumes that these registers | |
| 40 // can be used without saving upon entry to the method, & | |
| 41 // that they do not need to be saved at call sites. | |
| 42 // | |
| 43 // SOC = Save-On-Call: The register allocator assumes that these registers | |
| 44 // can be used without saving upon entry to the method, | |
| 45 // but that they must be saved at call sites. | |
| 46 // | |
| 47 // SOE = Save-On-Entry: The register allocator assumes that these registers | |
| 48 // must be saved before using them upon entry to the | |
| 49 // method, but they do not need to be saved at call | |
| 50 // sites. | |
| 51 // | |
| 52 // AS = Always-Save: The register allocator assumes that these registers | |
| 53 // must be saved before using them upon entry to the | |
| 54 // method, & that they must be saved at call sites. | |
| 55 // | |
| 56 // Ideal Register Type is used to determine how to save & restore a | |
| 57 // register. Op_RegI will get spilled with LoadI/StoreI, Op_RegP will get | |
| 58 // spilled with LoadP/StoreP. If the register supports both, use Op_RegI. | |
| 59 // | |
| 60 // The encoding number is the actual bit-pattern placed into the opcodes. | |
| 61 | |
| 62 // General Registers | |
| 63 // Previously set EBX, ESI, and EDI as save-on-entry for java code | |
| 64 // Turn off SOE in java-code due to frequent use of uncommon-traps. | |
| 65 // Now that allocator is better, turn on ESI and EDI as SOE registers. | |
| 66 | |
| 67 reg_def EBX(SOC, SOE, Op_RegI, 3, rbx->as_VMReg()); | |
| 68 reg_def ECX(SOC, SOC, Op_RegI, 1, rcx->as_VMReg()); | |
| 69 reg_def ESI(SOC, SOE, Op_RegI, 6, rsi->as_VMReg()); | |
| 70 reg_def EDI(SOC, SOE, Op_RegI, 7, rdi->as_VMReg()); | |
| 71 // now that adapter frames are gone EBP is always saved and restored by the prolog/epilog code | |
| 72 reg_def EBP(NS, SOE, Op_RegI, 5, rbp->as_VMReg()); | |
| 73 reg_def EDX(SOC, SOC, Op_RegI, 2, rdx->as_VMReg()); | |
| 74 reg_def EAX(SOC, SOC, Op_RegI, 0, rax->as_VMReg()); | |
| 75 reg_def ESP( NS, NS, Op_RegI, 4, rsp->as_VMReg()); | |
| 76 | |
| 77 // Special Registers | |
| 78 reg_def EFLAGS(SOC, SOC, 0, 8, VMRegImpl::Bad()); | |
| 79 | |
| 80 // Float registers. We treat TOS/FPR0 special. It is invisible to the | |
| 81 // allocator, and only shows up in the encodings. | |
| 82 reg_def FPR0L( SOC, SOC, Op_RegF, 0, VMRegImpl::Bad()); | |
| 83 reg_def FPR0H( SOC, SOC, Op_RegF, 0, VMRegImpl::Bad()); | |
| 84 // Ok so here's the trick FPR1 is really st(0) except in the midst | |
| 85 // of emission of assembly for a machnode. During the emission the fpu stack | |
| 86 // is pushed making FPR1 == st(1) temporarily. However at any safepoint | |
| 87 // the stack will not have this element so FPR1 == st(0) from the | |
| 88 // oopMap viewpoint. This same weirdness with numbering causes | |
| 89 // instruction encoding to have to play games with the register | |
| 90 // encode to correct for this 0/1 issue. See MachSpillCopyNode::implementation | |
| 91 // where it does flt->flt moves to see an example | |
| 92 // | |
| 93 reg_def FPR1L( SOC, SOC, Op_RegF, 1, as_FloatRegister(0)->as_VMReg()); | |
| 94 reg_def FPR1H( SOC, SOC, Op_RegF, 1, as_FloatRegister(0)->as_VMReg()->next()); | |
| 95 reg_def FPR2L( SOC, SOC, Op_RegF, 2, as_FloatRegister(1)->as_VMReg()); | |
| 96 reg_def FPR2H( SOC, SOC, Op_RegF, 2, as_FloatRegister(1)->as_VMReg()->next()); | |
| 97 reg_def FPR3L( SOC, SOC, Op_RegF, 3, as_FloatRegister(2)->as_VMReg()); | |
| 98 reg_def FPR3H( SOC, SOC, Op_RegF, 3, as_FloatRegister(2)->as_VMReg()->next()); | |
| 99 reg_def FPR4L( SOC, SOC, Op_RegF, 4, as_FloatRegister(3)->as_VMReg()); | |
| 100 reg_def FPR4H( SOC, SOC, Op_RegF, 4, as_FloatRegister(3)->as_VMReg()->next()); | |
| 101 reg_def FPR5L( SOC, SOC, Op_RegF, 5, as_FloatRegister(4)->as_VMReg()); | |
| 102 reg_def FPR5H( SOC, SOC, Op_RegF, 5, as_FloatRegister(4)->as_VMReg()->next()); | |
| 103 reg_def FPR6L( SOC, SOC, Op_RegF, 6, as_FloatRegister(5)->as_VMReg()); | |
| 104 reg_def FPR6H( SOC, SOC, Op_RegF, 6, as_FloatRegister(5)->as_VMReg()->next()); | |
| 105 reg_def FPR7L( SOC, SOC, Op_RegF, 7, as_FloatRegister(6)->as_VMReg()); | |
| 106 reg_def FPR7H( SOC, SOC, Op_RegF, 7, as_FloatRegister(6)->as_VMReg()->next()); | |
| 107 | |
| 108 // XMM registers. 128-bit registers or 4 words each, labeled a-d. | |
| 109 // Word a in each register holds a Float, words ab hold a Double. | |
| 110 // We currently do not use the SIMD capabilities, so registers cd | |
| 111 // are unused at the moment. | |
| 112 reg_def XMM0a( SOC, SOC, Op_RegF, 0, xmm0->as_VMReg()); | |
| 113 reg_def XMM0b( SOC, SOC, Op_RegF, 0, xmm0->as_VMReg()->next()); | |
| 114 reg_def XMM1a( SOC, SOC, Op_RegF, 1, xmm1->as_VMReg()); | |
| 115 reg_def XMM1b( SOC, SOC, Op_RegF, 1, xmm1->as_VMReg()->next()); | |
| 116 reg_def XMM2a( SOC, SOC, Op_RegF, 2, xmm2->as_VMReg()); | |
| 117 reg_def XMM2b( SOC, SOC, Op_RegF, 2, xmm2->as_VMReg()->next()); | |
| 118 reg_def XMM3a( SOC, SOC, Op_RegF, 3, xmm3->as_VMReg()); | |
| 119 reg_def XMM3b( SOC, SOC, Op_RegF, 3, xmm3->as_VMReg()->next()); | |
| 120 reg_def XMM4a( SOC, SOC, Op_RegF, 4, xmm4->as_VMReg()); | |
| 121 reg_def XMM4b( SOC, SOC, Op_RegF, 4, xmm4->as_VMReg()->next()); | |
| 122 reg_def XMM5a( SOC, SOC, Op_RegF, 5, xmm5->as_VMReg()); | |
| 123 reg_def XMM5b( SOC, SOC, Op_RegF, 5, xmm5->as_VMReg()->next()); | |
| 124 reg_def XMM6a( SOC, SOC, Op_RegF, 6, xmm6->as_VMReg()); | |
| 125 reg_def XMM6b( SOC, SOC, Op_RegF, 6, xmm6->as_VMReg()->next()); | |
| 126 reg_def XMM7a( SOC, SOC, Op_RegF, 7, xmm7->as_VMReg()); | |
| 127 reg_def XMM7b( SOC, SOC, Op_RegF, 7, xmm7->as_VMReg()->next()); | |
| 128 | |
| 129 // Specify priority of register selection within phases of register | |
| 130 // allocation. Highest priority is first. A useful heuristic is to | |
| 131 // give registers a low priority when they are required by machine | |
| 132 // instructions, like EAX and EDX. Registers which are used as | |
| 133 // pairs must fall on an even boundry (witness the FPR#L's in this list). | |
| 134 // For the Intel integer registers, the equivalent Long pairs are | |
| 135 // EDX:EAX, EBX:ECX, and EDI:EBP. | |
| 136 alloc_class chunk0( ECX, EBX, EBP, EDI, EAX, EDX, ESI, ESP, | |
| 137 FPR0L, FPR0H, FPR1L, FPR1H, FPR2L, FPR2H, | |
| 138 FPR3L, FPR3H, FPR4L, FPR4H, FPR5L, FPR5H, | |
| 139 FPR6L, FPR6H, FPR7L, FPR7H ); | |
| 140 | |
| 141 alloc_class chunk1( XMM0a, XMM0b, | |
| 142 XMM1a, XMM1b, | |
| 143 XMM2a, XMM2b, | |
| 144 XMM3a, XMM3b, | |
| 145 XMM4a, XMM4b, | |
| 146 XMM5a, XMM5b, | |
| 147 XMM6a, XMM6b, | |
| 148 XMM7a, XMM7b, EFLAGS); | |
| 149 | |
| 150 | |
| 151 //----------Architecture Description Register Classes-------------------------- | |
| 152 // Several register classes are automatically defined based upon information in | |
| 153 // this architecture description. | |
| 154 // 1) reg_class inline_cache_reg ( /* as def'd in frame section */ ) | |
| 155 // 2) reg_class compiler_method_oop_reg ( /* as def'd in frame section */ ) | |
| 156 // 2) reg_class interpreter_method_oop_reg ( /* as def'd in frame section */ ) | |
| 157 // 3) reg_class stack_slots( /* one chunk of stack-based "registers" */ ) | |
| 158 // | |
| 159 // Class for all registers | |
| 160 reg_class any_reg(EAX, EDX, EBP, EDI, ESI, ECX, EBX, ESP); | |
| 161 // Class for general registers | |
| 162 reg_class e_reg(EAX, EDX, EBP, EDI, ESI, ECX, EBX); | |
| 163 // Class for general registers which may be used for implicit null checks on win95 | |
| 164 // Also safe for use by tailjump. We don't want to allocate in rbp, | |
| 165 reg_class e_reg_no_rbp(EAX, EDX, EDI, ESI, ECX, EBX); | |
| 166 // Class of "X" registers | |
| 167 reg_class x_reg(EBX, ECX, EDX, EAX); | |
| 168 // Class of registers that can appear in an address with no offset. | |
| 169 // EBP and ESP require an extra instruction byte for zero offset. | |
| 170 // Used in fast-unlock | |
| 171 reg_class p_reg(EDX, EDI, ESI, EBX); | |
| 172 // Class for general registers not including ECX | |
| 173 reg_class ncx_reg(EAX, EDX, EBP, EDI, ESI, EBX); | |
| 174 // Class for general registers not including EAX | |
| 175 reg_class nax_reg(EDX, EDI, ESI, ECX, EBX); | |
| 176 // Class for general registers not including EAX or EBX. | |
| 177 reg_class nabx_reg(EDX, EDI, ESI, ECX, EBP); | |
| 178 // Class of EAX (for multiply and divide operations) | |
| 179 reg_class eax_reg(EAX); | |
| 180 // Class of EBX (for atomic add) | |
| 181 reg_class ebx_reg(EBX); | |
| 182 // Class of ECX (for shift and JCXZ operations and cmpLTMask) | |
| 183 reg_class ecx_reg(ECX); | |
| 184 // Class of EDX (for multiply and divide operations) | |
| 185 reg_class edx_reg(EDX); | |
| 186 // Class of EDI (for synchronization) | |
| 187 reg_class edi_reg(EDI); | |
| 188 // Class of ESI (for synchronization) | |
| 189 reg_class esi_reg(ESI); | |
| 190 // Singleton class for interpreter's stack pointer | |
| 191 reg_class ebp_reg(EBP); | |
| 192 // Singleton class for stack pointer | |
| 193 reg_class sp_reg(ESP); | |
| 194 // Singleton class for instruction pointer | |
| 195 // reg_class ip_reg(EIP); | |
| 196 // Singleton class for condition codes | |
| 197 reg_class int_flags(EFLAGS); | |
| 198 // Class of integer register pairs | |
| 199 reg_class long_reg( EAX,EDX, ECX,EBX, EBP,EDI ); | |
| 200 // Class of integer register pairs that aligns with calling convention | |
| 201 reg_class eadx_reg( EAX,EDX ); | |
| 202 reg_class ebcx_reg( ECX,EBX ); | |
| 203 // Not AX or DX, used in divides | |
| 204 reg_class nadx_reg( EBX,ECX,ESI,EDI,EBP ); | |
| 205 | |
| 206 // Floating point registers. Notice FPR0 is not a choice. | |
| 207 // FPR0 is not ever allocated; we use clever encodings to fake | |
| 208 // a 2-address instructions out of Intels FP stack. | |
| 209 reg_class flt_reg( FPR1L,FPR2L,FPR3L,FPR4L,FPR5L,FPR6L,FPR7L ); | |
| 210 | |
| 211 // make a register class for SSE registers | |
| 212 reg_class xmm_reg(XMM0a, XMM1a, XMM2a, XMM3a, XMM4a, XMM5a, XMM6a, XMM7a); | |
| 213 | |
| 214 // make a double register class for SSE2 registers | |
| 215 reg_class xdb_reg(XMM0a,XMM0b, XMM1a,XMM1b, XMM2a,XMM2b, XMM3a,XMM3b, | |
| 216 XMM4a,XMM4b, XMM5a,XMM5b, XMM6a,XMM6b, XMM7a,XMM7b ); | |
| 217 | |
| 218 reg_class dbl_reg( FPR1L,FPR1H, FPR2L,FPR2H, FPR3L,FPR3H, | |
| 219 FPR4L,FPR4H, FPR5L,FPR5H, FPR6L,FPR6H, | |
| 220 FPR7L,FPR7H ); | |
| 221 | |
| 222 reg_class flt_reg0( FPR1L ); | |
| 223 reg_class dbl_reg0( FPR1L,FPR1H ); | |
| 224 reg_class dbl_reg1( FPR2L,FPR2H ); | |
| 225 reg_class dbl_notreg0( FPR2L,FPR2H, FPR3L,FPR3H, FPR4L,FPR4H, | |
| 226 FPR5L,FPR5H, FPR6L,FPR6H, FPR7L,FPR7H ); | |
| 227 | |
| 228 // XMM6 and XMM7 could be used as temporary registers for long, float and | |
| 229 // double values for SSE2. | |
| 230 reg_class xdb_reg6( XMM6a,XMM6b ); | |
| 231 reg_class xdb_reg7( XMM7a,XMM7b ); | |
| 232 %} | |
| 233 | |
| 234 | |
| 235 //----------SOURCE BLOCK------------------------------------------------------- | |
| 236 // This is a block of C++ code which provides values, functions, and | |
| 237 // definitions necessary in the rest of the architecture description | |
| 238 source %{ | |
| 239 #define RELOC_IMM32 Assembler::imm32_operand | |
| 240 #define RELOC_DISP32 Assembler::disp32_operand | |
| 241 | |
| 242 #define __ _masm. | |
| 243 | |
| 244 // How to find the high register of a Long pair, given the low register | |
| 245 #define HIGH_FROM_LOW(x) ((x)+2) | |
| 246 | |
| 247 // These masks are used to provide 128-bit aligned bitmasks to the XMM | |
| 248 // instructions, to allow sign-masking or sign-bit flipping. They allow | |
| 249 // fast versions of NegF/NegD and AbsF/AbsD. | |
| 250 | |
| 251 // Note: 'double' and 'long long' have 32-bits alignment on x86. | |
| 252 static jlong* double_quadword(jlong *adr, jlong lo, jlong hi) { | |
| 253 // Use the expression (adr)&(~0xF) to provide 128-bits aligned address | |
| 254 // of 128-bits operands for SSE instructions. | |
| 255 jlong *operand = (jlong*)(((uintptr_t)adr)&((uintptr_t)(~0xF))); | |
| 256 // Store the value to a 128-bits operand. | |
| 257 operand[0] = lo; | |
| 258 operand[1] = hi; | |
| 259 return operand; | |
| 260 } | |
| 261 | |
| 262 // Buffer for 128-bits masks used by SSE instructions. | |
| 263 static jlong fp_signmask_pool[(4+1)*2]; // 4*128bits(data) + 128bits(alignment) | |
| 264 | |
| 265 // Static initialization during VM startup. | |
| 266 static jlong *float_signmask_pool = double_quadword(&fp_signmask_pool[1*2], CONST64(0x7FFFFFFF7FFFFFFF), CONST64(0x7FFFFFFF7FFFFFFF)); | |
| 267 static jlong *double_signmask_pool = double_quadword(&fp_signmask_pool[2*2], CONST64(0x7FFFFFFFFFFFFFFF), CONST64(0x7FFFFFFFFFFFFFFF)); | |
| 268 static jlong *float_signflip_pool = double_quadword(&fp_signmask_pool[3*2], CONST64(0x8000000080000000), CONST64(0x8000000080000000)); | |
| 269 static jlong *double_signflip_pool = double_quadword(&fp_signmask_pool[4*2], CONST64(0x8000000000000000), CONST64(0x8000000000000000)); | |
| 270 | |
| 271 // !!!!! Special hack to get all type of calls to specify the byte offset | |
| 272 // from the start of the call to the point where the return address | |
| 273 // will point. | |
| 274 int MachCallStaticJavaNode::ret_addr_offset() { | |
| 275 return 5 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); // 5 bytes from start of call to where return address points | |
| 276 } | |
| 277 | |
| 278 int MachCallDynamicJavaNode::ret_addr_offset() { | |
| 279 return 10 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); // 10 bytes from start of call to where return address points | |
| 280 } | |
| 281 | |
| 282 static int sizeof_FFree_Float_Stack_All = -1; | |
| 283 | |
| 284 int MachCallRuntimeNode::ret_addr_offset() { | |
| 285 assert(sizeof_FFree_Float_Stack_All != -1, "must have been emitted already"); | |
| 286 return sizeof_FFree_Float_Stack_All + 5 + (Compile::current()->in_24_bit_fp_mode() ? 6 : 0); | |
| 287 } | |
| 288 | |
| 289 // Indicate if the safepoint node needs the polling page as an input. | |
| 290 // Since x86 does have absolute addressing, it doesn't. | |
| 291 bool SafePointNode::needs_polling_address_input() { | |
| 292 return false; | |
| 293 } | |
| 294 | |
| 295 // | |
| 296 // Compute padding required for nodes which need alignment | |
| 297 // | |
| 298 | |
| 299 // The address of the call instruction needs to be 4-byte aligned to | |
| 300 // ensure that it does not span a cache line so that it can be patched. | |
| 301 int CallStaticJavaDirectNode::compute_padding(int current_offset) const { | |
| 302 if (Compile::current()->in_24_bit_fp_mode()) | |
| 303 current_offset += 6; // skip fldcw in pre_call_FPU, if any | |
| 304 current_offset += 1; // skip call opcode byte | |
| 305 return round_to(current_offset, alignment_required()) - current_offset; | |
| 306 } | |
| 307 | |
| 308 // The address of the call instruction needs to be 4-byte aligned to | |
| 309 // ensure that it does not span a cache line so that it can be patched. | |
| 310 int CallDynamicJavaDirectNode::compute_padding(int current_offset) const { | |
| 311 if (Compile::current()->in_24_bit_fp_mode()) | |
| 312 current_offset += 6; // skip fldcw in pre_call_FPU, if any | |
| 313 current_offset += 5; // skip MOV instruction | |
| 314 current_offset += 1; // skip call opcode byte | |
| 315 return round_to(current_offset, alignment_required()) - current_offset; | |
| 316 } | |
| 317 | |
| 318 #ifndef PRODUCT | |
| 319 void MachBreakpointNode::format( PhaseRegAlloc *, outputStream* st ) const { | |
| 320 st->print("INT3"); | |
| 321 } | |
| 322 #endif | |
| 323 | |
| 324 // EMIT_RM() | |
| 325 void emit_rm(CodeBuffer &cbuf, int f1, int f2, int f3) { | |
| 326 unsigned char c = (unsigned char)((f1 << 6) | (f2 << 3) | f3); | |
| 327 *(cbuf.code_end()) = c; | |
| 328 cbuf.set_code_end(cbuf.code_end() + 1); | |
| 329 } | |
| 330 | |
| 331 // EMIT_CC() | |
| 332 void emit_cc(CodeBuffer &cbuf, int f1, int f2) { | |
| 333 unsigned char c = (unsigned char)( f1 | f2 ); | |
| 334 *(cbuf.code_end()) = c; | |
| 335 cbuf.set_code_end(cbuf.code_end() + 1); | |
| 336 } | |
| 337 | |
| 338 // EMIT_OPCODE() | |
| 339 void emit_opcode(CodeBuffer &cbuf, int code) { | |
| 340 *(cbuf.code_end()) = (unsigned char)code; | |
| 341 cbuf.set_code_end(cbuf.code_end() + 1); | |
| 342 } | |
| 343 | |
| 344 // EMIT_OPCODE() w/ relocation information | |
| 345 void emit_opcode(CodeBuffer &cbuf, int code, relocInfo::relocType reloc, int offset = 0) { | |
| 346 cbuf.relocate(cbuf.inst_mark() + offset, reloc); | |
| 347 emit_opcode(cbuf, code); | |
| 348 } | |
| 349 | |
| 350 // EMIT_D8() | |
| 351 void emit_d8(CodeBuffer &cbuf, int d8) { | |
| 352 *(cbuf.code_end()) = (unsigned char)d8; | |
| 353 cbuf.set_code_end(cbuf.code_end() + 1); | |
| 354 } | |
| 355 | |
| 356 // EMIT_D16() | |
| 357 void emit_d16(CodeBuffer &cbuf, int d16) { | |
| 358 *((short *)(cbuf.code_end())) = d16; | |
| 359 cbuf.set_code_end(cbuf.code_end() + 2); | |
| 360 } | |
| 361 | |
| 362 // EMIT_D32() | |
| 363 void emit_d32(CodeBuffer &cbuf, int d32) { | |
| 364 *((int *)(cbuf.code_end())) = d32; | |
| 365 cbuf.set_code_end(cbuf.code_end() + 4); | |
| 366 } | |
| 367 | |
| 368 // emit 32 bit value and construct relocation entry from relocInfo::relocType | |
| 369 void emit_d32_reloc(CodeBuffer &cbuf, int d32, relocInfo::relocType reloc, | |
| 370 int format) { | |
| 371 cbuf.relocate(cbuf.inst_mark(), reloc, format); | |
| 372 | |
| 373 *((int *)(cbuf.code_end())) = d32; | |
| 374 cbuf.set_code_end(cbuf.code_end() + 4); | |
| 375 } | |
| 376 | |
| 377 // emit 32 bit value and construct relocation entry from RelocationHolder | |
| 378 void emit_d32_reloc(CodeBuffer &cbuf, int d32, RelocationHolder const& rspec, | |
| 379 int format) { | |
| 380 #ifdef ASSERT | |
| 381 if (rspec.reloc()->type() == relocInfo::oop_type && d32 != 0 && d32 != (int)Universe::non_oop_word()) { | |
| 382 assert(oop(d32)->is_oop() && oop(d32)->is_perm(), "cannot embed non-perm oops in code"); | |
| 383 } | |
| 384 #endif | |
| 385 cbuf.relocate(cbuf.inst_mark(), rspec, format); | |
| 386 | |
| 387 *((int *)(cbuf.code_end())) = d32; | |
| 388 cbuf.set_code_end(cbuf.code_end() + 4); | |
| 389 } | |
| 390 | |
| 391 // Access stack slot for load or store | |
| 392 void store_to_stackslot(CodeBuffer &cbuf, int opcode, int rm_field, int disp) { | |
| 393 emit_opcode( cbuf, opcode ); // (e.g., FILD [ESP+src]) | |
| 394 if( -128 <= disp && disp <= 127 ) { | |
| 395 emit_rm( cbuf, 0x01, rm_field, ESP_enc ); // R/M byte | |
| 396 emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte | |
| 397 emit_d8 (cbuf, disp); // Displacement // R/M byte | |
| 398 } else { | |
| 399 emit_rm( cbuf, 0x02, rm_field, ESP_enc ); // R/M byte | |
| 400 emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte | |
| 401 emit_d32(cbuf, disp); // Displacement // R/M byte | |
| 402 } | |
| 403 } | |
| 404 | |
| 405 // eRegI ereg, memory mem) %{ // emit_reg_mem | |
| 406 void encode_RegMem( CodeBuffer &cbuf, int reg_encoding, int base, int index, int scale, int displace, bool displace_is_oop ) { | |
| 407 // There is no index & no scale, use form without SIB byte | |
| 408 if ((index == 0x4) && | |
| 409 (scale == 0) && (base != ESP_enc)) { | |
| 410 // If no displacement, mode is 0x0; unless base is [EBP] | |
| 411 if ( (displace == 0) && (base != EBP_enc) ) { | |
| 412 emit_rm(cbuf, 0x0, reg_encoding, base); | |
| 413 } | |
| 414 else { // If 8-bit displacement, mode 0x1 | |
| 415 if ((displace >= -128) && (displace <= 127) | |
| 416 && !(displace_is_oop) ) { | |
| 417 emit_rm(cbuf, 0x1, reg_encoding, base); | |
| 418 emit_d8(cbuf, displace); | |
| 419 } | |
| 420 else { // If 32-bit displacement | |
| 421 if (base == -1) { // Special flag for absolute address | |
| 422 emit_rm(cbuf, 0x0, reg_encoding, 0x5); | |
| 423 // (manual lies; no SIB needed here) | |
| 424 if ( displace_is_oop ) { | |
| 425 emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); | |
| 426 } else { | |
| 427 emit_d32 (cbuf, displace); | |
| 428 } | |
| 429 } | |
| 430 else { // Normal base + offset | |
| 431 emit_rm(cbuf, 0x2, reg_encoding, base); | |
| 432 if ( displace_is_oop ) { | |
| 433 emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); | |
| 434 } else { | |
| 435 emit_d32 (cbuf, displace); | |
| 436 } | |
| 437 } | |
| 438 } | |
| 439 } | |
| 440 } | |
| 441 else { // Else, encode with the SIB byte | |
| 442 // If no displacement, mode is 0x0; unless base is [EBP] | |
| 443 if (displace == 0 && (base != EBP_enc)) { // If no displacement | |
| 444 emit_rm(cbuf, 0x0, reg_encoding, 0x4); | |
| 445 emit_rm(cbuf, scale, index, base); | |
| 446 } | |
| 447 else { // If 8-bit displacement, mode 0x1 | |
| 448 if ((displace >= -128) && (displace <= 127) | |
| 449 && !(displace_is_oop) ) { | |
| 450 emit_rm(cbuf, 0x1, reg_encoding, 0x4); | |
| 451 emit_rm(cbuf, scale, index, base); | |
| 452 emit_d8(cbuf, displace); | |
| 453 } | |
| 454 else { // If 32-bit displacement | |
| 455 if (base == 0x04 ) { | |
| 456 emit_rm(cbuf, 0x2, reg_encoding, 0x4); | |
| 457 emit_rm(cbuf, scale, index, 0x04); | |
| 458 } else { | |
| 459 emit_rm(cbuf, 0x2, reg_encoding, 0x4); | |
| 460 emit_rm(cbuf, scale, index, base); | |
| 461 } | |
| 462 if ( displace_is_oop ) { | |
| 463 emit_d32_reloc(cbuf, displace, relocInfo::oop_type, 1); | |
| 464 } else { | |
| 465 emit_d32 (cbuf, displace); | |
| 466 } | |
| 467 } | |
| 468 } | |
| 469 } | |
| 470 } | |
| 471 | |
| 472 | |
| 473 void encode_Copy( CodeBuffer &cbuf, int dst_encoding, int src_encoding ) { | |
| 474 if( dst_encoding == src_encoding ) { | |
| 475 // reg-reg copy, use an empty encoding | |
| 476 } else { | |
| 477 emit_opcode( cbuf, 0x8B ); | |
| 478 emit_rm(cbuf, 0x3, dst_encoding, src_encoding ); | |
| 479 } | |
| 480 } | |
| 481 | |
| 482 void encode_CopyXD( CodeBuffer &cbuf, int dst_encoding, int src_encoding ) { | |
| 483 if( dst_encoding == src_encoding ) { | |
| 484 // reg-reg copy, use an empty encoding | |
| 485 } else { | |
| 486 MacroAssembler _masm(&cbuf); | |
| 487 | |
| 488 __ movdqa(as_XMMRegister(dst_encoding), as_XMMRegister(src_encoding)); | |
| 489 } | |
| 490 } | |
| 491 | |
| 492 | |
| 493 //============================================================================= | |
| 494 #ifndef PRODUCT | |
| 495 void MachPrologNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
| 496 Compile* C = ra_->C; | |
| 497 if( C->in_24_bit_fp_mode() ) { | |
| 498 tty->print("FLDCW 24 bit fpu control word"); | |
| 499 tty->print_cr(""); tty->print("\t"); | |
| 500 } | |
| 501 | |
| 502 int framesize = C->frame_slots() << LogBytesPerInt; | |
| 503 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
| 504 // Remove two words for return addr and rbp, | |
| 505 framesize -= 2*wordSize; | |
| 506 | |
| 507 // Calls to C2R adapters often do not accept exceptional returns. | |
| 508 // We require that their callers must bang for them. But be careful, because | |
| 509 // some VM calls (such as call site linkage) can use several kilobytes of | |
| 510 // stack. But the stack safety zone should account for that. | |
| 511 // See bugs 4446381, 4468289, 4497237. | |
| 512 if (C->need_stack_bang(framesize)) { | |
| 513 tty->print_cr("# stack bang"); tty->print("\t"); | |
| 514 } | |
| 515 tty->print_cr("PUSHL EBP"); tty->print("\t"); | |
| 516 | |
| 517 if( VerifyStackAtCalls ) { // Majik cookie to verify stack depth | |
| 518 tty->print("PUSH 0xBADB100D\t# Majik cookie for stack depth check"); | |
| 519 tty->print_cr(""); tty->print("\t"); | |
| 520 framesize -= wordSize; | |
| 521 } | |
| 522 | |
| 523 if ((C->in_24_bit_fp_mode() || VerifyStackAtCalls ) && framesize < 128 ) { | |
| 524 if (framesize) { | |
| 525 tty->print("SUB ESP,%d\t# Create frame",framesize); | |
| 526 } | |
| 527 } else { | |
| 528 tty->print("SUB ESP,%d\t# Create frame",framesize); | |
| 529 } | |
| 530 } | |
| 531 #endif | |
| 532 | |
| 533 | |
| 534 void MachPrologNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
| 535 Compile* C = ra_->C; | |
| 536 | |
| 537 if (UseSSE >= 2 && VerifyFPU) { | |
| 538 MacroAssembler masm(&cbuf); | |
| 539 masm.verify_FPU(0, "FPU stack must be clean on entry"); | |
| 540 } | |
| 541 | |
| 542 // WARNING: Initial instruction MUST be 5 bytes or longer so that | |
| 543 // NativeJump::patch_verified_entry will be able to patch out the entry | |
| 544 // code safely. The fldcw is ok at 6 bytes, the push to verify stack | |
| 545 // depth is ok at 5 bytes, the frame allocation can be either 3 or | |
| 546 // 6 bytes. So if we don't do the fldcw or the push then we must | |
| 547 // use the 6 byte frame allocation even if we have no frame. :-( | |
| 548 // If method sets FPU control word do it now | |
| 549 if( C->in_24_bit_fp_mode() ) { | |
| 550 MacroAssembler masm(&cbuf); | |
| 551 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_24())); | |
| 552 } | |
| 553 | |
| 554 int framesize = C->frame_slots() << LogBytesPerInt; | |
| 555 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
| 556 // Remove two words for return addr and rbp, | |
| 557 framesize -= 2*wordSize; | |
| 558 | |
| 559 // Calls to C2R adapters often do not accept exceptional returns. | |
| 560 // We require that their callers must bang for them. But be careful, because | |
| 561 // some VM calls (such as call site linkage) can use several kilobytes of | |
| 562 // stack. But the stack safety zone should account for that. | |
| 563 // See bugs 4446381, 4468289, 4497237. | |
| 564 if (C->need_stack_bang(framesize)) { | |
| 565 MacroAssembler masm(&cbuf); | |
| 566 masm.generate_stack_overflow_check(framesize); | |
| 567 } | |
| 568 | |
| 569 // We always push rbp, so that on return to interpreter rbp, will be | |
| 570 // restored correctly and we can correct the stack. | |
| 571 emit_opcode(cbuf, 0x50 | EBP_enc); | |
| 572 | |
| 573 if( VerifyStackAtCalls ) { // Majik cookie to verify stack depth | |
| 574 emit_opcode(cbuf, 0x68); // push 0xbadb100d | |
| 575 emit_d32(cbuf, 0xbadb100d); | |
| 576 framesize -= wordSize; | |
| 577 } | |
| 578 | |
| 579 if ((C->in_24_bit_fp_mode() || VerifyStackAtCalls ) && framesize < 128 ) { | |
| 580 if (framesize) { | |
| 581 emit_opcode(cbuf, 0x83); // sub SP,#framesize | |
| 582 emit_rm(cbuf, 0x3, 0x05, ESP_enc); | |
| 583 emit_d8(cbuf, framesize); | |
| 584 } | |
| 585 } else { | |
| 586 emit_opcode(cbuf, 0x81); // sub SP,#framesize | |
| 587 emit_rm(cbuf, 0x3, 0x05, ESP_enc); | |
| 588 emit_d32(cbuf, framesize); | |
| 589 } | |
| 590 C->set_frame_complete(cbuf.code_end() - cbuf.code_begin()); | |
| 591 | |
| 592 #ifdef ASSERT | |
| 593 if (VerifyStackAtCalls) { | |
| 594 Label L; | |
| 595 MacroAssembler masm(&cbuf); | |
| 596 masm.pushl(rax); | |
| 597 masm.movl(rax, rsp); | |
| 598 masm.andl(rax, StackAlignmentInBytes-1); | |
| 599 masm.cmpl(rax, StackAlignmentInBytes-wordSize); | |
| 600 masm.popl(rax); | |
| 601 masm.jcc(Assembler::equal, L); | |
| 602 masm.stop("Stack is not properly aligned!"); | |
| 603 masm.bind(L); | |
| 604 } | |
| 605 #endif | |
| 606 | |
| 607 } | |
| 608 | |
| 609 uint MachPrologNode::size(PhaseRegAlloc *ra_) const { | |
| 610 return MachNode::size(ra_); // too many variables; just compute it the hard way | |
| 611 } | |
| 612 | |
| 613 int MachPrologNode::reloc() const { | |
| 614 return 0; // a large enough number | |
| 615 } | |
| 616 | |
| 617 //============================================================================= | |
| 618 #ifndef PRODUCT | |
| 619 void MachEpilogNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
| 620 Compile *C = ra_->C; | |
| 621 int framesize = C->frame_slots() << LogBytesPerInt; | |
| 622 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
| 623 // Remove two words for return addr and rbp, | |
| 624 framesize -= 2*wordSize; | |
| 625 | |
| 626 if( C->in_24_bit_fp_mode() ) { | |
| 627 st->print("FLDCW standard control word"); | |
| 628 st->cr(); st->print("\t"); | |
| 629 } | |
| 630 if( framesize ) { | |
| 631 st->print("ADD ESP,%d\t# Destroy frame",framesize); | |
| 632 st->cr(); st->print("\t"); | |
| 633 } | |
| 634 st->print_cr("POPL EBP"); st->print("\t"); | |
| 635 if( do_polling() && C->is_method_compilation() ) { | |
| 636 st->print("TEST PollPage,EAX\t! Poll Safepoint"); | |
| 637 st->cr(); st->print("\t"); | |
| 638 } | |
| 639 } | |
| 640 #endif | |
| 641 | |
| 642 void MachEpilogNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
| 643 Compile *C = ra_->C; | |
| 644 | |
| 645 // If method set FPU control word, restore to standard control word | |
| 646 if( C->in_24_bit_fp_mode() ) { | |
| 647 MacroAssembler masm(&cbuf); | |
| 648 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_std())); | |
| 649 } | |
| 650 | |
| 651 int framesize = C->frame_slots() << LogBytesPerInt; | |
| 652 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
| 653 // Remove two words for return addr and rbp, | |
| 654 framesize -= 2*wordSize; | |
| 655 | |
| 656 // Note that VerifyStackAtCalls' Majik cookie does not change the frame size popped here | |
| 657 | |
| 658 if( framesize >= 128 ) { | |
| 659 emit_opcode(cbuf, 0x81); // add SP, #framesize | |
| 660 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
| 661 emit_d32(cbuf, framesize); | |
| 662 } | |
| 663 else if( framesize ) { | |
| 664 emit_opcode(cbuf, 0x83); // add SP, #framesize | |
| 665 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
| 666 emit_d8(cbuf, framesize); | |
| 667 } | |
| 668 | |
| 669 emit_opcode(cbuf, 0x58 | EBP_enc); | |
| 670 | |
| 671 if( do_polling() && C->is_method_compilation() ) { | |
| 672 cbuf.relocate(cbuf.code_end(), relocInfo::poll_return_type, 0); | |
| 673 emit_opcode(cbuf,0x85); | |
| 674 emit_rm(cbuf, 0x0, EAX_enc, 0x5); // EAX | |
| 675 emit_d32(cbuf, (intptr_t)os::get_polling_page()); | |
| 676 } | |
| 677 } | |
| 678 | |
| 679 uint MachEpilogNode::size(PhaseRegAlloc *ra_) const { | |
| 680 Compile *C = ra_->C; | |
| 681 // If method set FPU control word, restore to standard control word | |
| 682 int size = C->in_24_bit_fp_mode() ? 6 : 0; | |
| 683 if( do_polling() && C->is_method_compilation() ) size += 6; | |
| 684 | |
| 685 int framesize = C->frame_slots() << LogBytesPerInt; | |
| 686 assert((framesize & (StackAlignmentInBytes-1)) == 0, "frame size not aligned"); | |
| 687 // Remove two words for return addr and rbp, | |
| 688 framesize -= 2*wordSize; | |
| 689 | |
| 690 size++; // popl rbp, | |
| 691 | |
| 692 if( framesize >= 128 ) { | |
| 693 size += 6; | |
| 694 } else { | |
| 695 size += framesize ? 3 : 0; | |
| 696 } | |
| 697 return size; | |
| 698 } | |
| 699 | |
| 700 int MachEpilogNode::reloc() const { | |
| 701 return 0; // a large enough number | |
| 702 } | |
| 703 | |
| 704 const Pipeline * MachEpilogNode::pipeline() const { | |
| 705 return MachNode::pipeline_class(); | |
| 706 } | |
| 707 | |
| 708 int MachEpilogNode::safepoint_offset() const { return 0; } | |
| 709 | |
| 710 //============================================================================= | |
| 711 | |
| 712 enum RC { rc_bad, rc_int, rc_float, rc_xmm, rc_stack }; | |
| 713 static enum RC rc_class( OptoReg::Name reg ) { | |
| 714 | |
| 715 if( !OptoReg::is_valid(reg) ) return rc_bad; | |
| 716 if (OptoReg::is_stack(reg)) return rc_stack; | |
| 717 | |
| 718 VMReg r = OptoReg::as_VMReg(reg); | |
| 719 if (r->is_Register()) return rc_int; | |
| 720 if (r->is_FloatRegister()) { | |
| 721 assert(UseSSE < 2, "shouldn't be used in SSE2+ mode"); | |
| 722 return rc_float; | |
| 723 } | |
| 724 assert(r->is_XMMRegister(), "must be"); | |
| 725 return rc_xmm; | |
| 726 } | |
| 727 | |
| 728 static int impl_helper( CodeBuffer *cbuf, bool do_size, bool is_load, int offset, int reg, int opcode, const char *op_str, int size ) { | |
| 729 if( cbuf ) { | |
| 730 emit_opcode (*cbuf, opcode ); | |
| 731 encode_RegMem(*cbuf, Matcher::_regEncode[reg], ESP_enc, 0x4, 0, offset, false); | |
| 732 #ifndef PRODUCT | |
| 733 } else if( !do_size ) { | |
| 734 if( size != 0 ) tty->print("\n\t"); | |
| 735 if( opcode == 0x8B || opcode == 0x89 ) { // MOV | |
| 736 if( is_load ) tty->print("%s %s,[ESP + #%d]",op_str,Matcher::regName[reg],offset); | |
| 737 else tty->print("%s [ESP + #%d],%s",op_str,offset,Matcher::regName[reg]); | |
| 738 } else { // FLD, FST, PUSH, POP | |
| 739 tty->print("%s [ESP + #%d]",op_str,offset); | |
| 740 } | |
| 741 #endif | |
| 742 } | |
| 743 int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); | |
| 744 return size+3+offset_size; | |
| 745 } | |
| 746 | |
| 747 // Helper for XMM registers. Extra opcode bits, limited syntax. | |
| 748 static int impl_x_helper( CodeBuffer *cbuf, bool do_size, bool is_load, | |
| 749 int offset, int reg_lo, int reg_hi, int size ) { | |
| 750 if( cbuf ) { | |
| 751 if( reg_lo+1 == reg_hi ) { // double move? | |
| 752 if( is_load && !UseXmmLoadAndClearUpper ) | |
| 753 emit_opcode(*cbuf, 0x66 ); // use 'movlpd' for load | |
| 754 else | |
| 755 emit_opcode(*cbuf, 0xF2 ); // use 'movsd' otherwise | |
| 756 } else { | |
| 757 emit_opcode(*cbuf, 0xF3 ); | |
| 758 } | |
| 759 emit_opcode(*cbuf, 0x0F ); | |
| 760 if( reg_lo+1 == reg_hi && is_load && !UseXmmLoadAndClearUpper ) | |
| 761 emit_opcode(*cbuf, 0x12 ); // use 'movlpd' for load | |
| 762 else | |
| 763 emit_opcode(*cbuf, is_load ? 0x10 : 0x11 ); | |
| 764 encode_RegMem(*cbuf, Matcher::_regEncode[reg_lo], ESP_enc, 0x4, 0, offset, false); | |
| 765 #ifndef PRODUCT | |
| 766 } else if( !do_size ) { | |
| 767 if( size != 0 ) tty->print("\n\t"); | |
| 768 if( reg_lo+1 == reg_hi ) { // double move? | |
| 769 if( is_load ) tty->print("%s %s,[ESP + #%d]", | |
| 770 UseXmmLoadAndClearUpper ? "MOVSD " : "MOVLPD", | |
| 771 Matcher::regName[reg_lo], offset); | |
| 772 else tty->print("MOVSD [ESP + #%d],%s", | |
| 773 offset, Matcher::regName[reg_lo]); | |
| 774 } else { | |
| 775 if( is_load ) tty->print("MOVSS %s,[ESP + #%d]", | |
| 776 Matcher::regName[reg_lo], offset); | |
| 777 else tty->print("MOVSS [ESP + #%d],%s", | |
| 778 offset, Matcher::regName[reg_lo]); | |
| 779 } | |
| 780 #endif | |
| 781 } | |
| 782 int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); | |
| 783 return size+5+offset_size; | |
| 784 } | |
| 785 | |
| 786 | |
| 787 static int impl_movx_helper( CodeBuffer *cbuf, bool do_size, int src_lo, int dst_lo, | |
| 788 int src_hi, int dst_hi, int size ) { | |
| 789 if( UseXmmRegToRegMoveAll ) {//Use movaps,movapd to move between xmm registers | |
| 790 if( cbuf ) { | |
| 791 if( (src_lo+1 == src_hi && dst_lo+1 == dst_hi) ) { | |
| 792 emit_opcode(*cbuf, 0x66 ); | |
| 793 } | |
| 794 emit_opcode(*cbuf, 0x0F ); | |
| 795 emit_opcode(*cbuf, 0x28 ); | |
| 796 emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst_lo], Matcher::_regEncode[src_lo] ); | |
| 797 #ifndef PRODUCT | |
| 798 } else if( !do_size ) { | |
| 799 if( size != 0 ) tty->print("\n\t"); | |
| 800 if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double move? | |
| 801 tty->print("MOVAPD %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
| 802 } else { | |
| 803 tty->print("MOVAPS %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
| 804 } | |
| 805 #endif | |
| 806 } | |
| 807 return size + ((src_lo+1 == src_hi && dst_lo+1 == dst_hi) ? 4 : 3); | |
| 808 } else { | |
| 809 if( cbuf ) { | |
| 810 emit_opcode(*cbuf, (src_lo+1 == src_hi && dst_lo+1 == dst_hi) ? 0xF2 : 0xF3 ); | |
| 811 emit_opcode(*cbuf, 0x0F ); | |
| 812 emit_opcode(*cbuf, 0x10 ); | |
| 813 emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst_lo], Matcher::_regEncode[src_lo] ); | |
| 814 #ifndef PRODUCT | |
| 815 } else if( !do_size ) { | |
| 816 if( size != 0 ) tty->print("\n\t"); | |
| 817 if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double move? | |
| 818 tty->print("MOVSD %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
| 819 } else { | |
| 820 tty->print("MOVSS %s,%s",Matcher::regName[dst_lo],Matcher::regName[src_lo]); | |
| 821 } | |
| 822 #endif | |
| 823 } | |
| 824 return size+4; | |
| 825 } | |
| 826 } | |
| 827 | |
| 828 static int impl_mov_helper( CodeBuffer *cbuf, bool do_size, int src, int dst, int size ) { | |
| 829 if( cbuf ) { | |
| 830 emit_opcode(*cbuf, 0x8B ); | |
| 831 emit_rm (*cbuf, 0x3, Matcher::_regEncode[dst], Matcher::_regEncode[src] ); | |
| 832 #ifndef PRODUCT | |
| 833 } else if( !do_size ) { | |
| 834 if( size != 0 ) tty->print("\n\t"); | |
| 835 tty->print("MOV %s,%s",Matcher::regName[dst],Matcher::regName[src]); | |
| 836 #endif | |
| 837 } | |
| 838 return size+2; | |
| 839 } | |
| 840 | |
| 841 static int impl_fp_store_helper( CodeBuffer *cbuf, bool do_size, int src_lo, int src_hi, int dst_lo, int dst_hi, int offset, int size ) { | |
| 842 if( src_lo != FPR1L_num ) { // Move value to top of FP stack, if not already there | |
| 843 if( cbuf ) { | |
| 844 emit_opcode( *cbuf, 0xD9 ); // FLD (i.e., push it) | |
| 845 emit_d8( *cbuf, 0xC0-1+Matcher::_regEncode[src_lo] ); | |
| 846 #ifndef PRODUCT | |
| 847 } else if( !do_size ) { | |
| 848 if( size != 0 ) tty->print("\n\t"); | |
| 849 tty->print("FLD %s",Matcher::regName[src_lo]); | |
| 850 #endif | |
| 851 } | |
| 852 size += 2; | |
| 853 } | |
| 854 | |
| 855 int st_op = (src_lo != FPR1L_num) ? EBX_num /*store & pop*/ : EDX_num /*store no pop*/; | |
| 856 const char *op_str; | |
| 857 int op; | |
| 858 if( src_lo+1 == src_hi && dst_lo+1 == dst_hi ) { // double store? | |
| 859 op_str = (src_lo != FPR1L_num) ? "FSTP_D" : "FST_D "; | |
| 860 op = 0xDD; | |
| 861 } else { // 32-bit store | |
| 862 op_str = (src_lo != FPR1L_num) ? "FSTP_S" : "FST_S "; | |
| 863 op = 0xD9; | |
| 864 assert( !OptoReg::is_valid(src_hi) && !OptoReg::is_valid(dst_hi), "no non-adjacent float-stores" ); | |
| 865 } | |
| 866 | |
| 867 return impl_helper(cbuf,do_size,false,offset,st_op,op,op_str,size); | |
| 868 } | |
| 869 | |
| 870 uint MachSpillCopyNode::implementation( CodeBuffer *cbuf, PhaseRegAlloc *ra_, bool do_size, outputStream* st ) const { | |
| 871 // Get registers to move | |
| 872 OptoReg::Name src_second = ra_->get_reg_second(in(1)); | |
| 873 OptoReg::Name src_first = ra_->get_reg_first(in(1)); | |
| 874 OptoReg::Name dst_second = ra_->get_reg_second(this ); | |
| 875 OptoReg::Name dst_first = ra_->get_reg_first(this ); | |
| 876 | |
| 877 enum RC src_second_rc = rc_class(src_second); | |
| 878 enum RC src_first_rc = rc_class(src_first); | |
| 879 enum RC dst_second_rc = rc_class(dst_second); | |
| 880 enum RC dst_first_rc = rc_class(dst_first); | |
| 881 | |
| 882 assert( OptoReg::is_valid(src_first) && OptoReg::is_valid(dst_first), "must move at least 1 register" ); | |
| 883 | |
| 884 // Generate spill code! | |
| 885 int size = 0; | |
| 886 | |
| 887 if( src_first == dst_first && src_second == dst_second ) | |
| 888 return size; // Self copy, no move | |
| 889 | |
| 890 // -------------------------------------- | |
| 891 // Check for mem-mem move. push/pop to move. | |
| 892 if( src_first_rc == rc_stack && dst_first_rc == rc_stack ) { | |
| 893 if( src_second == dst_first ) { // overlapping stack copy ranges | |
| 894 assert( src_second_rc == rc_stack && dst_second_rc == rc_stack, "we only expect a stk-stk copy here" ); | |
| 895 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),ESI_num,0xFF,"PUSH ",size); | |
| 896 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),EAX_num,0x8F,"POP ",size); | |
| 897 src_second_rc = dst_second_rc = rc_bad; // flag as already moved the second bits | |
| 898 } | |
| 899 // move low bits | |
| 900 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),ESI_num,0xFF,"PUSH ",size); | |
| 901 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),EAX_num,0x8F,"POP ",size); | |
| 902 if( src_second_rc == rc_stack && dst_second_rc == rc_stack ) { // mov second bits | |
| 903 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),ESI_num,0xFF,"PUSH ",size); | |
| 904 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),EAX_num,0x8F,"POP ",size); | |
| 905 } | |
| 906 return size; | |
| 907 } | |
| 908 | |
| 909 // -------------------------------------- | |
| 910 // Check for integer reg-reg copy | |
| 911 if( src_first_rc == rc_int && dst_first_rc == rc_int ) | |
| 912 size = impl_mov_helper(cbuf,do_size,src_first,dst_first,size); | |
| 913 | |
| 914 // Check for integer store | |
| 915 if( src_first_rc == rc_int && dst_first_rc == rc_stack ) | |
| 916 size = impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),src_first,0x89,"MOV ",size); | |
| 917 | |
| 918 // Check for integer load | |
| 919 if( dst_first_rc == rc_int && src_first_rc == rc_stack ) | |
| 920 size = impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),dst_first,0x8B,"MOV ",size); | |
| 921 | |
| 922 // -------------------------------------- | |
| 923 // Check for float reg-reg copy | |
| 924 if( src_first_rc == rc_float && dst_first_rc == rc_float ) { | |
| 925 assert( (src_second_rc == rc_bad && dst_second_rc == rc_bad) || | |
| 926 (src_first+1 == src_second && dst_first+1 == dst_second), "no non-adjacent float-moves" ); | |
| 927 if( cbuf ) { | |
| 928 | |
| 929 // Note the mucking with the register encode to compensate for the 0/1 | |
| 930 // indexing issue mentioned in a comment in the reg_def sections | |
| 931 // for FPR registers many lines above here. | |
| 932 | |
| 933 if( src_first != FPR1L_num ) { | |
| 934 emit_opcode (*cbuf, 0xD9 ); // FLD ST(i) | |
| 935 emit_d8 (*cbuf, 0xC0+Matcher::_regEncode[src_first]-1 ); | |
| 936 emit_opcode (*cbuf, 0xDD ); // FSTP ST(i) | |
| 937 emit_d8 (*cbuf, 0xD8+Matcher::_regEncode[dst_first] ); | |
| 938 } else { | |
| 939 emit_opcode (*cbuf, 0xDD ); // FST ST(i) | |
| 940 emit_d8 (*cbuf, 0xD0+Matcher::_regEncode[dst_first]-1 ); | |
| 941 } | |
| 942 #ifndef PRODUCT | |
| 943 } else if( !do_size ) { | |
| 944 if( size != 0 ) st->print("\n\t"); | |
| 945 if( src_first != FPR1L_num ) st->print("FLD %s\n\tFSTP %s",Matcher::regName[src_first],Matcher::regName[dst_first]); | |
| 946 else st->print( "FST %s", Matcher::regName[dst_first]); | |
| 947 #endif | |
| 948 } | |
| 949 return size + ((src_first != FPR1L_num) ? 2+2 : 2); | |
| 950 } | |
| 951 | |
| 952 // Check for float store | |
| 953 if( src_first_rc == rc_float && dst_first_rc == rc_stack ) { | |
| 954 return impl_fp_store_helper(cbuf,do_size,src_first,src_second,dst_first,dst_second,ra_->reg2offset(dst_first),size); | |
| 955 } | |
| 956 | |
| 957 // Check for float load | |
| 958 if( dst_first_rc == rc_float && src_first_rc == rc_stack ) { | |
| 959 int offset = ra_->reg2offset(src_first); | |
| 960 const char *op_str; | |
| 961 int op; | |
| 962 if( src_first+1 == src_second && dst_first+1 == dst_second ) { // double load? | |
| 963 op_str = "FLD_D"; | |
| 964 op = 0xDD; | |
| 965 } else { // 32-bit load | |
| 966 op_str = "FLD_S"; | |
| 967 op = 0xD9; | |
| 968 assert( src_second_rc == rc_bad && dst_second_rc == rc_bad, "no non-adjacent float-loads" ); | |
| 969 } | |
| 970 if( cbuf ) { | |
| 971 emit_opcode (*cbuf, op ); | |
| 972 encode_RegMem(*cbuf, 0x0, ESP_enc, 0x4, 0, offset, false); | |
| 973 emit_opcode (*cbuf, 0xDD ); // FSTP ST(i) | |
| 974 emit_d8 (*cbuf, 0xD8+Matcher::_regEncode[dst_first] ); | |
| 975 #ifndef PRODUCT | |
| 976 } else if( !do_size ) { | |
| 977 if( size != 0 ) st->print("\n\t"); | |
| 978 st->print("%s ST,[ESP + #%d]\n\tFSTP %s",op_str, offset,Matcher::regName[dst_first]); | |
| 979 #endif | |
| 980 } | |
| 981 int offset_size = (offset == 0) ? 0 : ((offset <= 127) ? 1 : 4); | |
| 982 return size + 3+offset_size+2; | |
| 983 } | |
| 984 | |
| 985 // Check for xmm reg-reg copy | |
| 986 if( src_first_rc == rc_xmm && dst_first_rc == rc_xmm ) { | |
| 987 assert( (src_second_rc == rc_bad && dst_second_rc == rc_bad) || | |
| 988 (src_first+1 == src_second && dst_first+1 == dst_second), | |
| 989 "no non-adjacent float-moves" ); | |
| 990 return impl_movx_helper(cbuf,do_size,src_first,dst_first,src_second, dst_second, size); | |
| 991 } | |
| 992 | |
| 993 // Check for xmm store | |
| 994 if( src_first_rc == rc_xmm && dst_first_rc == rc_stack ) { | |
| 995 return impl_x_helper(cbuf,do_size,false,ra_->reg2offset(dst_first),src_first, src_second, size); | |
| 996 } | |
| 997 | |
| 998 // Check for float xmm load | |
| 999 if( dst_first_rc == rc_xmm && src_first_rc == rc_stack ) { | |
| 1000 return impl_x_helper(cbuf,do_size,true ,ra_->reg2offset(src_first),dst_first, dst_second, size); | |
| 1001 } | |
| 1002 | |
| 1003 // Copy from float reg to xmm reg | |
| 1004 if( dst_first_rc == rc_xmm && src_first_rc == rc_float ) { | |
| 1005 // copy to the top of stack from floating point reg | |
| 1006 // and use LEA to preserve flags | |
| 1007 if( cbuf ) { | |
| 1008 emit_opcode(*cbuf,0x8D); // LEA ESP,[ESP-8] | |
| 1009 emit_rm(*cbuf, 0x1, ESP_enc, 0x04); | |
| 1010 emit_rm(*cbuf, 0x0, 0x04, ESP_enc); | |
| 1011 emit_d8(*cbuf,0xF8); | |
| 1012 #ifndef PRODUCT | |
| 1013 } else if( !do_size ) { | |
| 1014 if( size != 0 ) st->print("\n\t"); | |
| 1015 st->print("LEA ESP,[ESP-8]"); | |
| 1016 #endif | |
| 1017 } | |
| 1018 size += 4; | |
| 1019 | |
| 1020 size = impl_fp_store_helper(cbuf,do_size,src_first,src_second,dst_first,dst_second,0,size); | |
| 1021 | |
| 1022 // Copy from the temp memory to the xmm reg. | |
| 1023 size = impl_x_helper(cbuf,do_size,true ,0,dst_first, dst_second, size); | |
| 1024 | |
| 1025 if( cbuf ) { | |
| 1026 emit_opcode(*cbuf,0x8D); // LEA ESP,[ESP+8] | |
| 1027 emit_rm(*cbuf, 0x1, ESP_enc, 0x04); | |
| 1028 emit_rm(*cbuf, 0x0, 0x04, ESP_enc); | |
| 1029 emit_d8(*cbuf,0x08); | |
| 1030 #ifndef PRODUCT | |
| 1031 } else if( !do_size ) { | |
| 1032 if( size != 0 ) st->print("\n\t"); | |
| 1033 st->print("LEA ESP,[ESP+8]"); | |
| 1034 #endif | |
| 1035 } | |
| 1036 size += 4; | |
| 1037 return size; | |
| 1038 } | |
| 1039 | |
| 1040 assert( size > 0, "missed a case" ); | |
| 1041 | |
| 1042 // -------------------------------------------------------------------- | |
| 1043 // Check for second bits still needing moving. | |
| 1044 if( src_second == dst_second ) | |
| 1045 return size; // Self copy; no move | |
| 1046 assert( src_second_rc != rc_bad && dst_second_rc != rc_bad, "src_second & dst_second cannot be Bad" ); | |
| 1047 | |
| 1048 // Check for second word int-int move | |
| 1049 if( src_second_rc == rc_int && dst_second_rc == rc_int ) | |
| 1050 return impl_mov_helper(cbuf,do_size,src_second,dst_second,size); | |
| 1051 | |
| 1052 // Check for second word integer store | |
| 1053 if( src_second_rc == rc_int && dst_second_rc == rc_stack ) | |
| 1054 return impl_helper(cbuf,do_size,false,ra_->reg2offset(dst_second),src_second,0x89,"MOV ",size); | |
| 1055 | |
| 1056 // Check for second word integer load | |
| 1057 if( dst_second_rc == rc_int && src_second_rc == rc_stack ) | |
| 1058 return impl_helper(cbuf,do_size,true ,ra_->reg2offset(src_second),dst_second,0x8B,"MOV ",size); | |
| 1059 | |
| 1060 | |
| 1061 Unimplemented(); | |
| 1062 } | |
| 1063 | |
| 1064 #ifndef PRODUCT | |
| 1065 void MachSpillCopyNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
| 1066 implementation( NULL, ra_, false, st ); | |
| 1067 } | |
| 1068 #endif | |
| 1069 | |
| 1070 void MachSpillCopyNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
| 1071 implementation( &cbuf, ra_, false, NULL ); | |
| 1072 } | |
| 1073 | |
| 1074 uint MachSpillCopyNode::size(PhaseRegAlloc *ra_) const { | |
| 1075 return implementation( NULL, ra_, true, NULL ); | |
| 1076 } | |
| 1077 | |
| 1078 //============================================================================= | |
| 1079 #ifndef PRODUCT | |
| 1080 void MachNopNode::format( PhaseRegAlloc *, outputStream* st ) const { | |
| 1081 st->print("NOP \t# %d bytes pad for loops and calls", _count); | |
| 1082 } | |
| 1083 #endif | |
| 1084 | |
| 1085 void MachNopNode::emit(CodeBuffer &cbuf, PhaseRegAlloc * ) const { | |
| 1086 MacroAssembler _masm(&cbuf); | |
| 1087 __ nop(_count); | |
| 1088 } | |
| 1089 | |
| 1090 uint MachNopNode::size(PhaseRegAlloc *) const { | |
| 1091 return _count; | |
| 1092 } | |
| 1093 | |
| 1094 | |
| 1095 //============================================================================= | |
| 1096 #ifndef PRODUCT | |
| 1097 void BoxLockNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
| 1098 int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); | |
| 1099 int reg = ra_->get_reg_first(this); | |
| 1100 st->print("LEA %s,[ESP + #%d]",Matcher::regName[reg],offset); | |
| 1101 } | |
| 1102 #endif | |
| 1103 | |
| 1104 void BoxLockNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
| 1105 int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); | |
| 1106 int reg = ra_->get_encode(this); | |
| 1107 if( offset >= 128 ) { | |
| 1108 emit_opcode(cbuf, 0x8D); // LEA reg,[SP+offset] | |
| 1109 emit_rm(cbuf, 0x2, reg, 0x04); | |
| 1110 emit_rm(cbuf, 0x0, 0x04, ESP_enc); | |
| 1111 emit_d32(cbuf, offset); | |
| 1112 } | |
| 1113 else { | |
| 1114 emit_opcode(cbuf, 0x8D); // LEA reg,[SP+offset] | |
| 1115 emit_rm(cbuf, 0x1, reg, 0x04); | |
| 1116 emit_rm(cbuf, 0x0, 0x04, ESP_enc); | |
| 1117 emit_d8(cbuf, offset); | |
| 1118 } | |
| 1119 } | |
| 1120 | |
| 1121 uint BoxLockNode::size(PhaseRegAlloc *ra_) const { | |
| 1122 int offset = ra_->reg2offset(in_RegMask(0).find_first_elem()); | |
| 1123 if( offset >= 128 ) { | |
| 1124 return 7; | |
| 1125 } | |
| 1126 else { | |
| 1127 return 4; | |
| 1128 } | |
| 1129 } | |
| 1130 | |
| 1131 //============================================================================= | |
| 1132 | |
| 1133 // emit call stub, compiled java to interpreter | |
| 1134 void emit_java_to_interp(CodeBuffer &cbuf ) { | |
| 1135 // Stub is fixed up when the corresponding call is converted from calling | |
| 1136 // compiled code to calling interpreted code. | |
| 1137 // mov rbx,0 | |
| 1138 // jmp -1 | |
| 1139 | |
| 1140 address mark = cbuf.inst_mark(); // get mark within main instrs section | |
| 1141 | |
| 1142 // Note that the code buffer's inst_mark is always relative to insts. | |
| 1143 // That's why we must use the macroassembler to generate a stub. | |
| 1144 MacroAssembler _masm(&cbuf); | |
| 1145 | |
| 1146 address base = | |
| 1147 __ start_a_stub(Compile::MAX_stubs_size); | |
| 1148 if (base == NULL) return; // CodeBuffer::expand failed | |
| 1149 // static stub relocation stores the instruction address of the call | |
| 1150 __ relocate(static_stub_Relocation::spec(mark), RELOC_IMM32); | |
| 1151 // static stub relocation also tags the methodOop in the code-stream. | |
| 1152 __ movoop(rbx, (jobject)NULL); // method is zapped till fixup time | |
| 1153 __ jump(RuntimeAddress((address)-1)); | |
| 1154 | |
| 1155 __ end_a_stub(); | |
| 1156 // Update current stubs pointer and restore code_end. | |
| 1157 } | |
| 1158 // size of call stub, compiled java to interpretor | |
| 1159 uint size_java_to_interp() { | |
| 1160 return 10; // movl; jmp | |
| 1161 } | |
| 1162 // relocation entries for call stub, compiled java to interpretor | |
| 1163 uint reloc_java_to_interp() { | |
| 1164 return 4; // 3 in emit_java_to_interp + 1 in Java_Static_Call | |
| 1165 } | |
| 1166 | |
| 1167 //============================================================================= | |
| 1168 #ifndef PRODUCT | |
| 1169 void MachUEPNode::format( PhaseRegAlloc *ra_, outputStream* st ) const { | |
| 1170 st->print_cr( "CMP EAX,[ECX+4]\t# Inline cache check"); | |
| 1171 st->print_cr("\tJNE SharedRuntime::handle_ic_miss_stub"); | |
| 1172 st->print_cr("\tNOP"); | |
| 1173 st->print_cr("\tNOP"); | |
| 1174 if( !OptoBreakpoint ) | |
| 1175 st->print_cr("\tNOP"); | |
| 1176 } | |
| 1177 #endif | |
| 1178 | |
| 1179 void MachUEPNode::emit(CodeBuffer &cbuf, PhaseRegAlloc *ra_) const { | |
| 1180 MacroAssembler masm(&cbuf); | |
| 1181 #ifdef ASSERT | |
| 1182 uint code_size = cbuf.code_size(); | |
| 1183 #endif | |
| 1184 masm.cmpl(rax, Address(rcx, oopDesc::klass_offset_in_bytes())); | |
| 1185 masm.jump_cc(Assembler::notEqual, | |
| 1186 RuntimeAddress(SharedRuntime::get_ic_miss_stub())); | |
| 1187 /* WARNING these NOPs are critical so that verified entry point is properly | |
| 1188 aligned for patching by NativeJump::patch_verified_entry() */ | |
| 1189 int nops_cnt = 2; | |
| 1190 if( !OptoBreakpoint ) // Leave space for int3 | |
| 1191 nops_cnt += 1; | |
| 1192 masm.nop(nops_cnt); | |
| 1193 | |
| 1194 assert(cbuf.code_size() - code_size == size(ra_), "checking code size of inline cache node"); | |
| 1195 } | |
| 1196 | |
| 1197 uint MachUEPNode::size(PhaseRegAlloc *ra_) const { | |
| 1198 return OptoBreakpoint ? 11 : 12; | |
| 1199 } | |
| 1200 | |
| 1201 | |
| 1202 //============================================================================= | |
| 1203 uint size_exception_handler() { | |
| 1204 // NativeCall instruction size is the same as NativeJump. | |
| 1205 // exception handler starts out as jump and can be patched to | |
| 1206 // a call be deoptimization. (4932387) | |
| 1207 // Note that this value is also credited (in output.cpp) to | |
| 1208 // the size of the code section. | |
| 1209 return NativeJump::instruction_size; | |
| 1210 } | |
| 1211 | |
| 1212 // Emit exception handler code. Stuff framesize into a register | |
| 1213 // and call a VM stub routine. | |
| 1214 int emit_exception_handler(CodeBuffer& cbuf) { | |
| 1215 | |
| 1216 // Note that the code buffer's inst_mark is always relative to insts. | |
| 1217 // That's why we must use the macroassembler to generate a handler. | |
| 1218 MacroAssembler _masm(&cbuf); | |
| 1219 address base = | |
| 1220 __ start_a_stub(size_exception_handler()); | |
| 1221 if (base == NULL) return 0; // CodeBuffer::expand failed | |
| 1222 int offset = __ offset(); | |
| 1223 __ jump(RuntimeAddress(OptoRuntime::exception_blob()->instructions_begin())); | |
| 1224 assert(__ offset() - offset <= (int) size_exception_handler(), "overflow"); | |
| 1225 __ end_a_stub(); | |
| 1226 return offset; | |
| 1227 } | |
| 1228 | |
| 1229 uint size_deopt_handler() { | |
| 1230 // NativeCall instruction size is the same as NativeJump. | |
| 1231 // exception handler starts out as jump and can be patched to | |
| 1232 // a call be deoptimization. (4932387) | |
| 1233 // Note that this value is also credited (in output.cpp) to | |
| 1234 // the size of the code section. | |
| 1235 return 5 + NativeJump::instruction_size; // pushl(); jmp; | |
| 1236 } | |
| 1237 | |
| 1238 // Emit deopt handler code. | |
| 1239 int emit_deopt_handler(CodeBuffer& cbuf) { | |
| 1240 | |
| 1241 // Note that the code buffer's inst_mark is always relative to insts. | |
| 1242 // That's why we must use the macroassembler to generate a handler. | |
| 1243 MacroAssembler _masm(&cbuf); | |
| 1244 address base = | |
| 1245 __ start_a_stub(size_exception_handler()); | |
| 1246 if (base == NULL) return 0; // CodeBuffer::expand failed | |
| 1247 int offset = __ offset(); | |
| 1248 InternalAddress here(__ pc()); | |
| 1249 __ pushptr(here.addr()); | |
| 1250 | |
| 1251 __ jump(RuntimeAddress(SharedRuntime::deopt_blob()->unpack())); | |
| 1252 assert(__ offset() - offset <= (int) size_deopt_handler(), "overflow"); | |
| 1253 __ end_a_stub(); | |
| 1254 return offset; | |
| 1255 } | |
| 1256 | |
| 1257 | |
| 1258 static void emit_double_constant(CodeBuffer& cbuf, double x) { | |
| 1259 int mark = cbuf.insts()->mark_off(); | |
| 1260 MacroAssembler _masm(&cbuf); | |
| 1261 address double_address = __ double_constant(x); | |
| 1262 cbuf.insts()->set_mark_off(mark); // preserve mark across masm shift | |
| 1263 emit_d32_reloc(cbuf, | |
| 1264 (int)double_address, | |
| 1265 internal_word_Relocation::spec(double_address), | |
| 1266 RELOC_DISP32); | |
| 1267 } | |
| 1268 | |
| 1269 static void emit_float_constant(CodeBuffer& cbuf, float x) { | |
| 1270 int mark = cbuf.insts()->mark_off(); | |
| 1271 MacroAssembler _masm(&cbuf); | |
| 1272 address float_address = __ float_constant(x); | |
| 1273 cbuf.insts()->set_mark_off(mark); // preserve mark across masm shift | |
| 1274 emit_d32_reloc(cbuf, | |
| 1275 (int)float_address, | |
| 1276 internal_word_Relocation::spec(float_address), | |
| 1277 RELOC_DISP32); | |
| 1278 } | |
| 1279 | |
| 1280 | |
| 1281 int Matcher::regnum_to_fpu_offset(int regnum) { | |
| 1282 return regnum - 32; // The FP registers are in the second chunk | |
| 1283 } | |
| 1284 | |
| 1285 bool is_positive_zero_float(jfloat f) { | |
| 1286 return jint_cast(f) == jint_cast(0.0F); | |
| 1287 } | |
| 1288 | |
| 1289 bool is_positive_one_float(jfloat f) { | |
| 1290 return jint_cast(f) == jint_cast(1.0F); | |
| 1291 } | |
| 1292 | |
| 1293 bool is_positive_zero_double(jdouble d) { | |
| 1294 return jlong_cast(d) == jlong_cast(0.0); | |
| 1295 } | |
| 1296 | |
| 1297 bool is_positive_one_double(jdouble d) { | |
| 1298 return jlong_cast(d) == jlong_cast(1.0); | |
| 1299 } | |
| 1300 | |
| 1301 // This is UltraSparc specific, true just means we have fast l2f conversion | |
| 1302 const bool Matcher::convL2FSupported(void) { | |
| 1303 return true; | |
| 1304 } | |
| 1305 | |
| 1306 // Vector width in bytes | |
| 1307 const uint Matcher::vector_width_in_bytes(void) { | |
| 1308 return UseSSE >= 2 ? 8 : 0; | |
| 1309 } | |
| 1310 | |
| 1311 // Vector ideal reg | |
| 1312 const uint Matcher::vector_ideal_reg(void) { | |
| 1313 return Op_RegD; | |
| 1314 } | |
| 1315 | |
| 1316 // Is this branch offset short enough that a short branch can be used? | |
| 1317 // | |
| 1318 // NOTE: If the platform does not provide any short branch variants, then | |
| 1319 // this method should return false for offset 0. | |
| 1320 bool Matcher::is_short_branch_offset(int offset) { | |
| 1321 return (-128 <= offset && offset <= 127); | |
| 1322 } | |
| 1323 | |
| 1324 const bool Matcher::isSimpleConstant64(jlong value) { | |
| 1325 // Will one (StoreL ConL) be cheaper than two (StoreI ConI)?. | |
| 1326 return false; | |
| 1327 } | |
| 1328 | |
| 1329 // The ecx parameter to rep stos for the ClearArray node is in dwords. | |
| 1330 const bool Matcher::init_array_count_is_in_bytes = false; | |
| 1331 | |
| 1332 // Threshold size for cleararray. | |
| 1333 const int Matcher::init_array_short_size = 8 * BytesPerLong; | |
| 1334 | |
| 1335 // Should the Matcher clone shifts on addressing modes, expecting them to | |
| 1336 // be subsumed into complex addressing expressions or compute them into | |
| 1337 // registers? True for Intel but false for most RISCs | |
| 1338 const bool Matcher::clone_shift_expressions = true; | |
| 1339 | |
| 1340 // Is it better to copy float constants, or load them directly from memory? | |
| 1341 // Intel can load a float constant from a direct address, requiring no | |
| 1342 // extra registers. Most RISCs will have to materialize an address into a | |
| 1343 // register first, so they would do better to copy the constant from stack. | |
| 1344 const bool Matcher::rematerialize_float_constants = true; | |
| 1345 | |
| 1346 // If CPU can load and store mis-aligned doubles directly then no fixup is | |
| 1347 // needed. Else we split the double into 2 integer pieces and move it | |
| 1348 // piece-by-piece. Only happens when passing doubles into C code as the | |
| 1349 // Java calling convention forces doubles to be aligned. | |
| 1350 const bool Matcher::misaligned_doubles_ok = true; | |
| 1351 | |
| 1352 | |
| 1353 void Matcher::pd_implicit_null_fixup(MachNode *node, uint idx) { | |
| 1354 // Get the memory operand from the node | |
| 1355 uint numopnds = node->num_opnds(); // Virtual call for number of operands | |
| 1356 uint skipped = node->oper_input_base(); // Sum of leaves skipped so far | |
| 1357 assert( idx >= skipped, "idx too low in pd_implicit_null_fixup" ); | |
| 1358 uint opcnt = 1; // First operand | |
| 1359 uint num_edges = node->_opnds[1]->num_edges(); // leaves for first operand | |
| 1360 while( idx >= skipped+num_edges ) { | |
| 1361 skipped += num_edges; | |
| 1362 opcnt++; // Bump operand count | |
| 1363 assert( opcnt < numopnds, "Accessing non-existent operand" ); | |
| 1364 num_edges = node->_opnds[opcnt]->num_edges(); // leaves for next operand | |
| 1365 } | |
| 1366 | |
| 1367 MachOper *memory = node->_opnds[opcnt]; | |
| 1368 MachOper *new_memory = NULL; | |
| 1369 switch (memory->opcode()) { | |
| 1370 case DIRECT: | |
| 1371 case INDOFFSET32X: | |
| 1372 // No transformation necessary. | |
| 1373 return; | |
| 1374 case INDIRECT: | |
| 1375 new_memory = new (C) indirect_win95_safeOper( ); | |
| 1376 break; | |
| 1377 case INDOFFSET8: | |
| 1378 new_memory = new (C) indOffset8_win95_safeOper(memory->disp(NULL, NULL, 0)); | |
| 1379 break; | |
| 1380 case INDOFFSET32: | |
| 1381 new_memory = new (C) indOffset32_win95_safeOper(memory->disp(NULL, NULL, 0)); | |
| 1382 break; | |
| 1383 case INDINDEXOFFSET: | |
| 1384 new_memory = new (C) indIndexOffset_win95_safeOper(memory->disp(NULL, NULL, 0)); | |
| 1385 break; | |
| 1386 case INDINDEXSCALE: | |
| 1387 new_memory = new (C) indIndexScale_win95_safeOper(memory->scale()); | |
| 1388 break; | |
| 1389 case INDINDEXSCALEOFFSET: | |
| 1390 new_memory = new (C) indIndexScaleOffset_win95_safeOper(memory->scale(), memory->disp(NULL, NULL, 0)); | |
| 1391 break; | |
| 1392 case LOAD_LONG_INDIRECT: | |
| 1393 case LOAD_LONG_INDOFFSET32: | |
| 1394 // Does not use EBP as address register, use { EDX, EBX, EDI, ESI} | |
| 1395 return; | |
| 1396 default: | |
| 1397 assert(false, "unexpected memory operand in pd_implicit_null_fixup()"); | |
| 1398 return; | |
| 1399 } | |
| 1400 node->_opnds[opcnt] = new_memory; | |
| 1401 } | |
| 1402 | |
| 1403 // Advertise here if the CPU requires explicit rounding operations | |
| 1404 // to implement the UseStrictFP mode. | |
| 1405 const bool Matcher::strict_fp_requires_explicit_rounding = true; | |
| 1406 | |
| 1407 // Do floats take an entire double register or just half? | |
| 1408 const bool Matcher::float_in_double = true; | |
| 1409 // Do ints take an entire long register or just half? | |
| 1410 const bool Matcher::int_in_long = false; | |
| 1411 | |
| 1412 // Return whether or not this register is ever used as an argument. This | |
| 1413 // function is used on startup to build the trampoline stubs in generateOptoStub. | |
| 1414 // Registers not mentioned will be killed by the VM call in the trampoline, and | |
| 1415 // arguments in those registers not be available to the callee. | |
| 1416 bool Matcher::can_be_java_arg( int reg ) { | |
| 1417 if( reg == ECX_num || reg == EDX_num ) return true; | |
| 1418 if( (reg == XMM0a_num || reg == XMM1a_num) && UseSSE>=1 ) return true; | |
| 1419 if( (reg == XMM0b_num || reg == XMM1b_num) && UseSSE>=2 ) return true; | |
| 1420 return false; | |
| 1421 } | |
| 1422 | |
| 1423 bool Matcher::is_spillable_arg( int reg ) { | |
| 1424 return can_be_java_arg(reg); | |
| 1425 } | |
| 1426 | |
| 1427 // Register for DIVI projection of divmodI | |
| 1428 RegMask Matcher::divI_proj_mask() { | |
| 1429 return EAX_REG_mask; | |
| 1430 } | |
| 1431 | |
| 1432 // Register for MODI projection of divmodI | |
| 1433 RegMask Matcher::modI_proj_mask() { | |
| 1434 return EDX_REG_mask; | |
| 1435 } | |
| 1436 | |
| 1437 // Register for DIVL projection of divmodL | |
| 1438 RegMask Matcher::divL_proj_mask() { | |
| 1439 ShouldNotReachHere(); | |
| 1440 return RegMask(); | |
| 1441 } | |
| 1442 | |
| 1443 // Register for MODL projection of divmodL | |
| 1444 RegMask Matcher::modL_proj_mask() { | |
| 1445 ShouldNotReachHere(); | |
| 1446 return RegMask(); | |
| 1447 } | |
| 1448 | |
| 1449 %} | |
| 1450 | |
| 1451 //----------ENCODING BLOCK----------------------------------------------------- | |
| 1452 // This block specifies the encoding classes used by the compiler to output | |
| 1453 // byte streams. Encoding classes generate functions which are called by | |
| 1454 // Machine Instruction Nodes in order to generate the bit encoding of the | |
| 1455 // instruction. Operands specify their base encoding interface with the | |
| 1456 // interface keyword. There are currently supported four interfaces, | |
| 1457 // REG_INTER, CONST_INTER, MEMORY_INTER, & COND_INTER. REG_INTER causes an | |
| 1458 // operand to generate a function which returns its register number when | |
| 1459 // queried. CONST_INTER causes an operand to generate a function which | |
| 1460 // returns the value of the constant when queried. MEMORY_INTER causes an | |
| 1461 // operand to generate four functions which return the Base Register, the | |
| 1462 // Index Register, the Scale Value, and the Offset Value of the operand when | |
| 1463 // queried. COND_INTER causes an operand to generate six functions which | |
| 1464 // return the encoding code (ie - encoding bits for the instruction) | |
| 1465 // associated with each basic boolean condition for a conditional instruction. | |
| 1466 // Instructions specify two basic values for encoding. They use the | |
| 1467 // ins_encode keyword to specify their encoding class (which must be one of | |
| 1468 // the class names specified in the encoding block), and they use the | |
| 1469 // opcode keyword to specify, in order, their primary, secondary, and | |
| 1470 // tertiary opcode. Only the opcode sections which a particular instruction | |
| 1471 // needs for encoding need to be specified. | |
| 1472 encode %{ | |
| 1473 // Build emit functions for each basic byte or larger field in the intel | |
| 1474 // encoding scheme (opcode, rm, sib, immediate), and call them from C++ | |
| 1475 // code in the enc_class source block. Emit functions will live in the | |
| 1476 // main source block for now. In future, we can generalize this by | |
| 1477 // adding a syntax that specifies the sizes of fields in an order, | |
| 1478 // so that the adlc can build the emit functions automagically | |
| 1479 enc_class OpcP %{ // Emit opcode | |
| 1480 emit_opcode(cbuf,$primary); | |
| 1481 %} | |
| 1482 | |
| 1483 enc_class OpcS %{ // Emit opcode | |
| 1484 emit_opcode(cbuf,$secondary); | |
| 1485 %} | |
| 1486 | |
| 1487 enc_class Opcode(immI d8 ) %{ // Emit opcode | |
| 1488 emit_opcode(cbuf,$d8$$constant); | |
| 1489 %} | |
| 1490 | |
| 1491 enc_class SizePrefix %{ | |
| 1492 emit_opcode(cbuf,0x66); | |
| 1493 %} | |
| 1494 | |
| 1495 enc_class RegReg (eRegI dst, eRegI src) %{ // RegReg(Many) | |
| 1496 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 1497 %} | |
| 1498 | |
| 1499 enc_class OpcRegReg (immI opcode, eRegI dst, eRegI src) %{ // OpcRegReg(Many) | |
| 1500 emit_opcode(cbuf,$opcode$$constant); | |
| 1501 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 1502 %} | |
| 1503 | |
| 1504 enc_class mov_r32_imm0( eRegI dst ) %{ | |
| 1505 emit_opcode( cbuf, 0xB8 + $dst$$reg ); // 0xB8+ rd -- MOV r32 ,imm32 | |
| 1506 emit_d32 ( cbuf, 0x0 ); // imm32==0x0 | |
| 1507 %} | |
| 1508 | |
| 1509 enc_class cdq_enc %{ | |
| 1510 // Full implementation of Java idiv and irem; checks for | |
| 1511 // special case as described in JVM spec., p.243 & p.271. | |
| 1512 // | |
| 1513 // normal case special case | |
| 1514 // | |
| 1515 // input : rax,: dividend min_int | |
| 1516 // reg: divisor -1 | |
| 1517 // | |
| 1518 // output: rax,: quotient (= rax, idiv reg) min_int | |
| 1519 // rdx: remainder (= rax, irem reg) 0 | |
| 1520 // | |
| 1521 // Code sequnce: | |
| 1522 // | |
| 1523 // 81 F8 00 00 00 80 cmp rax,80000000h | |
| 1524 // 0F 85 0B 00 00 00 jne normal_case | |
| 1525 // 33 D2 xor rdx,edx | |
| 1526 // 83 F9 FF cmp rcx,0FFh | |
| 1527 // 0F 84 03 00 00 00 je done | |
| 1528 // normal_case: | |
| 1529 // 99 cdq | |
| 1530 // F7 F9 idiv rax,ecx | |
| 1531 // done: | |
| 1532 // | |
| 1533 emit_opcode(cbuf,0x81); emit_d8(cbuf,0xF8); | |
| 1534 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); | |
| 1535 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x80); // cmp rax,80000000h | |
| 1536 emit_opcode(cbuf,0x0F); emit_d8(cbuf,0x85); | |
| 1537 emit_opcode(cbuf,0x0B); emit_d8(cbuf,0x00); | |
| 1538 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); // jne normal_case | |
| 1539 emit_opcode(cbuf,0x33); emit_d8(cbuf,0xD2); // xor rdx,edx | |
| 1540 emit_opcode(cbuf,0x83); emit_d8(cbuf,0xF9); emit_d8(cbuf,0xFF); // cmp rcx,0FFh | |
| 1541 emit_opcode(cbuf,0x0F); emit_d8(cbuf,0x84); | |
| 1542 emit_opcode(cbuf,0x03); emit_d8(cbuf,0x00); | |
| 1543 emit_opcode(cbuf,0x00); emit_d8(cbuf,0x00); // je done | |
| 1544 // normal_case: | |
| 1545 emit_opcode(cbuf,0x99); // cdq | |
| 1546 // idiv (note: must be emitted by the user of this rule) | |
| 1547 // normal: | |
| 1548 %} | |
| 1549 | |
| 1550 // Dense encoding for older common ops | |
| 1551 enc_class Opc_plus(immI opcode, eRegI reg) %{ | |
| 1552 emit_opcode(cbuf, $opcode$$constant + $reg$$reg); | |
| 1553 %} | |
| 1554 | |
| 1555 | |
| 1556 // Opcde enc_class for 8/32 bit immediate instructions with sign-extension | |
| 1557 enc_class OpcSE (immI imm) %{ // Emit primary opcode and set sign-extend bit | |
| 1558 // Check for 8-bit immediate, and set sign extend bit in opcode | |
| 1559 if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { | |
| 1560 emit_opcode(cbuf, $primary | 0x02); | |
| 1561 } | |
| 1562 else { // If 32-bit immediate | |
| 1563 emit_opcode(cbuf, $primary); | |
| 1564 } | |
| 1565 %} | |
| 1566 | |
| 1567 enc_class OpcSErm (eRegI dst, immI imm) %{ // OpcSEr/m | |
| 1568 // Emit primary opcode and set sign-extend bit | |
| 1569 // Check for 8-bit immediate, and set sign extend bit in opcode | |
| 1570 if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { | |
| 1571 emit_opcode(cbuf, $primary | 0x02); } | |
| 1572 else { // If 32-bit immediate | |
| 1573 emit_opcode(cbuf, $primary); | |
| 1574 } | |
| 1575 // Emit r/m byte with secondary opcode, after primary opcode. | |
| 1576 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
| 1577 %} | |
| 1578 | |
| 1579 enc_class Con8or32 (immI imm) %{ // Con8or32(storeImmI), 8 or 32 bits | |
| 1580 // Check for 8-bit immediate, and set sign extend bit in opcode | |
| 1581 if (($imm$$constant >= -128) && ($imm$$constant <= 127)) { | |
| 1582 $$$emit8$imm$$constant; | |
| 1583 } | |
| 1584 else { // If 32-bit immediate | |
| 1585 // Output immediate | |
| 1586 $$$emit32$imm$$constant; | |
| 1587 } | |
| 1588 %} | |
| 1589 | |
| 1590 enc_class Long_OpcSErm_Lo(eRegL dst, immL imm) %{ | |
| 1591 // Emit primary opcode and set sign-extend bit | |
| 1592 // Check for 8-bit immediate, and set sign extend bit in opcode | |
| 1593 int con = (int)$imm$$constant; // Throw away top bits | |
| 1594 emit_opcode(cbuf, ((con >= -128) && (con <= 127)) ? ($primary | 0x02) : $primary); | |
| 1595 // Emit r/m byte with secondary opcode, after primary opcode. | |
| 1596 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
| 1597 if ((con >= -128) && (con <= 127)) emit_d8 (cbuf,con); | |
| 1598 else emit_d32(cbuf,con); | |
| 1599 %} | |
| 1600 | |
| 1601 enc_class Long_OpcSErm_Hi(eRegL dst, immL imm) %{ | |
| 1602 // Emit primary opcode and set sign-extend bit | |
| 1603 // Check for 8-bit immediate, and set sign extend bit in opcode | |
| 1604 int con = (int)($imm$$constant >> 32); // Throw away bottom bits | |
| 1605 emit_opcode(cbuf, ((con >= -128) && (con <= 127)) ? ($primary | 0x02) : $primary); | |
| 1606 // Emit r/m byte with tertiary opcode, after primary opcode. | |
| 1607 emit_rm(cbuf, 0x3, $tertiary, HIGH_FROM_LOW($dst$$reg)); | |
| 1608 if ((con >= -128) && (con <= 127)) emit_d8 (cbuf,con); | |
| 1609 else emit_d32(cbuf,con); | |
| 1610 %} | |
| 1611 | |
| 1612 enc_class Lbl (label labl) %{ // JMP, CALL | |
| 1613 Label *l = $labl$$label; | |
| 1614 emit_d32(cbuf, l ? (l->loc_pos() - (cbuf.code_size()+4)) : 0); | |
| 1615 %} | |
| 1616 | |
| 1617 enc_class LblShort (label labl) %{ // JMP, CALL | |
| 1618 Label *l = $labl$$label; | |
| 1619 int disp = l ? (l->loc_pos() - (cbuf.code_size()+1)) : 0; | |
| 1620 assert(-128 <= disp && disp <= 127, "Displacement too large for short jmp"); | |
| 1621 emit_d8(cbuf, disp); | |
| 1622 %} | |
| 1623 | |
| 1624 enc_class OpcSReg (eRegI dst) %{ // BSWAP | |
| 1625 emit_cc(cbuf, $secondary, $dst$$reg ); | |
| 1626 %} | |
| 1627 | |
| 1628 enc_class bswap_long_bytes(eRegL dst) %{ // BSWAP | |
| 1629 int destlo = $dst$$reg; | |
| 1630 int desthi = HIGH_FROM_LOW(destlo); | |
| 1631 // bswap lo | |
| 1632 emit_opcode(cbuf, 0x0F); | |
| 1633 emit_cc(cbuf, 0xC8, destlo); | |
| 1634 // bswap hi | |
| 1635 emit_opcode(cbuf, 0x0F); | |
| 1636 emit_cc(cbuf, 0xC8, desthi); | |
| 1637 // xchg lo and hi | |
| 1638 emit_opcode(cbuf, 0x87); | |
| 1639 emit_rm(cbuf, 0x3, destlo, desthi); | |
| 1640 %} | |
| 1641 | |
| 1642 enc_class RegOpc (eRegI div) %{ // IDIV, IMOD, JMP indirect, ... | |
| 1643 emit_rm(cbuf, 0x3, $secondary, $div$$reg ); | |
| 1644 %} | |
| 1645 | |
| 1646 enc_class Jcc (cmpOp cop, label labl) %{ // JCC | |
| 1647 Label *l = $labl$$label; | |
| 1648 $$$emit8$primary; | |
| 1649 emit_cc(cbuf, $secondary, $cop$$cmpcode); | |
| 1650 emit_d32(cbuf, l ? (l->loc_pos() - (cbuf.code_size()+4)) : 0); | |
| 1651 %} | |
| 1652 | |
| 1653 enc_class JccShort (cmpOp cop, label labl) %{ // JCC | |
| 1654 Label *l = $labl$$label; | |
| 1655 emit_cc(cbuf, $primary, $cop$$cmpcode); | |
| 1656 int disp = l ? (l->loc_pos() - (cbuf.code_size()+1)) : 0; | |
| 1657 assert(-128 <= disp && disp <= 127, "Displacement too large for short jmp"); | |
| 1658 emit_d8(cbuf, disp); | |
| 1659 %} | |
| 1660 | |
| 1661 enc_class enc_cmov(cmpOp cop ) %{ // CMOV | |
| 1662 $$$emit8$primary; | |
| 1663 emit_cc(cbuf, $secondary, $cop$$cmpcode); | |
| 1664 %} | |
| 1665 | |
| 1666 enc_class enc_cmov_d(cmpOp cop, regD src ) %{ // CMOV | |
| 1667 int op = 0xDA00 + $cop$$cmpcode + ($src$$reg-1); | |
| 1668 emit_d8(cbuf, op >> 8 ); | |
| 1669 emit_d8(cbuf, op & 255); | |
| 1670 %} | |
| 1671 | |
| 1672 // emulate a CMOV with a conditional branch around a MOV | |
| 1673 enc_class enc_cmov_branch( cmpOp cop, immI brOffs ) %{ // CMOV | |
| 1674 // Invert sense of branch from sense of CMOV | |
| 1675 emit_cc( cbuf, 0x70, ($cop$$cmpcode^1) ); | |
| 1676 emit_d8( cbuf, $brOffs$$constant ); | |
| 1677 %} | |
| 1678 | |
| 1679 enc_class enc_PartialSubtypeCheck( ) %{ | |
| 1680 Register Redi = as_Register(EDI_enc); // result register | |
| 1681 Register Reax = as_Register(EAX_enc); // super class | |
| 1682 Register Recx = as_Register(ECX_enc); // killed | |
| 1683 Register Resi = as_Register(ESI_enc); // sub class | |
| 1684 Label hit, miss; | |
| 1685 | |
| 1686 MacroAssembler _masm(&cbuf); | |
| 1687 // Compare super with sub directly, since super is not in its own SSA. | |
| 1688 // The compiler used to emit this test, but we fold it in here, | |
| 1689 // to allow platform-specific tweaking on sparc. | |
| 1690 __ cmpl(Reax, Resi); | |
| 1691 __ jcc(Assembler::equal, hit); | |
| 1692 #ifndef PRODUCT | |
| 1693 __ increment(ExternalAddress((address)&SharedRuntime::_partial_subtype_ctr)); | |
| 1694 #endif //PRODUCT | |
| 1695 __ movl(Redi,Address(Resi,sizeof(oopDesc) + Klass::secondary_supers_offset_in_bytes())); | |
| 1696 __ movl(Recx,Address(Redi,arrayOopDesc::length_offset_in_bytes())); | |
| 1697 __ addl(Redi,arrayOopDesc::base_offset_in_bytes(T_OBJECT)); | |
| 1698 __ repne_scan(); | |
| 1699 __ jcc(Assembler::notEqual, miss); | |
| 1700 __ movl(Address(Resi,sizeof(oopDesc) + Klass::secondary_super_cache_offset_in_bytes()),Reax); | |
| 1701 __ bind(hit); | |
| 1702 if( $primary ) | |
| 1703 __ xorl(Redi,Redi); | |
| 1704 __ bind(miss); | |
| 1705 %} | |
| 1706 | |
| 1707 enc_class FFree_Float_Stack_All %{ // Free_Float_Stack_All | |
| 1708 MacroAssembler masm(&cbuf); | |
| 1709 int start = masm.offset(); | |
| 1710 if (UseSSE >= 2) { | |
| 1711 if (VerifyFPU) { | |
| 1712 masm.verify_FPU(0, "must be empty in SSE2+ mode"); | |
| 1713 } | |
| 1714 } else { | |
| 1715 // External c_calling_convention expects the FPU stack to be 'clean'. | |
| 1716 // Compiled code leaves it dirty. Do cleanup now. | |
| 1717 masm.empty_FPU_stack(); | |
| 1718 } | |
| 1719 if (sizeof_FFree_Float_Stack_All == -1) { | |
| 1720 sizeof_FFree_Float_Stack_All = masm.offset() - start; | |
| 1721 } else { | |
| 1722 assert(masm.offset() - start == sizeof_FFree_Float_Stack_All, "wrong size"); | |
| 1723 } | |
| 1724 %} | |
| 1725 | |
| 1726 enc_class Verify_FPU_For_Leaf %{ | |
| 1727 if( VerifyFPU ) { | |
| 1728 MacroAssembler masm(&cbuf); | |
| 1729 masm.verify_FPU( -3, "Returning from Runtime Leaf call"); | |
| 1730 } | |
| 1731 %} | |
| 1732 | |
| 1733 enc_class Java_To_Runtime (method meth) %{ // CALL Java_To_Runtime, Java_To_Runtime_Leaf | |
| 1734 // This is the instruction starting address for relocation info. | |
| 1735 cbuf.set_inst_mark(); | |
| 1736 $$$emit8$primary; | |
| 1737 // CALL directly to the runtime | |
| 1738 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
| 1739 runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 1740 | |
| 1741 if (UseSSE >= 2) { | |
| 1742 MacroAssembler _masm(&cbuf); | |
| 1743 BasicType rt = tf()->return_type(); | |
| 1744 | |
| 1745 if ((rt == T_FLOAT || rt == T_DOUBLE) && !return_value_is_used()) { | |
| 1746 // A C runtime call where the return value is unused. In SSE2+ | |
| 1747 // mode the result needs to be removed from the FPU stack. It's | |
| 1748 // likely that this function call could be removed by the | |
| 1749 // optimizer if the C function is a pure function. | |
| 1750 __ ffree(0); | |
| 1751 } else if (rt == T_FLOAT) { | |
| 1752 __ leal(rsp, Address(rsp, -4)); | |
| 1753 __ fstp_s(Address(rsp, 0)); | |
| 1754 __ movflt(xmm0, Address(rsp, 0)); | |
| 1755 __ leal(rsp, Address(rsp, 4)); | |
| 1756 } else if (rt == T_DOUBLE) { | |
| 1757 __ leal(rsp, Address(rsp, -8)); | |
| 1758 __ fstp_d(Address(rsp, 0)); | |
| 1759 __ movdbl(xmm0, Address(rsp, 0)); | |
| 1760 __ leal(rsp, Address(rsp, 8)); | |
| 1761 } | |
| 1762 } | |
| 1763 %} | |
| 1764 | |
| 1765 | |
| 1766 enc_class pre_call_FPU %{ | |
| 1767 // If method sets FPU control word restore it here | |
| 1768 if( Compile::current()->in_24_bit_fp_mode() ) { | |
| 1769 MacroAssembler masm(&cbuf); | |
| 1770 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_std())); | |
| 1771 } | |
| 1772 %} | |
| 1773 | |
| 1774 enc_class post_call_FPU %{ | |
| 1775 // If method sets FPU control word do it here also | |
| 1776 if( Compile::current()->in_24_bit_fp_mode() ) { | |
| 1777 MacroAssembler masm(&cbuf); | |
| 1778 masm.fldcw(ExternalAddress(StubRoutines::addr_fpu_cntrl_wrd_24())); | |
| 1779 } | |
| 1780 %} | |
| 1781 | |
| 1782 enc_class Java_Static_Call (method meth) %{ // JAVA STATIC CALL | |
| 1783 // CALL to fixup routine. Fixup routine uses ScopeDesc info to determine | |
| 1784 // who we intended to call. | |
| 1785 cbuf.set_inst_mark(); | |
| 1786 $$$emit8$primary; | |
| 1787 if ( !_method ) { | |
| 1788 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
| 1789 runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 1790 } else if(_optimized_virtual) { | |
| 1791 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
| 1792 opt_virtual_call_Relocation::spec(), RELOC_IMM32 ); | |
| 1793 } else { | |
| 1794 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
| 1795 static_call_Relocation::spec(), RELOC_IMM32 ); | |
| 1796 } | |
| 1797 if( _method ) { // Emit stub for static call | |
| 1798 emit_java_to_interp(cbuf); | |
| 1799 } | |
| 1800 %} | |
| 1801 | |
| 1802 enc_class Java_Dynamic_Call (method meth) %{ // JAVA DYNAMIC CALL | |
| 1803 // !!!!! | |
| 1804 // Generate "Mov EAX,0x00", placeholder instruction to load oop-info | |
| 1805 // emit_call_dynamic_prologue( cbuf ); | |
| 1806 cbuf.set_inst_mark(); | |
| 1807 emit_opcode(cbuf, 0xB8 + EAX_enc); // mov EAX,-1 | |
| 1808 emit_d32_reloc(cbuf, (int)Universe::non_oop_word(), oop_Relocation::spec_for_immediate(), RELOC_IMM32); | |
| 1809 address virtual_call_oop_addr = cbuf.inst_mark(); | |
| 1810 // CALL to fixup routine. Fixup routine uses ScopeDesc info to determine | |
| 1811 // who we intended to call. | |
| 1812 cbuf.set_inst_mark(); | |
| 1813 $$$emit8$primary; | |
| 1814 emit_d32_reloc(cbuf, ($meth$$method - (int)(cbuf.code_end()) - 4), | |
| 1815 virtual_call_Relocation::spec(virtual_call_oop_addr), RELOC_IMM32 ); | |
| 1816 %} | |
| 1817 | |
| 1818 enc_class Java_Compiled_Call (method meth) %{ // JAVA COMPILED CALL | |
| 1819 int disp = in_bytes(methodOopDesc::from_compiled_offset()); | |
| 1820 assert( -128 <= disp && disp <= 127, "compiled_code_offset isn't small"); | |
| 1821 | |
| 1822 // CALL *[EAX+in_bytes(methodOopDesc::from_compiled_code_entry_point_offset())] | |
| 1823 cbuf.set_inst_mark(); | |
| 1824 $$$emit8$primary; | |
| 1825 emit_rm(cbuf, 0x01, $secondary, EAX_enc ); // R/M byte | |
| 1826 emit_d8(cbuf, disp); // Displacement | |
| 1827 | |
| 1828 %} | |
| 1829 | |
| 1830 enc_class Xor_Reg (eRegI dst) %{ | |
| 1831 emit_opcode(cbuf, 0x33); | |
| 1832 emit_rm(cbuf, 0x3, $dst$$reg, $dst$$reg); | |
| 1833 %} | |
| 1834 | |
| 1835 // Following encoding is no longer used, but may be restored if calling | |
| 1836 // convention changes significantly. | |
| 1837 // Became: Xor_Reg(EBP), Java_To_Runtime( labl ) | |
| 1838 // | |
| 1839 // enc_class Java_Interpreter_Call (label labl) %{ // JAVA INTERPRETER CALL | |
| 1840 // // int ic_reg = Matcher::inline_cache_reg(); | |
| 1841 // // int ic_encode = Matcher::_regEncode[ic_reg]; | |
| 1842 // // int imo_reg = Matcher::interpreter_method_oop_reg(); | |
| 1843 // // int imo_encode = Matcher::_regEncode[imo_reg]; | |
| 1844 // | |
| 1845 // // // Interpreter expects method_oop in EBX, currently a callee-saved register, | |
| 1846 // // // so we load it immediately before the call | |
| 1847 // // emit_opcode(cbuf, 0x8B); // MOV imo_reg,ic_reg # method_oop | |
| 1848 // // emit_rm(cbuf, 0x03, imo_encode, ic_encode ); // R/M byte | |
| 1849 // | |
| 1850 // // xor rbp,ebp | |
| 1851 // emit_opcode(cbuf, 0x33); | |
| 1852 // emit_rm(cbuf, 0x3, EBP_enc, EBP_enc); | |
| 1853 // | |
| 1854 // // CALL to interpreter. | |
| 1855 // cbuf.set_inst_mark(); | |
| 1856 // $$$emit8$primary; | |
| 1857 // emit_d32_reloc(cbuf, ($labl$$label - (int)(cbuf.code_end()) - 4), | |
| 1858 // runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 1859 // %} | |
| 1860 | |
| 1861 enc_class RegOpcImm (eRegI dst, immI8 shift) %{ // SHL, SAR, SHR | |
| 1862 $$$emit8$primary; | |
| 1863 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
| 1864 $$$emit8$shift$$constant; | |
| 1865 %} | |
| 1866 | |
| 1867 enc_class LdImmI (eRegI dst, immI src) %{ // Load Immediate | |
| 1868 // Load immediate does not have a zero or sign extended version | |
| 1869 // for 8-bit immediates | |
| 1870 emit_opcode(cbuf, 0xB8 + $dst$$reg); | |
| 1871 $$$emit32$src$$constant; | |
| 1872 %} | |
| 1873 | |
| 1874 enc_class LdImmP (eRegI dst, immI src) %{ // Load Immediate | |
| 1875 // Load immediate does not have a zero or sign extended version | |
| 1876 // for 8-bit immediates | |
| 1877 emit_opcode(cbuf, $primary + $dst$$reg); | |
| 1878 $$$emit32$src$$constant; | |
| 1879 %} | |
| 1880 | |
| 1881 enc_class LdImmL_Lo( eRegL dst, immL src) %{ // Load Immediate | |
| 1882 // Load immediate does not have a zero or sign extended version | |
| 1883 // for 8-bit immediates | |
| 1884 int dst_enc = $dst$$reg; | |
| 1885 int src_con = $src$$constant & 0x0FFFFFFFFL; | |
| 1886 if (src_con == 0) { | |
| 1887 // xor dst, dst | |
| 1888 emit_opcode(cbuf, 0x33); | |
| 1889 emit_rm(cbuf, 0x3, dst_enc, dst_enc); | |
| 1890 } else { | |
| 1891 emit_opcode(cbuf, $primary + dst_enc); | |
| 1892 emit_d32(cbuf, src_con); | |
| 1893 } | |
| 1894 %} | |
| 1895 | |
| 1896 enc_class LdImmL_Hi( eRegL dst, immL src) %{ // Load Immediate | |
| 1897 // Load immediate does not have a zero or sign extended version | |
| 1898 // for 8-bit immediates | |
| 1899 int dst_enc = $dst$$reg + 2; | |
| 1900 int src_con = ((julong)($src$$constant)) >> 32; | |
| 1901 if (src_con == 0) { | |
| 1902 // xor dst, dst | |
| 1903 emit_opcode(cbuf, 0x33); | |
| 1904 emit_rm(cbuf, 0x3, dst_enc, dst_enc); | |
| 1905 } else { | |
| 1906 emit_opcode(cbuf, $primary + dst_enc); | |
| 1907 emit_d32(cbuf, src_con); | |
| 1908 } | |
| 1909 %} | |
| 1910 | |
| 1911 | |
| 1912 enc_class LdImmD (immD src) %{ // Load Immediate | |
| 1913 if( is_positive_zero_double($src$$constant)) { | |
| 1914 // FLDZ | |
| 1915 emit_opcode(cbuf,0xD9); | |
| 1916 emit_opcode(cbuf,0xEE); | |
| 1917 } else if( is_positive_one_double($src$$constant)) { | |
| 1918 // FLD1 | |
| 1919 emit_opcode(cbuf,0xD9); | |
| 1920 emit_opcode(cbuf,0xE8); | |
| 1921 } else { | |
| 1922 emit_opcode(cbuf,0xDD); | |
| 1923 emit_rm(cbuf, 0x0, 0x0, 0x5); | |
| 1924 emit_double_constant(cbuf, $src$$constant); | |
| 1925 } | |
| 1926 %} | |
| 1927 | |
| 1928 | |
| 1929 enc_class LdImmF (immF src) %{ // Load Immediate | |
| 1930 if( is_positive_zero_float($src$$constant)) { | |
| 1931 emit_opcode(cbuf,0xD9); | |
| 1932 emit_opcode(cbuf,0xEE); | |
| 1933 } else if( is_positive_one_float($src$$constant)) { | |
| 1934 emit_opcode(cbuf,0xD9); | |
| 1935 emit_opcode(cbuf,0xE8); | |
| 1936 } else { | |
| 1937 $$$emit8$primary; | |
| 1938 // Load immediate does not have a zero or sign extended version | |
| 1939 // for 8-bit immediates | |
| 1940 // First load to TOS, then move to dst | |
| 1941 emit_rm(cbuf, 0x0, 0x0, 0x5); | |
| 1942 emit_float_constant(cbuf, $src$$constant); | |
| 1943 } | |
| 1944 %} | |
| 1945 | |
| 1946 enc_class LdImmX (regX dst, immXF con) %{ // Load Immediate | |
| 1947 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
| 1948 emit_float_constant(cbuf, $con$$constant); | |
| 1949 %} | |
| 1950 | |
| 1951 enc_class LdImmXD (regXD dst, immXD con) %{ // Load Immediate | |
| 1952 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
| 1953 emit_double_constant(cbuf, $con$$constant); | |
| 1954 %} | |
| 1955 | |
| 1956 enc_class load_conXD (regXD dst, immXD con) %{ // Load double constant | |
| 1957 // UseXmmLoadAndClearUpper ? movsd(dst, con) : movlpd(dst, con) | |
| 1958 emit_opcode(cbuf, UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
| 1959 emit_opcode(cbuf, 0x0F); | |
| 1960 emit_opcode(cbuf, UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
| 1961 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
| 1962 emit_double_constant(cbuf, $con$$constant); | |
| 1963 %} | |
| 1964 | |
| 1965 enc_class Opc_MemImm_F(immF src) %{ | |
| 1966 cbuf.set_inst_mark(); | |
| 1967 $$$emit8$primary; | |
| 1968 emit_rm(cbuf, 0x0, $secondary, 0x5); | |
| 1969 emit_float_constant(cbuf, $src$$constant); | |
| 1970 %} | |
| 1971 | |
| 1972 | |
| 1973 enc_class MovI2X_reg(regX dst, eRegI src) %{ | |
| 1974 emit_opcode(cbuf, 0x66 ); // MOVD dst,src | |
| 1975 emit_opcode(cbuf, 0x0F ); | |
| 1976 emit_opcode(cbuf, 0x6E ); | |
| 1977 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 1978 %} | |
| 1979 | |
| 1980 enc_class MovX2I_reg(eRegI dst, regX src) %{ | |
| 1981 emit_opcode(cbuf, 0x66 ); // MOVD dst,src | |
| 1982 emit_opcode(cbuf, 0x0F ); | |
| 1983 emit_opcode(cbuf, 0x7E ); | |
| 1984 emit_rm(cbuf, 0x3, $src$$reg, $dst$$reg); | |
| 1985 %} | |
| 1986 | |
| 1987 enc_class MovL2XD_reg(regXD dst, eRegL src, regXD tmp) %{ | |
| 1988 { // MOVD $dst,$src.lo | |
| 1989 emit_opcode(cbuf,0x66); | |
| 1990 emit_opcode(cbuf,0x0F); | |
| 1991 emit_opcode(cbuf,0x6E); | |
| 1992 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 1993 } | |
| 1994 { // MOVD $tmp,$src.hi | |
| 1995 emit_opcode(cbuf,0x66); | |
| 1996 emit_opcode(cbuf,0x0F); | |
| 1997 emit_opcode(cbuf,0x6E); | |
| 1998 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg)); | |
| 1999 } | |
| 2000 { // PUNPCKLDQ $dst,$tmp | |
| 2001 emit_opcode(cbuf,0x66); | |
| 2002 emit_opcode(cbuf,0x0F); | |
| 2003 emit_opcode(cbuf,0x62); | |
| 2004 emit_rm(cbuf, 0x3, $dst$$reg, $tmp$$reg); | |
| 2005 } | |
| 2006 %} | |
| 2007 | |
| 2008 enc_class MovXD2L_reg(eRegL dst, regXD src, regXD tmp) %{ | |
| 2009 { // MOVD $dst.lo,$src | |
| 2010 emit_opcode(cbuf,0x66); | |
| 2011 emit_opcode(cbuf,0x0F); | |
| 2012 emit_opcode(cbuf,0x7E); | |
| 2013 emit_rm(cbuf, 0x3, $src$$reg, $dst$$reg); | |
| 2014 } | |
| 2015 { // PSHUFLW $tmp,$src,0x4E (01001110b) | |
| 2016 emit_opcode(cbuf,0xF2); | |
| 2017 emit_opcode(cbuf,0x0F); | |
| 2018 emit_opcode(cbuf,0x70); | |
| 2019 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); | |
| 2020 emit_d8(cbuf, 0x4E); | |
| 2021 } | |
| 2022 { // MOVD $dst.hi,$tmp | |
| 2023 emit_opcode(cbuf,0x66); | |
| 2024 emit_opcode(cbuf,0x0F); | |
| 2025 emit_opcode(cbuf,0x7E); | |
| 2026 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg)); | |
| 2027 } | |
| 2028 %} | |
| 2029 | |
| 2030 | |
| 2031 // Encode a reg-reg copy. If it is useless, then empty encoding. | |
| 2032 enc_class enc_Copy( eRegI dst, eRegI src ) %{ | |
| 2033 encode_Copy( cbuf, $dst$$reg, $src$$reg ); | |
| 2034 %} | |
| 2035 | |
| 2036 enc_class enc_CopyL_Lo( eRegI dst, eRegL src ) %{ | |
| 2037 encode_Copy( cbuf, $dst$$reg, $src$$reg ); | |
| 2038 %} | |
| 2039 | |
| 2040 // Encode xmm reg-reg copy. If it is useless, then empty encoding. | |
| 2041 enc_class enc_CopyXD( RegXD dst, RegXD src ) %{ | |
| 2042 encode_CopyXD( cbuf, $dst$$reg, $src$$reg ); | |
| 2043 %} | |
| 2044 | |
| 2045 enc_class RegReg (eRegI dst, eRegI src) %{ // RegReg(Many) | |
| 2046 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 2047 %} | |
| 2048 | |
| 2049 enc_class RegReg_Lo(eRegL dst, eRegL src) %{ // RegReg(Many) | |
| 2050 $$$emit8$primary; | |
| 2051 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 2052 %} | |
| 2053 | |
| 2054 enc_class RegReg_Hi(eRegL dst, eRegL src) %{ // RegReg(Many) | |
| 2055 $$$emit8$secondary; | |
| 2056 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg)); | |
| 2057 %} | |
| 2058 | |
| 2059 enc_class RegReg_Lo2(eRegL dst, eRegL src) %{ // RegReg(Many) | |
| 2060 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 2061 %} | |
| 2062 | |
| 2063 enc_class RegReg_Hi2(eRegL dst, eRegL src) %{ // RegReg(Many) | |
| 2064 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg)); | |
| 2065 %} | |
| 2066 | |
| 2067 enc_class RegReg_HiLo( eRegL src, eRegI dst ) %{ | |
| 2068 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($src$$reg)); | |
| 2069 %} | |
| 2070 | |
| 2071 enc_class Con32 (immI src) %{ // Con32(storeImmI) | |
| 2072 // Output immediate | |
| 2073 $$$emit32$src$$constant; | |
| 2074 %} | |
| 2075 | |
| 2076 enc_class Con32F_as_bits(immF src) %{ // storeF_imm | |
| 2077 // Output Float immediate bits | |
| 2078 jfloat jf = $src$$constant; | |
| 2079 int jf_as_bits = jint_cast( jf ); | |
| 2080 emit_d32(cbuf, jf_as_bits); | |
| 2081 %} | |
| 2082 | |
| 2083 enc_class Con32XF_as_bits(immXF src) %{ // storeX_imm | |
| 2084 // Output Float immediate bits | |
| 2085 jfloat jf = $src$$constant; | |
| 2086 int jf_as_bits = jint_cast( jf ); | |
| 2087 emit_d32(cbuf, jf_as_bits); | |
| 2088 %} | |
| 2089 | |
| 2090 enc_class Con16 (immI src) %{ // Con16(storeImmI) | |
| 2091 // Output immediate | |
| 2092 $$$emit16$src$$constant; | |
| 2093 %} | |
| 2094 | |
| 2095 enc_class Con_d32(immI src) %{ | |
| 2096 emit_d32(cbuf,$src$$constant); | |
| 2097 %} | |
| 2098 | |
| 2099 enc_class conmemref (eRegP t1) %{ // Con32(storeImmI) | |
| 2100 // Output immediate memory reference | |
| 2101 emit_rm(cbuf, 0x00, $t1$$reg, 0x05 ); | |
| 2102 emit_d32(cbuf, 0x00); | |
| 2103 %} | |
| 2104 | |
| 2105 enc_class lock_prefix( ) %{ | |
| 2106 if( os::is_MP() ) | |
| 2107 emit_opcode(cbuf,0xF0); // [Lock] | |
| 2108 %} | |
| 2109 | |
| 2110 // Cmp-xchg long value. | |
| 2111 // Note: we need to swap rbx, and rcx before and after the | |
| 2112 // cmpxchg8 instruction because the instruction uses | |
| 2113 // rcx as the high order word of the new value to store but | |
| 2114 // our register encoding uses rbx,. | |
| 2115 enc_class enc_cmpxchg8(eSIRegP mem_ptr) %{ | |
| 2116 | |
| 2117 // XCHG rbx,ecx | |
| 2118 emit_opcode(cbuf,0x87); | |
| 2119 emit_opcode(cbuf,0xD9); | |
| 2120 // [Lock] | |
| 2121 if( os::is_MP() ) | |
| 2122 emit_opcode(cbuf,0xF0); | |
| 2123 // CMPXCHG8 [Eptr] | |
| 2124 emit_opcode(cbuf,0x0F); | |
| 2125 emit_opcode(cbuf,0xC7); | |
| 2126 emit_rm( cbuf, 0x0, 1, $mem_ptr$$reg ); | |
| 2127 // XCHG rbx,ecx | |
| 2128 emit_opcode(cbuf,0x87); | |
| 2129 emit_opcode(cbuf,0xD9); | |
| 2130 %} | |
| 2131 | |
| 2132 enc_class enc_cmpxchg(eSIRegP mem_ptr) %{ | |
| 2133 // [Lock] | |
| 2134 if( os::is_MP() ) | |
| 2135 emit_opcode(cbuf,0xF0); | |
| 2136 | |
| 2137 // CMPXCHG [Eptr] | |
| 2138 emit_opcode(cbuf,0x0F); | |
| 2139 emit_opcode(cbuf,0xB1); | |
| 2140 emit_rm( cbuf, 0x0, 1, $mem_ptr$$reg ); | |
| 2141 %} | |
| 2142 | |
| 2143 enc_class enc_flags_ne_to_boolean( iRegI res ) %{ | |
| 2144 int res_encoding = $res$$reg; | |
| 2145 | |
| 2146 // MOV res,0 | |
| 2147 emit_opcode( cbuf, 0xB8 + res_encoding); | |
| 2148 emit_d32( cbuf, 0 ); | |
| 2149 // JNE,s fail | |
| 2150 emit_opcode(cbuf,0x75); | |
| 2151 emit_d8(cbuf, 5 ); | |
| 2152 // MOV res,1 | |
| 2153 emit_opcode( cbuf, 0xB8 + res_encoding); | |
| 2154 emit_d32( cbuf, 1 ); | |
| 2155 // fail: | |
| 2156 %} | |
| 2157 | |
| 2158 enc_class set_instruction_start( ) %{ | |
| 2159 cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand | |
| 2160 %} | |
| 2161 | |
| 2162 enc_class RegMem (eRegI ereg, memory mem) %{ // emit_reg_mem | |
| 2163 int reg_encoding = $ereg$$reg; | |
| 2164 int base = $mem$$base; | |
| 2165 int index = $mem$$index; | |
| 2166 int scale = $mem$$scale; | |
| 2167 int displace = $mem$$disp; | |
| 2168 bool disp_is_oop = $mem->disp_is_oop(); | |
| 2169 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
| 2170 %} | |
| 2171 | |
| 2172 enc_class RegMem_Hi(eRegL ereg, memory mem) %{ // emit_reg_mem | |
| 2173 int reg_encoding = HIGH_FROM_LOW($ereg$$reg); // Hi register of pair, computed from lo | |
| 2174 int base = $mem$$base; | |
| 2175 int index = $mem$$index; | |
| 2176 int scale = $mem$$scale; | |
| 2177 int displace = $mem$$disp + 4; // Offset is 4 further in memory | |
| 2178 assert( !$mem->disp_is_oop(), "Cannot add 4 to oop" ); | |
| 2179 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, false/*disp_is_oop*/); | |
| 2180 %} | |
| 2181 | |
| 2182 enc_class move_long_small_shift( eRegL dst, immI_1_31 cnt ) %{ | |
| 2183 int r1, r2; | |
| 2184 if( $tertiary == 0xA4 ) { r1 = $dst$$reg; r2 = HIGH_FROM_LOW($dst$$reg); } | |
| 2185 else { r2 = $dst$$reg; r1 = HIGH_FROM_LOW($dst$$reg); } | |
| 2186 emit_opcode(cbuf,0x0F); | |
| 2187 emit_opcode(cbuf,$tertiary); | |
| 2188 emit_rm(cbuf, 0x3, r1, r2); | |
| 2189 emit_d8(cbuf,$cnt$$constant); | |
| 2190 emit_d8(cbuf,$primary); | |
| 2191 emit_rm(cbuf, 0x3, $secondary, r1); | |
| 2192 emit_d8(cbuf,$cnt$$constant); | |
| 2193 %} | |
| 2194 | |
| 2195 enc_class move_long_big_shift_sign( eRegL dst, immI_32_63 cnt ) %{ | |
| 2196 emit_opcode( cbuf, 0x8B ); // Move | |
| 2197 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg)); | |
| 2198 emit_d8(cbuf,$primary); | |
| 2199 emit_rm(cbuf, 0x3, $secondary, $dst$$reg); | |
| 2200 emit_d8(cbuf,$cnt$$constant-32); | |
| 2201 emit_d8(cbuf,$primary); | |
| 2202 emit_rm(cbuf, 0x3, $secondary, HIGH_FROM_LOW($dst$$reg)); | |
| 2203 emit_d8(cbuf,31); | |
| 2204 %} | |
| 2205 | |
| 2206 enc_class move_long_big_shift_clr( eRegL dst, immI_32_63 cnt ) %{ | |
| 2207 int r1, r2; | |
| 2208 if( $secondary == 0x5 ) { r1 = $dst$$reg; r2 = HIGH_FROM_LOW($dst$$reg); } | |
| 2209 else { r2 = $dst$$reg; r1 = HIGH_FROM_LOW($dst$$reg); } | |
| 2210 | |
| 2211 emit_opcode( cbuf, 0x8B ); // Move r1,r2 | |
| 2212 emit_rm(cbuf, 0x3, r1, r2); | |
| 2213 if( $cnt$$constant > 32 ) { // Shift, if not by zero | |
| 2214 emit_opcode(cbuf,$primary); | |
| 2215 emit_rm(cbuf, 0x3, $secondary, r1); | |
| 2216 emit_d8(cbuf,$cnt$$constant-32); | |
| 2217 } | |
| 2218 emit_opcode(cbuf,0x33); // XOR r2,r2 | |
| 2219 emit_rm(cbuf, 0x3, r2, r2); | |
| 2220 %} | |
| 2221 | |
| 2222 // Clone of RegMem but accepts an extra parameter to access each | |
| 2223 // half of a double in memory; it never needs relocation info. | |
| 2224 enc_class Mov_MemD_half_to_Reg (immI opcode, memory mem, immI disp_for_half, eRegI rm_reg) %{ | |
| 2225 emit_opcode(cbuf,$opcode$$constant); | |
| 2226 int reg_encoding = $rm_reg$$reg; | |
| 2227 int base = $mem$$base; | |
| 2228 int index = $mem$$index; | |
| 2229 int scale = $mem$$scale; | |
| 2230 int displace = $mem$$disp + $disp_for_half$$constant; | |
| 2231 bool disp_is_oop = false; | |
| 2232 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
| 2233 %} | |
| 2234 | |
| 2235 // !!!!! Special Custom Code used by MemMove, and stack access instructions !!!!! | |
| 2236 // | |
| 2237 // Clone of RegMem except the RM-byte's reg/opcode field is an ADLC-time constant | |
| 2238 // and it never needs relocation information. | |
| 2239 // Frequently used to move data between FPU's Stack Top and memory. | |
| 2240 enc_class RMopc_Mem_no_oop (immI rm_opcode, memory mem) %{ | |
| 2241 int rm_byte_opcode = $rm_opcode$$constant; | |
| 2242 int base = $mem$$base; | |
| 2243 int index = $mem$$index; | |
| 2244 int scale = $mem$$scale; | |
| 2245 int displace = $mem$$disp; | |
| 2246 assert( !$mem->disp_is_oop(), "No oops here because no relo info allowed" ); | |
| 2247 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, false); | |
| 2248 %} | |
| 2249 | |
| 2250 enc_class RMopc_Mem (immI rm_opcode, memory mem) %{ | |
| 2251 int rm_byte_opcode = $rm_opcode$$constant; | |
| 2252 int base = $mem$$base; | |
| 2253 int index = $mem$$index; | |
| 2254 int scale = $mem$$scale; | |
| 2255 int displace = $mem$$disp; | |
| 2256 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 2257 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); | |
| 2258 %} | |
| 2259 | |
| 2260 enc_class RegLea (eRegI dst, eRegI src0, immI src1 ) %{ // emit_reg_lea | |
| 2261 int reg_encoding = $dst$$reg; | |
| 2262 int base = $src0$$reg; // 0xFFFFFFFF indicates no base | |
| 2263 int index = 0x04; // 0x04 indicates no index | |
| 2264 int scale = 0x00; // 0x00 indicates no scale | |
| 2265 int displace = $src1$$constant; // 0x00 indicates no displacement | |
| 2266 bool disp_is_oop = false; | |
| 2267 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
| 2268 %} | |
| 2269 | |
| 2270 enc_class min_enc (eRegI dst, eRegI src) %{ // MIN | |
| 2271 // Compare dst,src | |
| 2272 emit_opcode(cbuf,0x3B); | |
| 2273 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 2274 // jmp dst < src around move | |
| 2275 emit_opcode(cbuf,0x7C); | |
| 2276 emit_d8(cbuf,2); | |
| 2277 // move dst,src | |
| 2278 emit_opcode(cbuf,0x8B); | |
| 2279 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 2280 %} | |
| 2281 | |
| 2282 enc_class max_enc (eRegI dst, eRegI src) %{ // MAX | |
| 2283 // Compare dst,src | |
| 2284 emit_opcode(cbuf,0x3B); | |
| 2285 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 2286 // jmp dst > src around move | |
| 2287 emit_opcode(cbuf,0x7F); | |
| 2288 emit_d8(cbuf,2); | |
| 2289 // move dst,src | |
| 2290 emit_opcode(cbuf,0x8B); | |
| 2291 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 2292 %} | |
| 2293 | |
| 2294 enc_class enc_FP_store(memory mem, regD src) %{ | |
| 2295 // If src is FPR1, we can just FST to store it. | |
| 2296 // Else we need to FLD it to FPR1, then FSTP to store/pop it. | |
| 2297 int reg_encoding = 0x2; // Just store | |
| 2298 int base = $mem$$base; | |
| 2299 int index = $mem$$index; | |
| 2300 int scale = $mem$$scale; | |
| 2301 int displace = $mem$$disp; | |
| 2302 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 2303 if( $src$$reg != FPR1L_enc ) { | |
| 2304 reg_encoding = 0x3; // Store & pop | |
| 2305 emit_opcode( cbuf, 0xD9 ); // FLD (i.e., push it) | |
| 2306 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
| 2307 } | |
| 2308 cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand | |
| 2309 emit_opcode(cbuf,$primary); | |
| 2310 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
| 2311 %} | |
| 2312 | |
| 2313 enc_class neg_reg(eRegI dst) %{ | |
| 2314 // NEG $dst | |
| 2315 emit_opcode(cbuf,0xF7); | |
| 2316 emit_rm(cbuf, 0x3, 0x03, $dst$$reg ); | |
| 2317 %} | |
| 2318 | |
| 2319 enc_class setLT_reg(eCXRegI dst) %{ | |
| 2320 // SETLT $dst | |
| 2321 emit_opcode(cbuf,0x0F); | |
| 2322 emit_opcode(cbuf,0x9C); | |
| 2323 emit_rm( cbuf, 0x3, 0x4, $dst$$reg ); | |
| 2324 %} | |
| 2325 | |
| 2326 enc_class enc_cmpLTP(ncxRegI p, ncxRegI q, ncxRegI y, eCXRegI tmp) %{ // cadd_cmpLT | |
| 2327 int tmpReg = $tmp$$reg; | |
| 2328 | |
| 2329 // SUB $p,$q | |
| 2330 emit_opcode(cbuf,0x2B); | |
| 2331 emit_rm(cbuf, 0x3, $p$$reg, $q$$reg); | |
| 2332 // SBB $tmp,$tmp | |
| 2333 emit_opcode(cbuf,0x1B); | |
| 2334 emit_rm(cbuf, 0x3, tmpReg, tmpReg); | |
| 2335 // AND $tmp,$y | |
| 2336 emit_opcode(cbuf,0x23); | |
| 2337 emit_rm(cbuf, 0x3, tmpReg, $y$$reg); | |
| 2338 // ADD $p,$tmp | |
| 2339 emit_opcode(cbuf,0x03); | |
| 2340 emit_rm(cbuf, 0x3, $p$$reg, tmpReg); | |
| 2341 %} | |
| 2342 | |
| 2343 enc_class enc_cmpLTP_mem(eRegI p, eRegI q, memory mem, eCXRegI tmp) %{ // cadd_cmpLT | |
| 2344 int tmpReg = $tmp$$reg; | |
| 2345 | |
| 2346 // SUB $p,$q | |
| 2347 emit_opcode(cbuf,0x2B); | |
| 2348 emit_rm(cbuf, 0x3, $p$$reg, $q$$reg); | |
| 2349 // SBB $tmp,$tmp | |
| 2350 emit_opcode(cbuf,0x1B); | |
| 2351 emit_rm(cbuf, 0x3, tmpReg, tmpReg); | |
| 2352 // AND $tmp,$y | |
| 2353 cbuf.set_inst_mark(); // Mark start of opcode for reloc info in mem operand | |
| 2354 emit_opcode(cbuf,0x23); | |
| 2355 int reg_encoding = tmpReg; | |
| 2356 int base = $mem$$base; | |
| 2357 int index = $mem$$index; | |
| 2358 int scale = $mem$$scale; | |
| 2359 int displace = $mem$$disp; | |
| 2360 bool disp_is_oop = $mem->disp_is_oop(); | |
| 2361 encode_RegMem(cbuf, reg_encoding, base, index, scale, displace, disp_is_oop); | |
| 2362 // ADD $p,$tmp | |
| 2363 emit_opcode(cbuf,0x03); | |
| 2364 emit_rm(cbuf, 0x3, $p$$reg, tmpReg); | |
| 2365 %} | |
| 2366 | |
| 2367 enc_class shift_left_long( eRegL dst, eCXRegI shift ) %{ | |
| 2368 // TEST shift,32 | |
| 2369 emit_opcode(cbuf,0xF7); | |
| 2370 emit_rm(cbuf, 0x3, 0, ECX_enc); | |
| 2371 emit_d32(cbuf,0x20); | |
| 2372 // JEQ,s small | |
| 2373 emit_opcode(cbuf, 0x74); | |
| 2374 emit_d8(cbuf, 0x04); | |
| 2375 // MOV $dst.hi,$dst.lo | |
| 2376 emit_opcode( cbuf, 0x8B ); | |
| 2377 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg ); | |
| 2378 // CLR $dst.lo | |
| 2379 emit_opcode(cbuf, 0x33); | |
| 2380 emit_rm(cbuf, 0x3, $dst$$reg, $dst$$reg); | |
| 2381 // small: | |
| 2382 // SHLD $dst.hi,$dst.lo,$shift | |
| 2383 emit_opcode(cbuf,0x0F); | |
| 2384 emit_opcode(cbuf,0xA5); | |
| 2385 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg)); | |
| 2386 // SHL $dst.lo,$shift" | |
| 2387 emit_opcode(cbuf,0xD3); | |
| 2388 emit_rm(cbuf, 0x3, 0x4, $dst$$reg ); | |
| 2389 %} | |
| 2390 | |
| 2391 enc_class shift_right_long( eRegL dst, eCXRegI shift ) %{ | |
| 2392 // TEST shift,32 | |
| 2393 emit_opcode(cbuf,0xF7); | |
| 2394 emit_rm(cbuf, 0x3, 0, ECX_enc); | |
| 2395 emit_d32(cbuf,0x20); | |
| 2396 // JEQ,s small | |
| 2397 emit_opcode(cbuf, 0x74); | |
| 2398 emit_d8(cbuf, 0x04); | |
| 2399 // MOV $dst.lo,$dst.hi | |
| 2400 emit_opcode( cbuf, 0x8B ); | |
| 2401 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
| 2402 // CLR $dst.hi | |
| 2403 emit_opcode(cbuf, 0x33); | |
| 2404 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($dst$$reg)); | |
| 2405 // small: | |
| 2406 // SHRD $dst.lo,$dst.hi,$shift | |
| 2407 emit_opcode(cbuf,0x0F); | |
| 2408 emit_opcode(cbuf,0xAD); | |
| 2409 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg); | |
| 2410 // SHR $dst.hi,$shift" | |
| 2411 emit_opcode(cbuf,0xD3); | |
| 2412 emit_rm(cbuf, 0x3, 0x5, HIGH_FROM_LOW($dst$$reg) ); | |
| 2413 %} | |
| 2414 | |
| 2415 enc_class shift_right_arith_long( eRegL dst, eCXRegI shift ) %{ | |
| 2416 // TEST shift,32 | |
| 2417 emit_opcode(cbuf,0xF7); | |
| 2418 emit_rm(cbuf, 0x3, 0, ECX_enc); | |
| 2419 emit_d32(cbuf,0x20); | |
| 2420 // JEQ,s small | |
| 2421 emit_opcode(cbuf, 0x74); | |
| 2422 emit_d8(cbuf, 0x05); | |
| 2423 // MOV $dst.lo,$dst.hi | |
| 2424 emit_opcode( cbuf, 0x8B ); | |
| 2425 emit_rm(cbuf, 0x3, $dst$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
| 2426 // SAR $dst.hi,31 | |
| 2427 emit_opcode(cbuf, 0xC1); | |
| 2428 emit_rm(cbuf, 0x3, 7, HIGH_FROM_LOW($dst$$reg) ); | |
| 2429 emit_d8(cbuf, 0x1F ); | |
| 2430 // small: | |
| 2431 // SHRD $dst.lo,$dst.hi,$shift | |
| 2432 emit_opcode(cbuf,0x0F); | |
| 2433 emit_opcode(cbuf,0xAD); | |
| 2434 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg); | |
| 2435 // SAR $dst.hi,$shift" | |
| 2436 emit_opcode(cbuf,0xD3); | |
| 2437 emit_rm(cbuf, 0x3, 0x7, HIGH_FROM_LOW($dst$$reg) ); | |
| 2438 %} | |
| 2439 | |
| 2440 | |
| 2441 // ----------------- Encodings for floating point unit ----------------- | |
| 2442 // May leave result in FPU-TOS or FPU reg depending on opcodes | |
| 2443 enc_class OpcReg_F (regF src) %{ // FMUL, FDIV | |
| 2444 $$$emit8$primary; | |
| 2445 emit_rm(cbuf, 0x3, $secondary, $src$$reg ); | |
| 2446 %} | |
| 2447 | |
| 2448 // Pop argument in FPR0 with FSTP ST(0) | |
| 2449 enc_class PopFPU() %{ | |
| 2450 emit_opcode( cbuf, 0xDD ); | |
| 2451 emit_d8( cbuf, 0xD8 ); | |
| 2452 %} | |
| 2453 | |
| 2454 // !!!!! equivalent to Pop_Reg_F | |
| 2455 enc_class Pop_Reg_D( regD dst ) %{ | |
| 2456 emit_opcode( cbuf, 0xDD ); // FSTP ST(i) | |
| 2457 emit_d8( cbuf, 0xD8+$dst$$reg ); | |
| 2458 %} | |
| 2459 | |
| 2460 enc_class Push_Reg_D( regD dst ) %{ | |
| 2461 emit_opcode( cbuf, 0xD9 ); | |
| 2462 emit_d8( cbuf, 0xC0-1+$dst$$reg ); // FLD ST(i-1) | |
| 2463 %} | |
| 2464 | |
| 2465 enc_class strictfp_bias1( regD dst ) %{ | |
| 2466 emit_opcode( cbuf, 0xDB ); // FLD m80real | |
| 2467 emit_opcode( cbuf, 0x2D ); | |
| 2468 emit_d32( cbuf, (int)StubRoutines::addr_fpu_subnormal_bias1() ); | |
| 2469 emit_opcode( cbuf, 0xDE ); // FMULP ST(dst), ST0 | |
| 2470 emit_opcode( cbuf, 0xC8+$dst$$reg ); | |
| 2471 %} | |
| 2472 | |
| 2473 enc_class strictfp_bias2( regD dst ) %{ | |
| 2474 emit_opcode( cbuf, 0xDB ); // FLD m80real | |
| 2475 emit_opcode( cbuf, 0x2D ); | |
| 2476 emit_d32( cbuf, (int)StubRoutines::addr_fpu_subnormal_bias2() ); | |
| 2477 emit_opcode( cbuf, 0xDE ); // FMULP ST(dst), ST0 | |
| 2478 emit_opcode( cbuf, 0xC8+$dst$$reg ); | |
| 2479 %} | |
| 2480 | |
| 2481 // Special case for moving an integer register to a stack slot. | |
| 2482 enc_class OpcPRegSS( stackSlotI dst, eRegI src ) %{ // RegSS | |
| 2483 store_to_stackslot( cbuf, $primary, $src$$reg, $dst$$disp ); | |
| 2484 %} | |
| 2485 | |
| 2486 // Special case for moving a register to a stack slot. | |
| 2487 enc_class RegSS( stackSlotI dst, eRegI src ) %{ // RegSS | |
| 2488 // Opcode already emitted | |
| 2489 emit_rm( cbuf, 0x02, $src$$reg, ESP_enc ); // R/M byte | |
| 2490 emit_rm( cbuf, 0x00, ESP_enc, ESP_enc); // SIB byte | |
| 2491 emit_d32(cbuf, $dst$$disp); // Displacement | |
| 2492 %} | |
| 2493 | |
| 2494 // Push the integer in stackSlot 'src' onto FP-stack | |
| 2495 enc_class Push_Mem_I( memory src ) %{ // FILD [ESP+src] | |
| 2496 store_to_stackslot( cbuf, $primary, $secondary, $src$$disp ); | |
| 2497 %} | |
| 2498 | |
| 2499 // Push the float in stackSlot 'src' onto FP-stack | |
| 2500 enc_class Push_Mem_F( memory src ) %{ // FLD_S [ESP+src] | |
| 2501 store_to_stackslot( cbuf, 0xD9, 0x00, $src$$disp ); | |
| 2502 %} | |
| 2503 | |
| 2504 // Push the double in stackSlot 'src' onto FP-stack | |
| 2505 enc_class Push_Mem_D( memory src ) %{ // FLD_D [ESP+src] | |
| 2506 store_to_stackslot( cbuf, 0xDD, 0x00, $src$$disp ); | |
| 2507 %} | |
| 2508 | |
| 2509 // Push FPU's TOS float to a stack-slot, and pop FPU-stack | |
| 2510 enc_class Pop_Mem_F( stackSlotF dst ) %{ // FSTP_S [ESP+dst] | |
| 2511 store_to_stackslot( cbuf, 0xD9, 0x03, $dst$$disp ); | |
| 2512 %} | |
| 2513 | |
| 2514 // Same as Pop_Mem_F except for opcode | |
| 2515 // Push FPU's TOS double to a stack-slot, and pop FPU-stack | |
| 2516 enc_class Pop_Mem_D( stackSlotD dst ) %{ // FSTP_D [ESP+dst] | |
| 2517 store_to_stackslot( cbuf, 0xDD, 0x03, $dst$$disp ); | |
| 2518 %} | |
| 2519 | |
| 2520 enc_class Pop_Reg_F( regF dst ) %{ | |
| 2521 emit_opcode( cbuf, 0xDD ); // FSTP ST(i) | |
| 2522 emit_d8( cbuf, 0xD8+$dst$$reg ); | |
| 2523 %} | |
| 2524 | |
| 2525 enc_class Push_Reg_F( regF dst ) %{ | |
| 2526 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
| 2527 emit_d8( cbuf, 0xC0-1+$dst$$reg ); | |
| 2528 %} | |
| 2529 | |
| 2530 // Push FPU's float to a stack-slot, and pop FPU-stack | |
| 2531 enc_class Pop_Mem_Reg_F( stackSlotF dst, regF src ) %{ | |
| 2532 int pop = 0x02; | |
| 2533 if ($src$$reg != FPR1L_enc) { | |
| 2534 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
| 2535 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
| 2536 pop = 0x03; | |
| 2537 } | |
| 2538 store_to_stackslot( cbuf, 0xD9, pop, $dst$$disp ); // FST<P>_S [ESP+dst] | |
| 2539 %} | |
| 2540 | |
| 2541 // Push FPU's double to a stack-slot, and pop FPU-stack | |
| 2542 enc_class Pop_Mem_Reg_D( stackSlotD dst, regD src ) %{ | |
| 2543 int pop = 0x02; | |
| 2544 if ($src$$reg != FPR1L_enc) { | |
| 2545 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
| 2546 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
| 2547 pop = 0x03; | |
| 2548 } | |
| 2549 store_to_stackslot( cbuf, 0xDD, pop, $dst$$disp ); // FST<P>_D [ESP+dst] | |
| 2550 %} | |
| 2551 | |
| 2552 // Push FPU's double to a FPU-stack-slot, and pop FPU-stack | |
| 2553 enc_class Pop_Reg_Reg_D( regD dst, regF src ) %{ | |
| 2554 int pop = 0xD0 - 1; // -1 since we skip FLD | |
| 2555 if ($src$$reg != FPR1L_enc) { | |
| 2556 emit_opcode( cbuf, 0xD9 ); // FLD ST(src-1) | |
| 2557 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
| 2558 pop = 0xD8; | |
| 2559 } | |
| 2560 emit_opcode( cbuf, 0xDD ); | |
| 2561 emit_d8( cbuf, pop+$dst$$reg ); // FST<P> ST(i) | |
| 2562 %} | |
| 2563 | |
| 2564 | |
| 2565 enc_class Mul_Add_F( regF dst, regF src, regF src1, regF src2 ) %{ | |
| 2566 MacroAssembler masm(&cbuf); | |
| 2567 masm.fld_s( $src1$$reg-1); // nothing at TOS, load TOS from src1.reg | |
| 2568 masm.fmul( $src2$$reg+0); // value at TOS | |
| 2569 masm.fadd( $src$$reg+0); // value at TOS | |
| 2570 masm.fstp_d( $dst$$reg+0); // value at TOS, popped off after store | |
| 2571 %} | |
| 2572 | |
| 2573 | |
| 2574 enc_class Push_Reg_Mod_D( regD dst, regD src) %{ | |
| 2575 // load dst in FPR0 | |
| 2576 emit_opcode( cbuf, 0xD9 ); | |
| 2577 emit_d8( cbuf, 0xC0-1+$dst$$reg ); | |
| 2578 if ($src$$reg != FPR1L_enc) { | |
| 2579 // fincstp | |
| 2580 emit_opcode (cbuf, 0xD9); | |
| 2581 emit_opcode (cbuf, 0xF7); | |
| 2582 // swap src with FPR1: | |
| 2583 // FXCH FPR1 with src | |
| 2584 emit_opcode(cbuf, 0xD9); | |
| 2585 emit_d8(cbuf, 0xC8-1+$src$$reg ); | |
| 2586 // fdecstp | |
| 2587 emit_opcode (cbuf, 0xD9); | |
| 2588 emit_opcode (cbuf, 0xF6); | |
| 2589 } | |
| 2590 %} | |
| 2591 | |
| 2592 enc_class Push_ModD_encoding( regXD src0, regXD src1) %{ | |
| 2593 // Allocate a word | |
| 2594 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
| 2595 emit_opcode(cbuf,0xEC); | |
| 2596 emit_d8(cbuf,0x08); | |
| 2597 | |
| 2598 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src1 | |
| 2599 emit_opcode (cbuf, 0x0F ); | |
| 2600 emit_opcode (cbuf, 0x11 ); | |
| 2601 encode_RegMem(cbuf, $src1$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2602 | |
| 2603 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
| 2604 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 2605 | |
| 2606 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src0 | |
| 2607 emit_opcode (cbuf, 0x0F ); | |
| 2608 emit_opcode (cbuf, 0x11 ); | |
| 2609 encode_RegMem(cbuf, $src0$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2610 | |
| 2611 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
| 2612 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 2613 | |
| 2614 %} | |
| 2615 | |
| 2616 enc_class Push_ModX_encoding( regX src0, regX src1) %{ | |
| 2617 // Allocate a word | |
| 2618 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
| 2619 emit_opcode(cbuf,0xEC); | |
| 2620 emit_d8(cbuf,0x04); | |
| 2621 | |
| 2622 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src1 | |
| 2623 emit_opcode (cbuf, 0x0F ); | |
| 2624 emit_opcode (cbuf, 0x11 ); | |
| 2625 encode_RegMem(cbuf, $src1$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2626 | |
| 2627 emit_opcode(cbuf,0xD9 ); // FLD [ESP] | |
| 2628 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 2629 | |
| 2630 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src0 | |
| 2631 emit_opcode (cbuf, 0x0F ); | |
| 2632 emit_opcode (cbuf, 0x11 ); | |
| 2633 encode_RegMem(cbuf, $src0$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2634 | |
| 2635 emit_opcode(cbuf,0xD9 ); // FLD [ESP] | |
| 2636 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 2637 | |
| 2638 %} | |
| 2639 | |
| 2640 enc_class Push_ResultXD(regXD dst) %{ | |
| 2641 store_to_stackslot( cbuf, 0xDD, 0x03, 0 ); //FSTP [ESP] | |
| 2642 | |
| 2643 // UseXmmLoadAndClearUpper ? movsd dst,[esp] : movlpd dst,[esp] | |
| 2644 emit_opcode (cbuf, UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
| 2645 emit_opcode (cbuf, 0x0F ); | |
| 2646 emit_opcode (cbuf, UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
| 2647 encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2648 | |
| 2649 emit_opcode(cbuf,0x83); // ADD ESP,8 | |
| 2650 emit_opcode(cbuf,0xC4); | |
| 2651 emit_d8(cbuf,0x08); | |
| 2652 %} | |
| 2653 | |
| 2654 enc_class Push_ResultX(regX dst, immI d8) %{ | |
| 2655 store_to_stackslot( cbuf, 0xD9, 0x03, 0 ); //FSTP_S [ESP] | |
| 2656 | |
| 2657 emit_opcode (cbuf, 0xF3 ); // MOVSS dst(xmm), [ESP] | |
| 2658 emit_opcode (cbuf, 0x0F ); | |
| 2659 emit_opcode (cbuf, 0x10 ); | |
| 2660 encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2661 | |
| 2662 emit_opcode(cbuf,0x83); // ADD ESP,d8 (4 or 8) | |
| 2663 emit_opcode(cbuf,0xC4); | |
| 2664 emit_d8(cbuf,$d8$$constant); | |
| 2665 %} | |
| 2666 | |
| 2667 enc_class Push_SrcXD(regXD src) %{ | |
| 2668 // Allocate a word | |
| 2669 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
| 2670 emit_opcode(cbuf,0xEC); | |
| 2671 emit_d8(cbuf,0x08); | |
| 2672 | |
| 2673 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src | |
| 2674 emit_opcode (cbuf, 0x0F ); | |
| 2675 emit_opcode (cbuf, 0x11 ); | |
| 2676 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2677 | |
| 2678 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
| 2679 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 2680 %} | |
| 2681 | |
| 2682 enc_class push_stack_temp_qword() %{ | |
| 2683 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
| 2684 emit_opcode(cbuf,0xEC); | |
| 2685 emit_d8 (cbuf,0x08); | |
| 2686 %} | |
| 2687 | |
| 2688 enc_class pop_stack_temp_qword() %{ | |
| 2689 emit_opcode(cbuf,0x83); // ADD ESP,8 | |
| 2690 emit_opcode(cbuf,0xC4); | |
| 2691 emit_d8 (cbuf,0x08); | |
| 2692 %} | |
| 2693 | |
| 2694 enc_class push_xmm_to_fpr1( regXD xmm_src ) %{ | |
| 2695 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], xmm_src | |
| 2696 emit_opcode (cbuf, 0x0F ); | |
| 2697 emit_opcode (cbuf, 0x11 ); | |
| 2698 encode_RegMem(cbuf, $xmm_src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 2699 | |
| 2700 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
| 2701 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 2702 %} | |
| 2703 | |
| 2704 // Compute X^Y using Intel's fast hardware instructions, if possible. | |
| 2705 // Otherwise return a NaN. | |
| 2706 enc_class pow_exp_core_encoding %{ | |
| 2707 // FPR1 holds Y*ln2(X). Compute FPR1 = 2^(Y*ln2(X)) | |
| 2708 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xC0); // fdup = fld st(0) Q Q | |
| 2709 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xFC); // frndint int(Q) Q | |
| 2710 emit_opcode(cbuf,0xDC); emit_opcode(cbuf,0xE9); // fsub st(1) -= st(0); int(Q) frac(Q) | |
| 2711 emit_opcode(cbuf,0xDB); // FISTP [ESP] frac(Q) | |
| 2712 emit_opcode(cbuf,0x1C); | |
| 2713 emit_d8(cbuf,0x24); | |
| 2714 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xF0); // f2xm1 2^frac(Q)-1 | |
| 2715 emit_opcode(cbuf,0xD9); emit_opcode(cbuf,0xE8); // fld1 1 2^frac(Q)-1 | |
| 2716 emit_opcode(cbuf,0xDE); emit_opcode(cbuf,0xC1); // faddp 2^frac(Q) | |
| 2717 emit_opcode(cbuf,0x8B); // mov rax,[esp+0]=int(Q) | |
| 2718 encode_RegMem(cbuf, EAX_enc, ESP_enc, 0x4, 0, 0, false); | |
| 2719 emit_opcode(cbuf,0xC7); // mov rcx,0xFFFFF800 - overflow mask | |
| 2720 emit_rm(cbuf, 0x3, 0x0, ECX_enc); | |
| 2721 emit_d32(cbuf,0xFFFFF800); | |
| 2722 emit_opcode(cbuf,0x81); // add rax,1023 - the double exponent bias | |
| 2723 emit_rm(cbuf, 0x3, 0x0, EAX_enc); | |
| 2724 emit_d32(cbuf,1023); | |
| 2725 emit_opcode(cbuf,0x8B); // mov rbx,eax | |
| 2726 emit_rm(cbuf, 0x3, EBX_enc, EAX_enc); | |
| 2727 emit_opcode(cbuf,0xC1); // shl rax,20 - Slide to exponent position | |
| 2728 emit_rm(cbuf,0x3,0x4,EAX_enc); | |
| 2729 emit_d8(cbuf,20); | |
| 2730 emit_opcode(cbuf,0x85); // test rbx,ecx - check for overflow | |
| 2731 emit_rm(cbuf, 0x3, EBX_enc, ECX_enc); | |
| 2732 emit_opcode(cbuf,0x0F); emit_opcode(cbuf,0x45); // CMOVne rax,ecx - overflow; stuff NAN into EAX | |
| 2733 emit_rm(cbuf, 0x3, EAX_enc, ECX_enc); | |
| 2734 emit_opcode(cbuf,0x89); // mov [esp+4],eax - Store as part of double word | |
| 2735 encode_RegMem(cbuf, EAX_enc, ESP_enc, 0x4, 0, 4, false); | |
| 2736 emit_opcode(cbuf,0xC7); // mov [esp+0],0 - [ESP] = (double)(1<<int(Q)) = 2^int(Q) | |
| 2737 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 2738 emit_d32(cbuf,0); | |
| 2739 emit_opcode(cbuf,0xDC); // fmul dword st(0),[esp+0]; FPR1 = 2^int(Q)*2^frac(Q) = 2^Q | |
| 2740 encode_RegMem(cbuf, 0x1, ESP_enc, 0x4, 0, 0, false); | |
| 2741 %} | |
| 2742 | |
| 2743 // enc_class Pop_Reg_Mod_D( regD dst, regD src) | |
| 2744 // was replaced by Push_Result_Mod_D followed by Pop_Reg_X() or Pop_Mem_X() | |
| 2745 | |
| 2746 enc_class Push_Result_Mod_D( regD src) %{ | |
| 2747 if ($src$$reg != FPR1L_enc) { | |
| 2748 // fincstp | |
| 2749 emit_opcode (cbuf, 0xD9); | |
| 2750 emit_opcode (cbuf, 0xF7); | |
| 2751 // FXCH FPR1 with src | |
| 2752 emit_opcode(cbuf, 0xD9); | |
| 2753 emit_d8(cbuf, 0xC8-1+$src$$reg ); | |
| 2754 // fdecstp | |
| 2755 emit_opcode (cbuf, 0xD9); | |
| 2756 emit_opcode (cbuf, 0xF6); | |
| 2757 } | |
| 2758 // // following asm replaced with Pop_Reg_F or Pop_Mem_F | |
| 2759 // // FSTP FPR$dst$$reg | |
| 2760 // emit_opcode( cbuf, 0xDD ); | |
| 2761 // emit_d8( cbuf, 0xD8+$dst$$reg ); | |
| 2762 %} | |
| 2763 | |
| 2764 enc_class fnstsw_sahf_skip_parity() %{ | |
| 2765 // fnstsw ax | |
| 2766 emit_opcode( cbuf, 0xDF ); | |
| 2767 emit_opcode( cbuf, 0xE0 ); | |
| 2768 // sahf | |
| 2769 emit_opcode( cbuf, 0x9E ); | |
| 2770 // jnp ::skip | |
| 2771 emit_opcode( cbuf, 0x7B ); | |
| 2772 emit_opcode( cbuf, 0x05 ); | |
| 2773 %} | |
| 2774 | |
| 2775 enc_class emitModD() %{ | |
| 2776 // fprem must be iterative | |
| 2777 // :: loop | |
| 2778 // fprem | |
| 2779 emit_opcode( cbuf, 0xD9 ); | |
| 2780 emit_opcode( cbuf, 0xF8 ); | |
| 2781 // wait | |
| 2782 emit_opcode( cbuf, 0x9b ); | |
| 2783 // fnstsw ax | |
| 2784 emit_opcode( cbuf, 0xDF ); | |
| 2785 emit_opcode( cbuf, 0xE0 ); | |
| 2786 // sahf | |
| 2787 emit_opcode( cbuf, 0x9E ); | |
| 2788 // jp ::loop | |
| 2789 emit_opcode( cbuf, 0x0F ); | |
| 2790 emit_opcode( cbuf, 0x8A ); | |
| 2791 emit_opcode( cbuf, 0xF4 ); | |
| 2792 emit_opcode( cbuf, 0xFF ); | |
| 2793 emit_opcode( cbuf, 0xFF ); | |
| 2794 emit_opcode( cbuf, 0xFF ); | |
| 2795 %} | |
| 2796 | |
| 2797 enc_class fpu_flags() %{ | |
| 2798 // fnstsw_ax | |
| 2799 emit_opcode( cbuf, 0xDF); | |
| 2800 emit_opcode( cbuf, 0xE0); | |
| 2801 // test ax,0x0400 | |
| 2802 emit_opcode( cbuf, 0x66 ); // operand-size prefix for 16-bit immediate | |
| 2803 emit_opcode( cbuf, 0xA9 ); | |
| 2804 emit_d16 ( cbuf, 0x0400 ); | |
| 2805 // // // This sequence works, but stalls for 12-16 cycles on PPro | |
| 2806 // // test rax,0x0400 | |
| 2807 // emit_opcode( cbuf, 0xA9 ); | |
| 2808 // emit_d32 ( cbuf, 0x00000400 ); | |
| 2809 // | |
| 2810 // jz exit (no unordered comparison) | |
| 2811 emit_opcode( cbuf, 0x74 ); | |
| 2812 emit_d8 ( cbuf, 0x02 ); | |
| 2813 // mov ah,1 - treat as LT case (set carry flag) | |
| 2814 emit_opcode( cbuf, 0xB4 ); | |
| 2815 emit_d8 ( cbuf, 0x01 ); | |
| 2816 // sahf | |
| 2817 emit_opcode( cbuf, 0x9E); | |
| 2818 %} | |
| 2819 | |
| 2820 enc_class cmpF_P6_fixup() %{ | |
| 2821 // Fixup the integer flags in case comparison involved a NaN | |
| 2822 // | |
| 2823 // JNP exit (no unordered comparison, P-flag is set by NaN) | |
| 2824 emit_opcode( cbuf, 0x7B ); | |
| 2825 emit_d8 ( cbuf, 0x03 ); | |
| 2826 // MOV AH,1 - treat as LT case (set carry flag) | |
| 2827 emit_opcode( cbuf, 0xB4 ); | |
| 2828 emit_d8 ( cbuf, 0x01 ); | |
| 2829 // SAHF | |
| 2830 emit_opcode( cbuf, 0x9E); | |
| 2831 // NOP // target for branch to avoid branch to branch | |
| 2832 emit_opcode( cbuf, 0x90); | |
| 2833 %} | |
| 2834 | |
| 2835 // fnstsw_ax(); | |
| 2836 // sahf(); | |
| 2837 // movl(dst, nan_result); | |
| 2838 // jcc(Assembler::parity, exit); | |
| 2839 // movl(dst, less_result); | |
| 2840 // jcc(Assembler::below, exit); | |
| 2841 // movl(dst, equal_result); | |
| 2842 // jcc(Assembler::equal, exit); | |
| 2843 // movl(dst, greater_result); | |
| 2844 | |
| 2845 // less_result = 1; | |
| 2846 // greater_result = -1; | |
| 2847 // equal_result = 0; | |
| 2848 // nan_result = -1; | |
| 2849 | |
| 2850 enc_class CmpF_Result(eRegI dst) %{ | |
| 2851 // fnstsw_ax(); | |
| 2852 emit_opcode( cbuf, 0xDF); | |
| 2853 emit_opcode( cbuf, 0xE0); | |
| 2854 // sahf | |
| 2855 emit_opcode( cbuf, 0x9E); | |
| 2856 // movl(dst, nan_result); | |
| 2857 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
| 2858 emit_d32( cbuf, -1 ); | |
| 2859 // jcc(Assembler::parity, exit); | |
| 2860 emit_opcode( cbuf, 0x7A ); | |
| 2861 emit_d8 ( cbuf, 0x13 ); | |
| 2862 // movl(dst, less_result); | |
| 2863 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
| 2864 emit_d32( cbuf, -1 ); | |
| 2865 // jcc(Assembler::below, exit); | |
| 2866 emit_opcode( cbuf, 0x72 ); | |
| 2867 emit_d8 ( cbuf, 0x0C ); | |
| 2868 // movl(dst, equal_result); | |
| 2869 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
| 2870 emit_d32( cbuf, 0 ); | |
| 2871 // jcc(Assembler::equal, exit); | |
| 2872 emit_opcode( cbuf, 0x74 ); | |
| 2873 emit_d8 ( cbuf, 0x05 ); | |
| 2874 // movl(dst, greater_result); | |
| 2875 emit_opcode( cbuf, 0xB8 + $dst$$reg); | |
| 2876 emit_d32( cbuf, 1 ); | |
| 2877 %} | |
| 2878 | |
| 2879 | |
| 2880 // XMM version of CmpF_Result. Because the XMM compare | |
| 2881 // instructions set the EFLAGS directly. It becomes simpler than | |
| 2882 // the float version above. | |
| 2883 enc_class CmpX_Result(eRegI dst) %{ | |
| 2884 MacroAssembler _masm(&cbuf); | |
| 2885 Label nan, inc, done; | |
| 2886 | |
| 2887 __ jccb(Assembler::parity, nan); | |
| 2888 __ jccb(Assembler::equal, done); | |
| 2889 __ jccb(Assembler::above, inc); | |
| 2890 __ bind(nan); | |
| 2891 __ decrement(as_Register($dst$$reg)); | |
| 2892 __ jmpb(done); | |
| 2893 __ bind(inc); | |
| 2894 __ increment(as_Register($dst$$reg)); | |
| 2895 __ bind(done); | |
| 2896 %} | |
| 2897 | |
| 2898 // Compare the longs and set flags | |
| 2899 // BROKEN! Do Not use as-is | |
| 2900 enc_class cmpl_test( eRegL src1, eRegL src2 ) %{ | |
| 2901 // CMP $src1.hi,$src2.hi | |
| 2902 emit_opcode( cbuf, 0x3B ); | |
| 2903 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($src1$$reg), HIGH_FROM_LOW($src2$$reg) ); | |
| 2904 // JNE,s done | |
| 2905 emit_opcode(cbuf,0x75); | |
| 2906 emit_d8(cbuf, 2 ); | |
| 2907 // CMP $src1.lo,$src2.lo | |
| 2908 emit_opcode( cbuf, 0x3B ); | |
| 2909 emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); | |
| 2910 // done: | |
| 2911 %} | |
| 2912 | |
| 2913 enc_class convert_int_long( regL dst, eRegI src ) %{ | |
| 2914 // mov $dst.lo,$src | |
| 2915 int dst_encoding = $dst$$reg; | |
| 2916 int src_encoding = $src$$reg; | |
| 2917 encode_Copy( cbuf, dst_encoding , src_encoding ); | |
| 2918 // mov $dst.hi,$src | |
| 2919 encode_Copy( cbuf, HIGH_FROM_LOW(dst_encoding), src_encoding ); | |
| 2920 // sar $dst.hi,31 | |
| 2921 emit_opcode( cbuf, 0xC1 ); | |
| 2922 emit_rm(cbuf, 0x3, 7, HIGH_FROM_LOW(dst_encoding) ); | |
| 2923 emit_d8(cbuf, 0x1F ); | |
| 2924 %} | |
| 2925 | |
| 2926 enc_class convert_long_double( eRegL src ) %{ | |
| 2927 // push $src.hi | |
| 2928 emit_opcode(cbuf, 0x50+HIGH_FROM_LOW($src$$reg)); | |
| 2929 // push $src.lo | |
| 2930 emit_opcode(cbuf, 0x50+$src$$reg ); | |
| 2931 // fild 64-bits at [SP] | |
| 2932 emit_opcode(cbuf,0xdf); | |
| 2933 emit_d8(cbuf, 0x6C); | |
| 2934 emit_d8(cbuf, 0x24); | |
| 2935 emit_d8(cbuf, 0x00); | |
| 2936 // pop stack | |
| 2937 emit_opcode(cbuf, 0x83); // add SP, #8 | |
| 2938 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
| 2939 emit_d8(cbuf, 0x8); | |
| 2940 %} | |
| 2941 | |
| 2942 enc_class multiply_con_and_shift_high( eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32_63 cnt, eFlagsReg cr ) %{ | |
| 2943 // IMUL EDX:EAX,$src1 | |
| 2944 emit_opcode( cbuf, 0xF7 ); | |
| 2945 emit_rm( cbuf, 0x3, 0x5, $src1$$reg ); | |
| 2946 // SAR EDX,$cnt-32 | |
| 2947 int shift_count = ((int)$cnt$$constant) - 32; | |
| 2948 if (shift_count > 0) { | |
| 2949 emit_opcode(cbuf, 0xC1); | |
| 2950 emit_rm(cbuf, 0x3, 7, $dst$$reg ); | |
| 2951 emit_d8(cbuf, shift_count); | |
| 2952 } | |
| 2953 %} | |
| 2954 | |
| 2955 // this version doesn't have add sp, 8 | |
| 2956 enc_class convert_long_double2( eRegL src ) %{ | |
| 2957 // push $src.hi | |
| 2958 emit_opcode(cbuf, 0x50+HIGH_FROM_LOW($src$$reg)); | |
| 2959 // push $src.lo | |
| 2960 emit_opcode(cbuf, 0x50+$src$$reg ); | |
| 2961 // fild 64-bits at [SP] | |
| 2962 emit_opcode(cbuf,0xdf); | |
| 2963 emit_d8(cbuf, 0x6C); | |
| 2964 emit_d8(cbuf, 0x24); | |
| 2965 emit_d8(cbuf, 0x00); | |
| 2966 %} | |
| 2967 | |
| 2968 enc_class long_int_multiply( eADXRegL dst, nadxRegI src) %{ | |
| 2969 // Basic idea: long = (long)int * (long)int | |
| 2970 // IMUL EDX:EAX, src | |
| 2971 emit_opcode( cbuf, 0xF7 ); | |
| 2972 emit_rm( cbuf, 0x3, 0x5, $src$$reg); | |
| 2973 %} | |
| 2974 | |
| 2975 enc_class long_uint_multiply( eADXRegL dst, nadxRegI src) %{ | |
| 2976 // Basic Idea: long = (int & 0xffffffffL) * (int & 0xffffffffL) | |
| 2977 // MUL EDX:EAX, src | |
| 2978 emit_opcode( cbuf, 0xF7 ); | |
| 2979 emit_rm( cbuf, 0x3, 0x4, $src$$reg); | |
| 2980 %} | |
| 2981 | |
| 2982 enc_class long_multiply( eADXRegL dst, eRegL src, eRegI tmp ) %{ | |
| 2983 // Basic idea: lo(result) = lo(x_lo * y_lo) | |
| 2984 // hi(result) = hi(x_lo * y_lo) + lo(x_hi * y_lo) + lo(x_lo * y_hi) | |
| 2985 // MOV $tmp,$src.lo | |
| 2986 encode_Copy( cbuf, $tmp$$reg, $src$$reg ); | |
| 2987 // IMUL $tmp,EDX | |
| 2988 emit_opcode( cbuf, 0x0F ); | |
| 2989 emit_opcode( cbuf, 0xAF ); | |
| 2990 emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
| 2991 // MOV EDX,$src.hi | |
| 2992 encode_Copy( cbuf, HIGH_FROM_LOW($dst$$reg), HIGH_FROM_LOW($src$$reg) ); | |
| 2993 // IMUL EDX,EAX | |
| 2994 emit_opcode( cbuf, 0x0F ); | |
| 2995 emit_opcode( cbuf, 0xAF ); | |
| 2996 emit_rm( cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $dst$$reg ); | |
| 2997 // ADD $tmp,EDX | |
| 2998 emit_opcode( cbuf, 0x03 ); | |
| 2999 emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
| 3000 // MUL EDX:EAX,$src.lo | |
| 3001 emit_opcode( cbuf, 0xF7 ); | |
| 3002 emit_rm( cbuf, 0x3, 0x4, $src$$reg ); | |
| 3003 // ADD EDX,ESI | |
| 3004 emit_opcode( cbuf, 0x03 ); | |
| 3005 emit_rm( cbuf, 0x3, HIGH_FROM_LOW($dst$$reg), $tmp$$reg ); | |
| 3006 %} | |
| 3007 | |
| 3008 enc_class long_multiply_con( eADXRegL dst, immL_127 src, eRegI tmp ) %{ | |
| 3009 // Basic idea: lo(result) = lo(src * y_lo) | |
| 3010 // hi(result) = hi(src * y_lo) + lo(src * y_hi) | |
| 3011 // IMUL $tmp,EDX,$src | |
| 3012 emit_opcode( cbuf, 0x6B ); | |
| 3013 emit_rm( cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg) ); | |
| 3014 emit_d8( cbuf, (int)$src$$constant ); | |
| 3015 // MOV EDX,$src | |
| 3016 emit_opcode(cbuf, 0xB8 + EDX_enc); | |
| 3017 emit_d32( cbuf, (int)$src$$constant ); | |
| 3018 // MUL EDX:EAX,EDX | |
| 3019 emit_opcode( cbuf, 0xF7 ); | |
| 3020 emit_rm( cbuf, 0x3, 0x4, EDX_enc ); | |
| 3021 // ADD EDX,ESI | |
| 3022 emit_opcode( cbuf, 0x03 ); | |
| 3023 emit_rm( cbuf, 0x3, EDX_enc, $tmp$$reg ); | |
| 3024 %} | |
| 3025 | |
| 3026 enc_class long_div( eRegL src1, eRegL src2 ) %{ | |
| 3027 // PUSH src1.hi | |
| 3028 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src1$$reg) ); | |
| 3029 // PUSH src1.lo | |
| 3030 emit_opcode(cbuf, 0x50+$src1$$reg ); | |
| 3031 // PUSH src2.hi | |
| 3032 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src2$$reg) ); | |
| 3033 // PUSH src2.lo | |
| 3034 emit_opcode(cbuf, 0x50+$src2$$reg ); | |
| 3035 // CALL directly to the runtime | |
| 3036 cbuf.set_inst_mark(); | |
| 3037 emit_opcode(cbuf,0xE8); // Call into runtime | |
| 3038 emit_d32_reloc(cbuf, (CAST_FROM_FN_PTR(address, SharedRuntime::ldiv) - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 3039 // Restore stack | |
| 3040 emit_opcode(cbuf, 0x83); // add SP, #framesize | |
| 3041 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
| 3042 emit_d8(cbuf, 4*4); | |
| 3043 %} | |
| 3044 | |
| 3045 enc_class long_mod( eRegL src1, eRegL src2 ) %{ | |
| 3046 // PUSH src1.hi | |
| 3047 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src1$$reg) ); | |
| 3048 // PUSH src1.lo | |
| 3049 emit_opcode(cbuf, 0x50+$src1$$reg ); | |
| 3050 // PUSH src2.hi | |
| 3051 emit_opcode(cbuf, HIGH_FROM_LOW(0x50+$src2$$reg) ); | |
| 3052 // PUSH src2.lo | |
| 3053 emit_opcode(cbuf, 0x50+$src2$$reg ); | |
| 3054 // CALL directly to the runtime | |
| 3055 cbuf.set_inst_mark(); | |
| 3056 emit_opcode(cbuf,0xE8); // Call into runtime | |
| 3057 emit_d32_reloc(cbuf, (CAST_FROM_FN_PTR(address, SharedRuntime::lrem ) - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 3058 // Restore stack | |
| 3059 emit_opcode(cbuf, 0x83); // add SP, #framesize | |
| 3060 emit_rm(cbuf, 0x3, 0x00, ESP_enc); | |
| 3061 emit_d8(cbuf, 4*4); | |
| 3062 %} | |
| 3063 | |
| 3064 enc_class long_cmp_flags0( eRegL src, eRegI tmp ) %{ | |
| 3065 // MOV $tmp,$src.lo | |
| 3066 emit_opcode(cbuf, 0x8B); | |
| 3067 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); | |
| 3068 // OR $tmp,$src.hi | |
| 3069 emit_opcode(cbuf, 0x0B); | |
| 3070 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg)); | |
| 3071 %} | |
| 3072 | |
| 3073 enc_class long_cmp_flags1( eRegL src1, eRegL src2 ) %{ | |
| 3074 // CMP $src1.lo,$src2.lo | |
| 3075 emit_opcode( cbuf, 0x3B ); | |
| 3076 emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); | |
| 3077 // JNE,s skip | |
| 3078 emit_cc(cbuf, 0x70, 0x5); | |
| 3079 emit_d8(cbuf,2); | |
| 3080 // CMP $src1.hi,$src2.hi | |
| 3081 emit_opcode( cbuf, 0x3B ); | |
| 3082 emit_rm(cbuf, 0x3, HIGH_FROM_LOW($src1$$reg), HIGH_FROM_LOW($src2$$reg) ); | |
| 3083 %} | |
| 3084 | |
| 3085 enc_class long_cmp_flags2( eRegL src1, eRegL src2, eRegI tmp ) %{ | |
| 3086 // CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits | |
| 3087 emit_opcode( cbuf, 0x3B ); | |
| 3088 emit_rm(cbuf, 0x3, $src1$$reg, $src2$$reg ); | |
| 3089 // MOV $tmp,$src1.hi | |
| 3090 emit_opcode( cbuf, 0x8B ); | |
| 3091 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src1$$reg) ); | |
| 3092 // SBB $tmp,$src2.hi\t! Compute flags for long compare | |
| 3093 emit_opcode( cbuf, 0x1B ); | |
| 3094 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src2$$reg) ); | |
| 3095 %} | |
| 3096 | |
| 3097 enc_class long_cmp_flags3( eRegL src, eRegI tmp ) %{ | |
| 3098 // XOR $tmp,$tmp | |
| 3099 emit_opcode(cbuf,0x33); // XOR | |
| 3100 emit_rm(cbuf,0x3, $tmp$$reg, $tmp$$reg); | |
| 3101 // CMP $tmp,$src.lo | |
| 3102 emit_opcode( cbuf, 0x3B ); | |
| 3103 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg ); | |
| 3104 // SBB $tmp,$src.hi | |
| 3105 emit_opcode( cbuf, 0x1B ); | |
| 3106 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($src$$reg) ); | |
| 3107 %} | |
| 3108 | |
| 3109 // Sniff, sniff... smells like Gnu Superoptimizer | |
| 3110 enc_class neg_long( eRegL dst ) %{ | |
| 3111 emit_opcode(cbuf,0xF7); // NEG hi | |
| 3112 emit_rm (cbuf,0x3, 0x3, HIGH_FROM_LOW($dst$$reg)); | |
| 3113 emit_opcode(cbuf,0xF7); // NEG lo | |
| 3114 emit_rm (cbuf,0x3, 0x3, $dst$$reg ); | |
| 3115 emit_opcode(cbuf,0x83); // SBB hi,0 | |
| 3116 emit_rm (cbuf,0x3, 0x3, HIGH_FROM_LOW($dst$$reg)); | |
| 3117 emit_d8 (cbuf,0 ); | |
| 3118 %} | |
| 3119 | |
| 3120 enc_class movq_ld(regXD dst, memory mem) %{ | |
| 3121 MacroAssembler _masm(&cbuf); | |
| 3122 Address madr = Address::make_raw($mem$$base, $mem$$index, $mem$$scale, $mem$$disp); | |
| 3123 __ movq(as_XMMRegister($dst$$reg), madr); | |
| 3124 %} | |
| 3125 | |
| 3126 enc_class movq_st(memory mem, regXD src) %{ | |
| 3127 MacroAssembler _masm(&cbuf); | |
| 3128 Address madr = Address::make_raw($mem$$base, $mem$$index, $mem$$scale, $mem$$disp); | |
| 3129 __ movq(madr, as_XMMRegister($src$$reg)); | |
| 3130 %} | |
| 3131 | |
| 3132 enc_class pshufd_8x8(regX dst, regX src) %{ | |
| 3133 MacroAssembler _masm(&cbuf); | |
| 3134 | |
| 3135 encode_CopyXD(cbuf, $dst$$reg, $src$$reg); | |
| 3136 __ punpcklbw(as_XMMRegister($dst$$reg), as_XMMRegister($dst$$reg)); | |
| 3137 __ pshuflw(as_XMMRegister($dst$$reg), as_XMMRegister($dst$$reg), 0x00); | |
| 3138 %} | |
| 3139 | |
| 3140 enc_class pshufd_4x16(regX dst, regX src) %{ | |
| 3141 MacroAssembler _masm(&cbuf); | |
| 3142 | |
| 3143 __ pshuflw(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg), 0x00); | |
| 3144 %} | |
| 3145 | |
| 3146 enc_class pshufd(regXD dst, regXD src, int mode) %{ | |
| 3147 MacroAssembler _masm(&cbuf); | |
| 3148 | |
| 3149 __ pshufd(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg), $mode); | |
| 3150 %} | |
| 3151 | |
| 3152 enc_class pxor(regXD dst, regXD src) %{ | |
| 3153 MacroAssembler _masm(&cbuf); | |
| 3154 | |
| 3155 __ pxor(as_XMMRegister($dst$$reg), as_XMMRegister($src$$reg)); | |
| 3156 %} | |
| 3157 | |
| 3158 enc_class mov_i2x(regXD dst, eRegI src) %{ | |
| 3159 MacroAssembler _masm(&cbuf); | |
| 3160 | |
| 3161 __ movd(as_XMMRegister($dst$$reg), as_Register($src$$reg)); | |
| 3162 %} | |
| 3163 | |
| 3164 | |
| 3165 // Because the transitions from emitted code to the runtime | |
| 3166 // monitorenter/exit helper stubs are so slow it's critical that | |
| 3167 // we inline both the stack-locking fast-path and the inflated fast path. | |
| 3168 // | |
| 3169 // See also: cmpFastLock and cmpFastUnlock. | |
| 3170 // | |
| 3171 // What follows is a specialized inline transliteration of the code | |
| 3172 // in slow_enter() and slow_exit(). If we're concerned about I$ bloat | |
| 3173 // another option would be to emit TrySlowEnter and TrySlowExit methods | |
| 3174 // at startup-time. These methods would accept arguments as | |
| 3175 // (rax,=Obj, rbx=Self, rcx=box, rdx=Scratch) and return success-failure | |
| 3176 // indications in the icc.ZFlag. Fast_Lock and Fast_Unlock would simply | |
| 3177 // marshal the arguments and emit calls to TrySlowEnter and TrySlowExit. | |
| 3178 // In practice, however, the # of lock sites is bounded and is usually small. | |
| 3179 // Besides the call overhead, TrySlowEnter and TrySlowExit might suffer | |
| 3180 // if the processor uses simple bimodal branch predictors keyed by EIP | |
| 3181 // Since the helper routines would be called from multiple synchronization | |
| 3182 // sites. | |
| 3183 // | |
| 3184 // An even better approach would be write "MonitorEnter()" and "MonitorExit()" | |
| 3185 // in java - using j.u.c and unsafe - and just bind the lock and unlock sites | |
| 3186 // to those specialized methods. That'd give us a mostly platform-independent | |
| 3187 // implementation that the JITs could optimize and inline at their pleasure. | |
| 3188 // Done correctly, the only time we'd need to cross to native could would be | |
| 3189 // to park() or unpark() threads. We'd also need a few more unsafe operators | |
| 3190 // to (a) prevent compiler-JIT reordering of non-volatile accesses, and | |
| 3191 // (b) explicit barriers or fence operations. | |
| 3192 // | |
| 3193 // TODO: | |
| 3194 // | |
| 3195 // * Arrange for C2 to pass "Self" into Fast_Lock and Fast_Unlock in one of the registers (scr). | |
| 3196 // This avoids manifesting the Self pointer in the Fast_Lock and Fast_Unlock terminals. | |
| 3197 // Given TLAB allocation, Self is usually manifested in a register, so passing it into | |
| 3198 // the lock operators would typically be faster than reifying Self. | |
| 3199 // | |
| 3200 // * Ideally I'd define the primitives as: | |
| 3201 // fast_lock (nax Obj, nax box, EAX tmp, nax scr) where box, tmp and scr are KILLED. | |
| 3202 // fast_unlock (nax Obj, EAX box, nax tmp) where box and tmp are KILLED | |
| 3203 // Unfortunately ADLC bugs prevent us from expressing the ideal form. | |
| 3204 // Instead, we're stuck with a rather awkward and brittle register assignments below. | |
| 3205 // Furthermore the register assignments are overconstrained, possibly resulting in | |
| 3206 // sub-optimal code near the synchronization site. | |
| 3207 // | |
| 3208 // * Eliminate the sp-proximity tests and just use "== Self" tests instead. | |
| 3209 // Alternately, use a better sp-proximity test. | |
| 3210 // | |
| 3211 // * Currently ObjectMonitor._Owner can hold either an sp value or a (THREAD *) value. | |
| 3212 // Either one is sufficient to uniquely identify a thread. | |
| 3213 // TODO: eliminate use of sp in _owner and use get_thread(tr) instead. | |
| 3214 // | |
| 3215 // * Intrinsify notify() and notifyAll() for the common cases where the | |
| 3216 // object is locked by the calling thread but the waitlist is empty. | |
| 3217 // avoid the expensive JNI call to JVM_Notify() and JVM_NotifyAll(). | |
| 3218 // | |
| 3219 // * use jccb and jmpb instead of jcc and jmp to improve code density. | |
| 3220 // But beware of excessive branch density on AMD Opterons. | |
| 3221 // | |
| 3222 // * Both Fast_Lock and Fast_Unlock set the ICC.ZF to indicate success | |
| 3223 // or failure of the fast-path. If the fast-path fails then we pass | |
| 3224 // control to the slow-path, typically in C. In Fast_Lock and | |
| 3225 // Fast_Unlock we often branch to DONE_LABEL, just to find that C2 | |
| 3226 // will emit a conditional branch immediately after the node. | |
| 3227 // So we have branches to branches and lots of ICC.ZF games. | |
| 3228 // Instead, it might be better to have C2 pass a "FailureLabel" | |
| 3229 // into Fast_Lock and Fast_Unlock. In the case of success, control | |
| 3230 // will drop through the node. ICC.ZF is undefined at exit. | |
| 3231 // In the case of failure, the node will branch directly to the | |
| 3232 // FailureLabel | |
| 3233 | |
| 3234 | |
| 3235 // obj: object to lock | |
| 3236 // box: on-stack box address (displaced header location) - KILLED | |
| 3237 // rax,: tmp -- KILLED | |
| 3238 // scr: tmp -- KILLED | |
| 3239 enc_class Fast_Lock( eRegP obj, eRegP box, eAXRegI tmp, eRegP scr ) %{ | |
| 3240 | |
| 3241 Register objReg = as_Register($obj$$reg); | |
| 3242 Register boxReg = as_Register($box$$reg); | |
| 3243 Register tmpReg = as_Register($tmp$$reg); | |
| 3244 Register scrReg = as_Register($scr$$reg); | |
| 3245 | |
| 3246 // Ensure the register assignents are disjoint | |
| 3247 guarantee (objReg != boxReg, "") ; | |
| 3248 guarantee (objReg != tmpReg, "") ; | |
| 3249 guarantee (objReg != scrReg, "") ; | |
| 3250 guarantee (boxReg != tmpReg, "") ; | |
| 3251 guarantee (boxReg != scrReg, "") ; | |
| 3252 guarantee (tmpReg == as_Register(EAX_enc), "") ; | |
| 3253 | |
| 3254 MacroAssembler masm(&cbuf); | |
| 3255 | |
| 3256 if (_counters != NULL) { | |
| 3257 masm.atomic_incl(ExternalAddress((address) _counters->total_entry_count_addr())); | |
| 3258 } | |
| 3259 if (EmitSync & 1) { | |
| 3260 // set box->dhw = unused_mark (3) | |
| 3261 // Force all sync thru slow-path: slow_enter() and slow_exit() | |
| 3262 masm.movl (Address(boxReg, 0), intptr_t(markOopDesc::unused_mark())) ; | |
| 3263 masm.cmpl (rsp, 0) ; | |
| 3264 } else | |
| 3265 if (EmitSync & 2) { | |
| 3266 Label DONE_LABEL ; | |
| 3267 if (UseBiasedLocking) { | |
| 3268 // Note: tmpReg maps to the swap_reg argument and scrReg to the tmp_reg argument. | |
| 3269 masm.biased_locking_enter(boxReg, objReg, tmpReg, scrReg, false, DONE_LABEL, NULL, _counters); | |
| 3270 } | |
| 3271 | |
| 3272 masm.movl (tmpReg, Address(objReg, 0)) ; // fetch markword | |
| 3273 masm.orl (tmpReg, 0x1); | |
| 3274 masm.movl (Address(boxReg, 0), tmpReg); // Anticipate successful CAS | |
| 3275 if (os::is_MP()) { masm.lock(); } | |
| 3276 masm.cmpxchg(boxReg, Address(objReg, 0)); // Updates tmpReg | |
| 3277 masm.jcc(Assembler::equal, DONE_LABEL); | |
| 3278 // Recursive locking | |
| 3279 masm.subl(tmpReg, rsp); | |
| 3280 masm.andl(tmpReg, 0xFFFFF003 ); | |
| 3281 masm.movl(Address(boxReg, 0), tmpReg); | |
| 3282 masm.bind(DONE_LABEL) ; | |
| 3283 } else { | |
| 3284 // Possible cases that we'll encounter in fast_lock | |
| 3285 // ------------------------------------------------ | |
| 3286 // * Inflated | |
| 3287 // -- unlocked | |
| 3288 // -- Locked | |
| 3289 // = by self | |
| 3290 // = by other | |
| 3291 // * biased | |
| 3292 // -- by Self | |
| 3293 // -- by other | |
| 3294 // * neutral | |
| 3295 // * stack-locked | |
| 3296 // -- by self | |
| 3297 // = sp-proximity test hits | |
| 3298 // = sp-proximity test generates false-negative | |
| 3299 // -- by other | |
| 3300 // | |
| 3301 | |
| 3302 Label IsInflated, DONE_LABEL, PopDone ; | |
| 3303 | |
| 3304 // TODO: optimize away redundant LDs of obj->mark and improve the markword triage | |
| 3305 // order to reduce the number of conditional branches in the most common cases. | |
| 3306 // Beware -- there's a subtle invariant that fetch of the markword | |
| 3307 // at [FETCH], below, will never observe a biased encoding (*101b). | |
| 3308 // If this invariant is not held we risk exclusion (safety) failure. | |
| 3309 if (UseBiasedLocking) { | |
| 3310 masm.biased_locking_enter(boxReg, objReg, tmpReg, scrReg, false, DONE_LABEL, NULL, _counters); | |
| 3311 } | |
| 3312 | |
| 3313 masm.movl (tmpReg, Address(objReg, 0)) ; // [FETCH] | |
| 3314 masm.testl (tmpReg, 0x02) ; // Inflated v (Stack-locked or neutral) | |
| 3315 masm.jccb (Assembler::notZero, IsInflated) ; | |
| 3316 | |
| 3317 // Attempt stack-locking ... | |
| 3318 masm.orl (tmpReg, 0x1); | |
| 3319 masm.movl (Address(boxReg, 0), tmpReg); // Anticipate successful CAS | |
| 3320 if (os::is_MP()) { masm.lock(); } | |
| 3321 masm.cmpxchg(boxReg, Address(objReg, 0)); // Updates tmpReg | |
| 3322 if (_counters != NULL) { | |
| 3323 masm.cond_inc32(Assembler::equal, | |
| 3324 ExternalAddress((address)_counters->fast_path_entry_count_addr())); | |
| 3325 } | |
| 3326 masm.jccb (Assembler::equal, DONE_LABEL); | |
| 3327 | |
| 3328 // Recursive locking | |
| 3329 masm.subl(tmpReg, rsp); | |
| 3330 masm.andl(tmpReg, 0xFFFFF003 ); | |
| 3331 masm.movl(Address(boxReg, 0), tmpReg); | |
| 3332 if (_counters != NULL) { | |
| 3333 masm.cond_inc32(Assembler::equal, | |
| 3334 ExternalAddress((address)_counters->fast_path_entry_count_addr())); | |
| 3335 } | |
| 3336 masm.jmp (DONE_LABEL) ; | |
| 3337 | |
| 3338 masm.bind (IsInflated) ; | |
| 3339 | |
| 3340 // The object is inflated. | |
| 3341 // | |
| 3342 // TODO-FIXME: eliminate the ugly use of manifest constants: | |
| 3343 // Use markOopDesc::monitor_value instead of "2". | |
| 3344 // use markOop::unused_mark() instead of "3". | |
| 3345 // The tmpReg value is an objectMonitor reference ORed with | |
| 3346 // markOopDesc::monitor_value (2). We can either convert tmpReg to an | |
| 3347 // objectmonitor pointer by masking off the "2" bit or we can just | |
| 3348 // use tmpReg as an objectmonitor pointer but bias the objectmonitor | |
| 3349 // field offsets with "-2" to compensate for and annul the low-order tag bit. | |
| 3350 // | |
| 3351 // I use the latter as it avoids AGI stalls. | |
| 3352 // As such, we write "mov r, [tmpReg+OFFSETOF(Owner)-2]" | |
| 3353 // instead of "mov r, [tmpReg+OFFSETOF(Owner)]". | |
| 3354 // | |
| 3355 #define OFFSET_SKEWED(f) ((ObjectMonitor::f ## _offset_in_bytes())-2) | |
| 3356 | |
| 3357 // boxReg refers to the on-stack BasicLock in the current frame. | |
| 3358 // We'd like to write: | |
| 3359 // set box->_displaced_header = markOop::unused_mark(). Any non-0 value suffices. | |
| 3360 // This is convenient but results a ST-before-CAS penalty. The following CAS suffers | |
| 3361 // additional latency as we have another ST in the store buffer that must drain. | |
| 3362 | |
| 3363 if (EmitSync & 8192) { | |
| 3364 masm.movl (Address(boxReg, 0), 3) ; // results in ST-before-CAS penalty | |
| 3365 masm.get_thread (scrReg) ; | |
| 3366 masm.movl (boxReg, tmpReg); // consider: LEA box, [tmp-2] | |
| 3367 masm.movl (tmpReg, 0); // consider: xor vs mov | |
| 3368 if (os::is_MP()) { masm.lock(); } | |
| 3369 masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
| 3370 } else | |
| 3371 if ((EmitSync & 128) == 0) { // avoid ST-before-CAS | |
| 3372 masm.movl (scrReg, boxReg) ; | |
| 3373 masm.movl (boxReg, tmpReg); // consider: LEA box, [tmp-2] | |
| 3374 | |
| 3375 // Using a prefetchw helps avoid later RTS->RTO upgrades and cache probes | |
| 3376 if ((EmitSync & 2048) && VM_Version::supports_3dnow() && os::is_MP()) { | |
| 3377 // prefetchw [eax + Offset(_owner)-2] | |
| 3378 masm.emit_raw (0x0F) ; | |
| 3379 masm.emit_raw (0x0D) ; | |
| 3380 masm.emit_raw (0x48) ; | |
| 3381 masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; | |
| 3382 } | |
| 3383 | |
| 3384 if ((EmitSync & 64) == 0) { | |
| 3385 // Optimistic form: consider XORL tmpReg,tmpReg | |
| 3386 masm.movl (tmpReg, 0 ) ; | |
| 3387 } else { | |
| 3388 // Can suffer RTS->RTO upgrades on shared or cold $ lines | |
| 3389 // Test-And-CAS instead of CAS | |
| 3390 masm.movl (tmpReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; // rax, = m->_owner | |
| 3391 masm.testl (tmpReg, tmpReg) ; // Locked ? | |
| 3392 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
| 3393 } | |
| 3394 | |
| 3395 // Appears unlocked - try to swing _owner from null to non-null. | |
| 3396 // Ideally, I'd manifest "Self" with get_thread and then attempt | |
| 3397 // to CAS the register containing Self into m->Owner. | |
| 3398 // But we don't have enough registers, so instead we can either try to CAS | |
| 3399 // rsp or the address of the box (in scr) into &m->owner. If the CAS succeeds | |
| 3400 // we later store "Self" into m->Owner. Transiently storing a stack address | |
| 3401 // (rsp or the address of the box) into m->owner is harmless. | |
| 3402 // Invariant: tmpReg == 0. tmpReg is EAX which is the implicit cmpxchg comparand. | |
| 3403 if (os::is_MP()) { masm.lock(); } | |
| 3404 masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
| 3405 masm.movl (Address(scrReg, 0), 3) ; // box->_displaced_header = 3 | |
| 3406 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
| 3407 masm.get_thread (scrReg) ; // beware: clobbers ICCs | |
| 3408 masm.movl (Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2), scrReg) ; | |
| 3409 masm.xorl (boxReg, boxReg) ; // set icc.ZFlag = 1 to indicate success | |
| 3410 | |
| 3411 // If the CAS fails we can either retry or pass control to the slow-path. | |
| 3412 // We use the latter tactic. | |
| 3413 // Pass the CAS result in the icc.ZFlag into DONE_LABEL | |
| 3414 // If the CAS was successful ... | |
| 3415 // Self has acquired the lock | |
| 3416 // Invariant: m->_recursions should already be 0, so we don't need to explicitly set it. | |
| 3417 // Intentional fall-through into DONE_LABEL ... | |
| 3418 } else { | |
| 3419 masm.movl (Address(boxReg, 0), 3) ; // results in ST-before-CAS penalty | |
| 3420 masm.movl (boxReg, tmpReg) ; | |
| 3421 | |
| 3422 // Using a prefetchw helps avoid later RTS->RTO upgrades and cache probes | |
| 3423 if ((EmitSync & 2048) && VM_Version::supports_3dnow() && os::is_MP()) { | |
| 3424 // prefetchw [eax + Offset(_owner)-2] | |
| 3425 masm.emit_raw (0x0F) ; | |
| 3426 masm.emit_raw (0x0D) ; | |
| 3427 masm.emit_raw (0x48) ; | |
| 3428 masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; | |
| 3429 } | |
| 3430 | |
| 3431 if ((EmitSync & 64) == 0) { | |
| 3432 // Optimistic form | |
| 3433 masm.xorl (tmpReg, tmpReg) ; | |
| 3434 } else { | |
| 3435 // Can suffer RTS->RTO upgrades on shared or cold $ lines | |
| 3436 masm.movl (tmpReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; // rax, = m->_owner | |
| 3437 masm.testl (tmpReg, tmpReg) ; // Locked ? | |
| 3438 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
| 3439 } | |
| 3440 | |
| 3441 // Appears unlocked - try to swing _owner from null to non-null. | |
| 3442 // Use either "Self" (in scr) or rsp as thread identity in _owner. | |
| 3443 // Invariant: tmpReg == 0. tmpReg is EAX which is the implicit cmpxchg comparand. | |
| 3444 masm.get_thread (scrReg) ; | |
| 3445 if (os::is_MP()) { masm.lock(); } | |
| 3446 masm.cmpxchg (scrReg, Address(boxReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
| 3447 | |
| 3448 // If the CAS fails we can either retry or pass control to the slow-path. | |
| 3449 // We use the latter tactic. | |
| 3450 // Pass the CAS result in the icc.ZFlag into DONE_LABEL | |
| 3451 // If the CAS was successful ... | |
| 3452 // Self has acquired the lock | |
| 3453 // Invariant: m->_recursions should already be 0, so we don't need to explicitly set it. | |
| 3454 // Intentional fall-through into DONE_LABEL ... | |
| 3455 } | |
| 3456 | |
| 3457 // DONE_LABEL is a hot target - we'd really like to place it at the | |
| 3458 // start of cache line by padding with NOPs. | |
| 3459 // See the AMD and Intel software optimization manuals for the | |
| 3460 // most efficient "long" NOP encodings. | |
| 3461 // Unfortunately none of our alignment mechanisms suffice. | |
| 3462 masm.bind(DONE_LABEL); | |
| 3463 | |
| 3464 // Avoid branch-to-branch on AMD processors | |
| 3465 // This appears to be superstition. | |
| 3466 if (EmitSync & 32) masm.nop() ; | |
| 3467 | |
| 3468 | |
| 3469 // At DONE_LABEL the icc ZFlag is set as follows ... | |
| 3470 // Fast_Unlock uses the same protocol. | |
| 3471 // ZFlag == 1 -> Success | |
| 3472 // ZFlag == 0 -> Failure - force control through the slow-path | |
| 3473 } | |
| 3474 %} | |
| 3475 | |
| 3476 // obj: object to unlock | |
| 3477 // box: box address (displaced header location), killed. Must be EAX. | |
| 3478 // rbx,: killed tmp; cannot be obj nor box. | |
| 3479 // | |
| 3480 // Some commentary on balanced locking: | |
| 3481 // | |
| 3482 // Fast_Lock and Fast_Unlock are emitted only for provably balanced lock sites. | |
| 3483 // Methods that don't have provably balanced locking are forced to run in the | |
| 3484 // interpreter - such methods won't be compiled to use fast_lock and fast_unlock. | |
| 3485 // The interpreter provides two properties: | |
| 3486 // I1: At return-time the interpreter automatically and quietly unlocks any | |
| 3487 // objects acquired the current activation (frame). Recall that the | |
| 3488 // interpreter maintains an on-stack list of locks currently held by | |
| 3489 // a frame. | |
| 3490 // I2: If a method attempts to unlock an object that is not held by the | |
| 3491 // the frame the interpreter throws IMSX. | |
| 3492 // | |
| 3493 // Lets say A(), which has provably balanced locking, acquires O and then calls B(). | |
| 3494 // B() doesn't have provably balanced locking so it runs in the interpreter. | |
| 3495 // Control returns to A() and A() unlocks O. By I1 and I2, above, we know that O | |
| 3496 // is still locked by A(). | |
| 3497 // | |
| 3498 // The only other source of unbalanced locking would be JNI. The "Java Native Interface: | |
| 3499 // Programmer's Guide and Specification" claims that an object locked by jni_monitorenter | |
| 3500 // should not be unlocked by "normal" java-level locking and vice-versa. The specification | |
| 3501 // doesn't specify what will occur if a program engages in such mixed-mode locking, however. | |
| 3502 | |
| 3503 enc_class Fast_Unlock( nabxRegP obj, eAXRegP box, eRegP tmp) %{ | |
| 3504 | |
| 3505 Register objReg = as_Register($obj$$reg); | |
| 3506 Register boxReg = as_Register($box$$reg); | |
| 3507 Register tmpReg = as_Register($tmp$$reg); | |
| 3508 | |
| 3509 guarantee (objReg != boxReg, "") ; | |
| 3510 guarantee (objReg != tmpReg, "") ; | |
| 3511 guarantee (boxReg != tmpReg, "") ; | |
| 3512 guarantee (boxReg == as_Register(EAX_enc), "") ; | |
| 3513 MacroAssembler masm(&cbuf); | |
| 3514 | |
| 3515 if (EmitSync & 4) { | |
| 3516 // Disable - inhibit all inlining. Force control through the slow-path | |
| 3517 masm.cmpl (rsp, 0) ; | |
| 3518 } else | |
| 3519 if (EmitSync & 8) { | |
| 3520 Label DONE_LABEL ; | |
| 3521 if (UseBiasedLocking) { | |
| 3522 masm.biased_locking_exit(objReg, tmpReg, DONE_LABEL); | |
| 3523 } | |
| 3524 // classic stack-locking code ... | |
| 3525 masm.movl (tmpReg, Address(boxReg, 0)) ; | |
| 3526 masm.testl (tmpReg, tmpReg) ; | |
| 3527 masm.jcc (Assembler::zero, DONE_LABEL) ; | |
| 3528 if (os::is_MP()) { masm.lock(); } | |
| 3529 masm.cmpxchg(tmpReg, Address(objReg, 0)); // Uses EAX which is box | |
| 3530 masm.bind(DONE_LABEL); | |
| 3531 } else { | |
| 3532 Label DONE_LABEL, Stacked, CheckSucc, Inflated ; | |
| 3533 | |
| 3534 // Critically, the biased locking test must have precedence over | |
| 3535 // and appear before the (box->dhw == 0) recursive stack-lock test. | |
| 3536 if (UseBiasedLocking) { | |
| 3537 masm.biased_locking_exit(objReg, tmpReg, DONE_LABEL); | |
| 3538 } | |
| 3539 | |
| 3540 masm.cmpl (Address(boxReg, 0), 0) ; // Examine the displaced header | |
| 3541 masm.movl (tmpReg, Address(objReg, 0)) ; // Examine the object's markword | |
| 3542 masm.jccb (Assembler::zero, DONE_LABEL) ; // 0 indicates recursive stack-lock | |
| 3543 | |
| 3544 masm.testl (tmpReg, 0x02) ; // Inflated? | |
| 3545 masm.jccb (Assembler::zero, Stacked) ; | |
| 3546 | |
| 3547 masm.bind (Inflated) ; | |
| 3548 // It's inflated. | |
| 3549 // Despite our balanced locking property we still check that m->_owner == Self | |
| 3550 // as java routines or native JNI code called by this thread might | |
| 3551 // have released the lock. | |
| 3552 // Refer to the comments in synchronizer.cpp for how we might encode extra | |
| 3553 // state in _succ so we can avoid fetching EntryList|cxq. | |
| 3554 // | |
| 3555 // I'd like to add more cases in fast_lock() and fast_unlock() -- | |
| 3556 // such as recursive enter and exit -- but we have to be wary of | |
| 3557 // I$ bloat, T$ effects and BP$ effects. | |
| 3558 // | |
| 3559 // If there's no contention try a 1-0 exit. That is, exit without | |
| 3560 // a costly MEMBAR or CAS. See synchronizer.cpp for details on how | |
| 3561 // we detect and recover from the race that the 1-0 exit admits. | |
| 3562 // | |
| 3563 // Conceptually Fast_Unlock() must execute a STST|LDST "release" barrier | |
| 3564 // before it STs null into _owner, releasing the lock. Updates | |
| 3565 // to data protected by the critical section must be visible before | |
| 3566 // we drop the lock (and thus before any other thread could acquire | |
| 3567 // the lock and observe the fields protected by the lock). | |
| 3568 // IA32's memory-model is SPO, so STs are ordered with respect to | |
| 3569 // each other and there's no need for an explicit barrier (fence). | |
| 3570 // See also http://gee.cs.oswego.edu/dl/jmm/cookbook.html. | |
| 3571 | |
| 3572 masm.get_thread (boxReg) ; | |
| 3573 if ((EmitSync & 4096) && VM_Version::supports_3dnow() && os::is_MP()) { | |
| 3574 // prefetchw [ebx + Offset(_owner)-2] | |
| 3575 masm.emit_raw (0x0F) ; | |
| 3576 masm.emit_raw (0x0D) ; | |
| 3577 masm.emit_raw (0x4B) ; | |
| 3578 masm.emit_raw (ObjectMonitor::owner_offset_in_bytes()-2) ; | |
| 3579 } | |
| 3580 | |
| 3581 // Note that we could employ various encoding schemes to reduce | |
| 3582 // the number of loads below (currently 4) to just 2 or 3. | |
| 3583 // Refer to the comments in synchronizer.cpp. | |
| 3584 // In practice the chain of fetches doesn't seem to impact performance, however. | |
| 3585 if ((EmitSync & 65536) == 0 && (EmitSync & 256)) { | |
| 3586 // Attempt to reduce branch density - AMD's branch predictor. | |
| 3587 masm.xorl (boxReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
| 3588 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::recursions_offset_in_bytes()-2)) ; | |
| 3589 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::EntryList_offset_in_bytes()-2)) ; | |
| 3590 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::cxq_offset_in_bytes()-2)) ; | |
| 3591 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
| 3592 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; | |
| 3593 masm.jmpb (DONE_LABEL) ; | |
| 3594 } else { | |
| 3595 masm.xorl (boxReg, Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)) ; | |
| 3596 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::recursions_offset_in_bytes()-2)) ; | |
| 3597 masm.jccb (Assembler::notZero, DONE_LABEL) ; | |
| 3598 masm.movl (boxReg, Address (tmpReg, ObjectMonitor::EntryList_offset_in_bytes()-2)) ; | |
| 3599 masm.orl (boxReg, Address (tmpReg, ObjectMonitor::cxq_offset_in_bytes()-2)) ; | |
| 3600 masm.jccb (Assembler::notZero, CheckSucc) ; | |
| 3601 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; | |
| 3602 masm.jmpb (DONE_LABEL) ; | |
| 3603 } | |
| 3604 | |
| 3605 // The Following code fragment (EmitSync & 65536) improves the performance of | |
| 3606 // contended applications and contended synchronization microbenchmarks. | |
| 3607 // Unfortunately the emission of the code - even though not executed - causes regressions | |
| 3608 // in scimark and jetstream, evidently because of $ effects. Replacing the code | |
| 3609 // with an equal number of never-executed NOPs results in the same regression. | |
| 3610 // We leave it off by default. | |
| 3611 | |
| 3612 if ((EmitSync & 65536) != 0) { | |
| 3613 Label LSuccess, LGoSlowPath ; | |
| 3614 | |
| 3615 masm.bind (CheckSucc) ; | |
| 3616 | |
| 3617 // Optional pre-test ... it's safe to elide this | |
| 3618 if ((EmitSync & 16) == 0) { | |
| 3619 masm.cmpl (Address (tmpReg, ObjectMonitor::succ_offset_in_bytes()-2), 0) ; | |
| 3620 masm.jccb (Assembler::zero, LGoSlowPath) ; | |
| 3621 } | |
| 3622 | |
| 3623 // We have a classic Dekker-style idiom: | |
| 3624 // ST m->_owner = 0 ; MEMBAR; LD m->_succ | |
| 3625 // There are a number of ways to implement the barrier: | |
| 3626 // (1) lock:andl &m->_owner, 0 | |
| 3627 // is fast, but mask doesn't currently support the "ANDL M,IMM32" form. | |
| 3628 // LOCK: ANDL [ebx+Offset(_Owner)-2], 0 | |
| 3629 // Encodes as 81 31 OFF32 IMM32 or 83 63 OFF8 IMM8 | |
| 3630 // (2) If supported, an explicit MFENCE is appealing. | |
| 3631 // In older IA32 processors MFENCE is slower than lock:add or xchg | |
| 3632 // particularly if the write-buffer is full as might be the case if | |
| 3633 // if stores closely precede the fence or fence-equivalent instruction. | |
| 3634 // In more modern implementations MFENCE appears faster, however. | |
| 3635 // (3) In lieu of an explicit fence, use lock:addl to the top-of-stack | |
| 3636 // The $lines underlying the top-of-stack should be in M-state. | |
| 3637 // The locked add instruction is serializing, of course. | |
| 3638 // (4) Use xchg, which is serializing | |
| 3639 // mov boxReg, 0; xchgl boxReg, [tmpReg + Offset(_owner)-2] also works | |
| 3640 // (5) ST m->_owner = 0 and then execute lock:orl &m->_succ, 0. | |
| 3641 // The integer condition codes will tell us if succ was 0. | |
| 3642 // Since _succ and _owner should reside in the same $line and | |
| 3643 // we just stored into _owner, it's likely that the $line | |
| 3644 // remains in M-state for the lock:orl. | |
| 3645 // | |
| 3646 // We currently use (3), although it's likely that switching to (2) | |
| 3647 // is correct for the future. | |
| 3648 | |
| 3649 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), 0) ; | |
| 3650 if (os::is_MP()) { | |
| 3651 if (VM_Version::supports_sse2() && 1 == FenceInstruction) { | |
| 3652 masm.emit_raw (0x0F) ; // MFENCE ... | |
| 3653 masm.emit_raw (0xAE) ; | |
| 3654 masm.emit_raw (0xF0) ; | |
| 3655 } else { | |
| 3656 masm.lock () ; masm.addl (Address(rsp, 0), 0) ; | |
| 3657 } | |
| 3658 } | |
| 3659 // Ratify _succ remains non-null | |
| 3660 masm.cmpl (Address (tmpReg, ObjectMonitor::succ_offset_in_bytes()-2), 0) ; | |
| 3661 masm.jccb (Assembler::notZero, LSuccess) ; | |
| 3662 | |
| 3663 masm.xorl (boxReg, boxReg) ; // box is really EAX | |
| 3664 if (os::is_MP()) { masm.lock(); } | |
| 3665 masm.cmpxchg(rsp, Address(tmpReg, ObjectMonitor::owner_offset_in_bytes()-2)); | |
| 3666 masm.jccb (Assembler::notEqual, LSuccess) ; | |
| 3667 // Since we're low on registers we installed rsp as a placeholding in _owner. | |
| 3668 // Now install Self over rsp. This is safe as we're transitioning from | |
| 3669 // non-null to non=null | |
| 3670 masm.get_thread (boxReg) ; | |
| 3671 masm.movl (Address (tmpReg, ObjectMonitor::owner_offset_in_bytes()-2), boxReg) ; | |
| 3672 // Intentional fall-through into LGoSlowPath ... | |
| 3673 | |
| 3674 masm.bind (LGoSlowPath) ; | |
| 3675 masm.orl (boxReg, 1) ; // set ICC.ZF=0 to indicate failure | |
| 3676 masm.jmpb (DONE_LABEL) ; | |
| 3677 | |
| 3678 masm.bind (LSuccess) ; | |
| 3679 masm.xorl (boxReg, boxReg) ; // set ICC.ZF=1 to indicate success | |
| 3680 masm.jmpb (DONE_LABEL) ; | |
| 3681 } | |
| 3682 | |
| 3683 masm.bind (Stacked) ; | |
| 3684 // It's not inflated and it's not recursively stack-locked and it's not biased. | |
| 3685 // It must be stack-locked. | |
| 3686 // Try to reset the header to displaced header. | |
| 3687 // The "box" value on the stack is stable, so we can reload | |
| 3688 // and be assured we observe the same value as above. | |
| 3689 masm.movl (tmpReg, Address(boxReg, 0)) ; | |
| 3690 if (os::is_MP()) { masm.lock(); } | |
| 3691 masm.cmpxchg(tmpReg, Address(objReg, 0)); // Uses EAX which is box | |
| 3692 // Intention fall-thru into DONE_LABEL | |
| 3693 | |
| 3694 | |
| 3695 // DONE_LABEL is a hot target - we'd really like to place it at the | |
| 3696 // start of cache line by padding with NOPs. | |
| 3697 // See the AMD and Intel software optimization manuals for the | |
| 3698 // most efficient "long" NOP encodings. | |
| 3699 // Unfortunately none of our alignment mechanisms suffice. | |
| 3700 if ((EmitSync & 65536) == 0) { | |
| 3701 masm.bind (CheckSucc) ; | |
| 3702 } | |
| 3703 masm.bind(DONE_LABEL); | |
| 3704 | |
| 3705 // Avoid branch to branch on AMD processors | |
| 3706 if (EmitSync & 32768) { masm.nop() ; } | |
| 3707 } | |
| 3708 %} | |
| 3709 | |
| 3710 enc_class enc_String_Compare() %{ | |
| 3711 Label ECX_GOOD_LABEL, LENGTH_DIFF_LABEL, | |
| 3712 POP_LABEL, DONE_LABEL, CONT_LABEL, | |
| 3713 WHILE_HEAD_LABEL; | |
| 3714 MacroAssembler masm(&cbuf); | |
| 3715 | |
| 3716 // Get the first character position in both strings | |
| 3717 // [8] char array, [12] offset, [16] count | |
| 3718 int value_offset = java_lang_String::value_offset_in_bytes(); | |
| 3719 int offset_offset = java_lang_String::offset_offset_in_bytes(); | |
| 3720 int count_offset = java_lang_String::count_offset_in_bytes(); | |
| 3721 int base_offset = arrayOopDesc::base_offset_in_bytes(T_CHAR); | |
| 3722 | |
| 3723 masm.movl(rax, Address(rsi, value_offset)); | |
| 3724 masm.movl(rcx, Address(rsi, offset_offset)); | |
| 3725 masm.leal(rax, Address(rax, rcx, Address::times_2, base_offset)); | |
| 3726 masm.movl(rbx, Address(rdi, value_offset)); | |
| 3727 masm.movl(rcx, Address(rdi, offset_offset)); | |
| 3728 masm.leal(rbx, Address(rbx, rcx, Address::times_2, base_offset)); | |
| 3729 | |
| 3730 // Compute the minimum of the string lengths(rsi) and the | |
| 3731 // difference of the string lengths (stack) | |
| 3732 | |
| 3733 | |
| 3734 if (VM_Version::supports_cmov()) { | |
| 3735 masm.movl(rdi, Address(rdi, count_offset)); | |
| 3736 masm.movl(rsi, Address(rsi, count_offset)); | |
| 3737 masm.movl(rcx, rdi); | |
| 3738 masm.subl(rdi, rsi); | |
| 3739 masm.pushl(rdi); | |
| 3740 masm.cmovl(Assembler::lessEqual, rsi, rcx); | |
| 3741 } else { | |
| 3742 masm.movl(rdi, Address(rdi, count_offset)); | |
| 3743 masm.movl(rcx, Address(rsi, count_offset)); | |
| 3744 masm.movl(rsi, rdi); | |
| 3745 masm.subl(rdi, rcx); | |
| 3746 masm.pushl(rdi); | |
| 3747 masm.jcc(Assembler::lessEqual, ECX_GOOD_LABEL); | |
| 3748 masm.movl(rsi, rcx); | |
| 3749 // rsi holds min, rcx is unused | |
| 3750 } | |
| 3751 | |
| 3752 // Is the minimum length zero? | |
| 3753 masm.bind(ECX_GOOD_LABEL); | |
| 3754 masm.testl(rsi, rsi); | |
| 3755 masm.jcc(Assembler::zero, LENGTH_DIFF_LABEL); | |
| 3756 | |
| 3757 // Load first characters | |
| 3758 masm.load_unsigned_word(rcx, Address(rbx, 0)); | |
| 3759 masm.load_unsigned_word(rdi, Address(rax, 0)); | |
| 3760 | |
| 3761 // Compare first characters | |
| 3762 masm.subl(rcx, rdi); | |
| 3763 masm.jcc(Assembler::notZero, POP_LABEL); | |
| 3764 masm.decrement(rsi); | |
| 3765 masm.jcc(Assembler::zero, LENGTH_DIFF_LABEL); | |
| 3766 | |
| 3767 { | |
| 3768 // Check after comparing first character to see if strings are equivalent | |
| 3769 Label LSkip2; | |
| 3770 // Check if the strings start at same location | |
| 3771 masm.cmpl(rbx,rax); | |
| 3772 masm.jcc(Assembler::notEqual, LSkip2); | |
| 3773 | |
| 3774 // Check if the length difference is zero (from stack) | |
| 3775 masm.cmpl(Address(rsp, 0), 0x0); | |
| 3776 masm.jcc(Assembler::equal, LENGTH_DIFF_LABEL); | |
| 3777 | |
| 3778 // Strings might not be equivalent | |
| 3779 masm.bind(LSkip2); | |
| 3780 } | |
| 3781 | |
| 3782 // Shift rax, and rbx, to the end of the arrays, negate min | |
| 3783 masm.leal(rax, Address(rax, rsi, Address::times_2, 2)); | |
| 3784 masm.leal(rbx, Address(rbx, rsi, Address::times_2, 2)); | |
| 3785 masm.negl(rsi); | |
| 3786 | |
| 3787 // Compare the rest of the characters | |
| 3788 masm.bind(WHILE_HEAD_LABEL); | |
| 3789 masm.load_unsigned_word(rcx, Address(rbx, rsi, Address::times_2, 0)); | |
| 3790 masm.load_unsigned_word(rdi, Address(rax, rsi, Address::times_2, 0)); | |
| 3791 masm.subl(rcx, rdi); | |
| 3792 masm.jcc(Assembler::notZero, POP_LABEL); | |
| 3793 masm.increment(rsi); | |
| 3794 masm.jcc(Assembler::notZero, WHILE_HEAD_LABEL); | |
| 3795 | |
| 3796 // Strings are equal up to min length. Return the length difference. | |
| 3797 masm.bind(LENGTH_DIFF_LABEL); | |
| 3798 masm.popl(rcx); | |
| 3799 masm.jmp(DONE_LABEL); | |
| 3800 | |
| 3801 // Discard the stored length difference | |
| 3802 masm.bind(POP_LABEL); | |
| 3803 masm.addl(rsp, 4); | |
| 3804 | |
| 3805 // That's it | |
| 3806 masm.bind(DONE_LABEL); | |
| 3807 %} | |
| 3808 | |
| 3809 enc_class enc_pop_rdx() %{ | |
| 3810 emit_opcode(cbuf,0x5A); | |
| 3811 %} | |
| 3812 | |
| 3813 enc_class enc_rethrow() %{ | |
| 3814 cbuf.set_inst_mark(); | |
| 3815 emit_opcode(cbuf, 0xE9); // jmp entry | |
| 3816 emit_d32_reloc(cbuf, (int)OptoRuntime::rethrow_stub() - ((int)cbuf.code_end())-4, | |
| 3817 runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 3818 %} | |
| 3819 | |
| 3820 | |
| 3821 // Convert a double to an int. Java semantics require we do complex | |
| 3822 // manglelations in the corner cases. So we set the rounding mode to | |
| 3823 // 'zero', store the darned double down as an int, and reset the | |
| 3824 // rounding mode to 'nearest'. The hardware throws an exception which | |
| 3825 // patches up the correct value directly to the stack. | |
| 3826 enc_class D2I_encoding( regD src ) %{ | |
| 3827 // Flip to round-to-zero mode. We attempted to allow invalid-op | |
| 3828 // exceptions here, so that a NAN or other corner-case value will | |
| 3829 // thrown an exception (but normal values get converted at full speed). | |
| 3830 // However, I2C adapters and other float-stack manglers leave pending | |
| 3831 // invalid-op exceptions hanging. We would have to clear them before | |
| 3832 // enabling them and that is more expensive than just testing for the | |
| 3833 // invalid value Intel stores down in the corner cases. | |
| 3834 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
| 3835 emit_opcode(cbuf,0x2D); | |
| 3836 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
| 3837 // Allocate a word | |
| 3838 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
| 3839 emit_opcode(cbuf,0xEC); | |
| 3840 emit_d8(cbuf,0x04); | |
| 3841 // Encoding assumes a double has been pushed into FPR0. | |
| 3842 // Store down the double as an int, popping the FPU stack | |
| 3843 emit_opcode(cbuf,0xDB); // FISTP [ESP] | |
| 3844 emit_opcode(cbuf,0x1C); | |
| 3845 emit_d8(cbuf,0x24); | |
| 3846 // Restore the rounding mode; mask the exception | |
| 3847 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
| 3848 emit_opcode(cbuf,0x2D); | |
| 3849 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
| 3850 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
| 3851 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
| 3852 | |
| 3853 // Load the converted int; adjust CPU stack | |
| 3854 emit_opcode(cbuf,0x58); // POP EAX | |
| 3855 emit_opcode(cbuf,0x3D); // CMP EAX,imm | |
| 3856 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
| 3857 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 3858 emit_d8 (cbuf,0x07); // Size of slow_call | |
| 3859 // Push src onto stack slow-path | |
| 3860 emit_opcode(cbuf,0xD9 ); // FLD ST(i) | |
| 3861 emit_d8 (cbuf,0xC0-1+$src$$reg ); | |
| 3862 // CALL directly to the runtime | |
| 3863 cbuf.set_inst_mark(); | |
| 3864 emit_opcode(cbuf,0xE8); // Call into runtime | |
| 3865 emit_d32_reloc(cbuf, (StubRoutines::d2i_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 3866 // Carry on here... | |
| 3867 %} | |
| 3868 | |
| 3869 enc_class D2L_encoding( regD src ) %{ | |
| 3870 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
| 3871 emit_opcode(cbuf,0x2D); | |
| 3872 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
| 3873 // Allocate a word | |
| 3874 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
| 3875 emit_opcode(cbuf,0xEC); | |
| 3876 emit_d8(cbuf,0x08); | |
| 3877 // Encoding assumes a double has been pushed into FPR0. | |
| 3878 // Store down the double as a long, popping the FPU stack | |
| 3879 emit_opcode(cbuf,0xDF); // FISTP [ESP] | |
| 3880 emit_opcode(cbuf,0x3C); | |
| 3881 emit_d8(cbuf,0x24); | |
| 3882 // Restore the rounding mode; mask the exception | |
| 3883 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
| 3884 emit_opcode(cbuf,0x2D); | |
| 3885 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
| 3886 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
| 3887 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
| 3888 | |
| 3889 // Load the converted int; adjust CPU stack | |
| 3890 emit_opcode(cbuf,0x58); // POP EAX | |
| 3891 emit_opcode(cbuf,0x5A); // POP EDX | |
| 3892 emit_opcode(cbuf,0x81); // CMP EDX,imm | |
| 3893 emit_d8 (cbuf,0xFA); // rdx | |
| 3894 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
| 3895 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 3896 emit_d8 (cbuf,0x07+4); // Size of slow_call | |
| 3897 emit_opcode(cbuf,0x85); // TEST EAX,EAX | |
| 3898 emit_opcode(cbuf,0xC0); // 2/rax,/rax, | |
| 3899 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 3900 emit_d8 (cbuf,0x07); // Size of slow_call | |
| 3901 // Push src onto stack slow-path | |
| 3902 emit_opcode(cbuf,0xD9 ); // FLD ST(i) | |
| 3903 emit_d8 (cbuf,0xC0-1+$src$$reg ); | |
| 3904 // CALL directly to the runtime | |
| 3905 cbuf.set_inst_mark(); | |
| 3906 emit_opcode(cbuf,0xE8); // Call into runtime | |
| 3907 emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 3908 // Carry on here... | |
| 3909 %} | |
| 3910 | |
| 3911 enc_class X2L_encoding( regX src ) %{ | |
| 3912 // Allocate a word | |
| 3913 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
| 3914 emit_opcode(cbuf,0xEC); | |
| 3915 emit_d8(cbuf,0x08); | |
| 3916 | |
| 3917 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src | |
| 3918 emit_opcode (cbuf, 0x0F ); | |
| 3919 emit_opcode (cbuf, 0x11 ); | |
| 3920 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 3921 | |
| 3922 emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] | |
| 3923 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 3924 | |
| 3925 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
| 3926 emit_opcode(cbuf,0x2D); | |
| 3927 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
| 3928 | |
| 3929 // Encoding assumes a double has been pushed into FPR0. | |
| 3930 // Store down the double as a long, popping the FPU stack | |
| 3931 emit_opcode(cbuf,0xDF); // FISTP [ESP] | |
| 3932 emit_opcode(cbuf,0x3C); | |
| 3933 emit_d8(cbuf,0x24); | |
| 3934 | |
| 3935 // Restore the rounding mode; mask the exception | |
| 3936 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
| 3937 emit_opcode(cbuf,0x2D); | |
| 3938 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
| 3939 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
| 3940 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
| 3941 | |
| 3942 // Load the converted int; adjust CPU stack | |
| 3943 emit_opcode(cbuf,0x58); // POP EAX | |
| 3944 | |
| 3945 emit_opcode(cbuf,0x5A); // POP EDX | |
| 3946 | |
| 3947 emit_opcode(cbuf,0x81); // CMP EDX,imm | |
| 3948 emit_d8 (cbuf,0xFA); // rdx | |
| 3949 emit_d32 (cbuf,0x80000000);// 0x80000000 | |
| 3950 | |
| 3951 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 3952 emit_d8 (cbuf,0x13+4); // Size of slow_call | |
| 3953 | |
| 3954 emit_opcode(cbuf,0x85); // TEST EAX,EAX | |
| 3955 emit_opcode(cbuf,0xC0); // 2/rax,/rax, | |
| 3956 | |
| 3957 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 3958 emit_d8 (cbuf,0x13); // Size of slow_call | |
| 3959 | |
| 3960 // Allocate a word | |
| 3961 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
| 3962 emit_opcode(cbuf,0xEC); | |
| 3963 emit_d8(cbuf,0x04); | |
| 3964 | |
| 3965 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], src | |
| 3966 emit_opcode (cbuf, 0x0F ); | |
| 3967 emit_opcode (cbuf, 0x11 ); | |
| 3968 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 3969 | |
| 3970 emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] | |
| 3971 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 3972 | |
| 3973 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
| 3974 emit_opcode(cbuf,0xC4); | |
| 3975 emit_d8(cbuf,0x04); | |
| 3976 | |
| 3977 // CALL directly to the runtime | |
| 3978 cbuf.set_inst_mark(); | |
| 3979 emit_opcode(cbuf,0xE8); // Call into runtime | |
| 3980 emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 3981 // Carry on here... | |
| 3982 %} | |
| 3983 | |
| 3984 enc_class XD2L_encoding( regXD src ) %{ | |
| 3985 // Allocate a word | |
| 3986 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
| 3987 emit_opcode(cbuf,0xEC); | |
| 3988 emit_d8(cbuf,0x08); | |
| 3989 | |
| 3990 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src | |
| 3991 emit_opcode (cbuf, 0x0F ); | |
| 3992 emit_opcode (cbuf, 0x11 ); | |
| 3993 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 3994 | |
| 3995 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
| 3996 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 3997 | |
| 3998 emit_opcode(cbuf,0xD9); // FLDCW trunc | |
| 3999 emit_opcode(cbuf,0x2D); | |
| 4000 emit_d32(cbuf,(int)StubRoutines::addr_fpu_cntrl_wrd_trunc()); | |
| 4001 | |
| 4002 // Encoding assumes a double has been pushed into FPR0. | |
| 4003 // Store down the double as a long, popping the FPU stack | |
| 4004 emit_opcode(cbuf,0xDF); // FISTP [ESP] | |
| 4005 emit_opcode(cbuf,0x3C); | |
| 4006 emit_d8(cbuf,0x24); | |
| 4007 | |
| 4008 // Restore the rounding mode; mask the exception | |
| 4009 emit_opcode(cbuf,0xD9); // FLDCW std/24-bit mode | |
| 4010 emit_opcode(cbuf,0x2D); | |
| 4011 emit_d32( cbuf, Compile::current()->in_24_bit_fp_mode() | |
| 4012 ? (int)StubRoutines::addr_fpu_cntrl_wrd_24() | |
| 4013 : (int)StubRoutines::addr_fpu_cntrl_wrd_std()); | |
| 4014 | |
| 4015 // Load the converted int; adjust CPU stack | |
| 4016 emit_opcode(cbuf,0x58); // POP EAX | |
| 4017 | |
| 4018 emit_opcode(cbuf,0x5A); // POP EDX | |
| 4019 | |
| 4020 emit_opcode(cbuf,0x81); // CMP EDX,imm | |
| 4021 emit_d8 (cbuf,0xFA); // rdx | |
| 4022 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
| 4023 | |
| 4024 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 4025 emit_d8 (cbuf,0x13+4); // Size of slow_call | |
| 4026 | |
| 4027 emit_opcode(cbuf,0x85); // TEST EAX,EAX | |
| 4028 emit_opcode(cbuf,0xC0); // 2/rax,/rax, | |
| 4029 | |
| 4030 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 4031 emit_d8 (cbuf,0x13); // Size of slow_call | |
| 4032 | |
| 4033 // Push src onto stack slow-path | |
| 4034 // Allocate a word | |
| 4035 emit_opcode(cbuf,0x83); // SUB ESP,8 | |
| 4036 emit_opcode(cbuf,0xEC); | |
| 4037 emit_d8(cbuf,0x08); | |
| 4038 | |
| 4039 emit_opcode (cbuf, 0xF2 ); // MOVSD [ESP], src | |
| 4040 emit_opcode (cbuf, 0x0F ); | |
| 4041 emit_opcode (cbuf, 0x11 ); | |
| 4042 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 4043 | |
| 4044 emit_opcode(cbuf,0xDD ); // FLD_D [ESP] | |
| 4045 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 4046 | |
| 4047 emit_opcode(cbuf,0x83); // ADD ESP,8 | |
| 4048 emit_opcode(cbuf,0xC4); | |
| 4049 emit_d8(cbuf,0x08); | |
| 4050 | |
| 4051 // CALL directly to the runtime | |
| 4052 cbuf.set_inst_mark(); | |
| 4053 emit_opcode(cbuf,0xE8); // Call into runtime | |
| 4054 emit_d32_reloc(cbuf, (StubRoutines::d2l_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 4055 // Carry on here... | |
| 4056 %} | |
| 4057 | |
| 4058 enc_class D2X_encoding( regX dst, regD src ) %{ | |
| 4059 // Allocate a word | |
| 4060 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
| 4061 emit_opcode(cbuf,0xEC); | |
| 4062 emit_d8(cbuf,0x04); | |
| 4063 int pop = 0x02; | |
| 4064 if ($src$$reg != FPR1L_enc) { | |
| 4065 emit_opcode( cbuf, 0xD9 ); // FLD ST(i-1) | |
| 4066 emit_d8( cbuf, 0xC0-1+$src$$reg ); | |
| 4067 pop = 0x03; | |
| 4068 } | |
| 4069 store_to_stackslot( cbuf, 0xD9, pop, 0 ); // FST<P>_S [ESP] | |
| 4070 | |
| 4071 emit_opcode (cbuf, 0xF3 ); // MOVSS dst(xmm), [ESP] | |
| 4072 emit_opcode (cbuf, 0x0F ); | |
| 4073 emit_opcode (cbuf, 0x10 ); | |
| 4074 encode_RegMem(cbuf, $dst$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 4075 | |
| 4076 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
| 4077 emit_opcode(cbuf,0xC4); | |
| 4078 emit_d8(cbuf,0x04); | |
| 4079 // Carry on here... | |
| 4080 %} | |
| 4081 | |
| 4082 enc_class FX2I_encoding( regX src, eRegI dst ) %{ | |
| 4083 emit_rm(cbuf, 0x3, $dst$$reg, $src$$reg); | |
| 4084 | |
| 4085 // Compare the result to see if we need to go to the slow path | |
| 4086 emit_opcode(cbuf,0x81); // CMP dst,imm | |
| 4087 emit_rm (cbuf,0x3,0x7,$dst$$reg); | |
| 4088 emit_d32 (cbuf,0x80000000); // 0x80000000 | |
| 4089 | |
| 4090 emit_opcode(cbuf,0x75); // JNE around_slow_call | |
| 4091 emit_d8 (cbuf,0x13); // Size of slow_call | |
| 4092 // Store xmm to a temp memory | |
| 4093 // location and push it onto stack. | |
| 4094 | |
| 4095 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
| 4096 emit_opcode(cbuf,0xEC); | |
| 4097 emit_d8(cbuf, $primary ? 0x8 : 0x4); | |
| 4098 | |
| 4099 emit_opcode (cbuf, $primary ? 0xF2 : 0xF3 ); // MOVSS [ESP], xmm | |
| 4100 emit_opcode (cbuf, 0x0F ); | |
| 4101 emit_opcode (cbuf, 0x11 ); | |
| 4102 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 4103 | |
| 4104 emit_opcode(cbuf, $primary ? 0xDD : 0xD9 ); // FLD [ESP] | |
| 4105 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 4106 | |
| 4107 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
| 4108 emit_opcode(cbuf,0xC4); | |
| 4109 emit_d8(cbuf, $primary ? 0x8 : 0x4); | |
| 4110 | |
| 4111 // CALL directly to the runtime | |
| 4112 cbuf.set_inst_mark(); | |
| 4113 emit_opcode(cbuf,0xE8); // Call into runtime | |
| 4114 emit_d32_reloc(cbuf, (StubRoutines::d2i_wrapper() - cbuf.code_end()) - 4, runtime_call_Relocation::spec(), RELOC_IMM32 ); | |
| 4115 | |
| 4116 // Carry on here... | |
| 4117 %} | |
| 4118 | |
| 4119 enc_class X2D_encoding( regD dst, regX src ) %{ | |
| 4120 // Allocate a word | |
| 4121 emit_opcode(cbuf,0x83); // SUB ESP,4 | |
| 4122 emit_opcode(cbuf,0xEC); | |
| 4123 emit_d8(cbuf,0x04); | |
| 4124 | |
| 4125 emit_opcode (cbuf, 0xF3 ); // MOVSS [ESP], xmm | |
| 4126 emit_opcode (cbuf, 0x0F ); | |
| 4127 emit_opcode (cbuf, 0x11 ); | |
| 4128 encode_RegMem(cbuf, $src$$reg, ESP_enc, 0x4, 0, 0, false); | |
| 4129 | |
| 4130 emit_opcode(cbuf,0xD9 ); // FLD_S [ESP] | |
| 4131 encode_RegMem(cbuf, 0x0, ESP_enc, 0x4, 0, 0, false); | |
| 4132 | |
| 4133 emit_opcode(cbuf,0x83); // ADD ESP,4 | |
| 4134 emit_opcode(cbuf,0xC4); | |
| 4135 emit_d8(cbuf,0x04); | |
| 4136 | |
| 4137 // Carry on here... | |
| 4138 %} | |
| 4139 | |
| 4140 enc_class AbsXF_encoding(regX dst) %{ | |
| 4141 address signmask_address=(address)float_signmask_pool; | |
| 4142 // andpd:\tANDPS $dst,[signconst] | |
| 4143 emit_opcode(cbuf, 0x0F); | |
| 4144 emit_opcode(cbuf, 0x54); | |
| 4145 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
| 4146 emit_d32(cbuf, (int)signmask_address); | |
| 4147 %} | |
| 4148 | |
| 4149 enc_class AbsXD_encoding(regXD dst) %{ | |
| 4150 address signmask_address=(address)double_signmask_pool; | |
| 4151 // andpd:\tANDPD $dst,[signconst] | |
| 4152 emit_opcode(cbuf, 0x66); | |
| 4153 emit_opcode(cbuf, 0x0F); | |
| 4154 emit_opcode(cbuf, 0x54); | |
| 4155 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
| 4156 emit_d32(cbuf, (int)signmask_address); | |
| 4157 %} | |
| 4158 | |
| 4159 enc_class NegXF_encoding(regX dst) %{ | |
| 4160 address signmask_address=(address)float_signflip_pool; | |
| 4161 // andpd:\tXORPS $dst,[signconst] | |
| 4162 emit_opcode(cbuf, 0x0F); | |
| 4163 emit_opcode(cbuf, 0x57); | |
| 4164 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
| 4165 emit_d32(cbuf, (int)signmask_address); | |
| 4166 %} | |
| 4167 | |
| 4168 enc_class NegXD_encoding(regXD dst) %{ | |
| 4169 address signmask_address=(address)double_signflip_pool; | |
| 4170 // andpd:\tXORPD $dst,[signconst] | |
| 4171 emit_opcode(cbuf, 0x66); | |
| 4172 emit_opcode(cbuf, 0x0F); | |
| 4173 emit_opcode(cbuf, 0x57); | |
| 4174 emit_rm(cbuf, 0x0, $dst$$reg, 0x5); | |
| 4175 emit_d32(cbuf, (int)signmask_address); | |
| 4176 %} | |
| 4177 | |
| 4178 enc_class FMul_ST_reg( eRegF src1 ) %{ | |
| 4179 // Operand was loaded from memory into fp ST (stack top) | |
| 4180 // FMUL ST,$src /* D8 C8+i */ | |
| 4181 emit_opcode(cbuf, 0xD8); | |
| 4182 emit_opcode(cbuf, 0xC8 + $src1$$reg); | |
| 4183 %} | |
| 4184 | |
| 4185 enc_class FAdd_ST_reg( eRegF src2 ) %{ | |
| 4186 // FADDP ST,src2 /* D8 C0+i */ | |
| 4187 emit_opcode(cbuf, 0xD8); | |
| 4188 emit_opcode(cbuf, 0xC0 + $src2$$reg); | |
| 4189 //could use FADDP src2,fpST /* DE C0+i */ | |
| 4190 %} | |
| 4191 | |
| 4192 enc_class FAddP_reg_ST( eRegF src2 ) %{ | |
| 4193 // FADDP src2,ST /* DE C0+i */ | |
| 4194 emit_opcode(cbuf, 0xDE); | |
| 4195 emit_opcode(cbuf, 0xC0 + $src2$$reg); | |
| 4196 %} | |
| 4197 | |
| 4198 enc_class subF_divF_encode( eRegF src1, eRegF src2) %{ | |
| 4199 // Operand has been loaded into fp ST (stack top) | |
| 4200 // FSUB ST,$src1 | |
| 4201 emit_opcode(cbuf, 0xD8); | |
| 4202 emit_opcode(cbuf, 0xE0 + $src1$$reg); | |
| 4203 | |
| 4204 // FDIV | |
| 4205 emit_opcode(cbuf, 0xD8); | |
| 4206 emit_opcode(cbuf, 0xF0 + $src2$$reg); | |
| 4207 %} | |
| 4208 | |
| 4209 enc_class MulFAddF (eRegF src1, eRegF src2) %{ | |
| 4210 // Operand was loaded from memory into fp ST (stack top) | |
| 4211 // FADD ST,$src /* D8 C0+i */ | |
| 4212 emit_opcode(cbuf, 0xD8); | |
| 4213 emit_opcode(cbuf, 0xC0 + $src1$$reg); | |
| 4214 | |
| 4215 // FMUL ST,src2 /* D8 C*+i */ | |
| 4216 emit_opcode(cbuf, 0xD8); | |
| 4217 emit_opcode(cbuf, 0xC8 + $src2$$reg); | |
| 4218 %} | |
| 4219 | |
| 4220 | |
| 4221 enc_class MulFAddFreverse (eRegF src1, eRegF src2) %{ | |
| 4222 // Operand was loaded from memory into fp ST (stack top) | |
| 4223 // FADD ST,$src /* D8 C0+i */ | |
| 4224 emit_opcode(cbuf, 0xD8); | |
| 4225 emit_opcode(cbuf, 0xC0 + $src1$$reg); | |
| 4226 | |
| 4227 // FMULP src2,ST /* DE C8+i */ | |
| 4228 emit_opcode(cbuf, 0xDE); | |
| 4229 emit_opcode(cbuf, 0xC8 + $src2$$reg); | |
| 4230 %} | |
| 4231 | |
| 4232 enc_class enc_membar_acquire %{ | |
| 4233 // Doug Lea believes this is not needed with current Sparcs and TSO. | |
| 4234 // MacroAssembler masm(&cbuf); | |
| 4235 // masm.membar(); | |
| 4236 %} | |
| 4237 | |
| 4238 enc_class enc_membar_release %{ | |
| 4239 // Doug Lea believes this is not needed with current Sparcs and TSO. | |
| 4240 // MacroAssembler masm(&cbuf); | |
| 4241 // masm.membar(); | |
| 4242 %} | |
| 4243 | |
| 4244 enc_class enc_membar_volatile %{ | |
| 4245 MacroAssembler masm(&cbuf); | |
| 4246 masm.membar(); | |
| 4247 %} | |
| 4248 | |
| 4249 // Atomically load the volatile long | |
| 4250 enc_class enc_loadL_volatile( memory mem, stackSlotL dst ) %{ | |
| 4251 emit_opcode(cbuf,0xDF); | |
| 4252 int rm_byte_opcode = 0x05; | |
| 4253 int base = $mem$$base; | |
| 4254 int index = $mem$$index; | |
| 4255 int scale = $mem$$scale; | |
| 4256 int displace = $mem$$disp; | |
| 4257 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4258 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); | |
| 4259 store_to_stackslot( cbuf, 0x0DF, 0x07, $dst$$disp ); | |
| 4260 %} | |
| 4261 | |
| 4262 enc_class enc_loadLX_volatile( memory mem, stackSlotL dst, regXD tmp ) %{ | |
| 4263 { // Atomic long load | |
| 4264 // UseXmmLoadAndClearUpper ? movsd $tmp,$mem : movlpd $tmp,$mem | |
| 4265 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
| 4266 emit_opcode(cbuf,0x0F); | |
| 4267 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
| 4268 int base = $mem$$base; | |
| 4269 int index = $mem$$index; | |
| 4270 int scale = $mem$$scale; | |
| 4271 int displace = $mem$$disp; | |
| 4272 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4273 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
| 4274 } | |
| 4275 { // MOVSD $dst,$tmp ! atomic long store | |
| 4276 emit_opcode(cbuf,0xF2); | |
| 4277 emit_opcode(cbuf,0x0F); | |
| 4278 emit_opcode(cbuf,0x11); | |
| 4279 int base = $dst$$base; | |
| 4280 int index = $dst$$index; | |
| 4281 int scale = $dst$$scale; | |
| 4282 int displace = $dst$$disp; | |
| 4283 bool disp_is_oop = $dst->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4284 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
| 4285 } | |
| 4286 %} | |
| 4287 | |
| 4288 enc_class enc_loadLX_reg_volatile( memory mem, eRegL dst, regXD tmp ) %{ | |
| 4289 { // Atomic long load | |
| 4290 // UseXmmLoadAndClearUpper ? movsd $tmp,$mem : movlpd $tmp,$mem | |
| 4291 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
| 4292 emit_opcode(cbuf,0x0F); | |
| 4293 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
| 4294 int base = $mem$$base; | |
| 4295 int index = $mem$$index; | |
| 4296 int scale = $mem$$scale; | |
| 4297 int displace = $mem$$disp; | |
| 4298 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4299 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
| 4300 } | |
| 4301 { // MOVD $dst.lo,$tmp | |
| 4302 emit_opcode(cbuf,0x66); | |
| 4303 emit_opcode(cbuf,0x0F); | |
| 4304 emit_opcode(cbuf,0x7E); | |
| 4305 emit_rm(cbuf, 0x3, $tmp$$reg, $dst$$reg); | |
| 4306 } | |
| 4307 { // PSRLQ $tmp,32 | |
| 4308 emit_opcode(cbuf,0x66); | |
| 4309 emit_opcode(cbuf,0x0F); | |
| 4310 emit_opcode(cbuf,0x73); | |
| 4311 emit_rm(cbuf, 0x3, 0x02, $tmp$$reg); | |
| 4312 emit_d8(cbuf, 0x20); | |
| 4313 } | |
| 4314 { // MOVD $dst.hi,$tmp | |
| 4315 emit_opcode(cbuf,0x66); | |
| 4316 emit_opcode(cbuf,0x0F); | |
| 4317 emit_opcode(cbuf,0x7E); | |
| 4318 emit_rm(cbuf, 0x3, $tmp$$reg, HIGH_FROM_LOW($dst$$reg)); | |
| 4319 } | |
| 4320 %} | |
| 4321 | |
| 4322 // Volatile Store Long. Must be atomic, so move it into | |
| 4323 // the FP TOS and then do a 64-bit FIST. Has to probe the | |
| 4324 // target address before the store (for null-ptr checks) | |
| 4325 // so the memory operand is used twice in the encoding. | |
| 4326 enc_class enc_storeL_volatile( memory mem, stackSlotL src ) %{ | |
| 4327 store_to_stackslot( cbuf, 0x0DF, 0x05, $src$$disp ); | |
| 4328 cbuf.set_inst_mark(); // Mark start of FIST in case $mem has an oop | |
| 4329 emit_opcode(cbuf,0xDF); | |
| 4330 int rm_byte_opcode = 0x07; | |
| 4331 int base = $mem$$base; | |
| 4332 int index = $mem$$index; | |
| 4333 int scale = $mem$$scale; | |
| 4334 int displace = $mem$$disp; | |
| 4335 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4336 encode_RegMem(cbuf, rm_byte_opcode, base, index, scale, displace, disp_is_oop); | |
| 4337 %} | |
| 4338 | |
| 4339 enc_class enc_storeLX_volatile( memory mem, stackSlotL src, regXD tmp) %{ | |
| 4340 { // Atomic long load | |
| 4341 // UseXmmLoadAndClearUpper ? movsd $tmp,[$src] : movlpd $tmp,[$src] | |
| 4342 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0xF2 : 0x66); | |
| 4343 emit_opcode(cbuf,0x0F); | |
| 4344 emit_opcode(cbuf,UseXmmLoadAndClearUpper ? 0x10 : 0x12); | |
| 4345 int base = $src$$base; | |
| 4346 int index = $src$$index; | |
| 4347 int scale = $src$$scale; | |
| 4348 int displace = $src$$disp; | |
| 4349 bool disp_is_oop = $src->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4350 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
| 4351 } | |
| 4352 cbuf.set_inst_mark(); // Mark start of MOVSD in case $mem has an oop | |
| 4353 { // MOVSD $mem,$tmp ! atomic long store | |
| 4354 emit_opcode(cbuf,0xF2); | |
| 4355 emit_opcode(cbuf,0x0F); | |
| 4356 emit_opcode(cbuf,0x11); | |
| 4357 int base = $mem$$base; | |
| 4358 int index = $mem$$index; | |
| 4359 int scale = $mem$$scale; | |
| 4360 int displace = $mem$$disp; | |
| 4361 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4362 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
| 4363 } | |
| 4364 %} | |
| 4365 | |
| 4366 enc_class enc_storeLX_reg_volatile( memory mem, eRegL src, regXD tmp, regXD tmp2) %{ | |
| 4367 { // MOVD $tmp,$src.lo | |
| 4368 emit_opcode(cbuf,0x66); | |
| 4369 emit_opcode(cbuf,0x0F); | |
| 4370 emit_opcode(cbuf,0x6E); | |
| 4371 emit_rm(cbuf, 0x3, $tmp$$reg, $src$$reg); | |
| 4372 } | |
| 4373 { // MOVD $tmp2,$src.hi | |
| 4374 emit_opcode(cbuf,0x66); | |
| 4375 emit_opcode(cbuf,0x0F); | |
| 4376 emit_opcode(cbuf,0x6E); | |
| 4377 emit_rm(cbuf, 0x3, $tmp2$$reg, HIGH_FROM_LOW($src$$reg)); | |
| 4378 } | |
| 4379 { // PUNPCKLDQ $tmp,$tmp2 | |
| 4380 emit_opcode(cbuf,0x66); | |
| 4381 emit_opcode(cbuf,0x0F); | |
| 4382 emit_opcode(cbuf,0x62); | |
| 4383 emit_rm(cbuf, 0x3, $tmp$$reg, $tmp2$$reg); | |
| 4384 } | |
| 4385 cbuf.set_inst_mark(); // Mark start of MOVSD in case $mem has an oop | |
| 4386 { // MOVSD $mem,$tmp ! atomic long store | |
| 4387 emit_opcode(cbuf,0xF2); | |
| 4388 emit_opcode(cbuf,0x0F); | |
| 4389 emit_opcode(cbuf,0x11); | |
| 4390 int base = $mem$$base; | |
| 4391 int index = $mem$$index; | |
| 4392 int scale = $mem$$scale; | |
| 4393 int displace = $mem$$disp; | |
| 4394 bool disp_is_oop = $mem->disp_is_oop(); // disp-as-oop when working with static globals | |
| 4395 encode_RegMem(cbuf, $tmp$$reg, base, index, scale, displace, disp_is_oop); | |
| 4396 } | |
| 4397 %} | |
| 4398 | |
| 4399 // Safepoint Poll. This polls the safepoint page, and causes an | |
| 4400 // exception if it is not readable. Unfortunately, it kills the condition code | |
| 4401 // in the process | |
| 4402 // We current use TESTL [spp],EDI | |
| 4403 // A better choice might be TESTB [spp + pagesize() - CacheLineSize()],0 | |
| 4404 | |
| 4405 enc_class Safepoint_Poll() %{ | |
| 4406 cbuf.relocate(cbuf.inst_mark(), relocInfo::poll_type, 0); | |
| 4407 emit_opcode(cbuf,0x85); | |
| 4408 emit_rm (cbuf, 0x0, 0x7, 0x5); | |
| 4409 emit_d32(cbuf, (intptr_t)os::get_polling_page()); | |
| 4410 %} | |
| 4411 %} | |
| 4412 | |
| 4413 | |
| 4414 //----------FRAME-------------------------------------------------------------- | |
| 4415 // Definition of frame structure and management information. | |
| 4416 // | |
| 4417 // S T A C K L A Y O U T Allocators stack-slot number | |
| 4418 // | (to get allocators register number | |
| 4419 // G Owned by | | v add OptoReg::stack0()) | |
| 4420 // r CALLER | | | |
| 4421 // o | +--------+ pad to even-align allocators stack-slot | |
| 4422 // w V | pad0 | numbers; owned by CALLER | |
| 4423 // t -----------+--------+----> Matcher::_in_arg_limit, unaligned | |
| 4424 // h ^ | in | 5 | |
| 4425 // | | args | 4 Holes in incoming args owned by SELF | |
| 4426 // | | | | 3 | |
| 4427 // | | +--------+ | |
| 4428 // V | | old out| Empty on Intel, window on Sparc | |
| 4429 // | old |preserve| Must be even aligned. | |
| 4430 // | SP-+--------+----> Matcher::_old_SP, even aligned | |
| 4431 // | | in | 3 area for Intel ret address | |
| 4432 // Owned by |preserve| Empty on Sparc. | |
| 4433 // SELF +--------+ | |
| 4434 // | | pad2 | 2 pad to align old SP | |
| 4435 // | +--------+ 1 | |
| 4436 // | | locks | 0 | |
| 4437 // | +--------+----> OptoReg::stack0(), even aligned | |
| 4438 // | | pad1 | 11 pad to align new SP | |
| 4439 // | +--------+ | |
| 4440 // | | | 10 | |
| 4441 // | | spills | 9 spills | |
| 4442 // V | | 8 (pad0 slot for callee) | |
| 4443 // -----------+--------+----> Matcher::_out_arg_limit, unaligned | |
| 4444 // ^ | out | 7 | |
| 4445 // | | args | 6 Holes in outgoing args owned by CALLEE | |
| 4446 // Owned by +--------+ | |
| 4447 // CALLEE | new out| 6 Empty on Intel, window on Sparc | |
| 4448 // | new |preserve| Must be even-aligned. | |
| 4449 // | SP-+--------+----> Matcher::_new_SP, even aligned | |
| 4450 // | | | | |
| 4451 // | |
| 4452 // Note 1: Only region 8-11 is determined by the allocator. Region 0-5 is | |
| 4453 // known from SELF's arguments and the Java calling convention. | |
| 4454 // Region 6-7 is determined per call site. | |
| 4455 // Note 2: If the calling convention leaves holes in the incoming argument | |
| 4456 // area, those holes are owned by SELF. Holes in the outgoing area | |
| 4457 // are owned by the CALLEE. Holes should not be nessecary in the | |
| 4458 // incoming area, as the Java calling convention is completely under | |
| 4459 // the control of the AD file. Doubles can be sorted and packed to | |
| 4460 // avoid holes. Holes in the outgoing arguments may be nessecary for | |
| 4461 // varargs C calling conventions. | |
| 4462 // Note 3: Region 0-3 is even aligned, with pad2 as needed. Region 3-5 is | |
| 4463 // even aligned with pad0 as needed. | |
| 4464 // Region 6 is even aligned. Region 6-7 is NOT even aligned; | |
| 4465 // region 6-11 is even aligned; it may be padded out more so that | |
| 4466 // the region from SP to FP meets the minimum stack alignment. | |
| 4467 | |
| 4468 frame %{ | |
| 4469 // What direction does stack grow in (assumed to be same for C & Java) | |
| 4470 stack_direction(TOWARDS_LOW); | |
| 4471 | |
| 4472 // These three registers define part of the calling convention | |
| 4473 // between compiled code and the interpreter. | |
| 4474 inline_cache_reg(EAX); // Inline Cache Register | |
| 4475 interpreter_method_oop_reg(EBX); // Method Oop Register when calling interpreter | |
| 4476 | |
| 4477 // Optional: name the operand used by cisc-spilling to access [stack_pointer + offset] | |
| 4478 cisc_spilling_operand_name(indOffset32); | |
| 4479 | |
| 4480 // Number of stack slots consumed by locking an object | |
| 4481 sync_stack_slots(1); | |
| 4482 | |
| 4483 // Compiled code's Frame Pointer | |
| 4484 frame_pointer(ESP); | |
| 4485 // Interpreter stores its frame pointer in a register which is | |
| 4486 // stored to the stack by I2CAdaptors. | |
| 4487 // I2CAdaptors convert from interpreted java to compiled java. | |
| 4488 interpreter_frame_pointer(EBP); | |
| 4489 | |
| 4490 // Stack alignment requirement | |
| 4491 // Alignment size in bytes (128-bit -> 16 bytes) | |
| 4492 stack_alignment(StackAlignmentInBytes); | |
| 4493 | |
| 4494 // Number of stack slots between incoming argument block and the start of | |
| 4495 // a new frame. The PROLOG must add this many slots to the stack. The | |
| 4496 // EPILOG must remove this many slots. Intel needs one slot for | |
| 4497 // return address and one for rbp, (must save rbp) | |
| 4498 in_preserve_stack_slots(2+VerifyStackAtCalls); | |
| 4499 | |
| 4500 // Number of outgoing stack slots killed above the out_preserve_stack_slots | |
| 4501 // for calls to C. Supports the var-args backing area for register parms. | |
| 4502 varargs_C_out_slots_killed(0); | |
| 4503 | |
| 4504 // The after-PROLOG location of the return address. Location of | |
| 4505 // return address specifies a type (REG or STACK) and a number | |
| 4506 // representing the register number (i.e. - use a register name) or | |
| 4507 // stack slot. | |
| 4508 // Ret Addr is on stack in slot 0 if no locks or verification or alignment. | |
| 4509 // Otherwise, it is above the locks and verification slot and alignment word | |
| 4510 return_addr(STACK - 1 + | |
| 4511 round_to(1+VerifyStackAtCalls+ | |
| 4512 Compile::current()->fixed_slots(), | |
| 4513 (StackAlignmentInBytes/wordSize))); | |
| 4514 | |
| 4515 // Body of function which returns an integer array locating | |
| 4516 // arguments either in registers or in stack slots. Passed an array | |
| 4517 // of ideal registers called "sig" and a "length" count. Stack-slot | |
| 4518 // offsets are based on outgoing arguments, i.e. a CALLER setting up | |
| 4519 // arguments for a CALLEE. Incoming stack arguments are | |
| 4520 // automatically biased by the preserve_stack_slots field above. | |
| 4521 calling_convention %{ | |
| 4522 // No difference between ingoing/outgoing just pass false | |
| 4523 SharedRuntime::java_calling_convention(sig_bt, regs, length, false); | |
| 4524 %} | |
| 4525 | |
| 4526 | |
| 4527 // Body of function which returns an integer array locating | |
| 4528 // arguments either in registers or in stack slots. Passed an array | |
| 4529 // of ideal registers called "sig" and a "length" count. Stack-slot | |
| 4530 // offsets are based on outgoing arguments, i.e. a CALLER setting up | |
| 4531 // arguments for a CALLEE. Incoming stack arguments are | |
| 4532 // automatically biased by the preserve_stack_slots field above. | |
| 4533 c_calling_convention %{ | |
| 4534 // This is obviously always outgoing | |
| 4535 (void) SharedRuntime::c_calling_convention(sig_bt, regs, length); | |
| 4536 %} | |
| 4537 | |
| 4538 // Location of C & interpreter return values | |
| 4539 c_return_value %{ | |
| 4540 assert( ideal_reg >= Op_RegI && ideal_reg <= Op_RegL, "only return normal values" ); | |
|
113
ba764ed4b6f2
6420645: Create a vm that uses compressed oops for up to 32gb heapsizes
coleenp
parents:
71
diff
changeset
|
4541 static int lo[Op_RegL+1] = { 0, 0, OptoReg::Bad, EAX_num, EAX_num, FPR1L_num, FPR1L_num, EAX_num }; |
|
ba764ed4b6f2
6420645: Create a vm that uses compressed oops for up to 32gb heapsizes
coleenp
parents:
71
diff
changeset
|
4542 static int hi[Op_RegL+1] = { 0, 0, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, FPR1H_num, EDX_num }; |
| 0 | 4543 |
| 4544 // in SSE2+ mode we want to keep the FPU stack clean so pretend | |
| 4545 // that C functions return float and double results in XMM0. | |
| 4546 if( ideal_reg == Op_RegD && UseSSE>=2 ) | |
| 4547 return OptoRegPair(XMM0b_num,XMM0a_num); | |
| 4548 if( ideal_reg == Op_RegF && UseSSE>=2 ) | |
| 4549 return OptoRegPair(OptoReg::Bad,XMM0a_num); | |
| 4550 | |
| 4551 return OptoRegPair(hi[ideal_reg],lo[ideal_reg]); | |
| 4552 %} | |
| 4553 | |
| 4554 // Location of return values | |
| 4555 return_value %{ | |
| 4556 assert( ideal_reg >= Op_RegI && ideal_reg <= Op_RegL, "only return normal values" ); | |
|
113
ba764ed4b6f2
6420645: Create a vm that uses compressed oops for up to 32gb heapsizes
coleenp
parents:
71
diff
changeset
|
4557 static int lo[Op_RegL+1] = { 0, 0, OptoReg::Bad, EAX_num, EAX_num, FPR1L_num, FPR1L_num, EAX_num }; |
|
ba764ed4b6f2
6420645: Create a vm that uses compressed oops for up to 32gb heapsizes
coleenp
parents:
71
diff
changeset
|
4558 static int hi[Op_RegL+1] = { 0, 0, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, OptoReg::Bad, FPR1H_num, EDX_num }; |
| 0 | 4559 if( ideal_reg == Op_RegD && UseSSE>=2 ) |
| 4560 return OptoRegPair(XMM0b_num,XMM0a_num); | |
| 4561 if( ideal_reg == Op_RegF && UseSSE>=1 ) | |
| 4562 return OptoRegPair(OptoReg::Bad,XMM0a_num); | |
| 4563 return OptoRegPair(hi[ideal_reg],lo[ideal_reg]); | |
| 4564 %} | |
| 4565 | |
| 4566 %} | |
| 4567 | |
| 4568 //----------ATTRIBUTES--------------------------------------------------------- | |
| 4569 //----------Operand Attributes------------------------------------------------- | |
| 4570 op_attrib op_cost(0); // Required cost attribute | |
| 4571 | |
| 4572 //----------Instruction Attributes--------------------------------------------- | |
| 4573 ins_attrib ins_cost(100); // Required cost attribute | |
| 4574 ins_attrib ins_size(8); // Required size attribute (in bits) | |
| 4575 ins_attrib ins_pc_relative(0); // Required PC Relative flag | |
| 4576 ins_attrib ins_short_branch(0); // Required flag: is this instruction a | |
| 4577 // non-matching short branch variant of some | |
| 4578 // long branch? | |
| 4579 ins_attrib ins_alignment(1); // Required alignment attribute (must be a power of 2) | |
| 4580 // specifies the alignment that some part of the instruction (not | |
| 4581 // necessarily the start) requires. If > 1, a compute_padding() | |
| 4582 // function must be provided for the instruction | |
| 4583 | |
| 4584 //----------OPERANDS----------------------------------------------------------- | |
| 4585 // Operand definitions must precede instruction definitions for correct parsing | |
| 4586 // in the ADLC because operands constitute user defined types which are used in | |
| 4587 // instruction definitions. | |
| 4588 | |
| 4589 //----------Simple Operands---------------------------------------------------- | |
| 4590 // Immediate Operands | |
| 4591 // Integer Immediate | |
| 4592 operand immI() %{ | |
| 4593 match(ConI); | |
| 4594 | |
| 4595 op_cost(10); | |
| 4596 format %{ %} | |
| 4597 interface(CONST_INTER); | |
| 4598 %} | |
| 4599 | |
| 4600 // Constant for test vs zero | |
| 4601 operand immI0() %{ | |
| 4602 predicate(n->get_int() == 0); | |
| 4603 match(ConI); | |
| 4604 | |
| 4605 op_cost(0); | |
| 4606 format %{ %} | |
| 4607 interface(CONST_INTER); | |
| 4608 %} | |
| 4609 | |
| 4610 // Constant for increment | |
| 4611 operand immI1() %{ | |
| 4612 predicate(n->get_int() == 1); | |
| 4613 match(ConI); | |
| 4614 | |
| 4615 op_cost(0); | |
| 4616 format %{ %} | |
| 4617 interface(CONST_INTER); | |
| 4618 %} | |
| 4619 | |
| 4620 // Constant for decrement | |
| 4621 operand immI_M1() %{ | |
| 4622 predicate(n->get_int() == -1); | |
| 4623 match(ConI); | |
| 4624 | |
| 4625 op_cost(0); | |
| 4626 format %{ %} | |
| 4627 interface(CONST_INTER); | |
| 4628 %} | |
| 4629 | |
| 4630 // Valid scale values for addressing modes | |
| 4631 operand immI2() %{ | |
| 4632 predicate(0 <= n->get_int() && (n->get_int() <= 3)); | |
| 4633 match(ConI); | |
| 4634 | |
| 4635 format %{ %} | |
| 4636 interface(CONST_INTER); | |
| 4637 %} | |
| 4638 | |
| 4639 operand immI8() %{ | |
| 4640 predicate((-128 <= n->get_int()) && (n->get_int() <= 127)); | |
| 4641 match(ConI); | |
| 4642 | |
| 4643 op_cost(5); | |
| 4644 format %{ %} | |
| 4645 interface(CONST_INTER); | |
| 4646 %} | |
| 4647 | |
| 4648 operand immI16() %{ | |
| 4649 predicate((-32768 <= n->get_int()) && (n->get_int() <= 32767)); | |
| 4650 match(ConI); | |
| 4651 | |
| 4652 op_cost(10); | |
| 4653 format %{ %} | |
| 4654 interface(CONST_INTER); | |
| 4655 %} | |
| 4656 | |
| 4657 // Constant for long shifts | |
| 4658 operand immI_32() %{ | |
| 4659 predicate( n->get_int() == 32 ); | |
| 4660 match(ConI); | |
| 4661 | |
| 4662 op_cost(0); | |
| 4663 format %{ %} | |
| 4664 interface(CONST_INTER); | |
| 4665 %} | |
| 4666 | |
| 4667 operand immI_1_31() %{ | |
| 4668 predicate( n->get_int() >= 1 && n->get_int() <= 31 ); | |
| 4669 match(ConI); | |
| 4670 | |
| 4671 op_cost(0); | |
| 4672 format %{ %} | |
| 4673 interface(CONST_INTER); | |
| 4674 %} | |
| 4675 | |
| 4676 operand immI_32_63() %{ | |
| 4677 predicate( n->get_int() >= 32 && n->get_int() <= 63 ); | |
| 4678 match(ConI); | |
| 4679 op_cost(0); | |
| 4680 | |
| 4681 format %{ %} | |
| 4682 interface(CONST_INTER); | |
| 4683 %} | |
| 4684 | |
| 4685 // Pointer Immediate | |
| 4686 operand immP() %{ | |
| 4687 match(ConP); | |
| 4688 | |
| 4689 op_cost(10); | |
| 4690 format %{ %} | |
| 4691 interface(CONST_INTER); | |
| 4692 %} | |
| 4693 | |
| 4694 // NULL Pointer Immediate | |
| 4695 operand immP0() %{ | |
| 4696 predicate( n->get_ptr() == 0 ); | |
| 4697 match(ConP); | |
| 4698 op_cost(0); | |
| 4699 | |
| 4700 format %{ %} | |
| 4701 interface(CONST_INTER); | |
| 4702 %} | |
| 4703 | |
| 4704 // Long Immediate | |
| 4705 operand immL() %{ | |
| 4706 match(ConL); | |
| 4707 | |
| 4708 op_cost(20); | |
| 4709 format %{ %} | |
| 4710 interface(CONST_INTER); | |
| 4711 %} | |
| 4712 | |
| 4713 // Long Immediate zero | |
| 4714 operand immL0() %{ | |
| 4715 predicate( n->get_long() == 0L ); | |
| 4716 match(ConL); | |
| 4717 op_cost(0); | |
| 4718 | |
| 4719 format %{ %} | |
| 4720 interface(CONST_INTER); | |
| 4721 %} | |
| 4722 | |
| 4723 // Long immediate from 0 to 127. | |
| 4724 // Used for a shorter form of long mul by 10. | |
| 4725 operand immL_127() %{ | |
| 4726 predicate((0 <= n->get_long()) && (n->get_long() <= 127)); | |
| 4727 match(ConL); | |
| 4728 op_cost(0); | |
| 4729 | |
| 4730 format %{ %} | |
| 4731 interface(CONST_INTER); | |
| 4732 %} | |
| 4733 | |
| 4734 // Long Immediate: low 32-bit mask | |
| 4735 operand immL_32bits() %{ | |
| 4736 predicate(n->get_long() == 0xFFFFFFFFL); | |
| 4737 match(ConL); | |
| 4738 op_cost(0); | |
| 4739 | |
| 4740 format %{ %} | |
| 4741 interface(CONST_INTER); | |
| 4742 %} | |
| 4743 | |
| 4744 // Long Immediate: low 32-bit mask | |
| 4745 operand immL32() %{ | |
| 4746 predicate(n->get_long() == (int)(n->get_long())); | |
| 4747 match(ConL); | |
| 4748 op_cost(20); | |
| 4749 | |
| 4750 format %{ %} | |
| 4751 interface(CONST_INTER); | |
| 4752 %} | |
| 4753 | |
| 4754 //Double Immediate zero | |
| 4755 operand immD0() %{ | |
| 4756 // Do additional (and counter-intuitive) test against NaN to work around VC++ | |
| 4757 // bug that generates code such that NaNs compare equal to 0.0 | |
| 4758 predicate( UseSSE<=1 && n->getd() == 0.0 && !g_isnan(n->getd()) ); | |
| 4759 match(ConD); | |
| 4760 | |
| 4761 op_cost(5); | |
| 4762 format %{ %} | |
| 4763 interface(CONST_INTER); | |
| 4764 %} | |
| 4765 | |
| 4766 // Double Immediate | |
| 4767 operand immD1() %{ | |
| 4768 predicate( UseSSE<=1 && n->getd() == 1.0 ); | |
| 4769 match(ConD); | |
| 4770 | |
| 4771 op_cost(5); | |
| 4772 format %{ %} | |
| 4773 interface(CONST_INTER); | |
| 4774 %} | |
| 4775 | |
| 4776 // Double Immediate | |
| 4777 operand immD() %{ | |
| 4778 predicate(UseSSE<=1); | |
| 4779 match(ConD); | |
| 4780 | |
| 4781 op_cost(5); | |
| 4782 format %{ %} | |
| 4783 interface(CONST_INTER); | |
| 4784 %} | |
| 4785 | |
| 4786 operand immXD() %{ | |
| 4787 predicate(UseSSE>=2); | |
| 4788 match(ConD); | |
| 4789 | |
| 4790 op_cost(5); | |
| 4791 format %{ %} | |
| 4792 interface(CONST_INTER); | |
| 4793 %} | |
| 4794 | |
| 4795 // Double Immediate zero | |
| 4796 operand immXD0() %{ | |
| 4797 // Do additional (and counter-intuitive) test against NaN to work around VC++ | |
| 4798 // bug that generates code such that NaNs compare equal to 0.0 AND do not | |
| 4799 // compare equal to -0.0. | |
| 4800 predicate( UseSSE>=2 && jlong_cast(n->getd()) == 0 ); | |
| 4801 match(ConD); | |
| 4802 | |
| 4803 format %{ %} | |
| 4804 interface(CONST_INTER); | |
| 4805 %} | |
| 4806 | |
| 4807 // Float Immediate zero | |
| 4808 operand immF0() %{ | |
| 4809 predicate( UseSSE == 0 && n->getf() == 0.0 ); | |
| 4810 match(ConF); | |
| 4811 | |
| 4812 op_cost(5); | |
| 4813 format %{ %} | |
| 4814 interface(CONST_INTER); | |
| 4815 %} | |
| 4816 | |
| 4817 // Float Immediate | |
| 4818 operand immF() %{ | |
| 4819 predicate( UseSSE == 0 ); | |
| 4820 match(ConF); | |
| 4821 | |
| 4822 op_cost(5); | |
| 4823 format %{ %} | |
| 4824 interface(CONST_INTER); | |
| 4825 %} | |
| 4826 | |
| 4827 // Float Immediate | |
| 4828 operand immXF() %{ | |
| 4829 predicate(UseSSE >= 1); | |
| 4830 match(ConF); | |
| 4831 | |
| 4832 op_cost(5); | |
| 4833 format %{ %} | |
| 4834 interface(CONST_INTER); | |
| 4835 %} | |
| 4836 | |
| 4837 // Float Immediate zero. Zero and not -0.0 | |
| 4838 operand immXF0() %{ | |
| 4839 predicate( UseSSE >= 1 && jint_cast(n->getf()) == 0 ); | |
| 4840 match(ConF); | |
| 4841 | |
| 4842 op_cost(5); | |
| 4843 format %{ %} | |
| 4844 interface(CONST_INTER); | |
| 4845 %} | |
| 4846 | |
| 4847 // Immediates for special shifts (sign extend) | |
| 4848 | |
| 4849 // Constants for increment | |
| 4850 operand immI_16() %{ | |
| 4851 predicate( n->get_int() == 16 ); | |
| 4852 match(ConI); | |
| 4853 | |
| 4854 format %{ %} | |
| 4855 interface(CONST_INTER); | |
| 4856 %} | |
| 4857 | |
| 4858 operand immI_24() %{ | |
| 4859 predicate( n->get_int() == 24 ); | |
| 4860 match(ConI); | |
| 4861 | |
| 4862 format %{ %} | |
| 4863 interface(CONST_INTER); | |
| 4864 %} | |
| 4865 | |
| 4866 // Constant for byte-wide masking | |
| 4867 operand immI_255() %{ | |
| 4868 predicate( n->get_int() == 255 ); | |
| 4869 match(ConI); | |
| 4870 | |
| 4871 format %{ %} | |
| 4872 interface(CONST_INTER); | |
| 4873 %} | |
| 4874 | |
| 4875 // Register Operands | |
| 4876 // Integer Register | |
| 4877 operand eRegI() %{ | |
| 4878 constraint(ALLOC_IN_RC(e_reg)); | |
| 4879 match(RegI); | |
| 4880 match(xRegI); | |
| 4881 match(eAXRegI); | |
| 4882 match(eBXRegI); | |
| 4883 match(eCXRegI); | |
| 4884 match(eDXRegI); | |
| 4885 match(eDIRegI); | |
| 4886 match(eSIRegI); | |
| 4887 | |
| 4888 format %{ %} | |
| 4889 interface(REG_INTER); | |
| 4890 %} | |
| 4891 | |
| 4892 // Subset of Integer Register | |
| 4893 operand xRegI(eRegI reg) %{ | |
| 4894 constraint(ALLOC_IN_RC(x_reg)); | |
| 4895 match(reg); | |
| 4896 match(eAXRegI); | |
| 4897 match(eBXRegI); | |
| 4898 match(eCXRegI); | |
| 4899 match(eDXRegI); | |
| 4900 | |
| 4901 format %{ %} | |
| 4902 interface(REG_INTER); | |
| 4903 %} | |
| 4904 | |
| 4905 // Special Registers | |
| 4906 operand eAXRegI(xRegI reg) %{ | |
| 4907 constraint(ALLOC_IN_RC(eax_reg)); | |
| 4908 match(reg); | |
| 4909 match(eRegI); | |
| 4910 | |
| 4911 format %{ "EAX" %} | |
| 4912 interface(REG_INTER); | |
| 4913 %} | |
| 4914 | |
| 4915 // Special Registers | |
| 4916 operand eBXRegI(xRegI reg) %{ | |
| 4917 constraint(ALLOC_IN_RC(ebx_reg)); | |
| 4918 match(reg); | |
| 4919 match(eRegI); | |
| 4920 | |
| 4921 format %{ "EBX" %} | |
| 4922 interface(REG_INTER); | |
| 4923 %} | |
| 4924 | |
| 4925 operand eCXRegI(xRegI reg) %{ | |
| 4926 constraint(ALLOC_IN_RC(ecx_reg)); | |
| 4927 match(reg); | |
| 4928 match(eRegI); | |
| 4929 | |
| 4930 format %{ "ECX" %} | |
| 4931 interface(REG_INTER); | |
| 4932 %} | |
| 4933 | |
| 4934 operand eDXRegI(xRegI reg) %{ | |
| 4935 constraint(ALLOC_IN_RC(edx_reg)); | |
| 4936 match(reg); | |
| 4937 match(eRegI); | |
| 4938 | |
| 4939 format %{ "EDX" %} | |
| 4940 interface(REG_INTER); | |
| 4941 %} | |
| 4942 | |
| 4943 operand eDIRegI(xRegI reg) %{ | |
| 4944 constraint(ALLOC_IN_RC(edi_reg)); | |
| 4945 match(reg); | |
| 4946 match(eRegI); | |
| 4947 | |
| 4948 format %{ "EDI" %} | |
| 4949 interface(REG_INTER); | |
| 4950 %} | |
| 4951 | |
| 4952 operand naxRegI() %{ | |
| 4953 constraint(ALLOC_IN_RC(nax_reg)); | |
| 4954 match(RegI); | |
| 4955 match(eCXRegI); | |
| 4956 match(eDXRegI); | |
| 4957 match(eSIRegI); | |
| 4958 match(eDIRegI); | |
| 4959 | |
| 4960 format %{ %} | |
| 4961 interface(REG_INTER); | |
| 4962 %} | |
| 4963 | |
| 4964 operand nadxRegI() %{ | |
| 4965 constraint(ALLOC_IN_RC(nadx_reg)); | |
| 4966 match(RegI); | |
| 4967 match(eBXRegI); | |
| 4968 match(eCXRegI); | |
| 4969 match(eSIRegI); | |
| 4970 match(eDIRegI); | |
| 4971 | |
| 4972 format %{ %} | |
| 4973 interface(REG_INTER); | |
| 4974 %} | |
| 4975 | |
| 4976 operand ncxRegI() %{ | |
| 4977 constraint(ALLOC_IN_RC(ncx_reg)); | |
| 4978 match(RegI); | |
| 4979 match(eAXRegI); | |
| 4980 match(eDXRegI); | |
| 4981 match(eSIRegI); | |
| 4982 match(eDIRegI); | |
| 4983 | |
| 4984 format %{ %} | |
| 4985 interface(REG_INTER); | |
| 4986 %} | |
| 4987 | |
| 4988 // // This operand was used by cmpFastUnlock, but conflicted with 'object' reg | |
| 4989 // // | |
| 4990 operand eSIRegI(xRegI reg) %{ | |
| 4991 constraint(ALLOC_IN_RC(esi_reg)); | |
| 4992 match(reg); | |
| 4993 match(eRegI); | |
| 4994 | |
| 4995 format %{ "ESI" %} | |
| 4996 interface(REG_INTER); | |
| 4997 %} | |
| 4998 | |
| 4999 // Pointer Register | |
| 5000 operand anyRegP() %{ | |
| 5001 constraint(ALLOC_IN_RC(any_reg)); | |
| 5002 match(RegP); | |
| 5003 match(eAXRegP); | |
| 5004 match(eBXRegP); | |
| 5005 match(eCXRegP); | |
| 5006 match(eDIRegP); | |
| 5007 match(eRegP); | |
| 5008 | |
| 5009 format %{ %} | |
| 5010 interface(REG_INTER); | |
| 5011 %} | |
| 5012 | |
| 5013 operand eRegP() %{ | |
| 5014 constraint(ALLOC_IN_RC(e_reg)); | |
| 5015 match(RegP); | |
| 5016 match(eAXRegP); | |
| 5017 match(eBXRegP); | |
| 5018 match(eCXRegP); | |
| 5019 match(eDIRegP); | |
| 5020 | |
| 5021 format %{ %} | |
| 5022 interface(REG_INTER); | |
| 5023 %} | |
| 5024 | |
| 5025 // On windows95, EBP is not safe to use for implicit null tests. | |
| 5026 operand eRegP_no_EBP() %{ | |
| 5027 constraint(ALLOC_IN_RC(e_reg_no_rbp)); | |
| 5028 match(RegP); | |
| 5029 match(eAXRegP); | |
| 5030 match(eBXRegP); | |
| 5031 match(eCXRegP); | |
| 5032 match(eDIRegP); | |
| 5033 | |
| 5034 op_cost(100); | |
| 5035 format %{ %} | |
| 5036 interface(REG_INTER); | |
| 5037 %} | |
| 5038 | |
| 5039 operand naxRegP() %{ | |
| 5040 constraint(ALLOC_IN_RC(nax_reg)); | |
| 5041 match(RegP); | |
| 5042 match(eBXRegP); | |
| 5043 match(eDXRegP); | |
| 5044 match(eCXRegP); | |
| 5045 match(eSIRegP); | |
| 5046 match(eDIRegP); | |
| 5047 | |
| 5048 format %{ %} | |
| 5049 interface(REG_INTER); | |
| 5050 %} | |
| 5051 | |
| 5052 operand nabxRegP() %{ | |
| 5053 constraint(ALLOC_IN_RC(nabx_reg)); | |
| 5054 match(RegP); | |
| 5055 match(eCXRegP); | |
| 5056 match(eDXRegP); | |
| 5057 match(eSIRegP); | |
| 5058 match(eDIRegP); | |
| 5059 | |
| 5060 format %{ %} | |
| 5061 interface(REG_INTER); | |
| 5062 %} | |
| 5063 | |
| 5064 operand pRegP() %{ | |
| 5065 constraint(ALLOC_IN_RC(p_reg)); | |
| 5066 match(RegP); | |
| 5067 match(eBXRegP); | |
| 5068 match(eDXRegP); | |
| 5069 match(eSIRegP); | |
| 5070 match(eDIRegP); | |
| 5071 | |
| 5072 format %{ %} | |
| 5073 interface(REG_INTER); | |
| 5074 %} | |
| 5075 | |
| 5076 // Special Registers | |
| 5077 // Return a pointer value | |
| 5078 operand eAXRegP(eRegP reg) %{ | |
| 5079 constraint(ALLOC_IN_RC(eax_reg)); | |
| 5080 match(reg); | |
| 5081 format %{ "EAX" %} | |
| 5082 interface(REG_INTER); | |
| 5083 %} | |
| 5084 | |
| 5085 // Used in AtomicAdd | |
| 5086 operand eBXRegP(eRegP reg) %{ | |
| 5087 constraint(ALLOC_IN_RC(ebx_reg)); | |
| 5088 match(reg); | |
| 5089 format %{ "EBX" %} | |
| 5090 interface(REG_INTER); | |
| 5091 %} | |
| 5092 | |
| 5093 // Tail-call (interprocedural jump) to interpreter | |
| 5094 operand eCXRegP(eRegP reg) %{ | |
| 5095 constraint(ALLOC_IN_RC(ecx_reg)); | |
| 5096 match(reg); | |
| 5097 format %{ "ECX" %} | |
| 5098 interface(REG_INTER); | |
| 5099 %} | |
| 5100 | |
| 5101 operand eSIRegP(eRegP reg) %{ | |
| 5102 constraint(ALLOC_IN_RC(esi_reg)); | |
| 5103 match(reg); | |
| 5104 format %{ "ESI" %} | |
| 5105 interface(REG_INTER); | |
| 5106 %} | |
| 5107 | |
| 5108 // Used in rep stosw | |
| 5109 operand eDIRegP(eRegP reg) %{ | |
| 5110 constraint(ALLOC_IN_RC(edi_reg)); | |
| 5111 match(reg); | |
| 5112 format %{ "EDI" %} | |
| 5113 interface(REG_INTER); | |
| 5114 %} | |
| 5115 | |
| 5116 operand eBPRegP() %{ | |
| 5117 constraint(ALLOC_IN_RC(ebp_reg)); | |
| 5118 match(RegP); | |
| 5119 format %{ "EBP" %} | |
| 5120 interface(REG_INTER); | |
| 5121 %} | |
| 5122 | |
| 5123 operand eRegL() %{ | |
| 5124 constraint(ALLOC_IN_RC(long_reg)); | |
| 5125 match(RegL); | |
| 5126 match(eADXRegL); | |
| 5127 | |
| 5128 format %{ %} | |
| 5129 interface(REG_INTER); | |
| 5130 %} | |
| 5131 | |
| 5132 operand eADXRegL( eRegL reg ) %{ | |
| 5133 constraint(ALLOC_IN_RC(eadx_reg)); | |
| 5134 match(reg); | |
| 5135 | |
| 5136 format %{ "EDX:EAX" %} | |
| 5137 interface(REG_INTER); | |
| 5138 %} | |
| 5139 | |
| 5140 operand eBCXRegL( eRegL reg ) %{ | |
| 5141 constraint(ALLOC_IN_RC(ebcx_reg)); | |
| 5142 match(reg); | |
| 5143 | |
| 5144 format %{ "EBX:ECX" %} | |
| 5145 interface(REG_INTER); | |
| 5146 %} | |
| 5147 | |
| 5148 // Special case for integer high multiply | |
| 5149 operand eADXRegL_low_only() %{ | |
| 5150 constraint(ALLOC_IN_RC(eadx_reg)); | |
| 5151 match(RegL); | |
| 5152 | |
| 5153 format %{ "EAX" %} | |
| 5154 interface(REG_INTER); | |
| 5155 %} | |
| 5156 | |
| 5157 // Flags register, used as output of compare instructions | |
| 5158 operand eFlagsReg() %{ | |
| 5159 constraint(ALLOC_IN_RC(int_flags)); | |
| 5160 match(RegFlags); | |
| 5161 | |
| 5162 format %{ "EFLAGS" %} | |
| 5163 interface(REG_INTER); | |
| 5164 %} | |
| 5165 | |
| 5166 // Flags register, used as output of FLOATING POINT compare instructions | |
| 5167 operand eFlagsRegU() %{ | |
| 5168 constraint(ALLOC_IN_RC(int_flags)); | |
| 5169 match(RegFlags); | |
| 5170 | |
| 5171 format %{ "EFLAGS_U" %} | |
| 5172 interface(REG_INTER); | |
| 5173 %} | |
| 5174 | |
| 5175 // Condition Code Register used by long compare | |
| 5176 operand flagsReg_long_LTGE() %{ | |
| 5177 constraint(ALLOC_IN_RC(int_flags)); | |
| 5178 match(RegFlags); | |
| 5179 format %{ "FLAGS_LTGE" %} | |
| 5180 interface(REG_INTER); | |
| 5181 %} | |
| 5182 operand flagsReg_long_EQNE() %{ | |
| 5183 constraint(ALLOC_IN_RC(int_flags)); | |
| 5184 match(RegFlags); | |
| 5185 format %{ "FLAGS_EQNE" %} | |
| 5186 interface(REG_INTER); | |
| 5187 %} | |
| 5188 operand flagsReg_long_LEGT() %{ | |
| 5189 constraint(ALLOC_IN_RC(int_flags)); | |
| 5190 match(RegFlags); | |
| 5191 format %{ "FLAGS_LEGT" %} | |
| 5192 interface(REG_INTER); | |
| 5193 %} | |
| 5194 | |
| 5195 // Float register operands | |
| 5196 operand regD() %{ | |
| 5197 predicate( UseSSE < 2 ); | |
| 5198 constraint(ALLOC_IN_RC(dbl_reg)); | |
| 5199 match(RegD); | |
| 5200 match(regDPR1); | |
| 5201 match(regDPR2); | |
| 5202 format %{ %} | |
| 5203 interface(REG_INTER); | |
| 5204 %} | |
| 5205 | |
| 5206 operand regDPR1(regD reg) %{ | |
| 5207 predicate( UseSSE < 2 ); | |
| 5208 constraint(ALLOC_IN_RC(dbl_reg0)); | |
| 5209 match(reg); | |
| 5210 format %{ "FPR1" %} | |
| 5211 interface(REG_INTER); | |
| 5212 %} | |
| 5213 | |
| 5214 operand regDPR2(regD reg) %{ | |
| 5215 predicate( UseSSE < 2 ); | |
| 5216 constraint(ALLOC_IN_RC(dbl_reg1)); | |
| 5217 match(reg); | |
| 5218 format %{ "FPR2" %} | |
| 5219 interface(REG_INTER); | |
| 5220 %} | |
| 5221 | |
| 5222 operand regnotDPR1(regD reg) %{ | |
| 5223 predicate( UseSSE < 2 ); | |
| 5224 constraint(ALLOC_IN_RC(dbl_notreg0)); | |
| 5225 match(reg); | |
| 5226 format %{ %} | |
| 5227 interface(REG_INTER); | |
| 5228 %} | |
| 5229 | |
| 5230 // XMM Double register operands | |
| 5231 operand regXD() %{ | |
| 5232 predicate( UseSSE>=2 ); | |
| 5233 constraint(ALLOC_IN_RC(xdb_reg)); | |
| 5234 match(RegD); | |
| 5235 match(regXD6); | |
| 5236 match(regXD7); | |
| 5237 format %{ %} | |
| 5238 interface(REG_INTER); | |
| 5239 %} | |
| 5240 | |
| 5241 // XMM6 double register operands | |
| 5242 operand regXD6(regXD reg) %{ | |
| 5243 predicate( UseSSE>=2 ); | |
| 5244 constraint(ALLOC_IN_RC(xdb_reg6)); | |
| 5245 match(reg); | |
| 5246 format %{ "XMM6" %} | |
| 5247 interface(REG_INTER); | |
| 5248 %} | |
| 5249 | |
| 5250 // XMM7 double register operands | |
| 5251 operand regXD7(regXD reg) %{ | |
| 5252 predicate( UseSSE>=2 ); | |
| 5253 constraint(ALLOC_IN_RC(xdb_reg7)); | |
| 5254 match(reg); | |
| 5255 format %{ "XMM7" %} | |
| 5256 interface(REG_INTER); | |
| 5257 %} | |
| 5258 | |
| 5259 // Float register operands | |
| 5260 operand regF() %{ | |
| 5261 predicate( UseSSE < 2 ); | |
| 5262 constraint(ALLOC_IN_RC(flt_reg)); | |
| 5263 match(RegF); | |
| 5264 match(regFPR1); | |
| 5265 format %{ %} | |
| 5266 interface(REG_INTER); | |
| 5267 %} | |
| 5268 | |
| 5269 // Float register operands | |
| 5270 operand regFPR1(regF reg) %{ | |
| 5271 predicate( UseSSE < 2 ); | |
| 5272 constraint(ALLOC_IN_RC(flt_reg0)); | |
| 5273 match(reg); | |
| 5274 format %{ "FPR1" %} | |
| 5275 interface(REG_INTER); | |
| 5276 %} | |
| 5277 | |
| 5278 // XMM register operands | |
| 5279 operand regX() %{ | |
| 5280 predicate( UseSSE>=1 ); | |
| 5281 constraint(ALLOC_IN_RC(xmm_reg)); | |
| 5282 match(RegF); | |
| 5283 format %{ %} | |
| 5284 interface(REG_INTER); | |
| 5285 %} | |
| 5286 | |
| 5287 | |
| 5288 //----------Memory Operands---------------------------------------------------- | |
| 5289 // Direct Memory Operand | |
| 5290 operand direct(immP addr) %{ | |
| 5291 match(addr); | |
| 5292 | |
| 5293 format %{ "[$addr]" %} | |
| 5294 interface(MEMORY_INTER) %{ | |
| 5295 base(0xFFFFFFFF); | |
| 5296 index(0x4); | |
| 5297 scale(0x0); | |
| 5298 disp($addr); | |
| 5299 %} | |
| 5300 %} | |
| 5301 | |
| 5302 // Indirect Memory Operand | |
| 5303 operand indirect(eRegP reg) %{ | |
| 5304 constraint(ALLOC_IN_RC(e_reg)); | |
| 5305 match(reg); | |
| 5306 | |
| 5307 format %{ "[$reg]" %} | |
| 5308 interface(MEMORY_INTER) %{ | |
| 5309 base($reg); | |
| 5310 index(0x4); | |
| 5311 scale(0x0); | |
| 5312 disp(0x0); | |
| 5313 %} | |
| 5314 %} | |
| 5315 | |
| 5316 // Indirect Memory Plus Short Offset Operand | |
| 5317 operand indOffset8(eRegP reg, immI8 off) %{ | |
| 5318 match(AddP reg off); | |
| 5319 | |
| 5320 format %{ "[$reg + $off]" %} | |
| 5321 interface(MEMORY_INTER) %{ | |
| 5322 base($reg); | |
| 5323 index(0x4); | |
| 5324 scale(0x0); | |
| 5325 disp($off); | |
| 5326 %} | |
| 5327 %} | |
| 5328 | |
| 5329 // Indirect Memory Plus Long Offset Operand | |
| 5330 operand indOffset32(eRegP reg, immI off) %{ | |
| 5331 match(AddP reg off); | |
| 5332 | |
| 5333 format %{ "[$reg + $off]" %} | |
| 5334 interface(MEMORY_INTER) %{ | |
| 5335 base($reg); | |
| 5336 index(0x4); | |
| 5337 scale(0x0); | |
| 5338 disp($off); | |
| 5339 %} | |
| 5340 %} | |
| 5341 | |
| 5342 // Indirect Memory Plus Long Offset Operand | |
| 5343 operand indOffset32X(eRegI reg, immP off) %{ | |
| 5344 match(AddP off reg); | |
| 5345 | |
| 5346 format %{ "[$reg + $off]" %} | |
| 5347 interface(MEMORY_INTER) %{ | |
| 5348 base($reg); | |
| 5349 index(0x4); | |
| 5350 scale(0x0); | |
| 5351 disp($off); | |
| 5352 %} | |
| 5353 %} | |
| 5354 | |
| 5355 // Indirect Memory Plus Index Register Plus Offset Operand | |
| 5356 operand indIndexOffset(eRegP reg, eRegI ireg, immI off) %{ | |
| 5357 match(AddP (AddP reg ireg) off); | |
| 5358 | |
| 5359 op_cost(10); | |
| 5360 format %{"[$reg + $off + $ireg]" %} | |
| 5361 interface(MEMORY_INTER) %{ | |
| 5362 base($reg); | |
| 5363 index($ireg); | |
| 5364 scale(0x0); | |
| 5365 disp($off); | |
| 5366 %} | |
| 5367 %} | |
| 5368 | |
| 5369 // Indirect Memory Plus Index Register Plus Offset Operand | |
| 5370 operand indIndex(eRegP reg, eRegI ireg) %{ | |
| 5371 match(AddP reg ireg); | |
| 5372 | |
| 5373 op_cost(10); | |
| 5374 format %{"[$reg + $ireg]" %} | |
| 5375 interface(MEMORY_INTER) %{ | |
| 5376 base($reg); | |
| 5377 index($ireg); | |
| 5378 scale(0x0); | |
| 5379 disp(0x0); | |
| 5380 %} | |
| 5381 %} | |
| 5382 | |
| 5383 // // ------------------------------------------------------------------------- | |
| 5384 // // 486 architecture doesn't support "scale * index + offset" with out a base | |
| 5385 // // ------------------------------------------------------------------------- | |
| 5386 // // Scaled Memory Operands | |
| 5387 // // Indirect Memory Times Scale Plus Offset Operand | |
| 5388 // operand indScaleOffset(immP off, eRegI ireg, immI2 scale) %{ | |
| 5389 // match(AddP off (LShiftI ireg scale)); | |
| 5390 // | |
| 5391 // op_cost(10); | |
| 5392 // format %{"[$off + $ireg << $scale]" %} | |
| 5393 // interface(MEMORY_INTER) %{ | |
| 5394 // base(0x4); | |
| 5395 // index($ireg); | |
| 5396 // scale($scale); | |
| 5397 // disp($off); | |
| 5398 // %} | |
| 5399 // %} | |
| 5400 | |
| 5401 // Indirect Memory Times Scale Plus Index Register | |
| 5402 operand indIndexScale(eRegP reg, eRegI ireg, immI2 scale) %{ | |
| 5403 match(AddP reg (LShiftI ireg scale)); | |
| 5404 | |
| 5405 op_cost(10); | |
| 5406 format %{"[$reg + $ireg << $scale]" %} | |
| 5407 interface(MEMORY_INTER) %{ | |
| 5408 base($reg); | |
| 5409 index($ireg); | |
| 5410 scale($scale); | |
| 5411 disp(0x0); | |
| 5412 %} | |
| 5413 %} | |
| 5414 | |
| 5415 // Indirect Memory Times Scale Plus Index Register Plus Offset Operand | |
| 5416 operand indIndexScaleOffset(eRegP reg, immI off, eRegI ireg, immI2 scale) %{ | |
| 5417 match(AddP (AddP reg (LShiftI ireg scale)) off); | |
| 5418 | |
| 5419 op_cost(10); | |
| 5420 format %{"[$reg + $off + $ireg << $scale]" %} | |
| 5421 interface(MEMORY_INTER) %{ | |
| 5422 base($reg); | |
| 5423 index($ireg); | |
| 5424 scale($scale); | |
| 5425 disp($off); | |
| 5426 %} | |
| 5427 %} | |
| 5428 | |
| 5429 //----------Load Long Memory Operands------------------------------------------ | |
| 5430 // The load-long idiom will use it's address expression again after loading | |
| 5431 // the first word of the long. If the load-long destination overlaps with | |
| 5432 // registers used in the addressing expression, the 2nd half will be loaded | |
| 5433 // from a clobbered address. Fix this by requiring that load-long use | |
| 5434 // address registers that do not overlap with the load-long target. | |
| 5435 | |
| 5436 // load-long support | |
| 5437 operand load_long_RegP() %{ | |
| 5438 constraint(ALLOC_IN_RC(esi_reg)); | |
| 5439 match(RegP); | |
| 5440 match(eSIRegP); | |
| 5441 op_cost(100); | |
| 5442 format %{ %} | |
| 5443 interface(REG_INTER); | |
| 5444 %} | |
| 5445 | |
| 5446 // Indirect Memory Operand Long | |
| 5447 operand load_long_indirect(load_long_RegP reg) %{ | |
| 5448 constraint(ALLOC_IN_RC(esi_reg)); | |
| 5449 match(reg); | |
| 5450 | |
| 5451 format %{ "[$reg]" %} | |
| 5452 interface(MEMORY_INTER) %{ | |
| 5453 base($reg); | |
| 5454 index(0x4); | |
| 5455 scale(0x0); | |
| 5456 disp(0x0); | |
| 5457 %} | |
| 5458 %} | |
| 5459 | |
| 5460 // Indirect Memory Plus Long Offset Operand | |
| 5461 operand load_long_indOffset32(load_long_RegP reg, immI off) %{ | |
| 5462 match(AddP reg off); | |
| 5463 | |
| 5464 format %{ "[$reg + $off]" %} | |
| 5465 interface(MEMORY_INTER) %{ | |
| 5466 base($reg); | |
| 5467 index(0x4); | |
| 5468 scale(0x0); | |
| 5469 disp($off); | |
| 5470 %} | |
| 5471 %} | |
| 5472 | |
| 5473 opclass load_long_memory(load_long_indirect, load_long_indOffset32); | |
| 5474 | |
| 5475 | |
| 5476 //----------Special Memory Operands-------------------------------------------- | |
| 5477 // Stack Slot Operand - This operand is used for loading and storing temporary | |
| 5478 // values on the stack where a match requires a value to | |
| 5479 // flow through memory. | |
| 5480 operand stackSlotP(sRegP reg) %{ | |
| 5481 constraint(ALLOC_IN_RC(stack_slots)); | |
| 5482 // No match rule because this operand is only generated in matching | |
| 5483 format %{ "[$reg]" %} | |
| 5484 interface(MEMORY_INTER) %{ | |
| 5485 base(0x4); // ESP | |
| 5486 index(0x4); // No Index | |
| 5487 scale(0x0); // No Scale | |
| 5488 disp($reg); // Stack Offset | |
| 5489 %} | |
| 5490 %} | |
| 5491 | |
| 5492 operand stackSlotI(sRegI reg) %{ | |
| 5493 constraint(ALLOC_IN_RC(stack_slots)); | |
| 5494 // No match rule because this operand is only generated in matching | |
| 5495 format %{ "[$reg]" %} | |
| 5496 interface(MEMORY_INTER) %{ | |
| 5497 base(0x4); // ESP | |
| 5498 index(0x4); // No Index | |
| 5499 scale(0x0); // No Scale | |
| 5500 disp($reg); // Stack Offset | |
| 5501 %} | |
| 5502 %} | |
| 5503 | |
| 5504 operand stackSlotF(sRegF reg) %{ | |
| 5505 constraint(ALLOC_IN_RC(stack_slots)); | |
| 5506 // No match rule because this operand is only generated in matching | |
| 5507 format %{ "[$reg]" %} | |
| 5508 interface(MEMORY_INTER) %{ | |
| 5509 base(0x4); // ESP | |
| 5510 index(0x4); // No Index | |
| 5511 scale(0x0); // No Scale | |
| 5512 disp($reg); // Stack Offset | |
| 5513 %} | |
| 5514 %} | |
| 5515 | |
| 5516 operand stackSlotD(sRegD reg) %{ | |
| 5517 constraint(ALLOC_IN_RC(stack_slots)); | |
| 5518 // No match rule because this operand is only generated in matching | |
| 5519 format %{ "[$reg]" %} | |
| 5520 interface(MEMORY_INTER) %{ | |
| 5521 base(0x4); // ESP | |
| 5522 index(0x4); // No Index | |
| 5523 scale(0x0); // No Scale | |
| 5524 disp($reg); // Stack Offset | |
| 5525 %} | |
| 5526 %} | |
| 5527 | |
| 5528 operand stackSlotL(sRegL reg) %{ | |
| 5529 constraint(ALLOC_IN_RC(stack_slots)); | |
| 5530 // No match rule because this operand is only generated in matching | |
| 5531 format %{ "[$reg]" %} | |
| 5532 interface(MEMORY_INTER) %{ | |
| 5533 base(0x4); // ESP | |
| 5534 index(0x4); // No Index | |
| 5535 scale(0x0); // No Scale | |
| 5536 disp($reg); // Stack Offset | |
| 5537 %} | |
| 5538 %} | |
| 5539 | |
| 5540 //----------Memory Operands - Win95 Implicit Null Variants---------------- | |
| 5541 // Indirect Memory Operand | |
| 5542 operand indirect_win95_safe(eRegP_no_EBP reg) | |
| 5543 %{ | |
| 5544 constraint(ALLOC_IN_RC(e_reg)); | |
| 5545 match(reg); | |
| 5546 | |
| 5547 op_cost(100); | |
| 5548 format %{ "[$reg]" %} | |
| 5549 interface(MEMORY_INTER) %{ | |
| 5550 base($reg); | |
| 5551 index(0x4); | |
| 5552 scale(0x0); | |
| 5553 disp(0x0); | |
| 5554 %} | |
| 5555 %} | |
| 5556 | |
| 5557 // Indirect Memory Plus Short Offset Operand | |
| 5558 operand indOffset8_win95_safe(eRegP_no_EBP reg, immI8 off) | |
| 5559 %{ | |
| 5560 match(AddP reg off); | |
| 5561 | |
| 5562 op_cost(100); | |
| 5563 format %{ "[$reg + $off]" %} | |
| 5564 interface(MEMORY_INTER) %{ | |
| 5565 base($reg); | |
| 5566 index(0x4); | |
| 5567 scale(0x0); | |
| 5568 disp($off); | |
| 5569 %} | |
| 5570 %} | |
| 5571 | |
| 5572 // Indirect Memory Plus Long Offset Operand | |
| 5573 operand indOffset32_win95_safe(eRegP_no_EBP reg, immI off) | |
| 5574 %{ | |
| 5575 match(AddP reg off); | |
| 5576 | |
| 5577 op_cost(100); | |
| 5578 format %{ "[$reg + $off]" %} | |
| 5579 interface(MEMORY_INTER) %{ | |
| 5580 base($reg); | |
| 5581 index(0x4); | |
| 5582 scale(0x0); | |
| 5583 disp($off); | |
| 5584 %} | |
| 5585 %} | |
| 5586 | |
| 5587 // Indirect Memory Plus Index Register Plus Offset Operand | |
| 5588 operand indIndexOffset_win95_safe(eRegP_no_EBP reg, eRegI ireg, immI off) | |
| 5589 %{ | |
| 5590 match(AddP (AddP reg ireg) off); | |
| 5591 | |
| 5592 op_cost(100); | |
| 5593 format %{"[$reg + $off + $ireg]" %} | |
| 5594 interface(MEMORY_INTER) %{ | |
| 5595 base($reg); | |
| 5596 index($ireg); | |
| 5597 scale(0x0); | |
| 5598 disp($off); | |
| 5599 %} | |
| 5600 %} | |
| 5601 | |
| 5602 // Indirect Memory Times Scale Plus Index Register | |
| 5603 operand indIndexScale_win95_safe(eRegP_no_EBP reg, eRegI ireg, immI2 scale) | |
| 5604 %{ | |
| 5605 match(AddP reg (LShiftI ireg scale)); | |
| 5606 | |
| 5607 op_cost(100); | |
| 5608 format %{"[$reg + $ireg << $scale]" %} | |
| 5609 interface(MEMORY_INTER) %{ | |
| 5610 base($reg); | |
| 5611 index($ireg); | |
| 5612 scale($scale); | |
| 5613 disp(0x0); | |
| 5614 %} | |
| 5615 %} | |
| 5616 | |
| 5617 // Indirect Memory Times Scale Plus Index Register Plus Offset Operand | |
| 5618 operand indIndexScaleOffset_win95_safe(eRegP_no_EBP reg, immI off, eRegI ireg, immI2 scale) | |
| 5619 %{ | |
| 5620 match(AddP (AddP reg (LShiftI ireg scale)) off); | |
| 5621 | |
| 5622 op_cost(100); | |
| 5623 format %{"[$reg + $off + $ireg << $scale]" %} | |
| 5624 interface(MEMORY_INTER) %{ | |
| 5625 base($reg); | |
| 5626 index($ireg); | |
| 5627 scale($scale); | |
| 5628 disp($off); | |
| 5629 %} | |
| 5630 %} | |
| 5631 | |
| 5632 //----------Conditional Branch Operands---------------------------------------- | |
| 5633 // Comparison Op - This is the operation of the comparison, and is limited to | |
| 5634 // the following set of codes: | |
| 5635 // L (<), LE (<=), G (>), GE (>=), E (==), NE (!=) | |
| 5636 // | |
| 5637 // Other attributes of the comparison, such as unsignedness, are specified | |
| 5638 // by the comparison instruction that sets a condition code flags register. | |
| 5639 // That result is represented by a flags operand whose subtype is appropriate | |
| 5640 // to the unsignedness (etc.) of the comparison. | |
| 5641 // | |
| 5642 // Later, the instruction which matches both the Comparison Op (a Bool) and | |
| 5643 // the flags (produced by the Cmp) specifies the coding of the comparison op | |
| 5644 // by matching a specific subtype of Bool operand below, such as cmpOpU. | |
| 5645 | |
| 5646 // Comparision Code | |
| 5647 operand cmpOp() %{ | |
| 5648 match(Bool); | |
| 5649 | |
| 5650 format %{ "" %} | |
| 5651 interface(COND_INTER) %{ | |
| 5652 equal(0x4); | |
| 5653 not_equal(0x5); | |
| 5654 less(0xC); | |
| 5655 greater_equal(0xD); | |
| 5656 less_equal(0xE); | |
| 5657 greater(0xF); | |
| 5658 %} | |
| 5659 %} | |
| 5660 | |
| 5661 // Comparison Code, unsigned compare. Used by FP also, with | |
| 5662 // C2 (unordered) turned into GT or LT already. The other bits | |
| 5663 // C0 and C3 are turned into Carry & Zero flags. | |
| 5664 operand cmpOpU() %{ | |
| 5665 match(Bool); | |
| 5666 | |
| 5667 format %{ "" %} | |
| 5668 interface(COND_INTER) %{ | |
| 5669 equal(0x4); | |
| 5670 not_equal(0x5); | |
| 5671 less(0x2); | |
| 5672 greater_equal(0x3); | |
| 5673 less_equal(0x6); | |
| 5674 greater(0x7); | |
| 5675 %} | |
| 5676 %} | |
| 5677 | |
| 5678 // Comparison Code for FP conditional move | |
| 5679 operand cmpOp_fcmov() %{ | |
| 5680 match(Bool); | |
| 5681 | |
| 5682 format %{ "" %} | |
| 5683 interface(COND_INTER) %{ | |
| 5684 equal (0x0C8); | |
| 5685 not_equal (0x1C8); | |
| 5686 less (0x0C0); | |
| 5687 greater_equal(0x1C0); | |
| 5688 less_equal (0x0D0); | |
| 5689 greater (0x1D0); | |
| 5690 %} | |
| 5691 %} | |
| 5692 | |
| 5693 // Comparision Code used in long compares | |
| 5694 operand cmpOp_commute() %{ | |
| 5695 match(Bool); | |
| 5696 | |
| 5697 format %{ "" %} | |
| 5698 interface(COND_INTER) %{ | |
| 5699 equal(0x4); | |
| 5700 not_equal(0x5); | |
| 5701 less(0xF); | |
| 5702 greater_equal(0xE); | |
| 5703 less_equal(0xD); | |
| 5704 greater(0xC); | |
| 5705 %} | |
| 5706 %} | |
| 5707 | |
| 5708 //----------OPERAND CLASSES---------------------------------------------------- | |
| 5709 // Operand Classes are groups of operands that are used as to simplify | |
| 5710 // instruction definitions by not requiring the AD writer to specify seperate | |
| 5711 // instructions for every form of operand when the instruction accepts | |
| 5712 // multiple operand types with the same basic encoding and format. The classic | |
| 5713 // case of this is memory operands. | |
| 5714 | |
| 5715 opclass memory(direct, indirect, indOffset8, indOffset32, indOffset32X, indIndexOffset, | |
| 5716 indIndex, indIndexScale, indIndexScaleOffset); | |
| 5717 | |
| 5718 // Long memory operations are encoded in 2 instructions and a +4 offset. | |
| 5719 // This means some kind of offset is always required and you cannot use | |
| 5720 // an oop as the offset (done when working on static globals). | |
| 5721 opclass long_memory(direct, indirect, indOffset8, indOffset32, indIndexOffset, | |
| 5722 indIndex, indIndexScale, indIndexScaleOffset); | |
| 5723 | |
| 5724 | |
| 5725 //----------PIPELINE----------------------------------------------------------- | |
| 5726 // Rules which define the behavior of the target architectures pipeline. | |
| 5727 pipeline %{ | |
| 5728 | |
| 5729 //----------ATTRIBUTES--------------------------------------------------------- | |
| 5730 attributes %{ | |
| 5731 variable_size_instructions; // Fixed size instructions | |
| 5732 max_instructions_per_bundle = 3; // Up to 3 instructions per bundle | |
| 5733 instruction_unit_size = 1; // An instruction is 1 bytes long | |
| 5734 instruction_fetch_unit_size = 16; // The processor fetches one line | |
| 5735 instruction_fetch_units = 1; // of 16 bytes | |
| 5736 | |
| 5737 // List of nop instructions | |
| 5738 nops( MachNop ); | |
| 5739 %} | |
| 5740 | |
| 5741 //----------RESOURCES---------------------------------------------------------- | |
| 5742 // Resources are the functional units available to the machine | |
| 5743 | |
| 5744 // Generic P2/P3 pipeline | |
| 5745 // 3 decoders, only D0 handles big operands; a "bundle" is the limit of | |
| 5746 // 3 instructions decoded per cycle. | |
| 5747 // 2 load/store ops per cycle, 1 branch, 1 FPU, | |
| 5748 // 2 ALU op, only ALU0 handles mul/div instructions. | |
| 5749 resources( D0, D1, D2, DECODE = D0 | D1 | D2, | |
| 5750 MS0, MS1, MEM = MS0 | MS1, | |
| 5751 BR, FPU, | |
| 5752 ALU0, ALU1, ALU = ALU0 | ALU1 ); | |
| 5753 | |
| 5754 //----------PIPELINE DESCRIPTION----------------------------------------------- | |
| 5755 // Pipeline Description specifies the stages in the machine's pipeline | |
| 5756 | |
| 5757 // Generic P2/P3 pipeline | |
| 5758 pipe_desc(S0, S1, S2, S3, S4, S5); | |
| 5759 | |
| 5760 //----------PIPELINE CLASSES--------------------------------------------------- | |
| 5761 // Pipeline Classes describe the stages in which input and output are | |
| 5762 // referenced by the hardware pipeline. | |
| 5763 | |
| 5764 // Naming convention: ialu or fpu | |
| 5765 // Then: _reg | |
| 5766 // Then: _reg if there is a 2nd register | |
| 5767 // Then: _long if it's a pair of instructions implementing a long | |
| 5768 // Then: _fat if it requires the big decoder | |
| 5769 // Or: _mem if it requires the big decoder and a memory unit. | |
| 5770 | |
| 5771 // Integer ALU reg operation | |
| 5772 pipe_class ialu_reg(eRegI dst) %{ | |
| 5773 single_instruction; | |
| 5774 dst : S4(write); | |
| 5775 dst : S3(read); | |
| 5776 DECODE : S0; // any decoder | |
| 5777 ALU : S3; // any alu | |
| 5778 %} | |
| 5779 | |
| 5780 // Long ALU reg operation | |
| 5781 pipe_class ialu_reg_long(eRegL dst) %{ | |
| 5782 instruction_count(2); | |
| 5783 dst : S4(write); | |
| 5784 dst : S3(read); | |
| 5785 DECODE : S0(2); // any 2 decoders | |
| 5786 ALU : S3(2); // both alus | |
| 5787 %} | |
| 5788 | |
| 5789 // Integer ALU reg operation using big decoder | |
| 5790 pipe_class ialu_reg_fat(eRegI dst) %{ | |
| 5791 single_instruction; | |
| 5792 dst : S4(write); | |
| 5793 dst : S3(read); | |
| 5794 D0 : S0; // big decoder only | |
| 5795 ALU : S3; // any alu | |
| 5796 %} | |
| 5797 | |
| 5798 // Long ALU reg operation using big decoder | |
| 5799 pipe_class ialu_reg_long_fat(eRegL dst) %{ | |
| 5800 instruction_count(2); | |
| 5801 dst : S4(write); | |
| 5802 dst : S3(read); | |
| 5803 D0 : S0(2); // big decoder only; twice | |
| 5804 ALU : S3(2); // any 2 alus | |
| 5805 %} | |
| 5806 | |
| 5807 // Integer ALU reg-reg operation | |
| 5808 pipe_class ialu_reg_reg(eRegI dst, eRegI src) %{ | |
| 5809 single_instruction; | |
| 5810 dst : S4(write); | |
| 5811 src : S3(read); | |
| 5812 DECODE : S0; // any decoder | |
| 5813 ALU : S3; // any alu | |
| 5814 %} | |
| 5815 | |
| 5816 // Long ALU reg-reg operation | |
| 5817 pipe_class ialu_reg_reg_long(eRegL dst, eRegL src) %{ | |
| 5818 instruction_count(2); | |
| 5819 dst : S4(write); | |
| 5820 src : S3(read); | |
| 5821 DECODE : S0(2); // any 2 decoders | |
| 5822 ALU : S3(2); // both alus | |
| 5823 %} | |
| 5824 | |
| 5825 // Integer ALU reg-reg operation | |
| 5826 pipe_class ialu_reg_reg_fat(eRegI dst, memory src) %{ | |
| 5827 single_instruction; | |
| 5828 dst : S4(write); | |
| 5829 src : S3(read); | |
| 5830 D0 : S0; // big decoder only | |
| 5831 ALU : S3; // any alu | |
| 5832 %} | |
| 5833 | |
| 5834 // Long ALU reg-reg operation | |
| 5835 pipe_class ialu_reg_reg_long_fat(eRegL dst, eRegL src) %{ | |
| 5836 instruction_count(2); | |
| 5837 dst : S4(write); | |
| 5838 src : S3(read); | |
| 5839 D0 : S0(2); // big decoder only; twice | |
| 5840 ALU : S3(2); // both alus | |
| 5841 %} | |
| 5842 | |
| 5843 // Integer ALU reg-mem operation | |
| 5844 pipe_class ialu_reg_mem(eRegI dst, memory mem) %{ | |
| 5845 single_instruction; | |
| 5846 dst : S5(write); | |
| 5847 mem : S3(read); | |
| 5848 D0 : S0; // big decoder only | |
| 5849 ALU : S4; // any alu | |
| 5850 MEM : S3; // any mem | |
| 5851 %} | |
| 5852 | |
| 5853 // Long ALU reg-mem operation | |
| 5854 pipe_class ialu_reg_long_mem(eRegL dst, load_long_memory mem) %{ | |
| 5855 instruction_count(2); | |
| 5856 dst : S5(write); | |
| 5857 mem : S3(read); | |
| 5858 D0 : S0(2); // big decoder only; twice | |
| 5859 ALU : S4(2); // any 2 alus | |
| 5860 MEM : S3(2); // both mems | |
| 5861 %} | |
| 5862 | |
| 5863 // Integer mem operation (prefetch) | |
| 5864 pipe_class ialu_mem(memory mem) | |
| 5865 %{ | |
| 5866 single_instruction; | |
| 5867 mem : S3(read); | |
| 5868 D0 : S0; // big decoder only | |
| 5869 MEM : S3; // any mem | |
| 5870 %} | |
| 5871 | |
| 5872 // Integer Store to Memory | |
| 5873 pipe_class ialu_mem_reg(memory mem, eRegI src) %{ | |
| 5874 single_instruction; | |
| 5875 mem : S3(read); | |
| 5876 src : S5(read); | |
| 5877 D0 : S0; // big decoder only | |
| 5878 ALU : S4; // any alu | |
| 5879 MEM : S3; | |
| 5880 %} | |
| 5881 | |
| 5882 // Long Store to Memory | |
| 5883 pipe_class ialu_mem_long_reg(memory mem, eRegL src) %{ | |
| 5884 instruction_count(2); | |
| 5885 mem : S3(read); | |
| 5886 src : S5(read); | |
| 5887 D0 : S0(2); // big decoder only; twice | |
| 5888 ALU : S4(2); // any 2 alus | |
| 5889 MEM : S3(2); // Both mems | |
| 5890 %} | |
| 5891 | |
| 5892 // Integer Store to Memory | |
| 5893 pipe_class ialu_mem_imm(memory mem) %{ | |
| 5894 single_instruction; | |
| 5895 mem : S3(read); | |
| 5896 D0 : S0; // big decoder only | |
| 5897 ALU : S4; // any alu | |
| 5898 MEM : S3; | |
| 5899 %} | |
| 5900 | |
| 5901 // Integer ALU0 reg-reg operation | |
| 5902 pipe_class ialu_reg_reg_alu0(eRegI dst, eRegI src) %{ | |
| 5903 single_instruction; | |
| 5904 dst : S4(write); | |
| 5905 src : S3(read); | |
| 5906 D0 : S0; // Big decoder only | |
| 5907 ALU0 : S3; // only alu0 | |
| 5908 %} | |
| 5909 | |
| 5910 // Integer ALU0 reg-mem operation | |
| 5911 pipe_class ialu_reg_mem_alu0(eRegI dst, memory mem) %{ | |
| 5912 single_instruction; | |
| 5913 dst : S5(write); | |
| 5914 mem : S3(read); | |
| 5915 D0 : S0; // big decoder only | |
| 5916 ALU0 : S4; // ALU0 only | |
| 5917 MEM : S3; // any mem | |
| 5918 %} | |
| 5919 | |
| 5920 // Integer ALU reg-reg operation | |
| 5921 pipe_class ialu_cr_reg_reg(eFlagsReg cr, eRegI src1, eRegI src2) %{ | |
| 5922 single_instruction; | |
| 5923 cr : S4(write); | |
| 5924 src1 : S3(read); | |
| 5925 src2 : S3(read); | |
| 5926 DECODE : S0; // any decoder | |
| 5927 ALU : S3; // any alu | |
| 5928 %} | |
| 5929 | |
| 5930 // Integer ALU reg-imm operation | |
| 5931 pipe_class ialu_cr_reg_imm(eFlagsReg cr, eRegI src1) %{ | |
| 5932 single_instruction; | |
| 5933 cr : S4(write); | |
| 5934 src1 : S3(read); | |
| 5935 DECODE : S0; // any decoder | |
| 5936 ALU : S3; // any alu | |
| 5937 %} | |
| 5938 | |
| 5939 // Integer ALU reg-mem operation | |
| 5940 pipe_class ialu_cr_reg_mem(eFlagsReg cr, eRegI src1, memory src2) %{ | |
| 5941 single_instruction; | |
| 5942 cr : S4(write); | |
| 5943 src1 : S3(read); | |
| 5944 src2 : S3(read); | |
| 5945 D0 : S0; // big decoder only | |
| 5946 ALU : S4; // any alu | |
| 5947 MEM : S3; | |
| 5948 %} | |
| 5949 | |
| 5950 // Conditional move reg-reg | |
| 5951 pipe_class pipe_cmplt( eRegI p, eRegI q, eRegI y ) %{ | |
| 5952 instruction_count(4); | |
| 5953 y : S4(read); | |
| 5954 q : S3(read); | |
| 5955 p : S3(read); | |
| 5956 DECODE : S0(4); // any decoder | |
| 5957 %} | |
| 5958 | |
| 5959 // Conditional move reg-reg | |
| 5960 pipe_class pipe_cmov_reg( eRegI dst, eRegI src, eFlagsReg cr ) %{ | |
| 5961 single_instruction; | |
| 5962 dst : S4(write); | |
| 5963 src : S3(read); | |
| 5964 cr : S3(read); | |
| 5965 DECODE : S0; // any decoder | |
| 5966 %} | |
| 5967 | |
| 5968 // Conditional move reg-mem | |
| 5969 pipe_class pipe_cmov_mem( eFlagsReg cr, eRegI dst, memory src) %{ | |
| 5970 single_instruction; | |
| 5971 dst : S4(write); | |
| 5972 src : S3(read); | |
| 5973 cr : S3(read); | |
| 5974 DECODE : S0; // any decoder | |
| 5975 MEM : S3; | |
| 5976 %} | |
| 5977 | |
| 5978 // Conditional move reg-reg long | |
| 5979 pipe_class pipe_cmov_reg_long( eFlagsReg cr, eRegL dst, eRegL src) %{ | |
| 5980 single_instruction; | |
| 5981 dst : S4(write); | |
| 5982 src : S3(read); | |
| 5983 cr : S3(read); | |
| 5984 DECODE : S0(2); // any 2 decoders | |
| 5985 %} | |
| 5986 | |
| 5987 // Conditional move double reg-reg | |
| 5988 pipe_class pipe_cmovD_reg( eFlagsReg cr, regDPR1 dst, regD src) %{ | |
| 5989 single_instruction; | |
| 5990 dst : S4(write); | |
| 5991 src : S3(read); | |
| 5992 cr : S3(read); | |
| 5993 DECODE : S0; // any decoder | |
| 5994 %} | |
| 5995 | |
| 5996 // Float reg-reg operation | |
| 5997 pipe_class fpu_reg(regD dst) %{ | |
| 5998 instruction_count(2); | |
| 5999 dst : S3(read); | |
| 6000 DECODE : S0(2); // any 2 decoders | |
| 6001 FPU : S3; | |
| 6002 %} | |
| 6003 | |
| 6004 // Float reg-reg operation | |
| 6005 pipe_class fpu_reg_reg(regD dst, regD src) %{ | |
| 6006 instruction_count(2); | |
| 6007 dst : S4(write); | |
| 6008 src : S3(read); | |
| 6009 DECODE : S0(2); // any 2 decoders | |
| 6010 FPU : S3; | |
| 6011 %} | |
| 6012 | |
| 6013 // Float reg-reg operation | |
| 6014 pipe_class fpu_reg_reg_reg(regD dst, regD src1, regD src2) %{ | |
| 6015 instruction_count(3); | |
| 6016 dst : S4(write); | |
| 6017 src1 : S3(read); | |
| 6018 src2 : S3(read); | |
| 6019 DECODE : S0(3); // any 3 decoders | |
| 6020 FPU : S3(2); | |
| 6021 %} | |
| 6022 | |
| 6023 // Float reg-reg operation | |
| 6024 pipe_class fpu_reg_reg_reg_reg(regD dst, regD src1, regD src2, regD src3) %{ | |
| 6025 instruction_count(4); | |
| 6026 dst : S4(write); | |
| 6027 src1 : S3(read); | |
| 6028 src2 : S3(read); | |
| 6029 src3 : S3(read); | |
| 6030 DECODE : S0(4); // any 3 decoders | |
| 6031 FPU : S3(2); | |
| 6032 %} | |
| 6033 | |
| 6034 // Float reg-reg operation | |
| 6035 pipe_class fpu_reg_mem_reg_reg(regD dst, memory src1, regD src2, regD src3) %{ | |
| 6036 instruction_count(4); | |
| 6037 dst : S4(write); | |
| 6038 src1 : S3(read); | |
| 6039 src2 : S3(read); | |
| 6040 src3 : S3(read); | |
| 6041 DECODE : S1(3); // any 3 decoders | |
| 6042 D0 : S0; // Big decoder only | |
| 6043 FPU : S3(2); | |
| 6044 MEM : S3; | |
| 6045 %} | |
| 6046 | |
| 6047 // Float reg-mem operation | |
| 6048 pipe_class fpu_reg_mem(regD dst, memory mem) %{ | |
| 6049 instruction_count(2); | |
| 6050 dst : S5(write); | |
| 6051 mem : S3(read); | |
| 6052 D0 : S0; // big decoder only | |
| 6053 DECODE : S1; // any decoder for FPU POP | |
| 6054 FPU : S4; | |
| 6055 MEM : S3; // any mem | |
| 6056 %} | |
| 6057 | |
| 6058 // Float reg-mem operation | |
| 6059 pipe_class fpu_reg_reg_mem(regD dst, regD src1, memory mem) %{ | |
| 6060 instruction_count(3); | |
| 6061 dst : S5(write); | |
| 6062 src1 : S3(read); | |
| 6063 mem : S3(read); | |
| 6064 D0 : S0; // big decoder only | |
| 6065 DECODE : S1(2); // any decoder for FPU POP | |
| 6066 FPU : S4; | |
| 6067 MEM : S3; // any mem | |
| 6068 %} | |
| 6069 | |
| 6070 // Float mem-reg operation | |
| 6071 pipe_class fpu_mem_reg(memory mem, regD src) %{ | |
| 6072 instruction_count(2); | |
| 6073 src : S5(read); | |
| 6074 mem : S3(read); | |
| 6075 DECODE : S0; // any decoder for FPU PUSH | |
| 6076 D0 : S1; // big decoder only | |
| 6077 FPU : S4; | |
| 6078 MEM : S3; // any mem | |
| 6079 %} | |
| 6080 | |
| 6081 pipe_class fpu_mem_reg_reg(memory mem, regD src1, regD src2) %{ | |
| 6082 instruction_count(3); | |
| 6083 src1 : S3(read); | |
| 6084 src2 : S3(read); | |
| 6085 mem : S3(read); | |
| 6086 DECODE : S0(2); // any decoder for FPU PUSH | |
| 6087 D0 : S1; // big decoder only | |
| 6088 FPU : S4; | |
| 6089 MEM : S3; // any mem | |
| 6090 %} | |
| 6091 | |
| 6092 pipe_class fpu_mem_reg_mem(memory mem, regD src1, memory src2) %{ | |
| 6093 instruction_count(3); | |
| 6094 src1 : S3(read); | |
| 6095 src2 : S3(read); | |
| 6096 mem : S4(read); | |
| 6097 DECODE : S0; // any decoder for FPU PUSH | |
| 6098 D0 : S0(2); // big decoder only | |
| 6099 FPU : S4; | |
| 6100 MEM : S3(2); // any mem | |
| 6101 %} | |
| 6102 | |
| 6103 pipe_class fpu_mem_mem(memory dst, memory src1) %{ | |
| 6104 instruction_count(2); | |
| 6105 src1 : S3(read); | |
| 6106 dst : S4(read); | |
| 6107 D0 : S0(2); // big decoder only | |
| 6108 MEM : S3(2); // any mem | |
| 6109 %} | |
| 6110 | |
| 6111 pipe_class fpu_mem_mem_mem(memory dst, memory src1, memory src2) %{ | |
| 6112 instruction_count(3); | |
| 6113 src1 : S3(read); | |
| 6114 src2 : S3(read); | |
| 6115 dst : S4(read); | |
| 6116 D0 : S0(3); // big decoder only | |
| 6117 FPU : S4; | |
| 6118 MEM : S3(3); // any mem | |
| 6119 %} | |
| 6120 | |
| 6121 pipe_class fpu_mem_reg_con(memory mem, regD src1) %{ | |
| 6122 instruction_count(3); | |
| 6123 src1 : S4(read); | |
| 6124 mem : S4(read); | |
| 6125 DECODE : S0; // any decoder for FPU PUSH | |
| 6126 D0 : S0(2); // big decoder only | |
| 6127 FPU : S4; | |
| 6128 MEM : S3(2); // any mem | |
| 6129 %} | |
| 6130 | |
| 6131 // Float load constant | |
| 6132 pipe_class fpu_reg_con(regD dst) %{ | |
| 6133 instruction_count(2); | |
| 6134 dst : S5(write); | |
| 6135 D0 : S0; // big decoder only for the load | |
| 6136 DECODE : S1; // any decoder for FPU POP | |
| 6137 FPU : S4; | |
| 6138 MEM : S3; // any mem | |
| 6139 %} | |
| 6140 | |
| 6141 // Float load constant | |
| 6142 pipe_class fpu_reg_reg_con(regD dst, regD src) %{ | |
| 6143 instruction_count(3); | |
| 6144 dst : S5(write); | |
| 6145 src : S3(read); | |
| 6146 D0 : S0; // big decoder only for the load | |
| 6147 DECODE : S1(2); // any decoder for FPU POP | |
| 6148 FPU : S4; | |
| 6149 MEM : S3; // any mem | |
| 6150 %} | |
| 6151 | |
| 6152 // UnConditional branch | |
| 6153 pipe_class pipe_jmp( label labl ) %{ | |
| 6154 single_instruction; | |
| 6155 BR : S3; | |
| 6156 %} | |
| 6157 | |
| 6158 // Conditional branch | |
| 6159 pipe_class pipe_jcc( cmpOp cmp, eFlagsReg cr, label labl ) %{ | |
| 6160 single_instruction; | |
| 6161 cr : S1(read); | |
| 6162 BR : S3; | |
| 6163 %} | |
| 6164 | |
| 6165 // Allocation idiom | |
| 6166 pipe_class pipe_cmpxchg( eRegP dst, eRegP heap_ptr ) %{ | |
| 6167 instruction_count(1); force_serialization; | |
| 6168 fixed_latency(6); | |
| 6169 heap_ptr : S3(read); | |
| 6170 DECODE : S0(3); | |
| 6171 D0 : S2; | |
| 6172 MEM : S3; | |
| 6173 ALU : S3(2); | |
| 6174 dst : S5(write); | |
| 6175 BR : S5; | |
| 6176 %} | |
| 6177 | |
| 6178 // Generic big/slow expanded idiom | |
| 6179 pipe_class pipe_slow( ) %{ | |
| 6180 instruction_count(10); multiple_bundles; force_serialization; | |
| 6181 fixed_latency(100); | |
| 6182 D0 : S0(2); | |
| 6183 MEM : S3(2); | |
| 6184 %} | |
| 6185 | |
| 6186 // The real do-nothing guy | |
| 6187 pipe_class empty( ) %{ | |
| 6188 instruction_count(0); | |
| 6189 %} | |
| 6190 | |
| 6191 // Define the class for the Nop node | |
| 6192 define %{ | |
| 6193 MachNop = empty; | |
| 6194 %} | |
| 6195 | |
| 6196 %} | |
| 6197 | |
| 6198 //----------INSTRUCTIONS------------------------------------------------------- | |
| 6199 // | |
| 6200 // match -- States which machine-independent subtree may be replaced | |
| 6201 // by this instruction. | |
| 6202 // ins_cost -- The estimated cost of this instruction is used by instruction | |
| 6203 // selection to identify a minimum cost tree of machine | |
| 6204 // instructions that matches a tree of machine-independent | |
| 6205 // instructions. | |
| 6206 // format -- A string providing the disassembly for this instruction. | |
| 6207 // The value of an instruction's operand may be inserted | |
| 6208 // by referring to it with a '$' prefix. | |
| 6209 // opcode -- Three instruction opcodes may be provided. These are referred | |
| 6210 // to within an encode class as $primary, $secondary, and $tertiary | |
| 6211 // respectively. The primary opcode is commonly used to | |
| 6212 // indicate the type of machine instruction, while secondary | |
| 6213 // and tertiary are often used for prefix options or addressing | |
| 6214 // modes. | |
| 6215 // ins_encode -- A list of encode classes with parameters. The encode class | |
| 6216 // name must have been defined in an 'enc_class' specification | |
| 6217 // in the encode section of the architecture description. | |
| 6218 | |
| 6219 //----------BSWAP-Instruction-------------------------------------------------- | |
| 6220 instruct bytes_reverse_int(eRegI dst) %{ | |
| 6221 match(Set dst (ReverseBytesI dst)); | |
| 6222 | |
| 6223 format %{ "BSWAP $dst" %} | |
| 6224 opcode(0x0F, 0xC8); | |
| 6225 ins_encode( OpcP, OpcSReg(dst) ); | |
| 6226 ins_pipe( ialu_reg ); | |
| 6227 %} | |
| 6228 | |
| 6229 instruct bytes_reverse_long(eRegL dst) %{ | |
| 6230 match(Set dst (ReverseBytesL dst)); | |
| 6231 | |
| 6232 format %{ "BSWAP $dst.lo\n\t" | |
| 6233 "BSWAP $dst.hi\n\t" | |
| 6234 "XCHG $dst.lo $dst.hi" %} | |
| 6235 | |
| 6236 ins_cost(125); | |
| 6237 ins_encode( bswap_long_bytes(dst) ); | |
| 6238 ins_pipe( ialu_reg_reg); | |
| 6239 %} | |
| 6240 | |
| 6241 | |
| 6242 //----------Load/Store/Move Instructions--------------------------------------- | |
| 6243 //----------Load Instructions-------------------------------------------------- | |
| 6244 // Load Byte (8bit signed) | |
| 6245 instruct loadB(xRegI dst, memory mem) %{ | |
| 6246 match(Set dst (LoadB mem)); | |
| 6247 | |
| 6248 ins_cost(125); | |
| 6249 format %{ "MOVSX8 $dst,$mem" %} | |
| 6250 opcode(0xBE, 0x0F); | |
| 6251 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
| 6252 ins_pipe( ialu_reg_mem ); | |
| 6253 %} | |
| 6254 | |
| 6255 // Load Byte (8bit UNsigned) | |
| 6256 instruct loadUB(xRegI dst, memory mem, immI_255 bytemask) %{ | |
| 6257 match(Set dst (AndI (LoadB mem) bytemask)); | |
| 6258 | |
| 6259 ins_cost(125); | |
| 6260 format %{ "MOVZX8 $dst,$mem" %} | |
| 6261 opcode(0xB6, 0x0F); | |
| 6262 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
| 6263 ins_pipe( ialu_reg_mem ); | |
| 6264 %} | |
| 6265 | |
| 6266 // Load Char (16bit unsigned) | |
| 6267 instruct loadC(eRegI dst, memory mem) %{ | |
| 6268 match(Set dst (LoadC mem)); | |
| 6269 | |
| 6270 ins_cost(125); | |
| 6271 format %{ "MOVZX $dst,$mem" %} | |
| 6272 opcode(0xB7, 0x0F); | |
| 6273 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
| 6274 ins_pipe( ialu_reg_mem ); | |
| 6275 %} | |
| 6276 | |
| 6277 // Load Integer | |
| 6278 instruct loadI(eRegI dst, memory mem) %{ | |
| 6279 match(Set dst (LoadI mem)); | |
| 6280 | |
| 6281 ins_cost(125); | |
| 6282 format %{ "MOV $dst,$mem" %} | |
| 6283 opcode(0x8B); | |
| 6284 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6285 ins_pipe( ialu_reg_mem ); | |
| 6286 %} | |
| 6287 | |
| 6288 // Load Long. Cannot clobber address while loading, so restrict address | |
| 6289 // register to ESI | |
| 6290 instruct loadL(eRegL dst, load_long_memory mem) %{ | |
| 6291 predicate(!((LoadLNode*)n)->require_atomic_access()); | |
| 6292 match(Set dst (LoadL mem)); | |
| 6293 | |
| 6294 ins_cost(250); | |
| 6295 format %{ "MOV $dst.lo,$mem\n\t" | |
| 6296 "MOV $dst.hi,$mem+4" %} | |
| 6297 opcode(0x8B, 0x8B); | |
| 6298 ins_encode( OpcP, RegMem(dst,mem), OpcS, RegMem_Hi(dst,mem)); | |
| 6299 ins_pipe( ialu_reg_long_mem ); | |
| 6300 %} | |
| 6301 | |
| 6302 // Volatile Load Long. Must be atomic, so do 64-bit FILD | |
| 6303 // then store it down to the stack and reload on the int | |
| 6304 // side. | |
| 6305 instruct loadL_volatile(stackSlotL dst, memory mem) %{ | |
| 6306 predicate(UseSSE<=1 && ((LoadLNode*)n)->require_atomic_access()); | |
| 6307 match(Set dst (LoadL mem)); | |
| 6308 | |
| 6309 ins_cost(200); | |
| 6310 format %{ "FILD $mem\t# Atomic volatile long load\n\t" | |
| 6311 "FISTp $dst" %} | |
| 6312 ins_encode(enc_loadL_volatile(mem,dst)); | |
| 6313 ins_pipe( fpu_reg_mem ); | |
| 6314 %} | |
| 6315 | |
| 6316 instruct loadLX_volatile(stackSlotL dst, memory mem, regXD tmp) %{ | |
| 6317 predicate(UseSSE>=2 && ((LoadLNode*)n)->require_atomic_access()); | |
| 6318 match(Set dst (LoadL mem)); | |
| 6319 effect(TEMP tmp); | |
| 6320 ins_cost(180); | |
| 6321 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
| 6322 "MOVSD $dst,$tmp" %} | |
| 6323 ins_encode(enc_loadLX_volatile(mem, dst, tmp)); | |
| 6324 ins_pipe( pipe_slow ); | |
| 6325 %} | |
| 6326 | |
| 6327 instruct loadLX_reg_volatile(eRegL dst, memory mem, regXD tmp) %{ | |
| 6328 predicate(UseSSE>=2 && ((LoadLNode*)n)->require_atomic_access()); | |
| 6329 match(Set dst (LoadL mem)); | |
| 6330 effect(TEMP tmp); | |
| 6331 ins_cost(160); | |
| 6332 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
| 6333 "MOVD $dst.lo,$tmp\n\t" | |
| 6334 "PSRLQ $tmp,32\n\t" | |
| 6335 "MOVD $dst.hi,$tmp" %} | |
| 6336 ins_encode(enc_loadLX_reg_volatile(mem, dst, tmp)); | |
| 6337 ins_pipe( pipe_slow ); | |
| 6338 %} | |
| 6339 | |
| 6340 // Load Range | |
| 6341 instruct loadRange(eRegI dst, memory mem) %{ | |
| 6342 match(Set dst (LoadRange mem)); | |
| 6343 | |
| 6344 ins_cost(125); | |
| 6345 format %{ "MOV $dst,$mem" %} | |
| 6346 opcode(0x8B); | |
| 6347 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6348 ins_pipe( ialu_reg_mem ); | |
| 6349 %} | |
| 6350 | |
| 6351 | |
| 6352 // Load Pointer | |
| 6353 instruct loadP(eRegP dst, memory mem) %{ | |
| 6354 match(Set dst (LoadP mem)); | |
| 6355 | |
| 6356 ins_cost(125); | |
| 6357 format %{ "MOV $dst,$mem" %} | |
| 6358 opcode(0x8B); | |
| 6359 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6360 ins_pipe( ialu_reg_mem ); | |
| 6361 %} | |
| 6362 | |
| 6363 // Load Klass Pointer | |
| 6364 instruct loadKlass(eRegP dst, memory mem) %{ | |
| 6365 match(Set dst (LoadKlass mem)); | |
| 6366 | |
| 6367 ins_cost(125); | |
| 6368 format %{ "MOV $dst,$mem" %} | |
| 6369 opcode(0x8B); | |
| 6370 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6371 ins_pipe( ialu_reg_mem ); | |
| 6372 %} | |
| 6373 | |
| 6374 // Load Short (16bit signed) | |
| 6375 instruct loadS(eRegI dst, memory mem) %{ | |
| 6376 match(Set dst (LoadS mem)); | |
| 6377 | |
| 6378 ins_cost(125); | |
| 6379 format %{ "MOVSX $dst,$mem" %} | |
| 6380 opcode(0xBF, 0x0F); | |
| 6381 ins_encode( OpcS, OpcP, RegMem(dst,mem)); | |
| 6382 ins_pipe( ialu_reg_mem ); | |
| 6383 %} | |
| 6384 | |
| 6385 // Load Double | |
| 6386 instruct loadD(regD dst, memory mem) %{ | |
| 6387 predicate(UseSSE<=1); | |
| 6388 match(Set dst (LoadD mem)); | |
| 6389 | |
| 6390 ins_cost(150); | |
| 6391 format %{ "FLD_D ST,$mem\n\t" | |
| 6392 "FSTP $dst" %} | |
| 6393 opcode(0xDD); /* DD /0 */ | |
| 6394 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
| 6395 Pop_Reg_D(dst) ); | |
| 6396 ins_pipe( fpu_reg_mem ); | |
| 6397 %} | |
| 6398 | |
| 6399 // Load Double to XMM | |
| 6400 instruct loadXD(regXD dst, memory mem) %{ | |
| 6401 predicate(UseSSE>=2 && UseXmmLoadAndClearUpper); | |
| 6402 match(Set dst (LoadD mem)); | |
| 6403 ins_cost(145); | |
| 6404 format %{ "MOVSD $dst,$mem" %} | |
| 6405 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x10), RegMem(dst,mem)); | |
| 6406 ins_pipe( pipe_slow ); | |
| 6407 %} | |
| 6408 | |
| 6409 instruct loadXD_partial(regXD dst, memory mem) %{ | |
| 6410 predicate(UseSSE>=2 && !UseXmmLoadAndClearUpper); | |
| 6411 match(Set dst (LoadD mem)); | |
| 6412 ins_cost(145); | |
| 6413 format %{ "MOVLPD $dst,$mem" %} | |
| 6414 ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x12), RegMem(dst,mem)); | |
| 6415 ins_pipe( pipe_slow ); | |
| 6416 %} | |
| 6417 | |
| 6418 // Load to XMM register (single-precision floating point) | |
| 6419 // MOVSS instruction | |
| 6420 instruct loadX(regX dst, memory mem) %{ | |
| 6421 predicate(UseSSE>=1); | |
| 6422 match(Set dst (LoadF mem)); | |
| 6423 ins_cost(145); | |
| 6424 format %{ "MOVSS $dst,$mem" %} | |
| 6425 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), RegMem(dst,mem)); | |
| 6426 ins_pipe( pipe_slow ); | |
| 6427 %} | |
| 6428 | |
| 6429 // Load Float | |
| 6430 instruct loadF(regF dst, memory mem) %{ | |
| 6431 predicate(UseSSE==0); | |
| 6432 match(Set dst (LoadF mem)); | |
| 6433 | |
| 6434 ins_cost(150); | |
| 6435 format %{ "FLD_S ST,$mem\n\t" | |
| 6436 "FSTP $dst" %} | |
| 6437 opcode(0xD9); /* D9 /0 */ | |
| 6438 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
| 6439 Pop_Reg_F(dst) ); | |
| 6440 ins_pipe( fpu_reg_mem ); | |
| 6441 %} | |
| 6442 | |
| 6443 // Load Aligned Packed Byte to XMM register | |
| 6444 instruct loadA8B(regXD dst, memory mem) %{ | |
| 6445 predicate(UseSSE>=1); | |
| 6446 match(Set dst (Load8B mem)); | |
| 6447 ins_cost(125); | |
| 6448 format %{ "MOVQ $dst,$mem\t! packed8B" %} | |
| 6449 ins_encode( movq_ld(dst, mem)); | |
| 6450 ins_pipe( pipe_slow ); | |
| 6451 %} | |
| 6452 | |
| 6453 // Load Aligned Packed Short to XMM register | |
| 6454 instruct loadA4S(regXD dst, memory mem) %{ | |
| 6455 predicate(UseSSE>=1); | |
| 6456 match(Set dst (Load4S mem)); | |
| 6457 ins_cost(125); | |
| 6458 format %{ "MOVQ $dst,$mem\t! packed4S" %} | |
| 6459 ins_encode( movq_ld(dst, mem)); | |
| 6460 ins_pipe( pipe_slow ); | |
| 6461 %} | |
| 6462 | |
| 6463 // Load Aligned Packed Char to XMM register | |
| 6464 instruct loadA4C(regXD dst, memory mem) %{ | |
| 6465 predicate(UseSSE>=1); | |
| 6466 match(Set dst (Load4C mem)); | |
| 6467 ins_cost(125); | |
| 6468 format %{ "MOVQ $dst,$mem\t! packed4C" %} | |
| 6469 ins_encode( movq_ld(dst, mem)); | |
| 6470 ins_pipe( pipe_slow ); | |
| 6471 %} | |
| 6472 | |
| 6473 // Load Aligned Packed Integer to XMM register | |
| 6474 instruct load2IU(regXD dst, memory mem) %{ | |
| 6475 predicate(UseSSE>=1); | |
| 6476 match(Set dst (Load2I mem)); | |
| 6477 ins_cost(125); | |
| 6478 format %{ "MOVQ $dst,$mem\t! packed2I" %} | |
| 6479 ins_encode( movq_ld(dst, mem)); | |
| 6480 ins_pipe( pipe_slow ); | |
| 6481 %} | |
| 6482 | |
| 6483 // Load Aligned Packed Single to XMM | |
| 6484 instruct loadA2F(regXD dst, memory mem) %{ | |
| 6485 predicate(UseSSE>=1); | |
| 6486 match(Set dst (Load2F mem)); | |
| 6487 ins_cost(145); | |
| 6488 format %{ "MOVQ $dst,$mem\t! packed2F" %} | |
| 6489 ins_encode( movq_ld(dst, mem)); | |
| 6490 ins_pipe( pipe_slow ); | |
| 6491 %} | |
| 6492 | |
| 6493 // Load Effective Address | |
| 6494 instruct leaP8(eRegP dst, indOffset8 mem) %{ | |
| 6495 match(Set dst mem); | |
| 6496 | |
| 6497 ins_cost(110); | |
| 6498 format %{ "LEA $dst,$mem" %} | |
| 6499 opcode(0x8D); | |
| 6500 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6501 ins_pipe( ialu_reg_reg_fat ); | |
| 6502 %} | |
| 6503 | |
| 6504 instruct leaP32(eRegP dst, indOffset32 mem) %{ | |
| 6505 match(Set dst mem); | |
| 6506 | |
| 6507 ins_cost(110); | |
| 6508 format %{ "LEA $dst,$mem" %} | |
| 6509 opcode(0x8D); | |
| 6510 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6511 ins_pipe( ialu_reg_reg_fat ); | |
| 6512 %} | |
| 6513 | |
| 6514 instruct leaPIdxOff(eRegP dst, indIndexOffset mem) %{ | |
| 6515 match(Set dst mem); | |
| 6516 | |
| 6517 ins_cost(110); | |
| 6518 format %{ "LEA $dst,$mem" %} | |
| 6519 opcode(0x8D); | |
| 6520 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6521 ins_pipe( ialu_reg_reg_fat ); | |
| 6522 %} | |
| 6523 | |
| 6524 instruct leaPIdxScale(eRegP dst, indIndexScale mem) %{ | |
| 6525 match(Set dst mem); | |
| 6526 | |
| 6527 ins_cost(110); | |
| 6528 format %{ "LEA $dst,$mem" %} | |
| 6529 opcode(0x8D); | |
| 6530 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6531 ins_pipe( ialu_reg_reg_fat ); | |
| 6532 %} | |
| 6533 | |
| 6534 instruct leaPIdxScaleOff(eRegP dst, indIndexScaleOffset mem) %{ | |
| 6535 match(Set dst mem); | |
| 6536 | |
| 6537 ins_cost(110); | |
| 6538 format %{ "LEA $dst,$mem" %} | |
| 6539 opcode(0x8D); | |
| 6540 ins_encode( OpcP, RegMem(dst,mem)); | |
| 6541 ins_pipe( ialu_reg_reg_fat ); | |
| 6542 %} | |
| 6543 | |
| 6544 // Load Constant | |
| 6545 instruct loadConI(eRegI dst, immI src) %{ | |
| 6546 match(Set dst src); | |
| 6547 | |
| 6548 format %{ "MOV $dst,$src" %} | |
| 6549 ins_encode( LdImmI(dst, src) ); | |
| 6550 ins_pipe( ialu_reg_fat ); | |
| 6551 %} | |
| 6552 | |
| 6553 // Load Constant zero | |
| 6554 instruct loadConI0(eRegI dst, immI0 src, eFlagsReg cr) %{ | |
| 6555 match(Set dst src); | |
| 6556 effect(KILL cr); | |
| 6557 | |
| 6558 ins_cost(50); | |
| 6559 format %{ "XOR $dst,$dst" %} | |
| 6560 opcode(0x33); /* + rd */ | |
| 6561 ins_encode( OpcP, RegReg( dst, dst ) ); | |
| 6562 ins_pipe( ialu_reg ); | |
| 6563 %} | |
| 6564 | |
| 6565 instruct loadConP(eRegP dst, immP src) %{ | |
| 6566 match(Set dst src); | |
| 6567 | |
| 6568 format %{ "MOV $dst,$src" %} | |
| 6569 opcode(0xB8); /* + rd */ | |
| 6570 ins_encode( LdImmP(dst, src) ); | |
| 6571 ins_pipe( ialu_reg_fat ); | |
| 6572 %} | |
| 6573 | |
| 6574 instruct loadConL(eRegL dst, immL src, eFlagsReg cr) %{ | |
| 6575 match(Set dst src); | |
| 6576 effect(KILL cr); | |
| 6577 ins_cost(200); | |
| 6578 format %{ "MOV $dst.lo,$src.lo\n\t" | |
| 6579 "MOV $dst.hi,$src.hi" %} | |
| 6580 opcode(0xB8); | |
| 6581 ins_encode( LdImmL_Lo(dst, src), LdImmL_Hi(dst, src) ); | |
| 6582 ins_pipe( ialu_reg_long_fat ); | |
| 6583 %} | |
| 6584 | |
| 6585 instruct loadConL0(eRegL dst, immL0 src, eFlagsReg cr) %{ | |
| 6586 match(Set dst src); | |
| 6587 effect(KILL cr); | |
| 6588 ins_cost(150); | |
| 6589 format %{ "XOR $dst.lo,$dst.lo\n\t" | |
| 6590 "XOR $dst.hi,$dst.hi" %} | |
| 6591 opcode(0x33,0x33); | |
| 6592 ins_encode( RegReg_Lo(dst,dst), RegReg_Hi(dst, dst) ); | |
| 6593 ins_pipe( ialu_reg_long ); | |
| 6594 %} | |
| 6595 | |
| 6596 // The instruction usage is guarded by predicate in operand immF(). | |
| 6597 instruct loadConF(regF dst, immF src) %{ | |
| 6598 match(Set dst src); | |
| 6599 ins_cost(125); | |
| 6600 | |
| 6601 format %{ "FLD_S ST,$src\n\t" | |
| 6602 "FSTP $dst" %} | |
| 6603 opcode(0xD9, 0x00); /* D9 /0 */ | |
| 6604 ins_encode(LdImmF(src), Pop_Reg_F(dst) ); | |
| 6605 ins_pipe( fpu_reg_con ); | |
| 6606 %} | |
| 6607 | |
| 6608 // The instruction usage is guarded by predicate in operand immXF(). | |
| 6609 instruct loadConX(regX dst, immXF con) %{ | |
| 6610 match(Set dst con); | |
| 6611 ins_cost(125); | |
| 6612 format %{ "MOVSS $dst,[$con]" %} | |
| 6613 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), LdImmX(dst, con)); | |
| 6614 ins_pipe( pipe_slow ); | |
| 6615 %} | |
| 6616 | |
| 6617 // The instruction usage is guarded by predicate in operand immXF0(). | |
| 6618 instruct loadConX0(regX dst, immXF0 src) %{ | |
| 6619 match(Set dst src); | |
| 6620 ins_cost(100); | |
| 6621 format %{ "XORPS $dst,$dst\t# float 0.0" %} | |
| 6622 ins_encode( Opcode(0x0F), Opcode(0x57), RegReg(dst,dst)); | |
| 6623 ins_pipe( pipe_slow ); | |
| 6624 %} | |
| 6625 | |
| 6626 // The instruction usage is guarded by predicate in operand immD(). | |
| 6627 instruct loadConD(regD dst, immD src) %{ | |
| 6628 match(Set dst src); | |
| 6629 ins_cost(125); | |
| 6630 | |
| 6631 format %{ "FLD_D ST,$src\n\t" | |
| 6632 "FSTP $dst" %} | |
| 6633 ins_encode(LdImmD(src), Pop_Reg_D(dst) ); | |
| 6634 ins_pipe( fpu_reg_con ); | |
| 6635 %} | |
| 6636 | |
| 6637 // The instruction usage is guarded by predicate in operand immXD(). | |
| 6638 instruct loadConXD(regXD dst, immXD con) %{ | |
| 6639 match(Set dst con); | |
| 6640 ins_cost(125); | |
| 6641 format %{ "MOVSD $dst,[$con]" %} | |
| 6642 ins_encode(load_conXD(dst, con)); | |
| 6643 ins_pipe( pipe_slow ); | |
| 6644 %} | |
| 6645 | |
| 6646 // The instruction usage is guarded by predicate in operand immXD0(). | |
| 6647 instruct loadConXD0(regXD dst, immXD0 src) %{ | |
| 6648 match(Set dst src); | |
| 6649 ins_cost(100); | |
| 6650 format %{ "XORPD $dst,$dst\t# double 0.0" %} | |
| 6651 ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x57), RegReg(dst,dst)); | |
| 6652 ins_pipe( pipe_slow ); | |
| 6653 %} | |
| 6654 | |
| 6655 // Load Stack Slot | |
| 6656 instruct loadSSI(eRegI dst, stackSlotI src) %{ | |
| 6657 match(Set dst src); | |
| 6658 ins_cost(125); | |
| 6659 | |
| 6660 format %{ "MOV $dst,$src" %} | |
| 6661 opcode(0x8B); | |
| 6662 ins_encode( OpcP, RegMem(dst,src)); | |
| 6663 ins_pipe( ialu_reg_mem ); | |
| 6664 %} | |
| 6665 | |
| 6666 instruct loadSSL(eRegL dst, stackSlotL src) %{ | |
| 6667 match(Set dst src); | |
| 6668 | |
| 6669 ins_cost(200); | |
| 6670 format %{ "MOV $dst,$src.lo\n\t" | |
| 6671 "MOV $dst+4,$src.hi" %} | |
| 6672 opcode(0x8B, 0x8B); | |
| 6673 ins_encode( OpcP, RegMem( dst, src ), OpcS, RegMem_Hi( dst, src ) ); | |
| 6674 ins_pipe( ialu_mem_long_reg ); | |
| 6675 %} | |
| 6676 | |
| 6677 // Load Stack Slot | |
| 6678 instruct loadSSP(eRegP dst, stackSlotP src) %{ | |
| 6679 match(Set dst src); | |
| 6680 ins_cost(125); | |
| 6681 | |
| 6682 format %{ "MOV $dst,$src" %} | |
| 6683 opcode(0x8B); | |
| 6684 ins_encode( OpcP, RegMem(dst,src)); | |
| 6685 ins_pipe( ialu_reg_mem ); | |
| 6686 %} | |
| 6687 | |
| 6688 // Load Stack Slot | |
| 6689 instruct loadSSF(regF dst, stackSlotF src) %{ | |
| 6690 match(Set dst src); | |
| 6691 ins_cost(125); | |
| 6692 | |
| 6693 format %{ "FLD_S $src\n\t" | |
| 6694 "FSTP $dst" %} | |
| 6695 opcode(0xD9); /* D9 /0, FLD m32real */ | |
| 6696 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
| 6697 Pop_Reg_F(dst) ); | |
| 6698 ins_pipe( fpu_reg_mem ); | |
| 6699 %} | |
| 6700 | |
| 6701 // Load Stack Slot | |
| 6702 instruct loadSSD(regD dst, stackSlotD src) %{ | |
| 6703 match(Set dst src); | |
| 6704 ins_cost(125); | |
| 6705 | |
| 6706 format %{ "FLD_D $src\n\t" | |
| 6707 "FSTP $dst" %} | |
| 6708 opcode(0xDD); /* DD /0, FLD m64real */ | |
| 6709 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
| 6710 Pop_Reg_D(dst) ); | |
| 6711 ins_pipe( fpu_reg_mem ); | |
| 6712 %} | |
| 6713 | |
| 6714 // Prefetch instructions. | |
| 6715 // Must be safe to execute with invalid address (cannot fault). | |
| 6716 | |
| 6717 instruct prefetchr0( memory mem ) %{ | |
| 6718 predicate(UseSSE==0 && !VM_Version::supports_3dnow()); | |
| 6719 match(PrefetchRead mem); | |
| 6720 ins_cost(0); | |
| 6721 size(0); | |
| 6722 format %{ "PREFETCHR (non-SSE is empty encoding)" %} | |
| 6723 ins_encode(); | |
| 6724 ins_pipe(empty); | |
| 6725 %} | |
| 6726 | |
| 6727 instruct prefetchr( memory mem ) %{ | |
| 6728 predicate(UseSSE==0 && VM_Version::supports_3dnow() || ReadPrefetchInstr==3); | |
| 6729 match(PrefetchRead mem); | |
| 6730 ins_cost(100); | |
| 6731 | |
| 6732 format %{ "PREFETCHR $mem\t! Prefetch into level 1 cache for read" %} | |
| 6733 opcode(0x0F, 0x0d); /* Opcode 0F 0d /0 */ | |
| 6734 ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); | |
| 6735 ins_pipe(ialu_mem); | |
| 6736 %} | |
| 6737 | |
| 6738 instruct prefetchrNTA( memory mem ) %{ | |
| 6739 predicate(UseSSE>=1 && ReadPrefetchInstr==0); | |
| 6740 match(PrefetchRead mem); | |
| 6741 ins_cost(100); | |
| 6742 | |
| 6743 format %{ "PREFETCHNTA $mem\t! Prefetch into non-temporal cache for read" %} | |
| 6744 opcode(0x0F, 0x18); /* Opcode 0F 18 /0 */ | |
| 6745 ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); | |
| 6746 ins_pipe(ialu_mem); | |
| 6747 %} | |
| 6748 | |
| 6749 instruct prefetchrT0( memory mem ) %{ | |
| 6750 predicate(UseSSE>=1 && ReadPrefetchInstr==1); | |
| 6751 match(PrefetchRead mem); | |
| 6752 ins_cost(100); | |
| 6753 | |
| 6754 format %{ "PREFETCHT0 $mem\t! Prefetch into L1 and L2 caches for read" %} | |
| 6755 opcode(0x0F, 0x18); /* Opcode 0F 18 /1 */ | |
| 6756 ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); | |
| 6757 ins_pipe(ialu_mem); | |
| 6758 %} | |
| 6759 | |
| 6760 instruct prefetchrT2( memory mem ) %{ | |
| 6761 predicate(UseSSE>=1 && ReadPrefetchInstr==2); | |
| 6762 match(PrefetchRead mem); | |
| 6763 ins_cost(100); | |
| 6764 | |
| 6765 format %{ "PREFETCHT2 $mem\t! Prefetch into L2 cache for read" %} | |
| 6766 opcode(0x0F, 0x18); /* Opcode 0F 18 /3 */ | |
| 6767 ins_encode(OpcP, OpcS, RMopc_Mem(0x03,mem)); | |
| 6768 ins_pipe(ialu_mem); | |
| 6769 %} | |
| 6770 | |
| 6771 instruct prefetchw0( memory mem ) %{ | |
| 6772 predicate(UseSSE==0 && !VM_Version::supports_3dnow()); | |
| 6773 match(PrefetchWrite mem); | |
| 6774 ins_cost(0); | |
| 6775 size(0); | |
| 6776 format %{ "Prefetch (non-SSE is empty encoding)" %} | |
| 6777 ins_encode(); | |
| 6778 ins_pipe(empty); | |
| 6779 %} | |
| 6780 | |
| 6781 instruct prefetchw( memory mem ) %{ | |
| 6782 predicate(UseSSE==0 && VM_Version::supports_3dnow() || AllocatePrefetchInstr==3); | |
| 6783 match( PrefetchWrite mem ); | |
| 6784 ins_cost(100); | |
| 6785 | |
| 6786 format %{ "PREFETCHW $mem\t! Prefetch into L1 cache and mark modified" %} | |
| 6787 opcode(0x0F, 0x0D); /* Opcode 0F 0D /1 */ | |
| 6788 ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); | |
| 6789 ins_pipe(ialu_mem); | |
| 6790 %} | |
| 6791 | |
| 6792 instruct prefetchwNTA( memory mem ) %{ | |
| 6793 predicate(UseSSE>=1 && AllocatePrefetchInstr==0); | |
| 6794 match(PrefetchWrite mem); | |
| 6795 ins_cost(100); | |
| 6796 | |
| 6797 format %{ "PREFETCHNTA $mem\t! Prefetch into non-temporal cache for write" %} | |
| 6798 opcode(0x0F, 0x18); /* Opcode 0F 18 /0 */ | |
| 6799 ins_encode(OpcP, OpcS, RMopc_Mem(0x00,mem)); | |
| 6800 ins_pipe(ialu_mem); | |
| 6801 %} | |
| 6802 | |
| 6803 instruct prefetchwT0( memory mem ) %{ | |
| 6804 predicate(UseSSE>=1 && AllocatePrefetchInstr==1); | |
| 6805 match(PrefetchWrite mem); | |
| 6806 ins_cost(100); | |
| 6807 | |
| 6808 format %{ "PREFETCHT0 $mem\t! Prefetch into L1 and L2 caches for write" %} | |
| 6809 opcode(0x0F, 0x18); /* Opcode 0F 18 /1 */ | |
| 6810 ins_encode(OpcP, OpcS, RMopc_Mem(0x01,mem)); | |
| 6811 ins_pipe(ialu_mem); | |
| 6812 %} | |
| 6813 | |
| 6814 instruct prefetchwT2( memory mem ) %{ | |
| 6815 predicate(UseSSE>=1 && AllocatePrefetchInstr==2); | |
| 6816 match(PrefetchWrite mem); | |
| 6817 ins_cost(100); | |
| 6818 | |
| 6819 format %{ "PREFETCHT2 $mem\t! Prefetch into L2 cache for write" %} | |
| 6820 opcode(0x0F, 0x18); /* Opcode 0F 18 /3 */ | |
| 6821 ins_encode(OpcP, OpcS, RMopc_Mem(0x03,mem)); | |
| 6822 ins_pipe(ialu_mem); | |
| 6823 %} | |
| 6824 | |
| 6825 //----------Store Instructions------------------------------------------------- | |
| 6826 | |
| 6827 // Store Byte | |
| 6828 instruct storeB(memory mem, xRegI src) %{ | |
| 6829 match(Set mem (StoreB mem src)); | |
| 6830 | |
| 6831 ins_cost(125); | |
| 6832 format %{ "MOV8 $mem,$src" %} | |
| 6833 opcode(0x88); | |
| 6834 ins_encode( OpcP, RegMem( src, mem ) ); | |
| 6835 ins_pipe( ialu_mem_reg ); | |
| 6836 %} | |
| 6837 | |
| 6838 // Store Char/Short | |
| 6839 instruct storeC(memory mem, eRegI src) %{ | |
| 6840 match(Set mem (StoreC mem src)); | |
| 6841 | |
| 6842 ins_cost(125); | |
| 6843 format %{ "MOV16 $mem,$src" %} | |
| 6844 opcode(0x89, 0x66); | |
| 6845 ins_encode( OpcS, OpcP, RegMem( src, mem ) ); | |
| 6846 ins_pipe( ialu_mem_reg ); | |
| 6847 %} | |
| 6848 | |
| 6849 // Store Integer | |
| 6850 instruct storeI(memory mem, eRegI src) %{ | |
| 6851 match(Set mem (StoreI mem src)); | |
| 6852 | |
| 6853 ins_cost(125); | |
| 6854 format %{ "MOV $mem,$src" %} | |
| 6855 opcode(0x89); | |
| 6856 ins_encode( OpcP, RegMem( src, mem ) ); | |
| 6857 ins_pipe( ialu_mem_reg ); | |
| 6858 %} | |
| 6859 | |
| 6860 // Store Long | |
| 6861 instruct storeL(long_memory mem, eRegL src) %{ | |
| 6862 predicate(!((StoreLNode*)n)->require_atomic_access()); | |
| 6863 match(Set mem (StoreL mem src)); | |
| 6864 | |
| 6865 ins_cost(200); | |
| 6866 format %{ "MOV $mem,$src.lo\n\t" | |
| 6867 "MOV $mem+4,$src.hi" %} | |
| 6868 opcode(0x89, 0x89); | |
| 6869 ins_encode( OpcP, RegMem( src, mem ), OpcS, RegMem_Hi( src, mem ) ); | |
| 6870 ins_pipe( ialu_mem_long_reg ); | |
| 6871 %} | |
| 6872 | |
| 6873 // Volatile Store Long. Must be atomic, so move it into | |
| 6874 // the FP TOS and then do a 64-bit FIST. Has to probe the | |
| 6875 // target address before the store (for null-ptr checks) | |
| 6876 // so the memory operand is used twice in the encoding. | |
| 6877 instruct storeL_volatile(memory mem, stackSlotL src, eFlagsReg cr ) %{ | |
| 6878 predicate(UseSSE<=1 && ((StoreLNode*)n)->require_atomic_access()); | |
| 6879 match(Set mem (StoreL mem src)); | |
| 6880 effect( KILL cr ); | |
| 6881 ins_cost(400); | |
| 6882 format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" | |
| 6883 "FILD $src\n\t" | |
| 6884 "FISTp $mem\t # 64-bit atomic volatile long store" %} | |
| 6885 opcode(0x3B); | |
| 6886 ins_encode( OpcP, RegMem( EAX, mem ), enc_storeL_volatile(mem,src)); | |
| 6887 ins_pipe( fpu_reg_mem ); | |
| 6888 %} | |
| 6889 | |
| 6890 instruct storeLX_volatile(memory mem, stackSlotL src, regXD tmp, eFlagsReg cr) %{ | |
| 6891 predicate(UseSSE>=2 && ((StoreLNode*)n)->require_atomic_access()); | |
| 6892 match(Set mem (StoreL mem src)); | |
| 6893 effect( TEMP tmp, KILL cr ); | |
| 6894 ins_cost(380); | |
| 6895 format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" | |
| 6896 "MOVSD $tmp,$src\n\t" | |
| 6897 "MOVSD $mem,$tmp\t # 64-bit atomic volatile long store" %} | |
| 6898 opcode(0x3B); | |
| 6899 ins_encode( OpcP, RegMem( EAX, mem ), enc_storeLX_volatile(mem, src, tmp)); | |
| 6900 ins_pipe( pipe_slow ); | |
| 6901 %} | |
| 6902 | |
| 6903 instruct storeLX_reg_volatile(memory mem, eRegL src, regXD tmp2, regXD tmp, eFlagsReg cr) %{ | |
| 6904 predicate(UseSSE>=2 && ((StoreLNode*)n)->require_atomic_access()); | |
| 6905 match(Set mem (StoreL mem src)); | |
| 6906 effect( TEMP tmp2 , TEMP tmp, KILL cr ); | |
| 6907 ins_cost(360); | |
| 6908 format %{ "CMP $mem,EAX\t# Probe address for implicit null check\n\t" | |
| 6909 "MOVD $tmp,$src.lo\n\t" | |
| 6910 "MOVD $tmp2,$src.hi\n\t" | |
| 6911 "PUNPCKLDQ $tmp,$tmp2\n\t" | |
| 6912 "MOVSD $mem,$tmp\t # 64-bit atomic volatile long store" %} | |
| 6913 opcode(0x3B); | |
| 6914 ins_encode( OpcP, RegMem( EAX, mem ), enc_storeLX_reg_volatile(mem, src, tmp, tmp2)); | |
| 6915 ins_pipe( pipe_slow ); | |
| 6916 %} | |
| 6917 | |
| 6918 // Store Pointer; for storing unknown oops and raw pointers | |
| 6919 instruct storeP(memory mem, anyRegP src) %{ | |
| 6920 match(Set mem (StoreP mem src)); | |
| 6921 | |
| 6922 ins_cost(125); | |
| 6923 format %{ "MOV $mem,$src" %} | |
| 6924 opcode(0x89); | |
| 6925 ins_encode( OpcP, RegMem( src, mem ) ); | |
| 6926 ins_pipe( ialu_mem_reg ); | |
| 6927 %} | |
| 6928 | |
| 6929 // Store Integer Immediate | |
| 6930 instruct storeImmI(memory mem, immI src) %{ | |
| 6931 match(Set mem (StoreI mem src)); | |
| 6932 | |
| 6933 ins_cost(150); | |
| 6934 format %{ "MOV $mem,$src" %} | |
| 6935 opcode(0xC7); /* C7 /0 */ | |
| 6936 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32( src )); | |
| 6937 ins_pipe( ialu_mem_imm ); | |
| 6938 %} | |
| 6939 | |
| 6940 // Store Short/Char Immediate | |
| 6941 instruct storeImmI16(memory mem, immI16 src) %{ | |
| 6942 predicate(UseStoreImmI16); | |
| 6943 match(Set mem (StoreC mem src)); | |
| 6944 | |
| 6945 ins_cost(150); | |
| 6946 format %{ "MOV16 $mem,$src" %} | |
| 6947 opcode(0xC7); /* C7 /0 Same as 32 store immediate with prefix */ | |
| 6948 ins_encode( SizePrefix, OpcP, RMopc_Mem(0x00,mem), Con16( src )); | |
| 6949 ins_pipe( ialu_mem_imm ); | |
| 6950 %} | |
| 6951 | |
| 6952 // Store Pointer Immediate; null pointers or constant oops that do not | |
| 6953 // need card-mark barriers. | |
| 6954 instruct storeImmP(memory mem, immP src) %{ | |
| 6955 match(Set mem (StoreP mem src)); | |
| 6956 | |
| 6957 ins_cost(150); | |
| 6958 format %{ "MOV $mem,$src" %} | |
| 6959 opcode(0xC7); /* C7 /0 */ | |
| 6960 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32( src )); | |
| 6961 ins_pipe( ialu_mem_imm ); | |
| 6962 %} | |
| 6963 | |
| 6964 // Store Byte Immediate | |
| 6965 instruct storeImmB(memory mem, immI8 src) %{ | |
| 6966 match(Set mem (StoreB mem src)); | |
| 6967 | |
| 6968 ins_cost(150); | |
| 6969 format %{ "MOV8 $mem,$src" %} | |
| 6970 opcode(0xC6); /* C6 /0 */ | |
| 6971 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con8or32( src )); | |
| 6972 ins_pipe( ialu_mem_imm ); | |
| 6973 %} | |
| 6974 | |
| 6975 // Store Aligned Packed Byte XMM register to memory | |
| 6976 instruct storeA8B(memory mem, regXD src) %{ | |
| 6977 predicate(UseSSE>=1); | |
| 6978 match(Set mem (Store8B mem src)); | |
| 6979 ins_cost(145); | |
| 6980 format %{ "MOVQ $mem,$src\t! packed8B" %} | |
| 6981 ins_encode( movq_st(mem, src)); | |
| 6982 ins_pipe( pipe_slow ); | |
| 6983 %} | |
| 6984 | |
| 6985 // Store Aligned Packed Char/Short XMM register to memory | |
| 6986 instruct storeA4C(memory mem, regXD src) %{ | |
| 6987 predicate(UseSSE>=1); | |
| 6988 match(Set mem (Store4C mem src)); | |
| 6989 ins_cost(145); | |
| 6990 format %{ "MOVQ $mem,$src\t! packed4C" %} | |
| 6991 ins_encode( movq_st(mem, src)); | |
| 6992 ins_pipe( pipe_slow ); | |
| 6993 %} | |
| 6994 | |
| 6995 // Store Aligned Packed Integer XMM register to memory | |
| 6996 instruct storeA2I(memory mem, regXD src) %{ | |
| 6997 predicate(UseSSE>=1); | |
| 6998 match(Set mem (Store2I mem src)); | |
| 6999 ins_cost(145); | |
| 7000 format %{ "MOVQ $mem,$src\t! packed2I" %} | |
| 7001 ins_encode( movq_st(mem, src)); | |
| 7002 ins_pipe( pipe_slow ); | |
| 7003 %} | |
| 7004 | |
| 7005 // Store CMS card-mark Immediate | |
| 7006 instruct storeImmCM(memory mem, immI8 src) %{ | |
| 7007 match(Set mem (StoreCM mem src)); | |
| 7008 | |
| 7009 ins_cost(150); | |
| 7010 format %{ "MOV8 $mem,$src\t! CMS card-mark imm0" %} | |
| 7011 opcode(0xC6); /* C6 /0 */ | |
| 7012 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con8or32( src )); | |
| 7013 ins_pipe( ialu_mem_imm ); | |
| 7014 %} | |
| 7015 | |
| 7016 // Store Double | |
| 7017 instruct storeD( memory mem, regDPR1 src) %{ | |
| 7018 predicate(UseSSE<=1); | |
| 7019 match(Set mem (StoreD mem src)); | |
| 7020 | |
| 7021 ins_cost(100); | |
| 7022 format %{ "FST_D $mem,$src" %} | |
| 7023 opcode(0xDD); /* DD /2 */ | |
| 7024 ins_encode( enc_FP_store(mem,src) ); | |
| 7025 ins_pipe( fpu_mem_reg ); | |
| 7026 %} | |
| 7027 | |
| 7028 // Store double does rounding on x86 | |
| 7029 instruct storeD_rounded( memory mem, regDPR1 src) %{ | |
| 7030 predicate(UseSSE<=1); | |
| 7031 match(Set mem (StoreD mem (RoundDouble src))); | |
| 7032 | |
| 7033 ins_cost(100); | |
| 7034 format %{ "FST_D $mem,$src\t# round" %} | |
| 7035 opcode(0xDD); /* DD /2 */ | |
| 7036 ins_encode( enc_FP_store(mem,src) ); | |
| 7037 ins_pipe( fpu_mem_reg ); | |
| 7038 %} | |
| 7039 | |
| 7040 // Store XMM register to memory (double-precision floating points) | |
| 7041 // MOVSD instruction | |
| 7042 instruct storeXD(memory mem, regXD src) %{ | |
| 7043 predicate(UseSSE>=2); | |
| 7044 match(Set mem (StoreD mem src)); | |
| 7045 ins_cost(95); | |
| 7046 format %{ "MOVSD $mem,$src" %} | |
| 7047 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x11), RegMem(src, mem)); | |
| 7048 ins_pipe( pipe_slow ); | |
| 7049 %} | |
| 7050 | |
| 7051 // Store XMM register to memory (single-precision floating point) | |
| 7052 // MOVSS instruction | |
| 7053 instruct storeX(memory mem, regX src) %{ | |
| 7054 predicate(UseSSE>=1); | |
| 7055 match(Set mem (StoreF mem src)); | |
| 7056 ins_cost(95); | |
| 7057 format %{ "MOVSS $mem,$src" %} | |
| 7058 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x11), RegMem(src, mem)); | |
| 7059 ins_pipe( pipe_slow ); | |
| 7060 %} | |
| 7061 | |
| 7062 // Store Aligned Packed Single Float XMM register to memory | |
| 7063 instruct storeA2F(memory mem, regXD src) %{ | |
| 7064 predicate(UseSSE>=1); | |
| 7065 match(Set mem (Store2F mem src)); | |
| 7066 ins_cost(145); | |
| 7067 format %{ "MOVQ $mem,$src\t! packed2F" %} | |
| 7068 ins_encode( movq_st(mem, src)); | |
| 7069 ins_pipe( pipe_slow ); | |
| 7070 %} | |
| 7071 | |
| 7072 // Store Float | |
| 7073 instruct storeF( memory mem, regFPR1 src) %{ | |
| 7074 predicate(UseSSE==0); | |
| 7075 match(Set mem (StoreF mem src)); | |
| 7076 | |
| 7077 ins_cost(100); | |
| 7078 format %{ "FST_S $mem,$src" %} | |
| 7079 opcode(0xD9); /* D9 /2 */ | |
| 7080 ins_encode( enc_FP_store(mem,src) ); | |
| 7081 ins_pipe( fpu_mem_reg ); | |
| 7082 %} | |
| 7083 | |
| 7084 // Store Float does rounding on x86 | |
| 7085 instruct storeF_rounded( memory mem, regFPR1 src) %{ | |
| 7086 predicate(UseSSE==0); | |
| 7087 match(Set mem (StoreF mem (RoundFloat src))); | |
| 7088 | |
| 7089 ins_cost(100); | |
| 7090 format %{ "FST_S $mem,$src\t# round" %} | |
| 7091 opcode(0xD9); /* D9 /2 */ | |
| 7092 ins_encode( enc_FP_store(mem,src) ); | |
| 7093 ins_pipe( fpu_mem_reg ); | |
| 7094 %} | |
| 7095 | |
| 7096 // Store Float does rounding on x86 | |
| 7097 instruct storeF_Drounded( memory mem, regDPR1 src) %{ | |
| 7098 predicate(UseSSE<=1); | |
| 7099 match(Set mem (StoreF mem (ConvD2F src))); | |
| 7100 | |
| 7101 ins_cost(100); | |
| 7102 format %{ "FST_S $mem,$src\t# D-round" %} | |
| 7103 opcode(0xD9); /* D9 /2 */ | |
| 7104 ins_encode( enc_FP_store(mem,src) ); | |
| 7105 ins_pipe( fpu_mem_reg ); | |
| 7106 %} | |
| 7107 | |
| 7108 // Store immediate Float value (it is faster than store from FPU register) | |
| 7109 // The instruction usage is guarded by predicate in operand immF(). | |
| 7110 instruct storeF_imm( memory mem, immF src) %{ | |
| 7111 match(Set mem (StoreF mem src)); | |
| 7112 | |
| 7113 ins_cost(50); | |
| 7114 format %{ "MOV $mem,$src\t# store float" %} | |
| 7115 opcode(0xC7); /* C7 /0 */ | |
| 7116 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32F_as_bits( src )); | |
| 7117 ins_pipe( ialu_mem_imm ); | |
| 7118 %} | |
| 7119 | |
| 7120 // Store immediate Float value (it is faster than store from XMM register) | |
| 7121 // The instruction usage is guarded by predicate in operand immXF(). | |
| 7122 instruct storeX_imm( memory mem, immXF src) %{ | |
| 7123 match(Set mem (StoreF mem src)); | |
| 7124 | |
| 7125 ins_cost(50); | |
| 7126 format %{ "MOV $mem,$src\t# store float" %} | |
| 7127 opcode(0xC7); /* C7 /0 */ | |
| 7128 ins_encode( OpcP, RMopc_Mem(0x00,mem), Con32XF_as_bits( src )); | |
| 7129 ins_pipe( ialu_mem_imm ); | |
| 7130 %} | |
| 7131 | |
| 7132 // Store Integer to stack slot | |
| 7133 instruct storeSSI(stackSlotI dst, eRegI src) %{ | |
| 7134 match(Set dst src); | |
| 7135 | |
| 7136 ins_cost(100); | |
| 7137 format %{ "MOV $dst,$src" %} | |
| 7138 opcode(0x89); | |
| 7139 ins_encode( OpcPRegSS( dst, src ) ); | |
| 7140 ins_pipe( ialu_mem_reg ); | |
| 7141 %} | |
| 7142 | |
| 7143 // Store Integer to stack slot | |
| 7144 instruct storeSSP(stackSlotP dst, eRegP src) %{ | |
| 7145 match(Set dst src); | |
| 7146 | |
| 7147 ins_cost(100); | |
| 7148 format %{ "MOV $dst,$src" %} | |
| 7149 opcode(0x89); | |
| 7150 ins_encode( OpcPRegSS( dst, src ) ); | |
| 7151 ins_pipe( ialu_mem_reg ); | |
| 7152 %} | |
| 7153 | |
| 7154 // Store Long to stack slot | |
| 7155 instruct storeSSL(stackSlotL dst, eRegL src) %{ | |
| 7156 match(Set dst src); | |
| 7157 | |
| 7158 ins_cost(200); | |
| 7159 format %{ "MOV $dst,$src.lo\n\t" | |
| 7160 "MOV $dst+4,$src.hi" %} | |
| 7161 opcode(0x89, 0x89); | |
| 7162 ins_encode( OpcP, RegMem( src, dst ), OpcS, RegMem_Hi( src, dst ) ); | |
| 7163 ins_pipe( ialu_mem_long_reg ); | |
| 7164 %} | |
| 7165 | |
| 7166 //----------MemBar Instructions----------------------------------------------- | |
| 7167 // Memory barrier flavors | |
| 7168 | |
| 7169 instruct membar_acquire() %{ | |
| 7170 match(MemBarAcquire); | |
| 7171 ins_cost(400); | |
| 7172 | |
| 7173 size(0); | |
| 7174 format %{ "MEMBAR-acquire" %} | |
| 7175 ins_encode( enc_membar_acquire ); | |
| 7176 ins_pipe(pipe_slow); | |
| 7177 %} | |
| 7178 | |
| 7179 instruct membar_acquire_lock() %{ | |
| 7180 match(MemBarAcquire); | |
| 7181 predicate(Matcher::prior_fast_lock(n)); | |
| 7182 ins_cost(0); | |
| 7183 | |
| 7184 size(0); | |
| 7185 format %{ "MEMBAR-acquire (prior CMPXCHG in FastLock so empty encoding)" %} | |
| 7186 ins_encode( ); | |
| 7187 ins_pipe(empty); | |
| 7188 %} | |
| 7189 | |
| 7190 instruct membar_release() %{ | |
| 7191 match(MemBarRelease); | |
| 7192 ins_cost(400); | |
| 7193 | |
| 7194 size(0); | |
| 7195 format %{ "MEMBAR-release" %} | |
| 7196 ins_encode( enc_membar_release ); | |
| 7197 ins_pipe(pipe_slow); | |
| 7198 %} | |
| 7199 | |
| 7200 instruct membar_release_lock() %{ | |
| 7201 match(MemBarRelease); | |
| 7202 predicate(Matcher::post_fast_unlock(n)); | |
| 7203 ins_cost(0); | |
| 7204 | |
| 7205 size(0); | |
| 7206 format %{ "MEMBAR-release (a FastUnlock follows so empty encoding)" %} | |
| 7207 ins_encode( ); | |
| 7208 ins_pipe(empty); | |
| 7209 %} | |
| 7210 | |
| 7211 instruct membar_volatile() %{ | |
| 7212 match(MemBarVolatile); | |
| 7213 ins_cost(400); | |
| 7214 | |
| 7215 format %{ "MEMBAR-volatile" %} | |
| 7216 ins_encode( enc_membar_volatile ); | |
| 7217 ins_pipe(pipe_slow); | |
| 7218 %} | |
| 7219 | |
| 7220 instruct unnecessary_membar_volatile() %{ | |
| 7221 match(MemBarVolatile); | |
| 7222 predicate(Matcher::post_store_load_barrier(n)); | |
| 7223 ins_cost(0); | |
| 7224 | |
| 7225 size(0); | |
| 7226 format %{ "MEMBAR-volatile (unnecessary so empty encoding)" %} | |
| 7227 ins_encode( ); | |
| 7228 ins_pipe(empty); | |
| 7229 %} | |
| 7230 | |
| 7231 //----------Move Instructions-------------------------------------------------- | |
| 7232 instruct castX2P(eAXRegP dst, eAXRegI src) %{ | |
| 7233 match(Set dst (CastX2P src)); | |
| 7234 format %{ "# X2P $dst, $src" %} | |
| 7235 ins_encode( /*empty encoding*/ ); | |
| 7236 ins_cost(0); | |
| 7237 ins_pipe(empty); | |
| 7238 %} | |
| 7239 | |
| 7240 instruct castP2X(eRegI dst, eRegP src ) %{ | |
| 7241 match(Set dst (CastP2X src)); | |
| 7242 ins_cost(50); | |
| 7243 format %{ "MOV $dst, $src\t# CastP2X" %} | |
| 7244 ins_encode( enc_Copy( dst, src) ); | |
| 7245 ins_pipe( ialu_reg_reg ); | |
| 7246 %} | |
| 7247 | |
| 7248 //----------Conditional Move--------------------------------------------------- | |
| 7249 // Conditional move | |
| 7250 instruct cmovI_reg(eRegI dst, eRegI src, eFlagsReg cr, cmpOp cop ) %{ | |
| 7251 predicate(VM_Version::supports_cmov() ); | |
| 7252 match(Set dst (CMoveI (Binary cop cr) (Binary dst src))); | |
| 7253 ins_cost(200); | |
| 7254 format %{ "CMOV$cop $dst,$src" %} | |
| 7255 opcode(0x0F,0x40); | |
| 7256 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
| 7257 ins_pipe( pipe_cmov_reg ); | |
| 7258 %} | |
| 7259 | |
| 7260 instruct cmovI_regU( eRegI dst, eRegI src, eFlagsRegU cr, cmpOpU cop ) %{ | |
| 7261 predicate(VM_Version::supports_cmov() ); | |
| 7262 match(Set dst (CMoveI (Binary cop cr) (Binary dst src))); | |
| 7263 ins_cost(200); | |
| 7264 format %{ "CMOV$cop $dst,$src" %} | |
| 7265 opcode(0x0F,0x40); | |
| 7266 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
| 7267 ins_pipe( pipe_cmov_reg ); | |
| 7268 %} | |
| 7269 | |
| 7270 // Conditional move | |
| 7271 instruct cmovI_mem(cmpOp cop, eFlagsReg cr, eRegI dst, memory src) %{ | |
| 7272 predicate(VM_Version::supports_cmov() ); | |
| 7273 match(Set dst (CMoveI (Binary cop cr) (Binary dst (LoadI src)))); | |
| 7274 ins_cost(250); | |
| 7275 format %{ "CMOV$cop $dst,$src" %} | |
| 7276 opcode(0x0F,0x40); | |
| 7277 ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
| 7278 ins_pipe( pipe_cmov_mem ); | |
| 7279 %} | |
| 7280 | |
| 7281 // Conditional move | |
| 7282 instruct cmovI_memu(cmpOpU cop, eFlagsRegU cr, eRegI dst, memory src) %{ | |
| 7283 predicate(VM_Version::supports_cmov() ); | |
| 7284 match(Set dst (CMoveI (Binary cop cr) (Binary dst (LoadI src)))); | |
| 7285 ins_cost(250); | |
| 7286 format %{ "CMOV$cop $dst,$src" %} | |
| 7287 opcode(0x0F,0x40); | |
| 7288 ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
| 7289 ins_pipe( pipe_cmov_mem ); | |
| 7290 %} | |
| 7291 | |
| 7292 // Conditional move | |
| 7293 instruct cmovP_reg(eRegP dst, eRegP src, eFlagsReg cr, cmpOp cop ) %{ | |
| 7294 predicate(VM_Version::supports_cmov() ); | |
| 7295 match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); | |
| 7296 ins_cost(200); | |
| 7297 format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
| 7298 opcode(0x0F,0x40); | |
| 7299 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
| 7300 ins_pipe( pipe_cmov_reg ); | |
| 7301 %} | |
| 7302 | |
| 7303 // Conditional move (non-P6 version) | |
| 7304 // Note: a CMoveP is generated for stubs and native wrappers | |
| 7305 // regardless of whether we are on a P6, so we | |
| 7306 // emulate a cmov here | |
| 7307 instruct cmovP_reg_nonP6(eRegP dst, eRegP src, eFlagsReg cr, cmpOp cop ) %{ | |
| 7308 match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); | |
| 7309 ins_cost(300); | |
| 7310 format %{ "Jn$cop skip\n\t" | |
| 7311 "MOV $dst,$src\t# pointer\n" | |
| 7312 "skip:" %} | |
| 7313 opcode(0x8b); | |
| 7314 ins_encode( enc_cmov_branch(cop, 0x2), OpcP, RegReg(dst, src)); | |
| 7315 ins_pipe( pipe_cmov_reg ); | |
| 7316 %} | |
| 7317 | |
| 7318 // Conditional move | |
| 7319 instruct cmovP_regU(eRegP dst, eRegP src, eFlagsRegU cr, cmpOpU cop ) %{ | |
| 7320 predicate(VM_Version::supports_cmov() ); | |
| 7321 match(Set dst (CMoveP (Binary cop cr) (Binary dst src))); | |
| 7322 ins_cost(200); | |
| 7323 format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
| 7324 opcode(0x0F,0x40); | |
| 7325 ins_encode( enc_cmov(cop), RegReg( dst, src ) ); | |
| 7326 ins_pipe( pipe_cmov_reg ); | |
| 7327 %} | |
| 7328 | |
| 7329 // DISABLED: Requires the ADLC to emit a bottom_type call that | |
| 7330 // correctly meets the two pointer arguments; one is an incoming | |
| 7331 // register but the other is a memory operand. ALSO appears to | |
| 7332 // be buggy with implicit null checks. | |
| 7333 // | |
| 7334 //// Conditional move | |
| 7335 //instruct cmovP_mem(cmpOp cop, eFlagsReg cr, eRegP dst, memory src) %{ | |
| 7336 // predicate(VM_Version::supports_cmov() ); | |
| 7337 // match(Set dst (CMoveP (Binary cop cr) (Binary dst (LoadP src)))); | |
| 7338 // ins_cost(250); | |
| 7339 // format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
| 7340 // opcode(0x0F,0x40); | |
| 7341 // ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
| 7342 // ins_pipe( pipe_cmov_mem ); | |
| 7343 //%} | |
| 7344 // | |
| 7345 //// Conditional move | |
| 7346 //instruct cmovP_memU(cmpOpU cop, eFlagsRegU cr, eRegP dst, memory src) %{ | |
| 7347 // predicate(VM_Version::supports_cmov() ); | |
| 7348 // match(Set dst (CMoveP (Binary cop cr) (Binary dst (LoadP src)))); | |
| 7349 // ins_cost(250); | |
| 7350 // format %{ "CMOV$cop $dst,$src\t# ptr" %} | |
| 7351 // opcode(0x0F,0x40); | |
| 7352 // ins_encode( enc_cmov(cop), RegMem( dst, src ) ); | |
| 7353 // ins_pipe( pipe_cmov_mem ); | |
| 7354 //%} | |
| 7355 | |
| 7356 // Conditional move | |
| 7357 instruct fcmovD_regU(cmpOp_fcmov cop, eFlagsRegU cr, regDPR1 dst, regD src) %{ | |
| 7358 predicate(UseSSE<=1); | |
| 7359 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
| 7360 ins_cost(200); | |
| 7361 format %{ "FCMOV$cop $dst,$src\t# double" %} | |
| 7362 opcode(0xDA); | |
| 7363 ins_encode( enc_cmov_d(cop,src) ); | |
| 7364 ins_pipe( pipe_cmovD_reg ); | |
| 7365 %} | |
| 7366 | |
| 7367 // Conditional move | |
| 7368 instruct fcmovF_regU(cmpOp_fcmov cop, eFlagsRegU cr, regFPR1 dst, regF src) %{ | |
| 7369 predicate(UseSSE==0); | |
| 7370 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
| 7371 ins_cost(200); | |
| 7372 format %{ "FCMOV$cop $dst,$src\t# float" %} | |
| 7373 opcode(0xDA); | |
| 7374 ins_encode( enc_cmov_d(cop,src) ); | |
| 7375 ins_pipe( pipe_cmovD_reg ); | |
| 7376 %} | |
| 7377 | |
| 7378 // Float CMOV on Intel doesn't handle *signed* compares, only unsigned. | |
| 7379 instruct fcmovD_regS(cmpOp cop, eFlagsReg cr, regD dst, regD src) %{ | |
| 7380 predicate(UseSSE<=1); | |
| 7381 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
| 7382 ins_cost(200); | |
| 7383 format %{ "Jn$cop skip\n\t" | |
| 7384 "MOV $dst,$src\t# double\n" | |
| 7385 "skip:" %} | |
| 7386 opcode (0xdd, 0x3); /* DD D8+i or DD /3 */ | |
| 7387 ins_encode( enc_cmov_branch( cop, 0x4 ), Push_Reg_D(src), OpcP, RegOpc(dst) ); | |
| 7388 ins_pipe( pipe_cmovD_reg ); | |
| 7389 %} | |
| 7390 | |
| 7391 // Float CMOV on Intel doesn't handle *signed* compares, only unsigned. | |
| 7392 instruct fcmovF_regS(cmpOp cop, eFlagsReg cr, regF dst, regF src) %{ | |
| 7393 predicate(UseSSE==0); | |
| 7394 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
| 7395 ins_cost(200); | |
| 7396 format %{ "Jn$cop skip\n\t" | |
| 7397 "MOV $dst,$src\t# float\n" | |
| 7398 "skip:" %} | |
| 7399 opcode (0xdd, 0x3); /* DD D8+i or DD /3 */ | |
| 7400 ins_encode( enc_cmov_branch( cop, 0x4 ), Push_Reg_F(src), OpcP, RegOpc(dst) ); | |
| 7401 ins_pipe( pipe_cmovD_reg ); | |
| 7402 %} | |
| 7403 | |
| 7404 // No CMOVE with SSE/SSE2 | |
| 7405 instruct fcmovX_regS(cmpOp cop, eFlagsReg cr, regX dst, regX src) %{ | |
| 7406 predicate (UseSSE>=1); | |
| 7407 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
| 7408 ins_cost(200); | |
| 7409 format %{ "Jn$cop skip\n\t" | |
| 7410 "MOVSS $dst,$src\t# float\n" | |
| 7411 "skip:" %} | |
| 7412 ins_encode %{ | |
| 7413 Label skip; | |
| 7414 // Invert sense of branch from sense of CMOV | |
| 7415 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
| 7416 __ movflt($dst$$XMMRegister, $src$$XMMRegister); | |
| 7417 __ bind(skip); | |
| 7418 %} | |
| 7419 ins_pipe( pipe_slow ); | |
| 7420 %} | |
| 7421 | |
| 7422 // No CMOVE with SSE/SSE2 | |
| 7423 instruct fcmovXD_regS(cmpOp cop, eFlagsReg cr, regXD dst, regXD src) %{ | |
| 7424 predicate (UseSSE>=2); | |
| 7425 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
| 7426 ins_cost(200); | |
| 7427 format %{ "Jn$cop skip\n\t" | |
| 7428 "MOVSD $dst,$src\t# float\n" | |
| 7429 "skip:" %} | |
| 7430 ins_encode %{ | |
| 7431 Label skip; | |
| 7432 // Invert sense of branch from sense of CMOV | |
| 7433 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
| 7434 __ movdbl($dst$$XMMRegister, $src$$XMMRegister); | |
| 7435 __ bind(skip); | |
| 7436 %} | |
| 7437 ins_pipe( pipe_slow ); | |
| 7438 %} | |
| 7439 | |
| 7440 // unsigned version | |
| 7441 instruct fcmovX_regU(cmpOpU cop, eFlagsRegU cr, regX dst, regX src) %{ | |
| 7442 predicate (UseSSE>=1); | |
| 7443 match(Set dst (CMoveF (Binary cop cr) (Binary dst src))); | |
| 7444 ins_cost(200); | |
| 7445 format %{ "Jn$cop skip\n\t" | |
| 7446 "MOVSS $dst,$src\t# float\n" | |
| 7447 "skip:" %} | |
| 7448 ins_encode %{ | |
| 7449 Label skip; | |
| 7450 // Invert sense of branch from sense of CMOV | |
| 7451 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
| 7452 __ movflt($dst$$XMMRegister, $src$$XMMRegister); | |
| 7453 __ bind(skip); | |
| 7454 %} | |
| 7455 ins_pipe( pipe_slow ); | |
| 7456 %} | |
| 7457 | |
| 7458 // unsigned version | |
| 7459 instruct fcmovXD_regU(cmpOpU cop, eFlagsRegU cr, regXD dst, regXD src) %{ | |
| 7460 predicate (UseSSE>=2); | |
| 7461 match(Set dst (CMoveD (Binary cop cr) (Binary dst src))); | |
| 7462 ins_cost(200); | |
| 7463 format %{ "Jn$cop skip\n\t" | |
| 7464 "MOVSD $dst,$src\t# float\n" | |
| 7465 "skip:" %} | |
| 7466 ins_encode %{ | |
| 7467 Label skip; | |
| 7468 // Invert sense of branch from sense of CMOV | |
| 7469 __ jccb((Assembler::Condition)($cop$$cmpcode^1), skip); | |
| 7470 __ movdbl($dst$$XMMRegister, $src$$XMMRegister); | |
| 7471 __ bind(skip); | |
| 7472 %} | |
| 7473 ins_pipe( pipe_slow ); | |
| 7474 %} | |
| 7475 | |
| 7476 instruct cmovL_reg(cmpOp cop, eFlagsReg cr, eRegL dst, eRegL src) %{ | |
| 7477 predicate(VM_Version::supports_cmov() ); | |
| 7478 match(Set dst (CMoveL (Binary cop cr) (Binary dst src))); | |
| 7479 ins_cost(200); | |
| 7480 format %{ "CMOV$cop $dst.lo,$src.lo\n\t" | |
| 7481 "CMOV$cop $dst.hi,$src.hi" %} | |
| 7482 opcode(0x0F,0x40); | |
| 7483 ins_encode( enc_cmov(cop), RegReg_Lo2( dst, src ), enc_cmov(cop), RegReg_Hi2( dst, src ) ); | |
| 7484 ins_pipe( pipe_cmov_reg_long ); | |
| 7485 %} | |
| 7486 | |
| 7487 instruct cmovL_regU(cmpOpU cop, eFlagsRegU cr, eRegL dst, eRegL src) %{ | |
| 7488 predicate(VM_Version::supports_cmov() ); | |
| 7489 match(Set dst (CMoveL (Binary cop cr) (Binary dst src))); | |
| 7490 ins_cost(200); | |
| 7491 format %{ "CMOV$cop $dst.lo,$src.lo\n\t" | |
| 7492 "CMOV$cop $dst.hi,$src.hi" %} | |
| 7493 opcode(0x0F,0x40); | |
| 7494 ins_encode( enc_cmov(cop), RegReg_Lo2( dst, src ), enc_cmov(cop), RegReg_Hi2( dst, src ) ); | |
| 7495 ins_pipe( pipe_cmov_reg_long ); | |
| 7496 %} | |
| 7497 | |
| 7498 //----------Arithmetic Instructions-------------------------------------------- | |
| 7499 //----------Addition Instructions---------------------------------------------- | |
| 7500 // Integer Addition Instructions | |
| 7501 instruct addI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
| 7502 match(Set dst (AddI dst src)); | |
| 7503 effect(KILL cr); | |
| 7504 | |
| 7505 size(2); | |
| 7506 format %{ "ADD $dst,$src" %} | |
| 7507 opcode(0x03); | |
| 7508 ins_encode( OpcP, RegReg( dst, src) ); | |
| 7509 ins_pipe( ialu_reg_reg ); | |
| 7510 %} | |
| 7511 | |
| 7512 instruct addI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
| 7513 match(Set dst (AddI dst src)); | |
| 7514 effect(KILL cr); | |
| 7515 | |
| 7516 format %{ "ADD $dst,$src" %} | |
| 7517 opcode(0x81, 0x00); /* /0 id */ | |
| 7518 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
| 7519 ins_pipe( ialu_reg ); | |
| 7520 %} | |
| 7521 | |
| 7522 instruct incI_eReg(eRegI dst, immI1 src, eFlagsReg cr) %{ | |
| 7523 predicate(UseIncDec); | |
| 7524 match(Set dst (AddI dst src)); | |
| 7525 effect(KILL cr); | |
| 7526 | |
| 7527 size(1); | |
| 7528 format %{ "INC $dst" %} | |
| 7529 opcode(0x40); /* */ | |
| 7530 ins_encode( Opc_plus( primary, dst ) ); | |
| 7531 ins_pipe( ialu_reg ); | |
| 7532 %} | |
| 7533 | |
| 7534 instruct leaI_eReg_immI(eRegI dst, eRegI src0, immI src1) %{ | |
| 7535 match(Set dst (AddI src0 src1)); | |
| 7536 ins_cost(110); | |
| 7537 | |
| 7538 format %{ "LEA $dst,[$src0 + $src1]" %} | |
| 7539 opcode(0x8D); /* 0x8D /r */ | |
| 7540 ins_encode( OpcP, RegLea( dst, src0, src1 ) ); | |
| 7541 ins_pipe( ialu_reg_reg ); | |
| 7542 %} | |
| 7543 | |
| 7544 instruct leaP_eReg_immI(eRegP dst, eRegP src0, immI src1) %{ | |
| 7545 match(Set dst (AddP src0 src1)); | |
| 7546 ins_cost(110); | |
| 7547 | |
| 7548 format %{ "LEA $dst,[$src0 + $src1]\t# ptr" %} | |
| 7549 opcode(0x8D); /* 0x8D /r */ | |
| 7550 ins_encode( OpcP, RegLea( dst, src0, src1 ) ); | |
| 7551 ins_pipe( ialu_reg_reg ); | |
| 7552 %} | |
| 7553 | |
| 7554 instruct decI_eReg(eRegI dst, immI_M1 src, eFlagsReg cr) %{ | |
| 7555 predicate(UseIncDec); | |
| 7556 match(Set dst (AddI dst src)); | |
| 7557 effect(KILL cr); | |
| 7558 | |
| 7559 size(1); | |
| 7560 format %{ "DEC $dst" %} | |
| 7561 opcode(0x48); /* */ | |
| 7562 ins_encode( Opc_plus( primary, dst ) ); | |
| 7563 ins_pipe( ialu_reg ); | |
| 7564 %} | |
| 7565 | |
| 7566 instruct addP_eReg(eRegP dst, eRegI src, eFlagsReg cr) %{ | |
| 7567 match(Set dst (AddP dst src)); | |
| 7568 effect(KILL cr); | |
| 7569 | |
| 7570 size(2); | |
| 7571 format %{ "ADD $dst,$src" %} | |
| 7572 opcode(0x03); | |
| 7573 ins_encode( OpcP, RegReg( dst, src) ); | |
| 7574 ins_pipe( ialu_reg_reg ); | |
| 7575 %} | |
| 7576 | |
| 7577 instruct addP_eReg_imm(eRegP dst, immI src, eFlagsReg cr) %{ | |
| 7578 match(Set dst (AddP dst src)); | |
| 7579 effect(KILL cr); | |
| 7580 | |
| 7581 format %{ "ADD $dst,$src" %} | |
| 7582 opcode(0x81,0x00); /* Opcode 81 /0 id */ | |
| 7583 // ins_encode( RegImm( dst, src) ); | |
| 7584 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
| 7585 ins_pipe( ialu_reg ); | |
| 7586 %} | |
| 7587 | |
| 7588 instruct addI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
| 7589 match(Set dst (AddI dst (LoadI src))); | |
| 7590 effect(KILL cr); | |
| 7591 | |
| 7592 ins_cost(125); | |
| 7593 format %{ "ADD $dst,$src" %} | |
| 7594 opcode(0x03); | |
| 7595 ins_encode( OpcP, RegMem( dst, src) ); | |
| 7596 ins_pipe( ialu_reg_mem ); | |
| 7597 %} | |
| 7598 | |
| 7599 instruct addI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
| 7600 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
| 7601 effect(KILL cr); | |
| 7602 | |
| 7603 ins_cost(150); | |
| 7604 format %{ "ADD $dst,$src" %} | |
| 7605 opcode(0x01); /* Opcode 01 /r */ | |
| 7606 ins_encode( OpcP, RegMem( src, dst ) ); | |
| 7607 ins_pipe( ialu_mem_reg ); | |
| 7608 %} | |
| 7609 | |
| 7610 // Add Memory with Immediate | |
| 7611 instruct addI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
| 7612 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
| 7613 effect(KILL cr); | |
| 7614 | |
| 7615 ins_cost(125); | |
| 7616 format %{ "ADD $dst,$src" %} | |
| 7617 opcode(0x81); /* Opcode 81 /0 id */ | |
| 7618 ins_encode( OpcSE( src ), RMopc_Mem(0x00,dst), Con8or32( src ) ); | |
| 7619 ins_pipe( ialu_mem_imm ); | |
| 7620 %} | |
| 7621 | |
| 7622 instruct incI_mem(memory dst, immI1 src, eFlagsReg cr) %{ | |
| 7623 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
| 7624 effect(KILL cr); | |
| 7625 | |
| 7626 ins_cost(125); | |
| 7627 format %{ "INC $dst" %} | |
| 7628 opcode(0xFF); /* Opcode FF /0 */ | |
| 7629 ins_encode( OpcP, RMopc_Mem(0x00,dst)); | |
| 7630 ins_pipe( ialu_mem_imm ); | |
| 7631 %} | |
| 7632 | |
| 7633 instruct decI_mem(memory dst, immI_M1 src, eFlagsReg cr) %{ | |
| 7634 match(Set dst (StoreI dst (AddI (LoadI dst) src))); | |
| 7635 effect(KILL cr); | |
| 7636 | |
| 7637 ins_cost(125); | |
| 7638 format %{ "DEC $dst" %} | |
| 7639 opcode(0xFF); /* Opcode FF /1 */ | |
| 7640 ins_encode( OpcP, RMopc_Mem(0x01,dst)); | |
| 7641 ins_pipe( ialu_mem_imm ); | |
| 7642 %} | |
| 7643 | |
| 7644 | |
| 7645 instruct checkCastPP( eRegP dst ) %{ | |
| 7646 match(Set dst (CheckCastPP dst)); | |
| 7647 | |
| 7648 size(0); | |
| 7649 format %{ "#checkcastPP of $dst" %} | |
| 7650 ins_encode( /*empty encoding*/ ); | |
| 7651 ins_pipe( empty ); | |
| 7652 %} | |
| 7653 | |
| 7654 instruct castPP( eRegP dst ) %{ | |
| 7655 match(Set dst (CastPP dst)); | |
| 7656 format %{ "#castPP of $dst" %} | |
| 7657 ins_encode( /*empty encoding*/ ); | |
| 7658 ins_pipe( empty ); | |
| 7659 %} | |
| 7660 | |
| 7661 instruct castII( eRegI dst ) %{ | |
| 7662 match(Set dst (CastII dst)); | |
| 7663 format %{ "#castII of $dst" %} | |
| 7664 ins_encode( /*empty encoding*/ ); | |
| 7665 ins_cost(0); | |
| 7666 ins_pipe( empty ); | |
| 7667 %} | |
| 7668 | |
| 7669 | |
| 7670 // Load-locked - same as a regular pointer load when used with compare-swap | |
| 7671 instruct loadPLocked(eRegP dst, memory mem) %{ | |
| 7672 match(Set dst (LoadPLocked mem)); | |
| 7673 | |
| 7674 ins_cost(125); | |
| 7675 format %{ "MOV $dst,$mem\t# Load ptr. locked" %} | |
| 7676 opcode(0x8B); | |
| 7677 ins_encode( OpcP, RegMem(dst,mem)); | |
| 7678 ins_pipe( ialu_reg_mem ); | |
| 7679 %} | |
| 7680 | |
| 7681 // LoadLong-locked - same as a volatile long load when used with compare-swap | |
| 7682 instruct loadLLocked(stackSlotL dst, load_long_memory mem) %{ | |
| 7683 predicate(UseSSE<=1); | |
| 7684 match(Set dst (LoadLLocked mem)); | |
| 7685 | |
| 7686 ins_cost(200); | |
| 7687 format %{ "FILD $mem\t# Atomic volatile long load\n\t" | |
| 7688 "FISTp $dst" %} | |
| 7689 ins_encode(enc_loadL_volatile(mem,dst)); | |
| 7690 ins_pipe( fpu_reg_mem ); | |
| 7691 %} | |
| 7692 | |
| 7693 instruct loadLX_Locked(stackSlotL dst, load_long_memory mem, regXD tmp) %{ | |
| 7694 predicate(UseSSE>=2); | |
| 7695 match(Set dst (LoadLLocked mem)); | |
| 7696 effect(TEMP tmp); | |
| 7697 ins_cost(180); | |
| 7698 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
| 7699 "MOVSD $dst,$tmp" %} | |
| 7700 ins_encode(enc_loadLX_volatile(mem, dst, tmp)); | |
| 7701 ins_pipe( pipe_slow ); | |
| 7702 %} | |
| 7703 | |
| 7704 instruct loadLX_reg_Locked(eRegL dst, load_long_memory mem, regXD tmp) %{ | |
| 7705 predicate(UseSSE>=2); | |
| 7706 match(Set dst (LoadLLocked mem)); | |
| 7707 effect(TEMP tmp); | |
| 7708 ins_cost(160); | |
| 7709 format %{ "MOVSD $tmp,$mem\t# Atomic volatile long load\n\t" | |
| 7710 "MOVD $dst.lo,$tmp\n\t" | |
| 7711 "PSRLQ $tmp,32\n\t" | |
| 7712 "MOVD $dst.hi,$tmp" %} | |
| 7713 ins_encode(enc_loadLX_reg_volatile(mem, dst, tmp)); | |
| 7714 ins_pipe( pipe_slow ); | |
| 7715 %} | |
| 7716 | |
| 7717 // Conditional-store of the updated heap-top. | |
| 7718 // Used during allocation of the shared heap. | |
| 7719 // Sets flags (EQ) on success. Implemented with a CMPXCHG on Intel. | |
| 7720 instruct storePConditional( memory heap_top_ptr, eAXRegP oldval, eRegP newval, eFlagsReg cr ) %{ | |
| 7721 match(Set cr (StorePConditional heap_top_ptr (Binary oldval newval))); | |
| 7722 // EAX is killed if there is contention, but then it's also unused. | |
| 7723 // In the common case of no contention, EAX holds the new oop address. | |
| 7724 format %{ "CMPXCHG $heap_top_ptr,$newval\t# If EAX==$heap_top_ptr Then store $newval into $heap_top_ptr" %} | |
| 7725 ins_encode( lock_prefix, Opcode(0x0F), Opcode(0xB1), RegMem(newval,heap_top_ptr) ); | |
| 7726 ins_pipe( pipe_cmpxchg ); | |
| 7727 %} | |
| 7728 | |
| 7729 // Conditional-store of a long value | |
| 7730 // Returns a boolean value (0/1) on success. Implemented with a CMPXCHG8 on Intel. | |
| 7731 // mem_ptr can actually be in either ESI or EDI | |
| 7732 instruct storeLConditional( eRegI res, eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr ) %{ | |
| 7733 match(Set res (StoreLConditional mem_ptr (Binary oldval newval))); | |
| 7734 effect(KILL cr); | |
| 7735 // EDX:EAX is killed if there is contention, but then it's also unused. | |
| 7736 // In the common case of no contention, EDX:EAX holds the new oop address. | |
| 7737 format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EDX:EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
| 7738 "MOV $res,0\n\t" | |
| 7739 "JNE,s fail\n\t" | |
| 7740 "MOV $res,1\n" | |
| 7741 "fail:" %} | |
| 7742 ins_encode( enc_cmpxchg8(mem_ptr), | |
| 7743 enc_flags_ne_to_boolean(res) ); | |
| 7744 ins_pipe( pipe_cmpxchg ); | |
| 7745 %} | |
| 7746 | |
| 7747 // Conditional-store of a long value | |
| 7748 // ZF flag is set on success, reset otherwise. Implemented with a CMPXCHG8 on Intel. | |
| 7749 // mem_ptr can actually be in either ESI or EDI | |
| 7750 instruct storeLConditional_flags( eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr, immI0 zero ) %{ | |
| 7751 match(Set cr (CmpI (StoreLConditional mem_ptr (Binary oldval newval)) zero)); | |
| 7752 // EDX:EAX is killed if there is contention, but then it's also unused. | |
| 7753 // In the common case of no contention, EDX:EAX holds the new oop address. | |
| 7754 format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" %} | |
| 7755 ins_encode( enc_cmpxchg8(mem_ptr) ); | |
| 7756 ins_pipe( pipe_cmpxchg ); | |
| 7757 %} | |
| 7758 | |
| 7759 // No flag versions for CompareAndSwap{P,I,L} because matcher can't match them | |
| 7760 | |
| 7761 instruct compareAndSwapL( eRegI res, eSIRegP mem_ptr, eADXRegL oldval, eBCXRegL newval, eFlagsReg cr ) %{ | |
| 7762 match(Set res (CompareAndSwapL mem_ptr (Binary oldval newval))); | |
| 7763 effect(KILL cr, KILL oldval); | |
| 7764 format %{ "CMPXCHG8 [$mem_ptr],$newval\t# If EDX:EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
| 7765 "MOV $res,0\n\t" | |
| 7766 "JNE,s fail\n\t" | |
| 7767 "MOV $res,1\n" | |
| 7768 "fail:" %} | |
| 7769 ins_encode( enc_cmpxchg8(mem_ptr), | |
| 7770 enc_flags_ne_to_boolean(res) ); | |
| 7771 ins_pipe( pipe_cmpxchg ); | |
| 7772 %} | |
| 7773 | |
| 7774 instruct compareAndSwapP( eRegI res, pRegP mem_ptr, eAXRegP oldval, eCXRegP newval, eFlagsReg cr) %{ | |
| 7775 match(Set res (CompareAndSwapP mem_ptr (Binary oldval newval))); | |
| 7776 effect(KILL cr, KILL oldval); | |
| 7777 format %{ "CMPXCHG [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
| 7778 "MOV $res,0\n\t" | |
| 7779 "JNE,s fail\n\t" | |
| 7780 "MOV $res,1\n" | |
| 7781 "fail:" %} | |
| 7782 ins_encode( enc_cmpxchg(mem_ptr), enc_flags_ne_to_boolean(res) ); | |
| 7783 ins_pipe( pipe_cmpxchg ); | |
| 7784 %} | |
| 7785 | |
| 7786 instruct compareAndSwapI( eRegI res, pRegP mem_ptr, eAXRegI oldval, eCXRegI newval, eFlagsReg cr) %{ | |
| 7787 match(Set res (CompareAndSwapI mem_ptr (Binary oldval newval))); | |
| 7788 effect(KILL cr, KILL oldval); | |
| 7789 format %{ "CMPXCHG [$mem_ptr],$newval\t# If EAX==[$mem_ptr] Then store $newval into [$mem_ptr]\n\t" | |
| 7790 "MOV $res,0\n\t" | |
| 7791 "JNE,s fail\n\t" | |
| 7792 "MOV $res,1\n" | |
| 7793 "fail:" %} | |
| 7794 ins_encode( enc_cmpxchg(mem_ptr), enc_flags_ne_to_boolean(res) ); | |
| 7795 ins_pipe( pipe_cmpxchg ); | |
| 7796 %} | |
| 7797 | |
| 7798 //----------Subtraction Instructions------------------------------------------- | |
| 7799 // Integer Subtraction Instructions | |
| 7800 instruct subI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
| 7801 match(Set dst (SubI dst src)); | |
| 7802 effect(KILL cr); | |
| 7803 | |
| 7804 size(2); | |
| 7805 format %{ "SUB $dst,$src" %} | |
| 7806 opcode(0x2B); | |
| 7807 ins_encode( OpcP, RegReg( dst, src) ); | |
| 7808 ins_pipe( ialu_reg_reg ); | |
| 7809 %} | |
| 7810 | |
| 7811 instruct subI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
| 7812 match(Set dst (SubI dst src)); | |
| 7813 effect(KILL cr); | |
| 7814 | |
| 7815 format %{ "SUB $dst,$src" %} | |
| 7816 opcode(0x81,0x05); /* Opcode 81 /5 */ | |
| 7817 // ins_encode( RegImm( dst, src) ); | |
| 7818 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
| 7819 ins_pipe( ialu_reg ); | |
| 7820 %} | |
| 7821 | |
| 7822 instruct subI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
| 7823 match(Set dst (SubI dst (LoadI src))); | |
| 7824 effect(KILL cr); | |
| 7825 | |
| 7826 ins_cost(125); | |
| 7827 format %{ "SUB $dst,$src" %} | |
| 7828 opcode(0x2B); | |
| 7829 ins_encode( OpcP, RegMem( dst, src) ); | |
| 7830 ins_pipe( ialu_reg_mem ); | |
| 7831 %} | |
| 7832 | |
| 7833 instruct subI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
| 7834 match(Set dst (StoreI dst (SubI (LoadI dst) src))); | |
| 7835 effect(KILL cr); | |
| 7836 | |
| 7837 ins_cost(150); | |
| 7838 format %{ "SUB $dst,$src" %} | |
| 7839 opcode(0x29); /* Opcode 29 /r */ | |
| 7840 ins_encode( OpcP, RegMem( src, dst ) ); | |
| 7841 ins_pipe( ialu_mem_reg ); | |
| 7842 %} | |
| 7843 | |
| 7844 // Subtract from a pointer | |
| 7845 instruct subP_eReg(eRegP dst, eRegI src, immI0 zero, eFlagsReg cr) %{ | |
| 7846 match(Set dst (AddP dst (SubI zero src))); | |
| 7847 effect(KILL cr); | |
| 7848 | |
| 7849 size(2); | |
| 7850 format %{ "SUB $dst,$src" %} | |
| 7851 opcode(0x2B); | |
| 7852 ins_encode( OpcP, RegReg( dst, src) ); | |
| 7853 ins_pipe( ialu_reg_reg ); | |
| 7854 %} | |
| 7855 | |
| 7856 instruct negI_eReg(eRegI dst, immI0 zero, eFlagsReg cr) %{ | |
| 7857 match(Set dst (SubI zero dst)); | |
| 7858 effect(KILL cr); | |
| 7859 | |
| 7860 size(2); | |
| 7861 format %{ "NEG $dst" %} | |
| 7862 opcode(0xF7,0x03); // Opcode F7 /3 | |
| 7863 ins_encode( OpcP, RegOpc( dst ) ); | |
| 7864 ins_pipe( ialu_reg ); | |
| 7865 %} | |
| 7866 | |
| 7867 | |
| 7868 //----------Multiplication/Division Instructions------------------------------- | |
| 7869 // Integer Multiplication Instructions | |
| 7870 // Multiply Register | |
| 7871 instruct mulI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
| 7872 match(Set dst (MulI dst src)); | |
| 7873 effect(KILL cr); | |
| 7874 | |
| 7875 size(3); | |
| 7876 ins_cost(300); | |
| 7877 format %{ "IMUL $dst,$src" %} | |
| 7878 opcode(0xAF, 0x0F); | |
| 7879 ins_encode( OpcS, OpcP, RegReg( dst, src) ); | |
| 7880 ins_pipe( ialu_reg_reg_alu0 ); | |
| 7881 %} | |
| 7882 | |
| 7883 // Multiply 32-bit Immediate | |
| 7884 instruct mulI_eReg_imm(eRegI dst, eRegI src, immI imm, eFlagsReg cr) %{ | |
| 7885 match(Set dst (MulI src imm)); | |
| 7886 effect(KILL cr); | |
| 7887 | |
| 7888 ins_cost(300); | |
| 7889 format %{ "IMUL $dst,$src,$imm" %} | |
| 7890 opcode(0x69); /* 69 /r id */ | |
| 7891 ins_encode( OpcSE(imm), RegReg( dst, src ), Con8or32( imm ) ); | |
| 7892 ins_pipe( ialu_reg_reg_alu0 ); | |
| 7893 %} | |
| 7894 | |
| 7895 instruct loadConL_low_only(eADXRegL_low_only dst, immL32 src, eFlagsReg cr) %{ | |
| 7896 match(Set dst src); | |
| 7897 effect(KILL cr); | |
| 7898 | |
| 7899 // Note that this is artificially increased to make it more expensive than loadConL | |
| 7900 ins_cost(250); | |
| 7901 format %{ "MOV EAX,$src\t// low word only" %} | |
| 7902 opcode(0xB8); | |
| 7903 ins_encode( LdImmL_Lo(dst, src) ); | |
| 7904 ins_pipe( ialu_reg_fat ); | |
| 7905 %} | |
| 7906 | |
| 7907 // Multiply by 32-bit Immediate, taking the shifted high order results | |
| 7908 // (special case for shift by 32) | |
| 7909 instruct mulI_imm_high(eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32 cnt, eFlagsReg cr) %{ | |
| 7910 match(Set dst (ConvL2I (RShiftL (MulL (ConvI2L src1) src2) cnt))); | |
| 7911 predicate( _kids[0]->_kids[0]->_kids[1]->_leaf->Opcode() == Op_ConL && | |
| 7912 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() >= min_jint && | |
| 7913 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() <= max_jint ); | |
| 7914 effect(USE src1, KILL cr); | |
| 7915 | |
| 7916 // Note that this is adjusted by 150 to compensate for the overcosting of loadConL_low_only | |
| 7917 ins_cost(0*100 + 1*400 - 150); | |
| 7918 format %{ "IMUL EDX:EAX,$src1" %} | |
| 7919 ins_encode( multiply_con_and_shift_high( dst, src1, src2, cnt, cr ) ); | |
| 7920 ins_pipe( pipe_slow ); | |
| 7921 %} | |
| 7922 | |
| 7923 // Multiply by 32-bit Immediate, taking the shifted high order results | |
| 7924 instruct mulI_imm_RShift_high(eDXRegI dst, nadxRegI src1, eADXRegL_low_only src2, immI_32_63 cnt, eFlagsReg cr) %{ | |
| 7925 match(Set dst (ConvL2I (RShiftL (MulL (ConvI2L src1) src2) cnt))); | |
| 7926 predicate( _kids[0]->_kids[0]->_kids[1]->_leaf->Opcode() == Op_ConL && | |
| 7927 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() >= min_jint && | |
| 7928 _kids[0]->_kids[0]->_kids[1]->_leaf->as_Type()->type()->is_long()->get_con() <= max_jint ); | |
| 7929 effect(USE src1, KILL cr); | |
| 7930 | |
| 7931 // Note that this is adjusted by 150 to compensate for the overcosting of loadConL_low_only | |
| 7932 ins_cost(1*100 + 1*400 - 150); | |
| 7933 format %{ "IMUL EDX:EAX,$src1\n\t" | |
| 7934 "SAR EDX,$cnt-32" %} | |
| 7935 ins_encode( multiply_con_and_shift_high( dst, src1, src2, cnt, cr ) ); | |
| 7936 ins_pipe( pipe_slow ); | |
| 7937 %} | |
| 7938 | |
| 7939 // Multiply Memory 32-bit Immediate | |
| 7940 instruct mulI_mem_imm(eRegI dst, memory src, immI imm, eFlagsReg cr) %{ | |
| 7941 match(Set dst (MulI (LoadI src) imm)); | |
| 7942 effect(KILL cr); | |
| 7943 | |
| 7944 ins_cost(300); | |
| 7945 format %{ "IMUL $dst,$src,$imm" %} | |
| 7946 opcode(0x69); /* 69 /r id */ | |
| 7947 ins_encode( OpcSE(imm), RegMem( dst, src ), Con8or32( imm ) ); | |
| 7948 ins_pipe( ialu_reg_mem_alu0 ); | |
| 7949 %} | |
| 7950 | |
| 7951 // Multiply Memory | |
| 7952 instruct mulI(eRegI dst, memory src, eFlagsReg cr) %{ | |
| 7953 match(Set dst (MulI dst (LoadI src))); | |
| 7954 effect(KILL cr); | |
| 7955 | |
| 7956 ins_cost(350); | |
| 7957 format %{ "IMUL $dst,$src" %} | |
| 7958 opcode(0xAF, 0x0F); | |
| 7959 ins_encode( OpcS, OpcP, RegMem( dst, src) ); | |
| 7960 ins_pipe( ialu_reg_mem_alu0 ); | |
| 7961 %} | |
| 7962 | |
| 7963 // Multiply Register Int to Long | |
| 7964 instruct mulI2L(eADXRegL dst, eAXRegI src, nadxRegI src1, eFlagsReg flags) %{ | |
| 7965 // Basic Idea: long = (long)int * (long)int | |
| 7966 match(Set dst (MulL (ConvI2L src) (ConvI2L src1))); | |
| 7967 effect(DEF dst, USE src, USE src1, KILL flags); | |
| 7968 | |
| 7969 ins_cost(300); | |
| 7970 format %{ "IMUL $dst,$src1" %} | |
| 7971 | |
| 7972 ins_encode( long_int_multiply( dst, src1 ) ); | |
| 7973 ins_pipe( ialu_reg_reg_alu0 ); | |
| 7974 %} | |
| 7975 | |
| 7976 instruct mulIS_eReg(eADXRegL dst, immL_32bits mask, eFlagsReg flags, eAXRegI src, nadxRegI src1) %{ | |
| 7977 // Basic Idea: long = (int & 0xffffffffL) * (int & 0xffffffffL) | |
| 7978 match(Set dst (MulL (AndL (ConvI2L src) mask) (AndL (ConvI2L src1) mask))); | |
| 7979 effect(KILL flags); | |
| 7980 | |
| 7981 ins_cost(300); | |
| 7982 format %{ "MUL $dst,$src1" %} | |
| 7983 | |
| 7984 ins_encode( long_uint_multiply(dst, src1) ); | |
| 7985 ins_pipe( ialu_reg_reg_alu0 ); | |
| 7986 %} | |
| 7987 | |
| 7988 // Multiply Register Long | |
| 7989 instruct mulL_eReg(eADXRegL dst, eRegL src, eRegI tmp, eFlagsReg cr) %{ | |
| 7990 match(Set dst (MulL dst src)); | |
| 7991 effect(KILL cr, TEMP tmp); | |
| 7992 ins_cost(4*100+3*400); | |
| 7993 // Basic idea: lo(result) = lo(x_lo * y_lo) | |
| 7994 // hi(result) = hi(x_lo * y_lo) + lo(x_hi * y_lo) + lo(x_lo * y_hi) | |
| 7995 format %{ "MOV $tmp,$src.lo\n\t" | |
| 7996 "IMUL $tmp,EDX\n\t" | |
| 7997 "MOV EDX,$src.hi\n\t" | |
| 7998 "IMUL EDX,EAX\n\t" | |
| 7999 "ADD $tmp,EDX\n\t" | |
| 8000 "MUL EDX:EAX,$src.lo\n\t" | |
| 8001 "ADD EDX,$tmp" %} | |
| 8002 ins_encode( long_multiply( dst, src, tmp ) ); | |
| 8003 ins_pipe( pipe_slow ); | |
| 8004 %} | |
| 8005 | |
| 8006 // Multiply Register Long by small constant | |
| 8007 instruct mulL_eReg_con(eADXRegL dst, immL_127 src, eRegI tmp, eFlagsReg cr) %{ | |
| 8008 match(Set dst (MulL dst src)); | |
| 8009 effect(KILL cr, TEMP tmp); | |
| 8010 ins_cost(2*100+2*400); | |
| 8011 size(12); | |
| 8012 // Basic idea: lo(result) = lo(src * EAX) | |
| 8013 // hi(result) = hi(src * EAX) + lo(src * EDX) | |
| 8014 format %{ "IMUL $tmp,EDX,$src\n\t" | |
| 8015 "MOV EDX,$src\n\t" | |
| 8016 "MUL EDX\t# EDX*EAX -> EDX:EAX\n\t" | |
| 8017 "ADD EDX,$tmp" %} | |
| 8018 ins_encode( long_multiply_con( dst, src, tmp ) ); | |
| 8019 ins_pipe( pipe_slow ); | |
| 8020 %} | |
| 8021 | |
| 8022 // Integer DIV with Register | |
| 8023 instruct divI_eReg(eAXRegI rax, eDXRegI rdx, eCXRegI div, eFlagsReg cr) %{ | |
| 8024 match(Set rax (DivI rax div)); | |
| 8025 effect(KILL rdx, KILL cr); | |
| 8026 size(26); | |
| 8027 ins_cost(30*100+10*100); | |
| 8028 format %{ "CMP EAX,0x80000000\n\t" | |
| 8029 "JNE,s normal\n\t" | |
| 8030 "XOR EDX,EDX\n\t" | |
| 8031 "CMP ECX,-1\n\t" | |
| 8032 "JE,s done\n" | |
| 8033 "normal: CDQ\n\t" | |
| 8034 "IDIV $div\n\t" | |
| 8035 "done:" %} | |
| 8036 opcode(0xF7, 0x7); /* Opcode F7 /7 */ | |
| 8037 ins_encode( cdq_enc, OpcP, RegOpc(div) ); | |
| 8038 ins_pipe( ialu_reg_reg_alu0 ); | |
| 8039 %} | |
| 8040 | |
| 8041 // Divide Register Long | |
| 8042 instruct divL_eReg( eADXRegL dst, eRegL src1, eRegL src2, eFlagsReg cr, eCXRegI cx, eBXRegI bx ) %{ | |
| 8043 match(Set dst (DivL src1 src2)); | |
| 8044 effect( KILL cr, KILL cx, KILL bx ); | |
| 8045 ins_cost(10000); | |
| 8046 format %{ "PUSH $src1.hi\n\t" | |
| 8047 "PUSH $src1.lo\n\t" | |
| 8048 "PUSH $src2.hi\n\t" | |
| 8049 "PUSH $src2.lo\n\t" | |
| 8050 "CALL SharedRuntime::ldiv\n\t" | |
| 8051 "ADD ESP,16" %} | |
| 8052 ins_encode( long_div(src1,src2) ); | |
| 8053 ins_pipe( pipe_slow ); | |
| 8054 %} | |
| 8055 | |
| 8056 // Integer DIVMOD with Register, both quotient and mod results | |
| 8057 instruct divModI_eReg_divmod(eAXRegI rax, eDXRegI rdx, eCXRegI div, eFlagsReg cr) %{ | |
| 8058 match(DivModI rax div); | |
| 8059 effect(KILL cr); | |
| 8060 size(26); | |
| 8061 ins_cost(30*100+10*100); | |
| 8062 format %{ "CMP EAX,0x80000000\n\t" | |
| 8063 "JNE,s normal\n\t" | |
| 8064 "XOR EDX,EDX\n\t" | |
| 8065 "CMP ECX,-1\n\t" | |
| 8066 "JE,s done\n" | |
| 8067 "normal: CDQ\n\t" | |
| 8068 "IDIV $div\n\t" | |
| 8069 "done:" %} | |
| 8070 opcode(0xF7, 0x7); /* Opcode F7 /7 */ | |
| 8071 ins_encode( cdq_enc, OpcP, RegOpc(div) ); | |
| 8072 ins_pipe( pipe_slow ); | |
| 8073 %} | |
| 8074 | |
| 8075 // Integer MOD with Register | |
| 8076 instruct modI_eReg(eDXRegI rdx, eAXRegI rax, eCXRegI div, eFlagsReg cr) %{ | |
| 8077 match(Set rdx (ModI rax div)); | |
| 8078 effect(KILL rax, KILL cr); | |
| 8079 | |
| 8080 size(26); | |
| 8081 ins_cost(300); | |
| 8082 format %{ "CDQ\n\t" | |
| 8083 "IDIV $div" %} | |
| 8084 opcode(0xF7, 0x7); /* Opcode F7 /7 */ | |
| 8085 ins_encode( cdq_enc, OpcP, RegOpc(div) ); | |
| 8086 ins_pipe( ialu_reg_reg_alu0 ); | |
| 8087 %} | |
| 8088 | |
| 8089 // Remainder Register Long | |
| 8090 instruct modL_eReg( eADXRegL dst, eRegL src1, eRegL src2, eFlagsReg cr, eCXRegI cx, eBXRegI bx ) %{ | |
| 8091 match(Set dst (ModL src1 src2)); | |
| 8092 effect( KILL cr, KILL cx, KILL bx ); | |
| 8093 ins_cost(10000); | |
| 8094 format %{ "PUSH $src1.hi\n\t" | |
| 8095 "PUSH $src1.lo\n\t" | |
| 8096 "PUSH $src2.hi\n\t" | |
| 8097 "PUSH $src2.lo\n\t" | |
| 8098 "CALL SharedRuntime::lrem\n\t" | |
| 8099 "ADD ESP,16" %} | |
| 8100 ins_encode( long_mod(src1,src2) ); | |
| 8101 ins_pipe( pipe_slow ); | |
| 8102 %} | |
| 8103 | |
| 8104 // Integer Shift Instructions | |
| 8105 // Shift Left by one | |
| 8106 instruct shlI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
| 8107 match(Set dst (LShiftI dst shift)); | |
| 8108 effect(KILL cr); | |
| 8109 | |
| 8110 size(2); | |
| 8111 format %{ "SHL $dst,$shift" %} | |
| 8112 opcode(0xD1, 0x4); /* D1 /4 */ | |
| 8113 ins_encode( OpcP, RegOpc( dst ) ); | |
| 8114 ins_pipe( ialu_reg ); | |
| 8115 %} | |
| 8116 | |
| 8117 // Shift Left by 8-bit immediate | |
| 8118 instruct salI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
| 8119 match(Set dst (LShiftI dst shift)); | |
| 8120 effect(KILL cr); | |
| 8121 | |
| 8122 size(3); | |
| 8123 format %{ "SHL $dst,$shift" %} | |
| 8124 opcode(0xC1, 0x4); /* C1 /4 ib */ | |
| 8125 ins_encode( RegOpcImm( dst, shift) ); | |
| 8126 ins_pipe( ialu_reg ); | |
| 8127 %} | |
| 8128 | |
| 8129 // Shift Left by variable | |
| 8130 instruct salI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
| 8131 match(Set dst (LShiftI dst shift)); | |
| 8132 effect(KILL cr); | |
| 8133 | |
| 8134 size(2); | |
| 8135 format %{ "SHL $dst,$shift" %} | |
| 8136 opcode(0xD3, 0x4); /* D3 /4 */ | |
| 8137 ins_encode( OpcP, RegOpc( dst ) ); | |
| 8138 ins_pipe( ialu_reg_reg ); | |
| 8139 %} | |
| 8140 | |
| 8141 // Arithmetic shift right by one | |
| 8142 instruct sarI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
| 8143 match(Set dst (RShiftI dst shift)); | |
| 8144 effect(KILL cr); | |
| 8145 | |
| 8146 size(2); | |
| 8147 format %{ "SAR $dst,$shift" %} | |
| 8148 opcode(0xD1, 0x7); /* D1 /7 */ | |
| 8149 ins_encode( OpcP, RegOpc( dst ) ); | |
| 8150 ins_pipe( ialu_reg ); | |
| 8151 %} | |
| 8152 | |
| 8153 // Arithmetic shift right by one | |
| 8154 instruct sarI_mem_1(memory dst, immI1 shift, eFlagsReg cr) %{ | |
| 8155 match(Set dst (StoreI dst (RShiftI (LoadI dst) shift))); | |
| 8156 effect(KILL cr); | |
| 8157 format %{ "SAR $dst,$shift" %} | |
| 8158 opcode(0xD1, 0x7); /* D1 /7 */ | |
| 8159 ins_encode( OpcP, RMopc_Mem(secondary,dst) ); | |
| 8160 ins_pipe( ialu_mem_imm ); | |
| 8161 %} | |
| 8162 | |
| 8163 // Arithmetic Shift Right by 8-bit immediate | |
| 8164 instruct sarI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
| 8165 match(Set dst (RShiftI dst shift)); | |
| 8166 effect(KILL cr); | |
| 8167 | |
| 8168 size(3); | |
| 8169 format %{ "SAR $dst,$shift" %} | |
| 8170 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
| 8171 ins_encode( RegOpcImm( dst, shift ) ); | |
| 8172 ins_pipe( ialu_mem_imm ); | |
| 8173 %} | |
| 8174 | |
| 8175 // Arithmetic Shift Right by 8-bit immediate | |
| 8176 instruct sarI_mem_imm(memory dst, immI8 shift, eFlagsReg cr) %{ | |
| 8177 match(Set dst (StoreI dst (RShiftI (LoadI dst) shift))); | |
| 8178 effect(KILL cr); | |
| 8179 | |
| 8180 format %{ "SAR $dst,$shift" %} | |
| 8181 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
| 8182 ins_encode( OpcP, RMopc_Mem(secondary, dst ), Con8or32( shift ) ); | |
| 8183 ins_pipe( ialu_mem_imm ); | |
| 8184 %} | |
| 8185 | |
| 8186 // Arithmetic Shift Right by variable | |
| 8187 instruct sarI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
| 8188 match(Set dst (RShiftI dst shift)); | |
| 8189 effect(KILL cr); | |
| 8190 | |
| 8191 size(2); | |
| 8192 format %{ "SAR $dst,$shift" %} | |
| 8193 opcode(0xD3, 0x7); /* D3 /7 */ | |
| 8194 ins_encode( OpcP, RegOpc( dst ) ); | |
| 8195 ins_pipe( ialu_reg_reg ); | |
| 8196 %} | |
| 8197 | |
| 8198 // Logical shift right by one | |
| 8199 instruct shrI_eReg_1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
| 8200 match(Set dst (URShiftI dst shift)); | |
| 8201 effect(KILL cr); | |
| 8202 | |
| 8203 size(2); | |
| 8204 format %{ "SHR $dst,$shift" %} | |
| 8205 opcode(0xD1, 0x5); /* D1 /5 */ | |
| 8206 ins_encode( OpcP, RegOpc( dst ) ); | |
| 8207 ins_pipe( ialu_reg ); | |
| 8208 %} | |
| 8209 | |
| 8210 // Logical Shift Right by 8-bit immediate | |
| 8211 instruct shrI_eReg_imm(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
| 8212 match(Set dst (URShiftI dst shift)); | |
| 8213 effect(KILL cr); | |
| 8214 | |
| 8215 size(3); | |
| 8216 format %{ "SHR $dst,$shift" %} | |
| 8217 opcode(0xC1, 0x5); /* C1 /5 ib */ | |
| 8218 ins_encode( RegOpcImm( dst, shift) ); | |
| 8219 ins_pipe( ialu_reg ); | |
| 8220 %} | |
| 8221 | |
| 8222 // Logical Shift Right by 24, followed by Arithmetic Shift Left by 24. | |
| 8223 // This idiom is used by the compiler for the i2b bytecode. | |
| 8224 instruct i2b(eRegI dst, xRegI src, immI_24 twentyfour, eFlagsReg cr) %{ | |
| 8225 match(Set dst (RShiftI (LShiftI src twentyfour) twentyfour)); | |
| 8226 effect(KILL cr); | |
| 8227 | |
| 8228 size(3); | |
| 8229 format %{ "MOVSX $dst,$src :8" %} | |
| 8230 opcode(0xBE, 0x0F); | |
| 8231 ins_encode( OpcS, OpcP, RegReg( dst, src)); | |
| 8232 ins_pipe( ialu_reg_reg ); | |
| 8233 %} | |
| 8234 | |
| 8235 // Logical Shift Right by 16, followed by Arithmetic Shift Left by 16. | |
| 8236 // This idiom is used by the compiler the i2s bytecode. | |
| 8237 instruct i2s(eRegI dst, xRegI src, immI_16 sixteen, eFlagsReg cr) %{ | |
| 8238 match(Set dst (RShiftI (LShiftI src sixteen) sixteen)); | |
| 8239 effect(KILL cr); | |
| 8240 | |
| 8241 size(3); | |
| 8242 format %{ "MOVSX $dst,$src :16" %} | |
| 8243 opcode(0xBF, 0x0F); | |
| 8244 ins_encode( OpcS, OpcP, RegReg( dst, src)); | |
| 8245 ins_pipe( ialu_reg_reg ); | |
| 8246 %} | |
| 8247 | |
| 8248 | |
| 8249 // Logical Shift Right by variable | |
| 8250 instruct shrI_eReg_CL(eRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
| 8251 match(Set dst (URShiftI dst shift)); | |
| 8252 effect(KILL cr); | |
| 8253 | |
| 8254 size(2); | |
| 8255 format %{ "SHR $dst,$shift" %} | |
| 8256 opcode(0xD3, 0x5); /* D3 /5 */ | |
| 8257 ins_encode( OpcP, RegOpc( dst ) ); | |
| 8258 ins_pipe( ialu_reg_reg ); | |
| 8259 %} | |
| 8260 | |
| 8261 | |
| 8262 //----------Logical Instructions----------------------------------------------- | |
| 8263 //----------Integer Logical Instructions--------------------------------------- | |
| 8264 // And Instructions | |
| 8265 // And Register with Register | |
| 8266 instruct andI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
| 8267 match(Set dst (AndI dst src)); | |
| 8268 effect(KILL cr); | |
| 8269 | |
| 8270 size(2); | |
| 8271 format %{ "AND $dst,$src" %} | |
| 8272 opcode(0x23); | |
| 8273 ins_encode( OpcP, RegReg( dst, src) ); | |
| 8274 ins_pipe( ialu_reg_reg ); | |
| 8275 %} | |
| 8276 | |
| 8277 // And Register with Immediate | |
| 8278 instruct andI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
| 8279 match(Set dst (AndI dst src)); | |
| 8280 effect(KILL cr); | |
| 8281 | |
| 8282 format %{ "AND $dst,$src" %} | |
| 8283 opcode(0x81,0x04); /* Opcode 81 /4 */ | |
| 8284 // ins_encode( RegImm( dst, src) ); | |
| 8285 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
| 8286 ins_pipe( ialu_reg ); | |
| 8287 %} | |
| 8288 | |
| 8289 // And Register with Memory | |
| 8290 instruct andI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
| 8291 match(Set dst (AndI dst (LoadI src))); | |
| 8292 effect(KILL cr); | |
| 8293 | |
| 8294 ins_cost(125); | |
| 8295 format %{ "AND $dst,$src" %} | |
| 8296 opcode(0x23); | |
| 8297 ins_encode( OpcP, RegMem( dst, src) ); | |
| 8298 ins_pipe( ialu_reg_mem ); | |
| 8299 %} | |
| 8300 | |
| 8301 // And Memory with Register | |
| 8302 instruct andI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
| 8303 match(Set dst (StoreI dst (AndI (LoadI dst) src))); | |
| 8304 effect(KILL cr); | |
| 8305 | |
| 8306 ins_cost(150); | |
| 8307 format %{ "AND $dst,$src" %} | |
| 8308 opcode(0x21); /* Opcode 21 /r */ | |
| 8309 ins_encode( OpcP, RegMem( src, dst ) ); | |
| 8310 ins_pipe( ialu_mem_reg ); | |
| 8311 %} | |
| 8312 | |
| 8313 // And Memory with Immediate | |
| 8314 instruct andI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
| 8315 match(Set dst (StoreI dst (AndI (LoadI dst) src))); | |
| 8316 effect(KILL cr); | |
| 8317 | |
| 8318 ins_cost(125); | |
| 8319 format %{ "AND $dst,$src" %} | |
| 8320 opcode(0x81, 0x4); /* Opcode 81 /4 id */ | |
| 8321 // ins_encode( MemImm( dst, src) ); | |
| 8322 ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); | |
| 8323 ins_pipe( ialu_mem_imm ); | |
| 8324 %} | |
| 8325 | |
| 8326 // Or Instructions | |
| 8327 // Or Register with Register | |
| 8328 instruct orI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
| 8329 match(Set dst (OrI dst src)); | |
| 8330 effect(KILL cr); | |
| 8331 | |
| 8332 size(2); | |
| 8333 format %{ "OR $dst,$src" %} | |
| 8334 opcode(0x0B); | |
| 8335 ins_encode( OpcP, RegReg( dst, src) ); | |
| 8336 ins_pipe( ialu_reg_reg ); | |
| 8337 %} | |
| 8338 | |
| 8339 // Or Register with Immediate | |
| 8340 instruct orI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
| 8341 match(Set dst (OrI dst src)); | |
| 8342 effect(KILL cr); | |
| 8343 | |
| 8344 format %{ "OR $dst,$src" %} | |
| 8345 opcode(0x81,0x01); /* Opcode 81 /1 id */ | |
| 8346 // ins_encode( RegImm( dst, src) ); | |
| 8347 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
| 8348 ins_pipe( ialu_reg ); | |
| 8349 %} | |
| 8350 | |
| 8351 // Or Register with Memory | |
| 8352 instruct orI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
| 8353 match(Set dst (OrI dst (LoadI src))); | |
| 8354 effect(KILL cr); | |
| 8355 | |
| 8356 ins_cost(125); | |
| 8357 format %{ "OR $dst,$src" %} | |
| 8358 opcode(0x0B); | |
| 8359 ins_encode( OpcP, RegMem( dst, src) ); | |
| 8360 ins_pipe( ialu_reg_mem ); | |
| 8361 %} | |
| 8362 | |
| 8363 // Or Memory with Register | |
| 8364 instruct orI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
| 8365 match(Set dst (StoreI dst (OrI (LoadI dst) src))); | |
| 8366 effect(KILL cr); | |
| 8367 | |
| 8368 ins_cost(150); | |
| 8369 format %{ "OR $dst,$src" %} | |
| 8370 opcode(0x09); /* Opcode 09 /r */ | |
| 8371 ins_encode( OpcP, RegMem( src, dst ) ); | |
| 8372 ins_pipe( ialu_mem_reg ); | |
| 8373 %} | |
| 8374 | |
| 8375 // Or Memory with Immediate | |
| 8376 instruct orI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
| 8377 match(Set dst (StoreI dst (OrI (LoadI dst) src))); | |
| 8378 effect(KILL cr); | |
| 8379 | |
| 8380 ins_cost(125); | |
| 8381 format %{ "OR $dst,$src" %} | |
| 8382 opcode(0x81,0x1); /* Opcode 81 /1 id */ | |
| 8383 // ins_encode( MemImm( dst, src) ); | |
| 8384 ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); | |
| 8385 ins_pipe( ialu_mem_imm ); | |
| 8386 %} | |
| 8387 | |
| 8388 // ROL/ROR | |
| 8389 // ROL expand | |
| 8390 instruct rolI_eReg_imm1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
| 8391 effect(USE_DEF dst, USE shift, KILL cr); | |
| 8392 | |
| 8393 format %{ "ROL $dst, $shift" %} | |
| 8394 opcode(0xD1, 0x0); /* Opcode D1 /0 */ | |
| 8395 ins_encode( OpcP, RegOpc( dst )); | |
| 8396 ins_pipe( ialu_reg ); | |
| 8397 %} | |
| 8398 | |
| 8399 instruct rolI_eReg_imm8(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
| 8400 effect(USE_DEF dst, USE shift, KILL cr); | |
| 8401 | |
| 8402 format %{ "ROL $dst, $shift" %} | |
| 8403 opcode(0xC1, 0x0); /*Opcode /C1 /0 */ | |
| 8404 ins_encode( RegOpcImm(dst, shift) ); | |
| 8405 ins_pipe(ialu_reg); | |
| 8406 %} | |
| 8407 | |
| 8408 instruct rolI_eReg_CL(ncxRegI dst, eCXRegI shift, eFlagsReg cr) %{ | |
| 8409 effect(USE_DEF dst, USE shift, KILL cr); | |
| 8410 | |
| 8411 format %{ "ROL $dst, $shift" %} | |
| 8412 opcode(0xD3, 0x0); /* Opcode D3 /0 */ | |
| 8413 ins_encode(OpcP, RegOpc(dst)); | |
| 8414 ins_pipe( ialu_reg_reg ); | |
| 8415 %} | |
| 8416 // end of ROL expand | |
| 8417 | |
| 8418 // ROL 32bit by one once | |
| 8419 instruct rolI_eReg_i1(eRegI dst, immI1 lshift, immI_M1 rshift, eFlagsReg cr) %{ | |
| 8420 match(Set dst ( OrI (LShiftI dst lshift) (URShiftI dst rshift))); | |
| 8421 | |
| 8422 expand %{ | |
| 8423 rolI_eReg_imm1(dst, lshift, cr); | |
| 8424 %} | |
| 8425 %} | |
| 8426 | |
| 8427 // ROL 32bit var by imm8 once | |
| 8428 instruct rolI_eReg_i8(eRegI dst, immI8 lshift, immI8 rshift, eFlagsReg cr) %{ | |
| 8429 predicate( 0 == ((n->in(1)->in(2)->get_int() + n->in(2)->in(2)->get_int()) & 0x1f)); | |
| 8430 match(Set dst ( OrI (LShiftI dst lshift) (URShiftI dst rshift))); | |
| 8431 | |
| 8432 expand %{ | |
| 8433 rolI_eReg_imm8(dst, lshift, cr); | |
| 8434 %} | |
| 8435 %} | |
| 8436 | |
| 8437 // ROL 32bit var by var once | |
| 8438 instruct rolI_eReg_Var_C0(ncxRegI dst, eCXRegI shift, immI0 zero, eFlagsReg cr) %{ | |
| 8439 match(Set dst ( OrI (LShiftI dst shift) (URShiftI dst (SubI zero shift)))); | |
| 8440 | |
| 8441 expand %{ | |
| 8442 rolI_eReg_CL(dst, shift, cr); | |
| 8443 %} | |
| 8444 %} | |
| 8445 | |
| 8446 // ROL 32bit var by var once | |
| 8447 instruct rolI_eReg_Var_C32(ncxRegI dst, eCXRegI shift, immI_32 c32, eFlagsReg cr) %{ | |
| 8448 match(Set dst ( OrI (LShiftI dst shift) (URShiftI dst (SubI c32 shift)))); | |
| 8449 | |
| 8450 expand %{ | |
| 8451 rolI_eReg_CL(dst, shift, cr); | |
| 8452 %} | |
| 8453 %} | |
| 8454 | |
| 8455 // ROR expand | |
| 8456 instruct rorI_eReg_imm1(eRegI dst, immI1 shift, eFlagsReg cr) %{ | |
| 8457 effect(USE_DEF dst, USE shift, KILL cr); | |
| 8458 | |
| 8459 format %{ "ROR $dst, $shift" %} | |
| 8460 opcode(0xD1,0x1); /* Opcode D1 /1 */ | |
| 8461 ins_encode( OpcP, RegOpc( dst ) ); | |
| 8462 ins_pipe( ialu_reg ); | |
| 8463 %} | |
| 8464 | |
| 8465 instruct rorI_eReg_imm8(eRegI dst, immI8 shift, eFlagsReg cr) %{ | |
| 8466 effect (USE_DEF dst, USE shift, KILL cr); | |
| 8467 | |
| 8468 format %{ "ROR $dst, $shift" %} | |
| 8469 opcode(0xC1, 0x1); /* Opcode /C1 /1 ib */ | |
| 8470 ins_encode( RegOpcImm(dst, shift) ); | |
| 8471 ins_pipe( ialu_reg ); | |
| 8472 %} | |
| 8473 | |
| 8474 instruct rorI_eReg_CL(ncxRegI dst, eCXRegI shift, eFlagsReg cr)%{ | |
| 8475 effect(USE_DEF dst, USE shift, KILL cr); | |
| 8476 | |
| 8477 format %{ "ROR $dst, $shift" %} | |
| 8478 opcode(0xD3, 0x1); /* Opcode D3 /1 */ | |
| 8479 ins_encode(OpcP, RegOpc(dst)); | |
| 8480 ins_pipe( ialu_reg_reg ); | |
| 8481 %} | |
| 8482 // end of ROR expand | |
| 8483 | |
| 8484 // ROR right once | |
| 8485 instruct rorI_eReg_i1(eRegI dst, immI1 rshift, immI_M1 lshift, eFlagsReg cr) %{ | |
| 8486 match(Set dst ( OrI (URShiftI dst rshift) (LShiftI dst lshift))); | |
| 8487 | |
| 8488 expand %{ | |
| 8489 rorI_eReg_imm1(dst, rshift, cr); | |
| 8490 %} | |
| 8491 %} | |
| 8492 | |
| 8493 // ROR 32bit by immI8 once | |
| 8494 instruct rorI_eReg_i8(eRegI dst, immI8 rshift, immI8 lshift, eFlagsReg cr) %{ | |
| 8495 predicate( 0 == ((n->in(1)->in(2)->get_int() + n->in(2)->in(2)->get_int()) & 0x1f)); | |
| 8496 match(Set dst ( OrI (URShiftI dst rshift) (LShiftI dst lshift))); | |
| 8497 | |
| 8498 expand %{ | |
| 8499 rorI_eReg_imm8(dst, rshift, cr); | |
| 8500 %} | |
| 8501 %} | |
| 8502 | |
| 8503 // ROR 32bit var by var once | |
| 8504 instruct rorI_eReg_Var_C0(ncxRegI dst, eCXRegI shift, immI0 zero, eFlagsReg cr) %{ | |
| 8505 match(Set dst ( OrI (URShiftI dst shift) (LShiftI dst (SubI zero shift)))); | |
| 8506 | |
| 8507 expand %{ | |
| 8508 rorI_eReg_CL(dst, shift, cr); | |
| 8509 %} | |
| 8510 %} | |
| 8511 | |
| 8512 // ROR 32bit var by var once | |
| 8513 instruct rorI_eReg_Var_C32(ncxRegI dst, eCXRegI shift, immI_32 c32, eFlagsReg cr) %{ | |
| 8514 match(Set dst ( OrI (URShiftI dst shift) (LShiftI dst (SubI c32 shift)))); | |
| 8515 | |
| 8516 expand %{ | |
| 8517 rorI_eReg_CL(dst, shift, cr); | |
| 8518 %} | |
| 8519 %} | |
| 8520 | |
| 8521 // Xor Instructions | |
| 8522 // Xor Register with Register | |
| 8523 instruct xorI_eReg(eRegI dst, eRegI src, eFlagsReg cr) %{ | |
| 8524 match(Set dst (XorI dst src)); | |
| 8525 effect(KILL cr); | |
| 8526 | |
| 8527 size(2); | |
| 8528 format %{ "XOR $dst,$src" %} | |
| 8529 opcode(0x33); | |
| 8530 ins_encode( OpcP, RegReg( dst, src) ); | |
| 8531 ins_pipe( ialu_reg_reg ); | |
| 8532 %} | |
| 8533 | |
| 8534 // Xor Register with Immediate | |
| 8535 instruct xorI_eReg_imm(eRegI dst, immI src, eFlagsReg cr) %{ | |
| 8536 match(Set dst (XorI dst src)); | |
| 8537 effect(KILL cr); | |
| 8538 | |
| 8539 format %{ "XOR $dst,$src" %} | |
| 8540 opcode(0x81,0x06); /* Opcode 81 /6 id */ | |
| 8541 // ins_encode( RegImm( dst, src) ); | |
| 8542 ins_encode( OpcSErm( dst, src ), Con8or32( src ) ); | |
| 8543 ins_pipe( ialu_reg ); | |
| 8544 %} | |
| 8545 | |
| 8546 // Xor Register with Memory | |
| 8547 instruct xorI_eReg_mem(eRegI dst, memory src, eFlagsReg cr) %{ | |
| 8548 match(Set dst (XorI dst (LoadI src))); | |
| 8549 effect(KILL cr); | |
| 8550 | |
| 8551 ins_cost(125); | |
| 8552 format %{ "XOR $dst,$src" %} | |
| 8553 opcode(0x33); | |
| 8554 ins_encode( OpcP, RegMem(dst, src) ); | |
| 8555 ins_pipe( ialu_reg_mem ); | |
| 8556 %} | |
| 8557 | |
| 8558 // Xor Memory with Register | |
| 8559 instruct xorI_mem_eReg(memory dst, eRegI src, eFlagsReg cr) %{ | |
| 8560 match(Set dst (StoreI dst (XorI (LoadI dst) src))); | |
| 8561 effect(KILL cr); | |
| 8562 | |
| 8563 ins_cost(150); | |
| 8564 format %{ "XOR $dst,$src" %} | |
| 8565 opcode(0x31); /* Opcode 31 /r */ | |
| 8566 ins_encode( OpcP, RegMem( src, dst ) ); | |
| 8567 ins_pipe( ialu_mem_reg ); | |
| 8568 %} | |
| 8569 | |
| 8570 // Xor Memory with Immediate | |
| 8571 instruct xorI_mem_imm(memory dst, immI src, eFlagsReg cr) %{ | |
| 8572 match(Set dst (StoreI dst (XorI (LoadI dst) src))); | |
| 8573 effect(KILL cr); | |
| 8574 | |
| 8575 ins_cost(125); | |
| 8576 format %{ "XOR $dst,$src" %} | |
| 8577 opcode(0x81,0x6); /* Opcode 81 /6 id */ | |
| 8578 ins_encode( OpcSE( src ), RMopc_Mem(secondary, dst ), Con8or32( src ) ); | |
| 8579 ins_pipe( ialu_mem_imm ); | |
| 8580 %} | |
| 8581 | |
| 8582 //----------Convert Int to Boolean--------------------------------------------- | |
| 8583 | |
| 8584 instruct movI_nocopy(eRegI dst, eRegI src) %{ | |
| 8585 effect( DEF dst, USE src ); | |
| 8586 format %{ "MOV $dst,$src" %} | |
| 8587 ins_encode( enc_Copy( dst, src) ); | |
| 8588 ins_pipe( ialu_reg_reg ); | |
| 8589 %} | |
| 8590 | |
| 8591 instruct ci2b( eRegI dst, eRegI src, eFlagsReg cr ) %{ | |
| 8592 effect( USE_DEF dst, USE src, KILL cr ); | |
| 8593 | |
| 8594 size(4); | |
| 8595 format %{ "NEG $dst\n\t" | |
| 8596 "ADC $dst,$src" %} | |
| 8597 ins_encode( neg_reg(dst), | |
| 8598 OpcRegReg(0x13,dst,src) ); | |
| 8599 ins_pipe( ialu_reg_reg_long ); | |
| 8600 %} | |
| 8601 | |
| 8602 instruct convI2B( eRegI dst, eRegI src, eFlagsReg cr ) %{ | |
| 8603 match(Set dst (Conv2B src)); | |
| 8604 | |
| 8605 expand %{ | |
| 8606 movI_nocopy(dst,src); | |
| 8607 ci2b(dst,src,cr); | |
| 8608 %} | |
| 8609 %} | |
| 8610 | |
| 8611 instruct movP_nocopy(eRegI dst, eRegP src) %{ | |
| 8612 effect( DEF dst, USE src ); | |
| 8613 format %{ "MOV $dst,$src" %} | |
| 8614 ins_encode( enc_Copy( dst, src) ); | |
| 8615 ins_pipe( ialu_reg_reg ); | |
| 8616 %} | |
| 8617 | |
| 8618 instruct cp2b( eRegI dst, eRegP src, eFlagsReg cr ) %{ | |
| 8619 effect( USE_DEF dst, USE src, KILL cr ); | |
| 8620 format %{ "NEG $dst\n\t" | |
| 8621 "ADC $dst,$src" %} | |
| 8622 ins_encode( neg_reg(dst), | |
| 8623 OpcRegReg(0x13,dst,src) ); | |
| 8624 ins_pipe( ialu_reg_reg_long ); | |
| 8625 %} | |
| 8626 | |
| 8627 instruct convP2B( eRegI dst, eRegP src, eFlagsReg cr ) %{ | |
| 8628 match(Set dst (Conv2B src)); | |
| 8629 | |
| 8630 expand %{ | |
| 8631 movP_nocopy(dst,src); | |
| 8632 cp2b(dst,src,cr); | |
| 8633 %} | |
| 8634 %} | |
| 8635 | |
| 8636 instruct cmpLTMask( eCXRegI dst, ncxRegI p, ncxRegI q, eFlagsReg cr ) %{ | |
| 8637 match(Set dst (CmpLTMask p q)); | |
| 8638 effect( KILL cr ); | |
| 8639 ins_cost(400); | |
| 8640 | |
| 8641 // SETlt can only use low byte of EAX,EBX, ECX, or EDX as destination | |
| 8642 format %{ "XOR $dst,$dst\n\t" | |
| 8643 "CMP $p,$q\n\t" | |
| 8644 "SETlt $dst\n\t" | |
| 8645 "NEG $dst" %} | |
| 8646 ins_encode( OpcRegReg(0x33,dst,dst), | |
| 8647 OpcRegReg(0x3B,p,q), | |
| 8648 setLT_reg(dst), neg_reg(dst) ); | |
| 8649 ins_pipe( pipe_slow ); | |
| 8650 %} | |
| 8651 | |
| 8652 instruct cmpLTMask0( eRegI dst, immI0 zero, eFlagsReg cr ) %{ | |
| 8653 match(Set dst (CmpLTMask dst zero)); | |
| 8654 effect( DEF dst, KILL cr ); | |
| 8655 ins_cost(100); | |
| 8656 | |
| 8657 format %{ "SAR $dst,31" %} | |
| 8658 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
| 8659 ins_encode( RegOpcImm( dst, 0x1F ) ); | |
| 8660 ins_pipe( ialu_reg ); | |
| 8661 %} | |
| 8662 | |
| 8663 | |
| 8664 instruct cadd_cmpLTMask( ncxRegI p, ncxRegI q, ncxRegI y, eCXRegI tmp, eFlagsReg cr ) %{ | |
| 8665 match(Set p (AddI (AndI (CmpLTMask p q) y) (SubI p q))); | |
| 8666 effect( KILL tmp, KILL cr ); | |
| 8667 ins_cost(400); | |
| 8668 // annoyingly, $tmp has no edges so you cant ask for it in | |
| 8669 // any format or encoding | |
| 8670 format %{ "SUB $p,$q\n\t" | |
| 8671 "SBB ECX,ECX\n\t" | |
| 8672 "AND ECX,$y\n\t" | |
| 8673 "ADD $p,ECX" %} | |
| 8674 ins_encode( enc_cmpLTP(p,q,y,tmp) ); | |
| 8675 ins_pipe( pipe_cmplt ); | |
| 8676 %} | |
| 8677 | |
| 8678 /* If I enable this, I encourage spilling in the inner loop of compress. | |
| 8679 instruct cadd_cmpLTMask_mem( ncxRegI p, ncxRegI q, memory y, eCXRegI tmp, eFlagsReg cr ) %{ | |
| 8680 match(Set p (AddI (AndI (CmpLTMask p q) (LoadI y)) (SubI p q))); | |
| 8681 effect( USE_KILL tmp, KILL cr ); | |
| 8682 ins_cost(400); | |
| 8683 | |
| 8684 format %{ "SUB $p,$q\n\t" | |
| 8685 "SBB ECX,ECX\n\t" | |
| 8686 "AND ECX,$y\n\t" | |
| 8687 "ADD $p,ECX" %} | |
| 8688 ins_encode( enc_cmpLTP_mem(p,q,y,tmp) ); | |
| 8689 %} | |
| 8690 */ | |
| 8691 | |
| 8692 //----------Long Instructions------------------------------------------------ | |
| 8693 // Add Long Register with Register | |
| 8694 instruct addL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
| 8695 match(Set dst (AddL dst src)); | |
| 8696 effect(KILL cr); | |
| 8697 ins_cost(200); | |
| 8698 format %{ "ADD $dst.lo,$src.lo\n\t" | |
| 8699 "ADC $dst.hi,$src.hi" %} | |
| 8700 opcode(0x03, 0x13); | |
| 8701 ins_encode( RegReg_Lo(dst, src), RegReg_Hi(dst,src) ); | |
| 8702 ins_pipe( ialu_reg_reg_long ); | |
| 8703 %} | |
| 8704 | |
| 8705 // Add Long Register with Immediate | |
| 8706 instruct addL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
| 8707 match(Set dst (AddL dst src)); | |
| 8708 effect(KILL cr); | |
| 8709 format %{ "ADD $dst.lo,$src.lo\n\t" | |
| 8710 "ADC $dst.hi,$src.hi" %} | |
| 8711 opcode(0x81,0x00,0x02); /* Opcode 81 /0, 81 /2 */ | |
| 8712 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
| 8713 ins_pipe( ialu_reg_long ); | |
| 8714 %} | |
| 8715 | |
| 8716 // Add Long Register with Memory | |
| 8717 instruct addL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
| 8718 match(Set dst (AddL dst (LoadL mem))); | |
| 8719 effect(KILL cr); | |
| 8720 ins_cost(125); | |
| 8721 format %{ "ADD $dst.lo,$mem\n\t" | |
| 8722 "ADC $dst.hi,$mem+4" %} | |
| 8723 opcode(0x03, 0x13); | |
| 8724 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
| 8725 ins_pipe( ialu_reg_long_mem ); | |
| 8726 %} | |
| 8727 | |
| 8728 // Subtract Long Register with Register. | |
| 8729 instruct subL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
| 8730 match(Set dst (SubL dst src)); | |
| 8731 effect(KILL cr); | |
| 8732 ins_cost(200); | |
| 8733 format %{ "SUB $dst.lo,$src.lo\n\t" | |
| 8734 "SBB $dst.hi,$src.hi" %} | |
| 8735 opcode(0x2B, 0x1B); | |
| 8736 ins_encode( RegReg_Lo(dst, src), RegReg_Hi(dst,src) ); | |
| 8737 ins_pipe( ialu_reg_reg_long ); | |
| 8738 %} | |
| 8739 | |
| 8740 // Subtract Long Register with Immediate | |
| 8741 instruct subL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
| 8742 match(Set dst (SubL dst src)); | |
| 8743 effect(KILL cr); | |
| 8744 format %{ "SUB $dst.lo,$src.lo\n\t" | |
| 8745 "SBB $dst.hi,$src.hi" %} | |
| 8746 opcode(0x81,0x05,0x03); /* Opcode 81 /5, 81 /3 */ | |
| 8747 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
| 8748 ins_pipe( ialu_reg_long ); | |
| 8749 %} | |
| 8750 | |
| 8751 // Subtract Long Register with Memory | |
| 8752 instruct subL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
| 8753 match(Set dst (SubL dst (LoadL mem))); | |
| 8754 effect(KILL cr); | |
| 8755 ins_cost(125); | |
| 8756 format %{ "SUB $dst.lo,$mem\n\t" | |
| 8757 "SBB $dst.hi,$mem+4" %} | |
| 8758 opcode(0x2B, 0x1B); | |
| 8759 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
| 8760 ins_pipe( ialu_reg_long_mem ); | |
| 8761 %} | |
| 8762 | |
| 8763 instruct negL_eReg(eRegL dst, immL0 zero, eFlagsReg cr) %{ | |
| 8764 match(Set dst (SubL zero dst)); | |
| 8765 effect(KILL cr); | |
| 8766 ins_cost(300); | |
| 8767 format %{ "NEG $dst.hi\n\tNEG $dst.lo\n\tSBB $dst.hi,0" %} | |
| 8768 ins_encode( neg_long(dst) ); | |
| 8769 ins_pipe( ialu_reg_reg_long ); | |
| 8770 %} | |
| 8771 | |
| 8772 // And Long Register with Register | |
| 8773 instruct andL_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
| 8774 match(Set dst (AndL dst src)); | |
| 8775 effect(KILL cr); | |
| 8776 format %{ "AND $dst.lo,$src.lo\n\t" | |
| 8777 "AND $dst.hi,$src.hi" %} | |
| 8778 opcode(0x23,0x23); | |
| 8779 ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); | |
| 8780 ins_pipe( ialu_reg_reg_long ); | |
| 8781 %} | |
| 8782 | |
| 8783 // And Long Register with Immediate | |
| 8784 instruct andL_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
| 8785 match(Set dst (AndL dst src)); | |
| 8786 effect(KILL cr); | |
| 8787 format %{ "AND $dst.lo,$src.lo\n\t" | |
| 8788 "AND $dst.hi,$src.hi" %} | |
| 8789 opcode(0x81,0x04,0x04); /* Opcode 81 /4, 81 /4 */ | |
| 8790 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
| 8791 ins_pipe( ialu_reg_long ); | |
| 8792 %} | |
| 8793 | |
| 8794 // And Long Register with Memory | |
| 8795 instruct andL_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
| 8796 match(Set dst (AndL dst (LoadL mem))); | |
| 8797 effect(KILL cr); | |
| 8798 ins_cost(125); | |
| 8799 format %{ "AND $dst.lo,$mem\n\t" | |
| 8800 "AND $dst.hi,$mem+4" %} | |
| 8801 opcode(0x23, 0x23); | |
| 8802 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
| 8803 ins_pipe( ialu_reg_long_mem ); | |
| 8804 %} | |
| 8805 | |
| 8806 // Or Long Register with Register | |
| 8807 instruct orl_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
| 8808 match(Set dst (OrL dst src)); | |
| 8809 effect(KILL cr); | |
| 8810 format %{ "OR $dst.lo,$src.lo\n\t" | |
| 8811 "OR $dst.hi,$src.hi" %} | |
| 8812 opcode(0x0B,0x0B); | |
| 8813 ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); | |
| 8814 ins_pipe( ialu_reg_reg_long ); | |
| 8815 %} | |
| 8816 | |
| 8817 // Or Long Register with Immediate | |
| 8818 instruct orl_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
| 8819 match(Set dst (OrL dst src)); | |
| 8820 effect(KILL cr); | |
| 8821 format %{ "OR $dst.lo,$src.lo\n\t" | |
| 8822 "OR $dst.hi,$src.hi" %} | |
| 8823 opcode(0x81,0x01,0x01); /* Opcode 81 /1, 81 /1 */ | |
| 8824 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
| 8825 ins_pipe( ialu_reg_long ); | |
| 8826 %} | |
| 8827 | |
| 8828 // Or Long Register with Memory | |
| 8829 instruct orl_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
| 8830 match(Set dst (OrL dst (LoadL mem))); | |
| 8831 effect(KILL cr); | |
| 8832 ins_cost(125); | |
| 8833 format %{ "OR $dst.lo,$mem\n\t" | |
| 8834 "OR $dst.hi,$mem+4" %} | |
| 8835 opcode(0x0B,0x0B); | |
| 8836 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
| 8837 ins_pipe( ialu_reg_long_mem ); | |
| 8838 %} | |
| 8839 | |
| 8840 // Xor Long Register with Register | |
| 8841 instruct xorl_eReg(eRegL dst, eRegL src, eFlagsReg cr) %{ | |
| 8842 match(Set dst (XorL dst src)); | |
| 8843 effect(KILL cr); | |
| 8844 format %{ "XOR $dst.lo,$src.lo\n\t" | |
| 8845 "XOR $dst.hi,$src.hi" %} | |
| 8846 opcode(0x33,0x33); | |
| 8847 ins_encode( RegReg_Lo( dst, src), RegReg_Hi( dst, src) ); | |
| 8848 ins_pipe( ialu_reg_reg_long ); | |
| 8849 %} | |
| 8850 | |
| 8851 // Xor Long Register with Immediate | |
| 8852 instruct xorl_eReg_imm(eRegL dst, immL src, eFlagsReg cr) %{ | |
| 8853 match(Set dst (XorL dst src)); | |
| 8854 effect(KILL cr); | |
| 8855 format %{ "XOR $dst.lo,$src.lo\n\t" | |
| 8856 "XOR $dst.hi,$src.hi" %} | |
| 8857 opcode(0x81,0x06,0x06); /* Opcode 81 /6, 81 /6 */ | |
| 8858 ins_encode( Long_OpcSErm_Lo( dst, src ), Long_OpcSErm_Hi( dst, src ) ); | |
| 8859 ins_pipe( ialu_reg_long ); | |
| 8860 %} | |
| 8861 | |
| 8862 // Xor Long Register with Memory | |
| 8863 instruct xorl_eReg_mem(eRegL dst, load_long_memory mem, eFlagsReg cr) %{ | |
| 8864 match(Set dst (XorL dst (LoadL mem))); | |
| 8865 effect(KILL cr); | |
| 8866 ins_cost(125); | |
| 8867 format %{ "XOR $dst.lo,$mem\n\t" | |
| 8868 "XOR $dst.hi,$mem+4" %} | |
| 8869 opcode(0x33,0x33); | |
| 8870 ins_encode( OpcP, RegMem( dst, mem), OpcS, RegMem_Hi(dst,mem) ); | |
| 8871 ins_pipe( ialu_reg_long_mem ); | |
| 8872 %} | |
| 8873 | |
| 8874 // Shift Left Long by 1-31 | |
| 8875 instruct shlL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ | |
| 8876 match(Set dst (LShiftL dst cnt)); | |
| 8877 effect(KILL cr); | |
| 8878 ins_cost(200); | |
| 8879 format %{ "SHLD $dst.hi,$dst.lo,$cnt\n\t" | |
| 8880 "SHL $dst.lo,$cnt" %} | |
| 8881 opcode(0xC1, 0x4, 0xA4); /* 0F/A4, then C1 /4 ib */ | |
| 8882 ins_encode( move_long_small_shift(dst,cnt) ); | |
| 8883 ins_pipe( ialu_reg_long ); | |
| 8884 %} | |
| 8885 | |
| 8886 // Shift Left Long by 32-63 | |
| 8887 instruct shlL_eReg_32_63(eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ | |
| 8888 match(Set dst (LShiftL dst cnt)); | |
| 8889 effect(KILL cr); | |
| 8890 ins_cost(300); | |
| 8891 format %{ "MOV $dst.hi,$dst.lo\n" | |
| 8892 "\tSHL $dst.hi,$cnt-32\n" | |
| 8893 "\tXOR $dst.lo,$dst.lo" %} | |
| 8894 opcode(0xC1, 0x4); /* C1 /4 ib */ | |
| 8895 ins_encode( move_long_big_shift_clr(dst,cnt) ); | |
| 8896 ins_pipe( ialu_reg_long ); | |
| 8897 %} | |
| 8898 | |
| 8899 // Shift Left Long by variable | |
| 8900 instruct salL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ | |
| 8901 match(Set dst (LShiftL dst shift)); | |
| 8902 effect(KILL cr); | |
| 8903 ins_cost(500+200); | |
| 8904 size(17); | |
| 8905 format %{ "TEST $shift,32\n\t" | |
| 8906 "JEQ,s small\n\t" | |
| 8907 "MOV $dst.hi,$dst.lo\n\t" | |
| 8908 "XOR $dst.lo,$dst.lo\n" | |
| 8909 "small:\tSHLD $dst.hi,$dst.lo,$shift\n\t" | |
| 8910 "SHL $dst.lo,$shift" %} | |
| 8911 ins_encode( shift_left_long( dst, shift ) ); | |
| 8912 ins_pipe( pipe_slow ); | |
| 8913 %} | |
| 8914 | |
| 8915 // Shift Right Long by 1-31 | |
| 8916 instruct shrL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ | |
| 8917 match(Set dst (URShiftL dst cnt)); | |
| 8918 effect(KILL cr); | |
| 8919 ins_cost(200); | |
| 8920 format %{ "SHRD $dst.lo,$dst.hi,$cnt\n\t" | |
| 8921 "SHR $dst.hi,$cnt" %} | |
| 8922 opcode(0xC1, 0x5, 0xAC); /* 0F/AC, then C1 /5 ib */ | |
| 8923 ins_encode( move_long_small_shift(dst,cnt) ); | |
| 8924 ins_pipe( ialu_reg_long ); | |
| 8925 %} | |
| 8926 | |
| 8927 // Shift Right Long by 32-63 | |
| 8928 instruct shrL_eReg_32_63(eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ | |
| 8929 match(Set dst (URShiftL dst cnt)); | |
| 8930 effect(KILL cr); | |
| 8931 ins_cost(300); | |
| 8932 format %{ "MOV $dst.lo,$dst.hi\n" | |
| 8933 "\tSHR $dst.lo,$cnt-32\n" | |
| 8934 "\tXOR $dst.hi,$dst.hi" %} | |
| 8935 opcode(0xC1, 0x5); /* C1 /5 ib */ | |
| 8936 ins_encode( move_long_big_shift_clr(dst,cnt) ); | |
| 8937 ins_pipe( ialu_reg_long ); | |
| 8938 %} | |
| 8939 | |
| 8940 // Shift Right Long by variable | |
| 8941 instruct shrL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ | |
| 8942 match(Set dst (URShiftL dst shift)); | |
| 8943 effect(KILL cr); | |
| 8944 ins_cost(600); | |
| 8945 size(17); | |
| 8946 format %{ "TEST $shift,32\n\t" | |
| 8947 "JEQ,s small\n\t" | |
| 8948 "MOV $dst.lo,$dst.hi\n\t" | |
| 8949 "XOR $dst.hi,$dst.hi\n" | |
| 8950 "small:\tSHRD $dst.lo,$dst.hi,$shift\n\t" | |
| 8951 "SHR $dst.hi,$shift" %} | |
| 8952 ins_encode( shift_right_long( dst, shift ) ); | |
| 8953 ins_pipe( pipe_slow ); | |
| 8954 %} | |
| 8955 | |
| 8956 // Shift Right Long by 1-31 | |
| 8957 instruct sarL_eReg_1_31(eRegL dst, immI_1_31 cnt, eFlagsReg cr) %{ | |
| 8958 match(Set dst (RShiftL dst cnt)); | |
| 8959 effect(KILL cr); | |
| 8960 ins_cost(200); | |
| 8961 format %{ "SHRD $dst.lo,$dst.hi,$cnt\n\t" | |
| 8962 "SAR $dst.hi,$cnt" %} | |
| 8963 opcode(0xC1, 0x7, 0xAC); /* 0F/AC, then C1 /7 ib */ | |
| 8964 ins_encode( move_long_small_shift(dst,cnt) ); | |
| 8965 ins_pipe( ialu_reg_long ); | |
| 8966 %} | |
| 8967 | |
| 8968 // Shift Right Long by 32-63 | |
| 8969 instruct sarL_eReg_32_63( eRegL dst, immI_32_63 cnt, eFlagsReg cr) %{ | |
| 8970 match(Set dst (RShiftL dst cnt)); | |
| 8971 effect(KILL cr); | |
| 8972 ins_cost(300); | |
| 8973 format %{ "MOV $dst.lo,$dst.hi\n" | |
| 8974 "\tSAR $dst.lo,$cnt-32\n" | |
| 8975 "\tSAR $dst.hi,31" %} | |
| 8976 opcode(0xC1, 0x7); /* C1 /7 ib */ | |
| 8977 ins_encode( move_long_big_shift_sign(dst,cnt) ); | |
| 8978 ins_pipe( ialu_reg_long ); | |
| 8979 %} | |
| 8980 | |
| 8981 // Shift Right arithmetic Long by variable | |
| 8982 instruct sarL_eReg_CL(eRegL dst, eCXRegI shift, eFlagsReg cr) %{ | |
| 8983 match(Set dst (RShiftL dst shift)); | |
| 8984 effect(KILL cr); | |
| 8985 ins_cost(600); | |
| 8986 size(18); | |
| 8987 format %{ "TEST $shift,32\n\t" | |
| 8988 "JEQ,s small\n\t" | |
| 8989 "MOV $dst.lo,$dst.hi\n\t" | |
| 8990 "SAR $dst.hi,31\n" | |
| 8991 "small:\tSHRD $dst.lo,$dst.hi,$shift\n\t" | |
| 8992 "SAR $dst.hi,$shift" %} | |
| 8993 ins_encode( shift_right_arith_long( dst, shift ) ); | |
| 8994 ins_pipe( pipe_slow ); | |
| 8995 %} | |
| 8996 | |
| 8997 | |
| 8998 //----------Double Instructions------------------------------------------------ | |
| 8999 // Double Math | |
| 9000 | |
| 9001 // Compare & branch | |
| 9002 | |
| 9003 // P6 version of float compare, sets condition codes in EFLAGS | |
| 9004 instruct cmpD_cc_P6(eFlagsRegU cr, regD src1, regD src2, eAXRegI rax) %{ | |
| 9005 predicate(VM_Version::supports_cmov() && UseSSE <=1); | |
| 9006 match(Set cr (CmpD src1 src2)); | |
| 9007 effect(KILL rax); | |
| 9008 ins_cost(150); | |
| 9009 format %{ "FLD $src1\n\t" | |
| 9010 "FUCOMIP ST,$src2 // P6 instruction\n\t" | |
| 9011 "JNP exit\n\t" | |
| 9012 "MOV ah,1 // saw a NaN, set CF\n\t" | |
| 9013 "SAHF\n" | |
| 9014 "exit:\tNOP // avoid branch to branch" %} | |
| 9015 opcode(0xDF, 0x05); /* DF E8+i or DF /5 */ | |
| 9016 ins_encode( Push_Reg_D(src1), | |
| 9017 OpcP, RegOpc(src2), | |
| 9018 cmpF_P6_fixup ); | |
| 9019 ins_pipe( pipe_slow ); | |
| 9020 %} | |
| 9021 | |
| 9022 // Compare & branch | |
| 9023 instruct cmpD_cc(eFlagsRegU cr, regD src1, regD src2, eAXRegI rax) %{ | |
| 9024 predicate(UseSSE<=1); | |
| 9025 match(Set cr (CmpD src1 src2)); | |
| 9026 effect(KILL rax); | |
| 9027 ins_cost(200); | |
| 9028 format %{ "FLD $src1\n\t" | |
| 9029 "FCOMp $src2\n\t" | |
| 9030 "FNSTSW AX\n\t" | |
| 9031 "TEST AX,0x400\n\t" | |
| 9032 "JZ,s flags\n\t" | |
| 9033 "MOV AH,1\t# unordered treat as LT\n" | |
| 9034 "flags:\tSAHF" %} | |
| 9035 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
| 9036 ins_encode( Push_Reg_D(src1), | |
| 9037 OpcP, RegOpc(src2), | |
| 9038 fpu_flags); | |
| 9039 ins_pipe( pipe_slow ); | |
| 9040 %} | |
| 9041 | |
| 9042 // Compare vs zero into -1,0,1 | |
| 9043 instruct cmpD_0(eRegI dst, regD src1, immD0 zero, eAXRegI rax, eFlagsReg cr) %{ | |
| 9044 predicate(UseSSE<=1); | |
| 9045 match(Set dst (CmpD3 src1 zero)); | |
| 9046 effect(KILL cr, KILL rax); | |
| 9047 ins_cost(280); | |
| 9048 format %{ "FTSTD $dst,$src1" %} | |
| 9049 opcode(0xE4, 0xD9); | |
| 9050 ins_encode( Push_Reg_D(src1), | |
| 9051 OpcS, OpcP, PopFPU, | |
| 9052 CmpF_Result(dst)); | |
| 9053 ins_pipe( pipe_slow ); | |
| 9054 %} | |
| 9055 | |
| 9056 // Compare into -1,0,1 | |
| 9057 instruct cmpD_reg(eRegI dst, regD src1, regD src2, eAXRegI rax, eFlagsReg cr) %{ | |
| 9058 predicate(UseSSE<=1); | |
| 9059 match(Set dst (CmpD3 src1 src2)); | |
| 9060 effect(KILL cr, KILL rax); | |
| 9061 ins_cost(300); | |
| 9062 format %{ "FCMPD $dst,$src1,$src2" %} | |
| 9063 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
| 9064 ins_encode( Push_Reg_D(src1), | |
| 9065 OpcP, RegOpc(src2), | |
| 9066 CmpF_Result(dst)); | |
| 9067 ins_pipe( pipe_slow ); | |
| 9068 %} | |
| 9069 | |
| 9070 // float compare and set condition codes in EFLAGS by XMM regs | |
| 9071 instruct cmpXD_cc(eFlagsRegU cr, regXD dst, regXD src, eAXRegI rax) %{ | |
| 9072 predicate(UseSSE>=2); | |
| 9073 match(Set cr (CmpD dst src)); | |
| 9074 effect(KILL rax); | |
| 9075 ins_cost(125); | |
| 9076 format %{ "COMISD $dst,$src\n" | |
| 9077 "\tJNP exit\n" | |
| 9078 "\tMOV ah,1 // saw a NaN, set CF\n" | |
| 9079 "\tSAHF\n" | |
| 9080 "exit:\tNOP // avoid branch to branch" %} | |
| 9081 opcode(0x66, 0x0F, 0x2F); | |
| 9082 ins_encode(OpcP, OpcS, Opcode(tertiary), RegReg(dst, src), cmpF_P6_fixup); | |
| 9083 ins_pipe( pipe_slow ); | |
| 9084 %} | |
| 9085 | |
| 9086 // float compare and set condition codes in EFLAGS by XMM regs | |
| 9087 instruct cmpXD_ccmem(eFlagsRegU cr, regXD dst, memory src, eAXRegI rax) %{ | |
| 9088 predicate(UseSSE>=2); | |
| 9089 match(Set cr (CmpD dst (LoadD src))); | |
| 9090 effect(KILL rax); | |
| 9091 ins_cost(145); | |
| 9092 format %{ "COMISD $dst,$src\n" | |
| 9093 "\tJNP exit\n" | |
| 9094 "\tMOV ah,1 // saw a NaN, set CF\n" | |
| 9095 "\tSAHF\n" | |
| 9096 "exit:\tNOP // avoid branch to branch" %} | |
| 9097 opcode(0x66, 0x0F, 0x2F); | |
| 9098 ins_encode(OpcP, OpcS, Opcode(tertiary), RegMem(dst, src), cmpF_P6_fixup); | |
| 9099 ins_pipe( pipe_slow ); | |
| 9100 %} | |
| 9101 | |
| 9102 // Compare into -1,0,1 in XMM | |
| 9103 instruct cmpXD_reg(eRegI dst, regXD src1, regXD src2, eFlagsReg cr) %{ | |
| 9104 predicate(UseSSE>=2); | |
| 9105 match(Set dst (CmpD3 src1 src2)); | |
| 9106 effect(KILL cr); | |
| 9107 ins_cost(255); | |
| 9108 format %{ "XOR $dst,$dst\n" | |
| 9109 "\tCOMISD $src1,$src2\n" | |
| 9110 "\tJP,s nan\n" | |
| 9111 "\tJEQ,s exit\n" | |
| 9112 "\tJA,s inc\n" | |
| 9113 "nan:\tDEC $dst\n" | |
| 9114 "\tJMP,s exit\n" | |
| 9115 "inc:\tINC $dst\n" | |
| 9116 "exit:" | |
| 9117 %} | |
| 9118 opcode(0x66, 0x0F, 0x2F); | |
| 9119 ins_encode(Xor_Reg(dst), OpcP, OpcS, Opcode(tertiary), RegReg(src1, src2), | |
| 9120 CmpX_Result(dst)); | |
| 9121 ins_pipe( pipe_slow ); | |
| 9122 %} | |
| 9123 | |
| 9124 // Compare into -1,0,1 in XMM and memory | |
| 9125 instruct cmpXD_regmem(eRegI dst, regXD src1, memory mem, eFlagsReg cr) %{ | |
| 9126 predicate(UseSSE>=2); | |
| 9127 match(Set dst (CmpD3 src1 (LoadD mem))); | |
| 9128 effect(KILL cr); | |
| 9129 ins_cost(275); | |
| 9130 format %{ "COMISD $src1,$mem\n" | |
| 9131 "\tMOV $dst,0\t\t# do not blow flags\n" | |
| 9132 "\tJP,s nan\n" | |
| 9133 "\tJEQ,s exit\n" | |
| 9134 "\tJA,s inc\n" | |
| 9135 "nan:\tDEC $dst\n" | |
| 9136 "\tJMP,s exit\n" | |
| 9137 "inc:\tINC $dst\n" | |
| 9138 "exit:" | |
| 9139 %} | |
| 9140 opcode(0x66, 0x0F, 0x2F); | |
| 9141 ins_encode(OpcP, OpcS, Opcode(tertiary), RegMem(src1, mem), | |
| 9142 LdImmI(dst,0x0), CmpX_Result(dst)); | |
| 9143 ins_pipe( pipe_slow ); | |
| 9144 %} | |
| 9145 | |
| 9146 | |
| 9147 instruct subD_reg(regD dst, regD src) %{ | |
| 9148 predicate (UseSSE <=1); | |
| 9149 match(Set dst (SubD dst src)); | |
| 9150 | |
| 9151 format %{ "FLD $src\n\t" | |
| 9152 "DSUBp $dst,ST" %} | |
| 9153 opcode(0xDE, 0x5); /* DE E8+i or DE /5 */ | |
| 9154 ins_cost(150); | |
| 9155 ins_encode( Push_Reg_D(src), | |
| 9156 OpcP, RegOpc(dst) ); | |
| 9157 ins_pipe( fpu_reg_reg ); | |
| 9158 %} | |
| 9159 | |
| 9160 instruct subD_reg_round(stackSlotD dst, regD src1, regD src2) %{ | |
| 9161 predicate (UseSSE <=1); | |
| 9162 match(Set dst (RoundDouble (SubD src1 src2))); | |
| 9163 ins_cost(250); | |
| 9164 | |
| 9165 format %{ "FLD $src2\n\t" | |
| 9166 "DSUB ST,$src1\n\t" | |
| 9167 "FSTP_D $dst\t# D-round" %} | |
| 9168 opcode(0xD8, 0x5); | |
| 9169 ins_encode( Push_Reg_D(src2), | |
| 9170 OpcP, RegOpc(src1), Pop_Mem_D(dst) ); | |
| 9171 ins_pipe( fpu_mem_reg_reg ); | |
| 9172 %} | |
| 9173 | |
| 9174 | |
| 9175 instruct subD_reg_mem(regD dst, memory src) %{ | |
| 9176 predicate (UseSSE <=1); | |
| 9177 match(Set dst (SubD dst (LoadD src))); | |
| 9178 ins_cost(150); | |
| 9179 | |
| 9180 format %{ "FLD $src\n\t" | |
| 9181 "DSUBp $dst,ST" %} | |
| 9182 opcode(0xDE, 0x5, 0xDD); /* DE C0+i */ /* LoadD DD /0 */ | |
| 9183 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
| 9184 OpcP, RegOpc(dst) ); | |
| 9185 ins_pipe( fpu_reg_mem ); | |
| 9186 %} | |
| 9187 | |
| 9188 instruct absD_reg(regDPR1 dst, regDPR1 src) %{ | |
| 9189 predicate (UseSSE<=1); | |
| 9190 match(Set dst (AbsD src)); | |
| 9191 ins_cost(100); | |
| 9192 format %{ "FABS" %} | |
| 9193 opcode(0xE1, 0xD9); | |
| 9194 ins_encode( OpcS, OpcP ); | |
| 9195 ins_pipe( fpu_reg_reg ); | |
| 9196 %} | |
| 9197 | |
| 9198 instruct absXD_reg( regXD dst ) %{ | |
| 9199 predicate(UseSSE>=2); | |
| 9200 match(Set dst (AbsD dst)); | |
| 9201 format %{ "ANDPD $dst,[0x7FFFFFFFFFFFFFFF]\t# ABS D by sign masking" %} | |
| 9202 ins_encode( AbsXD_encoding(dst)); | |
| 9203 ins_pipe( pipe_slow ); | |
| 9204 %} | |
| 9205 | |
| 9206 instruct negD_reg(regDPR1 dst, regDPR1 src) %{ | |
| 9207 predicate(UseSSE<=1); | |
| 9208 match(Set dst (NegD src)); | |
| 9209 ins_cost(100); | |
| 9210 format %{ "FCHS" %} | |
| 9211 opcode(0xE0, 0xD9); | |
| 9212 ins_encode( OpcS, OpcP ); | |
| 9213 ins_pipe( fpu_reg_reg ); | |
| 9214 %} | |
| 9215 | |
| 9216 instruct negXD_reg( regXD dst ) %{ | |
| 9217 predicate(UseSSE>=2); | |
| 9218 match(Set dst (NegD dst)); | |
| 9219 format %{ "XORPD $dst,[0x8000000000000000]\t# CHS D by sign flipping" %} | |
| 9220 ins_encode %{ | |
| 9221 __ xorpd($dst$$XMMRegister, | |
| 9222 ExternalAddress((address)double_signflip_pool)); | |
| 9223 %} | |
| 9224 ins_pipe( pipe_slow ); | |
| 9225 %} | |
| 9226 | |
| 9227 instruct addD_reg(regD dst, regD src) %{ | |
| 9228 predicate(UseSSE<=1); | |
| 9229 match(Set dst (AddD dst src)); | |
| 9230 format %{ "FLD $src\n\t" | |
| 9231 "DADD $dst,ST" %} | |
| 9232 size(4); | |
| 9233 ins_cost(150); | |
| 9234 opcode(0xDE, 0x0); /* DE C0+i or DE /0*/ | |
| 9235 ins_encode( Push_Reg_D(src), | |
| 9236 OpcP, RegOpc(dst) ); | |
| 9237 ins_pipe( fpu_reg_reg ); | |
| 9238 %} | |
| 9239 | |
| 9240 | |
| 9241 instruct addD_reg_round(stackSlotD dst, regD src1, regD src2) %{ | |
| 9242 predicate(UseSSE<=1); | |
| 9243 match(Set dst (RoundDouble (AddD src1 src2))); | |
| 9244 ins_cost(250); | |
| 9245 | |
| 9246 format %{ "FLD $src2\n\t" | |
| 9247 "DADD ST,$src1\n\t" | |
| 9248 "FSTP_D $dst\t# D-round" %} | |
| 9249 opcode(0xD8, 0x0); /* D8 C0+i or D8 /0*/ | |
| 9250 ins_encode( Push_Reg_D(src2), | |
| 9251 OpcP, RegOpc(src1), Pop_Mem_D(dst) ); | |
| 9252 ins_pipe( fpu_mem_reg_reg ); | |
| 9253 %} | |
| 9254 | |
| 9255 | |
| 9256 instruct addD_reg_mem(regD dst, memory src) %{ | |
| 9257 predicate(UseSSE<=1); | |
| 9258 match(Set dst (AddD dst (LoadD src))); | |
| 9259 ins_cost(150); | |
| 9260 | |
| 9261 format %{ "FLD $src\n\t" | |
| 9262 "DADDp $dst,ST" %} | |
| 9263 opcode(0xDE, 0x0, 0xDD); /* DE C0+i */ /* LoadD DD /0 */ | |
| 9264 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
| 9265 OpcP, RegOpc(dst) ); | |
| 9266 ins_pipe( fpu_reg_mem ); | |
| 9267 %} | |
| 9268 | |
| 9269 // add-to-memory | |
| 9270 instruct addD_mem_reg(memory dst, regD src) %{ | |
| 9271 predicate(UseSSE<=1); | |
| 9272 match(Set dst (StoreD dst (RoundDouble (AddD (LoadD dst) src)))); | |
| 9273 ins_cost(150); | |
| 9274 | |
| 9275 format %{ "FLD_D $dst\n\t" | |
| 9276 "DADD ST,$src\n\t" | |
| 9277 "FST_D $dst" %} | |
| 9278 opcode(0xDD, 0x0); | |
| 9279 ins_encode( Opcode(0xDD), RMopc_Mem(0x00,dst), | |
| 9280 Opcode(0xD8), RegOpc(src), | |
| 9281 set_instruction_start, | |
| 9282 Opcode(0xDD), RMopc_Mem(0x03,dst) ); | |
| 9283 ins_pipe( fpu_reg_mem ); | |
| 9284 %} | |
| 9285 | |
| 9286 instruct addD_reg_imm1(regD dst, immD1 src) %{ | |
| 9287 predicate(UseSSE<=1); | |
| 9288 match(Set dst (AddD dst src)); | |
| 9289 ins_cost(125); | |
| 9290 format %{ "FLD1\n\t" | |
| 9291 "DADDp $dst,ST" %} | |
| 9292 opcode(0xDE, 0x00); | |
| 9293 ins_encode( LdImmD(src), | |
| 9294 OpcP, RegOpc(dst) ); | |
| 9295 ins_pipe( fpu_reg ); | |
| 9296 %} | |
| 9297 | |
| 9298 instruct addD_reg_imm(regD dst, immD src) %{ | |
| 9299 predicate(UseSSE<=1 && _kids[1]->_leaf->getd() != 0.0 && _kids[1]->_leaf->getd() != 1.0 ); | |
| 9300 match(Set dst (AddD dst src)); | |
| 9301 ins_cost(200); | |
| 9302 format %{ "FLD_D [$src]\n\t" | |
| 9303 "DADDp $dst,ST" %} | |
| 9304 opcode(0xDE, 0x00); /* DE /0 */ | |
| 9305 ins_encode( LdImmD(src), | |
| 9306 OpcP, RegOpc(dst)); | |
| 9307 ins_pipe( fpu_reg_mem ); | |
| 9308 %} | |
| 9309 | |
| 9310 instruct addD_reg_imm_round(stackSlotD dst, regD src, immD con) %{ | |
| 9311 predicate(UseSSE<=1 && _kids[0]->_kids[1]->_leaf->getd() != 0.0 && _kids[0]->_kids[1]->_leaf->getd() != 1.0 ); | |
| 9312 match(Set dst (RoundDouble (AddD src con))); | |
| 9313 ins_cost(200); | |
| 9314 format %{ "FLD_D [$con]\n\t" | |
| 9315 "DADD ST,$src\n\t" | |
| 9316 "FSTP_D $dst\t# D-round" %} | |
| 9317 opcode(0xD8, 0x00); /* D8 /0 */ | |
| 9318 ins_encode( LdImmD(con), | |
| 9319 OpcP, RegOpc(src), Pop_Mem_D(dst)); | |
| 9320 ins_pipe( fpu_mem_reg_con ); | |
| 9321 %} | |
| 9322 | |
| 9323 // Add two double precision floating point values in xmm | |
| 9324 instruct addXD_reg(regXD dst, regXD src) %{ | |
| 9325 predicate(UseSSE>=2); | |
| 9326 match(Set dst (AddD dst src)); | |
| 9327 format %{ "ADDSD $dst,$src" %} | |
| 9328 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), RegReg(dst, src)); | |
| 9329 ins_pipe( pipe_slow ); | |
| 9330 %} | |
| 9331 | |
| 9332 instruct addXD_imm(regXD dst, immXD con) %{ | |
| 9333 predicate(UseSSE>=2); | |
| 9334 match(Set dst (AddD dst con)); | |
| 9335 format %{ "ADDSD $dst,[$con]" %} | |
| 9336 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), LdImmXD(dst, con) ); | |
| 9337 ins_pipe( pipe_slow ); | |
| 9338 %} | |
| 9339 | |
| 9340 instruct addXD_mem(regXD dst, memory mem) %{ | |
| 9341 predicate(UseSSE>=2); | |
| 9342 match(Set dst (AddD dst (LoadD mem))); | |
| 9343 format %{ "ADDSD $dst,$mem" %} | |
| 9344 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x58), RegMem(dst,mem)); | |
| 9345 ins_pipe( pipe_slow ); | |
| 9346 %} | |
| 9347 | |
| 9348 // Sub two double precision floating point values in xmm | |
| 9349 instruct subXD_reg(regXD dst, regXD src) %{ | |
| 9350 predicate(UseSSE>=2); | |
| 9351 match(Set dst (SubD dst src)); | |
| 9352 format %{ "SUBSD $dst,$src" %} | |
| 9353 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), RegReg(dst, src)); | |
| 9354 ins_pipe( pipe_slow ); | |
| 9355 %} | |
| 9356 | |
| 9357 instruct subXD_imm(regXD dst, immXD con) %{ | |
| 9358 predicate(UseSSE>=2); | |
| 9359 match(Set dst (SubD dst con)); | |
| 9360 format %{ "SUBSD $dst,[$con]" %} | |
| 9361 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), LdImmXD(dst, con) ); | |
| 9362 ins_pipe( pipe_slow ); | |
| 9363 %} | |
| 9364 | |
| 9365 instruct subXD_mem(regXD dst, memory mem) %{ | |
| 9366 predicate(UseSSE>=2); | |
| 9367 match(Set dst (SubD dst (LoadD mem))); | |
| 9368 format %{ "SUBSD $dst,$mem" %} | |
| 9369 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5C), RegMem(dst,mem)); | |
| 9370 ins_pipe( pipe_slow ); | |
| 9371 %} | |
| 9372 | |
| 9373 // Mul two double precision floating point values in xmm | |
| 9374 instruct mulXD_reg(regXD dst, regXD src) %{ | |
| 9375 predicate(UseSSE>=2); | |
| 9376 match(Set dst (MulD dst src)); | |
| 9377 format %{ "MULSD $dst,$src" %} | |
| 9378 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), RegReg(dst, src)); | |
| 9379 ins_pipe( pipe_slow ); | |
| 9380 %} | |
| 9381 | |
| 9382 instruct mulXD_imm(regXD dst, immXD con) %{ | |
| 9383 predicate(UseSSE>=2); | |
| 9384 match(Set dst (MulD dst con)); | |
| 9385 format %{ "MULSD $dst,[$con]" %} | |
| 9386 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), LdImmXD(dst, con) ); | |
| 9387 ins_pipe( pipe_slow ); | |
| 9388 %} | |
| 9389 | |
| 9390 instruct mulXD_mem(regXD dst, memory mem) %{ | |
| 9391 predicate(UseSSE>=2); | |
| 9392 match(Set dst (MulD dst (LoadD mem))); | |
| 9393 format %{ "MULSD $dst,$mem" %} | |
| 9394 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x59), RegMem(dst,mem)); | |
| 9395 ins_pipe( pipe_slow ); | |
| 9396 %} | |
| 9397 | |
| 9398 // Div two double precision floating point values in xmm | |
| 9399 instruct divXD_reg(regXD dst, regXD src) %{ | |
| 9400 predicate(UseSSE>=2); | |
| 9401 match(Set dst (DivD dst src)); | |
| 9402 format %{ "DIVSD $dst,$src" %} | |
| 9403 opcode(0xF2, 0x0F, 0x5E); | |
| 9404 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), RegReg(dst, src)); | |
| 9405 ins_pipe( pipe_slow ); | |
| 9406 %} | |
| 9407 | |
| 9408 instruct divXD_imm(regXD dst, immXD con) %{ | |
| 9409 predicate(UseSSE>=2); | |
| 9410 match(Set dst (DivD dst con)); | |
| 9411 format %{ "DIVSD $dst,[$con]" %} | |
| 9412 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), LdImmXD(dst, con)); | |
| 9413 ins_pipe( pipe_slow ); | |
| 9414 %} | |
| 9415 | |
| 9416 instruct divXD_mem(regXD dst, memory mem) %{ | |
| 9417 predicate(UseSSE>=2); | |
| 9418 match(Set dst (DivD dst (LoadD mem))); | |
| 9419 format %{ "DIVSD $dst,$mem" %} | |
| 9420 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x5E), RegMem(dst,mem)); | |
| 9421 ins_pipe( pipe_slow ); | |
| 9422 %} | |
| 9423 | |
| 9424 | |
| 9425 instruct mulD_reg(regD dst, regD src) %{ | |
| 9426 predicate(UseSSE<=1); | |
| 9427 match(Set dst (MulD dst src)); | |
| 9428 format %{ "FLD $src\n\t" | |
| 9429 "DMULp $dst,ST" %} | |
| 9430 opcode(0xDE, 0x1); /* DE C8+i or DE /1*/ | |
| 9431 ins_cost(150); | |
| 9432 ins_encode( Push_Reg_D(src), | |
| 9433 OpcP, RegOpc(dst) ); | |
| 9434 ins_pipe( fpu_reg_reg ); | |
| 9435 %} | |
| 9436 | |
| 9437 // Strict FP instruction biases argument before multiply then | |
| 9438 // biases result to avoid double rounding of subnormals. | |
| 9439 // | |
| 9440 // scale arg1 by multiplying arg1 by 2^(-15360) | |
| 9441 // load arg2 | |
| 9442 // multiply scaled arg1 by arg2 | |
| 9443 // rescale product by 2^(15360) | |
| 9444 // | |
| 9445 instruct strictfp_mulD_reg(regDPR1 dst, regnotDPR1 src) %{ | |
| 9446 predicate( UseSSE<=1 && Compile::current()->has_method() && Compile::current()->method()->is_strict() ); | |
| 9447 match(Set dst (MulD dst src)); | |
| 9448 ins_cost(1); // Select this instruction for all strict FP double multiplies | |
| 9449 | |
| 9450 format %{ "FLD StubRoutines::_fpu_subnormal_bias1\n\t" | |
| 9451 "DMULp $dst,ST\n\t" | |
| 9452 "FLD $src\n\t" | |
| 9453 "DMULp $dst,ST\n\t" | |
| 9454 "FLD StubRoutines::_fpu_subnormal_bias2\n\t" | |
| 9455 "DMULp $dst,ST\n\t" %} | |
| 9456 opcode(0xDE, 0x1); /* DE C8+i or DE /1*/ | |
| 9457 ins_encode( strictfp_bias1(dst), | |
| 9458 Push_Reg_D(src), | |
| 9459 OpcP, RegOpc(dst), | |
| 9460 strictfp_bias2(dst) ); | |
| 9461 ins_pipe( fpu_reg_reg ); | |
| 9462 %} | |
| 9463 | |
| 9464 instruct mulD_reg_imm(regD dst, immD src) %{ | |
| 9465 predicate( UseSSE<=1 && _kids[1]->_leaf->getd() != 0.0 && _kids[1]->_leaf->getd() != 1.0 ); | |
| 9466 match(Set dst (MulD dst src)); | |
| 9467 ins_cost(200); | |
| 9468 format %{ "FLD_D [$src]\n\t" | |
| 9469 "DMULp $dst,ST" %} | |
| 9470 opcode(0xDE, 0x1); /* DE /1 */ | |
| 9471 ins_encode( LdImmD(src), | |
| 9472 OpcP, RegOpc(dst) ); | |
| 9473 ins_pipe( fpu_reg_mem ); | |
| 9474 %} | |
| 9475 | |
| 9476 | |
| 9477 instruct mulD_reg_mem(regD dst, memory src) %{ | |
| 9478 predicate( UseSSE<=1 ); | |
| 9479 match(Set dst (MulD dst (LoadD src))); | |
| 9480 ins_cost(200); | |
| 9481 format %{ "FLD_D $src\n\t" | |
| 9482 "DMULp $dst,ST" %} | |
| 9483 opcode(0xDE, 0x1, 0xDD); /* DE C8+i or DE /1*/ /* LoadD DD /0 */ | |
| 9484 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
| 9485 OpcP, RegOpc(dst) ); | |
| 9486 ins_pipe( fpu_reg_mem ); | |
| 9487 %} | |
| 9488 | |
| 9489 // | |
| 9490 // Cisc-alternate to reg-reg multiply | |
| 9491 instruct mulD_reg_mem_cisc(regD dst, regD src, memory mem) %{ | |
| 9492 predicate( UseSSE<=1 ); | |
| 9493 match(Set dst (MulD src (LoadD mem))); | |
| 9494 ins_cost(250); | |
| 9495 format %{ "FLD_D $mem\n\t" | |
| 9496 "DMUL ST,$src\n\t" | |
| 9497 "FSTP_D $dst" %} | |
| 9498 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i */ /* LoadD D9 /0 */ | |
| 9499 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,mem), | |
| 9500 OpcReg_F(src), | |
| 9501 Pop_Reg_D(dst) ); | |
| 9502 ins_pipe( fpu_reg_reg_mem ); | |
| 9503 %} | |
| 9504 | |
| 9505 | |
| 9506 // MACRO3 -- addD a mulD | |
| 9507 // This instruction is a '2-address' instruction in that the result goes | |
| 9508 // back to src2. This eliminates a move from the macro; possibly the | |
| 9509 // register allocator will have to add it back (and maybe not). | |
| 9510 instruct addD_mulD_reg(regD src2, regD src1, regD src0) %{ | |
| 9511 predicate( UseSSE<=1 ); | |
| 9512 match(Set src2 (AddD (MulD src0 src1) src2)); | |
| 9513 format %{ "FLD $src0\t# ===MACRO3d===\n\t" | |
| 9514 "DMUL ST,$src1\n\t" | |
| 9515 "DADDp $src2,ST" %} | |
| 9516 ins_cost(250); | |
| 9517 opcode(0xDD); /* LoadD DD /0 */ | |
| 9518 ins_encode( Push_Reg_F(src0), | |
| 9519 FMul_ST_reg(src1), | |
| 9520 FAddP_reg_ST(src2) ); | |
| 9521 ins_pipe( fpu_reg_reg_reg ); | |
| 9522 %} | |
| 9523 | |
| 9524 | |
| 9525 // MACRO3 -- subD a mulD | |
| 9526 instruct subD_mulD_reg(regD src2, regD src1, regD src0) %{ | |
| 9527 predicate( UseSSE<=1 ); | |
| 9528 match(Set src2 (SubD (MulD src0 src1) src2)); | |
| 9529 format %{ "FLD $src0\t# ===MACRO3d===\n\t" | |
| 9530 "DMUL ST,$src1\n\t" | |
| 9531 "DSUBRp $src2,ST" %} | |
| 9532 ins_cost(250); | |
| 9533 ins_encode( Push_Reg_F(src0), | |
| 9534 FMul_ST_reg(src1), | |
| 9535 Opcode(0xDE), Opc_plus(0xE0,src2)); | |
| 9536 ins_pipe( fpu_reg_reg_reg ); | |
| 9537 %} | |
| 9538 | |
| 9539 | |
| 9540 instruct divD_reg(regD dst, regD src) %{ | |
| 9541 predicate( UseSSE<=1 ); | |
| 9542 match(Set dst (DivD dst src)); | |
| 9543 | |
| 9544 format %{ "FLD $src\n\t" | |
| 9545 "FDIVp $dst,ST" %} | |
| 9546 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
| 9547 ins_cost(150); | |
| 9548 ins_encode( Push_Reg_D(src), | |
| 9549 OpcP, RegOpc(dst) ); | |
| 9550 ins_pipe( fpu_reg_reg ); | |
| 9551 %} | |
| 9552 | |
| 9553 // Strict FP instruction biases argument before division then | |
| 9554 // biases result, to avoid double rounding of subnormals. | |
| 9555 // | |
| 9556 // scale dividend by multiplying dividend by 2^(-15360) | |
| 9557 // load divisor | |
| 9558 // divide scaled dividend by divisor | |
| 9559 // rescale quotient by 2^(15360) | |
| 9560 // | |
| 9561 instruct strictfp_divD_reg(regDPR1 dst, regnotDPR1 src) %{ | |
| 9562 predicate (UseSSE<=1); | |
| 9563 match(Set dst (DivD dst src)); | |
| 9564 predicate( UseSSE<=1 && Compile::current()->has_method() && Compile::current()->method()->is_strict() ); | |
| 9565 ins_cost(01); | |
| 9566 | |
| 9567 format %{ "FLD StubRoutines::_fpu_subnormal_bias1\n\t" | |
| 9568 "DMULp $dst,ST\n\t" | |
| 9569 "FLD $src\n\t" | |
| 9570 "FDIVp $dst,ST\n\t" | |
| 9571 "FLD StubRoutines::_fpu_subnormal_bias2\n\t" | |
| 9572 "DMULp $dst,ST\n\t" %} | |
| 9573 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
| 9574 ins_encode( strictfp_bias1(dst), | |
| 9575 Push_Reg_D(src), | |
| 9576 OpcP, RegOpc(dst), | |
| 9577 strictfp_bias2(dst) ); | |
| 9578 ins_pipe( fpu_reg_reg ); | |
| 9579 %} | |
| 9580 | |
| 9581 instruct divD_reg_round(stackSlotD dst, regD src1, regD src2) %{ | |
| 9582 predicate( UseSSE<=1 && !(Compile::current()->has_method() && Compile::current()->method()->is_strict()) ); | |
| 9583 match(Set dst (RoundDouble (DivD src1 src2))); | |
| 9584 | |
| 9585 format %{ "FLD $src1\n\t" | |
| 9586 "FDIV ST,$src2\n\t" | |
| 9587 "FSTP_D $dst\t# D-round" %} | |
| 9588 opcode(0xD8, 0x6); /* D8 F0+i or D8 /6 */ | |
| 9589 ins_encode( Push_Reg_D(src1), | |
| 9590 OpcP, RegOpc(src2), Pop_Mem_D(dst) ); | |
| 9591 ins_pipe( fpu_mem_reg_reg ); | |
| 9592 %} | |
| 9593 | |
| 9594 | |
| 9595 instruct modD_reg(regD dst, regD src, eAXRegI rax, eFlagsReg cr) %{ | |
| 9596 predicate(UseSSE<=1); | |
| 9597 match(Set dst (ModD dst src)); | |
| 9598 effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS | |
| 9599 | |
| 9600 format %{ "DMOD $dst,$src" %} | |
| 9601 ins_cost(250); | |
| 9602 ins_encode(Push_Reg_Mod_D(dst, src), | |
| 9603 emitModD(), | |
| 9604 Push_Result_Mod_D(src), | |
| 9605 Pop_Reg_D(dst)); | |
| 9606 ins_pipe( pipe_slow ); | |
| 9607 %} | |
| 9608 | |
| 9609 instruct modXD_reg(regXD dst, regXD src0, regXD src1, eAXRegI rax, eFlagsReg cr) %{ | |
| 9610 predicate(UseSSE>=2); | |
| 9611 match(Set dst (ModD src0 src1)); | |
| 9612 effect(KILL rax, KILL cr); | |
| 9613 | |
| 9614 format %{ "SUB ESP,8\t # DMOD\n" | |
| 9615 "\tMOVSD [ESP+0],$src1\n" | |
| 9616 "\tFLD_D [ESP+0]\n" | |
| 9617 "\tMOVSD [ESP+0],$src0\n" | |
| 9618 "\tFLD_D [ESP+0]\n" | |
| 9619 "loop:\tFPREM\n" | |
| 9620 "\tFWAIT\n" | |
| 9621 "\tFNSTSW AX\n" | |
| 9622 "\tSAHF\n" | |
| 9623 "\tJP loop\n" | |
| 9624 "\tFSTP_D [ESP+0]\n" | |
| 9625 "\tMOVSD $dst,[ESP+0]\n" | |
| 9626 "\tADD ESP,8\n" | |
| 9627 "\tFSTP ST0\t # Restore FPU Stack" | |
| 9628 %} | |
| 9629 ins_cost(250); | |
| 9630 ins_encode( Push_ModD_encoding(src0, src1), emitModD(), Push_ResultXD(dst), PopFPU); | |
| 9631 ins_pipe( pipe_slow ); | |
| 9632 %} | |
| 9633 | |
| 9634 instruct sinD_reg(regDPR1 dst, regDPR1 src) %{ | |
| 9635 predicate (UseSSE<=1); | |
| 9636 match(Set dst (SinD src)); | |
| 9637 ins_cost(1800); | |
| 9638 format %{ "DSIN $dst" %} | |
| 9639 opcode(0xD9, 0xFE); | |
| 9640 ins_encode( OpcP, OpcS ); | |
| 9641 ins_pipe( pipe_slow ); | |
| 9642 %} | |
| 9643 | |
| 9644 instruct sinXD_reg(regXD dst, eFlagsReg cr) %{ | |
| 9645 predicate (UseSSE>=2); | |
| 9646 match(Set dst (SinD dst)); | |
| 9647 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
| 9648 ins_cost(1800); | |
| 9649 format %{ "DSIN $dst" %} | |
| 9650 opcode(0xD9, 0xFE); | |
| 9651 ins_encode( Push_SrcXD(dst), OpcP, OpcS, Push_ResultXD(dst) ); | |
| 9652 ins_pipe( pipe_slow ); | |
| 9653 %} | |
| 9654 | |
| 9655 instruct cosD_reg(regDPR1 dst, regDPR1 src) %{ | |
| 9656 predicate (UseSSE<=1); | |
| 9657 match(Set dst (CosD src)); | |
| 9658 ins_cost(1800); | |
| 9659 format %{ "DCOS $dst" %} | |
| 9660 opcode(0xD9, 0xFF); | |
| 9661 ins_encode( OpcP, OpcS ); | |
| 9662 ins_pipe( pipe_slow ); | |
| 9663 %} | |
| 9664 | |
| 9665 instruct cosXD_reg(regXD dst, eFlagsReg cr) %{ | |
| 9666 predicate (UseSSE>=2); | |
| 9667 match(Set dst (CosD dst)); | |
| 9668 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
| 9669 ins_cost(1800); | |
| 9670 format %{ "DCOS $dst" %} | |
| 9671 opcode(0xD9, 0xFF); | |
| 9672 ins_encode( Push_SrcXD(dst), OpcP, OpcS, Push_ResultXD(dst) ); | |
| 9673 ins_pipe( pipe_slow ); | |
| 9674 %} | |
| 9675 | |
| 9676 instruct tanD_reg(regDPR1 dst, regDPR1 src) %{ | |
| 9677 predicate (UseSSE<=1); | |
| 9678 match(Set dst(TanD src)); | |
| 9679 format %{ "DTAN $dst" %} | |
| 9680 ins_encode( Opcode(0xD9), Opcode(0xF2), // fptan | |
| 9681 Opcode(0xDD), Opcode(0xD8)); // fstp st | |
| 9682 ins_pipe( pipe_slow ); | |
| 9683 %} | |
| 9684 | |
| 9685 instruct tanXD_reg(regXD dst, eFlagsReg cr) %{ | |
| 9686 predicate (UseSSE>=2); | |
| 9687 match(Set dst(TanD dst)); | |
| 9688 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
| 9689 format %{ "DTAN $dst" %} | |
| 9690 ins_encode( Push_SrcXD(dst), | |
| 9691 Opcode(0xD9), Opcode(0xF2), // fptan | |
| 9692 Opcode(0xDD), Opcode(0xD8), // fstp st | |
| 9693 Push_ResultXD(dst) ); | |
| 9694 ins_pipe( pipe_slow ); | |
| 9695 %} | |
| 9696 | |
| 9697 instruct atanD_reg(regD dst, regD src) %{ | |
| 9698 predicate (UseSSE<=1); | |
| 9699 match(Set dst(AtanD dst src)); | |
| 9700 format %{ "DATA $dst,$src" %} | |
| 9701 opcode(0xD9, 0xF3); | |
| 9702 ins_encode( Push_Reg_D(src), | |
| 9703 OpcP, OpcS, RegOpc(dst) ); | |
| 9704 ins_pipe( pipe_slow ); | |
| 9705 %} | |
| 9706 | |
| 9707 instruct atanXD_reg(regXD dst, regXD src, eFlagsReg cr) %{ | |
| 9708 predicate (UseSSE>=2); | |
| 9709 match(Set dst(AtanD dst src)); | |
| 9710 effect(KILL cr); // Push_{Src|Result}XD() uses "{SUB|ADD} ESP,8" | |
| 9711 format %{ "DATA $dst,$src" %} | |
| 9712 opcode(0xD9, 0xF3); | |
| 9713 ins_encode( Push_SrcXD(src), | |
| 9714 OpcP, OpcS, Push_ResultXD(dst) ); | |
| 9715 ins_pipe( pipe_slow ); | |
| 9716 %} | |
| 9717 | |
| 9718 instruct sqrtD_reg(regD dst, regD src) %{ | |
| 9719 predicate (UseSSE<=1); | |
| 9720 match(Set dst (SqrtD src)); | |
| 9721 format %{ "DSQRT $dst,$src" %} | |
| 9722 opcode(0xFA, 0xD9); | |
| 9723 ins_encode( Push_Reg_D(src), | |
| 9724 OpcS, OpcP, Pop_Reg_D(dst) ); | |
| 9725 ins_pipe( pipe_slow ); | |
| 9726 %} | |
| 9727 | |
| 9728 instruct powD_reg(regD X, regDPR1 Y, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ | |
| 9729 predicate (UseSSE<=1); | |
| 9730 match(Set Y (PowD X Y)); // Raise X to the Yth power | |
| 9731 effect(KILL rax, KILL rbx, KILL rcx); | |
| 9732 format %{ "SUB ESP,8\t\t# Fast-path POW encoding\n\t" | |
| 9733 "FLD_D $X\n\t" | |
| 9734 "FYL2X \t\t\t# Q=Y*ln2(X)\n\t" | |
| 9735 | |
| 9736 "FDUP \t\t\t# Q Q\n\t" | |
| 9737 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
| 9738 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
| 9739 "FISTP dword [ESP]\n\t" | |
| 9740 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
| 9741 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
| 9742 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
| 9743 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
| 9744 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
| 9745 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
| 9746 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
| 9747 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
| 9748 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
| 9749 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
| 9750 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
| 9751 "MOV [ESP+0],0\n\t" | |
| 9752 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
| 9753 | |
| 9754 "ADD ESP,8" | |
| 9755 %} | |
| 9756 ins_encode( push_stack_temp_qword, | |
| 9757 Push_Reg_D(X), | |
| 9758 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
| 9759 pow_exp_core_encoding, | |
| 9760 pop_stack_temp_qword); | |
| 9761 ins_pipe( pipe_slow ); | |
| 9762 %} | |
| 9763 | |
| 9764 instruct powXD_reg(regXD dst, regXD src0, regXD src1, regDPR1 tmp1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx ) %{ | |
| 9765 predicate (UseSSE>=2); | |
| 9766 match(Set dst (PowD src0 src1)); // Raise src0 to the src1'th power | |
| 9767 effect(KILL tmp1, KILL rax, KILL rbx, KILL rcx ); | |
| 9768 format %{ "SUB ESP,8\t\t# Fast-path POW encoding\n\t" | |
| 9769 "MOVSD [ESP],$src1\n\t" | |
| 9770 "FLD FPR1,$src1\n\t" | |
| 9771 "MOVSD [ESP],$src0\n\t" | |
| 9772 "FLD FPR1,$src0\n\t" | |
| 9773 "FYL2X \t\t\t# Q=Y*ln2(X)\n\t" | |
| 9774 | |
| 9775 "FDUP \t\t\t# Q Q\n\t" | |
| 9776 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
| 9777 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
| 9778 "FISTP dword [ESP]\n\t" | |
| 9779 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
| 9780 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
| 9781 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
| 9782 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
| 9783 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
| 9784 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
| 9785 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
| 9786 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
| 9787 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
| 9788 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
| 9789 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
| 9790 "MOV [ESP+0],0\n\t" | |
| 9791 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
| 9792 | |
| 9793 "FST_D [ESP]\n\t" | |
| 9794 "MOVSD $dst,[ESP]\n\t" | |
| 9795 "ADD ESP,8" | |
| 9796 %} | |
| 9797 ins_encode( push_stack_temp_qword, | |
| 9798 push_xmm_to_fpr1(src1), | |
| 9799 push_xmm_to_fpr1(src0), | |
| 9800 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
| 9801 pow_exp_core_encoding, | |
| 9802 Push_ResultXD(dst) ); | |
| 9803 ins_pipe( pipe_slow ); | |
| 9804 %} | |
| 9805 | |
| 9806 | |
| 9807 instruct expD_reg(regDPR1 dpr1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ | |
| 9808 predicate (UseSSE<=1); | |
| 9809 match(Set dpr1 (ExpD dpr1)); | |
| 9810 effect(KILL rax, KILL rbx, KILL rcx); | |
| 9811 format %{ "SUB ESP,8\t\t# Fast-path EXP encoding" | |
| 9812 "FLDL2E \t\t\t# Ld log2(e) X\n\t" | |
| 9813 "FMULP \t\t\t# Q=X*log2(e)\n\t" | |
| 9814 | |
| 9815 "FDUP \t\t\t# Q Q\n\t" | |
| 9816 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
| 9817 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
| 9818 "FISTP dword [ESP]\n\t" | |
| 9819 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
| 9820 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
| 9821 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
| 9822 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
| 9823 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
| 9824 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
| 9825 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
| 9826 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
| 9827 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
| 9828 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
| 9829 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
| 9830 "MOV [ESP+0],0\n\t" | |
| 9831 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
| 9832 | |
| 9833 "ADD ESP,8" | |
| 9834 %} | |
| 9835 ins_encode( push_stack_temp_qword, | |
| 9836 Opcode(0xD9), Opcode(0xEA), // fldl2e | |
| 9837 Opcode(0xDE), Opcode(0xC9), // fmulp | |
| 9838 pow_exp_core_encoding, | |
| 9839 pop_stack_temp_qword); | |
| 9840 ins_pipe( pipe_slow ); | |
| 9841 %} | |
| 9842 | |
| 9843 instruct expXD_reg(regXD dst, regXD src, regDPR1 tmp1, eAXRegI rax, eBXRegI rbx, eCXRegI rcx) %{ | |
| 9844 predicate (UseSSE>=2); | |
| 9845 match(Set dst (ExpD src)); | |
| 9846 effect(KILL tmp1, KILL rax, KILL rbx, KILL rcx); | |
| 9847 format %{ "SUB ESP,8\t\t# Fast-path EXP encoding\n\t" | |
| 9848 "MOVSD [ESP],$src\n\t" | |
| 9849 "FLDL2E \t\t\t# Ld log2(e) X\n\t" | |
| 9850 "FMULP \t\t\t# Q=X*log2(e) X\n\t" | |
| 9851 | |
| 9852 "FDUP \t\t\t# Q Q\n\t" | |
| 9853 "FRNDINT\t\t\t# int(Q) Q\n\t" | |
| 9854 "FSUB ST(1),ST(0)\t# int(Q) frac(Q)\n\t" | |
| 9855 "FISTP dword [ESP]\n\t" | |
| 9856 "F2XM1 \t\t\t# 2^frac(Q)-1 int(Q)\n\t" | |
| 9857 "FLD1 \t\t\t# 1 2^frac(Q)-1 int(Q)\n\t" | |
| 9858 "FADDP \t\t\t# 2^frac(Q) int(Q)\n\t" // could use FADD [1.000] instead | |
| 9859 "MOV EAX,[ESP]\t# Pick up int(Q)\n\t" | |
| 9860 "MOV ECX,0xFFFFF800\t# Overflow mask\n\t" | |
| 9861 "ADD EAX,1023\t\t# Double exponent bias\n\t" | |
| 9862 "MOV EBX,EAX\t\t# Preshifted biased expo\n\t" | |
| 9863 "SHL EAX,20\t\t# Shift exponent into place\n\t" | |
| 9864 "TEST EBX,ECX\t\t# Check for overflow\n\t" | |
| 9865 "CMOVne EAX,ECX\t\t# If overflow, stuff NaN into EAX\n\t" | |
| 9866 "MOV [ESP+4],EAX\t# Marshal 64-bit scaling double\n\t" | |
| 9867 "MOV [ESP+0],0\n\t" | |
| 9868 "FMUL ST(0),[ESP+0]\t# Scale\n\t" | |
| 9869 | |
| 9870 "FST_D [ESP]\n\t" | |
| 9871 "MOVSD $dst,[ESP]\n\t" | |
| 9872 "ADD ESP,8" | |
| 9873 %} | |
| 9874 ins_encode( Push_SrcXD(src), | |
| 9875 Opcode(0xD9), Opcode(0xEA), // fldl2e | |
| 9876 Opcode(0xDE), Opcode(0xC9), // fmulp | |
| 9877 pow_exp_core_encoding, | |
| 9878 Push_ResultXD(dst) ); | |
| 9879 ins_pipe( pipe_slow ); | |
| 9880 %} | |
| 9881 | |
| 9882 | |
| 9883 | |
| 9884 instruct log10D_reg(regDPR1 dst, regDPR1 src) %{ | |
| 9885 predicate (UseSSE<=1); | |
| 9886 // The source Double operand on FPU stack | |
| 9887 match(Set dst (Log10D src)); | |
| 9888 // fldlg2 ; push log_10(2) on the FPU stack; full 80-bit number | |
| 9889 // fxch ; swap ST(0) with ST(1) | |
| 9890 // fyl2x ; compute log_10(2) * log_2(x) | |
| 9891 format %{ "FLDLG2 \t\t\t#Log10\n\t" | |
| 9892 "FXCH \n\t" | |
| 9893 "FYL2X \t\t\t# Q=Log10*Log_2(x)" | |
| 9894 %} | |
| 9895 ins_encode( Opcode(0xD9), Opcode(0xEC), // fldlg2 | |
| 9896 Opcode(0xD9), Opcode(0xC9), // fxch | |
| 9897 Opcode(0xD9), Opcode(0xF1)); // fyl2x | |
| 9898 | |
| 9899 ins_pipe( pipe_slow ); | |
| 9900 %} | |
| 9901 | |
| 9902 instruct log10XD_reg(regXD dst, regXD src, eFlagsReg cr) %{ | |
| 9903 predicate (UseSSE>=2); | |
| 9904 effect(KILL cr); | |
| 9905 match(Set dst (Log10D src)); | |
| 9906 // fldlg2 ; push log_10(2) on the FPU stack; full 80-bit number | |
| 9907 // fyl2x ; compute log_10(2) * log_2(x) | |
| 9908 format %{ "FLDLG2 \t\t\t#Log10\n\t" | |
| 9909 "FYL2X \t\t\t# Q=Log10*Log_2(x)" | |
| 9910 %} | |
| 9911 ins_encode( Opcode(0xD9), Opcode(0xEC), // fldlg2 | |
| 9912 Push_SrcXD(src), | |
| 9913 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
| 9914 Push_ResultXD(dst)); | |
| 9915 | |
| 9916 ins_pipe( pipe_slow ); | |
| 9917 %} | |
| 9918 | |
| 9919 instruct logD_reg(regDPR1 dst, regDPR1 src) %{ | |
| 9920 predicate (UseSSE<=1); | |
| 9921 // The source Double operand on FPU stack | |
| 9922 match(Set dst (LogD src)); | |
| 9923 // fldln2 ; push log_e(2) on the FPU stack; full 80-bit number | |
| 9924 // fxch ; swap ST(0) with ST(1) | |
| 9925 // fyl2x ; compute log_e(2) * log_2(x) | |
| 9926 format %{ "FLDLN2 \t\t\t#Log_e\n\t" | |
| 9927 "FXCH \n\t" | |
| 9928 "FYL2X \t\t\t# Q=Log_e*Log_2(x)" | |
| 9929 %} | |
| 9930 ins_encode( Opcode(0xD9), Opcode(0xED), // fldln2 | |
| 9931 Opcode(0xD9), Opcode(0xC9), // fxch | |
| 9932 Opcode(0xD9), Opcode(0xF1)); // fyl2x | |
| 9933 | |
| 9934 ins_pipe( pipe_slow ); | |
| 9935 %} | |
| 9936 | |
| 9937 instruct logXD_reg(regXD dst, regXD src, eFlagsReg cr) %{ | |
| 9938 predicate (UseSSE>=2); | |
| 9939 effect(KILL cr); | |
| 9940 // The source and result Double operands in XMM registers | |
| 9941 match(Set dst (LogD src)); | |
| 9942 // fldln2 ; push log_e(2) on the FPU stack; full 80-bit number | |
| 9943 // fyl2x ; compute log_e(2) * log_2(x) | |
| 9944 format %{ "FLDLN2 \t\t\t#Log_e\n\t" | |
| 9945 "FYL2X \t\t\t# Q=Log_e*Log_2(x)" | |
| 9946 %} | |
| 9947 ins_encode( Opcode(0xD9), Opcode(0xED), // fldln2 | |
| 9948 Push_SrcXD(src), | |
| 9949 Opcode(0xD9), Opcode(0xF1), // fyl2x | |
| 9950 Push_ResultXD(dst)); | |
| 9951 ins_pipe( pipe_slow ); | |
| 9952 %} | |
| 9953 | |
| 9954 //-------------Float Instructions------------------------------- | |
| 9955 // Float Math | |
| 9956 | |
| 9957 // Code for float compare: | |
| 9958 // fcompp(); | |
| 9959 // fwait(); fnstsw_ax(); | |
| 9960 // sahf(); | |
| 9961 // movl(dst, unordered_result); | |
| 9962 // jcc(Assembler::parity, exit); | |
| 9963 // movl(dst, less_result); | |
| 9964 // jcc(Assembler::below, exit); | |
| 9965 // movl(dst, equal_result); | |
| 9966 // jcc(Assembler::equal, exit); | |
| 9967 // movl(dst, greater_result); | |
| 9968 // exit: | |
| 9969 | |
| 9970 // P6 version of float compare, sets condition codes in EFLAGS | |
| 9971 instruct cmpF_cc_P6(eFlagsRegU cr, regF src1, regF src2, eAXRegI rax) %{ | |
| 9972 predicate(VM_Version::supports_cmov() && UseSSE == 0); | |
| 9973 match(Set cr (CmpF src1 src2)); | |
| 9974 effect(KILL rax); | |
| 9975 ins_cost(150); | |
| 9976 format %{ "FLD $src1\n\t" | |
| 9977 "FUCOMIP ST,$src2 // P6 instruction\n\t" | |
| 9978 "JNP exit\n\t" | |
| 9979 "MOV ah,1 // saw a NaN, set CF (treat as LT)\n\t" | |
| 9980 "SAHF\n" | |
| 9981 "exit:\tNOP // avoid branch to branch" %} | |
| 9982 opcode(0xDF, 0x05); /* DF E8+i or DF /5 */ | |
| 9983 ins_encode( Push_Reg_D(src1), | |
| 9984 OpcP, RegOpc(src2), | |
| 9985 cmpF_P6_fixup ); | |
| 9986 ins_pipe( pipe_slow ); | |
| 9987 %} | |
| 9988 | |
| 9989 | |
| 9990 // Compare & branch | |
| 9991 instruct cmpF_cc(eFlagsRegU cr, regF src1, regF src2, eAXRegI rax) %{ | |
| 9992 predicate(UseSSE == 0); | |
| 9993 match(Set cr (CmpF src1 src2)); | |
| 9994 effect(KILL rax); | |
| 9995 ins_cost(200); | |
| 9996 format %{ "FLD $src1\n\t" | |
| 9997 "FCOMp $src2\n\t" | |
| 9998 "FNSTSW AX\n\t" | |
| 9999 "TEST AX,0x400\n\t" | |
| 10000 "JZ,s flags\n\t" | |
| 10001 "MOV AH,1\t# unordered treat as LT\n" | |
| 10002 "flags:\tSAHF" %} | |
| 10003 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
| 10004 ins_encode( Push_Reg_D(src1), | |
| 10005 OpcP, RegOpc(src2), | |
| 10006 fpu_flags); | |
| 10007 ins_pipe( pipe_slow ); | |
| 10008 %} | |
| 10009 | |
| 10010 // Compare vs zero into -1,0,1 | |
| 10011 instruct cmpF_0(eRegI dst, regF src1, immF0 zero, eAXRegI rax, eFlagsReg cr) %{ | |
| 10012 predicate(UseSSE == 0); | |
| 10013 match(Set dst (CmpF3 src1 zero)); | |
| 10014 effect(KILL cr, KILL rax); | |
| 10015 ins_cost(280); | |
| 10016 format %{ "FTSTF $dst,$src1" %} | |
| 10017 opcode(0xE4, 0xD9); | |
| 10018 ins_encode( Push_Reg_D(src1), | |
| 10019 OpcS, OpcP, PopFPU, | |
| 10020 CmpF_Result(dst)); | |
| 10021 ins_pipe( pipe_slow ); | |
| 10022 %} | |
| 10023 | |
| 10024 // Compare into -1,0,1 | |
| 10025 instruct cmpF_reg(eRegI dst, regF src1, regF src2, eAXRegI rax, eFlagsReg cr) %{ | |
| 10026 predicate(UseSSE == 0); | |
| 10027 match(Set dst (CmpF3 src1 src2)); | |
| 10028 effect(KILL cr, KILL rax); | |
| 10029 ins_cost(300); | |
| 10030 format %{ "FCMPF $dst,$src1,$src2" %} | |
| 10031 opcode(0xD8, 0x3); /* D8 D8+i or D8 /3 */ | |
| 10032 ins_encode( Push_Reg_D(src1), | |
| 10033 OpcP, RegOpc(src2), | |
| 10034 CmpF_Result(dst)); | |
| 10035 ins_pipe( pipe_slow ); | |
| 10036 %} | |
| 10037 | |
| 10038 // float compare and set condition codes in EFLAGS by XMM regs | |
| 10039 instruct cmpX_cc(eFlagsRegU cr, regX dst, regX src, eAXRegI rax) %{ | |
| 10040 predicate(UseSSE>=1); | |
| 10041 match(Set cr (CmpF dst src)); | |
| 10042 effect(KILL rax); | |
| 10043 ins_cost(145); | |
| 10044 format %{ "COMISS $dst,$src\n" | |
| 10045 "\tJNP exit\n" | |
| 10046 "\tMOV ah,1 // saw a NaN, set CF\n" | |
| 10047 "\tSAHF\n" | |
| 10048 "exit:\tNOP // avoid branch to branch" %} | |
| 10049 opcode(0x0F, 0x2F); | |
| 10050 ins_encode(OpcP, OpcS, RegReg(dst, src), cmpF_P6_fixup); | |
| 10051 ins_pipe( pipe_slow ); | |
| 10052 %} | |
| 10053 | |
| 10054 // float compare and set condition codes in EFLAGS by XMM regs | |
| 10055 instruct cmpX_ccmem(eFlagsRegU cr, regX dst, memory src, eAXRegI rax) %{ | |
| 10056 predicate(UseSSE>=1); | |
| 10057 match(Set cr (CmpF dst (LoadF src))); | |
| 10058 effect(KILL rax); | |
| 10059 ins_cost(165); | |
| 10060 format %{ "COMISS $dst,$src\n" | |
| 10061 "\tJNP exit\n" | |
| 10062 "\tMOV ah,1 // saw a NaN, set CF\n" | |
| 10063 "\tSAHF\n" | |
| 10064 "exit:\tNOP // avoid branch to branch" %} | |
| 10065 opcode(0x0F, 0x2F); | |
| 10066 ins_encode(OpcP, OpcS, RegMem(dst, src), cmpF_P6_fixup); | |
| 10067 ins_pipe( pipe_slow ); | |
| 10068 %} | |
| 10069 | |
| 10070 // Compare into -1,0,1 in XMM | |
| 10071 instruct cmpX_reg(eRegI dst, regX src1, regX src2, eFlagsReg cr) %{ | |
| 10072 predicate(UseSSE>=1); | |
| 10073 match(Set dst (CmpF3 src1 src2)); | |
| 10074 effect(KILL cr); | |
| 10075 ins_cost(255); | |
| 10076 format %{ "XOR $dst,$dst\n" | |
| 10077 "\tCOMISS $src1,$src2\n" | |
| 10078 "\tJP,s nan\n" | |
| 10079 "\tJEQ,s exit\n" | |
| 10080 "\tJA,s inc\n" | |
| 10081 "nan:\tDEC $dst\n" | |
| 10082 "\tJMP,s exit\n" | |
| 10083 "inc:\tINC $dst\n" | |
| 10084 "exit:" | |
| 10085 %} | |
| 10086 opcode(0x0F, 0x2F); | |
| 10087 ins_encode(Xor_Reg(dst), OpcP, OpcS, RegReg(src1, src2), CmpX_Result(dst)); | |
| 10088 ins_pipe( pipe_slow ); | |
| 10089 %} | |
| 10090 | |
| 10091 // Compare into -1,0,1 in XMM and memory | |
| 10092 instruct cmpX_regmem(eRegI dst, regX src1, memory mem, eFlagsReg cr) %{ | |
| 10093 predicate(UseSSE>=1); | |
| 10094 match(Set dst (CmpF3 src1 (LoadF mem))); | |
| 10095 effect(KILL cr); | |
| 10096 ins_cost(275); | |
| 10097 format %{ "COMISS $src1,$mem\n" | |
| 10098 "\tMOV $dst,0\t\t# do not blow flags\n" | |
| 10099 "\tJP,s nan\n" | |
| 10100 "\tJEQ,s exit\n" | |
| 10101 "\tJA,s inc\n" | |
| 10102 "nan:\tDEC $dst\n" | |
| 10103 "\tJMP,s exit\n" | |
| 10104 "inc:\tINC $dst\n" | |
| 10105 "exit:" | |
| 10106 %} | |
| 10107 opcode(0x0F, 0x2F); | |
| 10108 ins_encode(OpcP, OpcS, RegMem(src1, mem), LdImmI(dst,0x0), CmpX_Result(dst)); | |
| 10109 ins_pipe( pipe_slow ); | |
| 10110 %} | |
| 10111 | |
| 10112 // Spill to obtain 24-bit precision | |
| 10113 instruct subF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
| 10114 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10115 match(Set dst (SubF src1 src2)); | |
| 10116 | |
| 10117 format %{ "FSUB $dst,$src1 - $src2" %} | |
| 10118 opcode(0xD8, 0x4); /* D8 E0+i or D8 /4 mod==0x3 ;; result in TOS */ | |
| 10119 ins_encode( Push_Reg_F(src1), | |
| 10120 OpcReg_F(src2), | |
| 10121 Pop_Mem_F(dst) ); | |
| 10122 ins_pipe( fpu_mem_reg_reg ); | |
| 10123 %} | |
| 10124 // | |
| 10125 // This instruction does not round to 24-bits | |
| 10126 instruct subF_reg(regF dst, regF src) %{ | |
| 10127 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10128 match(Set dst (SubF dst src)); | |
| 10129 | |
| 10130 format %{ "FSUB $dst,$src" %} | |
| 10131 opcode(0xDE, 0x5); /* DE E8+i or DE /5 */ | |
| 10132 ins_encode( Push_Reg_F(src), | |
| 10133 OpcP, RegOpc(dst) ); | |
| 10134 ins_pipe( fpu_reg_reg ); | |
| 10135 %} | |
| 10136 | |
| 10137 // Spill to obtain 24-bit precision | |
| 10138 instruct addF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
| 10139 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10140 match(Set dst (AddF src1 src2)); | |
| 10141 | |
| 10142 format %{ "FADD $dst,$src1,$src2" %} | |
| 10143 opcode(0xD8, 0x0); /* D8 C0+i */ | |
| 10144 ins_encode( Push_Reg_F(src2), | |
| 10145 OpcReg_F(src1), | |
| 10146 Pop_Mem_F(dst) ); | |
| 10147 ins_pipe( fpu_mem_reg_reg ); | |
| 10148 %} | |
| 10149 // | |
| 10150 // This instruction does not round to 24-bits | |
| 10151 instruct addF_reg(regF dst, regF src) %{ | |
| 10152 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10153 match(Set dst (AddF dst src)); | |
| 10154 | |
| 10155 format %{ "FLD $src\n\t" | |
| 10156 "FADDp $dst,ST" %} | |
| 10157 opcode(0xDE, 0x0); /* DE C0+i or DE /0*/ | |
| 10158 ins_encode( Push_Reg_F(src), | |
| 10159 OpcP, RegOpc(dst) ); | |
| 10160 ins_pipe( fpu_reg_reg ); | |
| 10161 %} | |
| 10162 | |
| 10163 // Add two single precision floating point values in xmm | |
| 10164 instruct addX_reg(regX dst, regX src) %{ | |
| 10165 predicate(UseSSE>=1); | |
| 10166 match(Set dst (AddF dst src)); | |
| 10167 format %{ "ADDSS $dst,$src" %} | |
| 10168 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), RegReg(dst, src)); | |
| 10169 ins_pipe( pipe_slow ); | |
| 10170 %} | |
| 10171 | |
| 10172 instruct addX_imm(regX dst, immXF con) %{ | |
| 10173 predicate(UseSSE>=1); | |
| 10174 match(Set dst (AddF dst con)); | |
| 10175 format %{ "ADDSS $dst,[$con]" %} | |
| 10176 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), LdImmX(dst, con) ); | |
| 10177 ins_pipe( pipe_slow ); | |
| 10178 %} | |
| 10179 | |
| 10180 instruct addX_mem(regX dst, memory mem) %{ | |
| 10181 predicate(UseSSE>=1); | |
| 10182 match(Set dst (AddF dst (LoadF mem))); | |
| 10183 format %{ "ADDSS $dst,$mem" %} | |
| 10184 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x58), RegMem(dst, mem)); | |
| 10185 ins_pipe( pipe_slow ); | |
| 10186 %} | |
| 10187 | |
| 10188 // Subtract two single precision floating point values in xmm | |
| 10189 instruct subX_reg(regX dst, regX src) %{ | |
| 10190 predicate(UseSSE>=1); | |
| 10191 match(Set dst (SubF dst src)); | |
| 10192 format %{ "SUBSS $dst,$src" %} | |
| 10193 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), RegReg(dst, src)); | |
| 10194 ins_pipe( pipe_slow ); | |
| 10195 %} | |
| 10196 | |
| 10197 instruct subX_imm(regX dst, immXF con) %{ | |
| 10198 predicate(UseSSE>=1); | |
| 10199 match(Set dst (SubF dst con)); | |
| 10200 format %{ "SUBSS $dst,[$con]" %} | |
| 10201 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), LdImmX(dst, con) ); | |
| 10202 ins_pipe( pipe_slow ); | |
| 10203 %} | |
| 10204 | |
| 10205 instruct subX_mem(regX dst, memory mem) %{ | |
| 10206 predicate(UseSSE>=1); | |
| 10207 match(Set dst (SubF dst (LoadF mem))); | |
| 10208 format %{ "SUBSS $dst,$mem" %} | |
| 10209 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5C), RegMem(dst,mem)); | |
| 10210 ins_pipe( pipe_slow ); | |
| 10211 %} | |
| 10212 | |
| 10213 // Multiply two single precision floating point values in xmm | |
| 10214 instruct mulX_reg(regX dst, regX src) %{ | |
| 10215 predicate(UseSSE>=1); | |
| 10216 match(Set dst (MulF dst src)); | |
| 10217 format %{ "MULSS $dst,$src" %} | |
| 10218 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), RegReg(dst, src)); | |
| 10219 ins_pipe( pipe_slow ); | |
| 10220 %} | |
| 10221 | |
| 10222 instruct mulX_imm(regX dst, immXF con) %{ | |
| 10223 predicate(UseSSE>=1); | |
| 10224 match(Set dst (MulF dst con)); | |
| 10225 format %{ "MULSS $dst,[$con]" %} | |
| 10226 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), LdImmX(dst, con) ); | |
| 10227 ins_pipe( pipe_slow ); | |
| 10228 %} | |
| 10229 | |
| 10230 instruct mulX_mem(regX dst, memory mem) %{ | |
| 10231 predicate(UseSSE>=1); | |
| 10232 match(Set dst (MulF dst (LoadF mem))); | |
| 10233 format %{ "MULSS $dst,$mem" %} | |
| 10234 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x59), RegMem(dst,mem)); | |
| 10235 ins_pipe( pipe_slow ); | |
| 10236 %} | |
| 10237 | |
| 10238 // Divide two single precision floating point values in xmm | |
| 10239 instruct divX_reg(regX dst, regX src) %{ | |
| 10240 predicate(UseSSE>=1); | |
| 10241 match(Set dst (DivF dst src)); | |
| 10242 format %{ "DIVSS $dst,$src" %} | |
| 10243 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), RegReg(dst, src)); | |
| 10244 ins_pipe( pipe_slow ); | |
| 10245 %} | |
| 10246 | |
| 10247 instruct divX_imm(regX dst, immXF con) %{ | |
| 10248 predicate(UseSSE>=1); | |
| 10249 match(Set dst (DivF dst con)); | |
| 10250 format %{ "DIVSS $dst,[$con]" %} | |
| 10251 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), LdImmX(dst, con) ); | |
| 10252 ins_pipe( pipe_slow ); | |
| 10253 %} | |
| 10254 | |
| 10255 instruct divX_mem(regX dst, memory mem) %{ | |
| 10256 predicate(UseSSE>=1); | |
| 10257 match(Set dst (DivF dst (LoadF mem))); | |
| 10258 format %{ "DIVSS $dst,$mem" %} | |
| 10259 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x5E), RegMem(dst,mem)); | |
| 10260 ins_pipe( pipe_slow ); | |
| 10261 %} | |
| 10262 | |
| 10263 // Get the square root of a single precision floating point values in xmm | |
| 10264 instruct sqrtX_reg(regX dst, regX src) %{ | |
| 10265 predicate(UseSSE>=1); | |
| 10266 match(Set dst (ConvD2F (SqrtD (ConvF2D src)))); | |
| 10267 format %{ "SQRTSS $dst,$src" %} | |
| 10268 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x51), RegReg(dst, src)); | |
| 10269 ins_pipe( pipe_slow ); | |
| 10270 %} | |
| 10271 | |
| 10272 instruct sqrtX_mem(regX dst, memory mem) %{ | |
| 10273 predicate(UseSSE>=1); | |
| 10274 match(Set dst (ConvD2F (SqrtD (ConvF2D (LoadF mem))))); | |
| 10275 format %{ "SQRTSS $dst,$mem" %} | |
| 10276 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x51), RegMem(dst, mem)); | |
| 10277 ins_pipe( pipe_slow ); | |
| 10278 %} | |
| 10279 | |
| 10280 // Get the square root of a double precision floating point values in xmm | |
| 10281 instruct sqrtXD_reg(regXD dst, regXD src) %{ | |
| 10282 predicate(UseSSE>=2); | |
| 10283 match(Set dst (SqrtD src)); | |
| 10284 format %{ "SQRTSD $dst,$src" %} | |
| 10285 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x51), RegReg(dst, src)); | |
| 10286 ins_pipe( pipe_slow ); | |
| 10287 %} | |
| 10288 | |
| 10289 instruct sqrtXD_mem(regXD dst, memory mem) %{ | |
| 10290 predicate(UseSSE>=2); | |
| 10291 match(Set dst (SqrtD (LoadD mem))); | |
| 10292 format %{ "SQRTSD $dst,$mem" %} | |
| 10293 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x51), RegMem(dst, mem)); | |
| 10294 ins_pipe( pipe_slow ); | |
| 10295 %} | |
| 10296 | |
| 10297 instruct absF_reg(regFPR1 dst, regFPR1 src) %{ | |
| 10298 predicate(UseSSE==0); | |
| 10299 match(Set dst (AbsF src)); | |
| 10300 ins_cost(100); | |
| 10301 format %{ "FABS" %} | |
| 10302 opcode(0xE1, 0xD9); | |
| 10303 ins_encode( OpcS, OpcP ); | |
| 10304 ins_pipe( fpu_reg_reg ); | |
| 10305 %} | |
| 10306 | |
| 10307 instruct absX_reg(regX dst ) %{ | |
| 10308 predicate(UseSSE>=1); | |
| 10309 match(Set dst (AbsF dst)); | |
| 10310 format %{ "ANDPS $dst,[0x7FFFFFFF]\t# ABS F by sign masking" %} | |
| 10311 ins_encode( AbsXF_encoding(dst)); | |
| 10312 ins_pipe( pipe_slow ); | |
| 10313 %} | |
| 10314 | |
| 10315 instruct negF_reg(regFPR1 dst, regFPR1 src) %{ | |
| 10316 predicate(UseSSE==0); | |
| 10317 match(Set dst (NegF src)); | |
| 10318 ins_cost(100); | |
| 10319 format %{ "FCHS" %} | |
| 10320 opcode(0xE0, 0xD9); | |
| 10321 ins_encode( OpcS, OpcP ); | |
| 10322 ins_pipe( fpu_reg_reg ); | |
| 10323 %} | |
| 10324 | |
| 10325 instruct negX_reg( regX dst ) %{ | |
| 10326 predicate(UseSSE>=1); | |
| 10327 match(Set dst (NegF dst)); | |
| 10328 format %{ "XORPS $dst,[0x80000000]\t# CHS F by sign flipping" %} | |
| 10329 ins_encode( NegXF_encoding(dst)); | |
| 10330 ins_pipe( pipe_slow ); | |
| 10331 %} | |
| 10332 | |
| 10333 // Cisc-alternate to addF_reg | |
| 10334 // Spill to obtain 24-bit precision | |
| 10335 instruct addF24_reg_mem(stackSlotF dst, regF src1, memory src2) %{ | |
| 10336 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10337 match(Set dst (AddF src1 (LoadF src2))); | |
| 10338 | |
| 10339 format %{ "FLD $src2\n\t" | |
| 10340 "FADD ST,$src1\n\t" | |
| 10341 "FSTP_S $dst" %} | |
| 10342 opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ | |
| 10343 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
| 10344 OpcReg_F(src1), | |
| 10345 Pop_Mem_F(dst) ); | |
| 10346 ins_pipe( fpu_mem_reg_mem ); | |
| 10347 %} | |
| 10348 // | |
| 10349 // Cisc-alternate to addF_reg | |
| 10350 // This instruction does not round to 24-bits | |
| 10351 instruct addF_reg_mem(regF dst, memory src) %{ | |
| 10352 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10353 match(Set dst (AddF dst (LoadF src))); | |
| 10354 | |
| 10355 format %{ "FADD $dst,$src" %} | |
| 10356 opcode(0xDE, 0x0, 0xD9); /* DE C0+i or DE /0*/ /* LoadF D9 /0 */ | |
| 10357 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src), | |
| 10358 OpcP, RegOpc(dst) ); | |
| 10359 ins_pipe( fpu_reg_mem ); | |
| 10360 %} | |
| 10361 | |
| 10362 // // Following two instructions for _222_mpegaudio | |
| 10363 // Spill to obtain 24-bit precision | |
| 10364 instruct addF24_mem_reg(stackSlotF dst, regF src2, memory src1 ) %{ | |
| 10365 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10366 match(Set dst (AddF src1 src2)); | |
| 10367 | |
| 10368 format %{ "FADD $dst,$src1,$src2" %} | |
| 10369 opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ | |
| 10370 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src1), | |
| 10371 OpcReg_F(src2), | |
| 10372 Pop_Mem_F(dst) ); | |
| 10373 ins_pipe( fpu_mem_reg_mem ); | |
| 10374 %} | |
| 10375 | |
| 10376 // Cisc-spill variant | |
| 10377 // Spill to obtain 24-bit precision | |
| 10378 instruct addF24_mem_cisc(stackSlotF dst, memory src1, memory src2) %{ | |
| 10379 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10380 match(Set dst (AddF src1 (LoadF src2))); | |
| 10381 | |
| 10382 format %{ "FADD $dst,$src1,$src2 cisc" %} | |
| 10383 opcode(0xD8, 0x0, 0xD9); /* D8 C0+i */ /* LoadF D9 /0 */ | |
| 10384 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
| 10385 set_instruction_start, | |
| 10386 OpcP, RMopc_Mem(secondary,src1), | |
| 10387 Pop_Mem_F(dst) ); | |
| 10388 ins_pipe( fpu_mem_mem_mem ); | |
| 10389 %} | |
| 10390 | |
| 10391 // Spill to obtain 24-bit precision | |
| 10392 instruct addF24_mem_mem(stackSlotF dst, memory src1, memory src2) %{ | |
| 10393 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10394 match(Set dst (AddF src1 src2)); | |
| 10395 | |
| 10396 format %{ "FADD $dst,$src1,$src2" %} | |
| 10397 opcode(0xD8, 0x0, 0xD9); /* D8 /0 */ /* LoadF D9 /0 */ | |
| 10398 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
| 10399 set_instruction_start, | |
| 10400 OpcP, RMopc_Mem(secondary,src1), | |
| 10401 Pop_Mem_F(dst) ); | |
| 10402 ins_pipe( fpu_mem_mem_mem ); | |
| 10403 %} | |
| 10404 | |
| 10405 | |
| 10406 // Spill to obtain 24-bit precision | |
| 10407 instruct addF24_reg_imm(stackSlotF dst, regF src1, immF src2) %{ | |
| 10408 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10409 match(Set dst (AddF src1 src2)); | |
| 10410 format %{ "FLD $src1\n\t" | |
| 10411 "FADD $src2\n\t" | |
| 10412 "FSTP_S $dst" %} | |
| 10413 opcode(0xD8, 0x00); /* D8 /0 */ | |
| 10414 ins_encode( Push_Reg_F(src1), | |
| 10415 Opc_MemImm_F(src2), | |
| 10416 Pop_Mem_F(dst)); | |
| 10417 ins_pipe( fpu_mem_reg_con ); | |
| 10418 %} | |
| 10419 // | |
| 10420 // This instruction does not round to 24-bits | |
| 10421 instruct addF_reg_imm(regF dst, regF src1, immF src2) %{ | |
| 10422 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10423 match(Set dst (AddF src1 src2)); | |
| 10424 format %{ "FLD $src1\n\t" | |
| 10425 "FADD $src2\n\t" | |
| 10426 "FSTP_S $dst" %} | |
| 10427 opcode(0xD8, 0x00); /* D8 /0 */ | |
| 10428 ins_encode( Push_Reg_F(src1), | |
| 10429 Opc_MemImm_F(src2), | |
| 10430 Pop_Reg_F(dst)); | |
| 10431 ins_pipe( fpu_reg_reg_con ); | |
| 10432 %} | |
| 10433 | |
| 10434 // Spill to obtain 24-bit precision | |
| 10435 instruct mulF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
| 10436 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10437 match(Set dst (MulF src1 src2)); | |
| 10438 | |
| 10439 format %{ "FLD $src1\n\t" | |
| 10440 "FMUL $src2\n\t" | |
| 10441 "FSTP_S $dst" %} | |
| 10442 opcode(0xD8, 0x1); /* D8 C8+i or D8 /1 ;; result in TOS */ | |
| 10443 ins_encode( Push_Reg_F(src1), | |
| 10444 OpcReg_F(src2), | |
| 10445 Pop_Mem_F(dst) ); | |
| 10446 ins_pipe( fpu_mem_reg_reg ); | |
| 10447 %} | |
| 10448 // | |
| 10449 // This instruction does not round to 24-bits | |
| 10450 instruct mulF_reg(regF dst, regF src1, regF src2) %{ | |
| 10451 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10452 match(Set dst (MulF src1 src2)); | |
| 10453 | |
| 10454 format %{ "FLD $src1\n\t" | |
| 10455 "FMUL $src2\n\t" | |
| 10456 "FSTP_S $dst" %} | |
| 10457 opcode(0xD8, 0x1); /* D8 C8+i */ | |
| 10458 ins_encode( Push_Reg_F(src2), | |
| 10459 OpcReg_F(src1), | |
| 10460 Pop_Reg_F(dst) ); | |
| 10461 ins_pipe( fpu_reg_reg_reg ); | |
| 10462 %} | |
| 10463 | |
| 10464 | |
| 10465 // Spill to obtain 24-bit precision | |
| 10466 // Cisc-alternate to reg-reg multiply | |
| 10467 instruct mulF24_reg_mem(stackSlotF dst, regF src1, memory src2) %{ | |
| 10468 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10469 match(Set dst (MulF src1 (LoadF src2))); | |
| 10470 | |
| 10471 format %{ "FLD_S $src2\n\t" | |
| 10472 "FMUL $src1\n\t" | |
| 10473 "FSTP_S $dst" %} | |
| 10474 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i or DE /1*/ /* LoadF D9 /0 */ | |
| 10475 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
| 10476 OpcReg_F(src1), | |
| 10477 Pop_Mem_F(dst) ); | |
| 10478 ins_pipe( fpu_mem_reg_mem ); | |
| 10479 %} | |
| 10480 // | |
| 10481 // This instruction does not round to 24-bits | |
| 10482 // Cisc-alternate to reg-reg multiply | |
| 10483 instruct mulF_reg_mem(regF dst, regF src1, memory src2) %{ | |
| 10484 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10485 match(Set dst (MulF src1 (LoadF src2))); | |
| 10486 | |
| 10487 format %{ "FMUL $dst,$src1,$src2" %} | |
| 10488 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i */ /* LoadF D9 /0 */ | |
| 10489 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
| 10490 OpcReg_F(src1), | |
| 10491 Pop_Reg_F(dst) ); | |
| 10492 ins_pipe( fpu_reg_reg_mem ); | |
| 10493 %} | |
| 10494 | |
| 10495 // Spill to obtain 24-bit precision | |
| 10496 instruct mulF24_mem_mem(stackSlotF dst, memory src1, memory src2) %{ | |
| 10497 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10498 match(Set dst (MulF src1 src2)); | |
| 10499 | |
| 10500 format %{ "FMUL $dst,$src1,$src2" %} | |
| 10501 opcode(0xD8, 0x1, 0xD9); /* D8 /1 */ /* LoadF D9 /0 */ | |
| 10502 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,src2), | |
| 10503 set_instruction_start, | |
| 10504 OpcP, RMopc_Mem(secondary,src1), | |
| 10505 Pop_Mem_F(dst) ); | |
| 10506 ins_pipe( fpu_mem_mem_mem ); | |
| 10507 %} | |
| 10508 | |
| 10509 // Spill to obtain 24-bit precision | |
| 10510 instruct mulF24_reg_imm(stackSlotF dst, regF src1, immF src2) %{ | |
| 10511 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10512 match(Set dst (MulF src1 src2)); | |
| 10513 | |
| 10514 format %{ "FMULc $dst,$src1,$src2" %} | |
| 10515 opcode(0xD8, 0x1); /* D8 /1*/ | |
| 10516 ins_encode( Push_Reg_F(src1), | |
| 10517 Opc_MemImm_F(src2), | |
| 10518 Pop_Mem_F(dst)); | |
| 10519 ins_pipe( fpu_mem_reg_con ); | |
| 10520 %} | |
| 10521 // | |
| 10522 // This instruction does not round to 24-bits | |
| 10523 instruct mulF_reg_imm(regF dst, regF src1, immF src2) %{ | |
| 10524 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10525 match(Set dst (MulF src1 src2)); | |
| 10526 | |
| 10527 format %{ "FMULc $dst. $src1, $src2" %} | |
| 10528 opcode(0xD8, 0x1); /* D8 /1*/ | |
| 10529 ins_encode( Push_Reg_F(src1), | |
| 10530 Opc_MemImm_F(src2), | |
| 10531 Pop_Reg_F(dst)); | |
| 10532 ins_pipe( fpu_reg_reg_con ); | |
| 10533 %} | |
| 10534 | |
| 10535 | |
| 10536 // | |
| 10537 // MACRO1 -- subsume unshared load into mulF | |
| 10538 // This instruction does not round to 24-bits | |
| 10539 instruct mulF_reg_load1(regF dst, regF src, memory mem1 ) %{ | |
| 10540 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10541 match(Set dst (MulF (LoadF mem1) src)); | |
| 10542 | |
| 10543 format %{ "FLD $mem1 ===MACRO1===\n\t" | |
| 10544 "FMUL ST,$src\n\t" | |
| 10545 "FSTP $dst" %} | |
| 10546 opcode(0xD8, 0x1, 0xD9); /* D8 C8+i or D8 /1 */ /* LoadF D9 /0 */ | |
| 10547 ins_encode( Opcode(tertiary), RMopc_Mem(0x00,mem1), | |
| 10548 OpcReg_F(src), | |
| 10549 Pop_Reg_F(dst) ); | |
| 10550 ins_pipe( fpu_reg_reg_mem ); | |
| 10551 %} | |
| 10552 // | |
| 10553 // MACRO2 -- addF a mulF which subsumed an unshared load | |
| 10554 // This instruction does not round to 24-bits | |
| 10555 instruct addF_mulF_reg_load1(regF dst, memory mem1, regF src1, regF src2) %{ | |
| 10556 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10557 match(Set dst (AddF (MulF (LoadF mem1) src1) src2)); | |
| 10558 ins_cost(95); | |
| 10559 | |
| 10560 format %{ "FLD $mem1 ===MACRO2===\n\t" | |
| 10561 "FMUL ST,$src1 subsume mulF left load\n\t" | |
| 10562 "FADD ST,$src2\n\t" | |
| 10563 "FSTP $dst" %} | |
| 10564 opcode(0xD9); /* LoadF D9 /0 */ | |
| 10565 ins_encode( OpcP, RMopc_Mem(0x00,mem1), | |
| 10566 FMul_ST_reg(src1), | |
| 10567 FAdd_ST_reg(src2), | |
| 10568 Pop_Reg_F(dst) ); | |
| 10569 ins_pipe( fpu_reg_mem_reg_reg ); | |
| 10570 %} | |
| 10571 | |
| 10572 // MACRO3 -- addF a mulF | |
| 10573 // This instruction does not round to 24-bits. It is a '2-address' | |
| 10574 // instruction in that the result goes back to src2. This eliminates | |
| 10575 // a move from the macro; possibly the register allocator will have | |
| 10576 // to add it back (and maybe not). | |
| 10577 instruct addF_mulF_reg(regF src2, regF src1, regF src0) %{ | |
| 10578 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10579 match(Set src2 (AddF (MulF src0 src1) src2)); | |
| 10580 | |
| 10581 format %{ "FLD $src0 ===MACRO3===\n\t" | |
| 10582 "FMUL ST,$src1\n\t" | |
| 10583 "FADDP $src2,ST" %} | |
| 10584 opcode(0xD9); /* LoadF D9 /0 */ | |
| 10585 ins_encode( Push_Reg_F(src0), | |
| 10586 FMul_ST_reg(src1), | |
| 10587 FAddP_reg_ST(src2) ); | |
| 10588 ins_pipe( fpu_reg_reg_reg ); | |
| 10589 %} | |
| 10590 | |
| 10591 // MACRO4 -- divF subF | |
| 10592 // This instruction does not round to 24-bits | |
| 10593 instruct subF_divF_reg(regF dst, regF src1, regF src2, regF src3) %{ | |
| 10594 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10595 match(Set dst (DivF (SubF src2 src1) src3)); | |
| 10596 | |
| 10597 format %{ "FLD $src2 ===MACRO4===\n\t" | |
| 10598 "FSUB ST,$src1\n\t" | |
| 10599 "FDIV ST,$src3\n\t" | |
| 10600 "FSTP $dst" %} | |
| 10601 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
| 10602 ins_encode( Push_Reg_F(src2), | |
| 10603 subF_divF_encode(src1,src3), | |
| 10604 Pop_Reg_F(dst) ); | |
| 10605 ins_pipe( fpu_reg_reg_reg_reg ); | |
| 10606 %} | |
| 10607 | |
| 10608 // Spill to obtain 24-bit precision | |
| 10609 instruct divF24_reg(stackSlotF dst, regF src1, regF src2) %{ | |
| 10610 predicate(UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10611 match(Set dst (DivF src1 src2)); | |
| 10612 | |
| 10613 format %{ "FDIV $dst,$src1,$src2" %} | |
| 10614 opcode(0xD8, 0x6); /* D8 F0+i or DE /6*/ | |
| 10615 ins_encode( Push_Reg_F(src1), | |
| 10616 OpcReg_F(src2), | |
| 10617 Pop_Mem_F(dst) ); | |
| 10618 ins_pipe( fpu_mem_reg_reg ); | |
| 10619 %} | |
| 10620 // | |
| 10621 // This instruction does not round to 24-bits | |
| 10622 instruct divF_reg(regF dst, regF src) %{ | |
| 10623 predicate(UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10624 match(Set dst (DivF dst src)); | |
| 10625 | |
| 10626 format %{ "FDIV $dst,$src" %} | |
| 10627 opcode(0xDE, 0x7); /* DE F8+i or DE /7*/ | |
| 10628 ins_encode( Push_Reg_F(src), | |
| 10629 OpcP, RegOpc(dst) ); | |
| 10630 ins_pipe( fpu_reg_reg ); | |
| 10631 %} | |
| 10632 | |
| 10633 | |
| 10634 // Spill to obtain 24-bit precision | |
| 10635 instruct modF24_reg(stackSlotF dst, regF src1, regF src2, eAXRegI rax, eFlagsReg cr) %{ | |
| 10636 predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 10637 match(Set dst (ModF src1 src2)); | |
| 10638 effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS | |
| 10639 | |
| 10640 format %{ "FMOD $dst,$src1,$src2" %} | |
| 10641 ins_encode( Push_Reg_Mod_D(src1, src2), | |
| 10642 emitModD(), | |
| 10643 Push_Result_Mod_D(src2), | |
| 10644 Pop_Mem_F(dst)); | |
| 10645 ins_pipe( pipe_slow ); | |
| 10646 %} | |
| 10647 // | |
| 10648 // This instruction does not round to 24-bits | |
| 10649 instruct modF_reg(regF dst, regF src, eAXRegI rax, eFlagsReg cr) %{ | |
| 10650 predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 10651 match(Set dst (ModF dst src)); | |
| 10652 effect(KILL rax, KILL cr); // emitModD() uses EAX and EFLAGS | |
| 10653 | |
| 10654 format %{ "FMOD $dst,$src" %} | |
| 10655 ins_encode(Push_Reg_Mod_D(dst, src), | |
| 10656 emitModD(), | |
| 10657 Push_Result_Mod_D(src), | |
| 10658 Pop_Reg_F(dst)); | |
| 10659 ins_pipe( pipe_slow ); | |
| 10660 %} | |
| 10661 | |
| 10662 instruct modX_reg(regX dst, regX src0, regX src1, eAXRegI rax, eFlagsReg cr) %{ | |
| 10663 predicate(UseSSE>=1); | |
| 10664 match(Set dst (ModF src0 src1)); | |
| 10665 effect(KILL rax, KILL cr); | |
| 10666 format %{ "SUB ESP,4\t # FMOD\n" | |
| 10667 "\tMOVSS [ESP+0],$src1\n" | |
| 10668 "\tFLD_S [ESP+0]\n" | |
| 10669 "\tMOVSS [ESP+0],$src0\n" | |
| 10670 "\tFLD_S [ESP+0]\n" | |
| 10671 "loop:\tFPREM\n" | |
| 10672 "\tFWAIT\n" | |
| 10673 "\tFNSTSW AX\n" | |
| 10674 "\tSAHF\n" | |
| 10675 "\tJP loop\n" | |
| 10676 "\tFSTP_S [ESP+0]\n" | |
| 10677 "\tMOVSS $dst,[ESP+0]\n" | |
| 10678 "\tADD ESP,4\n" | |
| 10679 "\tFSTP ST0\t # Restore FPU Stack" | |
| 10680 %} | |
| 10681 ins_cost(250); | |
| 10682 ins_encode( Push_ModX_encoding(src0, src1), emitModD(), Push_ResultX(dst,0x4), PopFPU); | |
| 10683 ins_pipe( pipe_slow ); | |
| 10684 %} | |
| 10685 | |
| 10686 | |
| 10687 //----------Arithmetic Conversion Instructions--------------------------------- | |
| 10688 // The conversions operations are all Alpha sorted. Please keep it that way! | |
| 10689 | |
| 10690 instruct roundFloat_mem_reg(stackSlotF dst, regF src) %{ | |
| 10691 predicate(UseSSE==0); | |
| 10692 match(Set dst (RoundFloat src)); | |
| 10693 ins_cost(125); | |
| 10694 format %{ "FST_S $dst,$src\t# F-round" %} | |
| 10695 ins_encode( Pop_Mem_Reg_F(dst, src) ); | |
| 10696 ins_pipe( fpu_mem_reg ); | |
| 10697 %} | |
| 10698 | |
| 10699 instruct roundDouble_mem_reg(stackSlotD dst, regD src) %{ | |
| 10700 predicate(UseSSE<=1); | |
| 10701 match(Set dst (RoundDouble src)); | |
| 10702 ins_cost(125); | |
| 10703 format %{ "FST_D $dst,$src\t# D-round" %} | |
| 10704 ins_encode( Pop_Mem_Reg_D(dst, src) ); | |
| 10705 ins_pipe( fpu_mem_reg ); | |
| 10706 %} | |
| 10707 | |
| 10708 // Force rounding to 24-bit precision and 6-bit exponent | |
| 10709 instruct convD2F_reg(stackSlotF dst, regD src) %{ | |
| 10710 predicate(UseSSE==0); | |
| 10711 match(Set dst (ConvD2F src)); | |
| 10712 format %{ "FST_S $dst,$src\t# F-round" %} | |
| 10713 expand %{ | |
| 10714 roundFloat_mem_reg(dst,src); | |
| 10715 %} | |
| 10716 %} | |
| 10717 | |
| 10718 // Force rounding to 24-bit precision and 6-bit exponent | |
| 10719 instruct convD2X_reg(regX dst, regD src, eFlagsReg cr) %{ | |
| 10720 predicate(UseSSE==1); | |
| 10721 match(Set dst (ConvD2F src)); | |
| 10722 effect( KILL cr ); | |
| 10723 format %{ "SUB ESP,4\n\t" | |
| 10724 "FST_S [ESP],$src\t# F-round\n\t" | |
| 10725 "MOVSS $dst,[ESP]\n\t" | |
| 10726 "ADD ESP,4" %} | |
| 10727 ins_encode( D2X_encoding(dst, src) ); | |
| 10728 ins_pipe( pipe_slow ); | |
| 10729 %} | |
| 10730 | |
| 10731 // Force rounding double precision to single precision | |
| 10732 instruct convXD2X_reg(regX dst, regXD src) %{ | |
| 10733 predicate(UseSSE>=2); | |
| 10734 match(Set dst (ConvD2F src)); | |
| 10735 format %{ "CVTSD2SS $dst,$src\t# F-round" %} | |
| 10736 opcode(0xF2, 0x0F, 0x5A); | |
| 10737 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
| 10738 ins_pipe( pipe_slow ); | |
| 10739 %} | |
| 10740 | |
| 10741 instruct convF2D_reg_reg(regD dst, regF src) %{ | |
| 10742 predicate(UseSSE==0); | |
| 10743 match(Set dst (ConvF2D src)); | |
| 10744 format %{ "FST_S $dst,$src\t# D-round" %} | |
| 10745 ins_encode( Pop_Reg_Reg_D(dst, src)); | |
| 10746 ins_pipe( fpu_reg_reg ); | |
| 10747 %} | |
| 10748 | |
| 10749 instruct convF2D_reg(stackSlotD dst, regF src) %{ | |
| 10750 predicate(UseSSE==1); | |
| 10751 match(Set dst (ConvF2D src)); | |
| 10752 format %{ "FST_D $dst,$src\t# D-round" %} | |
| 10753 expand %{ | |
| 10754 roundDouble_mem_reg(dst,src); | |
| 10755 %} | |
| 10756 %} | |
| 10757 | |
| 10758 instruct convX2D_reg(regD dst, regX src, eFlagsReg cr) %{ | |
| 10759 predicate(UseSSE==1); | |
| 10760 match(Set dst (ConvF2D src)); | |
| 10761 effect( KILL cr ); | |
| 10762 format %{ "SUB ESP,4\n\t" | |
| 10763 "MOVSS [ESP] $src\n\t" | |
| 10764 "FLD_S [ESP]\n\t" | |
| 10765 "ADD ESP,4\n\t" | |
| 10766 "FSTP $dst\t# D-round" %} | |
| 10767 ins_encode( X2D_encoding(dst, src), Pop_Reg_D(dst)); | |
| 10768 ins_pipe( pipe_slow ); | |
| 10769 %} | |
| 10770 | |
| 10771 instruct convX2XD_reg(regXD dst, regX src) %{ | |
| 10772 predicate(UseSSE>=2); | |
| 10773 match(Set dst (ConvF2D src)); | |
| 10774 format %{ "CVTSS2SD $dst,$src\t# D-round" %} | |
| 10775 opcode(0xF3, 0x0F, 0x5A); | |
| 10776 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
| 10777 ins_pipe( pipe_slow ); | |
| 10778 %} | |
| 10779 | |
| 10780 // Convert a double to an int. If the double is a NAN, stuff a zero in instead. | |
| 10781 instruct convD2I_reg_reg( eAXRegI dst, eDXRegI tmp, regD src, eFlagsReg cr ) %{ | |
| 10782 predicate(UseSSE<=1); | |
| 10783 match(Set dst (ConvD2I src)); | |
| 10784 effect( KILL tmp, KILL cr ); | |
| 10785 format %{ "FLD $src\t# Convert double to int \n\t" | |
| 10786 "FLDCW trunc mode\n\t" | |
| 10787 "SUB ESP,4\n\t" | |
| 10788 "FISTp [ESP + #0]\n\t" | |
| 10789 "FLDCW std/24-bit mode\n\t" | |
| 10790 "POP EAX\n\t" | |
| 10791 "CMP EAX,0x80000000\n\t" | |
| 10792 "JNE,s fast\n\t" | |
| 10793 "FLD_D $src\n\t" | |
| 10794 "CALL d2i_wrapper\n" | |
| 10795 "fast:" %} | |
| 10796 ins_encode( Push_Reg_D(src), D2I_encoding(src) ); | |
| 10797 ins_pipe( pipe_slow ); | |
| 10798 %} | |
| 10799 | |
| 10800 // Convert a double to an int. If the double is a NAN, stuff a zero in instead. | |
| 10801 instruct convXD2I_reg_reg( eAXRegI dst, eDXRegI tmp, regXD src, eFlagsReg cr ) %{ | |
| 10802 predicate(UseSSE>=2); | |
| 10803 match(Set dst (ConvD2I src)); | |
| 10804 effect( KILL tmp, KILL cr ); | |
| 10805 format %{ "CVTTSD2SI $dst, $src\n\t" | |
| 10806 "CMP $dst,0x80000000\n\t" | |
| 10807 "JNE,s fast\n\t" | |
| 10808 "SUB ESP, 8\n\t" | |
| 10809 "MOVSD [ESP], $src\n\t" | |
| 10810 "FLD_D [ESP]\n\t" | |
| 10811 "ADD ESP, 8\n\t" | |
| 10812 "CALL d2i_wrapper\n" | |
| 10813 "fast:" %} | |
| 10814 opcode(0x1); // double-precision conversion | |
| 10815 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x2C), FX2I_encoding(src,dst)); | |
| 10816 ins_pipe( pipe_slow ); | |
| 10817 %} | |
| 10818 | |
| 10819 instruct convD2L_reg_reg( eADXRegL dst, regD src, eFlagsReg cr ) %{ | |
| 10820 predicate(UseSSE<=1); | |
| 10821 match(Set dst (ConvD2L src)); | |
| 10822 effect( KILL cr ); | |
| 10823 format %{ "FLD $src\t# Convert double to long\n\t" | |
| 10824 "FLDCW trunc mode\n\t" | |
| 10825 "SUB ESP,8\n\t" | |
| 10826 "FISTp [ESP + #0]\n\t" | |
| 10827 "FLDCW std/24-bit mode\n\t" | |
| 10828 "POP EAX\n\t" | |
| 10829 "POP EDX\n\t" | |
| 10830 "CMP EDX,0x80000000\n\t" | |
| 10831 "JNE,s fast\n\t" | |
| 10832 "TEST EAX,EAX\n\t" | |
| 10833 "JNE,s fast\n\t" | |
| 10834 "FLD $src\n\t" | |
| 10835 "CALL d2l_wrapper\n" | |
| 10836 "fast:" %} | |
| 10837 ins_encode( Push_Reg_D(src), D2L_encoding(src) ); | |
| 10838 ins_pipe( pipe_slow ); | |
| 10839 %} | |
| 10840 | |
| 10841 // XMM lacks a float/double->long conversion, so use the old FPU stack. | |
| 10842 instruct convXD2L_reg_reg( eADXRegL dst, regXD src, eFlagsReg cr ) %{ | |
| 10843 predicate (UseSSE>=2); | |
| 10844 match(Set dst (ConvD2L src)); | |
| 10845 effect( KILL cr ); | |
| 10846 format %{ "SUB ESP,8\t# Convert double to long\n\t" | |
| 10847 "MOVSD [ESP],$src\n\t" | |
| 10848 "FLD_D [ESP]\n\t" | |
| 10849 "FLDCW trunc mode\n\t" | |
| 10850 "FISTp [ESP + #0]\n\t" | |
| 10851 "FLDCW std/24-bit mode\n\t" | |
| 10852 "POP EAX\n\t" | |
| 10853 "POP EDX\n\t" | |
| 10854 "CMP EDX,0x80000000\n\t" | |
| 10855 "JNE,s fast\n\t" | |
| 10856 "TEST EAX,EAX\n\t" | |
| 10857 "JNE,s fast\n\t" | |
| 10858 "SUB ESP,8\n\t" | |
| 10859 "MOVSD [ESP],$src\n\t" | |
| 10860 "FLD_D [ESP]\n\t" | |
| 10861 "CALL d2l_wrapper\n" | |
| 10862 "fast:" %} | |
| 10863 ins_encode( XD2L_encoding(src) ); | |
| 10864 ins_pipe( pipe_slow ); | |
| 10865 %} | |
| 10866 | |
| 10867 // Convert a double to an int. Java semantics require we do complex | |
| 10868 // manglations in the corner cases. So we set the rounding mode to | |
| 10869 // 'zero', store the darned double down as an int, and reset the | |
| 10870 // rounding mode to 'nearest'. The hardware stores a flag value down | |
| 10871 // if we would overflow or converted a NAN; we check for this and | |
| 10872 // and go the slow path if needed. | |
| 10873 instruct convF2I_reg_reg(eAXRegI dst, eDXRegI tmp, regF src, eFlagsReg cr ) %{ | |
| 10874 predicate(UseSSE==0); | |
| 10875 match(Set dst (ConvF2I src)); | |
| 10876 effect( KILL tmp, KILL cr ); | |
| 10877 format %{ "FLD $src\t# Convert float to int \n\t" | |
| 10878 "FLDCW trunc mode\n\t" | |
| 10879 "SUB ESP,4\n\t" | |
| 10880 "FISTp [ESP + #0]\n\t" | |
| 10881 "FLDCW std/24-bit mode\n\t" | |
| 10882 "POP EAX\n\t" | |
| 10883 "CMP EAX,0x80000000\n\t" | |
| 10884 "JNE,s fast\n\t" | |
| 10885 "FLD $src\n\t" | |
| 10886 "CALL d2i_wrapper\n" | |
| 10887 "fast:" %} | |
| 10888 // D2I_encoding works for F2I | |
| 10889 ins_encode( Push_Reg_F(src), D2I_encoding(src) ); | |
| 10890 ins_pipe( pipe_slow ); | |
| 10891 %} | |
| 10892 | |
| 10893 // Convert a float in xmm to an int reg. | |
| 10894 instruct convX2I_reg(eAXRegI dst, eDXRegI tmp, regX src, eFlagsReg cr ) %{ | |
| 10895 predicate(UseSSE>=1); | |
| 10896 match(Set dst (ConvF2I src)); | |
| 10897 effect( KILL tmp, KILL cr ); | |
| 10898 format %{ "CVTTSS2SI $dst, $src\n\t" | |
| 10899 "CMP $dst,0x80000000\n\t" | |
| 10900 "JNE,s fast\n\t" | |
| 10901 "SUB ESP, 4\n\t" | |
| 10902 "MOVSS [ESP], $src\n\t" | |
| 10903 "FLD [ESP]\n\t" | |
| 10904 "ADD ESP, 4\n\t" | |
| 10905 "CALL d2i_wrapper\n" | |
| 10906 "fast:" %} | |
| 10907 opcode(0x0); // single-precision conversion | |
| 10908 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x2C), FX2I_encoding(src,dst)); | |
| 10909 ins_pipe( pipe_slow ); | |
| 10910 %} | |
| 10911 | |
| 10912 instruct convF2L_reg_reg( eADXRegL dst, regF src, eFlagsReg cr ) %{ | |
| 10913 predicate(UseSSE==0); | |
| 10914 match(Set dst (ConvF2L src)); | |
| 10915 effect( KILL cr ); | |
| 10916 format %{ "FLD $src\t# Convert float to long\n\t" | |
| 10917 "FLDCW trunc mode\n\t" | |
| 10918 "SUB ESP,8\n\t" | |
| 10919 "FISTp [ESP + #0]\n\t" | |
| 10920 "FLDCW std/24-bit mode\n\t" | |
| 10921 "POP EAX\n\t" | |
| 10922 "POP EDX\n\t" | |
| 10923 "CMP EDX,0x80000000\n\t" | |
| 10924 "JNE,s fast\n\t" | |
| 10925 "TEST EAX,EAX\n\t" | |
| 10926 "JNE,s fast\n\t" | |
| 10927 "FLD $src\n\t" | |
| 10928 "CALL d2l_wrapper\n" | |
| 10929 "fast:" %} | |
| 10930 // D2L_encoding works for F2L | |
| 10931 ins_encode( Push_Reg_F(src), D2L_encoding(src) ); | |
| 10932 ins_pipe( pipe_slow ); | |
| 10933 %} | |
| 10934 | |
| 10935 // XMM lacks a float/double->long conversion, so use the old FPU stack. | |
| 10936 instruct convX2L_reg_reg( eADXRegL dst, regX src, eFlagsReg cr ) %{ | |
| 10937 predicate (UseSSE>=1); | |
| 10938 match(Set dst (ConvF2L src)); | |
| 10939 effect( KILL cr ); | |
| 10940 format %{ "SUB ESP,8\t# Convert float to long\n\t" | |
| 10941 "MOVSS [ESP],$src\n\t" | |
| 10942 "FLD_S [ESP]\n\t" | |
| 10943 "FLDCW trunc mode\n\t" | |
| 10944 "FISTp [ESP + #0]\n\t" | |
| 10945 "FLDCW std/24-bit mode\n\t" | |
| 10946 "POP EAX\n\t" | |
| 10947 "POP EDX\n\t" | |
| 10948 "CMP EDX,0x80000000\n\t" | |
| 10949 "JNE,s fast\n\t" | |
| 10950 "TEST EAX,EAX\n\t" | |
| 10951 "JNE,s fast\n\t" | |
| 10952 "SUB ESP,4\t# Convert float to long\n\t" | |
| 10953 "MOVSS [ESP],$src\n\t" | |
| 10954 "FLD_S [ESP]\n\t" | |
| 10955 "ADD ESP,4\n\t" | |
| 10956 "CALL d2l_wrapper\n" | |
| 10957 "fast:" %} | |
| 10958 ins_encode( X2L_encoding(src) ); | |
| 10959 ins_pipe( pipe_slow ); | |
| 10960 %} | |
| 10961 | |
| 10962 instruct convI2D_reg(regD dst, stackSlotI src) %{ | |
| 10963 predicate( UseSSE<=1 ); | |
| 10964 match(Set dst (ConvI2D src)); | |
| 10965 format %{ "FILD $src\n\t" | |
| 10966 "FSTP $dst" %} | |
| 10967 opcode(0xDB, 0x0); /* DB /0 */ | |
| 10968 ins_encode(Push_Mem_I(src), Pop_Reg_D(dst)); | |
| 10969 ins_pipe( fpu_reg_mem ); | |
| 10970 %} | |
| 10971 | |
| 10972 instruct convI2XD_reg(regXD dst, eRegI src) %{ | |
| 71 | 10973 predicate( UseSSE>=2 && !UseXmmI2D ); |
| 0 | 10974 match(Set dst (ConvI2D src)); |
| 10975 format %{ "CVTSI2SD $dst,$src" %} | |
| 10976 opcode(0xF2, 0x0F, 0x2A); | |
| 10977 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
| 10978 ins_pipe( pipe_slow ); | |
| 10979 %} | |
| 10980 | |
| 10981 instruct convI2XD_mem(regXD dst, memory mem) %{ | |
| 10982 predicate( UseSSE>=2 ); | |
| 10983 match(Set dst (ConvI2D (LoadI mem))); | |
| 10984 format %{ "CVTSI2SD $dst,$mem" %} | |
| 10985 opcode(0xF2, 0x0F, 0x2A); | |
| 10986 ins_encode( OpcP, OpcS, Opcode(tertiary), RegMem(dst, mem)); | |
| 10987 ins_pipe( pipe_slow ); | |
| 10988 %} | |
| 10989 | |
| 71 | 10990 instruct convXI2XD_reg(regXD dst, eRegI src) |
| 10991 %{ | |
| 10992 predicate( UseSSE>=2 && UseXmmI2D ); | |
| 10993 match(Set dst (ConvI2D src)); | |
| 10994 | |
| 10995 format %{ "MOVD $dst,$src\n\t" | |
| 10996 "CVTDQ2PD $dst,$dst\t# i2d" %} | |
| 10997 ins_encode %{ | |
| 10998 __ movd($dst$$XMMRegister, $src$$Register); | |
| 10999 __ cvtdq2pd($dst$$XMMRegister, $dst$$XMMRegister); | |
| 11000 %} | |
| 11001 ins_pipe(pipe_slow); // XXX | |
| 11002 %} | |
| 11003 | |
| 0 | 11004 instruct convI2D_mem(regD dst, memory mem) %{ |
| 11005 predicate( UseSSE<=1 && !Compile::current()->select_24_bit_instr()); | |
| 11006 match(Set dst (ConvI2D (LoadI mem))); | |
| 11007 format %{ "FILD $mem\n\t" | |
| 11008 "FSTP $dst" %} | |
| 11009 opcode(0xDB); /* DB /0 */ | |
| 11010 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
| 11011 Pop_Reg_D(dst)); | |
| 11012 ins_pipe( fpu_reg_mem ); | |
| 11013 %} | |
| 11014 | |
| 11015 // Convert a byte to a float; no rounding step needed. | |
| 11016 instruct conv24I2F_reg(regF dst, stackSlotI src) %{ | |
| 11017 predicate( UseSSE==0 && n->in(1)->Opcode() == Op_AndI && n->in(1)->in(2)->is_Con() && n->in(1)->in(2)->get_int() == 255 ); | |
| 11018 match(Set dst (ConvI2F src)); | |
| 11019 format %{ "FILD $src\n\t" | |
| 11020 "FSTP $dst" %} | |
| 11021 | |
| 11022 opcode(0xDB, 0x0); /* DB /0 */ | |
| 11023 ins_encode(Push_Mem_I(src), Pop_Reg_F(dst)); | |
| 11024 ins_pipe( fpu_reg_mem ); | |
| 11025 %} | |
| 11026 | |
| 11027 // In 24-bit mode, force exponent rounding by storing back out | |
| 11028 instruct convI2F_SSF(stackSlotF dst, stackSlotI src) %{ | |
| 11029 predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 11030 match(Set dst (ConvI2F src)); | |
| 11031 ins_cost(200); | |
| 11032 format %{ "FILD $src\n\t" | |
| 11033 "FSTP_S $dst" %} | |
| 11034 opcode(0xDB, 0x0); /* DB /0 */ | |
| 11035 ins_encode( Push_Mem_I(src), | |
| 11036 Pop_Mem_F(dst)); | |
| 11037 ins_pipe( fpu_mem_mem ); | |
| 11038 %} | |
| 11039 | |
| 11040 // In 24-bit mode, force exponent rounding by storing back out | |
| 11041 instruct convI2F_SSF_mem(stackSlotF dst, memory mem) %{ | |
| 11042 predicate( UseSSE==0 && Compile::current()->select_24_bit_instr()); | |
| 11043 match(Set dst (ConvI2F (LoadI mem))); | |
| 11044 ins_cost(200); | |
| 11045 format %{ "FILD $mem\n\t" | |
| 11046 "FSTP_S $dst" %} | |
| 11047 opcode(0xDB); /* DB /0 */ | |
| 11048 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
| 11049 Pop_Mem_F(dst)); | |
| 11050 ins_pipe( fpu_mem_mem ); | |
| 11051 %} | |
| 11052 | |
| 11053 // This instruction does not round to 24-bits | |
| 11054 instruct convI2F_reg(regF dst, stackSlotI src) %{ | |
| 11055 predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 11056 match(Set dst (ConvI2F src)); | |
| 11057 format %{ "FILD $src\n\t" | |
| 11058 "FSTP $dst" %} | |
| 11059 opcode(0xDB, 0x0); /* DB /0 */ | |
| 11060 ins_encode( Push_Mem_I(src), | |
| 11061 Pop_Reg_F(dst)); | |
| 11062 ins_pipe( fpu_reg_mem ); | |
| 11063 %} | |
| 11064 | |
| 11065 // This instruction does not round to 24-bits | |
| 11066 instruct convI2F_mem(regF dst, memory mem) %{ | |
| 11067 predicate( UseSSE==0 && !Compile::current()->select_24_bit_instr()); | |
| 11068 match(Set dst (ConvI2F (LoadI mem))); | |
| 11069 format %{ "FILD $mem\n\t" | |
| 11070 "FSTP $dst" %} | |
| 11071 opcode(0xDB); /* DB /0 */ | |
| 11072 ins_encode( OpcP, RMopc_Mem(0x00,mem), | |
| 11073 Pop_Reg_F(dst)); | |
| 11074 ins_pipe( fpu_reg_mem ); | |
| 11075 %} | |
| 11076 | |
| 11077 // Convert an int to a float in xmm; no rounding step needed. | |
| 11078 instruct convI2X_reg(regX dst, eRegI src) %{ | |
| 71 | 11079 predicate( UseSSE==1 || UseSSE>=2 && !UseXmmI2F ); |
| 0 | 11080 match(Set dst (ConvI2F src)); |
| 11081 format %{ "CVTSI2SS $dst, $src" %} | |
| 11082 | |
| 11083 opcode(0xF3, 0x0F, 0x2A); /* F3 0F 2A /r */ | |
| 11084 ins_encode( OpcP, OpcS, Opcode(tertiary), RegReg(dst, src)); | |
| 11085 ins_pipe( pipe_slow ); | |
| 11086 %} | |
| 11087 | |
| 71 | 11088 instruct convXI2X_reg(regX dst, eRegI src) |
| 11089 %{ | |
| 11090 predicate( UseSSE>=2 && UseXmmI2F ); | |
| 11091 match(Set dst (ConvI2F src)); | |
| 11092 | |
| 11093 format %{ "MOVD $dst,$src\n\t" | |
| 11094 "CVTDQ2PS $dst,$dst\t# i2f" %} | |
| 11095 ins_encode %{ | |
| 11096 __ movd($dst$$XMMRegister, $src$$Register); | |
| 11097 __ cvtdq2ps($dst$$XMMRegister, $dst$$XMMRegister); | |
| 11098 %} | |
| 11099 ins_pipe(pipe_slow); // XXX | |
| 11100 %} | |
| 11101 | |
| 0 | 11102 instruct convI2L_reg( eRegL dst, eRegI src, eFlagsReg cr) %{ |
| 11103 match(Set dst (ConvI2L src)); | |
| 11104 effect(KILL cr); | |
| 11105 format %{ "MOV $dst.lo,$src\n\t" | |
| 11106 "MOV $dst.hi,$src\n\t" | |
| 11107 "SAR $dst.hi,31" %} | |
| 11108 ins_encode(convert_int_long(dst,src)); | |
| 11109 ins_pipe( ialu_reg_reg_long ); | |
| 11110 %} | |
| 11111 | |
| 11112 // Zero-extend convert int to long | |
| 11113 instruct convI2L_reg_zex(eRegL dst, eRegI src, immL_32bits mask, eFlagsReg flags ) %{ | |
| 11114 match(Set dst (AndL (ConvI2L src) mask) ); | |
| 11115 effect( KILL flags ); | |
| 11116 format %{ "MOV $dst.lo,$src\n\t" | |
| 11117 "XOR $dst.hi,$dst.hi" %} | |
| 11118 opcode(0x33); // XOR | |
| 11119 ins_encode(enc_Copy(dst,src), OpcP, RegReg_Hi2(dst,dst) ); | |
| 11120 ins_pipe( ialu_reg_reg_long ); | |
| 11121 %} | |
| 11122 | |
| 11123 // Zero-extend long | |
| 11124 instruct zerox_long(eRegL dst, eRegL src, immL_32bits mask, eFlagsReg flags ) %{ | |
| 11125 match(Set dst (AndL src mask) ); | |
| 11126 effect( KILL flags ); | |
| 11127 format %{ "MOV $dst.lo,$src.lo\n\t" | |
| 11128 "XOR $dst.hi,$dst.hi\n\t" %} | |
| 11129 opcode(0x33); // XOR | |
| 11130 ins_encode(enc_Copy(dst,src), OpcP, RegReg_Hi2(dst,dst) ); | |
| 11131 ins_pipe( ialu_reg_reg_long ); | |
| 11132 %} | |
| 11133 | |
| 11134 instruct convL2D_reg( stackSlotD dst, eRegL src, eFlagsReg cr) %{ | |
| 11135 predicate (UseSSE<=1); | |
| 11136 match(Set dst (ConvL2D src)); | |
| 11137 effect( KILL cr ); | |
| 11138 format %{ "PUSH $src.hi\t# Convert long to double\n\t" | |
| 11139 "PUSH $src.lo\n\t" | |
| 11140 "FILD ST,[ESP + #0]\n\t" | |
| 11141 "ADD ESP,8\n\t" | |
| 11142 "FSTP_D $dst\t# D-round" %} | |
| 11143 opcode(0xDF, 0x5); /* DF /5 */ | |
| 11144 ins_encode(convert_long_double(src), Pop_Mem_D(dst)); | |
| 11145 ins_pipe( pipe_slow ); | |
| 11146 %} | |
| 11147 | |
| 11148 instruct convL2XD_reg( regXD dst, eRegL src, eFlagsReg cr) %{ | |
| 11149 predicate (UseSSE>=2); | |
| 11150 match(Set dst (ConvL2D src)); | |
| 11151 effect( KILL cr ); | |
| 11152 format %{ "PUSH $src.hi\t# Convert long to double\n\t" | |
| 11153 "PUSH $src.lo\n\t" | |
| 11154 "FILD_D [ESP]\n\t" | |
| 11155 "FSTP_D [ESP]\n\t" | |
| 11156 "MOVSD $dst,[ESP]\n\t" | |
| 11157 "ADD ESP,8" %} | |
| 11158 opcode(0xDF, 0x5); /* DF /5 */ | |
| 11159 ins_encode(convert_long_double2(src), Push_ResultXD(dst)); | |
| 11160 ins_pipe( pipe_slow ); | |
| 11161 %} | |
| 11162 | |
| 11163 instruct convL2X_reg( regX dst, eRegL src, eFlagsReg cr) %{ | |
| 11164 predicate (UseSSE>=1); | |
| 11165 match(Set dst (ConvL2F src)); | |
| 11166 effect( KILL cr ); | |
| 11167 format %{ "PUSH $src.hi\t# Convert long to single float\n\t" | |
| 11168 "PUSH $src.lo\n\t" | |
| 11169 "FILD_D [ESP]\n\t" | |
| 11170 "FSTP_S [ESP]\n\t" | |
| 11171 "MOVSS $dst,[ESP]\n\t" | |
| 11172 "ADD ESP,8" %} | |
| 11173 opcode(0xDF, 0x5); /* DF /5 */ | |
| 11174 ins_encode(convert_long_double2(src), Push_ResultX(dst,0x8)); | |
| 11175 ins_pipe( pipe_slow ); | |
| 11176 %} | |
| 11177 | |
| 11178 instruct convL2F_reg( stackSlotF dst, eRegL src, eFlagsReg cr) %{ | |
| 11179 match(Set dst (ConvL2F src)); | |
| 11180 effect( KILL cr ); | |
| 11181 format %{ "PUSH $src.hi\t# Convert long to single float\n\t" | |
| 11182 "PUSH $src.lo\n\t" | |
| 11183 "FILD ST,[ESP + #0]\n\t" | |
| 11184 "ADD ESP,8\n\t" | |
| 11185 "FSTP_S $dst\t# F-round" %} | |
| 11186 opcode(0xDF, 0x5); /* DF /5 */ | |
| 11187 ins_encode(convert_long_double(src), Pop_Mem_F(dst)); | |
| 11188 ins_pipe( pipe_slow ); | |
| 11189 %} | |
| 11190 | |
| 11191 instruct convL2I_reg( eRegI dst, eRegL src ) %{ | |
| 11192 match(Set dst (ConvL2I src)); | |
| 11193 effect( DEF dst, USE src ); | |
| 11194 format %{ "MOV $dst,$src.lo" %} | |
| 11195 ins_encode(enc_CopyL_Lo(dst,src)); | |
| 11196 ins_pipe( ialu_reg_reg ); | |
| 11197 %} | |
| 11198 | |
| 11199 | |
| 11200 instruct MoveF2I_stack_reg(eRegI dst, stackSlotF src) %{ | |
| 11201 match(Set dst (MoveF2I src)); | |
| 11202 effect( DEF dst, USE src ); | |
| 11203 ins_cost(100); | |
| 11204 format %{ "MOV $dst,$src\t# MoveF2I_stack_reg" %} | |
| 11205 opcode(0x8B); | |
| 11206 ins_encode( OpcP, RegMem(dst,src)); | |
| 11207 ins_pipe( ialu_reg_mem ); | |
| 11208 %} | |
| 11209 | |
| 11210 instruct MoveF2I_reg_stack(stackSlotI dst, regF src) %{ | |
| 11211 predicate(UseSSE==0); | |
| 11212 match(Set dst (MoveF2I src)); | |
| 11213 effect( DEF dst, USE src ); | |
| 11214 | |
| 11215 ins_cost(125); | |
| 11216 format %{ "FST_S $dst,$src\t# MoveF2I_reg_stack" %} | |
| 11217 ins_encode( Pop_Mem_Reg_F(dst, src) ); | |
| 11218 ins_pipe( fpu_mem_reg ); | |
| 11219 %} | |
| 11220 | |
| 11221 instruct MoveF2I_reg_stack_sse(stackSlotI dst, regX src) %{ | |
| 11222 predicate(UseSSE>=1); | |
| 11223 match(Set dst (MoveF2I src)); | |
| 11224 effect( DEF dst, USE src ); | |
| 11225 | |
| 11226 ins_cost(95); | |
| 11227 format %{ "MOVSS $dst,$src\t# MoveF2I_reg_stack_sse" %} | |
| 11228 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x11), RegMem(src, dst)); | |
| 11229 ins_pipe( pipe_slow ); | |
| 11230 %} | |
| 11231 | |
| 11232 instruct MoveF2I_reg_reg_sse(eRegI dst, regX src) %{ | |
| 11233 predicate(UseSSE>=2); | |
| 11234 match(Set dst (MoveF2I src)); | |
| 11235 effect( DEF dst, USE src ); | |
| 11236 ins_cost(85); | |
| 11237 format %{ "MOVD $dst,$src\t# MoveF2I_reg_reg_sse" %} | |
| 11238 ins_encode( MovX2I_reg(dst, src)); | |
| 11239 ins_pipe( pipe_slow ); | |
| 11240 %} | |
| 11241 | |
| 11242 instruct MoveI2F_reg_stack(stackSlotF dst, eRegI src) %{ | |
| 11243 match(Set dst (MoveI2F src)); | |
| 11244 effect( DEF dst, USE src ); | |
| 11245 | |
| 11246 ins_cost(100); | |
| 11247 format %{ "MOV $dst,$src\t# MoveI2F_reg_stack" %} | |
| 11248 opcode(0x89); | |
| 11249 ins_encode( OpcPRegSS( dst, src ) ); | |
| 11250 ins_pipe( ialu_mem_reg ); | |
| 11251 %} | |
| 11252 | |
| 11253 | |
| 11254 instruct MoveI2F_stack_reg(regF dst, stackSlotI src) %{ | |
| 11255 predicate(UseSSE==0); | |
| 11256 match(Set dst (MoveI2F src)); | |
| 11257 effect(DEF dst, USE src); | |
| 11258 | |
| 11259 ins_cost(125); | |
| 11260 format %{ "FLD_S $src\n\t" | |
| 11261 "FSTP $dst\t# MoveI2F_stack_reg" %} | |
| 11262 opcode(0xD9); /* D9 /0, FLD m32real */ | |
| 11263 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
| 11264 Pop_Reg_F(dst) ); | |
| 11265 ins_pipe( fpu_reg_mem ); | |
| 11266 %} | |
| 11267 | |
| 11268 instruct MoveI2F_stack_reg_sse(regX dst, stackSlotI src) %{ | |
| 11269 predicate(UseSSE>=1); | |
| 11270 match(Set dst (MoveI2F src)); | |
| 11271 effect( DEF dst, USE src ); | |
| 11272 | |
| 11273 ins_cost(95); | |
| 11274 format %{ "MOVSS $dst,$src\t# MoveI2F_stack_reg_sse" %} | |
| 11275 ins_encode( Opcode(0xF3), Opcode(0x0F), Opcode(0x10), RegMem(dst,src)); | |
| 11276 ins_pipe( pipe_slow ); | |
| 11277 %} | |
| 11278 | |
| 11279 instruct MoveI2F_reg_reg_sse(regX dst, eRegI src) %{ | |
| 11280 predicate(UseSSE>=2); | |
| 11281 match(Set dst (MoveI2F src)); | |
| 11282 effect( DEF dst, USE src ); | |
| 11283 | |
| 11284 ins_cost(85); | |
| 11285 format %{ "MOVD $dst,$src\t# MoveI2F_reg_reg_sse" %} | |
| 11286 ins_encode( MovI2X_reg(dst, src) ); | |
| 11287 ins_pipe( pipe_slow ); | |
| 11288 %} | |
| 11289 | |
| 11290 instruct MoveD2L_stack_reg(eRegL dst, stackSlotD src) %{ | |
| 11291 match(Set dst (MoveD2L src)); | |
| 11292 effect(DEF dst, USE src); | |
| 11293 | |
| 11294 ins_cost(250); | |
| 11295 format %{ "MOV $dst.lo,$src\n\t" | |
| 11296 "MOV $dst.hi,$src+4\t# MoveD2L_stack_reg" %} | |
| 11297 opcode(0x8B, 0x8B); | |
| 11298 ins_encode( OpcP, RegMem(dst,src), OpcS, RegMem_Hi(dst,src)); | |
| 11299 ins_pipe( ialu_mem_long_reg ); | |
| 11300 %} | |
| 11301 | |
| 11302 instruct MoveD2L_reg_stack(stackSlotL dst, regD src) %{ | |
| 11303 predicate(UseSSE<=1); | |
| 11304 match(Set dst (MoveD2L src)); | |
| 11305 effect(DEF dst, USE src); | |
| 11306 | |
| 11307 ins_cost(125); | |
| 11308 format %{ "FST_D $dst,$src\t# MoveD2L_reg_stack" %} | |
| 11309 ins_encode( Pop_Mem_Reg_D(dst, src) ); | |
| 11310 ins_pipe( fpu_mem_reg ); | |
| 11311 %} | |
| 11312 | |
| 11313 instruct MoveD2L_reg_stack_sse(stackSlotL dst, regXD src) %{ | |
| 11314 predicate(UseSSE>=2); | |
| 11315 match(Set dst (MoveD2L src)); | |
| 11316 effect(DEF dst, USE src); | |
| 11317 ins_cost(95); | |
| 11318 | |
| 11319 format %{ "MOVSD $dst,$src\t# MoveD2L_reg_stack_sse" %} | |
| 11320 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x11), RegMem(src,dst)); | |
| 11321 ins_pipe( pipe_slow ); | |
| 11322 %} | |
| 11323 | |
| 11324 instruct MoveD2L_reg_reg_sse(eRegL dst, regXD src, regXD tmp) %{ | |
| 11325 predicate(UseSSE>=2); | |
| 11326 match(Set dst (MoveD2L src)); | |
| 11327 effect(DEF dst, USE src, TEMP tmp); | |
| 11328 ins_cost(85); | |
| 11329 format %{ "MOVD $dst.lo,$src\n\t" | |
| 11330 "PSHUFLW $tmp,$src,0x4E\n\t" | |
| 11331 "MOVD $dst.hi,$tmp\t# MoveD2L_reg_reg_sse" %} | |
| 11332 ins_encode( MovXD2L_reg(dst, src, tmp) ); | |
| 11333 ins_pipe( pipe_slow ); | |
| 11334 %} | |
| 11335 | |
| 11336 instruct MoveL2D_reg_stack(stackSlotD dst, eRegL src) %{ | |
| 11337 match(Set dst (MoveL2D src)); | |
| 11338 effect(DEF dst, USE src); | |
| 11339 | |
| 11340 ins_cost(200); | |
| 11341 format %{ "MOV $dst,$src.lo\n\t" | |
| 11342 "MOV $dst+4,$src.hi\t# MoveL2D_reg_stack" %} | |
| 11343 opcode(0x89, 0x89); | |
| 11344 ins_encode( OpcP, RegMem( src, dst ), OpcS, RegMem_Hi( src, dst ) ); | |
| 11345 ins_pipe( ialu_mem_long_reg ); | |
| 11346 %} | |
| 11347 | |
| 11348 | |
| 11349 instruct MoveL2D_stack_reg(regD dst, stackSlotL src) %{ | |
| 11350 predicate(UseSSE<=1); | |
| 11351 match(Set dst (MoveL2D src)); | |
| 11352 effect(DEF dst, USE src); | |
| 11353 ins_cost(125); | |
| 11354 | |
| 11355 format %{ "FLD_D $src\n\t" | |
| 11356 "FSTP $dst\t# MoveL2D_stack_reg" %} | |
| 11357 opcode(0xDD); /* DD /0, FLD m64real */ | |
| 11358 ins_encode( OpcP, RMopc_Mem_no_oop(0x00,src), | |
| 11359 Pop_Reg_D(dst) ); | |
| 11360 ins_pipe( fpu_reg_mem ); | |
| 11361 %} | |
| 11362 | |
| 11363 | |
| 11364 instruct MoveL2D_stack_reg_sse(regXD dst, stackSlotL src) %{ | |
| 11365 predicate(UseSSE>=2 && UseXmmLoadAndClearUpper); | |
| 11366 match(Set dst (MoveL2D src)); | |
| 11367 effect(DEF dst, USE src); | |
| 11368 | |
| 11369 ins_cost(95); | |
| 11370 format %{ "MOVSD $dst,$src\t# MoveL2D_stack_reg_sse" %} | |
| 11371 ins_encode( Opcode(0xF2), Opcode(0x0F), Opcode(0x10), RegMem(dst,src)); | |
| 11372 ins_pipe( pipe_slow ); | |
| 11373 %} | |
| 11374 | |
| 11375 instruct MoveL2D_stack_reg_sse_partial(regXD dst, stackSlotL src) %{ | |
| 11376 predicate(UseSSE>=2 && !UseXmmLoadAndClearUpper); | |
| 11377 match(Set dst (MoveL2D src)); | |
| 11378 effect(DEF dst, USE src); | |
| 11379 | |
| 11380 ins_cost(95); | |
| 11381 format %{ "MOVLPD $dst,$src\t# MoveL2D_stack_reg_sse" %} | |
| 11382 ins_encode( Opcode(0x66), Opcode(0x0F), Opcode(0x12), RegMem(dst,src)); | |
| 11383 ins_pipe( pipe_slow ); | |
| 11384 %} | |
| 11385 | |
| 11386 instruct MoveL2D_reg_reg_sse(regXD dst, eRegL src, regXD tmp) %{ | |
| 11387 predicate(UseSSE>=2); | |
| 11388 match(Set dst (MoveL2D src)); | |
| 11389 effect(TEMP dst, USE src, TEMP tmp); | |
| 11390 ins_cost(85); | |
| 11391 format %{ "MOVD $dst,$src.lo\n\t" | |
| 11392 "MOVD $tmp,$src.hi\n\t" | |
| 11393 "PUNPCKLDQ $dst,$tmp\t# MoveL2D_reg_reg_sse" %} | |
| 11394 ins_encode( MovL2XD_reg(dst, src, tmp) ); | |
| 11395 ins_pipe( pipe_slow ); | |
| 11396 %} | |
| 11397 | |
| 11398 // Replicate scalar to packed byte (1 byte) values in xmm | |
| 11399 instruct Repl8B_reg(regXD dst, regXD src) %{ | |
| 11400 predicate(UseSSE>=2); | |
| 11401 match(Set dst (Replicate8B src)); | |
| 11402 format %{ "MOVDQA $dst,$src\n\t" | |
| 11403 "PUNPCKLBW $dst,$dst\n\t" | |
| 11404 "PSHUFLW $dst,$dst,0x00\t! replicate8B" %} | |
| 11405 ins_encode( pshufd_8x8(dst, src)); | |
| 11406 ins_pipe( pipe_slow ); | |
| 11407 %} | |
| 11408 | |
| 11409 // Replicate scalar to packed byte (1 byte) values in xmm | |
| 11410 instruct Repl8B_eRegI(regXD dst, eRegI src) %{ | |
| 11411 predicate(UseSSE>=2); | |
| 11412 match(Set dst (Replicate8B src)); | |
| 11413 format %{ "MOVD $dst,$src\n\t" | |
| 11414 "PUNPCKLBW $dst,$dst\n\t" | |
| 11415 "PSHUFLW $dst,$dst,0x00\t! replicate8B" %} | |
| 11416 ins_encode( mov_i2x(dst, src), pshufd_8x8(dst, dst)); | |
| 11417 ins_pipe( pipe_slow ); | |
| 11418 %} | |
| 11419 | |
| 11420 // Replicate scalar zero to packed byte (1 byte) values in xmm | |
| 11421 instruct Repl8B_immI0(regXD dst, immI0 zero) %{ | |
| 11422 predicate(UseSSE>=2); | |
| 11423 match(Set dst (Replicate8B zero)); | |
| 11424 format %{ "PXOR $dst,$dst\t! replicate8B" %} | |
| 11425 ins_encode( pxor(dst, dst)); | |
| 11426 ins_pipe( fpu_reg_reg ); | |
| 11427 %} | |
| 11428 | |
| 11429 // Replicate scalar to packed shore (2 byte) values in xmm | |
| 11430 instruct Repl4S_reg(regXD dst, regXD src) %{ | |
| 11431 predicate(UseSSE>=2); | |
| 11432 match(Set dst (Replicate4S src)); | |
| 11433 format %{ "PSHUFLW $dst,$src,0x00\t! replicate4S" %} | |
| 11434 ins_encode( pshufd_4x16(dst, src)); | |
| 11435 ins_pipe( fpu_reg_reg ); | |
| 11436 %} | |
| 11437 | |
| 11438 // Replicate scalar to packed shore (2 byte) values in xmm | |
| 11439 instruct Repl4S_eRegI(regXD dst, eRegI src) %{ | |
| 11440 predicate(UseSSE>=2); | |
| 11441 match(Set dst (Replicate4S src)); | |
| 11442 format %{ "MOVD $dst,$src\n\t" | |
| 11443 "PSHUFLW $dst,$dst,0x00\t! replicate4S" %} | |
| 11444 ins_encode( mov_i2x(dst, src), pshufd_4x16(dst, dst)); | |
| 11445 ins_pipe( fpu_reg_reg ); | |
| 11446 %} | |
| 11447 | |
| 11448 // Replicate scalar zero to packed short (2 byte) values in xmm | |
| 11449 instruct Repl4S_immI0(regXD dst, immI0 zero) %{ | |
| 11450 predicate(UseSSE>=2); | |
| 11451 match(Set dst (Replicate4S zero)); | |
| 11452 format %{ "PXOR $dst,$dst\t! replicate4S" %} | |
| 11453 ins_encode( pxor(dst, dst)); | |
| 11454 ins_pipe( fpu_reg_reg ); | |
| 11455 %} | |
| 11456 | |
| 11457 // Replicate scalar to packed char (2 byte) values in xmm | |
| 11458 instruct Repl4C_reg(regXD dst, regXD src) %{ | |
| 11459 predicate(UseSSE>=2); | |
| 11460 match(Set dst (Replicate4C src)); | |
| 11461 format %{ "PSHUFLW $dst,$src,0x00\t! replicate4C" %} | |
| 11462 ins_encode( pshufd_4x16(dst, src)); | |
| 11463 ins_pipe( fpu_reg_reg ); | |
| 11464 %} | |
| 11465 | |
| 11466 // Replicate scalar to packed char (2 byte) values in xmm | |
| 11467 instruct Repl4C_eRegI(regXD dst, eRegI src) %{ | |
| 11468 predicate(UseSSE>=2); | |
| 11469 match(Set dst (Replicate4C src)); | |
| 11470 format %{ "MOVD $dst,$src\n\t" | |
| 11471 "PSHUFLW $dst,$dst,0x00\t! replicate4C" %} | |
| 11472 ins_encode( mov_i2x(dst, src), pshufd_4x16(dst, dst)); | |
| 11473 ins_pipe( fpu_reg_reg ); | |
| 11474 %} | |
| 11475 | |
| 11476 // Replicate scalar zero to packed char (2 byte) values in xmm | |
| 11477 instruct Repl4C_immI0(regXD dst, immI0 zero) %{ | |
| 11478 predicate(UseSSE>=2); | |
| 11479 match(Set dst (Replicate4C zero)); | |
| 11480 format %{ "PXOR $dst,$dst\t! replicate4C" %} | |
| 11481 ins_encode( pxor(dst, dst)); | |
| 11482 ins_pipe( fpu_reg_reg ); | |
| 11483 %} | |
| 11484 | |
| 11485 // Replicate scalar to packed integer (4 byte) values in xmm | |
| 11486 instruct Repl2I_reg(regXD dst, regXD src) %{ | |
| 11487 predicate(UseSSE>=2); | |
| 11488 match(Set dst (Replicate2I src)); | |
| 11489 format %{ "PSHUFD $dst,$src,0x00\t! replicate2I" %} | |
| 11490 ins_encode( pshufd(dst, src, 0x00)); | |
| 11491 ins_pipe( fpu_reg_reg ); | |
| 11492 %} | |
| 11493 | |
| 11494 // Replicate scalar to packed integer (4 byte) values in xmm | |
| 11495 instruct Repl2I_eRegI(regXD dst, eRegI src) %{ | |
| 11496 predicate(UseSSE>=2); | |
| 11497 match(Set dst (Replicate2I src)); | |
| 11498 format %{ "MOVD $dst,$src\n\t" | |
| 11499 "PSHUFD $dst,$dst,0x00\t! replicate2I" %} | |
| 11500 ins_encode( mov_i2x(dst, src), pshufd(dst, dst, 0x00)); | |
| 11501 ins_pipe( fpu_reg_reg ); | |
| 11502 %} | |
| 11503 | |
| 11504 // Replicate scalar zero to packed integer (2 byte) values in xmm | |
| 11505 instruct Repl2I_immI0(regXD dst, immI0 zero) %{ | |
| 11506 predicate(UseSSE>=2); | |
| 11507 match(Set dst (Replicate2I zero)); | |
| 11508 format %{ "PXOR $dst,$dst\t! replicate2I" %} | |
| 11509 ins_encode( pxor(dst, dst)); | |
| 11510 ins_pipe( fpu_reg_reg ); | |
| 11511 %} | |
| 11512 | |
| 11513 // Replicate scalar to packed single precision floating point values in xmm | |
| 11514 instruct Repl2F_reg(regXD dst, regXD src) %{ | |
| 11515 predicate(UseSSE>=2); | |
| 11516 match(Set dst (Replicate2F src)); | |
| 11517 format %{ "PSHUFD $dst,$src,0xe0\t! replicate2F" %} | |
| 11518 ins_encode( pshufd(dst, src, 0xe0)); | |
| 11519 ins_pipe( fpu_reg_reg ); | |
| 11520 %} | |
| 11521 | |
| 11522 // Replicate scalar to packed single precision floating point values in xmm | |
| 11523 instruct Repl2F_regX(regXD dst, regX src) %{ | |
| 11524 predicate(UseSSE>=2); | |
| 11525 match(Set dst (Replicate2F src)); | |
| 11526 format %{ "PSHUFD $dst,$src,0xe0\t! replicate2F" %} | |
| 11527 ins_encode( pshufd(dst, src, 0xe0)); | |
| 11528 ins_pipe( fpu_reg_reg ); | |
| 11529 %} | |
| 11530 | |
| 11531 // Replicate scalar to packed single precision floating point values in xmm | |
| 11532 instruct Repl2F_immXF0(regXD dst, immXF0 zero) %{ | |
| 11533 predicate(UseSSE>=2); | |
| 11534 match(Set dst (Replicate2F zero)); | |
| 11535 format %{ "PXOR $dst,$dst\t! replicate2F" %} | |
| 11536 ins_encode( pxor(dst, dst)); | |
| 11537 ins_pipe( fpu_reg_reg ); | |
| 11538 %} | |
| 11539 | |
| 11540 | |
| 11541 | |
| 11542 // ======================================================================= | |
| 11543 // fast clearing of an array | |
| 11544 | |
| 11545 instruct rep_stos(eCXRegI cnt, eDIRegP base, eAXRegI zero, Universe dummy, eFlagsReg cr) %{ | |
| 11546 match(Set dummy (ClearArray cnt base)); | |
| 11547 effect(USE_KILL cnt, USE_KILL base, KILL zero, KILL cr); | |
| 11548 format %{ "SHL ECX,1\t# Convert doublewords to words\n\t" | |
| 11549 "XOR EAX,EAX\n\t" | |
| 11550 "REP STOS\t# store EAX into [EDI++] while ECX--" %} | |
| 11551 opcode(0,0x4); | |
| 11552 ins_encode( Opcode(0xD1), RegOpc(ECX), | |
| 11553 OpcRegReg(0x33,EAX,EAX), | |
| 11554 Opcode(0xF3), Opcode(0xAB) ); | |
| 11555 ins_pipe( pipe_slow ); | |
| 11556 %} | |
| 11557 | |
| 11558 instruct string_compare(eDIRegP str1, eSIRegP str2, eAXRegI tmp1, eBXRegI tmp2, eCXRegI result, eFlagsReg cr) %{ | |
| 11559 match(Set result (StrComp str1 str2)); | |
| 11560 effect(USE_KILL str1, USE_KILL str2, KILL tmp1, KILL tmp2, KILL cr); | |
| 11561 //ins_cost(300); | |
| 11562 | |
| 11563 format %{ "String Compare $str1,$str2 -> $result // KILL EAX, EBX" %} | |
| 11564 ins_encode( enc_String_Compare() ); | |
| 11565 ins_pipe( pipe_slow ); | |
| 11566 %} | |
| 11567 | |
| 11568 //----------Control Flow Instructions------------------------------------------ | |
| 11569 // Signed compare Instructions | |
| 11570 instruct compI_eReg(eFlagsReg cr, eRegI op1, eRegI op2) %{ | |
| 11571 match(Set cr (CmpI op1 op2)); | |
| 11572 effect( DEF cr, USE op1, USE op2 ); | |
| 11573 format %{ "CMP $op1,$op2" %} | |
| 11574 opcode(0x3B); /* Opcode 3B /r */ | |
| 11575 ins_encode( OpcP, RegReg( op1, op2) ); | |
| 11576 ins_pipe( ialu_cr_reg_reg ); | |
| 11577 %} | |
| 11578 | |
| 11579 instruct compI_eReg_imm(eFlagsReg cr, eRegI op1, immI op2) %{ | |
| 11580 match(Set cr (CmpI op1 op2)); | |
| 11581 effect( DEF cr, USE op1 ); | |
| 11582 format %{ "CMP $op1,$op2" %} | |
| 11583 opcode(0x81,0x07); /* Opcode 81 /7 */ | |
| 11584 // ins_encode( RegImm( op1, op2) ); /* Was CmpImm */ | |
| 11585 ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); | |
| 11586 ins_pipe( ialu_cr_reg_imm ); | |
| 11587 %} | |
| 11588 | |
| 11589 // Cisc-spilled version of cmpI_eReg | |
| 11590 instruct compI_eReg_mem(eFlagsReg cr, eRegI op1, memory op2) %{ | |
| 11591 match(Set cr (CmpI op1 (LoadI op2))); | |
| 11592 | |
| 11593 format %{ "CMP $op1,$op2" %} | |
| 11594 ins_cost(500); | |
| 11595 opcode(0x3B); /* Opcode 3B /r */ | |
| 11596 ins_encode( OpcP, RegMem( op1, op2) ); | |
| 11597 ins_pipe( ialu_cr_reg_mem ); | |
| 11598 %} | |
| 11599 | |
| 11600 instruct testI_reg( eFlagsReg cr, eRegI src, immI0 zero ) %{ | |
| 11601 match(Set cr (CmpI src zero)); | |
| 11602 effect( DEF cr, USE src ); | |
| 11603 | |
| 11604 format %{ "TEST $src,$src" %} | |
| 11605 opcode(0x85); | |
| 11606 ins_encode( OpcP, RegReg( src, src ) ); | |
| 11607 ins_pipe( ialu_cr_reg_imm ); | |
| 11608 %} | |
| 11609 | |
| 11610 instruct testI_reg_imm( eFlagsReg cr, eRegI src, immI con, immI0 zero ) %{ | |
| 11611 match(Set cr (CmpI (AndI src con) zero)); | |
| 11612 | |
| 11613 format %{ "TEST $src,$con" %} | |
| 11614 opcode(0xF7,0x00); | |
| 11615 ins_encode( OpcP, RegOpc(src), Con32(con) ); | |
| 11616 ins_pipe( ialu_cr_reg_imm ); | |
| 11617 %} | |
| 11618 | |
| 11619 instruct testI_reg_mem( eFlagsReg cr, eRegI src, memory mem, immI0 zero ) %{ | |
| 11620 match(Set cr (CmpI (AndI src mem) zero)); | |
| 11621 | |
| 11622 format %{ "TEST $src,$mem" %} | |
| 11623 opcode(0x85); | |
| 11624 ins_encode( OpcP, RegMem( src, mem ) ); | |
| 11625 ins_pipe( ialu_cr_reg_mem ); | |
| 11626 %} | |
| 11627 | |
| 11628 // Unsigned compare Instructions; really, same as signed except they | |
| 11629 // produce an eFlagsRegU instead of eFlagsReg. | |
| 11630 instruct compU_eReg(eFlagsRegU cr, eRegI op1, eRegI op2) %{ | |
| 11631 match(Set cr (CmpU op1 op2)); | |
| 11632 | |
| 11633 format %{ "CMPu $op1,$op2" %} | |
| 11634 opcode(0x3B); /* Opcode 3B /r */ | |
| 11635 ins_encode( OpcP, RegReg( op1, op2) ); | |
| 11636 ins_pipe( ialu_cr_reg_reg ); | |
| 11637 %} | |
| 11638 | |
| 11639 instruct compU_eReg_imm(eFlagsRegU cr, eRegI op1, immI op2) %{ | |
| 11640 match(Set cr (CmpU op1 op2)); | |
| 11641 | |
| 11642 format %{ "CMPu $op1,$op2" %} | |
| 11643 opcode(0x81,0x07); /* Opcode 81 /7 */ | |
| 11644 ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); | |
| 11645 ins_pipe( ialu_cr_reg_imm ); | |
| 11646 %} | |
| 11647 | |
| 11648 // // Cisc-spilled version of cmpU_eReg | |
| 11649 instruct compU_eReg_mem(eFlagsRegU cr, eRegI op1, memory op2) %{ | |
| 11650 match(Set cr (CmpU op1 (LoadI op2))); | |
| 11651 | |
| 11652 format %{ "CMPu $op1,$op2" %} | |
| 11653 ins_cost(500); | |
| 11654 opcode(0x3B); /* Opcode 3B /r */ | |
| 11655 ins_encode( OpcP, RegMem( op1, op2) ); | |
| 11656 ins_pipe( ialu_cr_reg_mem ); | |
| 11657 %} | |
| 11658 | |
| 11659 // // Cisc-spilled version of cmpU_eReg | |
| 11660 //instruct compU_mem_eReg(eFlagsRegU cr, memory op1, eRegI op2) %{ | |
| 11661 // match(Set cr (CmpU (LoadI op1) op2)); | |
| 11662 // | |
| 11663 // format %{ "CMPu $op1,$op2" %} | |
| 11664 // ins_cost(500); | |
| 11665 // opcode(0x39); /* Opcode 39 /r */ | |
| 11666 // ins_encode( OpcP, RegMem( op1, op2) ); | |
| 11667 //%} | |
| 11668 | |
| 11669 instruct testU_reg( eFlagsRegU cr, eRegI src, immI0 zero ) %{ | |
| 11670 match(Set cr (CmpU src zero)); | |
| 11671 | |
| 11672 format %{ "TESTu $src,$src" %} | |
| 11673 opcode(0x85); | |
| 11674 ins_encode( OpcP, RegReg( src, src ) ); | |
| 11675 ins_pipe( ialu_cr_reg_imm ); | |
| 11676 %} | |
| 11677 | |
| 11678 // Unsigned pointer compare Instructions | |
| 11679 instruct compP_eReg(eFlagsRegU cr, eRegP op1, eRegP op2) %{ | |
| 11680 match(Set cr (CmpP op1 op2)); | |
| 11681 | |
| 11682 format %{ "CMPu $op1,$op2" %} | |
| 11683 opcode(0x3B); /* Opcode 3B /r */ | |
| 11684 ins_encode( OpcP, RegReg( op1, op2) ); | |
| 11685 ins_pipe( ialu_cr_reg_reg ); | |
| 11686 %} | |
| 11687 | |
| 11688 instruct compP_eReg_imm(eFlagsRegU cr, eRegP op1, immP op2) %{ | |
| 11689 match(Set cr (CmpP op1 op2)); | |
| 11690 | |
| 11691 format %{ "CMPu $op1,$op2" %} | |
| 11692 opcode(0x81,0x07); /* Opcode 81 /7 */ | |
| 11693 ins_encode( OpcSErm( op1, op2 ), Con8or32( op2 ) ); | |
| 11694 ins_pipe( ialu_cr_reg_imm ); | |
| 11695 %} | |
| 11696 | |
| 11697 // // Cisc-spilled version of cmpP_eReg | |
| 11698 instruct compP_eReg_mem(eFlagsRegU cr, eRegP op1, memory op2) %{ | |
| 11699 match(Set cr (CmpP op1 (LoadP op2))); | |
| 11700 | |
| 11701 format %{ "CMPu $op1,$op2" %} | |
| 11702 ins_cost(500); | |
| 11703 opcode(0x3B); /* Opcode 3B /r */ | |
| 11704 ins_encode( OpcP, RegMem( op1, op2) ); | |
| 11705 ins_pipe( ialu_cr_reg_mem ); | |
| 11706 %} | |
| 11707 | |
| 11708 // // Cisc-spilled version of cmpP_eReg | |
| 11709 //instruct compP_mem_eReg(eFlagsRegU cr, memory op1, eRegP op2) %{ | |
| 11710 // match(Set cr (CmpP (LoadP op1) op2)); | |
| 11711 // | |
| 11712 // format %{ "CMPu $op1,$op2" %} | |
| 11713 // ins_cost(500); | |
| 11714 // opcode(0x39); /* Opcode 39 /r */ | |
| 11715 // ins_encode( OpcP, RegMem( op1, op2) ); | |
| 11716 //%} | |
| 11717 | |
| 11718 // Compare raw pointer (used in out-of-heap check). | |
| 11719 // Only works because non-oop pointers must be raw pointers | |
| 11720 // and raw pointers have no anti-dependencies. | |
| 11721 instruct compP_mem_eReg( eFlagsRegU cr, eRegP op1, memory op2 ) %{ | |
| 11722 predicate( !n->in(2)->in(2)->bottom_type()->isa_oop_ptr() ); | |
| 11723 match(Set cr (CmpP op1 (LoadP op2))); | |
| 11724 | |
| 11725 format %{ "CMPu $op1,$op2" %} | |
| 11726 opcode(0x3B); /* Opcode 3B /r */ | |
| 11727 ins_encode( OpcP, RegMem( op1, op2) ); | |
| 11728 ins_pipe( ialu_cr_reg_mem ); | |
| 11729 %} | |
| 11730 | |
| 11731 // | |
| 11732 // This will generate a signed flags result. This should be ok | |
| 11733 // since any compare to a zero should be eq/neq. | |
| 11734 instruct testP_reg( eFlagsReg cr, eRegP src, immP0 zero ) %{ | |
| 11735 match(Set cr (CmpP src zero)); | |
| 11736 | |
| 11737 format %{ "TEST $src,$src" %} | |
| 11738 opcode(0x85); | |
| 11739 ins_encode( OpcP, RegReg( src, src ) ); | |
| 11740 ins_pipe( ialu_cr_reg_imm ); | |
| 11741 %} | |
| 11742 | |
| 11743 // Cisc-spilled version of testP_reg | |
| 11744 // This will generate a signed flags result. This should be ok | |
| 11745 // since any compare to a zero should be eq/neq. | |
| 11746 instruct testP_Reg_mem( eFlagsReg cr, memory op, immI0 zero ) %{ | |
| 11747 match(Set cr (CmpP (LoadP op) zero)); | |
| 11748 | |
| 11749 format %{ "TEST $op,0xFFFFFFFF" %} | |
| 11750 ins_cost(500); | |
| 11751 opcode(0xF7); /* Opcode F7 /0 */ | |
| 11752 ins_encode( OpcP, RMopc_Mem(0x00,op), Con_d32(0xFFFFFFFF) ); | |
| 11753 ins_pipe( ialu_cr_reg_imm ); | |
| 11754 %} | |
| 11755 | |
| 11756 // Yanked all unsigned pointer compare operations. | |
| 11757 // Pointer compares are done with CmpP which is already unsigned. | |
| 11758 | |
| 11759 //----------Max and Min-------------------------------------------------------- | |
| 11760 // Min Instructions | |
| 11761 //// | |
| 11762 // *** Min and Max using the conditional move are slower than the | |
| 11763 // *** branch version on a Pentium III. | |
| 11764 // // Conditional move for min | |
| 11765 //instruct cmovI_reg_lt( eRegI op2, eRegI op1, eFlagsReg cr ) %{ | |
| 11766 // effect( USE_DEF op2, USE op1, USE cr ); | |
| 11767 // format %{ "CMOVlt $op2,$op1\t! min" %} | |
| 11768 // opcode(0x4C,0x0F); | |
| 11769 // ins_encode( OpcS, OpcP, RegReg( op2, op1 ) ); | |
| 11770 // ins_pipe( pipe_cmov_reg ); | |
| 11771 //%} | |
| 11772 // | |
| 11773 //// Min Register with Register (P6 version) | |
| 11774 //instruct minI_eReg_p6( eRegI op1, eRegI op2 ) %{ | |
| 11775 // predicate(VM_Version::supports_cmov() ); | |
| 11776 // match(Set op2 (MinI op1 op2)); | |
| 11777 // ins_cost(200); | |
| 11778 // expand %{ | |
| 11779 // eFlagsReg cr; | |
| 11780 // compI_eReg(cr,op1,op2); | |
| 11781 // cmovI_reg_lt(op2,op1,cr); | |
| 11782 // %} | |
| 11783 //%} | |
| 11784 | |
| 11785 // Min Register with Register (generic version) | |
| 11786 instruct minI_eReg(eRegI dst, eRegI src, eFlagsReg flags) %{ | |
| 11787 match(Set dst (MinI dst src)); | |
| 11788 effect(KILL flags); | |
| 11789 ins_cost(300); | |
| 11790 | |
| 11791 format %{ "MIN $dst,$src" %} | |
| 11792 opcode(0xCC); | |
| 11793 ins_encode( min_enc(dst,src) ); | |
| 11794 ins_pipe( pipe_slow ); | |
| 11795 %} | |
| 11796 | |
| 11797 // Max Register with Register | |
| 11798 // *** Min and Max using the conditional move are slower than the | |
| 11799 // *** branch version on a Pentium III. | |
| 11800 // // Conditional move for max | |
| 11801 //instruct cmovI_reg_gt( eRegI op2, eRegI op1, eFlagsReg cr ) %{ | |
| 11802 // effect( USE_DEF op2, USE op1, USE cr ); | |
| 11803 // format %{ "CMOVgt $op2,$op1\t! max" %} | |
| 11804 // opcode(0x4F,0x0F); | |
| 11805 // ins_encode( OpcS, OpcP, RegReg( op2, op1 ) ); | |
| 11806 // ins_pipe( pipe_cmov_reg ); | |
| 11807 //%} | |
| 11808 // | |
| 11809 // // Max Register with Register (P6 version) | |
| 11810 //instruct maxI_eReg_p6( eRegI op1, eRegI op2 ) %{ | |
| 11811 // predicate(VM_Version::supports_cmov() ); | |
| 11812 // match(Set op2 (MaxI op1 op2)); | |
| 11813 // ins_cost(200); | |
| 11814 // expand %{ | |
| 11815 // eFlagsReg cr; | |
| 11816 // compI_eReg(cr,op1,op2); | |
| 11817 // cmovI_reg_gt(op2,op1,cr); | |
| 11818 // %} | |
| 11819 //%} | |
| 11820 | |
| 11821 // Max Register with Register (generic version) | |
| 11822 instruct maxI_eReg(eRegI dst, eRegI src, eFlagsReg flags) %{ | |
| 11823 match(Set dst (MaxI dst src)); | |
| 11824 effect(KILL flags); | |
| 11825 ins_cost(300); | |
| 11826 | |
| 11827 format %{ "MAX $dst,$src" %} | |
| 11828 opcode(0xCC); | |
| 11829 ins_encode( max_enc(dst,src) ); | |
| 11830 ins_pipe( pipe_slow ); | |
| 11831 %} | |
| 11832 | |
| 11833 // ============================================================================ | |
| 11834 // Branch Instructions | |
| 11835 // Jump Table | |
| 11836 instruct jumpXtnd(eRegI switch_val) %{ | |
| 11837 match(Jump switch_val); | |
| 11838 ins_cost(350); | |
| 11839 | |
| 11840 format %{ "JMP [table_base](,$switch_val,1)\n\t" %} | |
| 11841 | |
| 11842 ins_encode %{ | |
| 11843 address table_base = __ address_table_constant(_index2label); | |
| 11844 | |
| 11845 // Jump to Address(table_base + switch_reg) | |
| 11846 InternalAddress table(table_base); | |
| 11847 Address index(noreg, $switch_val$$Register, Address::times_1); | |
| 11848 __ jump(ArrayAddress(table, index)); | |
| 11849 %} | |
| 11850 ins_pc_relative(1); | |
| 11851 ins_pipe(pipe_jmp); | |
| 11852 %} | |
| 11853 | |
| 11854 // Jump Direct - Label defines a relative address from JMP+1 | |
| 11855 instruct jmpDir(label labl) %{ | |
| 11856 match(Goto); | |
| 11857 effect(USE labl); | |
| 11858 | |
| 11859 ins_cost(300); | |
| 11860 format %{ "JMP $labl" %} | |
| 11861 size(5); | |
| 11862 opcode(0xE9); | |
| 11863 ins_encode( OpcP, Lbl( labl ) ); | |
| 11864 ins_pipe( pipe_jmp ); | |
| 11865 ins_pc_relative(1); | |
| 11866 %} | |
| 11867 | |
| 11868 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
| 11869 instruct jmpCon(cmpOp cop, eFlagsReg cr, label labl) %{ | |
| 11870 match(If cop cr); | |
| 11871 effect(USE labl); | |
| 11872 | |
| 11873 ins_cost(300); | |
| 11874 format %{ "J$cop $labl" %} | |
| 11875 size(6); | |
| 11876 opcode(0x0F, 0x80); | |
| 11877 ins_encode( Jcc( cop, labl) ); | |
| 11878 ins_pipe( pipe_jcc ); | |
| 11879 ins_pc_relative(1); | |
| 11880 %} | |
| 11881 | |
| 11882 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
| 11883 instruct jmpLoopEnd(cmpOp cop, eFlagsReg cr, label labl) %{ | |
| 11884 match(CountedLoopEnd cop cr); | |
| 11885 effect(USE labl); | |
| 11886 | |
| 11887 ins_cost(300); | |
| 11888 format %{ "J$cop $labl\t# Loop end" %} | |
| 11889 size(6); | |
| 11890 opcode(0x0F, 0x80); | |
| 11891 ins_encode( Jcc( cop, labl) ); | |
| 11892 ins_pipe( pipe_jcc ); | |
| 11893 ins_pc_relative(1); | |
| 11894 %} | |
| 11895 | |
| 11896 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
| 11897 instruct jmpLoopEndU(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
| 11898 match(CountedLoopEnd cop cmp); | |
| 11899 effect(USE labl); | |
| 11900 | |
| 11901 ins_cost(300); | |
| 11902 format %{ "J$cop,u $labl\t# Loop end" %} | |
| 11903 size(6); | |
| 11904 opcode(0x0F, 0x80); | |
| 11905 ins_encode( Jcc( cop, labl) ); | |
| 11906 ins_pipe( pipe_jcc ); | |
| 11907 ins_pc_relative(1); | |
| 11908 %} | |
| 11909 | |
| 11910 // Jump Direct Conditional - using unsigned comparison | |
| 11911 instruct jmpConU(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
| 11912 match(If cop cmp); | |
| 11913 effect(USE labl); | |
| 11914 | |
| 11915 ins_cost(300); | |
| 11916 format %{ "J$cop,u $labl" %} | |
| 11917 size(6); | |
| 11918 opcode(0x0F, 0x80); | |
| 11919 ins_encode( Jcc( cop, labl) ); | |
| 11920 ins_pipe( pipe_jcc ); | |
| 11921 ins_pc_relative(1); | |
| 11922 %} | |
| 11923 | |
| 11924 // ============================================================================ | |
| 11925 // The 2nd slow-half of a subtype check. Scan the subklass's 2ndary superklass | |
| 11926 // array for an instance of the superklass. Set a hidden internal cache on a | |
| 11927 // hit (cache is checked with exposed code in gen_subtype_check()). Return | |
| 11928 // NZ for a miss or zero for a hit. The encoding ALSO sets flags. | |
| 11929 instruct partialSubtypeCheck( eDIRegP result, eSIRegP sub, eAXRegP super, eCXRegI rcx, eFlagsReg cr ) %{ | |
| 11930 match(Set result (PartialSubtypeCheck sub super)); | |
| 11931 effect( KILL rcx, KILL cr ); | |
| 11932 | |
| 11933 ins_cost(1100); // slightly larger than the next version | |
| 11934 format %{ "CMPL EAX,ESI\n\t" | |
| 11935 "JEQ,s hit\n\t" | |
| 11936 "MOV EDI,[$sub+Klass::secondary_supers]\n\t" | |
| 11937 "MOV ECX,[EDI+arrayKlass::length]\t# length to scan\n\t" | |
| 11938 "ADD EDI,arrayKlass::base_offset\t# Skip to start of data; set NZ in case count is zero\n\t" | |
| 11939 "REPNE SCASD\t# Scan *EDI++ for a match with EAX while CX-- != 0\n\t" | |
| 11940 "JNE,s miss\t\t# Missed: EDI not-zero\n\t" | |
| 11941 "MOV [$sub+Klass::secondary_super_cache],$super\t# Hit: update cache\n\t" | |
| 11942 "hit:\n\t" | |
| 11943 "XOR $result,$result\t\t Hit: EDI zero\n\t" | |
| 11944 "miss:\t" %} | |
| 11945 | |
| 11946 opcode(0x1); // Force a XOR of EDI | |
| 11947 ins_encode( enc_PartialSubtypeCheck() ); | |
| 11948 ins_pipe( pipe_slow ); | |
| 11949 %} | |
| 11950 | |
| 11951 instruct partialSubtypeCheck_vs_Zero( eFlagsReg cr, eSIRegP sub, eAXRegP super, eCXRegI rcx, eDIRegP result, immP0 zero ) %{ | |
| 11952 match(Set cr (CmpP (PartialSubtypeCheck sub super) zero)); | |
| 11953 effect( KILL rcx, KILL result ); | |
| 11954 | |
| 11955 ins_cost(1000); | |
| 11956 format %{ "CMPL EAX,ESI\n\t" | |
| 11957 "JEQ,s miss\t# Actually a hit; we are done.\n\t" | |
| 11958 "MOV EDI,[$sub+Klass::secondary_supers]\n\t" | |
| 11959 "MOV ECX,[EDI+arrayKlass::length]\t# length to scan\n\t" | |
| 11960 "ADD EDI,arrayKlass::base_offset\t# Skip to start of data; set NZ in case count is zero\n\t" | |
| 11961 "REPNE SCASD\t# Scan *EDI++ for a match with EAX while CX-- != 0\n\t" | |
| 11962 "JNE,s miss\t\t# Missed: flags NZ\n\t" | |
| 11963 "MOV [$sub+Klass::secondary_super_cache],$super\t# Hit: update cache, flags Z\n\t" | |
| 11964 "miss:\t" %} | |
| 11965 | |
| 11966 opcode(0x0); // No need to XOR EDI | |
| 11967 ins_encode( enc_PartialSubtypeCheck() ); | |
| 11968 ins_pipe( pipe_slow ); | |
| 11969 %} | |
| 11970 | |
| 11971 // ============================================================================ | |
| 11972 // Branch Instructions -- short offset versions | |
| 11973 // | |
| 11974 // These instructions are used to replace jumps of a long offset (the default | |
| 11975 // match) with jumps of a shorter offset. These instructions are all tagged | |
| 11976 // with the ins_short_branch attribute, which causes the ADLC to suppress the | |
| 11977 // match rules in general matching. Instead, the ADLC generates a conversion | |
| 11978 // method in the MachNode which can be used to do in-place replacement of the | |
| 11979 // long variant with the shorter variant. The compiler will determine if a | |
| 11980 // branch can be taken by the is_short_branch_offset() predicate in the machine | |
| 11981 // specific code section of the file. | |
| 11982 | |
| 11983 // Jump Direct - Label defines a relative address from JMP+1 | |
| 11984 instruct jmpDir_short(label labl) %{ | |
| 11985 match(Goto); | |
| 11986 effect(USE labl); | |
| 11987 | |
| 11988 ins_cost(300); | |
| 11989 format %{ "JMP,s $labl" %} | |
| 11990 size(2); | |
| 11991 opcode(0xEB); | |
| 11992 ins_encode( OpcP, LblShort( labl ) ); | |
| 11993 ins_pipe( pipe_jmp ); | |
| 11994 ins_pc_relative(1); | |
| 11995 ins_short_branch(1); | |
| 11996 %} | |
| 11997 | |
| 11998 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
| 11999 instruct jmpCon_short(cmpOp cop, eFlagsReg cr, label labl) %{ | |
| 12000 match(If cop cr); | |
| 12001 effect(USE labl); | |
| 12002 | |
| 12003 ins_cost(300); | |
| 12004 format %{ "J$cop,s $labl" %} | |
| 12005 size(2); | |
| 12006 opcode(0x70); | |
| 12007 ins_encode( JccShort( cop, labl) ); | |
| 12008 ins_pipe( pipe_jcc ); | |
| 12009 ins_pc_relative(1); | |
| 12010 ins_short_branch(1); | |
| 12011 %} | |
| 12012 | |
| 12013 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
| 12014 instruct jmpLoopEnd_short(cmpOp cop, eFlagsReg cr, label labl) %{ | |
| 12015 match(CountedLoopEnd cop cr); | |
| 12016 effect(USE labl); | |
| 12017 | |
| 12018 ins_cost(300); | |
| 12019 format %{ "J$cop,s $labl" %} | |
| 12020 size(2); | |
| 12021 opcode(0x70); | |
| 12022 ins_encode( JccShort( cop, labl) ); | |
| 12023 ins_pipe( pipe_jcc ); | |
| 12024 ins_pc_relative(1); | |
| 12025 ins_short_branch(1); | |
| 12026 %} | |
| 12027 | |
| 12028 // Jump Direct Conditional - Label defines a relative address from Jcc+1 | |
| 12029 instruct jmpLoopEndU_short(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
| 12030 match(CountedLoopEnd cop cmp); | |
| 12031 effect(USE labl); | |
| 12032 | |
| 12033 ins_cost(300); | |
| 12034 format %{ "J$cop,us $labl" %} | |
| 12035 size(2); | |
| 12036 opcode(0x70); | |
| 12037 ins_encode( JccShort( cop, labl) ); | |
| 12038 ins_pipe( pipe_jcc ); | |
| 12039 ins_pc_relative(1); | |
| 12040 ins_short_branch(1); | |
| 12041 %} | |
| 12042 | |
| 12043 // Jump Direct Conditional - using unsigned comparison | |
| 12044 instruct jmpConU_short(cmpOpU cop, eFlagsRegU cmp, label labl) %{ | |
| 12045 match(If cop cmp); | |
| 12046 effect(USE labl); | |
| 12047 | |
| 12048 ins_cost(300); | |
| 12049 format %{ "J$cop,us $labl" %} | |
| 12050 size(2); | |
| 12051 opcode(0x70); | |
| 12052 ins_encode( JccShort( cop, labl) ); | |
| 12053 ins_pipe( pipe_jcc ); | |
| 12054 ins_pc_relative(1); | |
| 12055 ins_short_branch(1); | |
| 12056 %} | |
| 12057 | |
| 12058 // ============================================================================ | |
| 12059 // Long Compare | |
| 12060 // | |
| 12061 // Currently we hold longs in 2 registers. Comparing such values efficiently | |
| 12062 // is tricky. The flavor of compare used depends on whether we are testing | |
| 12063 // for LT, LE, or EQ. For a simple LT test we can check just the sign bit. | |
| 12064 // The GE test is the negated LT test. The LE test can be had by commuting | |
| 12065 // the operands (yielding a GE test) and then negating; negate again for the | |
| 12066 // GT test. The EQ test is done by ORcc'ing the high and low halves, and the | |
| 12067 // NE test is negated from that. | |
| 12068 | |
| 12069 // Due to a shortcoming in the ADLC, it mixes up expressions like: | |
| 12070 // (foo (CmpI (CmpL X Y) 0)) and (bar (CmpI (CmpL X 0L) 0)). Note the | |
| 12071 // difference between 'Y' and '0L'. The tree-matches for the CmpI sections | |
| 12072 // are collapsed internally in the ADLC's dfa-gen code. The match for | |
| 12073 // (CmpI (CmpL X Y) 0) is silently replaced with (CmpI (CmpL X 0L) 0) and the | |
| 12074 // foo match ends up with the wrong leaf. One fix is to not match both | |
| 12075 // reg-reg and reg-zero forms of long-compare. This is unfortunate because | |
| 12076 // both forms beat the trinary form of long-compare and both are very useful | |
| 12077 // on Intel which has so few registers. | |
| 12078 | |
| 12079 // Manifest a CmpL result in an integer register. Very painful. | |
| 12080 // This is the test to avoid. | |
| 12081 instruct cmpL3_reg_reg(eSIRegI dst, eRegL src1, eRegL src2, eFlagsReg flags ) %{ | |
| 12082 match(Set dst (CmpL3 src1 src2)); | |
| 12083 effect( KILL flags ); | |
| 12084 ins_cost(1000); | |
| 12085 format %{ "XOR $dst,$dst\n\t" | |
| 12086 "CMP $src1.hi,$src2.hi\n\t" | |
| 12087 "JLT,s m_one\n\t" | |
| 12088 "JGT,s p_one\n\t" | |
| 12089 "CMP $src1.lo,$src2.lo\n\t" | |
| 12090 "JB,s m_one\n\t" | |
| 12091 "JEQ,s done\n" | |
| 12092 "p_one:\tINC $dst\n\t" | |
| 12093 "JMP,s done\n" | |
| 12094 "m_one:\tDEC $dst\n" | |
| 12095 "done:" %} | |
| 12096 ins_encode %{ | |
| 12097 Label p_one, m_one, done; | |
| 12098 __ xorl($dst$$Register, $dst$$Register); | |
| 12099 __ cmpl(HIGH_FROM_LOW($src1$$Register), HIGH_FROM_LOW($src2$$Register)); | |
| 12100 __ jccb(Assembler::less, m_one); | |
| 12101 __ jccb(Assembler::greater, p_one); | |
| 12102 __ cmpl($src1$$Register, $src2$$Register); | |
| 12103 __ jccb(Assembler::below, m_one); | |
| 12104 __ jccb(Assembler::equal, done); | |
| 12105 __ bind(p_one); | |
| 12106 __ increment($dst$$Register); | |
| 12107 __ jmpb(done); | |
| 12108 __ bind(m_one); | |
| 12109 __ decrement($dst$$Register); | |
| 12110 __ bind(done); | |
| 12111 %} | |
| 12112 ins_pipe( pipe_slow ); | |
| 12113 %} | |
| 12114 | |
| 12115 //====== | |
| 12116 // Manifest a CmpL result in the normal flags. Only good for LT or GE | |
| 12117 // compares. Can be used for LE or GT compares by reversing arguments. | |
| 12118 // NOT GOOD FOR EQ/NE tests. | |
| 12119 instruct cmpL_zero_flags_LTGE( flagsReg_long_LTGE flags, eRegL src, immL0 zero ) %{ | |
| 12120 match( Set flags (CmpL src zero )); | |
| 12121 ins_cost(100); | |
| 12122 format %{ "TEST $src.hi,$src.hi" %} | |
| 12123 opcode(0x85); | |
| 12124 ins_encode( OpcP, RegReg_Hi2( src, src ) ); | |
| 12125 ins_pipe( ialu_cr_reg_reg ); | |
| 12126 %} | |
| 12127 | |
| 12128 // Manifest a CmpL result in the normal flags. Only good for LT or GE | |
| 12129 // compares. Can be used for LE or GT compares by reversing arguments. | |
| 12130 // NOT GOOD FOR EQ/NE tests. | |
| 12131 instruct cmpL_reg_flags_LTGE( flagsReg_long_LTGE flags, eRegL src1, eRegL src2, eRegI tmp ) %{ | |
| 12132 match( Set flags (CmpL src1 src2 )); | |
| 12133 effect( TEMP tmp ); | |
| 12134 ins_cost(300); | |
| 12135 format %{ "CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits\n\t" | |
| 12136 "MOV $tmp,$src1.hi\n\t" | |
| 12137 "SBB $tmp,$src2.hi\t! Compute flags for long compare" %} | |
| 12138 ins_encode( long_cmp_flags2( src1, src2, tmp ) ); | |
| 12139 ins_pipe( ialu_cr_reg_reg ); | |
| 12140 %} | |
| 12141 | |
| 12142 // Long compares reg < zero/req OR reg >= zero/req. | |
| 12143 // Just a wrapper for a normal branch, plus the predicate test. | |
| 12144 instruct cmpL_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, label labl) %{ | |
| 12145 match(If cmp flags); | |
| 12146 effect(USE labl); | |
| 12147 predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
| 12148 expand %{ | |
| 12149 jmpCon(cmp,flags,labl); // JLT or JGE... | |
| 12150 %} | |
| 12151 %} | |
| 12152 | |
| 12153 // Compare 2 longs and CMOVE longs. | |
| 12154 instruct cmovLL_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegL dst, eRegL src) %{ | |
| 12155 match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); | |
| 12156 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
| 12157 ins_cost(400); | |
| 12158 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
| 12159 "CMOV$cmp $dst.hi,$src.hi" %} | |
| 12160 opcode(0x0F,0x40); | |
| 12161 ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); | |
| 12162 ins_pipe( pipe_cmov_reg_long ); | |
| 12163 %} | |
| 12164 | |
| 12165 instruct cmovLL_mem_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegL dst, load_long_memory src) %{ | |
| 12166 match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); | |
| 12167 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
| 12168 ins_cost(500); | |
| 12169 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
| 12170 "CMOV$cmp $dst.hi,$src.hi" %} | |
| 12171 opcode(0x0F,0x40); | |
| 12172 ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); | |
| 12173 ins_pipe( pipe_cmov_reg_long ); | |
| 12174 %} | |
| 12175 | |
| 12176 // Compare 2 longs and CMOVE ints. | |
| 12177 instruct cmovII_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegI dst, eRegI src) %{ | |
| 12178 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
| 12179 match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); | |
| 12180 ins_cost(200); | |
| 12181 format %{ "CMOV$cmp $dst,$src" %} | |
| 12182 opcode(0x0F,0x40); | |
| 12183 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
| 12184 ins_pipe( pipe_cmov_reg ); | |
| 12185 %} | |
| 12186 | |
| 12187 instruct cmovII_mem_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegI dst, memory src) %{ | |
| 12188 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
| 12189 match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); | |
| 12190 ins_cost(250); | |
| 12191 format %{ "CMOV$cmp $dst,$src" %} | |
| 12192 opcode(0x0F,0x40); | |
| 12193 ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); | |
| 12194 ins_pipe( pipe_cmov_mem ); | |
| 12195 %} | |
| 12196 | |
| 12197 // Compare 2 longs and CMOVE ints. | |
| 12198 instruct cmovPP_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, eRegP dst, eRegP src) %{ | |
| 12199 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge )); | |
| 12200 match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); | |
| 12201 ins_cost(200); | |
| 12202 format %{ "CMOV$cmp $dst,$src" %} | |
| 12203 opcode(0x0F,0x40); | |
| 12204 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
| 12205 ins_pipe( pipe_cmov_reg ); | |
| 12206 %} | |
| 12207 | |
| 12208 // Compare 2 longs and CMOVE doubles | |
| 12209 instruct cmovDD_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regD dst, regD src) %{ | |
| 12210 predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
| 12211 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
| 12212 ins_cost(200); | |
| 12213 expand %{ | |
| 12214 fcmovD_regS(cmp,flags,dst,src); | |
| 12215 %} | |
| 12216 %} | |
| 12217 | |
| 12218 // Compare 2 longs and CMOVE doubles | |
| 12219 instruct cmovXDD_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regXD dst, regXD src) %{ | |
| 12220 predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
| 12221 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
| 12222 ins_cost(200); | |
| 12223 expand %{ | |
| 12224 fcmovXD_regS(cmp,flags,dst,src); | |
| 12225 %} | |
| 12226 %} | |
| 12227 | |
| 12228 instruct cmovFF_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regF dst, regF src) %{ | |
| 12229 predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
| 12230 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
| 12231 ins_cost(200); | |
| 12232 expand %{ | |
| 12233 fcmovF_regS(cmp,flags,dst,src); | |
| 12234 %} | |
| 12235 %} | |
| 12236 | |
| 12237 instruct cmovXX_reg_LTGE(cmpOp cmp, flagsReg_long_LTGE flags, regX dst, regX src) %{ | |
| 12238 predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::lt || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ge ); | |
| 12239 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
| 12240 ins_cost(200); | |
| 12241 expand %{ | |
| 12242 fcmovX_regS(cmp,flags,dst,src); | |
| 12243 %} | |
| 12244 %} | |
| 12245 | |
| 12246 //====== | |
| 12247 // Manifest a CmpL result in the normal flags. Only good for EQ/NE compares. | |
| 12248 instruct cmpL_zero_flags_EQNE( flagsReg_long_EQNE flags, eRegL src, immL0 zero, eRegI tmp ) %{ | |
| 12249 match( Set flags (CmpL src zero )); | |
| 12250 effect(TEMP tmp); | |
| 12251 ins_cost(200); | |
| 12252 format %{ "MOV $tmp,$src.lo\n\t" | |
| 12253 "OR $tmp,$src.hi\t! Long is EQ/NE 0?" %} | |
| 12254 ins_encode( long_cmp_flags0( src, tmp ) ); | |
| 12255 ins_pipe( ialu_reg_reg_long ); | |
| 12256 %} | |
| 12257 | |
| 12258 // Manifest a CmpL result in the normal flags. Only good for EQ/NE compares. | |
| 12259 instruct cmpL_reg_flags_EQNE( flagsReg_long_EQNE flags, eRegL src1, eRegL src2 ) %{ | |
| 12260 match( Set flags (CmpL src1 src2 )); | |
| 12261 ins_cost(200+300); | |
| 12262 format %{ "CMP $src1.lo,$src2.lo\t! Long compare; set flags for low bits\n\t" | |
| 12263 "JNE,s skip\n\t" | |
| 12264 "CMP $src1.hi,$src2.hi\n\t" | |
| 12265 "skip:\t" %} | |
| 12266 ins_encode( long_cmp_flags1( src1, src2 ) ); | |
| 12267 ins_pipe( ialu_cr_reg_reg ); | |
| 12268 %} | |
| 12269 | |
| 12270 // Long compare reg == zero/reg OR reg != zero/reg | |
| 12271 // Just a wrapper for a normal branch, plus the predicate test. | |
| 12272 instruct cmpL_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, label labl) %{ | |
| 12273 match(If cmp flags); | |
| 12274 effect(USE labl); | |
| 12275 predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
| 12276 expand %{ | |
| 12277 jmpCon(cmp,flags,labl); // JEQ or JNE... | |
| 12278 %} | |
| 12279 %} | |
| 12280 | |
| 12281 // Compare 2 longs and CMOVE longs. | |
| 12282 instruct cmovLL_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegL dst, eRegL src) %{ | |
| 12283 match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); | |
| 12284 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
| 12285 ins_cost(400); | |
| 12286 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
| 12287 "CMOV$cmp $dst.hi,$src.hi" %} | |
| 12288 opcode(0x0F,0x40); | |
| 12289 ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); | |
| 12290 ins_pipe( pipe_cmov_reg_long ); | |
| 12291 %} | |
| 12292 | |
| 12293 instruct cmovLL_mem_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegL dst, load_long_memory src) %{ | |
| 12294 match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); | |
| 12295 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
| 12296 ins_cost(500); | |
| 12297 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
| 12298 "CMOV$cmp $dst.hi,$src.hi" %} | |
| 12299 opcode(0x0F,0x40); | |
| 12300 ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); | |
| 12301 ins_pipe( pipe_cmov_reg_long ); | |
| 12302 %} | |
| 12303 | |
| 12304 // Compare 2 longs and CMOVE ints. | |
| 12305 instruct cmovII_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegI dst, eRegI src) %{ | |
| 12306 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
| 12307 match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); | |
| 12308 ins_cost(200); | |
| 12309 format %{ "CMOV$cmp $dst,$src" %} | |
| 12310 opcode(0x0F,0x40); | |
| 12311 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
| 12312 ins_pipe( pipe_cmov_reg ); | |
| 12313 %} | |
| 12314 | |
| 12315 instruct cmovII_mem_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegI dst, memory src) %{ | |
| 12316 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
| 12317 match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); | |
| 12318 ins_cost(250); | |
| 12319 format %{ "CMOV$cmp $dst,$src" %} | |
| 12320 opcode(0x0F,0x40); | |
| 12321 ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); | |
| 12322 ins_pipe( pipe_cmov_mem ); | |
| 12323 %} | |
| 12324 | |
| 12325 // Compare 2 longs and CMOVE ints. | |
| 12326 instruct cmovPP_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, eRegP dst, eRegP src) %{ | |
| 12327 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne )); | |
| 12328 match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); | |
| 12329 ins_cost(200); | |
| 12330 format %{ "CMOV$cmp $dst,$src" %} | |
| 12331 opcode(0x0F,0x40); | |
| 12332 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
| 12333 ins_pipe( pipe_cmov_reg ); | |
| 12334 %} | |
| 12335 | |
| 12336 // Compare 2 longs and CMOVE doubles | |
| 12337 instruct cmovDD_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regD dst, regD src) %{ | |
| 12338 predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
| 12339 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
| 12340 ins_cost(200); | |
| 12341 expand %{ | |
| 12342 fcmovD_regS(cmp,flags,dst,src); | |
| 12343 %} | |
| 12344 %} | |
| 12345 | |
| 12346 // Compare 2 longs and CMOVE doubles | |
| 12347 instruct cmovXDD_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regXD dst, regXD src) %{ | |
| 12348 predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
| 12349 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
| 12350 ins_cost(200); | |
| 12351 expand %{ | |
| 12352 fcmovXD_regS(cmp,flags,dst,src); | |
| 12353 %} | |
| 12354 %} | |
| 12355 | |
| 12356 instruct cmovFF_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regF dst, regF src) %{ | |
| 12357 predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
| 12358 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
| 12359 ins_cost(200); | |
| 12360 expand %{ | |
| 12361 fcmovF_regS(cmp,flags,dst,src); | |
| 12362 %} | |
| 12363 %} | |
| 12364 | |
| 12365 instruct cmovXX_reg_EQNE(cmpOp cmp, flagsReg_long_EQNE flags, regX dst, regX src) %{ | |
| 12366 predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::eq || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::ne ); | |
| 12367 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
| 12368 ins_cost(200); | |
| 12369 expand %{ | |
| 12370 fcmovX_regS(cmp,flags,dst,src); | |
| 12371 %} | |
| 12372 %} | |
| 12373 | |
| 12374 //====== | |
| 12375 // Manifest a CmpL result in the normal flags. Only good for LE or GT compares. | |
| 12376 // Same as cmpL_reg_flags_LEGT except must negate src | |
| 12377 instruct cmpL_zero_flags_LEGT( flagsReg_long_LEGT flags, eRegL src, immL0 zero, eRegI tmp ) %{ | |
| 12378 match( Set flags (CmpL src zero )); | |
| 12379 effect( TEMP tmp ); | |
| 12380 ins_cost(300); | |
| 12381 format %{ "XOR $tmp,$tmp\t# Long compare for -$src < 0, use commuted test\n\t" | |
| 12382 "CMP $tmp,$src.lo\n\t" | |
| 12383 "SBB $tmp,$src.hi\n\t" %} | |
| 12384 ins_encode( long_cmp_flags3(src, tmp) ); | |
| 12385 ins_pipe( ialu_reg_reg_long ); | |
| 12386 %} | |
| 12387 | |
| 12388 // Manifest a CmpL result in the normal flags. Only good for LE or GT compares. | |
| 12389 // Same as cmpL_reg_flags_LTGE except operands swapped. Swapping operands | |
| 12390 // requires a commuted test to get the same result. | |
| 12391 instruct cmpL_reg_flags_LEGT( flagsReg_long_LEGT flags, eRegL src1, eRegL src2, eRegI tmp ) %{ | |
| 12392 match( Set flags (CmpL src1 src2 )); | |
| 12393 effect( TEMP tmp ); | |
| 12394 ins_cost(300); | |
| 12395 format %{ "CMP $src2.lo,$src1.lo\t! Long compare, swapped operands, use with commuted test\n\t" | |
| 12396 "MOV $tmp,$src2.hi\n\t" | |
| 12397 "SBB $tmp,$src1.hi\t! Compute flags for long compare" %} | |
| 12398 ins_encode( long_cmp_flags2( src2, src1, tmp ) ); | |
| 12399 ins_pipe( ialu_cr_reg_reg ); | |
| 12400 %} | |
| 12401 | |
| 12402 // Long compares reg < zero/req OR reg >= zero/req. | |
| 12403 // Just a wrapper for a normal branch, plus the predicate test | |
| 12404 instruct cmpL_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, label labl) %{ | |
| 12405 match(If cmp flags); | |
| 12406 effect(USE labl); | |
| 12407 predicate( _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt || _kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le ); | |
| 12408 ins_cost(300); | |
| 12409 expand %{ | |
| 12410 jmpCon(cmp,flags,labl); // JGT or JLE... | |
| 12411 %} | |
| 12412 %} | |
| 12413 | |
| 12414 // Compare 2 longs and CMOVE longs. | |
| 12415 instruct cmovLL_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegL dst, eRegL src) %{ | |
| 12416 match(Set dst (CMoveL (Binary cmp flags) (Binary dst src))); | |
| 12417 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
| 12418 ins_cost(400); | |
| 12419 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
| 12420 "CMOV$cmp $dst.hi,$src.hi" %} | |
| 12421 opcode(0x0F,0x40); | |
| 12422 ins_encode( enc_cmov(cmp), RegReg_Lo2( dst, src ), enc_cmov(cmp), RegReg_Hi2( dst, src ) ); | |
| 12423 ins_pipe( pipe_cmov_reg_long ); | |
| 12424 %} | |
| 12425 | |
| 12426 instruct cmovLL_mem_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegL dst, load_long_memory src) %{ | |
| 12427 match(Set dst (CMoveL (Binary cmp flags) (Binary dst (LoadL src)))); | |
| 12428 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
| 12429 ins_cost(500); | |
| 12430 format %{ "CMOV$cmp $dst.lo,$src.lo\n\t" | |
| 12431 "CMOV$cmp $dst.hi,$src.hi+4" %} | |
| 12432 opcode(0x0F,0x40); | |
| 12433 ins_encode( enc_cmov(cmp), RegMem(dst, src), enc_cmov(cmp), RegMem_Hi(dst, src) ); | |
| 12434 ins_pipe( pipe_cmov_reg_long ); | |
| 12435 %} | |
| 12436 | |
| 12437 // Compare 2 longs and CMOVE ints. | |
| 12438 instruct cmovII_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegI dst, eRegI src) %{ | |
| 12439 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
| 12440 match(Set dst (CMoveI (Binary cmp flags) (Binary dst src))); | |
| 12441 ins_cost(200); | |
| 12442 format %{ "CMOV$cmp $dst,$src" %} | |
| 12443 opcode(0x0F,0x40); | |
| 12444 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
| 12445 ins_pipe( pipe_cmov_reg ); | |
| 12446 %} | |
| 12447 | |
| 12448 instruct cmovII_mem_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegI dst, memory src) %{ | |
| 12449 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
| 12450 match(Set dst (CMoveI (Binary cmp flags) (Binary dst (LoadI src)))); | |
| 12451 ins_cost(250); | |
| 12452 format %{ "CMOV$cmp $dst,$src" %} | |
| 12453 opcode(0x0F,0x40); | |
| 12454 ins_encode( enc_cmov(cmp), RegMem( dst, src ) ); | |
| 12455 ins_pipe( pipe_cmov_mem ); | |
| 12456 %} | |
| 12457 | |
| 12458 // Compare 2 longs and CMOVE ptrs. | |
| 12459 instruct cmovPP_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, eRegP dst, eRegP src) %{ | |
| 12460 predicate(VM_Version::supports_cmov() && ( _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt )); | |
| 12461 match(Set dst (CMoveP (Binary cmp flags) (Binary dst src))); | |
| 12462 ins_cost(200); | |
| 12463 format %{ "CMOV$cmp $dst,$src" %} | |
| 12464 opcode(0x0F,0x40); | |
| 12465 ins_encode( enc_cmov(cmp), RegReg( dst, src ) ); | |
| 12466 ins_pipe( pipe_cmov_reg ); | |
| 12467 %} | |
| 12468 | |
| 12469 // Compare 2 longs and CMOVE doubles | |
| 12470 instruct cmovDD_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regD dst, regD src) %{ | |
| 12471 predicate( UseSSE<=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
| 12472 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
| 12473 ins_cost(200); | |
| 12474 expand %{ | |
| 12475 fcmovD_regS(cmp,flags,dst,src); | |
| 12476 %} | |
| 12477 %} | |
| 12478 | |
| 12479 // Compare 2 longs and CMOVE doubles | |
| 12480 instruct cmovXDD_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regXD dst, regXD src) %{ | |
| 12481 predicate( UseSSE>=2 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
| 12482 match(Set dst (CMoveD (Binary cmp flags) (Binary dst src))); | |
| 12483 ins_cost(200); | |
| 12484 expand %{ | |
| 12485 fcmovXD_regS(cmp,flags,dst,src); | |
| 12486 %} | |
| 12487 %} | |
| 12488 | |
| 12489 instruct cmovFF_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regF dst, regF src) %{ | |
| 12490 predicate( UseSSE==0 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
| 12491 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
| 12492 ins_cost(200); | |
| 12493 expand %{ | |
| 12494 fcmovF_regS(cmp,flags,dst,src); | |
| 12495 %} | |
| 12496 %} | |
| 12497 | |
| 12498 | |
| 12499 instruct cmovXX_reg_LEGT(cmpOp_commute cmp, flagsReg_long_LEGT flags, regX dst, regX src) %{ | |
| 12500 predicate( UseSSE>=1 && _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::le || _kids[0]->_kids[0]->_leaf->as_Bool()->_test._test == BoolTest::gt ); | |
| 12501 match(Set dst (CMoveF (Binary cmp flags) (Binary dst src))); | |
| 12502 ins_cost(200); | |
| 12503 expand %{ | |
| 12504 fcmovX_regS(cmp,flags,dst,src); | |
| 12505 %} | |
| 12506 %} | |
| 12507 | |
| 12508 | |
| 12509 // ============================================================================ | |
| 12510 // Procedure Call/Return Instructions | |
| 12511 // Call Java Static Instruction | |
| 12512 // Note: If this code changes, the corresponding ret_addr_offset() and | |
| 12513 // compute_padding() functions will have to be adjusted. | |
| 12514 instruct CallStaticJavaDirect(method meth) %{ | |
| 12515 match(CallStaticJava); | |
| 12516 effect(USE meth); | |
| 12517 | |
| 12518 ins_cost(300); | |
| 12519 format %{ "CALL,static " %} | |
| 12520 opcode(0xE8); /* E8 cd */ | |
| 12521 ins_encode( pre_call_FPU, | |
| 12522 Java_Static_Call( meth ), | |
| 12523 call_epilog, | |
| 12524 post_call_FPU ); | |
| 12525 ins_pipe( pipe_slow ); | |
| 12526 ins_pc_relative(1); | |
| 12527 ins_alignment(4); | |
| 12528 %} | |
| 12529 | |
| 12530 // Call Java Dynamic Instruction | |
| 12531 // Note: If this code changes, the corresponding ret_addr_offset() and | |
| 12532 // compute_padding() functions will have to be adjusted. | |
| 12533 instruct CallDynamicJavaDirect(method meth) %{ | |
| 12534 match(CallDynamicJava); | |
| 12535 effect(USE meth); | |
| 12536 | |
| 12537 ins_cost(300); | |
| 12538 format %{ "MOV EAX,(oop)-1\n\t" | |
| 12539 "CALL,dynamic" %} | |
| 12540 opcode(0xE8); /* E8 cd */ | |
| 12541 ins_encode( pre_call_FPU, | |
| 12542 Java_Dynamic_Call( meth ), | |
| 12543 call_epilog, | |
| 12544 post_call_FPU ); | |
| 12545 ins_pipe( pipe_slow ); | |
| 12546 ins_pc_relative(1); | |
| 12547 ins_alignment(4); | |
| 12548 %} | |
| 12549 | |
| 12550 // Call Runtime Instruction | |
| 12551 instruct CallRuntimeDirect(method meth) %{ | |
| 12552 match(CallRuntime ); | |
| 12553 effect(USE meth); | |
| 12554 | |
| 12555 ins_cost(300); | |
| 12556 format %{ "CALL,runtime " %} | |
| 12557 opcode(0xE8); /* E8 cd */ | |
| 12558 // Use FFREEs to clear entries in float stack | |
| 12559 ins_encode( pre_call_FPU, | |
| 12560 FFree_Float_Stack_All, | |
| 12561 Java_To_Runtime( meth ), | |
| 12562 post_call_FPU ); | |
| 12563 ins_pipe( pipe_slow ); | |
| 12564 ins_pc_relative(1); | |
| 12565 %} | |
| 12566 | |
| 12567 // Call runtime without safepoint | |
| 12568 instruct CallLeafDirect(method meth) %{ | |
| 12569 match(CallLeaf); | |
| 12570 effect(USE meth); | |
| 12571 | |
| 12572 ins_cost(300); | |
| 12573 format %{ "CALL_LEAF,runtime " %} | |
| 12574 opcode(0xE8); /* E8 cd */ | |
| 12575 ins_encode( pre_call_FPU, | |
| 12576 FFree_Float_Stack_All, | |
| 12577 Java_To_Runtime( meth ), | |
| 12578 Verify_FPU_For_Leaf, post_call_FPU ); | |
| 12579 ins_pipe( pipe_slow ); | |
| 12580 ins_pc_relative(1); | |
| 12581 %} | |
| 12582 | |
| 12583 instruct CallLeafNoFPDirect(method meth) %{ | |
| 12584 match(CallLeafNoFP); | |
| 12585 effect(USE meth); | |
| 12586 | |
| 12587 ins_cost(300); | |
| 12588 format %{ "CALL_LEAF_NOFP,runtime " %} | |
| 12589 opcode(0xE8); /* E8 cd */ | |
| 12590 ins_encode(Java_To_Runtime(meth)); | |
| 12591 ins_pipe( pipe_slow ); | |
| 12592 ins_pc_relative(1); | |
| 12593 %} | |
| 12594 | |
| 12595 | |
| 12596 // Return Instruction | |
| 12597 // Remove the return address & jump to it. | |
| 12598 instruct Ret() %{ | |
| 12599 match(Return); | |
| 12600 format %{ "RET" %} | |
| 12601 opcode(0xC3); | |
| 12602 ins_encode(OpcP); | |
| 12603 ins_pipe( pipe_jmp ); | |
| 12604 %} | |
| 12605 | |
| 12606 // Tail Call; Jump from runtime stub to Java code. | |
| 12607 // Also known as an 'interprocedural jump'. | |
| 12608 // Target of jump will eventually return to caller. | |
| 12609 // TailJump below removes the return address. | |
| 12610 instruct TailCalljmpInd(eRegP_no_EBP jump_target, eBXRegP method_oop) %{ | |
| 12611 match(TailCall jump_target method_oop ); | |
| 12612 ins_cost(300); | |
| 12613 format %{ "JMP $jump_target \t# EBX holds method oop" %} | |
| 12614 opcode(0xFF, 0x4); /* Opcode FF /4 */ | |
| 12615 ins_encode( OpcP, RegOpc(jump_target) ); | |
| 12616 ins_pipe( pipe_jmp ); | |
| 12617 %} | |
| 12618 | |
| 12619 | |
| 12620 // Tail Jump; remove the return address; jump to target. | |
| 12621 // TailCall above leaves the return address around. | |
| 12622 instruct tailjmpInd(eRegP_no_EBP jump_target, eAXRegP ex_oop) %{ | |
| 12623 match( TailJump jump_target ex_oop ); | |
| 12624 ins_cost(300); | |
| 12625 format %{ "POP EDX\t# pop return address into dummy\n\t" | |
| 12626 "JMP $jump_target " %} | |
| 12627 opcode(0xFF, 0x4); /* Opcode FF /4 */ | |
| 12628 ins_encode( enc_pop_rdx, | |
| 12629 OpcP, RegOpc(jump_target) ); | |
| 12630 ins_pipe( pipe_jmp ); | |
| 12631 %} | |
| 12632 | |
| 12633 // Create exception oop: created by stack-crawling runtime code. | |
| 12634 // Created exception is now available to this handler, and is setup | |
| 12635 // just prior to jumping to this handler. No code emitted. | |
| 12636 instruct CreateException( eAXRegP ex_oop ) | |
| 12637 %{ | |
| 12638 match(Set ex_oop (CreateEx)); | |
| 12639 | |
| 12640 size(0); | |
| 12641 // use the following format syntax | |
| 12642 format %{ "# exception oop is in EAX; no code emitted" %} | |
| 12643 ins_encode(); | |
| 12644 ins_pipe( empty ); | |
| 12645 %} | |
| 12646 | |
| 12647 | |
| 12648 // Rethrow exception: | |
| 12649 // The exception oop will come in the first argument position. | |
| 12650 // Then JUMP (not call) to the rethrow stub code. | |
| 12651 instruct RethrowException() | |
| 12652 %{ | |
| 12653 match(Rethrow); | |
| 12654 | |
| 12655 // use the following format syntax | |
| 12656 format %{ "JMP rethrow_stub" %} | |
| 12657 ins_encode(enc_rethrow); | |
| 12658 ins_pipe( pipe_jmp ); | |
| 12659 %} | |
| 12660 | |
| 12661 // inlined locking and unlocking | |
| 12662 | |
| 12663 | |
| 12664 instruct cmpFastLock( eFlagsReg cr, eRegP object, eRegP box, eAXRegI tmp, eRegP scr) %{ | |
| 12665 match( Set cr (FastLock object box) ); | |
| 12666 effect( TEMP tmp, TEMP scr ); | |
| 12667 ins_cost(300); | |
| 12668 format %{ "FASTLOCK $object, $box KILLS $tmp,$scr" %} | |
| 12669 ins_encode( Fast_Lock(object,box,tmp,scr) ); | |
| 12670 ins_pipe( pipe_slow ); | |
| 12671 ins_pc_relative(1); | |
| 12672 %} | |
| 12673 | |
| 12674 instruct cmpFastUnlock( eFlagsReg cr, eRegP object, eAXRegP box, eRegP tmp ) %{ | |
| 12675 match( Set cr (FastUnlock object box) ); | |
| 12676 effect( TEMP tmp ); | |
| 12677 ins_cost(300); | |
| 12678 format %{ "FASTUNLOCK $object, $box, $tmp" %} | |
| 12679 ins_encode( Fast_Unlock(object,box,tmp) ); | |
| 12680 ins_pipe( pipe_slow ); | |
| 12681 ins_pc_relative(1); | |
| 12682 %} | |
| 12683 | |
| 12684 | |
| 12685 | |
| 12686 // ============================================================================ | |
| 12687 // Safepoint Instruction | |
| 12688 instruct safePoint_poll(eFlagsReg cr) %{ | |
| 12689 match(SafePoint); | |
| 12690 effect(KILL cr); | |
| 12691 | |
| 12692 // TODO-FIXME: we currently poll at offset 0 of the safepoint polling page. | |
| 12693 // On SPARC that might be acceptable as we can generate the address with | |
| 12694 // just a sethi, saving an or. By polling at offset 0 we can end up | |
| 12695 // putting additional pressure on the index-0 in the D$. Because of | |
| 12696 // alignment (just like the situation at hand) the lower indices tend | |
| 12697 // to see more traffic. It'd be better to change the polling address | |
| 12698 // to offset 0 of the last $line in the polling page. | |
| 12699 | |
| 12700 format %{ "TSTL #polladdr,EAX\t! Safepoint: poll for GC" %} | |
| 12701 ins_cost(125); | |
| 12702 size(6) ; | |
| 12703 ins_encode( Safepoint_Poll() ); | |
| 12704 ins_pipe( ialu_reg_mem ); | |
| 12705 %} | |
| 12706 | |
| 12707 //----------PEEPHOLE RULES----------------------------------------------------- | |
| 12708 // These must follow all instruction definitions as they use the names | |
| 12709 // defined in the instructions definitions. | |
| 12710 // | |
| 12711 // peepmatch ( root_instr_name [preceeding_instruction]* ); | |
| 12712 // | |
| 12713 // peepconstraint %{ | |
| 12714 // (instruction_number.operand_name relational_op instruction_number.operand_name | |
| 12715 // [, ...] ); | |
| 12716 // // instruction numbers are zero-based using left to right order in peepmatch | |
| 12717 // | |
| 12718 // peepreplace ( instr_name ( [instruction_number.operand_name]* ) ); | |
| 12719 // // provide an instruction_number.operand_name for each operand that appears | |
| 12720 // // in the replacement instruction's match rule | |
| 12721 // | |
| 12722 // ---------VM FLAGS--------------------------------------------------------- | |
| 12723 // | |
| 12724 // All peephole optimizations can be turned off using -XX:-OptoPeephole | |
| 12725 // | |
| 12726 // Each peephole rule is given an identifying number starting with zero and | |
| 12727 // increasing by one in the order seen by the parser. An individual peephole | |
| 12728 // can be enabled, and all others disabled, by using -XX:OptoPeepholeAt=# | |
| 12729 // on the command-line. | |
| 12730 // | |
| 12731 // ---------CURRENT LIMITATIONS---------------------------------------------- | |
| 12732 // | |
| 12733 // Only match adjacent instructions in same basic block | |
| 12734 // Only equality constraints | |
| 12735 // Only constraints between operands, not (0.dest_reg == EAX_enc) | |
| 12736 // Only one replacement instruction | |
| 12737 // | |
| 12738 // ---------EXAMPLE---------------------------------------------------------- | |
| 12739 // | |
| 12740 // // pertinent parts of existing instructions in architecture description | |
| 12741 // instruct movI(eRegI dst, eRegI src) %{ | |
| 12742 // match(Set dst (CopyI src)); | |
| 12743 // %} | |
| 12744 // | |
| 12745 // instruct incI_eReg(eRegI dst, immI1 src, eFlagsReg cr) %{ | |
| 12746 // match(Set dst (AddI dst src)); | |
| 12747 // effect(KILL cr); | |
| 12748 // %} | |
| 12749 // | |
| 12750 // // Change (inc mov) to lea | |
| 12751 // peephole %{ | |
| 12752 // // increment preceeded by register-register move | |
| 12753 // peepmatch ( incI_eReg movI ); | |
| 12754 // // require that the destination register of the increment | |
| 12755 // // match the destination register of the move | |
| 12756 // peepconstraint ( 0.dst == 1.dst ); | |
| 12757 // // construct a replacement instruction that sets | |
| 12758 // // the destination to ( move's source register + one ) | |
| 12759 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
| 12760 // %} | |
| 12761 // | |
| 12762 // Implementation no longer uses movX instructions since | |
| 12763 // machine-independent system no longer uses CopyX nodes. | |
| 12764 // | |
| 12765 // peephole %{ | |
| 12766 // peepmatch ( incI_eReg movI ); | |
| 12767 // peepconstraint ( 0.dst == 1.dst ); | |
| 12768 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
| 12769 // %} | |
| 12770 // | |
| 12771 // peephole %{ | |
| 12772 // peepmatch ( decI_eReg movI ); | |
| 12773 // peepconstraint ( 0.dst == 1.dst ); | |
| 12774 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
| 12775 // %} | |
| 12776 // | |
| 12777 // peephole %{ | |
| 12778 // peepmatch ( addI_eReg_imm movI ); | |
| 12779 // peepconstraint ( 0.dst == 1.dst ); | |
| 12780 // peepreplace ( leaI_eReg_immI( 0.dst 1.src 0.src ) ); | |
| 12781 // %} | |
| 12782 // | |
| 12783 // peephole %{ | |
| 12784 // peepmatch ( addP_eReg_imm movP ); | |
| 12785 // peepconstraint ( 0.dst == 1.dst ); | |
| 12786 // peepreplace ( leaP_eReg_immI( 0.dst 1.src 0.src ) ); | |
| 12787 // %} | |
| 12788 | |
| 12789 // // Change load of spilled value to only a spill | |
| 12790 // instruct storeI(memory mem, eRegI src) %{ | |
| 12791 // match(Set mem (StoreI mem src)); | |
| 12792 // %} | |
| 12793 // | |
| 12794 // instruct loadI(eRegI dst, memory mem) %{ | |
| 12795 // match(Set dst (LoadI mem)); | |
| 12796 // %} | |
| 12797 // | |
| 12798 peephole %{ | |
| 12799 peepmatch ( loadI storeI ); | |
| 12800 peepconstraint ( 1.src == 0.dst, 1.mem == 0.mem ); | |
| 12801 peepreplace ( storeI( 1.mem 1.mem 1.src ) ); | |
| 12802 %} | |
| 12803 | |
| 12804 //----------SMARTSPILL RULES--------------------------------------------------- | |
| 12805 // These must follow all instruction definitions as they use the names | |
| 12806 // defined in the instructions definitions. |